diff --git a/docs/css/style.css b/docs/css/style.css
new file mode 100644
index 0000000..b525524
--- /dev/null
+++ b/docs/css/style.css
@@ -0,0 +1,1027 @@
+/*
+  Theme Name: Avilon
+  Theme URL: https://bootstrapmade.com/avilon-bootstrap-landing-page-template/
+  Author: BootstrapMade.com
+  License: https://bootstrapmade.com/license/
+*/
+
+/*--------------------------------------------------------------
+# General
+--------------------------------------------------------------*/
+
+body {
+  background: #fff;
+  color: #666666;
+  font-family: "Open Sans", sans-serif;
+  overflow-x: hidden;
+}
+
+a {
+  color: #1dc8cd;
+  transition: 0.5s;
+}
+
+a:hover,
+a:active,
+a:focus {
+  color: #1dc9ce;
+  outline: none;
+  text-decoration: none;
+}
+
+p {
+  padding: 0;
+  margin: 0 0 30px 0;
+}
+
+h1,
+h2,
+h3,
+h4,
+h5,
+h6 {
+  font-family: "Montserrat", sans-serif;
+  font-weight: 400;
+  margin: 0 0 20px 0;
+  padding: 0;
+}
+
+/* Back to top button */
+
+.back-to-top {
+  position: fixed;
+  display: none;
+  background: linear-gradient(45deg, #1de099, #1dc8cd);
+  color: #fff;
+  padding: 2px 20px 8px 20px;
+  font-size: 16px;
+  border-radius: 4px 4px 0 0;
+  right: 15px;
+  bottom: 0;
+  transition: none;
+}
+
+.back-to-top:focus {
+  background: linear-gradient(45deg, #1de099, #1dc8cd);
+  color: #fff;
+  outline: none;
+}
+
+.back-to-top:hover {
+  background: #1dc8cd;
+  color: #fff;
+}
+
+/*--------------------------------------------------------------
+# Header
+--------------------------------------------------------------*/
+
+#header {
+  padding: 30px 0;
+  height: 92px;
+  position: fixed;
+  left: 0;
+  top: 0;
+  right: 0;
+  transition: all 0.5s;
+  z-index: 997;
+}
+
+#header #logo {
+  float: left;
+}
+
+#header #logo h1 {
+  font-size: 36px;
+  margin: -4px 0 0 0;
+  padding: 0;
+  line-height: 1;
+  display: inline-block;
+  font-family: "Montserrat", sans-serif;
+  font-weight: 300;
+  letter-spacing: 3px;
+  text-transform: uppercase;
+}
+
+#header #logo h1 a,
+#header #logo h1 a:hover {
+  color: #fff;
+}
+
+#header #logo img {
+  padding: 0;
+  margin: 0;
+}
+
+#header.header-fixed {
+  background: linear-gradient(45deg, #1de099, #1dc8cd);
+  padding: 20px 0;
+  height: 72px;
+  transition: all 0.5s;
+}
+
+/*--------------------------------------------------------------
+# Intro Section
+--------------------------------------------------------------*/
+
+#intro {
+  width: 100%;
+  height: 100vh;
+  background: linear-gradient(45deg, rgba(29, 224, 153, 0), rgba(29, 200, 205, 0.8)), url("../img/intro-bg.jpg") center top no-repeat;
+  background-size: cover;
+  position: relative;
+}
+
+#intro .intro-text {
+  position: absolute;
+  left: 0;
+  top: 60px;
+  right: 0;
+  height: calc(50% - 60px);
+  display: -webkit-box;
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: center;
+  -webkit-align-items: center;
+  -ms-flex-align: center;
+  align-items: center;
+  -webkit-box-pack: center;
+  -webkit-justify-content: center;
+  -ms-flex-pack: center;
+  justify-content: center;
+  text-align: center;
+  -webkit-box-orient: vertical;
+  -webkit-box-direction: normal;
+  -webkit-flex-direction: column;
+  -ms-flex-direction: column;
+  flex-direction: column;
+}
+
+#intro h2 {
+  margin: 30px 0 10px 0;
+  padding: 0 15px;
+  font-size: 48px;
+  font-weight: 400;
+  line-height: 56px;
+  color: #fff;
+}
+
+#intro p {
+  color: #fff;
+  margin-bottom: 20px;
+  padding: 0 15px;
+  font-size: 24px;
+}
+
+#intro .btn-get-started {
+  font-family: "Montserrat", sans-serif;
+  font-weight: 400;
+  font-size: 16px;
+  letter-spacing: 1px;
+  display: inline-block;
+  padding: 8px 28px;
+  border-radius: 50px;
+  transition: 0.5s;
+  margin: 10px;
+  border: 2px solid #fff;
+  color: #fff;
+}
+
+#intro .btn-get-started:hover {
+  color: #1dc8cd;
+  background: #fff;
+}
+
+#intro .product-screens {
+  position: absolute;
+  left: 0;
+  right: 0;
+  bottom: 0;
+  overflow: hidden;
+  text-align: center;
+  width: 100%;
+  height: 50%;
+}
+
+#intro .product-screens img {
+  box-shadow: 0px -2px 19px 4px rgba(0, 0, 0, 0.29);
+}
+
+#intro .product-screens .product-screen-1 {
+  position: absolute;
+  z-index: 30;
+  left: calc(50% + 54px);
+  bottom: 0;
+  top: 30px;
+}
+
+#intro .product-screens .product-screen-2 {
+  position: absolute;
+  z-index: 20;
+  left: calc(50% - 154px);
+  bottom: 0;
+  top: 90px;
+}
+
+#intro .product-screens .product-screen-3 {
+  position: absolute;
+  z-index: 10;
+  left: calc(50% - 374px);
+  bottom: 0;
+  top: 150px;
+}
+
+/*--------------------------------------------------------------
+# Navigation Menu
+--------------------------------------------------------------*/
+
+/* Nav Menu Essentials */
+
+.nav-menu,
+.nav-menu * {
+  margin: 0;
+  padding: 0;
+  list-style: none;
+}
+
+.nav-menu ul {
+  position: absolute;
+  display: none;
+  top: 100%;
+  left: 0;
+  z-index: 99;
+}
+
+.nav-menu li {
+  position: relative;
+  white-space: nowrap;
+}
+
+.nav-menu > li {
+  float: left;
+}
+
+.nav-menu li:hover > ul,
+.nav-menu li.sfHover > ul {
+  display: block;
+}
+
+.nav-menu ul ul {
+  top: 0;
+  left: 100%;
+}
+
+.nav-menu ul li {
+  min-width: 180px;
+}
+
+/* Nav Menu Arrows */
+
+.sf-arrows .sf-with-ul {
+  padding-right: 30px;
+}
+
+.sf-arrows .sf-with-ul:after {
+  content: "\f107";
+  position: absolute;
+  right: 15px;
+  font-family: FontAwesome;
+  font-style: normal;
+  font-weight: normal;
+}
+
+.sf-arrows ul .sf-with-ul:after {
+  content: "\f105";
+}
+
+/* Nav Meu Container */
+
+#nav-menu-container {
+  float: right;
+  margin: 0;
+}
+
+/* Nav Meu Styling */
+
+.nav-menu a {
+  padding: 0 8px 10px 8px;
+  text-decoration: none;
+  display: inline-block;
+  color: #fff;
+  font-family: "Montserrat", sans-serif;
+  font-weight: 400;
+  font-size: 14px;
+  outline: none;
+}
+
+.nav-menu > li {
+  margin-left: 10px;
+}
+
+.nav-menu ul {
+  margin: 4px 0 0 0;
+  padding: 10px;
+  box-shadow: 0px 0px 30px rgba(127, 137, 161, 0.25);
+  background: #fff;
+}
+
+.nav-menu ul li {
+  transition: 0.3s;
+}
+
+.nav-menu ul li a {
+  padding: 10px;
+  color: #333;
+  transition: 0.3s;
+  display: block;
+  font-size: 13px;
+  text-transform: none;
+}
+
+.nav-menu ul li:hover > a {
+  color: #1dc8cd;
+}
+
+.nav-menu ul ul {
+  margin: 0;
+}
+
+/* Mobile Nav Toggle */
+
+#mobile-nav-toggle {
+  position: fixed;
+  right: 0;
+  top: 0;
+  z-index: 999;
+  margin: 20px 20px 0 0;
+  border: 0;
+  background: none;
+  font-size: 24px;
+  display: none;
+  transition: all 0.4s;
+  outline: none;
+  cursor: pointer;
+}
+
+#mobile-nav-toggle i {
+  color: #fff;
+}
+
+/* Mobile Nav Styling */
+
+#mobile-nav {
+  position: fixed;
+  top: 0;
+  padding-top: 18px;
+  bottom: 0;
+  z-index: 998;
+  background: rgba(52, 59, 64, 0.9);
+  left: -260px;
+  width: 260px;
+  overflow-y: auto;
+  transition: 0.4s;
+}
+
+#mobile-nav ul {
+  padding: 0;
+  margin: 0;
+  list-style: none;
+}
+
+#mobile-nav ul li {
+  position: relative;
+}
+
+#mobile-nav ul li a {
+  color: #fff;
+  font-size: 16px;
+  overflow: hidden;
+  padding: 10px 22px 10px 15px;
+  position: relative;
+  text-decoration: none;
+  width: 100%;
+  display: block;
+  outline: none;
+}
+
+#mobile-nav ul li a:hover {
+  color: #fff;
+}
+
+#mobile-nav ul li li {
+  padding-left: 30px;
+}
+
+#mobile-nav ul .menu-has-children i {
+  position: absolute;
+  right: 0;
+  z-index: 99;
+  padding: 15px;
+  cursor: pointer;
+  color: #fff;
+}
+
+#mobile-nav ul .menu-has-children i.fa-chevron-up {
+  color: #1dc8cd;
+}
+
+#mobile-nav ul .menu-item-active {
+  color: #1dc8cd;
+}
+
+#mobile-body-overly {
+  width: 100%;
+  height: 100%;
+  z-index: 997;
+  top: 0;
+  left: 0;
+  position: fixed;
+  background: rgba(52, 59, 64, 0.9);
+  display: none;
+}
+
+/* Mobile Nav body classes */
+
+body.mobile-nav-active {
+  overflow: hidden;
+}
+
+body.mobile-nav-active #mobile-nav {
+  left: 0;
+}
+
+body.mobile-nav-active #mobile-nav-toggle {
+  color: #fff;
+}
+
+/*--------------------------------------------------------------
+# Sections
+--------------------------------------------------------------*/
+
+/* Sections Header
+--------------------------------*/
+
+.section-header .section-title {
+  font-size: 32px;
+  color: #111;
+  text-align: center;
+  font-weight: 400;
+}
+
+.section-header .section-description {
+  text-align: center;
+  padding-bottom: 40px;
+  color: #777;
+  font-style: italic;
+}
+
+.section-header .section-divider {
+  display: block;
+  width: 60px;
+  height: 3px;
+  background: #1dc8cd;
+  background: linear-gradient(0deg, #1dc8cd 0%, #55fabe 100%);
+  margin: 0 auto;
+  margin-bottom: 20px;
+}
+
+/* Section with background
+--------------------------------*/
+
+.section-bg {
+  background: #eff5f5;
+}
+
+/* About Us Section
+--------------------------------*/
+
+#about {
+  padding: 60px 0;
+  overflow: hidden;
+}
+
+#about .about-img {
+  height: 510px;
+  overflow: hidden;
+}
+
+#about .about-img img {
+  margin-left: -15px;
+  max-width: 100%;
+}
+
+#about .content .h2 {
+  color: #333;
+  font-weight: 300;
+  font-size: 24px;
+}
+
+#about .content h3 {
+  color: #777;
+  font-weight: 300;
+  font-size: 18px;
+  line-height: 26px;
+  font-style: italic;
+}
+
+#about .content p {
+  line-height: 26px;
+}
+
+#about .content p:last-child {
+  margin-bottom: 0;
+}
+
+#about .content i {
+  font-size: 20px;
+  padding-right: 4px;
+  color: #1dc8cd;
+}
+
+#about .content ul {
+  list-style: none;
+  padding: 0;
+}
+
+#about .content ul li {
+  padding-bottom: 10px;
+}
+
+/* Product Featuress Section
+--------------------------------*/
+
+#features {
+  background: #fff;
+  padding: 60px 0 0 0;
+  overflow: hidden;
+}
+
+#features .features-img {
+  text-align: center;
+  padding-top: 20px;
+}
+
+#features .features-img img {
+  max-width: 100%;
+}
+
+#features .box {
+  margin-bottom: 15px;
+  text-align: center;
+}
+
+#features .icon {
+  margin-bottom: 10px;
+}
+
+#features .icon i {
+  color: #666666;
+  font-size: 40px;
+  transition: 0.5s;
+}
+
+#features .icon i:before {
+  background: #1dc8cd;
+  background: linear-gradient(45deg, #1dc8cd 0%, #55fabe 100%);
+  background-clip: border-box;
+  -webkit-background-clip: text;
+  -webkit-text-fill-color: transparent;
+}
+
+#features .title {
+  font-weight: 300;
+  margin-bottom: 15px;
+  font-size: 22px;
+}
+
+#features .title a {
+  color: #111;
+}
+
+#features .description {
+  font-size: 14px;
+  line-height: 24px;
+  margin-bottom: 10px;
+}
+
+#features .section-description {
+  padding-bottom: 10px;
+}
+
+/* Product Advanced Featuress Section
+--------------------------------*/
+
+#advanced-features {
+  overflow: hidden;
+}
+
+#advanced-features .features-row {
+  padding: 60px 0 30px 0;
+}
+
+#advanced-features h2 {
+  font-size: 26px;
+  font-weight: 700;
+  color: #000;
+}
+
+#advanced-features h3 {
+  font-size: 16px;
+  line-height: 24px;
+  font-weight: 400;
+  font-style: italic;
+  color: #999;
+}
+
+#advanced-features p {
+  line-height: 24px;
+  color: #777;
+  margin-bottom: 30px;
+}
+
+#advanced-features i {
+  color: #666666;
+  font-size: 64px;
+  transition: 0.5s;
+  float: left;
+  padding: 0 15px 0px 0;
+  line-height: 1;
+}
+
+#advanced-features i:before {
+  background: #1dc8cd;
+  background: linear-gradient(45deg, #1dc8cd 0%, #55fabe 100%);
+  background-clip: border-box;
+  -webkit-background-clip: text;
+  -webkit-text-fill-color: transparent;
+}
+
+#advanced-features .advanced-feature-img-right {
+  max-width: 100%;
+  float: right;
+  padding: 0 0 30px 30px;
+}
+
+#advanced-features .advanced-feature-img-left {
+  max-width: 100%;
+  float: left;
+  padding: 0 30px 30px 0;
+}
+
+/* Call To Action Section
+--------------------------------*/
+
+#call-to-action {
+  overflow: hidden;
+  background: linear-gradient(rgba(29, 200, 205, 0.65), rgba(29, 205, 89, 0.2)), url(../img/call-to-action-bg.jpg) fixed center center;
+  background-size: cover;
+  padding: 80px 0;
+}
+
+#call-to-action .cta-title {
+  color: #fff;
+  font-size: 28px;
+  font-weight: 700;
+}
+
+#call-to-action .cta-text {
+  color: #fff;
+}
+
+#call-to-action .cta-btn {
+  font-family: "Montserrat", sans-serif;
+  font-weight: 500;
+  font-size: 16px;
+  letter-spacing: 1px;
+  display: inline-block;
+  padding: 8px 30px;
+  border-radius: 25px;
+  transition: background 0.5s;
+  margin: 10px;
+  border: 2px solid #fff;
+  color: #fff;
+}
+
+#call-to-action .cta-btn:hover {
+  background: #1dc8cd;
+  border: 2px solid #1dc8cd;
+}
+
+/* More Features Section
+--------------------------------*/
+
+#more-features {
+  padding: 60px 0 60px 0;
+  overflow: hidden;
+}
+
+#more-features .box {
+  padding: 40px;
+  margin-bottom: 30px;
+  box-shadow: 0px 0px 30px rgba(73, 78, 92, 0.15);
+  background: #fff;
+  transition: 0.4s;
+}
+
+#more-features .icon {
+  float: left;
+}
+
+#more-features .icon i {
+  color: #666666;
+  font-size: 80px;
+  transition: 0.5s;
+  line-height: 0;
+}
+
+#more-features .icon i:before {
+  background: #1dc8cd;
+  background: linear-gradient(45deg, #1dc8cd 0%, #55fabe 100%);
+  background-clip: border-box;
+  -webkit-background-clip: text;
+  -webkit-text-fill-color: transparent;
+}
+
+#more-features h4 {
+  margin-left: 100px;
+  font-weight: 700;
+  margin-bottom: 15px;
+  font-size: 18px;
+}
+
+#more-features h4 a {
+  color: #111;
+}
+
+#more-features p {
+  font-size: 14px;
+  margin-left: 100px;
+  margin-bottom: 0;
+  line-height: 24px;
+}
+
+
+/* Gallery Section
+--------------------------------*/
+
+#gallery {
+  background: #fff;
+  padding: 60px 0 0 0;
+  overflow: hidden;
+}
+
+#gallery .container-fluid {
+  padding: 0px;
+}
+
+#gallery .gallery-overlay {
+  position: absolute;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  width: 100%;
+  height: 100%;
+  opacity: 1;
+  transition: all ease-in-out 0.4s;
+}
+
+#gallery .gallery-item {
+  overflow: hidden;
+  position: relative;
+  padding: 0;
+  vertical-align: middle;
+  text-align: center;
+}
+
+#gallery .gallery-item img {
+  transition: all ease-in-out 0.4s;
+  width: 100%;
+}
+
+#gallery .gallery-item:hover img {
+  -webkit-transform: scale(1.1);
+  transform: scale(1.1);
+}
+
+#gallery .gallery-item:hover .gallery-overlay {
+  opacity: 1;
+  background: rgba(0, 0, 0, 0.7);
+}
+
+/* Contact Section
+--------------------------------*/
+
+#contact {
+  box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.1);
+  padding: 60px 0;
+  overflow: hidden;
+}
+
+#contact .contact-about h3 {
+  font-size: 36px;
+  margin: 0 0 10px 0;
+  padding: 0;
+  line-height: 1;
+  font-family: "Montserrat", sans-serif;
+  font-weight: 300;
+  letter-spacing: 3px;
+  text-transform: uppercase;
+  color: #1dc8cd;
+}
+
+#contact .contact-about p {
+  font-size: 14px;
+  line-height: 24px;
+  font-family: "Montserrat", sans-serif;
+  color: #888;
+}
+
+#contact .social-links {
+  padding-bottom: 20px;
+}
+
+#contact .social-links a {
+  font-size: 18px;
+  display: inline-block;
+  background: #fff;
+  color: #1dc8cd;
+  line-height: 1;
+  padding: 8px 0;
+  margin-right: 4px;
+  border-radius: 50%;
+  text-align: center;
+  width: 36px;
+  height: 36px;
+  transition: 0.3s;
+  border: 1px solid #1dc8cd;
+}
+
+#contact .social-links a:hover {
+  background: #1dc8cd;
+  color: #fff;
+}
+
+#contact .info {
+  color: #333333;
+}
+
+#contact .info i {
+  font-size: 32px;
+  color: #1dc8cd;
+  float: left;
+  line-height: 1;
+}
+
+#contact .info p {
+  padding: 0 0 10px 42px;
+  line-height: 28px;
+  font-size: 14px;
+}
+
+
+/*--------------------------------------------------------------
+# Footer
+--------------------------------------------------------------*/
+
+#footer {
+  background: #fff;
+  box-shadow: 0px 0px 12px 0px rgba(0, 0, 0, 0.1);
+  padding: 30px 0;
+  color: #333;
+  font-size: 14px;
+}
+
+#footer .credits {
+  font-size: 13px;
+  color: #888;
+}
+
+#footer .footer-links a {
+  color: #666;
+  padding-left: 15px;
+}
+
+#footer .footer-links a:first-child {
+  padding-left: 0;
+}
+
+#footer .footer-links a:hover {
+  color: #1dc8cd;
+}
+
+@media (min-width: 769px) {
+  #features .features-img {
+    padding-top: 120px;
+    margin-top: -200px;
+  }
+
+  #call-to-action .cta-btn-container {
+    display: -webkit-box;
+    display: -webkit-flex;
+    display: -ms-flexbox;
+    display: flex;
+    -webkit-box-align: center;
+    -webkit-align-items: center;
+    -ms-flex-align: center;
+    align-items: center;
+    -webkit-box-pack: end;
+    -webkit-justify-content: flex-end;
+    -ms-flex-pack: end;
+    justify-content: flex-end;
+  }
+}
+
+@media (min-width: 1025px) {
+  #intro {
+    background-attachment: fixed;
+  }
+}
+
+@media (max-width: 768px) {
+  #header #logo h1 {
+    font-size: 28px;
+    margin-top: 0;
+  }
+
+  #header #logo img {
+    max-height: 40px;
+  }
+
+  #intro h2 {
+    font-size: 28px;
+    line-height: 36px;
+  }
+
+  #intro p {
+    font-size: 18px;
+    line-height: 24px;
+    margin-bottom: 20px;
+  }
+
+  #nav-menu-container {
+    display: none;
+  }
+
+  #mobile-nav-toggle {
+    display: inline;
+  }
+
+  #about .about-img {
+    height: auto;
+  }
+
+  #about .about-img img {
+    margin-left: 0;
+    padding-bottom: 30px;
+  }
+
+  #advanced-features .advanced-feature-img-right,
+  #advanced-features .advanced-feature-img-left {
+    max-width: 50%;
+  }
+
+  #faq #faq-list a {
+    font-size: 18px;
+  }
+
+  #faq #faq-list i {
+    top: 13px;
+  }
+}
+
+@media (max-width: 767px) {
+  #intro .product-screens .product-screen-1 {
+    position: static;
+    padding-top: 30px;
+  }
+
+  #intro .product-screens .product-screen-2,
+  #intro .product-screens .product-screen-3 {
+    display: none;
+  }
+
+  #advanced-features .advanced-feature-img-right,
+  #advanced-features .advanced-feature-img-left {
+    max-width: 100%;
+    float: none;
+    padding: 0 0 30px 0;
+  }
+
+  #more-features .box {
+    margin-bottom: 20px;
+  }
+
+  #more-features .icon {
+    float: none;
+    text-align: center;
+    padding-bottom: 15px;
+  }
+
+  #more-features h4,
+  #more-features p {
+    margin-left: 0;
+    text-align: center;
+  }
+}
\ No newline at end of file
diff --git a/docs/img/about-img.jpg b/docs/img/about-img.jpg
new file mode 100644
index 0000000..331d990
Binary files /dev/null and b/docs/img/about-img.jpg differ
diff --git a/docs/img/advanced-feature-1.jpg b/docs/img/advanced-feature-1.jpg
new file mode 100644
index 0000000..1884df8
Binary files /dev/null and b/docs/img/advanced-feature-1.jpg differ
diff --git a/docs/img/advanced-feature-2.jpg b/docs/img/advanced-feature-2.jpg
new file mode 100644
index 0000000..62e1a95
Binary files /dev/null and b/docs/img/advanced-feature-2.jpg differ
diff --git a/docs/img/advanced-feature-3.jpg b/docs/img/advanced-feature-3.jpg
new file mode 100644
index 0000000..4ae7b9a
Binary files /dev/null and b/docs/img/advanced-feature-3.jpg differ
diff --git a/docs/img/call-to-action-bg.jpg b/docs/img/call-to-action-bg.jpg
new file mode 100644
index 0000000..1bb61af
Binary files /dev/null and b/docs/img/call-to-action-bg.jpg differ
diff --git a/docs/img/gallery/gallery-1.jpg b/docs/img/gallery/gallery-1.jpg
new file mode 100644
index 0000000..1daf5d5
Binary files /dev/null and b/docs/img/gallery/gallery-1.jpg differ
diff --git a/docs/img/gallery/gallery-2.jpg b/docs/img/gallery/gallery-2.jpg
new file mode 100644
index 0000000..bf99f31
Binary files /dev/null and b/docs/img/gallery/gallery-2.jpg differ
diff --git a/docs/img/gallery/gallery-3.jpg b/docs/img/gallery/gallery-3.jpg
new file mode 100644
index 0000000..9644678
Binary files /dev/null and b/docs/img/gallery/gallery-3.jpg differ
diff --git a/docs/img/gallery/gallery-4.jpg b/docs/img/gallery/gallery-4.jpg
new file mode 100644
index 0000000..d1700c7
Binary files /dev/null and b/docs/img/gallery/gallery-4.jpg differ
diff --git a/docs/img/gallery/gallery-5.jpg b/docs/img/gallery/gallery-5.jpg
new file mode 100644
index 0000000..e7cdde1
Binary files /dev/null and b/docs/img/gallery/gallery-5.jpg differ
diff --git a/docs/img/gallery/gallery-6.jpg b/docs/img/gallery/gallery-6.jpg
new file mode 100644
index 0000000..915e2ec
Binary files /dev/null and b/docs/img/gallery/gallery-6.jpg differ
diff --git a/docs/img/intro-bg.jpg b/docs/img/intro-bg.jpg
new file mode 100644
index 0000000..91e8993
Binary files /dev/null and b/docs/img/intro-bg.jpg differ
diff --git a/docs/img/logo.png b/docs/img/logo.png
new file mode 100644
index 0000000..a3bfb2b
Binary files /dev/null and b/docs/img/logo.png differ
diff --git a/docs/img/product-features.png b/docs/img/product-features.png
new file mode 100644
index 0000000..409340e
Binary files /dev/null and b/docs/img/product-features.png differ
diff --git a/docs/img/product-screen-1.png b/docs/img/product-screen-1.png
new file mode 100644
index 0000000..9d63cc3
Binary files /dev/null and b/docs/img/product-screen-1.png differ
diff --git a/docs/img/product-screen-2.png b/docs/img/product-screen-2.png
new file mode 100644
index 0000000..a0c4b35
Binary files /dev/null and b/docs/img/product-screen-2.png differ
diff --git a/docs/img/product-screen-3.png b/docs/img/product-screen-3.png
new file mode 100644
index 0000000..b9ca9c5
Binary files /dev/null and b/docs/img/product-screen-3.png differ
diff --git a/docs/index.html b/docs/index.html
new file mode 100644
index 0000000..d28f3f2
--- /dev/null
+++ b/docs/index.html
@@ -0,0 +1,468 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+  <meta charset="utf-8">
+  <title>DSC IITP Shabd</title>
+  <meta content="width=device-width, initial-scale=1.0" name="viewport">
+  <meta content="" name="keywords">
+  <meta content="" name="description">
+
+  <!-- Favicons -->
+  <link href="img/favicon.png" rel="icon">
+  <link href="img/apple-touch-icon.png" rel="apple-touch-icon">
+
+  <!-- Google Fonts -->
+  <link href="https://fonts.googleapis.com/css?family=Montserrat:300,400,500,700|Open+Sans:300,300i,400,400i,700,700i" rel="stylesheet">
+
+  <!-- Bootstrap CSS File -->
+  <link href="lib/bootstrap/css/bootstrap.min.css" rel="stylesheet">
+
+  <!-- Libraries CSS Files -->
+  <link href="lib/animate/animate.min.css" rel="stylesheet">
+  <link href="lib/font-awesome/css/font-awesome.min.css" rel="stylesheet">
+  <link href="lib/ionicons/css/ionicons.min.css" rel="stylesheet">
+  <link href="lib/magnific-popup/magnific-popup.css" rel="stylesheet">
+
+  <!-- Main Stylesheet File -->
+  <link href="css/style.css" rel="stylesheet">
+</head>
+
+<body>
+
+  <!--==========================
+    Header
+  ============================-->
+  <header id="header">
+    <div class="container">
+
+      <div id="logo" class="pull-left">
+        <h1><a href="#intro" class="scrollto">Shabd App</a></h1>
+        <!-- Uncomment below if you prefer to use an image logo -->
+        <!-- <a href="#intro"><img src="img/logo.png" alt="" title=""></a> -->
+      </div>
+
+      <nav id="nav-menu-container">
+        <ul class="nav-menu">
+          <li class="menu-active"><a href="#intro">Home</a></li>
+          <li><a href="#about">About Shabd</a></li>
+          <li><a href="#features">Features</a></li>
+          <li><a href="#gallery">Gallery</a></li>
+          <li><a href="#contact">Contact Us</a></li>
+        </ul>
+      </nav><!-- #nav-menu-container -->
+    </div>
+  </header><!-- #header -->
+
+  <!--==========================
+    Intro Section
+  ============================-->
+  <section id="intro">
+
+    <div class="intro-text">
+      <h2>Welcome to Avilon</h2>
+      <p>We are team of talanted designers making websites with Bootstrap</p>
+      <a href="#about" class="btn-get-started scrollto">Get Started</a>
+    </div>
+
+    <div class="product-screens">
+
+      <div class="product-screen-1 wow fadeInUp" data-wow-delay="0.4s" data-wow-duration="0.6s">
+        <img src="img/product-screen-1.png" alt="">
+      </div>
+
+      <div class="product-screen-2 wow fadeInUp" data-wow-delay="0.2s" data-wow-duration="0.6s">
+        <img src="img/product-screen-2.png" alt="">
+      </div>
+
+      <div class="product-screen-3 wow fadeInUp" data-wow-duration="0.6s">
+        <img src="img/product-screen-3.png" alt="">
+      </div>
+
+    </div>
+
+  </section><!-- #intro -->
+
+  <main id="main">
+
+    <!--==========================
+      About Shabd Section
+    ============================-->
+    <section id="about" class="section-bg">
+      <div class="container">
+        <div class="section-header">
+          <h3 class="section-title">About Shabd</h3>
+          <span class="section-divider"></span>
+          <p class="section-description">
+            Sed ut perspiciatis unde omnis iste natus error sit voluptatem accusantium doloremque<br>
+            sunt in culpa qui officia deserunt mollit anim id est laborum
+          </p>
+        </div>
+
+        <div class="row">
+          <div class="col-lg-6 about-img wow fadeInLeft">
+            <img src="img/about-img.jpg" alt="">
+          </div>
+
+          <div class="col-lg-6 content wow fadeInRight">
+            <h2>Lorem ipsum dolor sit amet, consectetur adipiscing elite storium paralate</h2>
+            <h3>Excepteur sint occaecat cupidatat non proident, sunt in culpa qui officia deserunt mollit anim id est laborum.</h3>
+            <p>
+              Lorem ipsum dolor sit amet, consectetur adipiscing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua ullamco laboris nisi ut aliquip ex ea commodo consequat.
+            </p>
+
+            <ul>
+              <li><i class="ion-android-checkmark-circle"></i> Ullamco laboris nisi ut aliquip ex ea commodo consequat.</li>
+              <li><i class="ion-android-checkmark-circle"></i> Duis aute irure dolor in reprehenderit in voluptate velit.</li>
+              <li><i class="ion-android-checkmark-circle"></i> Duis aute irure dolor in reprehenderit in voluptate trideta storacalaperda mastiro dolore eu fugiat nulla pariatur.</li>
+            </ul>
+          </div>
+        </div>
+
+      </div>
+    </section><!-- #about -->
+
+    <!--==========================
+      Product Featuress Section
+    ============================-->
+    <section id="features">
+      <div class="container">
+
+        <div class="row">
+
+          <div class="col-lg-8 offset-lg-4">
+            <div class="section-header wow fadeIn" data-wow-duration="1s">
+              <h3 class="section-title">Featuress</h3>
+              <span class="section-divider"></span>
+            </div>
+          </div>
+
+          <div class="col-lg-4 col-md-5 features-img">
+            <img src="img/product-features.png" alt="" class="wow fadeInLeft">
+          </div>
+
+          <div class="col-lg-8 col-md-7 ">
+
+            <div class="row">
+
+              <div class="col-lg-6 col-md-6 box wow fadeInRight">
+                <div class="icon"><i class="ion-ios-speedometer-outline"></i></div>
+                <h4 class="title"><a href="">Lorem Ipsum</a></h4>
+                <p class="description">Voluptatum deleniti atque corrupti quos dolores et quas molestias excepturi sint occaecati cupiditate non provident clarida perendo.</p>
+              </div>
+              <div class="col-lg-6 col-md-6 box wow fadeInRight" data-wow-delay="0.1s">
+                <div class="icon"><i class="ion-ios-flask-outline"></i></div>
+                <h4 class="title"><a href="">Dolor Sitema</a></h4>
+                <p class="description">Minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat tarad limino ata noble dynala mark.</p>
+              </div>
+              <div class="col-lg-6 col-md-6 box wow fadeInRight" data-wow-delay="0.2s">
+                <div class="icon"><i class="ion-social-buffer-outline"></i></div>
+                <h4 class="title"><a href="">Sed ut perspiciatis</a></h4>
+                <p class="description">Duis aute irure dolor in reprehenderit in voluptate velit esse cillum dolore eu fugiat nulla pariatur teleca starter sinode park ledo.</p>
+              </div>
+              <div class="col-lg-6 col-md-6 box wow fadeInRight" data-wow-delay="0.3s">
+                <div class="icon"><i class="ion-ios-analytics-outline"></i></div>
+                <h4 class="title"><a href="">Magni Dolores</a></h4>
+                <p class="description">Excepteur sint occaecat cupidatat non proident, sunt in culpa qui officia deserunt mollit anim id est laborum dinoun trade capsule.</p>
+              </div>
+            </div>
+
+          </div>
+
+        </div>
+
+      </div>
+
+    </section><!-- #features -->
+
+    <!--==========================
+      Product Advanced Featuress Section
+    ============================-->
+    <section id="advanced-features">
+
+      <div class="features-row section-bg">
+        <div class="container">
+          <div class="row">
+            <div class="col-12">
+              <img class="advanced-feature-img-right wow fadeInRight" src="img/advanced-feature-1.jpg" alt="">
+              <div class="wow fadeInLeft">
+                <h2>Duis aute irure dolor in reprehenderit in voluptate velit esse</h2>
+                <h3>Excepteur sint occaecat cupidatat non proident, sunt in culpa qui officia deserunt mollit anim id est laborum.</h3>
+                <p>Lorem ipsum dolor sit amet, consectetur adipiscing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam.</p>
+                <p>Quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat. Duis aute irure dolor in reprehenderit in voluptate velit esse cillum dolore eu fugiat nulla pariatur. Excepteur sint occaecat cupidatat non proident, sunt in culpa qui officia deserunt mollit anim id est laborum.</p>
+              </div>
+            </div>
+          </div>
+        </div>
+      </div>
+
+      <div class="features-row">
+        <div class="container">
+          <div class="row">
+            <div class="col-12">
+              <img class="advanced-feature-img-left" src="img/advanced-feature-2.jpg" alt="">
+              <div class="wow fadeInRight">
+                <h2>Duis aute irure dolor in reprehenderit in voluptate velit esse</h2>
+                <i class="ion-ios-paper-outline" class="wow fadeInRight" data-wow-duration="0.5s"></i>
+                <p class="wow fadeInRight" data-wow-duration="0.5s">Lorem ipsum dolor sit amet, consectetur adipiscing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam.</p>
+                <i class="ion-ios-color-filter-outline wow fadeInRight" data-wow-delay="0.2s" data-wow-duration="0.5s"></i>
+                <p class="wow fadeInRight" data-wow-delay="0.2s" data-wow-duration="0.5s">Quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat. Duis aute irure dolor in reprehenderit in voluptate velit esse cillum.</p>
+                <i class="ion-ios-barcode-outline wow fadeInRight" data-wow-delay="0.4" data-wow-duration="0.5s"></i>
+                <p class="wow fadeInRight" data-wow-delay="0.4s" data-wow-duration="0.5s">Quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat. Duis aute irure dolor in reprehenderit in voluptate velit esse cillum.</p>
+              </div>
+            </div>
+          </div>
+        </div>
+      </div>
+
+      <div class="features-row section-bg">
+        <div class="container">
+          <div class="row">
+            <div class="col-12">
+              <img class="advanced-feature-img-right wow fadeInRight" src="img/advanced-feature-3.jpg" alt="">
+              <div class="wow fadeInLeft">
+                <h2>Duis aute irure dolor in reprehenderit in voluptate velit esse</h2>
+                <h3>Excepteur sint occaecat cupidatat non proident, sunt in culpa qui officia deserunt mollit anim id est laborum.</h3>
+                <p>Lorem ipsum dolor sit amet, consectetur adipiscing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam</p>
+                <i class="ion-ios-albums-outline"></i>
+                <p>Quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat. Duis aute irure dolor in reprehenderit in voluptate velit esse cillum dolore eu fugiat nulla pariatur. Excepteur sint occaecat cupidatat non proident, sunt in culpa qui officia deserunt mollit anim id est laborum.</p>
+              </div>
+            </div>
+          </div>
+        </div>
+      </div>
+    </section><!-- #advanced-features -->
+
+    <!--==========================
+      Call To Action Section
+    ============================-->
+    <section id="call-to-action">
+      <div class="container">
+        <div class="row">
+          <div class="col-lg-9 text-center text-lg-left">
+            <h3 class="cta-title">Call To Action</h3>
+            <p class="cta-text"> Duis aute irure dolor in reprehenderit in voluptate velit esse cillum dolore eu fugiat nulla pariatur. Excepteur sint occaecat cupidatat non proident, sunt in culpa qui officia deserunt mollit anim id est laborum.</p>
+          </div>
+          <div class="col-lg-3 cta-btn-container text-center">
+            <a class="cta-btn align-middle" href="#">Call To Action</a>
+          </div>
+        </div>
+
+      </div>
+    </section><!-- #call-to-action -->
+
+    <!--==========================
+      More Features Section
+    ============================-->
+    <section id="more-features" class="section-bg">
+      <div class="container">
+
+        <div class="section-header">
+          <h3 class="section-title">More Features</h3>
+          <span class="section-divider"></span>
+          <p class="section-description">Sed ut perspiciatis unde omnis iste natus error sit voluptatem accusantium doloremque</p>
+        </div>
+
+        <div class="row">
+
+          <div class="col-lg-6">
+            <div class="box wow fadeInLeft">
+              <div class="icon"><i class="ion-ios-stopwatch-outline"></i></div>
+              <h4 class="title"><a href="">Lorem Ipsum</a></h4>
+              <p class="description">Voluptatum deleniti atque corrupti quos dolores et quas molestias excepturi sint occaecati cupiditate non provident etiro rabeta lingo.</p>
+            </div>
+          </div>
+
+          <div class="col-lg-6">
+            <div class="box wow fadeInRight">
+              <div class="icon"><i class="ion-ios-bookmarks-outline"></i></div>
+              <h4 class="title"><a href="">Dolor Sitema</a></h4>
+              <p class="description">Minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat tarad limino ata nodera clas.</p>
+            </div>
+          </div>
+
+          <div class="col-lg-6">
+            <div class="box wow fadeInLeft">
+              <div class="icon"><i class="ion-ios-heart-outline"></i></div>
+              <h4 class="title"><a href="">Sed ut perspiciatis</a></h4>
+              <p class="description">Duis aute irure dolor in reprehenderit in voluptate velit esse cillum dolore eu fugiat nulla pariatur trinige zareta lobur trade.</p>
+            </div>
+          </div>
+
+          <div class="col-lg-6">
+            <div class="box wow fadeInRight">
+              <div class="icon"><i class="ion-ios-analytics-outline"></i></div>
+              <h4 class="title"><a href="">Magni Dolores</a></h4>
+              <p class="description">Excepteur sint occaecat cupidatat non proident, sunt in culpa qui officia deserunt mollit anim id est laborum rideta zanox satirente madera</p>
+            </div>
+          </div>
+
+        </div>
+      </div>
+    </section><!-- #more-features -->
+
+    <!--==========================
+      Gallery Section
+    ============================-->
+    <section id="gallery">
+      <div class="container-fluid">
+        <div class="section-header">
+          <h3 class="section-title">Gallery</h3>
+          <span class="section-divider"></span>
+          <p class="section-description">Sed ut perspiciatis unde omnis iste natus error sit voluptatem accusantium doloremque</p>
+        </div>
+
+        <div class="row no-gutters">
+
+          <div class="col-lg-4 col-md-6">
+            <div class="gallery-item wow fadeInUp">
+              <a href="img/gallery/gallery-1.jpg" class="gallery-popup">
+                <img src="img/gallery/gallery-1.jpg" alt="">
+              </a>
+            </div>
+          </div>
+
+          <div class="col-lg-4 col-md-6">
+            <div class="gallery-item wow fadeInUp">
+              <a href="img/gallery/gallery-2.jpg" class="gallery-popup">
+                <img src="img/gallery/gallery-2.jpg" alt="">
+              </a>
+            </div>
+          </div>
+
+          <div class="col-lg-4 col-md-6">
+            <div class="gallery-item wow fadeInUp">
+              <a href="img/gallery/gallery-3.jpg" class="gallery-popup">
+                <img src="img/gallery/gallery-3.jpg" alt="">
+              </a>
+            </div>
+          </div>
+
+          <div class="col-lg-4 col-md-6">
+            <div class="gallery-item wow fadeInUp">
+              <a href="img/gallery/gallery-4.jpg" class="gallery-popup">
+                <img src="img/gallery/gallery-4.jpg" alt="">
+              </a>
+            </div>
+          </div>
+
+          <div class="col-lg-4 col-md-6">
+            <div class="gallery-item wow fadeInUp">
+              <a href="img/gallery/gallery-5.jpg" class="gallery-popup">
+                <img src="img/gallery/gallery-5.jpg" alt="">
+              </a>
+            </div>
+          </div>
+
+          <div class="col-lg-4 col-md-6">
+            <div class="gallery-item wow fadeInUp">
+              <a href="img/gallery/gallery-6.jpg" class="gallery-popup">
+                <img src="img/gallery/gallery-6.jpg" alt="">
+              </a>
+            </div>
+          </div>
+
+        </div>
+
+      </div>
+    </section><!-- #gallery -->
+
+    <!--==========================
+      Contact Section
+    ============================-->
+    <section id="contact">
+      <div class="container">
+        <div class="row wow fadeInUp d-flex justify-content-center">
+
+          <div class="col-lg-4 col-md-4">
+            <div class="contact-about">
+              <h3>Avilon</h3>
+              <p>Cras fermentum odio eu feugiat. Justo eget magna fermentum iaculis eu non diam phasellus. Scelerisque felis imperdiet proin fermentum leo. Amet volutpat consequat mauris nunc congue.</p>
+              <div class="social-links">
+                <a href="#" class="twitter"><i class="fa fa-twitter"></i></a>
+                <a href="#" class="facebook"><i class="fa fa-facebook"></i></a>
+                <a href="#" class="instagram"><i class="fa fa-instagram"></i></a>
+                <a href="#" class="google-plus"><i class="fa fa-google-plus"></i></a>
+                <a href="#" class="linkedin"><i class="fa fa-linkedin"></i></a>
+              </div>
+            </div>
+          </div>
+
+          <div class="col-lg-4 col-md-4">
+            <div class="info">
+              <div>
+                <i class="ion-ios-location-outline"></i>
+                <p>A108 Adam Street<br>New York, NY 535022</p>
+              </div>
+
+              <div>
+                <i class="ion-ios-email-outline"></i>
+                <p>info@example.com</p>
+              </div>
+
+              <div>
+                <i class="ion-ios-telephone-outline"></i>
+                <p>+1 5589 55488 55s</p>
+              </div>
+
+            </div>
+          </div>
+
+        </div>
+
+      </div>
+    </section><!-- #contact -->
+
+  </main>
+
+  <!--==========================
+    Footer
+  ============================-->
+  <footer id="footer">
+    <div class="container">
+      <div class="row">
+        <div class="col-lg-6 text-lg-left text-center">
+          <div class="copyright">
+            &copy; Copyright <strong>Avilon</strong>. All Rights Reserved
+          </div>
+          <div class="credits">
+            <!--
+              All the links in the footer should remain intact.
+              You can delete the links only if you purchased the pro version.
+              Licensing information: https://bootstrapmade.com/license/
+              Purchase the pro version with working PHP/AJAX contact form: https://bootstrapmade.com/buy/?theme=Avilon
+            -->
+            Designed by <a href="https://bootstrapmade.com/">BootstrapMade</a>
+          </div>
+        </div>
+        <div class="col-lg-6">
+          <nav class="footer-links text-lg-right text-center pt-2 pt-lg-0">
+            <a href="#intro" class="scrollto">Home</a>
+            <a href="#about" class="scrollto">About</a>
+            <a href="#">Privacy Policy</a>
+            <a href="#">Terms of Use</a>
+          </nav>
+        </div>
+      </div>
+    </div>
+  </footer><!-- #footer -->
+
+  <a href="#" class="back-to-top"><i class="fa fa-chevron-up"></i></a>
+
+  <!-- JavaScript Libraries -->
+  <script src="lib/jquery/jquery.min.js"></script>
+  <script src="lib/jquery/jquery-migrate.min.js"></script>
+  <script src="lib/bootstrap/js/bootstrap.bundle.min.js"></script>
+  <script src="lib/easing/easing.min.js"></script>
+  <script src="lib/wow/wow.min.js"></script>
+  <script src="lib/superfish/hoverIntent.js"></script>
+  <script src="lib/superfish/superfish.min.js"></script>
+  <script src="lib/magnific-popup/magnific-popup.min.js"></script>
+
+  <!-- Contact Form JavaScript File -->
+  <script src="contactform/contactform.js"></script>
+
+  <!-- Template Main Javascript File -->
+  <script src="js/main.js"></script>
+
+</body>
+</html>
diff --git a/docs/js/main.js b/docs/js/main.js
new file mode 100644
index 0000000..b92b630
--- /dev/null
+++ b/docs/js/main.js
@@ -0,0 +1,131 @@
+jQuery(document).ready(function($) {
+
+  // Header fixed and Back to top button
+  $(window).scroll(function() {
+    if ($(this).scrollTop() > 100) {
+      $('.back-to-top').fadeIn('slow');
+      $('#header').addClass('header-fixed');
+    } else {
+      $('.back-to-top').fadeOut('slow');
+      $('#header').removeClass('header-fixed');
+    }
+  });
+
+  if ($(this).scrollTop() > 100) {
+    $('.back-to-top').fadeIn('slow');
+    $('#header').addClass('header-fixed');
+  }
+
+  $('.back-to-top').click(function() {
+    $('html, body').animate({
+      scrollTop: 0
+    }, 1500, 'easeInOutExpo');
+    return false;
+  });
+
+  // Initiate the wowjs animation library
+  new WOW().init();
+
+  // Initiate superfish on nav menu
+  $('.nav-menu').superfish({
+    animation: {
+      opacity: 'show'
+    },
+    speed: 400
+  });
+
+  // Mobile Navigation
+  if ($('#nav-menu-container').length) {
+    var $mobile_nav = $('#nav-menu-container').clone().prop({
+      id: 'mobile-nav'
+    });
+    $mobile_nav.find('> ul').attr({
+      'class': '',
+      'id': ''
+    });
+    $('body').append($mobile_nav);
+    $('body').prepend('<button type="button" id="mobile-nav-toggle"><i class="fa fa-bars"></i></button>');
+    $('body').append('<div id="mobile-body-overly"></div>');
+    $('#mobile-nav').find('.menu-has-children').prepend('<i class="fa fa-chevron-down"></i>');
+
+    $(document).on('click', '.menu-has-children i', function(e) {
+      $(this).next().toggleClass('menu-item-active');
+      $(this).nextAll('ul').eq(0).slideToggle();
+      $(this).toggleClass("fa-chevron-up fa-chevron-down");
+    });
+
+    $(document).on('click', '#mobile-nav-toggle', function(e) {
+      $('body').toggleClass('mobile-nav-active');
+      $('#mobile-nav-toggle i').toggleClass('fa-times fa-bars');
+      $('#mobile-body-overly').toggle();
+    });
+
+    $(document).click(function(e) {
+      var container = $("#mobile-nav, #mobile-nav-toggle");
+      if (!container.is(e.target) && container.has(e.target).length === 0) {
+        if ($('body').hasClass('mobile-nav-active')) {
+          $('body').removeClass('mobile-nav-active');
+          $('#mobile-nav-toggle i').toggleClass('fa-times fa-bars');
+          $('#mobile-body-overly').fadeOut();
+        }
+      }
+    });
+  } else if ($("#mobile-nav, #mobile-nav-toggle").length) {
+    $("#mobile-nav, #mobile-nav-toggle").hide();
+  }
+
+  // Smoth scroll on page hash links
+  $('.nav-menu a, #mobile-nav a, .scrollto').on('click', function() {
+    if (location.pathname.replace(/^\//, '') == this.pathname.replace(/^\//, '') && location.hostname == this.hostname) {
+      var target = $(this.hash);
+      if (target.length) {
+        var top_space = 0;
+
+        if ($('#header').length) {
+          top_space = $('#header').outerHeight();
+
+          if( ! $('#header').hasClass('header-fixed') ) {
+            top_space = top_space - 20;
+          }
+        }
+
+        $('html, body').animate({
+          scrollTop: target.offset().top - top_space
+        }, 1500, 'easeInOutExpo');
+
+        if ($(this).parents('.nav-menu').length) {
+          $('.nav-menu .menu-active').removeClass('menu-active');
+          $(this).closest('li').addClass('menu-active');
+        }
+
+        if ($('body').hasClass('mobile-nav-active')) {
+          $('body').removeClass('mobile-nav-active');
+          $('#mobile-nav-toggle i').toggleClass('fa-times fa-bars');
+          $('#mobile-body-overly').fadeOut();
+        }
+        return false;
+      }
+    }
+  });
+
+  // Gallery - uses the magnific popup jQuery plugin
+  $('.gallery-popup').magnificPopup({
+    type: 'image',
+    removalDelay: 300,
+    mainClass: 'mfp-fade',
+    gallery: {
+      enabled: true
+    },
+    zoom: {
+      enabled: true,
+      duration: 300,
+      easing: 'ease-in-out',
+      opener: function(openerElement) {
+        return openerElement.is('img') ? openerElement : openerElement.find('img');
+      }
+    }
+  });
+
+  // custom code
+
+});
diff --git a/docs/lib/animate/animate.css b/docs/lib/animate/animate.css
new file mode 100644
index 0000000..1e79e03
--- /dev/null
+++ b/docs/lib/animate/animate.css
@@ -0,0 +1,1579 @@
+@charset "UTF-8";
+
+/*!
+ * animate.css -http://daneden.me/animate
+ * Version - 3.5.2
+ * Licensed under the MIT license - http://opensource.org/licenses/MIT
+ *
+ * Copyright (c) 2017 Daniel Eden
+ */
+
+.animated {
+  animation-duration: 1s;
+  animation-fill-mode: both;
+}
+
+.animated.infinite {
+  animation-iteration-count: infinite;
+}
+
+.animated.hinge {
+  animation-duration: 2s;
+}
+
+.animated.flipOutX,
+.animated.flipOutY,
+.animated.bounceIn,
+.animated.bounceOut {
+  animation-duration: .75s;
+}
+
+@keyframes bounce {
+  from, 20%, 53%, 80%, to {
+    animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
+    transform: translate3d(0,0,0);
+  }
+
+  40%, 43% {
+    animation-timing-function: cubic-bezier(0.755, 0.050, 0.855, 0.060);
+    transform: translate3d(0, -30px, 0);
+  }
+
+  70% {
+    animation-timing-function: cubic-bezier(0.755, 0.050, 0.855, 0.060);
+    transform: translate3d(0, -15px, 0);
+  }
+
+  90% {
+    transform: translate3d(0,-4px,0);
+  }
+}
+
+.bounce {
+  animation-name: bounce;
+  transform-origin: center bottom;
+}
+
+@keyframes flash {
+  from, 50%, to {
+    opacity: 1;
+  }
+
+  25%, 75% {
+    opacity: 0;
+  }
+}
+
+.flash {
+  animation-name: flash;
+}
+
+/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */
+
+@keyframes pulse {
+  from {
+    transform: scale3d(1, 1, 1);
+  }
+
+  50% {
+    transform: scale3d(1.05, 1.05, 1.05);
+  }
+
+  to {
+    transform: scale3d(1, 1, 1);
+  }
+}
+
+.pulse {
+  animation-name: pulse;
+}
+
+@keyframes rubberBand {
+  from {
+    transform: scale3d(1, 1, 1);
+  }
+
+  30% {
+    transform: scale3d(1.25, 0.75, 1);
+  }
+
+  40% {
+    transform: scale3d(0.75, 1.25, 1);
+  }
+
+  50% {
+    transform: scale3d(1.15, 0.85, 1);
+  }
+
+  65% {
+    transform: scale3d(.95, 1.05, 1);
+  }
+
+  75% {
+    transform: scale3d(1.05, .95, 1);
+  }
+
+  to {
+    transform: scale3d(1, 1, 1);
+  }
+}
+
+.rubberBand {
+  animation-name: rubberBand;
+}
+
+@keyframes shake {
+  from, to {
+    transform: translate3d(0, 0, 0);
+  }
+
+  10%, 30%, 50%, 70%, 90% {
+    transform: translate3d(-10px, 0, 0);
+  }
+
+  20%, 40%, 60%, 80% {
+    transform: translate3d(10px, 0, 0);
+  }
+}
+
+.shake {
+  animation-name: shake;
+}
+
+@keyframes headShake {
+  0% {
+    transform: translateX(0);
+  }
+
+  6.5% {
+    transform: translateX(-6px) rotateY(-9deg);
+  }
+
+  18.5% {
+    transform: translateX(5px) rotateY(7deg);
+  }
+
+  31.5% {
+    transform: translateX(-3px) rotateY(-5deg);
+  }
+
+  43.5% {
+    transform: translateX(2px) rotateY(3deg);
+  }
+
+  50% {
+    transform: translateX(0);
+  }
+}
+
+.headShake {
+  animation-timing-function: ease-in-out;
+  animation-name: headShake;
+}
+
+@keyframes swing {
+  20% {
+    transform: rotate3d(0, 0, 1, 15deg);
+  }
+
+  40% {
+    transform: rotate3d(0, 0, 1, -10deg);
+  }
+
+  60% {
+    transform: rotate3d(0, 0, 1, 5deg);
+  }
+
+  80% {
+    transform: rotate3d(0, 0, 1, -5deg);
+  }
+
+  to {
+    transform: rotate3d(0, 0, 1, 0deg);
+  }
+}
+
+.swing {
+  transform-origin: top center;
+  animation-name: swing;
+}
+
+@keyframes tada {
+  from {
+    transform: scale3d(1, 1, 1);
+  }
+
+  10%, 20% {
+    transform: scale3d(.9, .9, .9) rotate3d(0, 0, 1, -3deg);
+  }
+
+  30%, 50%, 70%, 90% {
+    transform: scale3d(1.1, 1.1, 1.1) rotate3d(0, 0, 1, 3deg);
+  }
+
+  40%, 60%, 80% {
+    transform: scale3d(1.1, 1.1, 1.1) rotate3d(0, 0, 1, -3deg);
+  }
+
+  to {
+    transform: scale3d(1, 1, 1);
+  }
+}
+
+.tada {
+  animation-name: tada;
+}
+
+/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */
+
+@keyframes wobble {
+  from {
+    transform: none;
+  }
+
+  15% {
+    transform: translate3d(-25%, 0, 0) rotate3d(0, 0, 1, -5deg);
+  }
+
+  30% {
+    transform: translate3d(20%, 0, 0) rotate3d(0, 0, 1, 3deg);
+  }
+
+  45% {
+    transform: translate3d(-15%, 0, 0) rotate3d(0, 0, 1, -3deg);
+  }
+
+  60% {
+    transform: translate3d(10%, 0, 0) rotate3d(0, 0, 1, 2deg);
+  }
+
+  75% {
+    transform: translate3d(-5%, 0, 0) rotate3d(0, 0, 1, -1deg);
+  }
+
+  to {
+    transform: none;
+  }
+}
+
+.wobble {
+  animation-name: wobble;
+}
+
+@keyframes jello {
+  from, 11.1%, to {
+    transform: none;
+  }
+
+  22.2% {
+    transform: skewX(-12.5deg) skewY(-12.5deg);
+  }
+
+  33.3% {
+    transform: skewX(6.25deg) skewY(6.25deg);
+  }
+
+  44.4% {
+    transform: skewX(-3.125deg) skewY(-3.125deg);
+  }
+
+  55.5% {
+    transform: skewX(1.5625deg) skewY(1.5625deg);
+  }
+
+  66.6% {
+    transform: skewX(-0.78125deg) skewY(-0.78125deg);
+  }
+
+  77.7% {
+    transform: skewX(0.390625deg) skewY(0.390625deg);
+  }
+
+  88.8% {
+    transform: skewX(-0.1953125deg) skewY(-0.1953125deg);
+  }
+}
+
+.jello {
+  animation-name: jello;
+  transform-origin: center;
+}
+
+@keyframes bounceIn {
+  from, 20%, 40%, 60%, 80%, to {
+    animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
+  }
+
+  0% {
+    opacity: 0;
+    transform: scale3d(.3, .3, .3);
+  }
+
+  20% {
+    transform: scale3d(1.1, 1.1, 1.1);
+  }
+
+  40% {
+    transform: scale3d(.9, .9, .9);
+  }
+
+  60% {
+    opacity: 1;
+    transform: scale3d(1.03, 1.03, 1.03);
+  }
+
+  80% {
+    transform: scale3d(.97, .97, .97);
+  }
+
+  to {
+    opacity: 1;
+    transform: scale3d(1, 1, 1);
+  }
+}
+
+.bounceIn {
+  animation-name: bounceIn;
+}
+
+@keyframes bounceInDown {
+  from, 60%, 75%, 90%, to {
+    animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
+  }
+
+  0% {
+    opacity: 0;
+    transform: translate3d(0, -3000px, 0);
+  }
+
+  60% {
+    opacity: 1;
+    transform: translate3d(0, 25px, 0);
+  }
+
+  75% {
+    transform: translate3d(0, -10px, 0);
+  }
+
+  90% {
+    transform: translate3d(0, 5px, 0);
+  }
+
+  to {
+    transform: none;
+  }
+}
+
+.bounceInDown {
+  animation-name: bounceInDown;
+}
+
+@keyframes bounceInLeft {
+  from, 60%, 75%, 90%, to {
+    animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
+  }
+
+  0% {
+    opacity: 0;
+    transform: translate3d(-3000px, 0, 0);
+  }
+
+  60% {
+    opacity: 1;
+    transform: translate3d(25px, 0, 0);
+  }
+
+  75% {
+    transform: translate3d(-10px, 0, 0);
+  }
+
+  90% {
+    transform: translate3d(5px, 0, 0);
+  }
+
+  to {
+    transform: none;
+  }
+}
+
+.bounceInLeft {
+  animation-name: bounceInLeft;
+}
+
+@keyframes bounceInRight {
+  from, 60%, 75%, 90%, to {
+    animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
+  }
+
+  from {
+    opacity: 0;
+    transform: translate3d(3000px, 0, 0);
+  }
+
+  60% {
+    opacity: 1;
+    transform: translate3d(-25px, 0, 0);
+  }
+
+  75% {
+    transform: translate3d(10px, 0, 0);
+  }
+
+  90% {
+    transform: translate3d(-5px, 0, 0);
+  }
+
+  to {
+    transform: none;
+  }
+}
+
+.bounceInRight {
+  animation-name: bounceInRight;
+}
+
+@keyframes bounceInUp {
+  from, 60%, 75%, 90%, to {
+    animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
+  }
+
+  from {
+    opacity: 0;
+    transform: translate3d(0, 3000px, 0);
+  }
+
+  60% {
+    opacity: 1;
+    transform: translate3d(0, -20px, 0);
+  }
+
+  75% {
+    transform: translate3d(0, 10px, 0);
+  }
+
+  90% {
+    transform: translate3d(0, -5px, 0);
+  }
+
+  to {
+    transform: translate3d(0, 0, 0);
+  }
+}
+
+.bounceInUp {
+  animation-name: bounceInUp;
+}
+
+@keyframes bounceOut {
+  20% {
+    transform: scale3d(.9, .9, .9);
+  }
+
+  50%, 55% {
+    opacity: 1;
+    transform: scale3d(1.1, 1.1, 1.1);
+  }
+
+  to {
+    opacity: 0;
+    transform: scale3d(.3, .3, .3);
+  }
+}
+
+.bounceOut {
+  animation-name: bounceOut;
+}
+
+@keyframes bounceOutDown {
+  20% {
+    transform: translate3d(0, 10px, 0);
+  }
+
+  40%, 45% {
+    opacity: 1;
+    transform: translate3d(0, -20px, 0);
+  }
+
+  to {
+    opacity: 0;
+    transform: translate3d(0, 2000px, 0);
+  }
+}
+
+.bounceOutDown {
+  animation-name: bounceOutDown;
+}
+
+@keyframes bounceOutLeft {
+  20% {
+    opacity: 1;
+    transform: translate3d(20px, 0, 0);
+  }
+
+  to {
+    opacity: 0;
+    transform: translate3d(-2000px, 0, 0);
+  }
+}
+
+.bounceOutLeft {
+  animation-name: bounceOutLeft;
+}
+
+@keyframes bounceOutRight {
+  20% {
+    opacity: 1;
+    transform: translate3d(-20px, 0, 0);
+  }
+
+  to {
+    opacity: 0;
+    transform: translate3d(2000px, 0, 0);
+  }
+}
+
+.bounceOutRight {
+  animation-name: bounceOutRight;
+}
+
+@keyframes bounceOutUp {
+  20% {
+    transform: translate3d(0, -10px, 0);
+  }
+
+  40%, 45% {
+    opacity: 1;
+    transform: translate3d(0, 20px, 0);
+  }
+
+  to {
+    opacity: 0;
+    transform: translate3d(0, -2000px, 0);
+  }
+}
+
+.bounceOutUp {
+  animation-name: bounceOutUp;
+}
+
+@keyframes fadeIn {
+  from {
+    opacity: 0;
+  }
+
+  to {
+    opacity: 1;
+  }
+}
+
+.fadeIn {
+  animation-name: fadeIn;
+}
+
+@keyframes fadeInDown {
+  from {
+    opacity: 0;
+    transform: translate3d(0, -100%, 0);
+  }
+
+  to {
+    opacity: 1;
+    transform: none;
+  }
+}
+
+.fadeInDown {
+  animation-name: fadeInDown;
+}
+
+@keyframes fadeInDownBig {
+  from {
+    opacity: 0;
+    transform: translate3d(0, -2000px, 0);
+  }
+
+  to {
+    opacity: 1;
+    transform: none;
+  }
+}
+
+.fadeInDownBig {
+  animation-name: fadeInDownBig;
+}
+
+@keyframes fadeInLeft {
+  from {
+    opacity: 0;
+    transform: translate3d(-100%, 0, 0);
+  }
+
+  to {
+    opacity: 1;
+    transform: none;
+  }
+}
+
+.fadeInLeft {
+  animation-name: fadeInLeft;
+}
+
+@keyframes fadeInLeftBig {
+  from {
+    opacity: 0;
+    transform: translate3d(-2000px, 0, 0);
+  }
+
+  to {
+    opacity: 1;
+    transform: none;
+  }
+}
+
+.fadeInLeftBig {
+  animation-name: fadeInLeftBig;
+}
+
+@keyframes fadeInRight {
+  from {
+    opacity: 0;
+    transform: translate3d(100%, 0, 0);
+  }
+
+  to {
+    opacity: 1;
+    transform: none;
+  }
+}
+
+.fadeInRight {
+  animation-name: fadeInRight;
+}
+
+@keyframes fadeInRightBig {
+  from {
+    opacity: 0;
+    transform: translate3d(2000px, 0, 0);
+  }
+
+  to {
+    opacity: 1;
+    transform: none;
+  }
+}
+
+.fadeInRightBig {
+  animation-name: fadeInRightBig;
+}
+
+@keyframes fadeInUp {
+  from {
+    opacity: 0;
+    transform: translate3d(0, 100%, 0);
+  }
+
+  to {
+    opacity: 1;
+    transform: none;
+  }
+}
+
+.fadeInUp {
+  animation-name: fadeInUp;
+}
+
+@keyframes fadeInUpBig {
+  from {
+    opacity: 0;
+    transform: translate3d(0, 2000px, 0);
+  }
+
+  to {
+    opacity: 1;
+    transform: none;
+  }
+}
+
+.fadeInUpBig {
+  animation-name: fadeInUpBig;
+}
+
+@keyframes fadeOut {
+  from {
+    opacity: 1;
+  }
+
+  to {
+    opacity: 0;
+  }
+}
+
+.fadeOut {
+  animation-name: fadeOut;
+}
+
+@keyframes fadeOutDown {
+  from {
+    opacity: 1;
+  }
+
+  to {
+    opacity: 0;
+    transform: translate3d(0, 100%, 0);
+  }
+}
+
+.fadeOutDown {
+  animation-name: fadeOutDown;
+}
+
+@keyframes fadeOutDownBig {
+  from {
+    opacity: 1;
+  }
+
+  to {
+    opacity: 0;
+    transform: translate3d(0, 2000px, 0);
+  }
+}
+
+.fadeOutDownBig {
+  animation-name: fadeOutDownBig;
+}
+
+@keyframes fadeOutLeft {
+  from {
+    opacity: 1;
+  }
+
+  to {
+    opacity: 0;
+    transform: translate3d(-100%, 0, 0);
+  }
+}
+
+.fadeOutLeft {
+  animation-name: fadeOutLeft;
+}
+
+@keyframes fadeOutLeftBig {
+  from {
+    opacity: 1;
+  }
+
+  to {
+    opacity: 0;
+    transform: translate3d(-2000px, 0, 0);
+  }
+}
+
+.fadeOutLeftBig {
+  animation-name: fadeOutLeftBig;
+}
+
+@keyframes fadeOutRight {
+  from {
+    opacity: 1;
+  }
+
+  to {
+    opacity: 0;
+    transform: translate3d(100%, 0, 0);
+  }
+}
+
+.fadeOutRight {
+  animation-name: fadeOutRight;
+}
+
+@keyframes fadeOutRightBig {
+  from {
+    opacity: 1;
+  }
+
+  to {
+    opacity: 0;
+    transform: translate3d(2000px, 0, 0);
+  }
+}
+
+.fadeOutRightBig {
+  animation-name: fadeOutRightBig;
+}
+
+@keyframes fadeOutUp {
+  from {
+    opacity: 1;
+  }
+
+  to {
+    opacity: 0;
+    transform: translate3d(0, -100%, 0);
+  }
+}
+
+.fadeOutUp {
+  animation-name: fadeOutUp;
+}
+
+@keyframes fadeOutUpBig {
+  from {
+    opacity: 1;
+  }
+
+  to {
+    opacity: 0;
+    transform: translate3d(0, -2000px, 0);
+  }
+}
+
+.fadeOutUpBig {
+  animation-name: fadeOutUpBig;
+}
+
+@keyframes flip {
+  from {
+    transform: perspective(400px) rotate3d(0, 1, 0, -360deg);
+    animation-timing-function: ease-out;
+  }
+
+  40% {
+    transform: perspective(400px) translate3d(0, 0, 150px) rotate3d(0, 1, 0, -190deg);
+    animation-timing-function: ease-out;
+  }
+
+  50% {
+    transform: perspective(400px) translate3d(0, 0, 150px) rotate3d(0, 1, 0, -170deg);
+    animation-timing-function: ease-in;
+  }
+
+  80% {
+    transform: perspective(400px) scale3d(.95, .95, .95);
+    animation-timing-function: ease-in;
+  }
+
+  to {
+    transform: perspective(400px);
+    animation-timing-function: ease-in;
+  }
+}
+
+.animated.flip {
+  -webkit-backface-visibility: visible;
+  backface-visibility: visible;
+  animation-name: flip;
+}
+
+@keyframes flipInX {
+  from {
+    transform: perspective(400px) rotate3d(1, 0, 0, 90deg);
+    animation-timing-function: ease-in;
+    opacity: 0;
+  }
+
+  40% {
+    transform: perspective(400px) rotate3d(1, 0, 0, -20deg);
+    animation-timing-function: ease-in;
+  }
+
+  60% {
+    transform: perspective(400px) rotate3d(1, 0, 0, 10deg);
+    opacity: 1;
+  }
+
+  80% {
+    transform: perspective(400px) rotate3d(1, 0, 0, -5deg);
+  }
+
+  to {
+    transform: perspective(400px);
+  }
+}
+
+.flipInX {
+  -webkit-backface-visibility: visible !important;
+  backface-visibility: visible !important;
+  animation-name: flipInX;
+}
+
+@keyframes flipInY {
+  from {
+    transform: perspective(400px) rotate3d(0, 1, 0, 90deg);
+    animation-timing-function: ease-in;
+    opacity: 0;
+  }
+
+  40% {
+    transform: perspective(400px) rotate3d(0, 1, 0, -20deg);
+    animation-timing-function: ease-in;
+  }
+
+  60% {
+    transform: perspective(400px) rotate3d(0, 1, 0, 10deg);
+    opacity: 1;
+  }
+
+  80% {
+    transform: perspective(400px) rotate3d(0, 1, 0, -5deg);
+  }
+
+  to {
+    transform: perspective(400px);
+  }
+}
+
+.flipInY {
+  -webkit-backface-visibility: visible !important;
+  backface-visibility: visible !important;
+  animation-name: flipInY;
+}
+
+@keyframes flipOutX {
+  from {
+    transform: perspective(400px);
+  }
+
+  30% {
+    transform: perspective(400px) rotate3d(1, 0, 0, -20deg);
+    opacity: 1;
+  }
+
+  to {
+    transform: perspective(400px) rotate3d(1, 0, 0, 90deg);
+    opacity: 0;
+  }
+}
+
+.flipOutX {
+  animation-name: flipOutX;
+  -webkit-backface-visibility: visible !important;
+  backface-visibility: visible !important;
+}
+
+@keyframes flipOutY {
+  from {
+    transform: perspective(400px);
+  }
+
+  30% {
+    transform: perspective(400px) rotate3d(0, 1, 0, -15deg);
+    opacity: 1;
+  }
+
+  to {
+    transform: perspective(400px) rotate3d(0, 1, 0, 90deg);
+    opacity: 0;
+  }
+}
+
+.flipOutY {
+  -webkit-backface-visibility: visible !important;
+  backface-visibility: visible !important;
+  animation-name: flipOutY;
+}
+
+@keyframes lightSpeedIn {
+  from {
+    transform: translate3d(100%, 0, 0) skewX(-30deg);
+    opacity: 0;
+  }
+
+  60% {
+    transform: skewX(20deg);
+    opacity: 1;
+  }
+
+  80% {
+    transform: skewX(-5deg);
+    opacity: 1;
+  }
+
+  to {
+    transform: none;
+    opacity: 1;
+  }
+}
+
+.lightSpeedIn {
+  animation-name: lightSpeedIn;
+  animation-timing-function: ease-out;
+}
+
+@keyframes lightSpeedOut {
+  from {
+    opacity: 1;
+  }
+
+  to {
+    transform: translate3d(100%, 0, 0) skewX(30deg);
+    opacity: 0;
+  }
+}
+
+.lightSpeedOut {
+  animation-name: lightSpeedOut;
+  animation-timing-function: ease-in;
+}
+
+@keyframes rotateIn {
+  from {
+    transform-origin: center;
+    transform: rotate3d(0, 0, 1, -200deg);
+    opacity: 0;
+  }
+
+  to {
+    transform-origin: center;
+    transform: none;
+    opacity: 1;
+  }
+}
+
+.rotateIn {
+  animation-name: rotateIn;
+}
+
+@keyframes rotateInDownLeft {
+  from {
+    transform-origin: left bottom;
+    transform: rotate3d(0, 0, 1, -45deg);
+    opacity: 0;
+  }
+
+  to {
+    transform-origin: left bottom;
+    transform: none;
+    opacity: 1;
+  }
+}
+
+.rotateInDownLeft {
+  animation-name: rotateInDownLeft;
+}
+
+@keyframes rotateInDownRight {
+  from {
+    transform-origin: right bottom;
+    transform: rotate3d(0, 0, 1, 45deg);
+    opacity: 0;
+  }
+
+  to {
+    transform-origin: right bottom;
+    transform: none;
+    opacity: 1;
+  }
+}
+
+.rotateInDownRight {
+  animation-name: rotateInDownRight;
+}
+
+@keyframes rotateInUpLeft {
+  from {
+    transform-origin: left bottom;
+    transform: rotate3d(0, 0, 1, 45deg);
+    opacity: 0;
+  }
+
+  to {
+    transform-origin: left bottom;
+    transform: none;
+    opacity: 1;
+  }
+}
+
+.rotateInUpLeft {
+  animation-name: rotateInUpLeft;
+}
+
+@keyframes rotateInUpRight {
+  from {
+    transform-origin: right bottom;
+    transform: rotate3d(0, 0, 1, -90deg);
+    opacity: 0;
+  }
+
+  to {
+    transform-origin: right bottom;
+    transform: none;
+    opacity: 1;
+  }
+}
+
+.rotateInUpRight {
+  animation-name: rotateInUpRight;
+}
+
+@keyframes rotateOut {
+  from {
+    transform-origin: center;
+    opacity: 1;
+  }
+
+  to {
+    transform-origin: center;
+    transform: rotate3d(0, 0, 1, 200deg);
+    opacity: 0;
+  }
+}
+
+.rotateOut {
+  animation-name: rotateOut;
+}
+
+@keyframes rotateOutDownLeft {
+  from {
+    transform-origin: left bottom;
+    opacity: 1;
+  }
+
+  to {
+    transform-origin: left bottom;
+    transform: rotate3d(0, 0, 1, 45deg);
+    opacity: 0;
+  }
+}
+
+.rotateOutDownLeft {
+  animation-name: rotateOutDownLeft;
+}
+
+@keyframes rotateOutDownRight {
+  from {
+    transform-origin: right bottom;
+    opacity: 1;
+  }
+
+  to {
+    transform-origin: right bottom;
+    transform: rotate3d(0, 0, 1, -45deg);
+    opacity: 0;
+  }
+}
+
+.rotateOutDownRight {
+  animation-name: rotateOutDownRight;
+}
+
+@keyframes rotateOutUpLeft {
+  from {
+    transform-origin: left bottom;
+    opacity: 1;
+  }
+
+  to {
+    transform-origin: left bottom;
+    transform: rotate3d(0, 0, 1, -45deg);
+    opacity: 0;
+  }
+}
+
+.rotateOutUpLeft {
+  animation-name: rotateOutUpLeft;
+}
+
+@keyframes rotateOutUpRight {
+  from {
+    transform-origin: right bottom;
+    opacity: 1;
+  }
+
+  to {
+    transform-origin: right bottom;
+    transform: rotate3d(0, 0, 1, 90deg);
+    opacity: 0;
+  }
+}
+
+.rotateOutUpRight {
+  animation-name: rotateOutUpRight;
+}
+
+@keyframes hinge {
+  0% {
+    transform-origin: top left;
+    animation-timing-function: ease-in-out;
+  }
+
+  20%, 60% {
+    transform: rotate3d(0, 0, 1, 80deg);
+    transform-origin: top left;
+    animation-timing-function: ease-in-out;
+  }
+
+  40%, 80% {
+    transform: rotate3d(0, 0, 1, 60deg);
+    transform-origin: top left;
+    animation-timing-function: ease-in-out;
+    opacity: 1;
+  }
+
+  to {
+    transform: translate3d(0, 700px, 0);
+    opacity: 0;
+  }
+}
+
+.hinge {
+  animation-name: hinge;
+}
+
+@keyframes jackInTheBox {
+  from {
+    opacity: 0;
+    transform: scale(0.1) rotate(30deg);
+    transform-origin: center bottom;
+  }
+
+  50% {
+    transform: rotate(-10deg);
+  }
+
+  70% {
+    transform: rotate(3deg);
+  }
+
+  to {
+    opacity: 1;
+    transform: scale(1);
+  }
+}
+
+.jackInTheBox {
+  animation-name: jackInTheBox;
+}
+
+/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */
+
+@keyframes rollIn {
+  from {
+    opacity: 0;
+    transform: translate3d(-100%, 0, 0) rotate3d(0, 0, 1, -120deg);
+  }
+
+  to {
+    opacity: 1;
+    transform: none;
+  }
+}
+
+.rollIn {
+  animation-name: rollIn;
+}
+
+/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */
+
+@keyframes rollOut {
+  from {
+    opacity: 1;
+  }
+
+  to {
+    opacity: 0;
+    transform: translate3d(100%, 0, 0) rotate3d(0, 0, 1, 120deg);
+  }
+}
+
+.rollOut {
+  animation-name: rollOut;
+}
+
+@keyframes zoomIn {
+  from {
+    opacity: 0;
+    transform: scale3d(.3, .3, .3);
+  }
+
+  50% {
+    opacity: 1;
+  }
+}
+
+.zoomIn {
+  animation-name: zoomIn;
+}
+
+@keyframes zoomInDown {
+  from {
+    opacity: 0;
+    transform: scale3d(.1, .1, .1) translate3d(0, -1000px, 0);
+    animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
+  }
+
+  60% {
+    opacity: 1;
+    transform: scale3d(.475, .475, .475) translate3d(0, 60px, 0);
+    animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
+  }
+}
+
+.zoomInDown {
+  animation-name: zoomInDown;
+}
+
+@keyframes zoomInLeft {
+  from {
+    opacity: 0;
+    transform: scale3d(.1, .1, .1) translate3d(-1000px, 0, 0);
+    animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
+  }
+
+  60% {
+    opacity: 1;
+    transform: scale3d(.475, .475, .475) translate3d(10px, 0, 0);
+    animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
+  }
+}
+
+.zoomInLeft {
+  animation-name: zoomInLeft;
+}
+
+@keyframes zoomInRight {
+  from {
+    opacity: 0;
+    transform: scale3d(.1, .1, .1) translate3d(1000px, 0, 0);
+    animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
+  }
+
+  60% {
+    opacity: 1;
+    transform: scale3d(.475, .475, .475) translate3d(-10px, 0, 0);
+    animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
+  }
+}
+
+.zoomInRight {
+  animation-name: zoomInRight;
+}
+
+@keyframes zoomInUp {
+  from {
+    opacity: 0;
+    transform: scale3d(.1, .1, .1) translate3d(0, 1000px, 0);
+    animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
+  }
+
+  60% {
+    opacity: 1;
+    transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0);
+    animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
+  }
+}
+
+.zoomInUp {
+  animation-name: zoomInUp;
+}
+
+@keyframes zoomOut {
+  from {
+    opacity: 1;
+  }
+
+  50% {
+    opacity: 0;
+    transform: scale3d(.3, .3, .3);
+  }
+
+  to {
+    opacity: 0;
+  }
+}
+
+.zoomOut {
+  animation-name: zoomOut;
+}
+
+@keyframes zoomOutDown {
+  40% {
+    opacity: 1;
+    transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0);
+    animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
+  }
+
+  to {
+    opacity: 0;
+    transform: scale3d(.1, .1, .1) translate3d(0, 2000px, 0);
+    transform-origin: center bottom;
+    animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
+  }
+}
+
+.zoomOutDown {
+  animation-name: zoomOutDown;
+}
+
+@keyframes zoomOutLeft {
+  40% {
+    opacity: 1;
+    transform: scale3d(.475, .475, .475) translate3d(42px, 0, 0);
+  }
+
+  to {
+    opacity: 0;
+    transform: scale(.1) translate3d(-2000px, 0, 0);
+    transform-origin: left center;
+  }
+}
+
+.zoomOutLeft {
+  animation-name: zoomOutLeft;
+}
+
+@keyframes zoomOutRight {
+  40% {
+    opacity: 1;
+    transform: scale3d(.475, .475, .475) translate3d(-42px, 0, 0);
+  }
+
+  to {
+    opacity: 0;
+    transform: scale(.1) translate3d(2000px, 0, 0);
+    transform-origin: right center;
+  }
+}
+
+.zoomOutRight {
+  animation-name: zoomOutRight;
+}
+
+@keyframes zoomOutUp {
+  40% {
+    opacity: 1;
+    transform: scale3d(.475, .475, .475) translate3d(0, 60px, 0);
+    animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
+  }
+
+  to {
+    opacity: 0;
+    transform: scale3d(.1, .1, .1) translate3d(0, -2000px, 0);
+    transform-origin: center bottom;
+    animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
+  }
+}
+
+.zoomOutUp {
+  animation-name: zoomOutUp;
+}
+
+@keyframes slideInDown {
+  from {
+    transform: translate3d(0, -100%, 0);
+    visibility: visible;
+  }
+
+  to {
+    transform: translate3d(0, 0, 0);
+  }
+}
+
+.slideInDown {
+  animation-name: slideInDown;
+}
+
+@keyframes slideInLeft {
+  from {
+    transform: translate3d(-100%, 0, 0);
+    visibility: visible;
+  }
+
+  to {
+    transform: translate3d(0, 0, 0);
+  }
+}
+
+.slideInLeft {
+  animation-name: slideInLeft;
+}
+
+@keyframes slideInRight {
+  from {
+    transform: translate3d(100%, 0, 0);
+    visibility: visible;
+  }
+
+  to {
+    transform: translate3d(0, 0, 0);
+  }
+}
+
+.slideInRight {
+  animation-name: slideInRight;
+}
+
+@keyframes slideInUp {
+  from {
+    transform: translate3d(0, 100%, 0);
+    visibility: visible;
+  }
+
+  to {
+    transform: translate3d(0, 0, 0);
+  }
+}
+
+.slideInUp {
+  animation-name: slideInUp;
+}
+
+@keyframes slideOutDown {
+  from {
+    transform: translate3d(0, 0, 0);
+  }
+
+  to {
+    visibility: hidden;
+    transform: translate3d(0, 100%, 0);
+  }
+}
+
+.slideOutDown {
+  animation-name: slideOutDown;
+}
+
+@keyframes slideOutLeft {
+  from {
+    transform: translate3d(0, 0, 0);
+  }
+
+  to {
+    visibility: hidden;
+    transform: translate3d(-100%, 0, 0);
+  }
+}
+
+.slideOutLeft {
+  animation-name: slideOutLeft;
+}
+
+@keyframes slideOutRight {
+  from {
+    transform: translate3d(0, 0, 0);
+  }
+
+  to {
+    visibility: hidden;
+    transform: translate3d(100%, 0, 0);
+  }
+}
+
+.slideOutRight {
+  animation-name: slideOutRight;
+}
+
+@keyframes slideOutUp {
+  from {
+    transform: translate3d(0, 0, 0);
+  }
+
+  to {
+    visibility: hidden;
+    transform: translate3d(0, -100%, 0);
+  }
+}
+
+.slideOutUp {
+  animation-name: slideOutUp;
+}
diff --git a/docs/lib/animate/animate.min.css b/docs/lib/animate/animate.min.css
new file mode 100644
index 0000000..511b52a
--- /dev/null
+++ b/docs/lib/animate/animate.min.css
@@ -0,0 +1,11 @@
+@charset "UTF-8";
+
+/*!
+ * animate.css -http://daneden.me/animate
+ * Version - 3.5.2
+ * Licensed under the MIT license - http://opensource.org/licenses/MIT
+ *
+ * Copyright (c) 2017 Daniel Eden
+ */
+
+.animated{animation-duration:1s;animation-fill-mode:both}.animated.infinite{animation-iteration-count:infinite}.animated.hinge{animation-duration:2s}.animated.bounceIn,.animated.bounceOut,.animated.flipOutX,.animated.flipOutY{animation-duration:.75s}@keyframes bounce{0%,20%,53%,80%,to{animation-timing-function:cubic-bezier(.215,.61,.355,1);transform:translateZ(0)}40%,43%{animation-timing-function:cubic-bezier(.755,.05,.855,.06);transform:translate3d(0,-30px,0)}70%{animation-timing-function:cubic-bezier(.755,.05,.855,.06);transform:translate3d(0,-15px,0)}90%{transform:translate3d(0,-4px,0)}}.bounce{animation-name:bounce;transform-origin:center bottom}@keyframes flash{0%,50%,to{opacity:1}25%,75%{opacity:0}}.flash{animation-name:flash}@keyframes pulse{0%{transform:scaleX(1)}50%{transform:scale3d(1.05,1.05,1.05)}to{transform:scaleX(1)}}.pulse{animation-name:pulse}@keyframes rubberBand{0%{transform:scaleX(1)}30%{transform:scale3d(1.25,.75,1)}40%{transform:scale3d(.75,1.25,1)}50%{transform:scale3d(1.15,.85,1)}65%{transform:scale3d(.95,1.05,1)}75%{transform:scale3d(1.05,.95,1)}to{transform:scaleX(1)}}.rubberBand{animation-name:rubberBand}@keyframes shake{0%,to{transform:translateZ(0)}10%,30%,50%,70%,90%{transform:translate3d(-10px,0,0)}20%,40%,60%,80%{transform:translate3d(10px,0,0)}}.shake{animation-name:shake}@keyframes headShake{0%{transform:translateX(0)}6.5%{transform:translateX(-6px) rotateY(-9deg)}18.5%{transform:translateX(5px) rotateY(7deg)}31.5%{transform:translateX(-3px) rotateY(-5deg)}43.5%{transform:translateX(2px) rotateY(3deg)}50%{transform:translateX(0)}}.headShake{animation-timing-function:ease-in-out;animation-name:headShake}@keyframes swing{20%{transform:rotate(15deg)}40%{transform:rotate(-10deg)}60%{transform:rotate(5deg)}80%{transform:rotate(-5deg)}to{transform:rotate(0deg)}}.swing{transform-origin:top center;animation-name:swing}@keyframes tada{0%{transform:scaleX(1)}10%,20%{transform:scale3d(.9,.9,.9) rotate(-3deg)}30%,50%,70%,90%{transform:scale3d(1.1,1.1,1.1) rotate(3deg)}40%,60%,80%{transform:scale3d(1.1,1.1,1.1) rotate(-3deg)}to{transform:scaleX(1)}}.tada{animation-name:tada}@keyframes wobble{0%{transform:none}15%{transform:translate3d(-25%,0,0) rotate(-5deg)}30%{transform:translate3d(20%,0,0) rotate(3deg)}45%{transform:translate3d(-15%,0,0) rotate(-3deg)}60%{transform:translate3d(10%,0,0) rotate(2deg)}75%{transform:translate3d(-5%,0,0) rotate(-1deg)}to{transform:none}}.wobble{animation-name:wobble}@keyframes jello{0%,11.1%,to{transform:none}22.2%{transform:skewX(-12.5deg) skewY(-12.5deg)}33.3%{transform:skewX(6.25deg) skewY(6.25deg)}44.4%{transform:skewX(-3.125deg) skewY(-3.125deg)}55.5%{transform:skewX(1.5625deg) skewY(1.5625deg)}66.6%{transform:skewX(-.78125deg) skewY(-.78125deg)}77.7%{transform:skewX(.390625deg) skewY(.390625deg)}88.8%{transform:skewX(-.1953125deg) skewY(-.1953125deg)}}.jello{animation-name:jello;transform-origin:center}@keyframes bounceIn{0%,20%,40%,60%,80%,to{animation-timing-function:cubic-bezier(.215,.61,.355,1)}0%{opacity:0;transform:scale3d(.3,.3,.3)}20%{transform:scale3d(1.1,1.1,1.1)}40%{transform:scale3d(.9,.9,.9)}60%{opacity:1;transform:scale3d(1.03,1.03,1.03)}80%{transform:scale3d(.97,.97,.97)}to{opacity:1;transform:scaleX(1)}}.bounceIn{animation-name:bounceIn}@keyframes bounceInDown{0%,60%,75%,90%,to{animation-timing-function:cubic-bezier(.215,.61,.355,1)}0%{opacity:0;transform:translate3d(0,-3000px,0)}60%{opacity:1;transform:translate3d(0,25px,0)}75%{transform:translate3d(0,-10px,0)}90%{transform:translate3d(0,5px,0)}to{transform:none}}.bounceInDown{animation-name:bounceInDown}@keyframes bounceInLeft{0%,60%,75%,90%,to{animation-timing-function:cubic-bezier(.215,.61,.355,1)}0%{opacity:0;transform:translate3d(-3000px,0,0)}60%{opacity:1;transform:translate3d(25px,0,0)}75%{transform:translate3d(-10px,0,0)}90%{transform:translate3d(5px,0,0)}to{transform:none}}.bounceInLeft{animation-name:bounceInLeft}@keyframes bounceInRight{0%,60%,75%,90%,to{animation-timing-function:cubic-bezier(.215,.61,.355,1)}0%{opacity:0;transform:translate3d(3000px,0,0)}60%{opacity:1;transform:translate3d(-25px,0,0)}75%{transform:translate3d(10px,0,0)}90%{transform:translate3d(-5px,0,0)}to{transform:none}}.bounceInRight{animation-name:bounceInRight}@keyframes bounceInUp{0%,60%,75%,90%,to{animation-timing-function:cubic-bezier(.215,.61,.355,1)}0%{opacity:0;transform:translate3d(0,3000px,0)}60%{opacity:1;transform:translate3d(0,-20px,0)}75%{transform:translate3d(0,10px,0)}90%{transform:translate3d(0,-5px,0)}to{transform:translateZ(0)}}.bounceInUp{animation-name:bounceInUp}@keyframes bounceOut{20%{transform:scale3d(.9,.9,.9)}50%,55%{opacity:1;transform:scale3d(1.1,1.1,1.1)}to{opacity:0;transform:scale3d(.3,.3,.3)}}.bounceOut{animation-name:bounceOut}@keyframes bounceOutDown{20%{transform:translate3d(0,10px,0)}40%,45%{opacity:1;transform:translate3d(0,-20px,0)}to{opacity:0;transform:translate3d(0,2000px,0)}}.bounceOutDown{animation-name:bounceOutDown}@keyframes bounceOutLeft{20%{opacity:1;transform:translate3d(20px,0,0)}to{opacity:0;transform:translate3d(-2000px,0,0)}}.bounceOutLeft{animation-name:bounceOutLeft}@keyframes bounceOutRight{20%{opacity:1;transform:translate3d(-20px,0,0)}to{opacity:0;transform:translate3d(2000px,0,0)}}.bounceOutRight{animation-name:bounceOutRight}@keyframes bounceOutUp{20%{transform:translate3d(0,-10px,0)}40%,45%{opacity:1;transform:translate3d(0,20px,0)}to{opacity:0;transform:translate3d(0,-2000px,0)}}.bounceOutUp{animation-name:bounceOutUp}@keyframes fadeIn{0%{opacity:0}to{opacity:1}}.fadeIn{animation-name:fadeIn}@keyframes fadeInDown{0%{opacity:0;transform:translate3d(0,-100%,0)}to{opacity:1;transform:none}}.fadeInDown{animation-name:fadeInDown}@keyframes fadeInDownBig{0%{opacity:0;transform:translate3d(0,-2000px,0)}to{opacity:1;transform:none}}.fadeInDownBig{animation-name:fadeInDownBig}@keyframes fadeInLeft{0%{opacity:0;transform:translate3d(-100%,0,0)}to{opacity:1;transform:none}}.fadeInLeft{animation-name:fadeInLeft}@keyframes fadeInLeftBig{0%{opacity:0;transform:translate3d(-2000px,0,0)}to{opacity:1;transform:none}}.fadeInLeftBig{animation-name:fadeInLeftBig}@keyframes fadeInRight{0%{opacity:0;transform:translate3d(100%,0,0)}to{opacity:1;transform:none}}.fadeInRight{animation-name:fadeInRight}@keyframes fadeInRightBig{0%{opacity:0;transform:translate3d(2000px,0,0)}to{opacity:1;transform:none}}.fadeInRightBig{animation-name:fadeInRightBig}@keyframes fadeInUp{0%{opacity:0;transform:translate3d(0,100%,0)}to{opacity:1;transform:none}}.fadeInUp{animation-name:fadeInUp}@keyframes fadeInUpBig{0%{opacity:0;transform:translate3d(0,2000px,0)}to{opacity:1;transform:none}}.fadeInUpBig{animation-name:fadeInUpBig}@keyframes fadeOut{0%{opacity:1}to{opacity:0}}.fadeOut{animation-name:fadeOut}@keyframes fadeOutDown{0%{opacity:1}to{opacity:0;transform:translate3d(0,100%,0)}}.fadeOutDown{animation-name:fadeOutDown}@keyframes fadeOutDownBig{0%{opacity:1}to{opacity:0;transform:translate3d(0,2000px,0)}}.fadeOutDownBig{animation-name:fadeOutDownBig}@keyframes fadeOutLeft{0%{opacity:1}to{opacity:0;transform:translate3d(-100%,0,0)}}.fadeOutLeft{animation-name:fadeOutLeft}@keyframes fadeOutLeftBig{0%{opacity:1}to{opacity:0;transform:translate3d(-2000px,0,0)}}.fadeOutLeftBig{animation-name:fadeOutLeftBig}@keyframes fadeOutRight{0%{opacity:1}to{opacity:0;transform:translate3d(100%,0,0)}}.fadeOutRight{animation-name:fadeOutRight}@keyframes fadeOutRightBig{0%{opacity:1}to{opacity:0;transform:translate3d(2000px,0,0)}}.fadeOutRightBig{animation-name:fadeOutRightBig}@keyframes fadeOutUp{0%{opacity:1}to{opacity:0;transform:translate3d(0,-100%,0)}}.fadeOutUp{animation-name:fadeOutUp}@keyframes fadeOutUpBig{0%{opacity:1}to{opacity:0;transform:translate3d(0,-2000px,0)}}.fadeOutUpBig{animation-name:fadeOutUpBig}@keyframes flip{0%{transform:perspective(400px) rotateY(-1turn);animation-timing-function:ease-out}40%{transform:perspective(400px) translateZ(150px) rotateY(-190deg);animation-timing-function:ease-out}50%{transform:perspective(400px) translateZ(150px) rotateY(-170deg);animation-timing-function:ease-in}80%{transform:perspective(400px) scale3d(.95,.95,.95);animation-timing-function:ease-in}to{transform:perspective(400px);animation-timing-function:ease-in}}.animated.flip{-webkit-backface-visibility:visible;backface-visibility:visible;animation-name:flip}@keyframes flipInX{0%{transform:perspective(400px) rotateX(90deg);animation-timing-function:ease-in;opacity:0}40%{transform:perspective(400px) rotateX(-20deg);animation-timing-function:ease-in}60%{transform:perspective(400px) rotateX(10deg);opacity:1}80%{transform:perspective(400px) rotateX(-5deg)}to{transform:perspective(400px)}}.flipInX{-webkit-backface-visibility:visible!important;backface-visibility:visible!important;animation-name:flipInX}@keyframes flipInY{0%{transform:perspective(400px) rotateY(90deg);animation-timing-function:ease-in;opacity:0}40%{transform:perspective(400px) rotateY(-20deg);animation-timing-function:ease-in}60%{transform:perspective(400px) rotateY(10deg);opacity:1}80%{transform:perspective(400px) rotateY(-5deg)}to{transform:perspective(400px)}}.flipInY{-webkit-backface-visibility:visible!important;backface-visibility:visible!important;animation-name:flipInY}@keyframes flipOutX{0%{transform:perspective(400px)}30%{transform:perspective(400px) rotateX(-20deg);opacity:1}to{transform:perspective(400px) rotateX(90deg);opacity:0}}.flipOutX{animation-name:flipOutX;-webkit-backface-visibility:visible!important;backface-visibility:visible!important}@keyframes flipOutY{0%{transform:perspective(400px)}30%{transform:perspective(400px) rotateY(-15deg);opacity:1}to{transform:perspective(400px) rotateY(90deg);opacity:0}}.flipOutY{-webkit-backface-visibility:visible!important;backface-visibility:visible!important;animation-name:flipOutY}@keyframes lightSpeedIn{0%{transform:translate3d(100%,0,0) skewX(-30deg);opacity:0}60%{transform:skewX(20deg);opacity:1}80%{transform:skewX(-5deg);opacity:1}to{transform:none;opacity:1}}.lightSpeedIn{animation-name:lightSpeedIn;animation-timing-function:ease-out}@keyframes lightSpeedOut{0%{opacity:1}to{transform:translate3d(100%,0,0) skewX(30deg);opacity:0}}.lightSpeedOut{animation-name:lightSpeedOut;animation-timing-function:ease-in}@keyframes rotateIn{0%{transform-origin:center;transform:rotate(-200deg);opacity:0}to{transform-origin:center;transform:none;opacity:1}}.rotateIn{animation-name:rotateIn}@keyframes rotateInDownLeft{0%{transform-origin:left bottom;transform:rotate(-45deg);opacity:0}to{transform-origin:left bottom;transform:none;opacity:1}}.rotateInDownLeft{animation-name:rotateInDownLeft}@keyframes rotateInDownRight{0%{transform-origin:right bottom;transform:rotate(45deg);opacity:0}to{transform-origin:right bottom;transform:none;opacity:1}}.rotateInDownRight{animation-name:rotateInDownRight}@keyframes rotateInUpLeft{0%{transform-origin:left bottom;transform:rotate(45deg);opacity:0}to{transform-origin:left bottom;transform:none;opacity:1}}.rotateInUpLeft{animation-name:rotateInUpLeft}@keyframes rotateInUpRight{0%{transform-origin:right bottom;transform:rotate(-90deg);opacity:0}to{transform-origin:right bottom;transform:none;opacity:1}}.rotateInUpRight{animation-name:rotateInUpRight}@keyframes rotateOut{0%{transform-origin:center;opacity:1}to{transform-origin:center;transform:rotate(200deg);opacity:0}}.rotateOut{animation-name:rotateOut}@keyframes rotateOutDownLeft{0%{transform-origin:left bottom;opacity:1}to{transform-origin:left bottom;transform:rotate(45deg);opacity:0}}.rotateOutDownLeft{animation-name:rotateOutDownLeft}@keyframes rotateOutDownRight{0%{transform-origin:right bottom;opacity:1}to{transform-origin:right bottom;transform:rotate(-45deg);opacity:0}}.rotateOutDownRight{animation-name:rotateOutDownRight}@keyframes rotateOutUpLeft{0%{transform-origin:left bottom;opacity:1}to{transform-origin:left bottom;transform:rotate(-45deg);opacity:0}}.rotateOutUpLeft{animation-name:rotateOutUpLeft}@keyframes rotateOutUpRight{0%{transform-origin:right bottom;opacity:1}to{transform-origin:right bottom;transform:rotate(90deg);opacity:0}}.rotateOutUpRight{animation-name:rotateOutUpRight}@keyframes hinge{0%{transform-origin:top left;animation-timing-function:ease-in-out}20%,60%{transform:rotate(80deg);transform-origin:top left;animation-timing-function:ease-in-out}40%,80%{transform:rotate(60deg);transform-origin:top left;animation-timing-function:ease-in-out;opacity:1}to{transform:translate3d(0,700px,0);opacity:0}}.hinge{animation-name:hinge}@keyframes jackInTheBox{0%{opacity:0;transform:scale(.1) rotate(30deg);transform-origin:center bottom}50%{transform:rotate(-10deg)}70%{transform:rotate(3deg)}to{opacity:1;transform:scale(1)}}.jackInTheBox{animation-name:jackInTheBox}@keyframes rollIn{0%{opacity:0;transform:translate3d(-100%,0,0) rotate(-120deg)}to{opacity:1;transform:none}}.rollIn{animation-name:rollIn}@keyframes rollOut{0%{opacity:1}to{opacity:0;transform:translate3d(100%,0,0) rotate(120deg)}}.rollOut{animation-name:rollOut}@keyframes zoomIn{0%{opacity:0;transform:scale3d(.3,.3,.3)}50%{opacity:1}}.zoomIn{animation-name:zoomIn}@keyframes zoomInDown{0%{opacity:0;transform:scale3d(.1,.1,.1) translate3d(0,-1000px,0);animation-timing-function:cubic-bezier(.55,.055,.675,.19)}60%{opacity:1;transform:scale3d(.475,.475,.475) translate3d(0,60px,0);animation-timing-function:cubic-bezier(.175,.885,.32,1)}}.zoomInDown{animation-name:zoomInDown}@keyframes zoomInLeft{0%{opacity:0;transform:scale3d(.1,.1,.1) translate3d(-1000px,0,0);animation-timing-function:cubic-bezier(.55,.055,.675,.19)}60%{opacity:1;transform:scale3d(.475,.475,.475) translate3d(10px,0,0);animation-timing-function:cubic-bezier(.175,.885,.32,1)}}.zoomInLeft{animation-name:zoomInLeft}@keyframes zoomInRight{0%{opacity:0;transform:scale3d(.1,.1,.1) translate3d(1000px,0,0);animation-timing-function:cubic-bezier(.55,.055,.675,.19)}60%{opacity:1;transform:scale3d(.475,.475,.475) translate3d(-10px,0,0);animation-timing-function:cubic-bezier(.175,.885,.32,1)}}.zoomInRight{animation-name:zoomInRight}@keyframes zoomInUp{0%{opacity:0;transform:scale3d(.1,.1,.1) translate3d(0,1000px,0);animation-timing-function:cubic-bezier(.55,.055,.675,.19)}60%{opacity:1;transform:scale3d(.475,.475,.475) translate3d(0,-60px,0);animation-timing-function:cubic-bezier(.175,.885,.32,1)}}.zoomInUp{animation-name:zoomInUp}@keyframes zoomOut{0%{opacity:1}50%{opacity:0;transform:scale3d(.3,.3,.3)}to{opacity:0}}.zoomOut{animation-name:zoomOut}@keyframes zoomOutDown{40%{opacity:1;transform:scale3d(.475,.475,.475) translate3d(0,-60px,0);animation-timing-function:cubic-bezier(.55,.055,.675,.19)}to{opacity:0;transform:scale3d(.1,.1,.1) translate3d(0,2000px,0);transform-origin:center bottom;animation-timing-function:cubic-bezier(.175,.885,.32,1)}}.zoomOutDown{animation-name:zoomOutDown}@keyframes zoomOutLeft{40%{opacity:1;transform:scale3d(.475,.475,.475) translate3d(42px,0,0)}to{opacity:0;transform:scale(.1) translate3d(-2000px,0,0);transform-origin:left center}}.zoomOutLeft{animation-name:zoomOutLeft}@keyframes zoomOutRight{40%{opacity:1;transform:scale3d(.475,.475,.475) translate3d(-42px,0,0)}to{opacity:0;transform:scale(.1) translate3d(2000px,0,0);transform-origin:right center}}.zoomOutRight{animation-name:zoomOutRight}@keyframes zoomOutUp{40%{opacity:1;transform:scale3d(.475,.475,.475) translate3d(0,60px,0);animation-timing-function:cubic-bezier(.55,.055,.675,.19)}to{opacity:0;transform:scale3d(.1,.1,.1) translate3d(0,-2000px,0);transform-origin:center bottom;animation-timing-function:cubic-bezier(.175,.885,.32,1)}}.zoomOutUp{animation-name:zoomOutUp}@keyframes slideInDown{0%{transform:translate3d(0,-100%,0);visibility:visible}to{transform:translateZ(0)}}.slideInDown{animation-name:slideInDown}@keyframes slideInLeft{0%{transform:translate3d(-100%,0,0);visibility:visible}to{transform:translateZ(0)}}.slideInLeft{animation-name:slideInLeft}@keyframes slideInRight{0%{transform:translate3d(100%,0,0);visibility:visible}to{transform:translateZ(0)}}.slideInRight{animation-name:slideInRight}@keyframes slideInUp{0%{transform:translate3d(0,100%,0);visibility:visible}to{transform:translateZ(0)}}.slideInUp{animation-name:slideInUp}@keyframes slideOutDown{0%{transform:translateZ(0)}to{visibility:hidden;transform:translate3d(0,100%,0)}}.slideOutDown{animation-name:slideOutDown}@keyframes slideOutLeft{0%{transform:translateZ(0)}to{visibility:hidden;transform:translate3d(-100%,0,0)}}.slideOutLeft{animation-name:slideOutLeft}@keyframes slideOutRight{0%{transform:translateZ(0)}to{visibility:hidden;transform:translate3d(100%,0,0)}}.slideOutRight{animation-name:slideOutRight}@keyframes slideOutUp{0%{transform:translateZ(0)}to{visibility:hidden;transform:translate3d(0,-100%,0)}}.slideOutUp{animation-name:slideOutUp}
diff --git a/docs/lib/bootstrap/css/bootstrap.css b/docs/lib/bootstrap/css/bootstrap.css
new file mode 100644
index 0000000..aa49713
--- /dev/null
+++ b/docs/lib/bootstrap/css/bootstrap.css
@@ -0,0 +1,8975 @@
+/*!
+ * Bootstrap v4.0.0 (https://getbootstrap.com)
+ * Copyright 2011-2018 The Bootstrap Authors
+ * Copyright 2011-2018 Twitter, Inc.
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ */
+:root {
+  --blue: #007bff;
+  --indigo: #6610f2;
+  --purple: #6f42c1;
+  --pink: #e83e8c;
+  --red: #dc3545;
+  --orange: #fd7e14;
+  --yellow: #ffc107;
+  --green: #28a745;
+  --teal: #20c997;
+  --cyan: #17a2b8;
+  --white: #fff;
+  --gray: #6c757d;
+  --gray-dark: #343a40;
+  --primary: #007bff;
+  --secondary: #6c757d;
+  --success: #28a745;
+  --info: #17a2b8;
+  --warning: #ffc107;
+  --danger: #dc3545;
+  --light: #f8f9fa;
+  --dark: #343a40;
+  --breakpoint-xs: 0;
+  --breakpoint-sm: 576px;
+  --breakpoint-md: 768px;
+  --breakpoint-lg: 992px;
+  --breakpoint-xl: 1200px;
+  --font-family-sans-serif: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol";
+  --font-family-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
+}
+
+*,
+*::before,
+*::after {
+  box-sizing: border-box;
+}
+
+html {
+  font-family: sans-serif;
+  line-height: 1.15;
+  -webkit-text-size-adjust: 100%;
+  -ms-text-size-adjust: 100%;
+  -ms-overflow-style: scrollbar;
+  -webkit-tap-highlight-color: transparent;
+}
+
+@-ms-viewport {
+  width: device-width;
+}
+
+article, aside, dialog, figcaption, figure, footer, header, hgroup, main, nav, section {
+  display: block;
+}
+
+body {
+  margin: 0;
+  font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol";
+  font-size: 1rem;
+  font-weight: 400;
+  line-height: 1.5;
+  color: #212529;
+  text-align: left;
+  background-color: #fff;
+}
+
+[tabindex="-1"]:focus {
+  outline: 0 !important;
+}
+
+hr {
+  box-sizing: content-box;
+  height: 0;
+  overflow: visible;
+}
+
+h1, h2, h3, h4, h5, h6 {
+  margin-top: 0;
+  margin-bottom: 0.5rem;
+}
+
+p {
+  margin-top: 0;
+  margin-bottom: 1rem;
+}
+
+abbr[title],
+abbr[data-original-title] {
+  text-decoration: underline;
+  -webkit-text-decoration: underline dotted;
+  text-decoration: underline dotted;
+  cursor: help;
+  border-bottom: 0;
+}
+
+address {
+  margin-bottom: 1rem;
+  font-style: normal;
+  line-height: inherit;
+}
+
+ol,
+ul,
+dl {
+  margin-top: 0;
+  margin-bottom: 1rem;
+}
+
+ol ol,
+ul ul,
+ol ul,
+ul ol {
+  margin-bottom: 0;
+}
+
+dt {
+  font-weight: 700;
+}
+
+dd {
+  margin-bottom: .5rem;
+  margin-left: 0;
+}
+
+blockquote {
+  margin: 0 0 1rem;
+}
+
+dfn {
+  font-style: italic;
+}
+
+b,
+strong {
+  font-weight: bolder;
+}
+
+small {
+  font-size: 80%;
+}
+
+sub,
+sup {
+  position: relative;
+  font-size: 75%;
+  line-height: 0;
+  vertical-align: baseline;
+}
+
+sub {
+  bottom: -.25em;
+}
+
+sup {
+  top: -.5em;
+}
+
+a {
+  color: #007bff;
+  text-decoration: none;
+  background-color: transparent;
+  -webkit-text-decoration-skip: objects;
+}
+
+a:hover {
+  color: #0056b3;
+  text-decoration: underline;
+}
+
+a:not([href]):not([tabindex]) {
+  color: inherit;
+  text-decoration: none;
+}
+
+a:not([href]):not([tabindex]):hover, a:not([href]):not([tabindex]):focus {
+  color: inherit;
+  text-decoration: none;
+}
+
+a:not([href]):not([tabindex]):focus {
+  outline: 0;
+}
+
+pre,
+code,
+kbd,
+samp {
+  font-family: monospace, monospace;
+  font-size: 1em;
+}
+
+pre {
+  margin-top: 0;
+  margin-bottom: 1rem;
+  overflow: auto;
+  -ms-overflow-style: scrollbar;
+}
+
+figure {
+  margin: 0 0 1rem;
+}
+
+img {
+  vertical-align: middle;
+  border-style: none;
+}
+
+svg:not(:root) {
+  overflow: hidden;
+}
+
+table {
+  border-collapse: collapse;
+}
+
+caption {
+  padding-top: 0.75rem;
+  padding-bottom: 0.75rem;
+  color: #6c757d;
+  text-align: left;
+  caption-side: bottom;
+}
+
+th {
+  text-align: inherit;
+}
+
+label {
+  display: inline-block;
+  margin-bottom: .5rem;
+}
+
+button {
+  border-radius: 0;
+}
+
+button:focus {
+  outline: 1px dotted;
+  outline: 5px auto -webkit-focus-ring-color;
+}
+
+input,
+button,
+select,
+optgroup,
+textarea {
+  margin: 0;
+  font-family: inherit;
+  font-size: inherit;
+  line-height: inherit;
+}
+
+button,
+input {
+  overflow: visible;
+}
+
+button,
+select {
+  text-transform: none;
+}
+
+button,
+html [type="button"],
+[type="reset"],
+[type="submit"] {
+  -webkit-appearance: button;
+}
+
+button::-moz-focus-inner,
+[type="button"]::-moz-focus-inner,
+[type="reset"]::-moz-focus-inner,
+[type="submit"]::-moz-focus-inner {
+  padding: 0;
+  border-style: none;
+}
+
+input[type="radio"],
+input[type="checkbox"] {
+  box-sizing: border-box;
+  padding: 0;
+}
+
+input[type="date"],
+input[type="time"],
+input[type="datetime-local"],
+input[type="month"] {
+  -webkit-appearance: listbox;
+}
+
+textarea {
+  overflow: auto;
+  resize: vertical;
+}
+
+fieldset {
+  min-width: 0;
+  padding: 0;
+  margin: 0;
+  border: 0;
+}
+
+legend {
+  display: block;
+  width: 100%;
+  max-width: 100%;
+  padding: 0;
+  margin-bottom: .5rem;
+  font-size: 1.5rem;
+  line-height: inherit;
+  color: inherit;
+  white-space: normal;
+}
+
+progress {
+  vertical-align: baseline;
+}
+
+[type="number"]::-webkit-inner-spin-button,
+[type="number"]::-webkit-outer-spin-button {
+  height: auto;
+}
+
+[type="search"] {
+  outline-offset: -2px;
+  -webkit-appearance: none;
+}
+
+[type="search"]::-webkit-search-cancel-button,
+[type="search"]::-webkit-search-decoration {
+  -webkit-appearance: none;
+}
+
+::-webkit-file-upload-button {
+  font: inherit;
+  -webkit-appearance: button;
+}
+
+output {
+  display: inline-block;
+}
+
+summary {
+  display: list-item;
+  cursor: pointer;
+}
+
+template {
+  display: none;
+}
+
+[hidden] {
+  display: none !important;
+}
+
+h1, h2, h3, h4, h5, h6,
+.h1, .h2, .h3, .h4, .h5, .h6 {
+  margin-bottom: 0.5rem;
+  font-family: inherit;
+  font-weight: 500;
+  line-height: 1.2;
+  color: inherit;
+}
+
+h1, .h1 {
+  font-size: 2.5rem;
+}
+
+h2, .h2 {
+  font-size: 2rem;
+}
+
+h3, .h3 {
+  font-size: 1.75rem;
+}
+
+h4, .h4 {
+  font-size: 1.5rem;
+}
+
+h5, .h5 {
+  font-size: 1.25rem;
+}
+
+h6, .h6 {
+  font-size: 1rem;
+}
+
+.lead {
+  font-size: 1.25rem;
+  font-weight: 300;
+}
+
+.display-1 {
+  font-size: 6rem;
+  font-weight: 300;
+  line-height: 1.2;
+}
+
+.display-2 {
+  font-size: 5.5rem;
+  font-weight: 300;
+  line-height: 1.2;
+}
+
+.display-3 {
+  font-size: 4.5rem;
+  font-weight: 300;
+  line-height: 1.2;
+}
+
+.display-4 {
+  font-size: 3.5rem;
+  font-weight: 300;
+  line-height: 1.2;
+}
+
+hr {
+  margin-top: 1rem;
+  margin-bottom: 1rem;
+  border: 0;
+  border-top: 1px solid rgba(0, 0, 0, 0.1);
+}
+
+small,
+.small {
+  font-size: 80%;
+  font-weight: 400;
+}
+
+mark,
+.mark {
+  padding: 0.2em;
+  background-color: #fcf8e3;
+}
+
+.list-unstyled {
+  padding-left: 0;
+  list-style: none;
+}
+
+.list-inline {
+  padding-left: 0;
+  list-style: none;
+}
+
+.list-inline-item {
+  display: inline-block;
+}
+
+.list-inline-item:not(:last-child) {
+  margin-right: 0.5rem;
+}
+
+.initialism {
+  font-size: 90%;
+  text-transform: uppercase;
+}
+
+.blockquote {
+  margin-bottom: 1rem;
+  font-size: 1.25rem;
+}
+
+.blockquote-footer {
+  display: block;
+  font-size: 80%;
+  color: #6c757d;
+}
+
+.blockquote-footer::before {
+  content: "\2014 \00A0";
+}
+
+.img-fluid {
+  max-width: 100%;
+  height: auto;
+}
+
+.img-thumbnail {
+  padding: 0.25rem;
+  background-color: #fff;
+  border: 1px solid #dee2e6;
+  border-radius: 0.25rem;
+  max-width: 100%;
+  height: auto;
+}
+
+.figure {
+  display: inline-block;
+}
+
+.figure-img {
+  margin-bottom: 0.5rem;
+  line-height: 1;
+}
+
+.figure-caption {
+  font-size: 90%;
+  color: #6c757d;
+}
+
+code,
+kbd,
+pre,
+samp {
+  font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
+}
+
+code {
+  font-size: 87.5%;
+  color: #e83e8c;
+  word-break: break-word;
+}
+
+a > code {
+  color: inherit;
+}
+
+kbd {
+  padding: 0.2rem 0.4rem;
+  font-size: 87.5%;
+  color: #fff;
+  background-color: #212529;
+  border-radius: 0.2rem;
+}
+
+kbd kbd {
+  padding: 0;
+  font-size: 100%;
+  font-weight: 700;
+}
+
+pre {
+  display: block;
+  font-size: 87.5%;
+  color: #212529;
+}
+
+pre code {
+  font-size: inherit;
+  color: inherit;
+  word-break: normal;
+}
+
+.pre-scrollable {
+  max-height: 340px;
+  overflow-y: scroll;
+}
+
+.container {
+  width: 100%;
+  padding-right: 15px;
+  padding-left: 15px;
+  margin-right: auto;
+  margin-left: auto;
+}
+
+@media (min-width: 576px) {
+  .container {
+    max-width: 540px;
+  }
+}
+
+@media (min-width: 768px) {
+  .container {
+    max-width: 720px;
+  }
+}
+
+@media (min-width: 992px) {
+  .container {
+    max-width: 960px;
+  }
+}
+
+@media (min-width: 1200px) {
+  .container {
+    max-width: 1140px;
+  }
+}
+
+.container-fluid {
+  width: 100%;
+  padding-right: 15px;
+  padding-left: 15px;
+  margin-right: auto;
+  margin-left: auto;
+}
+
+.row {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -ms-flex-wrap: wrap;
+  flex-wrap: wrap;
+  margin-right: -15px;
+  margin-left: -15px;
+}
+
+.no-gutters {
+  margin-right: 0;
+  margin-left: 0;
+}
+
+.no-gutters > .col,
+.no-gutters > [class*="col-"] {
+  padding-right: 0;
+  padding-left: 0;
+}
+
+.col-1, .col-2, .col-3, .col-4, .col-5, .col-6, .col-7, .col-8, .col-9, .col-10, .col-11, .col-12, .col,
+.col-auto, .col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12, .col-sm,
+.col-sm-auto, .col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12, .col-md,
+.col-md-auto, .col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12, .col-lg,
+.col-lg-auto, .col-xl-1, .col-xl-2, .col-xl-3, .col-xl-4, .col-xl-5, .col-xl-6, .col-xl-7, .col-xl-8, .col-xl-9, .col-xl-10, .col-xl-11, .col-xl-12, .col-xl,
+.col-xl-auto {
+  position: relative;
+  width: 100%;
+  min-height: 1px;
+  padding-right: 15px;
+  padding-left: 15px;
+}
+
+.col {
+  -ms-flex-preferred-size: 0;
+  flex-basis: 0;
+  -webkit-box-flex: 1;
+  -ms-flex-positive: 1;
+  flex-grow: 1;
+  max-width: 100%;
+}
+
+.col-auto {
+  -webkit-box-flex: 0;
+  -ms-flex: 0 0 auto;
+  flex: 0 0 auto;
+  width: auto;
+  max-width: none;
+}
+
+.col-1 {
+  -webkit-box-flex: 0;
+  -ms-flex: 0 0 8.333333%;
+  flex: 0 0 8.333333%;
+  max-width: 8.333333%;
+}
+
+.col-2 {
+  -webkit-box-flex: 0;
+  -ms-flex: 0 0 16.666667%;
+  flex: 0 0 16.666667%;
+  max-width: 16.666667%;
+}
+
+.col-3 {
+  -webkit-box-flex: 0;
+  -ms-flex: 0 0 25%;
+  flex: 0 0 25%;
+  max-width: 25%;
+}
+
+.col-4 {
+  -webkit-box-flex: 0;
+  -ms-flex: 0 0 33.333333%;
+  flex: 0 0 33.333333%;
+  max-width: 33.333333%;
+}
+
+.col-5 {
+  -webkit-box-flex: 0;
+  -ms-flex: 0 0 41.666667%;
+  flex: 0 0 41.666667%;
+  max-width: 41.666667%;
+}
+
+.col-6 {
+  -webkit-box-flex: 0;
+  -ms-flex: 0 0 50%;
+  flex: 0 0 50%;
+  max-width: 50%;
+}
+
+.col-7 {
+  -webkit-box-flex: 0;
+  -ms-flex: 0 0 58.333333%;
+  flex: 0 0 58.333333%;
+  max-width: 58.333333%;
+}
+
+.col-8 {
+  -webkit-box-flex: 0;
+  -ms-flex: 0 0 66.666667%;
+  flex: 0 0 66.666667%;
+  max-width: 66.666667%;
+}
+
+.col-9 {
+  -webkit-box-flex: 0;
+  -ms-flex: 0 0 75%;
+  flex: 0 0 75%;
+  max-width: 75%;
+}
+
+.col-10 {
+  -webkit-box-flex: 0;
+  -ms-flex: 0 0 83.333333%;
+  flex: 0 0 83.333333%;
+  max-width: 83.333333%;
+}
+
+.col-11 {
+  -webkit-box-flex: 0;
+  -ms-flex: 0 0 91.666667%;
+  flex: 0 0 91.666667%;
+  max-width: 91.666667%;
+}
+
+.col-12 {
+  -webkit-box-flex: 0;
+  -ms-flex: 0 0 100%;
+  flex: 0 0 100%;
+  max-width: 100%;
+}
+
+.order-first {
+  -webkit-box-ordinal-group: 0;
+  -ms-flex-order: -1;
+  order: -1;
+}
+
+.order-last {
+  -webkit-box-ordinal-group: 14;
+  -ms-flex-order: 13;
+  order: 13;
+}
+
+.order-0 {
+  -webkit-box-ordinal-group: 1;
+  -ms-flex-order: 0;
+  order: 0;
+}
+
+.order-1 {
+  -webkit-box-ordinal-group: 2;
+  -ms-flex-order: 1;
+  order: 1;
+}
+
+.order-2 {
+  -webkit-box-ordinal-group: 3;
+  -ms-flex-order: 2;
+  order: 2;
+}
+
+.order-3 {
+  -webkit-box-ordinal-group: 4;
+  -ms-flex-order: 3;
+  order: 3;
+}
+
+.order-4 {
+  -webkit-box-ordinal-group: 5;
+  -ms-flex-order: 4;
+  order: 4;
+}
+
+.order-5 {
+  -webkit-box-ordinal-group: 6;
+  -ms-flex-order: 5;
+  order: 5;
+}
+
+.order-6 {
+  -webkit-box-ordinal-group: 7;
+  -ms-flex-order: 6;
+  order: 6;
+}
+
+.order-7 {
+  -webkit-box-ordinal-group: 8;
+  -ms-flex-order: 7;
+  order: 7;
+}
+
+.order-8 {
+  -webkit-box-ordinal-group: 9;
+  -ms-flex-order: 8;
+  order: 8;
+}
+
+.order-9 {
+  -webkit-box-ordinal-group: 10;
+  -ms-flex-order: 9;
+  order: 9;
+}
+
+.order-10 {
+  -webkit-box-ordinal-group: 11;
+  -ms-flex-order: 10;
+  order: 10;
+}
+
+.order-11 {
+  -webkit-box-ordinal-group: 12;
+  -ms-flex-order: 11;
+  order: 11;
+}
+
+.order-12 {
+  -webkit-box-ordinal-group: 13;
+  -ms-flex-order: 12;
+  order: 12;
+}
+
+.offset-1 {
+  margin-left: 8.333333%;
+}
+
+.offset-2 {
+  margin-left: 16.666667%;
+}
+
+.offset-3 {
+  margin-left: 25%;
+}
+
+.offset-4 {
+  margin-left: 33.333333%;
+}
+
+.offset-5 {
+  margin-left: 41.666667%;
+}
+
+.offset-6 {
+  margin-left: 50%;
+}
+
+.offset-7 {
+  margin-left: 58.333333%;
+}
+
+.offset-8 {
+  margin-left: 66.666667%;
+}
+
+.offset-9 {
+  margin-left: 75%;
+}
+
+.offset-10 {
+  margin-left: 83.333333%;
+}
+
+.offset-11 {
+  margin-left: 91.666667%;
+}
+
+@media (min-width: 576px) {
+  .col-sm {
+    -ms-flex-preferred-size: 0;
+    flex-basis: 0;
+    -webkit-box-flex: 1;
+    -ms-flex-positive: 1;
+    flex-grow: 1;
+    max-width: 100%;
+  }
+  .col-sm-auto {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 auto;
+    flex: 0 0 auto;
+    width: auto;
+    max-width: none;
+  }
+  .col-sm-1 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 8.333333%;
+    flex: 0 0 8.333333%;
+    max-width: 8.333333%;
+  }
+  .col-sm-2 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 16.666667%;
+    flex: 0 0 16.666667%;
+    max-width: 16.666667%;
+  }
+  .col-sm-3 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 25%;
+    flex: 0 0 25%;
+    max-width: 25%;
+  }
+  .col-sm-4 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 33.333333%;
+    flex: 0 0 33.333333%;
+    max-width: 33.333333%;
+  }
+  .col-sm-5 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 41.666667%;
+    flex: 0 0 41.666667%;
+    max-width: 41.666667%;
+  }
+  .col-sm-6 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 50%;
+    flex: 0 0 50%;
+    max-width: 50%;
+  }
+  .col-sm-7 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 58.333333%;
+    flex: 0 0 58.333333%;
+    max-width: 58.333333%;
+  }
+  .col-sm-8 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 66.666667%;
+    flex: 0 0 66.666667%;
+    max-width: 66.666667%;
+  }
+  .col-sm-9 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 75%;
+    flex: 0 0 75%;
+    max-width: 75%;
+  }
+  .col-sm-10 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 83.333333%;
+    flex: 0 0 83.333333%;
+    max-width: 83.333333%;
+  }
+  .col-sm-11 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 91.666667%;
+    flex: 0 0 91.666667%;
+    max-width: 91.666667%;
+  }
+  .col-sm-12 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 100%;
+    flex: 0 0 100%;
+    max-width: 100%;
+  }
+  .order-sm-first {
+    -webkit-box-ordinal-group: 0;
+    -ms-flex-order: -1;
+    order: -1;
+  }
+  .order-sm-last {
+    -webkit-box-ordinal-group: 14;
+    -ms-flex-order: 13;
+    order: 13;
+  }
+  .order-sm-0 {
+    -webkit-box-ordinal-group: 1;
+    -ms-flex-order: 0;
+    order: 0;
+  }
+  .order-sm-1 {
+    -webkit-box-ordinal-group: 2;
+    -ms-flex-order: 1;
+    order: 1;
+  }
+  .order-sm-2 {
+    -webkit-box-ordinal-group: 3;
+    -ms-flex-order: 2;
+    order: 2;
+  }
+  .order-sm-3 {
+    -webkit-box-ordinal-group: 4;
+    -ms-flex-order: 3;
+    order: 3;
+  }
+  .order-sm-4 {
+    -webkit-box-ordinal-group: 5;
+    -ms-flex-order: 4;
+    order: 4;
+  }
+  .order-sm-5 {
+    -webkit-box-ordinal-group: 6;
+    -ms-flex-order: 5;
+    order: 5;
+  }
+  .order-sm-6 {
+    -webkit-box-ordinal-group: 7;
+    -ms-flex-order: 6;
+    order: 6;
+  }
+  .order-sm-7 {
+    -webkit-box-ordinal-group: 8;
+    -ms-flex-order: 7;
+    order: 7;
+  }
+  .order-sm-8 {
+    -webkit-box-ordinal-group: 9;
+    -ms-flex-order: 8;
+    order: 8;
+  }
+  .order-sm-9 {
+    -webkit-box-ordinal-group: 10;
+    -ms-flex-order: 9;
+    order: 9;
+  }
+  .order-sm-10 {
+    -webkit-box-ordinal-group: 11;
+    -ms-flex-order: 10;
+    order: 10;
+  }
+  .order-sm-11 {
+    -webkit-box-ordinal-group: 12;
+    -ms-flex-order: 11;
+    order: 11;
+  }
+  .order-sm-12 {
+    -webkit-box-ordinal-group: 13;
+    -ms-flex-order: 12;
+    order: 12;
+  }
+  .offset-sm-0 {
+    margin-left: 0;
+  }
+  .offset-sm-1 {
+    margin-left: 8.333333%;
+  }
+  .offset-sm-2 {
+    margin-left: 16.666667%;
+  }
+  .offset-sm-3 {
+    margin-left: 25%;
+  }
+  .offset-sm-4 {
+    margin-left: 33.333333%;
+  }
+  .offset-sm-5 {
+    margin-left: 41.666667%;
+  }
+  .offset-sm-6 {
+    margin-left: 50%;
+  }
+  .offset-sm-7 {
+    margin-left: 58.333333%;
+  }
+  .offset-sm-8 {
+    margin-left: 66.666667%;
+  }
+  .offset-sm-9 {
+    margin-left: 75%;
+  }
+  .offset-sm-10 {
+    margin-left: 83.333333%;
+  }
+  .offset-sm-11 {
+    margin-left: 91.666667%;
+  }
+}
+
+@media (min-width: 768px) {
+  .col-md {
+    -ms-flex-preferred-size: 0;
+    flex-basis: 0;
+    -webkit-box-flex: 1;
+    -ms-flex-positive: 1;
+    flex-grow: 1;
+    max-width: 100%;
+  }
+  .col-md-auto {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 auto;
+    flex: 0 0 auto;
+    width: auto;
+    max-width: none;
+  }
+  .col-md-1 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 8.333333%;
+    flex: 0 0 8.333333%;
+    max-width: 8.333333%;
+  }
+  .col-md-2 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 16.666667%;
+    flex: 0 0 16.666667%;
+    max-width: 16.666667%;
+  }
+  .col-md-3 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 25%;
+    flex: 0 0 25%;
+    max-width: 25%;
+  }
+  .col-md-4 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 33.333333%;
+    flex: 0 0 33.333333%;
+    max-width: 33.333333%;
+  }
+  .col-md-5 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 41.666667%;
+    flex: 0 0 41.666667%;
+    max-width: 41.666667%;
+  }
+  .col-md-6 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 50%;
+    flex: 0 0 50%;
+    max-width: 50%;
+  }
+  .col-md-7 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 58.333333%;
+    flex: 0 0 58.333333%;
+    max-width: 58.333333%;
+  }
+  .col-md-8 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 66.666667%;
+    flex: 0 0 66.666667%;
+    max-width: 66.666667%;
+  }
+  .col-md-9 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 75%;
+    flex: 0 0 75%;
+    max-width: 75%;
+  }
+  .col-md-10 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 83.333333%;
+    flex: 0 0 83.333333%;
+    max-width: 83.333333%;
+  }
+  .col-md-11 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 91.666667%;
+    flex: 0 0 91.666667%;
+    max-width: 91.666667%;
+  }
+  .col-md-12 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 100%;
+    flex: 0 0 100%;
+    max-width: 100%;
+  }
+  .order-md-first {
+    -webkit-box-ordinal-group: 0;
+    -ms-flex-order: -1;
+    order: -1;
+  }
+  .order-md-last {
+    -webkit-box-ordinal-group: 14;
+    -ms-flex-order: 13;
+    order: 13;
+  }
+  .order-md-0 {
+    -webkit-box-ordinal-group: 1;
+    -ms-flex-order: 0;
+    order: 0;
+  }
+  .order-md-1 {
+    -webkit-box-ordinal-group: 2;
+    -ms-flex-order: 1;
+    order: 1;
+  }
+  .order-md-2 {
+    -webkit-box-ordinal-group: 3;
+    -ms-flex-order: 2;
+    order: 2;
+  }
+  .order-md-3 {
+    -webkit-box-ordinal-group: 4;
+    -ms-flex-order: 3;
+    order: 3;
+  }
+  .order-md-4 {
+    -webkit-box-ordinal-group: 5;
+    -ms-flex-order: 4;
+    order: 4;
+  }
+  .order-md-5 {
+    -webkit-box-ordinal-group: 6;
+    -ms-flex-order: 5;
+    order: 5;
+  }
+  .order-md-6 {
+    -webkit-box-ordinal-group: 7;
+    -ms-flex-order: 6;
+    order: 6;
+  }
+  .order-md-7 {
+    -webkit-box-ordinal-group: 8;
+    -ms-flex-order: 7;
+    order: 7;
+  }
+  .order-md-8 {
+    -webkit-box-ordinal-group: 9;
+    -ms-flex-order: 8;
+    order: 8;
+  }
+  .order-md-9 {
+    -webkit-box-ordinal-group: 10;
+    -ms-flex-order: 9;
+    order: 9;
+  }
+  .order-md-10 {
+    -webkit-box-ordinal-group: 11;
+    -ms-flex-order: 10;
+    order: 10;
+  }
+  .order-md-11 {
+    -webkit-box-ordinal-group: 12;
+    -ms-flex-order: 11;
+    order: 11;
+  }
+  .order-md-12 {
+    -webkit-box-ordinal-group: 13;
+    -ms-flex-order: 12;
+    order: 12;
+  }
+  .offset-md-0 {
+    margin-left: 0;
+  }
+  .offset-md-1 {
+    margin-left: 8.333333%;
+  }
+  .offset-md-2 {
+    margin-left: 16.666667%;
+  }
+  .offset-md-3 {
+    margin-left: 25%;
+  }
+  .offset-md-4 {
+    margin-left: 33.333333%;
+  }
+  .offset-md-5 {
+    margin-left: 41.666667%;
+  }
+  .offset-md-6 {
+    margin-left: 50%;
+  }
+  .offset-md-7 {
+    margin-left: 58.333333%;
+  }
+  .offset-md-8 {
+    margin-left: 66.666667%;
+  }
+  .offset-md-9 {
+    margin-left: 75%;
+  }
+  .offset-md-10 {
+    margin-left: 83.333333%;
+  }
+  .offset-md-11 {
+    margin-left: 91.666667%;
+  }
+}
+
+@media (min-width: 992px) {
+  .col-lg {
+    -ms-flex-preferred-size: 0;
+    flex-basis: 0;
+    -webkit-box-flex: 1;
+    -ms-flex-positive: 1;
+    flex-grow: 1;
+    max-width: 100%;
+  }
+  .col-lg-auto {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 auto;
+    flex: 0 0 auto;
+    width: auto;
+    max-width: none;
+  }
+  .col-lg-1 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 8.333333%;
+    flex: 0 0 8.333333%;
+    max-width: 8.333333%;
+  }
+  .col-lg-2 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 16.666667%;
+    flex: 0 0 16.666667%;
+    max-width: 16.666667%;
+  }
+  .col-lg-3 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 25%;
+    flex: 0 0 25%;
+    max-width: 25%;
+  }
+  .col-lg-4 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 33.333333%;
+    flex: 0 0 33.333333%;
+    max-width: 33.333333%;
+  }
+  .col-lg-5 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 41.666667%;
+    flex: 0 0 41.666667%;
+    max-width: 41.666667%;
+  }
+  .col-lg-6 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 50%;
+    flex: 0 0 50%;
+    max-width: 50%;
+  }
+  .col-lg-7 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 58.333333%;
+    flex: 0 0 58.333333%;
+    max-width: 58.333333%;
+  }
+  .col-lg-8 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 66.666667%;
+    flex: 0 0 66.666667%;
+    max-width: 66.666667%;
+  }
+  .col-lg-9 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 75%;
+    flex: 0 0 75%;
+    max-width: 75%;
+  }
+  .col-lg-10 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 83.333333%;
+    flex: 0 0 83.333333%;
+    max-width: 83.333333%;
+  }
+  .col-lg-11 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 91.666667%;
+    flex: 0 0 91.666667%;
+    max-width: 91.666667%;
+  }
+  .col-lg-12 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 100%;
+    flex: 0 0 100%;
+    max-width: 100%;
+  }
+  .order-lg-first {
+    -webkit-box-ordinal-group: 0;
+    -ms-flex-order: -1;
+    order: -1;
+  }
+  .order-lg-last {
+    -webkit-box-ordinal-group: 14;
+    -ms-flex-order: 13;
+    order: 13;
+  }
+  .order-lg-0 {
+    -webkit-box-ordinal-group: 1;
+    -ms-flex-order: 0;
+    order: 0;
+  }
+  .order-lg-1 {
+    -webkit-box-ordinal-group: 2;
+    -ms-flex-order: 1;
+    order: 1;
+  }
+  .order-lg-2 {
+    -webkit-box-ordinal-group: 3;
+    -ms-flex-order: 2;
+    order: 2;
+  }
+  .order-lg-3 {
+    -webkit-box-ordinal-group: 4;
+    -ms-flex-order: 3;
+    order: 3;
+  }
+  .order-lg-4 {
+    -webkit-box-ordinal-group: 5;
+    -ms-flex-order: 4;
+    order: 4;
+  }
+  .order-lg-5 {
+    -webkit-box-ordinal-group: 6;
+    -ms-flex-order: 5;
+    order: 5;
+  }
+  .order-lg-6 {
+    -webkit-box-ordinal-group: 7;
+    -ms-flex-order: 6;
+    order: 6;
+  }
+  .order-lg-7 {
+    -webkit-box-ordinal-group: 8;
+    -ms-flex-order: 7;
+    order: 7;
+  }
+  .order-lg-8 {
+    -webkit-box-ordinal-group: 9;
+    -ms-flex-order: 8;
+    order: 8;
+  }
+  .order-lg-9 {
+    -webkit-box-ordinal-group: 10;
+    -ms-flex-order: 9;
+    order: 9;
+  }
+  .order-lg-10 {
+    -webkit-box-ordinal-group: 11;
+    -ms-flex-order: 10;
+    order: 10;
+  }
+  .order-lg-11 {
+    -webkit-box-ordinal-group: 12;
+    -ms-flex-order: 11;
+    order: 11;
+  }
+  .order-lg-12 {
+    -webkit-box-ordinal-group: 13;
+    -ms-flex-order: 12;
+    order: 12;
+  }
+  .offset-lg-0 {
+    margin-left: 0;
+  }
+  .offset-lg-1 {
+    margin-left: 8.333333%;
+  }
+  .offset-lg-2 {
+    margin-left: 16.666667%;
+  }
+  .offset-lg-3 {
+    margin-left: 25%;
+  }
+  .offset-lg-4 {
+    margin-left: 33.333333%;
+  }
+  .offset-lg-5 {
+    margin-left: 41.666667%;
+  }
+  .offset-lg-6 {
+    margin-left: 50%;
+  }
+  .offset-lg-7 {
+    margin-left: 58.333333%;
+  }
+  .offset-lg-8 {
+    margin-left: 66.666667%;
+  }
+  .offset-lg-9 {
+    margin-left: 75%;
+  }
+  .offset-lg-10 {
+    margin-left: 83.333333%;
+  }
+  .offset-lg-11 {
+    margin-left: 91.666667%;
+  }
+}
+
+@media (min-width: 1200px) {
+  .col-xl {
+    -ms-flex-preferred-size: 0;
+    flex-basis: 0;
+    -webkit-box-flex: 1;
+    -ms-flex-positive: 1;
+    flex-grow: 1;
+    max-width: 100%;
+  }
+  .col-xl-auto {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 auto;
+    flex: 0 0 auto;
+    width: auto;
+    max-width: none;
+  }
+  .col-xl-1 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 8.333333%;
+    flex: 0 0 8.333333%;
+    max-width: 8.333333%;
+  }
+  .col-xl-2 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 16.666667%;
+    flex: 0 0 16.666667%;
+    max-width: 16.666667%;
+  }
+  .col-xl-3 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 25%;
+    flex: 0 0 25%;
+    max-width: 25%;
+  }
+  .col-xl-4 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 33.333333%;
+    flex: 0 0 33.333333%;
+    max-width: 33.333333%;
+  }
+  .col-xl-5 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 41.666667%;
+    flex: 0 0 41.666667%;
+    max-width: 41.666667%;
+  }
+  .col-xl-6 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 50%;
+    flex: 0 0 50%;
+    max-width: 50%;
+  }
+  .col-xl-7 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 58.333333%;
+    flex: 0 0 58.333333%;
+    max-width: 58.333333%;
+  }
+  .col-xl-8 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 66.666667%;
+    flex: 0 0 66.666667%;
+    max-width: 66.666667%;
+  }
+  .col-xl-9 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 75%;
+    flex: 0 0 75%;
+    max-width: 75%;
+  }
+  .col-xl-10 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 83.333333%;
+    flex: 0 0 83.333333%;
+    max-width: 83.333333%;
+  }
+  .col-xl-11 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 91.666667%;
+    flex: 0 0 91.666667%;
+    max-width: 91.666667%;
+  }
+  .col-xl-12 {
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 100%;
+    flex: 0 0 100%;
+    max-width: 100%;
+  }
+  .order-xl-first {
+    -webkit-box-ordinal-group: 0;
+    -ms-flex-order: -1;
+    order: -1;
+  }
+  .order-xl-last {
+    -webkit-box-ordinal-group: 14;
+    -ms-flex-order: 13;
+    order: 13;
+  }
+  .order-xl-0 {
+    -webkit-box-ordinal-group: 1;
+    -ms-flex-order: 0;
+    order: 0;
+  }
+  .order-xl-1 {
+    -webkit-box-ordinal-group: 2;
+    -ms-flex-order: 1;
+    order: 1;
+  }
+  .order-xl-2 {
+    -webkit-box-ordinal-group: 3;
+    -ms-flex-order: 2;
+    order: 2;
+  }
+  .order-xl-3 {
+    -webkit-box-ordinal-group: 4;
+    -ms-flex-order: 3;
+    order: 3;
+  }
+  .order-xl-4 {
+    -webkit-box-ordinal-group: 5;
+    -ms-flex-order: 4;
+    order: 4;
+  }
+  .order-xl-5 {
+    -webkit-box-ordinal-group: 6;
+    -ms-flex-order: 5;
+    order: 5;
+  }
+  .order-xl-6 {
+    -webkit-box-ordinal-group: 7;
+    -ms-flex-order: 6;
+    order: 6;
+  }
+  .order-xl-7 {
+    -webkit-box-ordinal-group: 8;
+    -ms-flex-order: 7;
+    order: 7;
+  }
+  .order-xl-8 {
+    -webkit-box-ordinal-group: 9;
+    -ms-flex-order: 8;
+    order: 8;
+  }
+  .order-xl-9 {
+    -webkit-box-ordinal-group: 10;
+    -ms-flex-order: 9;
+    order: 9;
+  }
+  .order-xl-10 {
+    -webkit-box-ordinal-group: 11;
+    -ms-flex-order: 10;
+    order: 10;
+  }
+  .order-xl-11 {
+    -webkit-box-ordinal-group: 12;
+    -ms-flex-order: 11;
+    order: 11;
+  }
+  .order-xl-12 {
+    -webkit-box-ordinal-group: 13;
+    -ms-flex-order: 12;
+    order: 12;
+  }
+  .offset-xl-0 {
+    margin-left: 0;
+  }
+  .offset-xl-1 {
+    margin-left: 8.333333%;
+  }
+  .offset-xl-2 {
+    margin-left: 16.666667%;
+  }
+  .offset-xl-3 {
+    margin-left: 25%;
+  }
+  .offset-xl-4 {
+    margin-left: 33.333333%;
+  }
+  .offset-xl-5 {
+    margin-left: 41.666667%;
+  }
+  .offset-xl-6 {
+    margin-left: 50%;
+  }
+  .offset-xl-7 {
+    margin-left: 58.333333%;
+  }
+  .offset-xl-8 {
+    margin-left: 66.666667%;
+  }
+  .offset-xl-9 {
+    margin-left: 75%;
+  }
+  .offset-xl-10 {
+    margin-left: 83.333333%;
+  }
+  .offset-xl-11 {
+    margin-left: 91.666667%;
+  }
+}
+
+.table {
+  width: 100%;
+  max-width: 100%;
+  margin-bottom: 1rem;
+  background-color: transparent;
+}
+
+.table th,
+.table td {
+  padding: 0.75rem;
+  vertical-align: top;
+  border-top: 1px solid #dee2e6;
+}
+
+.table thead th {
+  vertical-align: bottom;
+  border-bottom: 2px solid #dee2e6;
+}
+
+.table tbody + tbody {
+  border-top: 2px solid #dee2e6;
+}
+
+.table .table {
+  background-color: #fff;
+}
+
+.table-sm th,
+.table-sm td {
+  padding: 0.3rem;
+}
+
+.table-bordered {
+  border: 1px solid #dee2e6;
+}
+
+.table-bordered th,
+.table-bordered td {
+  border: 1px solid #dee2e6;
+}
+
+.table-bordered thead th,
+.table-bordered thead td {
+  border-bottom-width: 2px;
+}
+
+.table-striped tbody tr:nth-of-type(odd) {
+  background-color: rgba(0, 0, 0, 0.05);
+}
+
+.table-hover tbody tr:hover {
+  background-color: rgba(0, 0, 0, 0.075);
+}
+
+.table-primary,
+.table-primary > th,
+.table-primary > td {
+  background-color: #b8daff;
+}
+
+.table-hover .table-primary:hover {
+  background-color: #9fcdff;
+}
+
+.table-hover .table-primary:hover > td,
+.table-hover .table-primary:hover > th {
+  background-color: #9fcdff;
+}
+
+.table-secondary,
+.table-secondary > th,
+.table-secondary > td {
+  background-color: #d6d8db;
+}
+
+.table-hover .table-secondary:hover {
+  background-color: #c8cbcf;
+}
+
+.table-hover .table-secondary:hover > td,
+.table-hover .table-secondary:hover > th {
+  background-color: #c8cbcf;
+}
+
+.table-success,
+.table-success > th,
+.table-success > td {
+  background-color: #c3e6cb;
+}
+
+.table-hover .table-success:hover {
+  background-color: #b1dfbb;
+}
+
+.table-hover .table-success:hover > td,
+.table-hover .table-success:hover > th {
+  background-color: #b1dfbb;
+}
+
+.table-info,
+.table-info > th,
+.table-info > td {
+  background-color: #bee5eb;
+}
+
+.table-hover .table-info:hover {
+  background-color: #abdde5;
+}
+
+.table-hover .table-info:hover > td,
+.table-hover .table-info:hover > th {
+  background-color: #abdde5;
+}
+
+.table-warning,
+.table-warning > th,
+.table-warning > td {
+  background-color: #ffeeba;
+}
+
+.table-hover .table-warning:hover {
+  background-color: #ffe8a1;
+}
+
+.table-hover .table-warning:hover > td,
+.table-hover .table-warning:hover > th {
+  background-color: #ffe8a1;
+}
+
+.table-danger,
+.table-danger > th,
+.table-danger > td {
+  background-color: #f5c6cb;
+}
+
+.table-hover .table-danger:hover {
+  background-color: #f1b0b7;
+}
+
+.table-hover .table-danger:hover > td,
+.table-hover .table-danger:hover > th {
+  background-color: #f1b0b7;
+}
+
+.table-light,
+.table-light > th,
+.table-light > td {
+  background-color: #fdfdfe;
+}
+
+.table-hover .table-light:hover {
+  background-color: #ececf6;
+}
+
+.table-hover .table-light:hover > td,
+.table-hover .table-light:hover > th {
+  background-color: #ececf6;
+}
+
+.table-dark,
+.table-dark > th,
+.table-dark > td {
+  background-color: #c6c8ca;
+}
+
+.table-hover .table-dark:hover {
+  background-color: #b9bbbe;
+}
+
+.table-hover .table-dark:hover > td,
+.table-hover .table-dark:hover > th {
+  background-color: #b9bbbe;
+}
+
+.table-active,
+.table-active > th,
+.table-active > td {
+  background-color: rgba(0, 0, 0, 0.075);
+}
+
+.table-hover .table-active:hover {
+  background-color: rgba(0, 0, 0, 0.075);
+}
+
+.table-hover .table-active:hover > td,
+.table-hover .table-active:hover > th {
+  background-color: rgba(0, 0, 0, 0.075);
+}
+
+.table .thead-dark th {
+  color: #fff;
+  background-color: #212529;
+  border-color: #32383e;
+}
+
+.table .thead-light th {
+  color: #495057;
+  background-color: #e9ecef;
+  border-color: #dee2e6;
+}
+
+.table-dark {
+  color: #fff;
+  background-color: #212529;
+}
+
+.table-dark th,
+.table-dark td,
+.table-dark thead th {
+  border-color: #32383e;
+}
+
+.table-dark.table-bordered {
+  border: 0;
+}
+
+.table-dark.table-striped tbody tr:nth-of-type(odd) {
+  background-color: rgba(255, 255, 255, 0.05);
+}
+
+.table-dark.table-hover tbody tr:hover {
+  background-color: rgba(255, 255, 255, 0.075);
+}
+
+@media (max-width: 575.98px) {
+  .table-responsive-sm {
+    display: block;
+    width: 100%;
+    overflow-x: auto;
+    -webkit-overflow-scrolling: touch;
+    -ms-overflow-style: -ms-autohiding-scrollbar;
+  }
+  .table-responsive-sm > .table-bordered {
+    border: 0;
+  }
+}
+
+@media (max-width: 767.98px) {
+  .table-responsive-md {
+    display: block;
+    width: 100%;
+    overflow-x: auto;
+    -webkit-overflow-scrolling: touch;
+    -ms-overflow-style: -ms-autohiding-scrollbar;
+  }
+  .table-responsive-md > .table-bordered {
+    border: 0;
+  }
+}
+
+@media (max-width: 991.98px) {
+  .table-responsive-lg {
+    display: block;
+    width: 100%;
+    overflow-x: auto;
+    -webkit-overflow-scrolling: touch;
+    -ms-overflow-style: -ms-autohiding-scrollbar;
+  }
+  .table-responsive-lg > .table-bordered {
+    border: 0;
+  }
+}
+
+@media (max-width: 1199.98px) {
+  .table-responsive-xl {
+    display: block;
+    width: 100%;
+    overflow-x: auto;
+    -webkit-overflow-scrolling: touch;
+    -ms-overflow-style: -ms-autohiding-scrollbar;
+  }
+  .table-responsive-xl > .table-bordered {
+    border: 0;
+  }
+}
+
+.table-responsive {
+  display: block;
+  width: 100%;
+  overflow-x: auto;
+  -webkit-overflow-scrolling: touch;
+  -ms-overflow-style: -ms-autohiding-scrollbar;
+}
+
+.table-responsive > .table-bordered {
+  border: 0;
+}
+
+.form-control {
+  display: block;
+  width: 100%;
+  padding: 0.375rem 0.75rem;
+  font-size: 1rem;
+  line-height: 1.5;
+  color: #495057;
+  background-color: #fff;
+  background-clip: padding-box;
+  border: 1px solid #ced4da;
+  border-radius: 0.25rem;
+  transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
+}
+
+.form-control::-ms-expand {
+  background-color: transparent;
+  border: 0;
+}
+
+.form-control:focus {
+  color: #495057;
+  background-color: #fff;
+  border-color: #80bdff;
+  outline: 0;
+  box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
+}
+
+.form-control::-webkit-input-placeholder {
+  color: #6c757d;
+  opacity: 1;
+}
+
+.form-control::-moz-placeholder {
+  color: #6c757d;
+  opacity: 1;
+}
+
+.form-control:-ms-input-placeholder {
+  color: #6c757d;
+  opacity: 1;
+}
+
+.form-control::-ms-input-placeholder {
+  color: #6c757d;
+  opacity: 1;
+}
+
+.form-control::placeholder {
+  color: #6c757d;
+  opacity: 1;
+}
+
+.form-control:disabled, .form-control[readonly] {
+  background-color: #e9ecef;
+  opacity: 1;
+}
+
+select.form-control:not([size]):not([multiple]) {
+  height: calc(2.25rem + 2px);
+}
+
+select.form-control:focus::-ms-value {
+  color: #495057;
+  background-color: #fff;
+}
+
+.form-control-file,
+.form-control-range {
+  display: block;
+  width: 100%;
+}
+
+.col-form-label {
+  padding-top: calc(0.375rem + 1px);
+  padding-bottom: calc(0.375rem + 1px);
+  margin-bottom: 0;
+  font-size: inherit;
+  line-height: 1.5;
+}
+
+.col-form-label-lg {
+  padding-top: calc(0.5rem + 1px);
+  padding-bottom: calc(0.5rem + 1px);
+  font-size: 1.25rem;
+  line-height: 1.5;
+}
+
+.col-form-label-sm {
+  padding-top: calc(0.25rem + 1px);
+  padding-bottom: calc(0.25rem + 1px);
+  font-size: 0.875rem;
+  line-height: 1.5;
+}
+
+.form-control-plaintext {
+  display: block;
+  width: 100%;
+  padding-top: 0.375rem;
+  padding-bottom: 0.375rem;
+  margin-bottom: 0;
+  line-height: 1.5;
+  background-color: transparent;
+  border: solid transparent;
+  border-width: 1px 0;
+}
+
+.form-control-plaintext.form-control-sm, .input-group-sm > .form-control-plaintext.form-control,
+.input-group-sm > .input-group-prepend > .form-control-plaintext.input-group-text,
+.input-group-sm > .input-group-append > .form-control-plaintext.input-group-text,
+.input-group-sm > .input-group-prepend > .form-control-plaintext.btn,
+.input-group-sm > .input-group-append > .form-control-plaintext.btn, .form-control-plaintext.form-control-lg, .input-group-lg > .form-control-plaintext.form-control,
+.input-group-lg > .input-group-prepend > .form-control-plaintext.input-group-text,
+.input-group-lg > .input-group-append > .form-control-plaintext.input-group-text,
+.input-group-lg > .input-group-prepend > .form-control-plaintext.btn,
+.input-group-lg > .input-group-append > .form-control-plaintext.btn {
+  padding-right: 0;
+  padding-left: 0;
+}
+
+.form-control-sm, .input-group-sm > .form-control,
+.input-group-sm > .input-group-prepend > .input-group-text,
+.input-group-sm > .input-group-append > .input-group-text,
+.input-group-sm > .input-group-prepend > .btn,
+.input-group-sm > .input-group-append > .btn {
+  padding: 0.25rem 0.5rem;
+  font-size: 0.875rem;
+  line-height: 1.5;
+  border-radius: 0.2rem;
+}
+
+select.form-control-sm:not([size]):not([multiple]), .input-group-sm > select.form-control:not([size]):not([multiple]),
+.input-group-sm > .input-group-prepend > select.input-group-text:not([size]):not([multiple]),
+.input-group-sm > .input-group-append > select.input-group-text:not([size]):not([multiple]),
+.input-group-sm > .input-group-prepend > select.btn:not([size]):not([multiple]),
+.input-group-sm > .input-group-append > select.btn:not([size]):not([multiple]) {
+  height: calc(1.8125rem + 2px);
+}
+
+.form-control-lg, .input-group-lg > .form-control,
+.input-group-lg > .input-group-prepend > .input-group-text,
+.input-group-lg > .input-group-append > .input-group-text,
+.input-group-lg > .input-group-prepend > .btn,
+.input-group-lg > .input-group-append > .btn {
+  padding: 0.5rem 1rem;
+  font-size: 1.25rem;
+  line-height: 1.5;
+  border-radius: 0.3rem;
+}
+
+select.form-control-lg:not([size]):not([multiple]), .input-group-lg > select.form-control:not([size]):not([multiple]),
+.input-group-lg > .input-group-prepend > select.input-group-text:not([size]):not([multiple]),
+.input-group-lg > .input-group-append > select.input-group-text:not([size]):not([multiple]),
+.input-group-lg > .input-group-prepend > select.btn:not([size]):not([multiple]),
+.input-group-lg > .input-group-append > select.btn:not([size]):not([multiple]) {
+  height: calc(2.875rem + 2px);
+}
+
+.form-group {
+  margin-bottom: 1rem;
+}
+
+.form-text {
+  display: block;
+  margin-top: 0.25rem;
+}
+
+.form-row {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -ms-flex-wrap: wrap;
+  flex-wrap: wrap;
+  margin-right: -5px;
+  margin-left: -5px;
+}
+
+.form-row > .col,
+.form-row > [class*="col-"] {
+  padding-right: 5px;
+  padding-left: 5px;
+}
+
+.form-check {
+  position: relative;
+  display: block;
+  padding-left: 1.25rem;
+}
+
+.form-check-input {
+  position: absolute;
+  margin-top: 0.3rem;
+  margin-left: -1.25rem;
+}
+
+.form-check-input:disabled ~ .form-check-label {
+  color: #6c757d;
+}
+
+.form-check-label {
+  margin-bottom: 0;
+}
+
+.form-check-inline {
+  display: -webkit-inline-box;
+  display: -ms-inline-flexbox;
+  display: inline-flex;
+  -webkit-box-align: center;
+  -ms-flex-align: center;
+  align-items: center;
+  padding-left: 0;
+  margin-right: 0.75rem;
+}
+
+.form-check-inline .form-check-input {
+  position: static;
+  margin-top: 0;
+  margin-right: 0.3125rem;
+  margin-left: 0;
+}
+
+.valid-feedback {
+  display: none;
+  width: 100%;
+  margin-top: 0.25rem;
+  font-size: 80%;
+  color: #28a745;
+}
+
+.valid-tooltip {
+  position: absolute;
+  top: 100%;
+  z-index: 5;
+  display: none;
+  max-width: 100%;
+  padding: .5rem;
+  margin-top: .1rem;
+  font-size: .875rem;
+  line-height: 1;
+  color: #fff;
+  background-color: rgba(40, 167, 69, 0.8);
+  border-radius: .2rem;
+}
+
+.was-validated .form-control:valid, .form-control.is-valid, .was-validated
+.custom-select:valid,
+.custom-select.is-valid {
+  border-color: #28a745;
+}
+
+.was-validated .form-control:valid:focus, .form-control.is-valid:focus, .was-validated
+.custom-select:valid:focus,
+.custom-select.is-valid:focus {
+  border-color: #28a745;
+  box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25);
+}
+
+.was-validated .form-control:valid ~ .valid-feedback,
+.was-validated .form-control:valid ~ .valid-tooltip, .form-control.is-valid ~ .valid-feedback,
+.form-control.is-valid ~ .valid-tooltip, .was-validated
+.custom-select:valid ~ .valid-feedback,
+.was-validated
+.custom-select:valid ~ .valid-tooltip,
+.custom-select.is-valid ~ .valid-feedback,
+.custom-select.is-valid ~ .valid-tooltip {
+  display: block;
+}
+
+.was-validated .form-check-input:valid ~ .form-check-label, .form-check-input.is-valid ~ .form-check-label {
+  color: #28a745;
+}
+
+.was-validated .form-check-input:valid ~ .valid-feedback,
+.was-validated .form-check-input:valid ~ .valid-tooltip, .form-check-input.is-valid ~ .valid-feedback,
+.form-check-input.is-valid ~ .valid-tooltip {
+  display: block;
+}
+
+.was-validated .custom-control-input:valid ~ .custom-control-label, .custom-control-input.is-valid ~ .custom-control-label {
+  color: #28a745;
+}
+
+.was-validated .custom-control-input:valid ~ .custom-control-label::before, .custom-control-input.is-valid ~ .custom-control-label::before {
+  background-color: #71dd8a;
+}
+
+.was-validated .custom-control-input:valid ~ .valid-feedback,
+.was-validated .custom-control-input:valid ~ .valid-tooltip, .custom-control-input.is-valid ~ .valid-feedback,
+.custom-control-input.is-valid ~ .valid-tooltip {
+  display: block;
+}
+
+.was-validated .custom-control-input:valid:checked ~ .custom-control-label::before, .custom-control-input.is-valid:checked ~ .custom-control-label::before {
+  background-color: #34ce57;
+}
+
+.was-validated .custom-control-input:valid:focus ~ .custom-control-label::before, .custom-control-input.is-valid:focus ~ .custom-control-label::before {
+  box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(40, 167, 69, 0.25);
+}
+
+.was-validated .custom-file-input:valid ~ .custom-file-label, .custom-file-input.is-valid ~ .custom-file-label {
+  border-color: #28a745;
+}
+
+.was-validated .custom-file-input:valid ~ .custom-file-label::before, .custom-file-input.is-valid ~ .custom-file-label::before {
+  border-color: inherit;
+}
+
+.was-validated .custom-file-input:valid ~ .valid-feedback,
+.was-validated .custom-file-input:valid ~ .valid-tooltip, .custom-file-input.is-valid ~ .valid-feedback,
+.custom-file-input.is-valid ~ .valid-tooltip {
+  display: block;
+}
+
+.was-validated .custom-file-input:valid:focus ~ .custom-file-label, .custom-file-input.is-valid:focus ~ .custom-file-label {
+  box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25);
+}
+
+.invalid-feedback {
+  display: none;
+  width: 100%;
+  margin-top: 0.25rem;
+  font-size: 80%;
+  color: #dc3545;
+}
+
+.invalid-tooltip {
+  position: absolute;
+  top: 100%;
+  z-index: 5;
+  display: none;
+  max-width: 100%;
+  padding: .5rem;
+  margin-top: .1rem;
+  font-size: .875rem;
+  line-height: 1;
+  color: #fff;
+  background-color: rgba(220, 53, 69, 0.8);
+  border-radius: .2rem;
+}
+
+.was-validated .form-control:invalid, .form-control.is-invalid, .was-validated
+.custom-select:invalid,
+.custom-select.is-invalid {
+  border-color: #dc3545;
+}
+
+.was-validated .form-control:invalid:focus, .form-control.is-invalid:focus, .was-validated
+.custom-select:invalid:focus,
+.custom-select.is-invalid:focus {
+  border-color: #dc3545;
+  box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25);
+}
+
+.was-validated .form-control:invalid ~ .invalid-feedback,
+.was-validated .form-control:invalid ~ .invalid-tooltip, .form-control.is-invalid ~ .invalid-feedback,
+.form-control.is-invalid ~ .invalid-tooltip, .was-validated
+.custom-select:invalid ~ .invalid-feedback,
+.was-validated
+.custom-select:invalid ~ .invalid-tooltip,
+.custom-select.is-invalid ~ .invalid-feedback,
+.custom-select.is-invalid ~ .invalid-tooltip {
+  display: block;
+}
+
+.was-validated .form-check-input:invalid ~ .form-check-label, .form-check-input.is-invalid ~ .form-check-label {
+  color: #dc3545;
+}
+
+.was-validated .form-check-input:invalid ~ .invalid-feedback,
+.was-validated .form-check-input:invalid ~ .invalid-tooltip, .form-check-input.is-invalid ~ .invalid-feedback,
+.form-check-input.is-invalid ~ .invalid-tooltip {
+  display: block;
+}
+
+.was-validated .custom-control-input:invalid ~ .custom-control-label, .custom-control-input.is-invalid ~ .custom-control-label {
+  color: #dc3545;
+}
+
+.was-validated .custom-control-input:invalid ~ .custom-control-label::before, .custom-control-input.is-invalid ~ .custom-control-label::before {
+  background-color: #efa2a9;
+}
+
+.was-validated .custom-control-input:invalid ~ .invalid-feedback,
+.was-validated .custom-control-input:invalid ~ .invalid-tooltip, .custom-control-input.is-invalid ~ .invalid-feedback,
+.custom-control-input.is-invalid ~ .invalid-tooltip {
+  display: block;
+}
+
+.was-validated .custom-control-input:invalid:checked ~ .custom-control-label::before, .custom-control-input.is-invalid:checked ~ .custom-control-label::before {
+  background-color: #e4606d;
+}
+
+.was-validated .custom-control-input:invalid:focus ~ .custom-control-label::before, .custom-control-input.is-invalid:focus ~ .custom-control-label::before {
+  box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(220, 53, 69, 0.25);
+}
+
+.was-validated .custom-file-input:invalid ~ .custom-file-label, .custom-file-input.is-invalid ~ .custom-file-label {
+  border-color: #dc3545;
+}
+
+.was-validated .custom-file-input:invalid ~ .custom-file-label::before, .custom-file-input.is-invalid ~ .custom-file-label::before {
+  border-color: inherit;
+}
+
+.was-validated .custom-file-input:invalid ~ .invalid-feedback,
+.was-validated .custom-file-input:invalid ~ .invalid-tooltip, .custom-file-input.is-invalid ~ .invalid-feedback,
+.custom-file-input.is-invalid ~ .invalid-tooltip {
+  display: block;
+}
+
+.was-validated .custom-file-input:invalid:focus ~ .custom-file-label, .custom-file-input.is-invalid:focus ~ .custom-file-label {
+  box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25);
+}
+
+.form-inline {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-orient: horizontal;
+  -webkit-box-direction: normal;
+  -ms-flex-flow: row wrap;
+  flex-flow: row wrap;
+  -webkit-box-align: center;
+  -ms-flex-align: center;
+  align-items: center;
+}
+
+.form-inline .form-check {
+  width: 100%;
+}
+
+@media (min-width: 576px) {
+  .form-inline label {
+    display: -webkit-box;
+    display: -ms-flexbox;
+    display: flex;
+    -webkit-box-align: center;
+    -ms-flex-align: center;
+    align-items: center;
+    -webkit-box-pack: center;
+    -ms-flex-pack: center;
+    justify-content: center;
+    margin-bottom: 0;
+  }
+  .form-inline .form-group {
+    display: -webkit-box;
+    display: -ms-flexbox;
+    display: flex;
+    -webkit-box-flex: 0;
+    -ms-flex: 0 0 auto;
+    flex: 0 0 auto;
+    -webkit-box-orient: horizontal;
+    -webkit-box-direction: normal;
+    -ms-flex-flow: row wrap;
+    flex-flow: row wrap;
+    -webkit-box-align: center;
+    -ms-flex-align: center;
+    align-items: center;
+    margin-bottom: 0;
+  }
+  .form-inline .form-control {
+    display: inline-block;
+    width: auto;
+    vertical-align: middle;
+  }
+  .form-inline .form-control-plaintext {
+    display: inline-block;
+  }
+  .form-inline .input-group {
+    width: auto;
+  }
+  .form-inline .form-check {
+    display: -webkit-box;
+    display: -ms-flexbox;
+    display: flex;
+    -webkit-box-align: center;
+    -ms-flex-align: center;
+    align-items: center;
+    -webkit-box-pack: center;
+    -ms-flex-pack: center;
+    justify-content: center;
+    width: auto;
+    padding-left: 0;
+  }
+  .form-inline .form-check-input {
+    position: relative;
+    margin-top: 0;
+    margin-right: 0.25rem;
+    margin-left: 0;
+  }
+  .form-inline .custom-control {
+    -webkit-box-align: center;
+    -ms-flex-align: center;
+    align-items: center;
+    -webkit-box-pack: center;
+    -ms-flex-pack: center;
+    justify-content: center;
+  }
+  .form-inline .custom-control-label {
+    margin-bottom: 0;
+  }
+}
+
+.btn {
+  display: inline-block;
+  font-weight: 400;
+  text-align: center;
+  white-space: nowrap;
+  vertical-align: middle;
+  -webkit-user-select: none;
+  -moz-user-select: none;
+  -ms-user-select: none;
+  user-select: none;
+  border: 1px solid transparent;
+  padding: 0.375rem 0.75rem;
+  font-size: 1rem;
+  line-height: 1.5;
+  border-radius: 0.25rem;
+  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
+}
+
+.btn:hover, .btn:focus {
+  text-decoration: none;
+}
+
+.btn:focus, .btn.focus {
+  outline: 0;
+  box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
+}
+
+.btn.disabled, .btn:disabled {
+  opacity: 0.65;
+}
+
+.btn:not(:disabled):not(.disabled) {
+  cursor: pointer;
+}
+
+.btn:not(:disabled):not(.disabled):active, .btn:not(:disabled):not(.disabled).active {
+  background-image: none;
+}
+
+a.btn.disabled,
+fieldset:disabled a.btn {
+  pointer-events: none;
+}
+
+.btn-primary {
+  color: #fff;
+  background-color: #007bff;
+  border-color: #007bff;
+}
+
+.btn-primary:hover {
+  color: #fff;
+  background-color: #0069d9;
+  border-color: #0062cc;
+}
+
+.btn-primary:focus, .btn-primary.focus {
+  box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.5);
+}
+
+.btn-primary.disabled, .btn-primary:disabled {
+  color: #fff;
+  background-color: #007bff;
+  border-color: #007bff;
+}
+
+.btn-primary:not(:disabled):not(.disabled):active, .btn-primary:not(:disabled):not(.disabled).active,
+.show > .btn-primary.dropdown-toggle {
+  color: #fff;
+  background-color: #0062cc;
+  border-color: #005cbf;
+}
+
+.btn-primary:not(:disabled):not(.disabled):active:focus, .btn-primary:not(:disabled):not(.disabled).active:focus,
+.show > .btn-primary.dropdown-toggle:focus {
+  box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.5);
+}
+
+.btn-secondary {
+  color: #fff;
+  background-color: #6c757d;
+  border-color: #6c757d;
+}
+
+.btn-secondary:hover {
+  color: #fff;
+  background-color: #5a6268;
+  border-color: #545b62;
+}
+
+.btn-secondary:focus, .btn-secondary.focus {
+  box-shadow: 0 0 0 0.2rem rgba(108, 117, 125, 0.5);
+}
+
+.btn-secondary.disabled, .btn-secondary:disabled {
+  color: #fff;
+  background-color: #6c757d;
+  border-color: #6c757d;
+}
+
+.btn-secondary:not(:disabled):not(.disabled):active, .btn-secondary:not(:disabled):not(.disabled).active,
+.show > .btn-secondary.dropdown-toggle {
+  color: #fff;
+  background-color: #545b62;
+  border-color: #4e555b;
+}
+
+.btn-secondary:not(:disabled):not(.disabled):active:focus, .btn-secondary:not(:disabled):not(.disabled).active:focus,
+.show > .btn-secondary.dropdown-toggle:focus {
+  box-shadow: 0 0 0 0.2rem rgba(108, 117, 125, 0.5);
+}
+
+.btn-success {
+  color: #fff;
+  background-color: #28a745;
+  border-color: #28a745;
+}
+
+.btn-success:hover {
+  color: #fff;
+  background-color: #218838;
+  border-color: #1e7e34;
+}
+
+.btn-success:focus, .btn-success.focus {
+  box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5);
+}
+
+.btn-success.disabled, .btn-success:disabled {
+  color: #fff;
+  background-color: #28a745;
+  border-color: #28a745;
+}
+
+.btn-success:not(:disabled):not(.disabled):active, .btn-success:not(:disabled):not(.disabled).active,
+.show > .btn-success.dropdown-toggle {
+  color: #fff;
+  background-color: #1e7e34;
+  border-color: #1c7430;
+}
+
+.btn-success:not(:disabled):not(.disabled):active:focus, .btn-success:not(:disabled):not(.disabled).active:focus,
+.show > .btn-success.dropdown-toggle:focus {
+  box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5);
+}
+
+.btn-info {
+  color: #fff;
+  background-color: #17a2b8;
+  border-color: #17a2b8;
+}
+
+.btn-info:hover {
+  color: #fff;
+  background-color: #138496;
+  border-color: #117a8b;
+}
+
+.btn-info:focus, .btn-info.focus {
+  box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5);
+}
+
+.btn-info.disabled, .btn-info:disabled {
+  color: #fff;
+  background-color: #17a2b8;
+  border-color: #17a2b8;
+}
+
+.btn-info:not(:disabled):not(.disabled):active, .btn-info:not(:disabled):not(.disabled).active,
+.show > .btn-info.dropdown-toggle {
+  color: #fff;
+  background-color: #117a8b;
+  border-color: #10707f;
+}
+
+.btn-info:not(:disabled):not(.disabled):active:focus, .btn-info:not(:disabled):not(.disabled).active:focus,
+.show > .btn-info.dropdown-toggle:focus {
+  box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5);
+}
+
+.btn-warning {
+  color: #212529;
+  background-color: #ffc107;
+  border-color: #ffc107;
+}
+
+.btn-warning:hover {
+  color: #212529;
+  background-color: #e0a800;
+  border-color: #d39e00;
+}
+
+.btn-warning:focus, .btn-warning.focus {
+  box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5);
+}
+
+.btn-warning.disabled, .btn-warning:disabled {
+  color: #212529;
+  background-color: #ffc107;
+  border-color: #ffc107;
+}
+
+.btn-warning:not(:disabled):not(.disabled):active, .btn-warning:not(:disabled):not(.disabled).active,
+.show > .btn-warning.dropdown-toggle {
+  color: #212529;
+  background-color: #d39e00;
+  border-color: #c69500;
+}
+
+.btn-warning:not(:disabled):not(.disabled):active:focus, .btn-warning:not(:disabled):not(.disabled).active:focus,
+.show > .btn-warning.dropdown-toggle:focus {
+  box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5);
+}
+
+.btn-danger {
+  color: #fff;
+  background-color: #dc3545;
+  border-color: #dc3545;
+}
+
+.btn-danger:hover {
+  color: #fff;
+  background-color: #c82333;
+  border-color: #bd2130;
+}
+
+.btn-danger:focus, .btn-danger.focus {
+  box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5);
+}
+
+.btn-danger.disabled, .btn-danger:disabled {
+  color: #fff;
+  background-color: #dc3545;
+  border-color: #dc3545;
+}
+
+.btn-danger:not(:disabled):not(.disabled):active, .btn-danger:not(:disabled):not(.disabled).active,
+.show > .btn-danger.dropdown-toggle {
+  color: #fff;
+  background-color: #bd2130;
+  border-color: #b21f2d;
+}
+
+.btn-danger:not(:disabled):not(.disabled):active:focus, .btn-danger:not(:disabled):not(.disabled).active:focus,
+.show > .btn-danger.dropdown-toggle:focus {
+  box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5);
+}
+
+.btn-light {
+  color: #212529;
+  background-color: #f8f9fa;
+  border-color: #f8f9fa;
+}
+
+.btn-light:hover {
+  color: #212529;
+  background-color: #e2e6ea;
+  border-color: #dae0e5;
+}
+
+.btn-light:focus, .btn-light.focus {
+  box-shadow: 0 0 0 0.2rem rgba(248, 249, 250, 0.5);
+}
+
+.btn-light.disabled, .btn-light:disabled {
+  color: #212529;
+  background-color: #f8f9fa;
+  border-color: #f8f9fa;
+}
+
+.btn-light:not(:disabled):not(.disabled):active, .btn-light:not(:disabled):not(.disabled).active,
+.show > .btn-light.dropdown-toggle {
+  color: #212529;
+  background-color: #dae0e5;
+  border-color: #d3d9df;
+}
+
+.btn-light:not(:disabled):not(.disabled):active:focus, .btn-light:not(:disabled):not(.disabled).active:focus,
+.show > .btn-light.dropdown-toggle:focus {
+  box-shadow: 0 0 0 0.2rem rgba(248, 249, 250, 0.5);
+}
+
+.btn-dark {
+  color: #fff;
+  background-color: #343a40;
+  border-color: #343a40;
+}
+
+.btn-dark:hover {
+  color: #fff;
+  background-color: #23272b;
+  border-color: #1d2124;
+}
+
+.btn-dark:focus, .btn-dark.focus {
+  box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5);
+}
+
+.btn-dark.disabled, .btn-dark:disabled {
+  color: #fff;
+  background-color: #343a40;
+  border-color: #343a40;
+}
+
+.btn-dark:not(:disabled):not(.disabled):active, .btn-dark:not(:disabled):not(.disabled).active,
+.show > .btn-dark.dropdown-toggle {
+  color: #fff;
+  background-color: #1d2124;
+  border-color: #171a1d;
+}
+
+.btn-dark:not(:disabled):not(.disabled):active:focus, .btn-dark:not(:disabled):not(.disabled).active:focus,
+.show > .btn-dark.dropdown-toggle:focus {
+  box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5);
+}
+
+.btn-outline-primary {
+  color: #007bff;
+  background-color: transparent;
+  background-image: none;
+  border-color: #007bff;
+}
+
+.btn-outline-primary:hover {
+  color: #fff;
+  background-color: #007bff;
+  border-color: #007bff;
+}
+
+.btn-outline-primary:focus, .btn-outline-primary.focus {
+  box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.5);
+}
+
+.btn-outline-primary.disabled, .btn-outline-primary:disabled {
+  color: #007bff;
+  background-color: transparent;
+}
+
+.btn-outline-primary:not(:disabled):not(.disabled):active, .btn-outline-primary:not(:disabled):not(.disabled).active,
+.show > .btn-outline-primary.dropdown-toggle {
+  color: #fff;
+  background-color: #007bff;
+  border-color: #007bff;
+}
+
+.btn-outline-primary:not(:disabled):not(.disabled):active:focus, .btn-outline-primary:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-primary.dropdown-toggle:focus {
+  box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.5);
+}
+
+.btn-outline-secondary {
+  color: #6c757d;
+  background-color: transparent;
+  background-image: none;
+  border-color: #6c757d;
+}
+
+.btn-outline-secondary:hover {
+  color: #fff;
+  background-color: #6c757d;
+  border-color: #6c757d;
+}
+
+.btn-outline-secondary:focus, .btn-outline-secondary.focus {
+  box-shadow: 0 0 0 0.2rem rgba(108, 117, 125, 0.5);
+}
+
+.btn-outline-secondary.disabled, .btn-outline-secondary:disabled {
+  color: #6c757d;
+  background-color: transparent;
+}
+
+.btn-outline-secondary:not(:disabled):not(.disabled):active, .btn-outline-secondary:not(:disabled):not(.disabled).active,
+.show > .btn-outline-secondary.dropdown-toggle {
+  color: #fff;
+  background-color: #6c757d;
+  border-color: #6c757d;
+}
+
+.btn-outline-secondary:not(:disabled):not(.disabled):active:focus, .btn-outline-secondary:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-secondary.dropdown-toggle:focus {
+  box-shadow: 0 0 0 0.2rem rgba(108, 117, 125, 0.5);
+}
+
+.btn-outline-success {
+  color: #28a745;
+  background-color: transparent;
+  background-image: none;
+  border-color: #28a745;
+}
+
+.btn-outline-success:hover {
+  color: #fff;
+  background-color: #28a745;
+  border-color: #28a745;
+}
+
+.btn-outline-success:focus, .btn-outline-success.focus {
+  box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5);
+}
+
+.btn-outline-success.disabled, .btn-outline-success:disabled {
+  color: #28a745;
+  background-color: transparent;
+}
+
+.btn-outline-success:not(:disabled):not(.disabled):active, .btn-outline-success:not(:disabled):not(.disabled).active,
+.show > .btn-outline-success.dropdown-toggle {
+  color: #fff;
+  background-color: #28a745;
+  border-color: #28a745;
+}
+
+.btn-outline-success:not(:disabled):not(.disabled):active:focus, .btn-outline-success:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-success.dropdown-toggle:focus {
+  box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5);
+}
+
+.btn-outline-info {
+  color: #17a2b8;
+  background-color: transparent;
+  background-image: none;
+  border-color: #17a2b8;
+}
+
+.btn-outline-info:hover {
+  color: #fff;
+  background-color: #17a2b8;
+  border-color: #17a2b8;
+}
+
+.btn-outline-info:focus, .btn-outline-info.focus {
+  box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5);
+}
+
+.btn-outline-info.disabled, .btn-outline-info:disabled {
+  color: #17a2b8;
+  background-color: transparent;
+}
+
+.btn-outline-info:not(:disabled):not(.disabled):active, .btn-outline-info:not(:disabled):not(.disabled).active,
+.show > .btn-outline-info.dropdown-toggle {
+  color: #fff;
+  background-color: #17a2b8;
+  border-color: #17a2b8;
+}
+
+.btn-outline-info:not(:disabled):not(.disabled):active:focus, .btn-outline-info:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-info.dropdown-toggle:focus {
+  box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5);
+}
+
+.btn-outline-warning {
+  color: #ffc107;
+  background-color: transparent;
+  background-image: none;
+  border-color: #ffc107;
+}
+
+.btn-outline-warning:hover {
+  color: #212529;
+  background-color: #ffc107;
+  border-color: #ffc107;
+}
+
+.btn-outline-warning:focus, .btn-outline-warning.focus {
+  box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5);
+}
+
+.btn-outline-warning.disabled, .btn-outline-warning:disabled {
+  color: #ffc107;
+  background-color: transparent;
+}
+
+.btn-outline-warning:not(:disabled):not(.disabled):active, .btn-outline-warning:not(:disabled):not(.disabled).active,
+.show > .btn-outline-warning.dropdown-toggle {
+  color: #212529;
+  background-color: #ffc107;
+  border-color: #ffc107;
+}
+
+.btn-outline-warning:not(:disabled):not(.disabled):active:focus, .btn-outline-warning:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-warning.dropdown-toggle:focus {
+  box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5);
+}
+
+.btn-outline-danger {
+  color: #dc3545;
+  background-color: transparent;
+  background-image: none;
+  border-color: #dc3545;
+}
+
+.btn-outline-danger:hover {
+  color: #fff;
+  background-color: #dc3545;
+  border-color: #dc3545;
+}
+
+.btn-outline-danger:focus, .btn-outline-danger.focus {
+  box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5);
+}
+
+.btn-outline-danger.disabled, .btn-outline-danger:disabled {
+  color: #dc3545;
+  background-color: transparent;
+}
+
+.btn-outline-danger:not(:disabled):not(.disabled):active, .btn-outline-danger:not(:disabled):not(.disabled).active,
+.show > .btn-outline-danger.dropdown-toggle {
+  color: #fff;
+  background-color: #dc3545;
+  border-color: #dc3545;
+}
+
+.btn-outline-danger:not(:disabled):not(.disabled):active:focus, .btn-outline-danger:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-danger.dropdown-toggle:focus {
+  box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5);
+}
+
+.btn-outline-light {
+  color: #f8f9fa;
+  background-color: transparent;
+  background-image: none;
+  border-color: #f8f9fa;
+}
+
+.btn-outline-light:hover {
+  color: #212529;
+  background-color: #f8f9fa;
+  border-color: #f8f9fa;
+}
+
+.btn-outline-light:focus, .btn-outline-light.focus {
+  box-shadow: 0 0 0 0.2rem rgba(248, 249, 250, 0.5);
+}
+
+.btn-outline-light.disabled, .btn-outline-light:disabled {
+  color: #f8f9fa;
+  background-color: transparent;
+}
+
+.btn-outline-light:not(:disabled):not(.disabled):active, .btn-outline-light:not(:disabled):not(.disabled).active,
+.show > .btn-outline-light.dropdown-toggle {
+  color: #212529;
+  background-color: #f8f9fa;
+  border-color: #f8f9fa;
+}
+
+.btn-outline-light:not(:disabled):not(.disabled):active:focus, .btn-outline-light:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-light.dropdown-toggle:focus {
+  box-shadow: 0 0 0 0.2rem rgba(248, 249, 250, 0.5);
+}
+
+.btn-outline-dark {
+  color: #343a40;
+  background-color: transparent;
+  background-image: none;
+  border-color: #343a40;
+}
+
+.btn-outline-dark:hover {
+  color: #fff;
+  background-color: #343a40;
+  border-color: #343a40;
+}
+
+.btn-outline-dark:focus, .btn-outline-dark.focus {
+  box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5);
+}
+
+.btn-outline-dark.disabled, .btn-outline-dark:disabled {
+  color: #343a40;
+  background-color: transparent;
+}
+
+.btn-outline-dark:not(:disabled):not(.disabled):active, .btn-outline-dark:not(:disabled):not(.disabled).active,
+.show > .btn-outline-dark.dropdown-toggle {
+  color: #fff;
+  background-color: #343a40;
+  border-color: #343a40;
+}
+
+.btn-outline-dark:not(:disabled):not(.disabled):active:focus, .btn-outline-dark:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-dark.dropdown-toggle:focus {
+  box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5);
+}
+
+.btn-link {
+  font-weight: 400;
+  color: #007bff;
+  background-color: transparent;
+}
+
+.btn-link:hover {
+  color: #0056b3;
+  text-decoration: underline;
+  background-color: transparent;
+  border-color: transparent;
+}
+
+.btn-link:focus, .btn-link.focus {
+  text-decoration: underline;
+  border-color: transparent;
+  box-shadow: none;
+}
+
+.btn-link:disabled, .btn-link.disabled {
+  color: #6c757d;
+}
+
+.btn-lg, .btn-group-lg > .btn {
+  padding: 0.5rem 1rem;
+  font-size: 1.25rem;
+  line-height: 1.5;
+  border-radius: 0.3rem;
+}
+
+.btn-sm, .btn-group-sm > .btn {
+  padding: 0.25rem 0.5rem;
+  font-size: 0.875rem;
+  line-height: 1.5;
+  border-radius: 0.2rem;
+}
+
+.btn-block {
+  display: block;
+  width: 100%;
+}
+
+.btn-block + .btn-block {
+  margin-top: 0.5rem;
+}
+
+input[type="submit"].btn-block,
+input[type="reset"].btn-block,
+input[type="button"].btn-block {
+  width: 100%;
+}
+
+.fade {
+  opacity: 0;
+  transition: opacity 0.15s linear;
+}
+
+.fade.show {
+  opacity: 1;
+}
+
+.collapse {
+  display: none;
+}
+
+.collapse.show {
+  display: block;
+}
+
+tr.collapse.show {
+  display: table-row;
+}
+
+tbody.collapse.show {
+  display: table-row-group;
+}
+
+.collapsing {
+  position: relative;
+  height: 0;
+  overflow: hidden;
+  transition: height 0.35s ease;
+}
+
+.dropup,
+.dropdown {
+  position: relative;
+}
+
+.dropdown-toggle::after {
+  display: inline-block;
+  width: 0;
+  height: 0;
+  margin-left: 0.255em;
+  vertical-align: 0.255em;
+  content: "";
+  border-top: 0.3em solid;
+  border-right: 0.3em solid transparent;
+  border-bottom: 0;
+  border-left: 0.3em solid transparent;
+}
+
+.dropdown-toggle:empty::after {
+  margin-left: 0;
+}
+
+.dropdown-menu {
+  position: absolute;
+  top: 100%;
+  left: 0;
+  z-index: 1000;
+  display: none;
+  float: left;
+  min-width: 10rem;
+  padding: 0.5rem 0;
+  margin: 0.125rem 0 0;
+  font-size: 1rem;
+  color: #212529;
+  text-align: left;
+  list-style: none;
+  background-color: #fff;
+  background-clip: padding-box;
+  border: 1px solid rgba(0, 0, 0, 0.15);
+  border-radius: 0.25rem;
+}
+
+.dropup .dropdown-menu {
+  margin-top: 0;
+  margin-bottom: 0.125rem;
+}
+
+.dropup .dropdown-toggle::after {
+  display: inline-block;
+  width: 0;
+  height: 0;
+  margin-left: 0.255em;
+  vertical-align: 0.255em;
+  content: "";
+  border-top: 0;
+  border-right: 0.3em solid transparent;
+  border-bottom: 0.3em solid;
+  border-left: 0.3em solid transparent;
+}
+
+.dropup .dropdown-toggle:empty::after {
+  margin-left: 0;
+}
+
+.dropright .dropdown-menu {
+  margin-top: 0;
+  margin-left: 0.125rem;
+}
+
+.dropright .dropdown-toggle::after {
+  display: inline-block;
+  width: 0;
+  height: 0;
+  margin-left: 0.255em;
+  vertical-align: 0.255em;
+  content: "";
+  border-top: 0.3em solid transparent;
+  border-bottom: 0.3em solid transparent;
+  border-left: 0.3em solid;
+}
+
+.dropright .dropdown-toggle:empty::after {
+  margin-left: 0;
+}
+
+.dropright .dropdown-toggle::after {
+  vertical-align: 0;
+}
+
+.dropleft .dropdown-menu {
+  margin-top: 0;
+  margin-right: 0.125rem;
+}
+
+.dropleft .dropdown-toggle::after {
+  display: inline-block;
+  width: 0;
+  height: 0;
+  margin-left: 0.255em;
+  vertical-align: 0.255em;
+  content: "";
+}
+
+.dropleft .dropdown-toggle::after {
+  display: none;
+}
+
+.dropleft .dropdown-toggle::before {
+  display: inline-block;
+  width: 0;
+  height: 0;
+  margin-right: 0.255em;
+  vertical-align: 0.255em;
+  content: "";
+  border-top: 0.3em solid transparent;
+  border-right: 0.3em solid;
+  border-bottom: 0.3em solid transparent;
+}
+
+.dropleft .dropdown-toggle:empty::after {
+  margin-left: 0;
+}
+
+.dropleft .dropdown-toggle::before {
+  vertical-align: 0;
+}
+
+.dropdown-divider {
+  height: 0;
+  margin: 0.5rem 0;
+  overflow: hidden;
+  border-top: 1px solid #e9ecef;
+}
+
+.dropdown-item {
+  display: block;
+  width: 100%;
+  padding: 0.25rem 1.5rem;
+  clear: both;
+  font-weight: 400;
+  color: #212529;
+  text-align: inherit;
+  white-space: nowrap;
+  background-color: transparent;
+  border: 0;
+}
+
+.dropdown-item:hover, .dropdown-item:focus {
+  color: #16181b;
+  text-decoration: none;
+  background-color: #f8f9fa;
+}
+
+.dropdown-item.active, .dropdown-item:active {
+  color: #fff;
+  text-decoration: none;
+  background-color: #007bff;
+}
+
+.dropdown-item.disabled, .dropdown-item:disabled {
+  color: #6c757d;
+  background-color: transparent;
+}
+
+.dropdown-menu.show {
+  display: block;
+}
+
+.dropdown-header {
+  display: block;
+  padding: 0.5rem 1.5rem;
+  margin-bottom: 0;
+  font-size: 0.875rem;
+  color: #6c757d;
+  white-space: nowrap;
+}
+
+.btn-group,
+.btn-group-vertical {
+  position: relative;
+  display: -webkit-inline-box;
+  display: -ms-inline-flexbox;
+  display: inline-flex;
+  vertical-align: middle;
+}
+
+.btn-group > .btn,
+.btn-group-vertical > .btn {
+  position: relative;
+  -webkit-box-flex: 0;
+  -ms-flex: 0 1 auto;
+  flex: 0 1 auto;
+}
+
+.btn-group > .btn:hover,
+.btn-group-vertical > .btn:hover {
+  z-index: 1;
+}
+
+.btn-group > .btn:focus, .btn-group > .btn:active, .btn-group > .btn.active,
+.btn-group-vertical > .btn:focus,
+.btn-group-vertical > .btn:active,
+.btn-group-vertical > .btn.active {
+  z-index: 1;
+}
+
+.btn-group .btn + .btn,
+.btn-group .btn + .btn-group,
+.btn-group .btn-group + .btn,
+.btn-group .btn-group + .btn-group,
+.btn-group-vertical .btn + .btn,
+.btn-group-vertical .btn + .btn-group,
+.btn-group-vertical .btn-group + .btn,
+.btn-group-vertical .btn-group + .btn-group {
+  margin-left: -1px;
+}
+
+.btn-toolbar {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -ms-flex-wrap: wrap;
+  flex-wrap: wrap;
+  -webkit-box-pack: start;
+  -ms-flex-pack: start;
+  justify-content: flex-start;
+}
+
+.btn-toolbar .input-group {
+  width: auto;
+}
+
+.btn-group > .btn:first-child {
+  margin-left: 0;
+}
+
+.btn-group > .btn:not(:last-child):not(.dropdown-toggle),
+.btn-group > .btn-group:not(:last-child) > .btn {
+  border-top-right-radius: 0;
+  border-bottom-right-radius: 0;
+}
+
+.btn-group > .btn:not(:first-child),
+.btn-group > .btn-group:not(:first-child) > .btn {
+  border-top-left-radius: 0;
+  border-bottom-left-radius: 0;
+}
+
+.dropdown-toggle-split {
+  padding-right: 0.5625rem;
+  padding-left: 0.5625rem;
+}
+
+.dropdown-toggle-split::after {
+  margin-left: 0;
+}
+
+.btn-sm + .dropdown-toggle-split, .btn-group-sm > .btn + .dropdown-toggle-split {
+  padding-right: 0.375rem;
+  padding-left: 0.375rem;
+}
+
+.btn-lg + .dropdown-toggle-split, .btn-group-lg > .btn + .dropdown-toggle-split {
+  padding-right: 0.75rem;
+  padding-left: 0.75rem;
+}
+
+.btn-group-vertical {
+  -webkit-box-orient: vertical;
+  -webkit-box-direction: normal;
+  -ms-flex-direction: column;
+  flex-direction: column;
+  -webkit-box-align: start;
+  -ms-flex-align: start;
+  align-items: flex-start;
+  -webkit-box-pack: center;
+  -ms-flex-pack: center;
+  justify-content: center;
+}
+
+.btn-group-vertical .btn,
+.btn-group-vertical .btn-group {
+  width: 100%;
+}
+
+.btn-group-vertical > .btn + .btn,
+.btn-group-vertical > .btn + .btn-group,
+.btn-group-vertical > .btn-group + .btn,
+.btn-group-vertical > .btn-group + .btn-group {
+  margin-top: -1px;
+  margin-left: 0;
+}
+
+.btn-group-vertical > .btn:not(:last-child):not(.dropdown-toggle),
+.btn-group-vertical > .btn-group:not(:last-child) > .btn {
+  border-bottom-right-radius: 0;
+  border-bottom-left-radius: 0;
+}
+
+.btn-group-vertical > .btn:not(:first-child),
+.btn-group-vertical > .btn-group:not(:first-child) > .btn {
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+}
+
+.btn-group-toggle > .btn,
+.btn-group-toggle > .btn-group > .btn {
+  margin-bottom: 0;
+}
+
+.btn-group-toggle > .btn input[type="radio"],
+.btn-group-toggle > .btn input[type="checkbox"],
+.btn-group-toggle > .btn-group > .btn input[type="radio"],
+.btn-group-toggle > .btn-group > .btn input[type="checkbox"] {
+  position: absolute;
+  clip: rect(0, 0, 0, 0);
+  pointer-events: none;
+}
+
+.input-group {
+  position: relative;
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -ms-flex-wrap: wrap;
+  flex-wrap: wrap;
+  -webkit-box-align: stretch;
+  -ms-flex-align: stretch;
+  align-items: stretch;
+  width: 100%;
+}
+
+.input-group > .form-control,
+.input-group > .custom-select,
+.input-group > .custom-file {
+  position: relative;
+  -webkit-box-flex: 1;
+  -ms-flex: 1 1 auto;
+  flex: 1 1 auto;
+  width: 1%;
+  margin-bottom: 0;
+}
+
+.input-group > .form-control:focus,
+.input-group > .custom-select:focus,
+.input-group > .custom-file:focus {
+  z-index: 3;
+}
+
+.input-group > .form-control + .form-control,
+.input-group > .form-control + .custom-select,
+.input-group > .form-control + .custom-file,
+.input-group > .custom-select + .form-control,
+.input-group > .custom-select + .custom-select,
+.input-group > .custom-select + .custom-file,
+.input-group > .custom-file + .form-control,
+.input-group > .custom-file + .custom-select,
+.input-group > .custom-file + .custom-file {
+  margin-left: -1px;
+}
+
+.input-group > .form-control:not(:last-child),
+.input-group > .custom-select:not(:last-child) {
+  border-top-right-radius: 0;
+  border-bottom-right-radius: 0;
+}
+
+.input-group > .form-control:not(:first-child),
+.input-group > .custom-select:not(:first-child) {
+  border-top-left-radius: 0;
+  border-bottom-left-radius: 0;
+}
+
+.input-group > .custom-file {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: center;
+  -ms-flex-align: center;
+  align-items: center;
+}
+
+.input-group > .custom-file:not(:last-child) .custom-file-label,
+.input-group > .custom-file:not(:last-child) .custom-file-label::before {
+  border-top-right-radius: 0;
+  border-bottom-right-radius: 0;
+}
+
+.input-group > .custom-file:not(:first-child) .custom-file-label,
+.input-group > .custom-file:not(:first-child) .custom-file-label::before {
+  border-top-left-radius: 0;
+  border-bottom-left-radius: 0;
+}
+
+.input-group-prepend,
+.input-group-append {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+}
+
+.input-group-prepend .btn,
+.input-group-append .btn {
+  position: relative;
+  z-index: 2;
+}
+
+.input-group-prepend .btn + .btn,
+.input-group-prepend .btn + .input-group-text,
+.input-group-prepend .input-group-text + .input-group-text,
+.input-group-prepend .input-group-text + .btn,
+.input-group-append .btn + .btn,
+.input-group-append .btn + .input-group-text,
+.input-group-append .input-group-text + .input-group-text,
+.input-group-append .input-group-text + .btn {
+  margin-left: -1px;
+}
+
+.input-group-prepend {
+  margin-right: -1px;
+}
+
+.input-group-append {
+  margin-left: -1px;
+}
+
+.input-group-text {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: center;
+  -ms-flex-align: center;
+  align-items: center;
+  padding: 0.375rem 0.75rem;
+  margin-bottom: 0;
+  font-size: 1rem;
+  font-weight: 400;
+  line-height: 1.5;
+  color: #495057;
+  text-align: center;
+  white-space: nowrap;
+  background-color: #e9ecef;
+  border: 1px solid #ced4da;
+  border-radius: 0.25rem;
+}
+
+.input-group-text input[type="radio"],
+.input-group-text input[type="checkbox"] {
+  margin-top: 0;
+}
+
+.input-group > .input-group-prepend > .btn,
+.input-group > .input-group-prepend > .input-group-text,
+.input-group > .input-group-append:not(:last-child) > .btn,
+.input-group > .input-group-append:not(:last-child) > .input-group-text,
+.input-group > .input-group-append:last-child > .btn:not(:last-child):not(.dropdown-toggle),
+.input-group > .input-group-append:last-child > .input-group-text:not(:last-child) {
+  border-top-right-radius: 0;
+  border-bottom-right-radius: 0;
+}
+
+.input-group > .input-group-append > .btn,
+.input-group > .input-group-append > .input-group-text,
+.input-group > .input-group-prepend:not(:first-child) > .btn,
+.input-group > .input-group-prepend:not(:first-child) > .input-group-text,
+.input-group > .input-group-prepend:first-child > .btn:not(:first-child),
+.input-group > .input-group-prepend:first-child > .input-group-text:not(:first-child) {
+  border-top-left-radius: 0;
+  border-bottom-left-radius: 0;
+}
+
+.custom-control {
+  position: relative;
+  display: block;
+  min-height: 1.5rem;
+  padding-left: 1.5rem;
+}
+
+.custom-control-inline {
+  display: -webkit-inline-box;
+  display: -ms-inline-flexbox;
+  display: inline-flex;
+  margin-right: 1rem;
+}
+
+.custom-control-input {
+  position: absolute;
+  z-index: -1;
+  opacity: 0;
+}
+
+.custom-control-input:checked ~ .custom-control-label::before {
+  color: #fff;
+  background-color: #007bff;
+}
+
+.custom-control-input:focus ~ .custom-control-label::before {
+  box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
+}
+
+.custom-control-input:active ~ .custom-control-label::before {
+  color: #fff;
+  background-color: #b3d7ff;
+}
+
+.custom-control-input:disabled ~ .custom-control-label {
+  color: #6c757d;
+}
+
+.custom-control-input:disabled ~ .custom-control-label::before {
+  background-color: #e9ecef;
+}
+
+.custom-control-label {
+  margin-bottom: 0;
+}
+
+.custom-control-label::before {
+  position: absolute;
+  top: 0.25rem;
+  left: 0;
+  display: block;
+  width: 1rem;
+  height: 1rem;
+  pointer-events: none;
+  content: "";
+  -webkit-user-select: none;
+  -moz-user-select: none;
+  -ms-user-select: none;
+  user-select: none;
+  background-color: #dee2e6;
+}
+
+.custom-control-label::after {
+  position: absolute;
+  top: 0.25rem;
+  left: 0;
+  display: block;
+  width: 1rem;
+  height: 1rem;
+  content: "";
+  background-repeat: no-repeat;
+  background-position: center center;
+  background-size: 50% 50%;
+}
+
+.custom-checkbox .custom-control-label::before {
+  border-radius: 0.25rem;
+}
+
+.custom-checkbox .custom-control-input:checked ~ .custom-control-label::before {
+  background-color: #007bff;
+}
+
+.custom-checkbox .custom-control-input:checked ~ .custom-control-label::after {
+  background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E");
+}
+
+.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::before {
+  background-color: #007bff;
+}
+
+.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::after {
+  background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 4'%3E%3Cpath stroke='%23fff' d='M0 2h4'/%3E%3C/svg%3E");
+}
+
+.custom-checkbox .custom-control-input:disabled:checked ~ .custom-control-label::before {
+  background-color: rgba(0, 123, 255, 0.5);
+}
+
+.custom-checkbox .custom-control-input:disabled:indeterminate ~ .custom-control-label::before {
+  background-color: rgba(0, 123, 255, 0.5);
+}
+
+.custom-radio .custom-control-label::before {
+  border-radius: 50%;
+}
+
+.custom-radio .custom-control-input:checked ~ .custom-control-label::before {
+  background-color: #007bff;
+}
+
+.custom-radio .custom-control-input:checked ~ .custom-control-label::after {
+  background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3E%3Ccircle r='3' fill='%23fff'/%3E%3C/svg%3E");
+}
+
+.custom-radio .custom-control-input:disabled:checked ~ .custom-control-label::before {
+  background-color: rgba(0, 123, 255, 0.5);
+}
+
+.custom-select {
+  display: inline-block;
+  width: 100%;
+  height: calc(2.25rem + 2px);
+  padding: 0.375rem 1.75rem 0.375rem 0.75rem;
+  line-height: 1.5;
+  color: #495057;
+  vertical-align: middle;
+  background: #fff url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3E%3Cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3E%3C/svg%3E") no-repeat right 0.75rem center;
+  background-size: 8px 10px;
+  border: 1px solid #ced4da;
+  border-radius: 0.25rem;
+  -webkit-appearance: none;
+  -moz-appearance: none;
+  appearance: none;
+}
+
+.custom-select:focus {
+  border-color: #80bdff;
+  outline: 0;
+  box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.075), 0 0 5px rgba(128, 189, 255, 0.5);
+}
+
+.custom-select:focus::-ms-value {
+  color: #495057;
+  background-color: #fff;
+}
+
+.custom-select[multiple], .custom-select[size]:not([size="1"]) {
+  height: auto;
+  padding-right: 0.75rem;
+  background-image: none;
+}
+
+.custom-select:disabled {
+  color: #6c757d;
+  background-color: #e9ecef;
+}
+
+.custom-select::-ms-expand {
+  opacity: 0;
+}
+
+.custom-select-sm {
+  height: calc(1.8125rem + 2px);
+  padding-top: 0.375rem;
+  padding-bottom: 0.375rem;
+  font-size: 75%;
+}
+
+.custom-select-lg {
+  height: calc(2.875rem + 2px);
+  padding-top: 0.375rem;
+  padding-bottom: 0.375rem;
+  font-size: 125%;
+}
+
+.custom-file {
+  position: relative;
+  display: inline-block;
+  width: 100%;
+  height: calc(2.25rem + 2px);
+  margin-bottom: 0;
+}
+
+.custom-file-input {
+  position: relative;
+  z-index: 2;
+  width: 100%;
+  height: calc(2.25rem + 2px);
+  margin: 0;
+  opacity: 0;
+}
+
+.custom-file-input:focus ~ .custom-file-control {
+  border-color: #80bdff;
+  box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
+}
+
+.custom-file-input:focus ~ .custom-file-control::before {
+  border-color: #80bdff;
+}
+
+.custom-file-input:lang(en) ~ .custom-file-label::after {
+  content: "Browse";
+}
+
+.custom-file-label {
+  position: absolute;
+  top: 0;
+  right: 0;
+  left: 0;
+  z-index: 1;
+  height: calc(2.25rem + 2px);
+  padding: 0.375rem 0.75rem;
+  line-height: 1.5;
+  color: #495057;
+  background-color: #fff;
+  border: 1px solid #ced4da;
+  border-radius: 0.25rem;
+}
+
+.custom-file-label::after {
+  position: absolute;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  z-index: 3;
+  display: block;
+  height: calc(calc(2.25rem + 2px) - 1px * 2);
+  padding: 0.375rem 0.75rem;
+  line-height: 1.5;
+  color: #495057;
+  content: "Browse";
+  background-color: #e9ecef;
+  border-left: 1px solid #ced4da;
+  border-radius: 0 0.25rem 0.25rem 0;
+}
+
+.nav {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -ms-flex-wrap: wrap;
+  flex-wrap: wrap;
+  padding-left: 0;
+  margin-bottom: 0;
+  list-style: none;
+}
+
+.nav-link {
+  display: block;
+  padding: 0.5rem 1rem;
+}
+
+.nav-link:hover, .nav-link:focus {
+  text-decoration: none;
+}
+
+.nav-link.disabled {
+  color: #6c757d;
+}
+
+.nav-tabs {
+  border-bottom: 1px solid #dee2e6;
+}
+
+.nav-tabs .nav-item {
+  margin-bottom: -1px;
+}
+
+.nav-tabs .nav-link {
+  border: 1px solid transparent;
+  border-top-left-radius: 0.25rem;
+  border-top-right-radius: 0.25rem;
+}
+
+.nav-tabs .nav-link:hover, .nav-tabs .nav-link:focus {
+  border-color: #e9ecef #e9ecef #dee2e6;
+}
+
+.nav-tabs .nav-link.disabled {
+  color: #6c757d;
+  background-color: transparent;
+  border-color: transparent;
+}
+
+.nav-tabs .nav-link.active,
+.nav-tabs .nav-item.show .nav-link {
+  color: #495057;
+  background-color: #fff;
+  border-color: #dee2e6 #dee2e6 #fff;
+}
+
+.nav-tabs .dropdown-menu {
+  margin-top: -1px;
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+}
+
+.nav-pills .nav-link {
+  border-radius: 0.25rem;
+}
+
+.nav-pills .nav-link.active,
+.nav-pills .show > .nav-link {
+  color: #fff;
+  background-color: #007bff;
+}
+
+.nav-fill .nav-item {
+  -webkit-box-flex: 1;
+  -ms-flex: 1 1 auto;
+  flex: 1 1 auto;
+  text-align: center;
+}
+
+.nav-justified .nav-item {
+  -ms-flex-preferred-size: 0;
+  flex-basis: 0;
+  -webkit-box-flex: 1;
+  -ms-flex-positive: 1;
+  flex-grow: 1;
+  text-align: center;
+}
+
+.tab-content > .tab-pane {
+  display: none;
+}
+
+.tab-content > .active {
+  display: block;
+}
+
+.navbar {
+  position: relative;
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -ms-flex-wrap: wrap;
+  flex-wrap: wrap;
+  -webkit-box-align: center;
+  -ms-flex-align: center;
+  align-items: center;
+  -webkit-box-pack: justify;
+  -ms-flex-pack: justify;
+  justify-content: space-between;
+  padding: 0.5rem 1rem;
+}
+
+.navbar > .container,
+.navbar > .container-fluid {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -ms-flex-wrap: wrap;
+  flex-wrap: wrap;
+  -webkit-box-align: center;
+  -ms-flex-align: center;
+  align-items: center;
+  -webkit-box-pack: justify;
+  -ms-flex-pack: justify;
+  justify-content: space-between;
+}
+
+.navbar-brand {
+  display: inline-block;
+  padding-top: 0.3125rem;
+  padding-bottom: 0.3125rem;
+  margin-right: 1rem;
+  font-size: 1.25rem;
+  line-height: inherit;
+  white-space: nowrap;
+}
+
+.navbar-brand:hover, .navbar-brand:focus {
+  text-decoration: none;
+}
+
+.navbar-nav {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-orient: vertical;
+  -webkit-box-direction: normal;
+  -ms-flex-direction: column;
+  flex-direction: column;
+  padding-left: 0;
+  margin-bottom: 0;
+  list-style: none;
+}
+
+.navbar-nav .nav-link {
+  padding-right: 0;
+  padding-left: 0;
+}
+
+.navbar-nav .dropdown-menu {
+  position: static;
+  float: none;
+}
+
+.navbar-text {
+  display: inline-block;
+  padding-top: 0.5rem;
+  padding-bottom: 0.5rem;
+}
+
+.navbar-collapse {
+  -ms-flex-preferred-size: 100%;
+  flex-basis: 100%;
+  -webkit-box-flex: 1;
+  -ms-flex-positive: 1;
+  flex-grow: 1;
+  -webkit-box-align: center;
+  -ms-flex-align: center;
+  align-items: center;
+}
+
+.navbar-toggler {
+  padding: 0.25rem 0.75rem;
+  font-size: 1.25rem;
+  line-height: 1;
+  background-color: transparent;
+  border: 1px solid transparent;
+  border-radius: 0.25rem;
+}
+
+.navbar-toggler:hover, .navbar-toggler:focus {
+  text-decoration: none;
+}
+
+.navbar-toggler:not(:disabled):not(.disabled) {
+  cursor: pointer;
+}
+
+.navbar-toggler-icon {
+  display: inline-block;
+  width: 1.5em;
+  height: 1.5em;
+  vertical-align: middle;
+  content: "";
+  background: no-repeat center center;
+  background-size: 100% 100%;
+}
+
+@media (max-width: 575.98px) {
+  .navbar-expand-sm > .container,
+  .navbar-expand-sm > .container-fluid {
+    padding-right: 0;
+    padding-left: 0;
+  }
+}
+
+@media (min-width: 576px) {
+  .navbar-expand-sm {
+    -webkit-box-orient: horizontal;
+    -webkit-box-direction: normal;
+    -ms-flex-flow: row nowrap;
+    flex-flow: row nowrap;
+    -webkit-box-pack: start;
+    -ms-flex-pack: start;
+    justify-content: flex-start;
+  }
+  .navbar-expand-sm .navbar-nav {
+    -webkit-box-orient: horizontal;
+    -webkit-box-direction: normal;
+    -ms-flex-direction: row;
+    flex-direction: row;
+  }
+  .navbar-expand-sm .navbar-nav .dropdown-menu {
+    position: absolute;
+  }
+  .navbar-expand-sm .navbar-nav .dropdown-menu-right {
+    right: 0;
+    left: auto;
+  }
+  .navbar-expand-sm .navbar-nav .nav-link {
+    padding-right: 0.5rem;
+    padding-left: 0.5rem;
+  }
+  .navbar-expand-sm > .container,
+  .navbar-expand-sm > .container-fluid {
+    -ms-flex-wrap: nowrap;
+    flex-wrap: nowrap;
+  }
+  .navbar-expand-sm .navbar-collapse {
+    display: -webkit-box !important;
+    display: -ms-flexbox !important;
+    display: flex !important;
+    -ms-flex-preferred-size: auto;
+    flex-basis: auto;
+  }
+  .navbar-expand-sm .navbar-toggler {
+    display: none;
+  }
+  .navbar-expand-sm .dropup .dropdown-menu {
+    top: auto;
+    bottom: 100%;
+  }
+}
+
+@media (max-width: 767.98px) {
+  .navbar-expand-md > .container,
+  .navbar-expand-md > .container-fluid {
+    padding-right: 0;
+    padding-left: 0;
+  }
+}
+
+@media (min-width: 768px) {
+  .navbar-expand-md {
+    -webkit-box-orient: horizontal;
+    -webkit-box-direction: normal;
+    -ms-flex-flow: row nowrap;
+    flex-flow: row nowrap;
+    -webkit-box-pack: start;
+    -ms-flex-pack: start;
+    justify-content: flex-start;
+  }
+  .navbar-expand-md .navbar-nav {
+    -webkit-box-orient: horizontal;
+    -webkit-box-direction: normal;
+    -ms-flex-direction: row;
+    flex-direction: row;
+  }
+  .navbar-expand-md .navbar-nav .dropdown-menu {
+    position: absolute;
+  }
+  .navbar-expand-md .navbar-nav .dropdown-menu-right {
+    right: 0;
+    left: auto;
+  }
+  .navbar-expand-md .navbar-nav .nav-link {
+    padding-right: 0.5rem;
+    padding-left: 0.5rem;
+  }
+  .navbar-expand-md > .container,
+  .navbar-expand-md > .container-fluid {
+    -ms-flex-wrap: nowrap;
+    flex-wrap: nowrap;
+  }
+  .navbar-expand-md .navbar-collapse {
+    display: -webkit-box !important;
+    display: -ms-flexbox !important;
+    display: flex !important;
+    -ms-flex-preferred-size: auto;
+    flex-basis: auto;
+  }
+  .navbar-expand-md .navbar-toggler {
+    display: none;
+  }
+  .navbar-expand-md .dropup .dropdown-menu {
+    top: auto;
+    bottom: 100%;
+  }
+}
+
+@media (max-width: 991.98px) {
+  .navbar-expand-lg > .container,
+  .navbar-expand-lg > .container-fluid {
+    padding-right: 0;
+    padding-left: 0;
+  }
+}
+
+@media (min-width: 992px) {
+  .navbar-expand-lg {
+    -webkit-box-orient: horizontal;
+    -webkit-box-direction: normal;
+    -ms-flex-flow: row nowrap;
+    flex-flow: row nowrap;
+    -webkit-box-pack: start;
+    -ms-flex-pack: start;
+    justify-content: flex-start;
+  }
+  .navbar-expand-lg .navbar-nav {
+    -webkit-box-orient: horizontal;
+    -webkit-box-direction: normal;
+    -ms-flex-direction: row;
+    flex-direction: row;
+  }
+  .navbar-expand-lg .navbar-nav .dropdown-menu {
+    position: absolute;
+  }
+  .navbar-expand-lg .navbar-nav .dropdown-menu-right {
+    right: 0;
+    left: auto;
+  }
+  .navbar-expand-lg .navbar-nav .nav-link {
+    padding-right: 0.5rem;
+    padding-left: 0.5rem;
+  }
+  .navbar-expand-lg > .container,
+  .navbar-expand-lg > .container-fluid {
+    -ms-flex-wrap: nowrap;
+    flex-wrap: nowrap;
+  }
+  .navbar-expand-lg .navbar-collapse {
+    display: -webkit-box !important;
+    display: -ms-flexbox !important;
+    display: flex !important;
+    -ms-flex-preferred-size: auto;
+    flex-basis: auto;
+  }
+  .navbar-expand-lg .navbar-toggler {
+    display: none;
+  }
+  .navbar-expand-lg .dropup .dropdown-menu {
+    top: auto;
+    bottom: 100%;
+  }
+}
+
+@media (max-width: 1199.98px) {
+  .navbar-expand-xl > .container,
+  .navbar-expand-xl > .container-fluid {
+    padding-right: 0;
+    padding-left: 0;
+  }
+}
+
+@media (min-width: 1200px) {
+  .navbar-expand-xl {
+    -webkit-box-orient: horizontal;
+    -webkit-box-direction: normal;
+    -ms-flex-flow: row nowrap;
+    flex-flow: row nowrap;
+    -webkit-box-pack: start;
+    -ms-flex-pack: start;
+    justify-content: flex-start;
+  }
+  .navbar-expand-xl .navbar-nav {
+    -webkit-box-orient: horizontal;
+    -webkit-box-direction: normal;
+    -ms-flex-direction: row;
+    flex-direction: row;
+  }
+  .navbar-expand-xl .navbar-nav .dropdown-menu {
+    position: absolute;
+  }
+  .navbar-expand-xl .navbar-nav .dropdown-menu-right {
+    right: 0;
+    left: auto;
+  }
+  .navbar-expand-xl .navbar-nav .nav-link {
+    padding-right: 0.5rem;
+    padding-left: 0.5rem;
+  }
+  .navbar-expand-xl > .container,
+  .navbar-expand-xl > .container-fluid {
+    -ms-flex-wrap: nowrap;
+    flex-wrap: nowrap;
+  }
+  .navbar-expand-xl .navbar-collapse {
+    display: -webkit-box !important;
+    display: -ms-flexbox !important;
+    display: flex !important;
+    -ms-flex-preferred-size: auto;
+    flex-basis: auto;
+  }
+  .navbar-expand-xl .navbar-toggler {
+    display: none;
+  }
+  .navbar-expand-xl .dropup .dropdown-menu {
+    top: auto;
+    bottom: 100%;
+  }
+}
+
+.navbar-expand {
+  -webkit-box-orient: horizontal;
+  -webkit-box-direction: normal;
+  -ms-flex-flow: row nowrap;
+  flex-flow: row nowrap;
+  -webkit-box-pack: start;
+  -ms-flex-pack: start;
+  justify-content: flex-start;
+}
+
+.navbar-expand > .container,
+.navbar-expand > .container-fluid {
+  padding-right: 0;
+  padding-left: 0;
+}
+
+.navbar-expand .navbar-nav {
+  -webkit-box-orient: horizontal;
+  -webkit-box-direction: normal;
+  -ms-flex-direction: row;
+  flex-direction: row;
+}
+
+.navbar-expand .navbar-nav .dropdown-menu {
+  position: absolute;
+}
+
+.navbar-expand .navbar-nav .dropdown-menu-right {
+  right: 0;
+  left: auto;
+}
+
+.navbar-expand .navbar-nav .nav-link {
+  padding-right: 0.5rem;
+  padding-left: 0.5rem;
+}
+
+.navbar-expand > .container,
+.navbar-expand > .container-fluid {
+  -ms-flex-wrap: nowrap;
+  flex-wrap: nowrap;
+}
+
+.navbar-expand .navbar-collapse {
+  display: -webkit-box !important;
+  display: -ms-flexbox !important;
+  display: flex !important;
+  -ms-flex-preferred-size: auto;
+  flex-basis: auto;
+}
+
+.navbar-expand .navbar-toggler {
+  display: none;
+}
+
+.navbar-expand .dropup .dropdown-menu {
+  top: auto;
+  bottom: 100%;
+}
+
+.navbar-light .navbar-brand {
+  color: rgba(0, 0, 0, 0.9);
+}
+
+.navbar-light .navbar-brand:hover, .navbar-light .navbar-brand:focus {
+  color: rgba(0, 0, 0, 0.9);
+}
+
+.navbar-light .navbar-nav .nav-link {
+  color: rgba(0, 0, 0, 0.5);
+}
+
+.navbar-light .navbar-nav .nav-link:hover, .navbar-light .navbar-nav .nav-link:focus {
+  color: rgba(0, 0, 0, 0.7);
+}
+
+.navbar-light .navbar-nav .nav-link.disabled {
+  color: rgba(0, 0, 0, 0.3);
+}
+
+.navbar-light .navbar-nav .show > .nav-link,
+.navbar-light .navbar-nav .active > .nav-link,
+.navbar-light .navbar-nav .nav-link.show,
+.navbar-light .navbar-nav .nav-link.active {
+  color: rgba(0, 0, 0, 0.9);
+}
+
+.navbar-light .navbar-toggler {
+  color: rgba(0, 0, 0, 0.5);
+  border-color: rgba(0, 0, 0, 0.1);
+}
+
+.navbar-light .navbar-toggler-icon {
+  background-image: url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(0, 0, 0, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E");
+}
+
+.navbar-light .navbar-text {
+  color: rgba(0, 0, 0, 0.5);
+}
+
+.navbar-light .navbar-text a {
+  color: rgba(0, 0, 0, 0.9);
+}
+
+.navbar-light .navbar-text a:hover, .navbar-light .navbar-text a:focus {
+  color: rgba(0, 0, 0, 0.9);
+}
+
+.navbar-dark .navbar-brand {
+  color: #fff;
+}
+
+.navbar-dark .navbar-brand:hover, .navbar-dark .navbar-brand:focus {
+  color: #fff;
+}
+
+.navbar-dark .navbar-nav .nav-link {
+  color: rgba(255, 255, 255, 0.5);
+}
+
+.navbar-dark .navbar-nav .nav-link:hover, .navbar-dark .navbar-nav .nav-link:focus {
+  color: rgba(255, 255, 255, 0.75);
+}
+
+.navbar-dark .navbar-nav .nav-link.disabled {
+  color: rgba(255, 255, 255, 0.25);
+}
+
+.navbar-dark .navbar-nav .show > .nav-link,
+.navbar-dark .navbar-nav .active > .nav-link,
+.navbar-dark .navbar-nav .nav-link.show,
+.navbar-dark .navbar-nav .nav-link.active {
+  color: #fff;
+}
+
+.navbar-dark .navbar-toggler {
+  color: rgba(255, 255, 255, 0.5);
+  border-color: rgba(255, 255, 255, 0.1);
+}
+
+.navbar-dark .navbar-toggler-icon {
+  background-image: url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(255, 255, 255, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E");
+}
+
+.navbar-dark .navbar-text {
+  color: rgba(255, 255, 255, 0.5);
+}
+
+.navbar-dark .navbar-text a {
+  color: #fff;
+}
+
+.navbar-dark .navbar-text a:hover, .navbar-dark .navbar-text a:focus {
+  color: #fff;
+}
+
+.card {
+  position: relative;
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-orient: vertical;
+  -webkit-box-direction: normal;
+  -ms-flex-direction: column;
+  flex-direction: column;
+  min-width: 0;
+  word-wrap: break-word;
+  background-color: #fff;
+  background-clip: border-box;
+  border: 1px solid rgba(0, 0, 0, 0.125);
+  border-radius: 0.25rem;
+}
+
+.card > hr {
+  margin-right: 0;
+  margin-left: 0;
+}
+
+.card > .list-group:first-child .list-group-item:first-child {
+  border-top-left-radius: 0.25rem;
+  border-top-right-radius: 0.25rem;
+}
+
+.card > .list-group:last-child .list-group-item:last-child {
+  border-bottom-right-radius: 0.25rem;
+  border-bottom-left-radius: 0.25rem;
+}
+
+.card-body {
+  -webkit-box-flex: 1;
+  -ms-flex: 1 1 auto;
+  flex: 1 1 auto;
+  padding: 1.25rem;
+}
+
+.card-title {
+  margin-bottom: 0.75rem;
+}
+
+.card-subtitle {
+  margin-top: -0.375rem;
+  margin-bottom: 0;
+}
+
+.card-text:last-child {
+  margin-bottom: 0;
+}
+
+.card-link:hover {
+  text-decoration: none;
+}
+
+.card-link + .card-link {
+  margin-left: 1.25rem;
+}
+
+.card-header {
+  padding: 0.75rem 1.25rem;
+  margin-bottom: 0;
+  background-color: rgba(0, 0, 0, 0.03);
+  border-bottom: 1px solid rgba(0, 0, 0, 0.125);
+}
+
+.card-header:first-child {
+  border-radius: calc(0.25rem - 1px) calc(0.25rem - 1px) 0 0;
+}
+
+.card-header + .list-group .list-group-item:first-child {
+  border-top: 0;
+}
+
+.card-footer {
+  padding: 0.75rem 1.25rem;
+  background-color: rgba(0, 0, 0, 0.03);
+  border-top: 1px solid rgba(0, 0, 0, 0.125);
+}
+
+.card-footer:last-child {
+  border-radius: 0 0 calc(0.25rem - 1px) calc(0.25rem - 1px);
+}
+
+.card-header-tabs {
+  margin-right: -0.625rem;
+  margin-bottom: -0.75rem;
+  margin-left: -0.625rem;
+  border-bottom: 0;
+}
+
+.card-header-pills {
+  margin-right: -0.625rem;
+  margin-left: -0.625rem;
+}
+
+.card-img-overlay {
+  position: absolute;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  padding: 1.25rem;
+}
+
+.card-img {
+  width: 100%;
+  border-radius: calc(0.25rem - 1px);
+}
+
+.card-img-top {
+  width: 100%;
+  border-top-left-radius: calc(0.25rem - 1px);
+  border-top-right-radius: calc(0.25rem - 1px);
+}
+
+.card-img-bottom {
+  width: 100%;
+  border-bottom-right-radius: calc(0.25rem - 1px);
+  border-bottom-left-radius: calc(0.25rem - 1px);
+}
+
+.card-deck {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-orient: vertical;
+  -webkit-box-direction: normal;
+  -ms-flex-direction: column;
+  flex-direction: column;
+}
+
+.card-deck .card {
+  margin-bottom: 15px;
+}
+
+@media (min-width: 576px) {
+  .card-deck {
+    -webkit-box-orient: horizontal;
+    -webkit-box-direction: normal;
+    -ms-flex-flow: row wrap;
+    flex-flow: row wrap;
+    margin-right: -15px;
+    margin-left: -15px;
+  }
+  .card-deck .card {
+    display: -webkit-box;
+    display: -ms-flexbox;
+    display: flex;
+    -webkit-box-flex: 1;
+    -ms-flex: 1 0 0%;
+    flex: 1 0 0%;
+    -webkit-box-orient: vertical;
+    -webkit-box-direction: normal;
+    -ms-flex-direction: column;
+    flex-direction: column;
+    margin-right: 15px;
+    margin-bottom: 0;
+    margin-left: 15px;
+  }
+}
+
+.card-group {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-orient: vertical;
+  -webkit-box-direction: normal;
+  -ms-flex-direction: column;
+  flex-direction: column;
+}
+
+.card-group > .card {
+  margin-bottom: 15px;
+}
+
+@media (min-width: 576px) {
+  .card-group {
+    -webkit-box-orient: horizontal;
+    -webkit-box-direction: normal;
+    -ms-flex-flow: row wrap;
+    flex-flow: row wrap;
+  }
+  .card-group > .card {
+    -webkit-box-flex: 1;
+    -ms-flex: 1 0 0%;
+    flex: 1 0 0%;
+    margin-bottom: 0;
+  }
+  .card-group > .card + .card {
+    margin-left: 0;
+    border-left: 0;
+  }
+  .card-group > .card:first-child {
+    border-top-right-radius: 0;
+    border-bottom-right-radius: 0;
+  }
+  .card-group > .card:first-child .card-img-top,
+  .card-group > .card:first-child .card-header {
+    border-top-right-radius: 0;
+  }
+  .card-group > .card:first-child .card-img-bottom,
+  .card-group > .card:first-child .card-footer {
+    border-bottom-right-radius: 0;
+  }
+  .card-group > .card:last-child {
+    border-top-left-radius: 0;
+    border-bottom-left-radius: 0;
+  }
+  .card-group > .card:last-child .card-img-top,
+  .card-group > .card:last-child .card-header {
+    border-top-left-radius: 0;
+  }
+  .card-group > .card:last-child .card-img-bottom,
+  .card-group > .card:last-child .card-footer {
+    border-bottom-left-radius: 0;
+  }
+  .card-group > .card:only-child {
+    border-radius: 0.25rem;
+  }
+  .card-group > .card:only-child .card-img-top,
+  .card-group > .card:only-child .card-header {
+    border-top-left-radius: 0.25rem;
+    border-top-right-radius: 0.25rem;
+  }
+  .card-group > .card:only-child .card-img-bottom,
+  .card-group > .card:only-child .card-footer {
+    border-bottom-right-radius: 0.25rem;
+    border-bottom-left-radius: 0.25rem;
+  }
+  .card-group > .card:not(:first-child):not(:last-child):not(:only-child) {
+    border-radius: 0;
+  }
+  .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-img-top,
+  .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-img-bottom,
+  .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-header,
+  .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-footer {
+    border-radius: 0;
+  }
+}
+
+.card-columns .card {
+  margin-bottom: 0.75rem;
+}
+
+@media (min-width: 576px) {
+  .card-columns {
+    -webkit-column-count: 3;
+    -moz-column-count: 3;
+    column-count: 3;
+    -webkit-column-gap: 1.25rem;
+    -moz-column-gap: 1.25rem;
+    column-gap: 1.25rem;
+  }
+  .card-columns .card {
+    display: inline-block;
+    width: 100%;
+  }
+}
+
+.breadcrumb {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -ms-flex-wrap: wrap;
+  flex-wrap: wrap;
+  padding: 0.75rem 1rem;
+  margin-bottom: 1rem;
+  list-style: none;
+  background-color: #e9ecef;
+  border-radius: 0.25rem;
+}
+
+.breadcrumb-item + .breadcrumb-item::before {
+  display: inline-block;
+  padding-right: 0.5rem;
+  padding-left: 0.5rem;
+  color: #6c757d;
+  content: "/";
+}
+
+.breadcrumb-item + .breadcrumb-item:hover::before {
+  text-decoration: underline;
+}
+
+.breadcrumb-item + .breadcrumb-item:hover::before {
+  text-decoration: none;
+}
+
+.breadcrumb-item.active {
+  color: #6c757d;
+}
+
+.pagination {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  padding-left: 0;
+  list-style: none;
+  border-radius: 0.25rem;
+}
+
+.page-link {
+  position: relative;
+  display: block;
+  padding: 0.5rem 0.75rem;
+  margin-left: -1px;
+  line-height: 1.25;
+  color: #007bff;
+  background-color: #fff;
+  border: 1px solid #dee2e6;
+}
+
+.page-link:hover {
+  color: #0056b3;
+  text-decoration: none;
+  background-color: #e9ecef;
+  border-color: #dee2e6;
+}
+
+.page-link:focus {
+  z-index: 2;
+  outline: 0;
+  box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
+}
+
+.page-link:not(:disabled):not(.disabled) {
+  cursor: pointer;
+}
+
+.page-item:first-child .page-link {
+  margin-left: 0;
+  border-top-left-radius: 0.25rem;
+  border-bottom-left-radius: 0.25rem;
+}
+
+.page-item:last-child .page-link {
+  border-top-right-radius: 0.25rem;
+  border-bottom-right-radius: 0.25rem;
+}
+
+.page-item.active .page-link {
+  z-index: 1;
+  color: #fff;
+  background-color: #007bff;
+  border-color: #007bff;
+}
+
+.page-item.disabled .page-link {
+  color: #6c757d;
+  pointer-events: none;
+  cursor: auto;
+  background-color: #fff;
+  border-color: #dee2e6;
+}
+
+.pagination-lg .page-link {
+  padding: 0.75rem 1.5rem;
+  font-size: 1.25rem;
+  line-height: 1.5;
+}
+
+.pagination-lg .page-item:first-child .page-link {
+  border-top-left-radius: 0.3rem;
+  border-bottom-left-radius: 0.3rem;
+}
+
+.pagination-lg .page-item:last-child .page-link {
+  border-top-right-radius: 0.3rem;
+  border-bottom-right-radius: 0.3rem;
+}
+
+.pagination-sm .page-link {
+  padding: 0.25rem 0.5rem;
+  font-size: 0.875rem;
+  line-height: 1.5;
+}
+
+.pagination-sm .page-item:first-child .page-link {
+  border-top-left-radius: 0.2rem;
+  border-bottom-left-radius: 0.2rem;
+}
+
+.pagination-sm .page-item:last-child .page-link {
+  border-top-right-radius: 0.2rem;
+  border-bottom-right-radius: 0.2rem;
+}
+
+.badge {
+  display: inline-block;
+  padding: 0.25em 0.4em;
+  font-size: 75%;
+  font-weight: 700;
+  line-height: 1;
+  text-align: center;
+  white-space: nowrap;
+  vertical-align: baseline;
+  border-radius: 0.25rem;
+}
+
+.badge:empty {
+  display: none;
+}
+
+.btn .badge {
+  position: relative;
+  top: -1px;
+}
+
+.badge-pill {
+  padding-right: 0.6em;
+  padding-left: 0.6em;
+  border-radius: 10rem;
+}
+
+.badge-primary {
+  color: #fff;
+  background-color: #007bff;
+}
+
+.badge-primary[href]:hover, .badge-primary[href]:focus {
+  color: #fff;
+  text-decoration: none;
+  background-color: #0062cc;
+}
+
+.badge-secondary {
+  color: #fff;
+  background-color: #6c757d;
+}
+
+.badge-secondary[href]:hover, .badge-secondary[href]:focus {
+  color: #fff;
+  text-decoration: none;
+  background-color: #545b62;
+}
+
+.badge-success {
+  color: #fff;
+  background-color: #28a745;
+}
+
+.badge-success[href]:hover, .badge-success[href]:focus {
+  color: #fff;
+  text-decoration: none;
+  background-color: #1e7e34;
+}
+
+.badge-info {
+  color: #fff;
+  background-color: #17a2b8;
+}
+
+.badge-info[href]:hover, .badge-info[href]:focus {
+  color: #fff;
+  text-decoration: none;
+  background-color: #117a8b;
+}
+
+.badge-warning {
+  color: #212529;
+  background-color: #ffc107;
+}
+
+.badge-warning[href]:hover, .badge-warning[href]:focus {
+  color: #212529;
+  text-decoration: none;
+  background-color: #d39e00;
+}
+
+.badge-danger {
+  color: #fff;
+  background-color: #dc3545;
+}
+
+.badge-danger[href]:hover, .badge-danger[href]:focus {
+  color: #fff;
+  text-decoration: none;
+  background-color: #bd2130;
+}
+
+.badge-light {
+  color: #212529;
+  background-color: #f8f9fa;
+}
+
+.badge-light[href]:hover, .badge-light[href]:focus {
+  color: #212529;
+  text-decoration: none;
+  background-color: #dae0e5;
+}
+
+.badge-dark {
+  color: #fff;
+  background-color: #343a40;
+}
+
+.badge-dark[href]:hover, .badge-dark[href]:focus {
+  color: #fff;
+  text-decoration: none;
+  background-color: #1d2124;
+}
+
+.jumbotron {
+  padding: 2rem 1rem;
+  margin-bottom: 2rem;
+  background-color: #e9ecef;
+  border-radius: 0.3rem;
+}
+
+@media (min-width: 576px) {
+  .jumbotron {
+    padding: 4rem 2rem;
+  }
+}
+
+.jumbotron-fluid {
+  padding-right: 0;
+  padding-left: 0;
+  border-radius: 0;
+}
+
+.alert {
+  position: relative;
+  padding: 0.75rem 1.25rem;
+  margin-bottom: 1rem;
+  border: 1px solid transparent;
+  border-radius: 0.25rem;
+}
+
+.alert-heading {
+  color: inherit;
+}
+
+.alert-link {
+  font-weight: 700;
+}
+
+.alert-dismissible {
+  padding-right: 4rem;
+}
+
+.alert-dismissible .close {
+  position: absolute;
+  top: 0;
+  right: 0;
+  padding: 0.75rem 1.25rem;
+  color: inherit;
+}
+
+.alert-primary {
+  color: #004085;
+  background-color: #cce5ff;
+  border-color: #b8daff;
+}
+
+.alert-primary hr {
+  border-top-color: #9fcdff;
+}
+
+.alert-primary .alert-link {
+  color: #002752;
+}
+
+.alert-secondary {
+  color: #383d41;
+  background-color: #e2e3e5;
+  border-color: #d6d8db;
+}
+
+.alert-secondary hr {
+  border-top-color: #c8cbcf;
+}
+
+.alert-secondary .alert-link {
+  color: #202326;
+}
+
+.alert-success {
+  color: #155724;
+  background-color: #d4edda;
+  border-color: #c3e6cb;
+}
+
+.alert-success hr {
+  border-top-color: #b1dfbb;
+}
+
+.alert-success .alert-link {
+  color: #0b2e13;
+}
+
+.alert-info {
+  color: #0c5460;
+  background-color: #d1ecf1;
+  border-color: #bee5eb;
+}
+
+.alert-info hr {
+  border-top-color: #abdde5;
+}
+
+.alert-info .alert-link {
+  color: #062c33;
+}
+
+.alert-warning {
+  color: #856404;
+  background-color: #fff3cd;
+  border-color: #ffeeba;
+}
+
+.alert-warning hr {
+  border-top-color: #ffe8a1;
+}
+
+.alert-warning .alert-link {
+  color: #533f03;
+}
+
+.alert-danger {
+  color: #721c24;
+  background-color: #f8d7da;
+  border-color: #f5c6cb;
+}
+
+.alert-danger hr {
+  border-top-color: #f1b0b7;
+}
+
+.alert-danger .alert-link {
+  color: #491217;
+}
+
+.alert-light {
+  color: #818182;
+  background-color: #fefefe;
+  border-color: #fdfdfe;
+}
+
+.alert-light hr {
+  border-top-color: #ececf6;
+}
+
+.alert-light .alert-link {
+  color: #686868;
+}
+
+.alert-dark {
+  color: #1b1e21;
+  background-color: #d6d8d9;
+  border-color: #c6c8ca;
+}
+
+.alert-dark hr {
+  border-top-color: #b9bbbe;
+}
+
+.alert-dark .alert-link {
+  color: #040505;
+}
+
+@-webkit-keyframes progress-bar-stripes {
+  from {
+    background-position: 1rem 0;
+  }
+  to {
+    background-position: 0 0;
+  }
+}
+
+@keyframes progress-bar-stripes {
+  from {
+    background-position: 1rem 0;
+  }
+  to {
+    background-position: 0 0;
+  }
+}
+
+.progress {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  height: 1rem;
+  overflow: hidden;
+  font-size: 0.75rem;
+  background-color: #e9ecef;
+  border-radius: 0.25rem;
+}
+
+.progress-bar {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-orient: vertical;
+  -webkit-box-direction: normal;
+  -ms-flex-direction: column;
+  flex-direction: column;
+  -webkit-box-pack: center;
+  -ms-flex-pack: center;
+  justify-content: center;
+  color: #fff;
+  text-align: center;
+  background-color: #007bff;
+  transition: width 0.6s ease;
+}
+
+.progress-bar-striped {
+  background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+  background-size: 1rem 1rem;
+}
+
+.progress-bar-animated {
+  -webkit-animation: progress-bar-stripes 1s linear infinite;
+  animation: progress-bar-stripes 1s linear infinite;
+}
+
+.media {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: start;
+  -ms-flex-align: start;
+  align-items: flex-start;
+}
+
+.media-body {
+  -webkit-box-flex: 1;
+  -ms-flex: 1;
+  flex: 1;
+}
+
+.list-group {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-orient: vertical;
+  -webkit-box-direction: normal;
+  -ms-flex-direction: column;
+  flex-direction: column;
+  padding-left: 0;
+  margin-bottom: 0;
+}
+
+.list-group-item-action {
+  width: 100%;
+  color: #495057;
+  text-align: inherit;
+}
+
+.list-group-item-action:hover, .list-group-item-action:focus {
+  color: #495057;
+  text-decoration: none;
+  background-color: #f8f9fa;
+}
+
+.list-group-item-action:active {
+  color: #212529;
+  background-color: #e9ecef;
+}
+
+.list-group-item {
+  position: relative;
+  display: block;
+  padding: 0.75rem 1.25rem;
+  margin-bottom: -1px;
+  background-color: #fff;
+  border: 1px solid rgba(0, 0, 0, 0.125);
+}
+
+.list-group-item:first-child {
+  border-top-left-radius: 0.25rem;
+  border-top-right-radius: 0.25rem;
+}
+
+.list-group-item:last-child {
+  margin-bottom: 0;
+  border-bottom-right-radius: 0.25rem;
+  border-bottom-left-radius: 0.25rem;
+}
+
+.list-group-item:hover, .list-group-item:focus {
+  z-index: 1;
+  text-decoration: none;
+}
+
+.list-group-item.disabled, .list-group-item:disabled {
+  color: #6c757d;
+  background-color: #fff;
+}
+
+.list-group-item.active {
+  z-index: 2;
+  color: #fff;
+  background-color: #007bff;
+  border-color: #007bff;
+}
+
+.list-group-flush .list-group-item {
+  border-right: 0;
+  border-left: 0;
+  border-radius: 0;
+}
+
+.list-group-flush:first-child .list-group-item:first-child {
+  border-top: 0;
+}
+
+.list-group-flush:last-child .list-group-item:last-child {
+  border-bottom: 0;
+}
+
+.list-group-item-primary {
+  color: #004085;
+  background-color: #b8daff;
+}
+
+.list-group-item-primary.list-group-item-action:hover, .list-group-item-primary.list-group-item-action:focus {
+  color: #004085;
+  background-color: #9fcdff;
+}
+
+.list-group-item-primary.list-group-item-action.active {
+  color: #fff;
+  background-color: #004085;
+  border-color: #004085;
+}
+
+.list-group-item-secondary {
+  color: #383d41;
+  background-color: #d6d8db;
+}
+
+.list-group-item-secondary.list-group-item-action:hover, .list-group-item-secondary.list-group-item-action:focus {
+  color: #383d41;
+  background-color: #c8cbcf;
+}
+
+.list-group-item-secondary.list-group-item-action.active {
+  color: #fff;
+  background-color: #383d41;
+  border-color: #383d41;
+}
+
+.list-group-item-success {
+  color: #155724;
+  background-color: #c3e6cb;
+}
+
+.list-group-item-success.list-group-item-action:hover, .list-group-item-success.list-group-item-action:focus {
+  color: #155724;
+  background-color: #b1dfbb;
+}
+
+.list-group-item-success.list-group-item-action.active {
+  color: #fff;
+  background-color: #155724;
+  border-color: #155724;
+}
+
+.list-group-item-info {
+  color: #0c5460;
+  background-color: #bee5eb;
+}
+
+.list-group-item-info.list-group-item-action:hover, .list-group-item-info.list-group-item-action:focus {
+  color: #0c5460;
+  background-color: #abdde5;
+}
+
+.list-group-item-info.list-group-item-action.active {
+  color: #fff;
+  background-color: #0c5460;
+  border-color: #0c5460;
+}
+
+.list-group-item-warning {
+  color: #856404;
+  background-color: #ffeeba;
+}
+
+.list-group-item-warning.list-group-item-action:hover, .list-group-item-warning.list-group-item-action:focus {
+  color: #856404;
+  background-color: #ffe8a1;
+}
+
+.list-group-item-warning.list-group-item-action.active {
+  color: #fff;
+  background-color: #856404;
+  border-color: #856404;
+}
+
+.list-group-item-danger {
+  color: #721c24;
+  background-color: #f5c6cb;
+}
+
+.list-group-item-danger.list-group-item-action:hover, .list-group-item-danger.list-group-item-action:focus {
+  color: #721c24;
+  background-color: #f1b0b7;
+}
+
+.list-group-item-danger.list-group-item-action.active {
+  color: #fff;
+  background-color: #721c24;
+  border-color: #721c24;
+}
+
+.list-group-item-light {
+  color: #818182;
+  background-color: #fdfdfe;
+}
+
+.list-group-item-light.list-group-item-action:hover, .list-group-item-light.list-group-item-action:focus {
+  color: #818182;
+  background-color: #ececf6;
+}
+
+.list-group-item-light.list-group-item-action.active {
+  color: #fff;
+  background-color: #818182;
+  border-color: #818182;
+}
+
+.list-group-item-dark {
+  color: #1b1e21;
+  background-color: #c6c8ca;
+}
+
+.list-group-item-dark.list-group-item-action:hover, .list-group-item-dark.list-group-item-action:focus {
+  color: #1b1e21;
+  background-color: #b9bbbe;
+}
+
+.list-group-item-dark.list-group-item-action.active {
+  color: #fff;
+  background-color: #1b1e21;
+  border-color: #1b1e21;
+}
+
+.close {
+  float: right;
+  font-size: 1.5rem;
+  font-weight: 700;
+  line-height: 1;
+  color: #000;
+  text-shadow: 0 1px 0 #fff;
+  opacity: .5;
+}
+
+.close:hover, .close:focus {
+  color: #000;
+  text-decoration: none;
+  opacity: .75;
+}
+
+.close:not(:disabled):not(.disabled) {
+  cursor: pointer;
+}
+
+button.close {
+  padding: 0;
+  background-color: transparent;
+  border: 0;
+  -webkit-appearance: none;
+}
+
+.modal-open {
+  overflow: hidden;
+}
+
+.modal {
+  position: fixed;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: 1050;
+  display: none;
+  overflow: hidden;
+  outline: 0;
+}
+
+.modal-open .modal {
+  overflow-x: hidden;
+  overflow-y: auto;
+}
+
+.modal-dialog {
+  position: relative;
+  width: auto;
+  margin: 0.5rem;
+  pointer-events: none;
+}
+
+.modal.fade .modal-dialog {
+  transition: -webkit-transform 0.3s ease-out;
+  transition: transform 0.3s ease-out;
+  transition: transform 0.3s ease-out, -webkit-transform 0.3s ease-out;
+  -webkit-transform: translate(0, -25%);
+  transform: translate(0, -25%);
+}
+
+.modal.show .modal-dialog {
+  -webkit-transform: translate(0, 0);
+  transform: translate(0, 0);
+}
+
+.modal-dialog-centered {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: center;
+  -ms-flex-align: center;
+  align-items: center;
+  min-height: calc(100% - (0.5rem * 2));
+}
+
+.modal-content {
+  position: relative;
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-orient: vertical;
+  -webkit-box-direction: normal;
+  -ms-flex-direction: column;
+  flex-direction: column;
+  width: 100%;
+  pointer-events: auto;
+  background-color: #fff;
+  background-clip: padding-box;
+  border: 1px solid rgba(0, 0, 0, 0.2);
+  border-radius: 0.3rem;
+  outline: 0;
+}
+
+.modal-backdrop {
+  position: fixed;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: 1040;
+  background-color: #000;
+}
+
+.modal-backdrop.fade {
+  opacity: 0;
+}
+
+.modal-backdrop.show {
+  opacity: 0.5;
+}
+
+.modal-header {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: start;
+  -ms-flex-align: start;
+  align-items: flex-start;
+  -webkit-box-pack: justify;
+  -ms-flex-pack: justify;
+  justify-content: space-between;
+  padding: 1rem;
+  border-bottom: 1px solid #e9ecef;
+  border-top-left-radius: 0.3rem;
+  border-top-right-radius: 0.3rem;
+}
+
+.modal-header .close {
+  padding: 1rem;
+  margin: -1rem -1rem -1rem auto;
+}
+
+.modal-title {
+  margin-bottom: 0;
+  line-height: 1.5;
+}
+
+.modal-body {
+  position: relative;
+  -webkit-box-flex: 1;
+  -ms-flex: 1 1 auto;
+  flex: 1 1 auto;
+  padding: 1rem;
+}
+
+.modal-footer {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: center;
+  -ms-flex-align: center;
+  align-items: center;
+  -webkit-box-pack: end;
+  -ms-flex-pack: end;
+  justify-content: flex-end;
+  padding: 1rem;
+  border-top: 1px solid #e9ecef;
+}
+
+.modal-footer > :not(:first-child) {
+  margin-left: .25rem;
+}
+
+.modal-footer > :not(:last-child) {
+  margin-right: .25rem;
+}
+
+.modal-scrollbar-measure {
+  position: absolute;
+  top: -9999px;
+  width: 50px;
+  height: 50px;
+  overflow: scroll;
+}
+
+@media (min-width: 576px) {
+  .modal-dialog {
+    max-width: 500px;
+    margin: 1.75rem auto;
+  }
+  .modal-dialog-centered {
+    min-height: calc(100% - (1.75rem * 2));
+  }
+  .modal-sm {
+    max-width: 300px;
+  }
+}
+
+@media (min-width: 992px) {
+  .modal-lg {
+    max-width: 800px;
+  }
+}
+
+.tooltip {
+  position: absolute;
+  z-index: 1070;
+  display: block;
+  margin: 0;
+  font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol";
+  font-style: normal;
+  font-weight: 400;
+  line-height: 1.5;
+  text-align: left;
+  text-align: start;
+  text-decoration: none;
+  text-shadow: none;
+  text-transform: none;
+  letter-spacing: normal;
+  word-break: normal;
+  word-spacing: normal;
+  white-space: normal;
+  line-break: auto;
+  font-size: 0.875rem;
+  word-wrap: break-word;
+  opacity: 0;
+}
+
+.tooltip.show {
+  opacity: 0.9;
+}
+
+.tooltip .arrow {
+  position: absolute;
+  display: block;
+  width: 0.8rem;
+  height: 0.4rem;
+}
+
+.tooltip .arrow::before {
+  position: absolute;
+  content: "";
+  border-color: transparent;
+  border-style: solid;
+}
+
+.bs-tooltip-top, .bs-tooltip-auto[x-placement^="top"] {
+  padding: 0.4rem 0;
+}
+
+.bs-tooltip-top .arrow, .bs-tooltip-auto[x-placement^="top"] .arrow {
+  bottom: 0;
+}
+
+.bs-tooltip-top .arrow::before, .bs-tooltip-auto[x-placement^="top"] .arrow::before {
+  top: 0;
+  border-width: 0.4rem 0.4rem 0;
+  border-top-color: #000;
+}
+
+.bs-tooltip-right, .bs-tooltip-auto[x-placement^="right"] {
+  padding: 0 0.4rem;
+}
+
+.bs-tooltip-right .arrow, .bs-tooltip-auto[x-placement^="right"] .arrow {
+  left: 0;
+  width: 0.4rem;
+  height: 0.8rem;
+}
+
+.bs-tooltip-right .arrow::before, .bs-tooltip-auto[x-placement^="right"] .arrow::before {
+  right: 0;
+  border-width: 0.4rem 0.4rem 0.4rem 0;
+  border-right-color: #000;
+}
+
+.bs-tooltip-bottom, .bs-tooltip-auto[x-placement^="bottom"] {
+  padding: 0.4rem 0;
+}
+
+.bs-tooltip-bottom .arrow, .bs-tooltip-auto[x-placement^="bottom"] .arrow {
+  top: 0;
+}
+
+.bs-tooltip-bottom .arrow::before, .bs-tooltip-auto[x-placement^="bottom"] .arrow::before {
+  bottom: 0;
+  border-width: 0 0.4rem 0.4rem;
+  border-bottom-color: #000;
+}
+
+.bs-tooltip-left, .bs-tooltip-auto[x-placement^="left"] {
+  padding: 0 0.4rem;
+}
+
+.bs-tooltip-left .arrow, .bs-tooltip-auto[x-placement^="left"] .arrow {
+  right: 0;
+  width: 0.4rem;
+  height: 0.8rem;
+}
+
+.bs-tooltip-left .arrow::before, .bs-tooltip-auto[x-placement^="left"] .arrow::before {
+  left: 0;
+  border-width: 0.4rem 0 0.4rem 0.4rem;
+  border-left-color: #000;
+}
+
+.tooltip-inner {
+  max-width: 200px;
+  padding: 0.25rem 0.5rem;
+  color: #fff;
+  text-align: center;
+  background-color: #000;
+  border-radius: 0.25rem;
+}
+
+.popover {
+  position: absolute;
+  top: 0;
+  left: 0;
+  z-index: 1060;
+  display: block;
+  max-width: 276px;
+  font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol";
+  font-style: normal;
+  font-weight: 400;
+  line-height: 1.5;
+  text-align: left;
+  text-align: start;
+  text-decoration: none;
+  text-shadow: none;
+  text-transform: none;
+  letter-spacing: normal;
+  word-break: normal;
+  word-spacing: normal;
+  white-space: normal;
+  line-break: auto;
+  font-size: 0.875rem;
+  word-wrap: break-word;
+  background-color: #fff;
+  background-clip: padding-box;
+  border: 1px solid rgba(0, 0, 0, 0.2);
+  border-radius: 0.3rem;
+}
+
+.popover .arrow {
+  position: absolute;
+  display: block;
+  width: 1rem;
+  height: 0.5rem;
+  margin: 0 0.3rem;
+}
+
+.popover .arrow::before, .popover .arrow::after {
+  position: absolute;
+  display: block;
+  content: "";
+  border-color: transparent;
+  border-style: solid;
+}
+
+.bs-popover-top, .bs-popover-auto[x-placement^="top"] {
+  margin-bottom: 0.5rem;
+}
+
+.bs-popover-top .arrow, .bs-popover-auto[x-placement^="top"] .arrow {
+  bottom: calc((0.5rem + 1px) * -1);
+}
+
+.bs-popover-top .arrow::before, .bs-popover-auto[x-placement^="top"] .arrow::before,
+.bs-popover-top .arrow::after, .bs-popover-auto[x-placement^="top"] .arrow::after {
+  border-width: 0.5rem 0.5rem 0;
+}
+
+.bs-popover-top .arrow::before, .bs-popover-auto[x-placement^="top"] .arrow::before {
+  bottom: 0;
+  border-top-color: rgba(0, 0, 0, 0.25);
+}
+
+.bs-popover-top .arrow::after, .bs-popover-auto[x-placement^="top"] .arrow::after {
+  bottom: 1px;
+  border-top-color: #fff;
+}
+
+.bs-popover-right, .bs-popover-auto[x-placement^="right"] {
+  margin-left: 0.5rem;
+}
+
+.bs-popover-right .arrow, .bs-popover-auto[x-placement^="right"] .arrow {
+  left: calc((0.5rem + 1px) * -1);
+  width: 0.5rem;
+  height: 1rem;
+  margin: 0.3rem 0;
+}
+
+.bs-popover-right .arrow::before, .bs-popover-auto[x-placement^="right"] .arrow::before,
+.bs-popover-right .arrow::after, .bs-popover-auto[x-placement^="right"] .arrow::after {
+  border-width: 0.5rem 0.5rem 0.5rem 0;
+}
+
+.bs-popover-right .arrow::before, .bs-popover-auto[x-placement^="right"] .arrow::before {
+  left: 0;
+  border-right-color: rgba(0, 0, 0, 0.25);
+}
+
+.bs-popover-right .arrow::after, .bs-popover-auto[x-placement^="right"] .arrow::after {
+  left: 1px;
+  border-right-color: #fff;
+}
+
+.bs-popover-bottom, .bs-popover-auto[x-placement^="bottom"] {
+  margin-top: 0.5rem;
+}
+
+.bs-popover-bottom .arrow, .bs-popover-auto[x-placement^="bottom"] .arrow {
+  top: calc((0.5rem + 1px) * -1);
+}
+
+.bs-popover-bottom .arrow::before, .bs-popover-auto[x-placement^="bottom"] .arrow::before,
+.bs-popover-bottom .arrow::after, .bs-popover-auto[x-placement^="bottom"] .arrow::after {
+  border-width: 0 0.5rem 0.5rem 0.5rem;
+}
+
+.bs-popover-bottom .arrow::before, .bs-popover-auto[x-placement^="bottom"] .arrow::before {
+  top: 0;
+  border-bottom-color: rgba(0, 0, 0, 0.25);
+}
+
+.bs-popover-bottom .arrow::after, .bs-popover-auto[x-placement^="bottom"] .arrow::after {
+  top: 1px;
+  border-bottom-color: #fff;
+}
+
+.bs-popover-bottom .popover-header::before, .bs-popover-auto[x-placement^="bottom"] .popover-header::before {
+  position: absolute;
+  top: 0;
+  left: 50%;
+  display: block;
+  width: 1rem;
+  margin-left: -0.5rem;
+  content: "";
+  border-bottom: 1px solid #f7f7f7;
+}
+
+.bs-popover-left, .bs-popover-auto[x-placement^="left"] {
+  margin-right: 0.5rem;
+}
+
+.bs-popover-left .arrow, .bs-popover-auto[x-placement^="left"] .arrow {
+  right: calc((0.5rem + 1px) * -1);
+  width: 0.5rem;
+  height: 1rem;
+  margin: 0.3rem 0;
+}
+
+.bs-popover-left .arrow::before, .bs-popover-auto[x-placement^="left"] .arrow::before,
+.bs-popover-left .arrow::after, .bs-popover-auto[x-placement^="left"] .arrow::after {
+  border-width: 0.5rem 0 0.5rem 0.5rem;
+}
+
+.bs-popover-left .arrow::before, .bs-popover-auto[x-placement^="left"] .arrow::before {
+  right: 0;
+  border-left-color: rgba(0, 0, 0, 0.25);
+}
+
+.bs-popover-left .arrow::after, .bs-popover-auto[x-placement^="left"] .arrow::after {
+  right: 1px;
+  border-left-color: #fff;
+}
+
+.popover-header {
+  padding: 0.5rem 0.75rem;
+  margin-bottom: 0;
+  font-size: 1rem;
+  color: inherit;
+  background-color: #f7f7f7;
+  border-bottom: 1px solid #ebebeb;
+  border-top-left-radius: calc(0.3rem - 1px);
+  border-top-right-radius: calc(0.3rem - 1px);
+}
+
+.popover-header:empty {
+  display: none;
+}
+
+.popover-body {
+  padding: 0.5rem 0.75rem;
+  color: #212529;
+}
+
+.carousel {
+  position: relative;
+}
+
+.carousel-inner {
+  position: relative;
+  width: 100%;
+  overflow: hidden;
+}
+
+.carousel-item {
+  position: relative;
+  display: none;
+  -webkit-box-align: center;
+  -ms-flex-align: center;
+  align-items: center;
+  width: 100%;
+  transition: -webkit-transform 0.6s ease;
+  transition: transform 0.6s ease;
+  transition: transform 0.6s ease, -webkit-transform 0.6s ease;
+  -webkit-backface-visibility: hidden;
+  backface-visibility: hidden;
+  -webkit-perspective: 1000px;
+  perspective: 1000px;
+}
+
+.carousel-item.active,
+.carousel-item-next,
+.carousel-item-prev {
+  display: block;
+}
+
+.carousel-item-next,
+.carousel-item-prev {
+  position: absolute;
+  top: 0;
+}
+
+.carousel-item-next.carousel-item-left,
+.carousel-item-prev.carousel-item-right {
+  -webkit-transform: translateX(0);
+  transform: translateX(0);
+}
+
+@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) {
+  .carousel-item-next.carousel-item-left,
+  .carousel-item-prev.carousel-item-right {
+    -webkit-transform: translate3d(0, 0, 0);
+    transform: translate3d(0, 0, 0);
+  }
+}
+
+.carousel-item-next,
+.active.carousel-item-right {
+  -webkit-transform: translateX(100%);
+  transform: translateX(100%);
+}
+
+@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) {
+  .carousel-item-next,
+  .active.carousel-item-right {
+    -webkit-transform: translate3d(100%, 0, 0);
+    transform: translate3d(100%, 0, 0);
+  }
+}
+
+.carousel-item-prev,
+.active.carousel-item-left {
+  -webkit-transform: translateX(-100%);
+  transform: translateX(-100%);
+}
+
+@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) {
+  .carousel-item-prev,
+  .active.carousel-item-left {
+    -webkit-transform: translate3d(-100%, 0, 0);
+    transform: translate3d(-100%, 0, 0);
+  }
+}
+
+.carousel-control-prev,
+.carousel-control-next {
+  position: absolute;
+  top: 0;
+  bottom: 0;
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: center;
+  -ms-flex-align: center;
+  align-items: center;
+  -webkit-box-pack: center;
+  -ms-flex-pack: center;
+  justify-content: center;
+  width: 15%;
+  color: #fff;
+  text-align: center;
+  opacity: 0.5;
+}
+
+.carousel-control-prev:hover, .carousel-control-prev:focus,
+.carousel-control-next:hover,
+.carousel-control-next:focus {
+  color: #fff;
+  text-decoration: none;
+  outline: 0;
+  opacity: .9;
+}
+
+.carousel-control-prev {
+  left: 0;
+}
+
+.carousel-control-next {
+  right: 0;
+}
+
+.carousel-control-prev-icon,
+.carousel-control-next-icon {
+  display: inline-block;
+  width: 20px;
+  height: 20px;
+  background: transparent no-repeat center center;
+  background-size: 100% 100%;
+}
+
+.carousel-control-prev-icon {
+  background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M5.25 0l-4 4 4 4 1.5-1.5-2.5-2.5 2.5-2.5-1.5-1.5z'/%3E%3C/svg%3E");
+}
+
+.carousel-control-next-icon {
+  background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M2.75 0l-1.5 1.5 2.5 2.5-2.5 2.5 1.5 1.5 4-4-4-4z'/%3E%3C/svg%3E");
+}
+
+.carousel-indicators {
+  position: absolute;
+  right: 0;
+  bottom: 10px;
+  left: 0;
+  z-index: 15;
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-pack: center;
+  -ms-flex-pack: center;
+  justify-content: center;
+  padding-left: 0;
+  margin-right: 15%;
+  margin-left: 15%;
+  list-style: none;
+}
+
+.carousel-indicators li {
+  position: relative;
+  -webkit-box-flex: 0;
+  -ms-flex: 0 1 auto;
+  flex: 0 1 auto;
+  width: 30px;
+  height: 3px;
+  margin-right: 3px;
+  margin-left: 3px;
+  text-indent: -999px;
+  background-color: rgba(255, 255, 255, 0.5);
+}
+
+.carousel-indicators li::before {
+  position: absolute;
+  top: -10px;
+  left: 0;
+  display: inline-block;
+  width: 100%;
+  height: 10px;
+  content: "";
+}
+
+.carousel-indicators li::after {
+  position: absolute;
+  bottom: -10px;
+  left: 0;
+  display: inline-block;
+  width: 100%;
+  height: 10px;
+  content: "";
+}
+
+.carousel-indicators .active {
+  background-color: #fff;
+}
+
+.carousel-caption {
+  position: absolute;
+  right: 15%;
+  bottom: 20px;
+  left: 15%;
+  z-index: 10;
+  padding-top: 20px;
+  padding-bottom: 20px;
+  color: #fff;
+  text-align: center;
+}
+
+.align-baseline {
+  vertical-align: baseline !important;
+}
+
+.align-top {
+  vertical-align: top !important;
+}
+
+.align-middle {
+  vertical-align: middle !important;
+}
+
+.align-bottom {
+  vertical-align: bottom !important;
+}
+
+.align-text-bottom {
+  vertical-align: text-bottom !important;
+}
+
+.align-text-top {
+  vertical-align: text-top !important;
+}
+
+.bg-primary {
+  background-color: #007bff !important;
+}
+
+a.bg-primary:hover, a.bg-primary:focus,
+button.bg-primary:hover,
+button.bg-primary:focus {
+  background-color: #0062cc !important;
+}
+
+.bg-secondary {
+  background-color: #6c757d !important;
+}
+
+a.bg-secondary:hover, a.bg-secondary:focus,
+button.bg-secondary:hover,
+button.bg-secondary:focus {
+  background-color: #545b62 !important;
+}
+
+.bg-success {
+  background-color: #28a745 !important;
+}
+
+a.bg-success:hover, a.bg-success:focus,
+button.bg-success:hover,
+button.bg-success:focus {
+  background-color: #1e7e34 !important;
+}
+
+.bg-info {
+  background-color: #17a2b8 !important;
+}
+
+a.bg-info:hover, a.bg-info:focus,
+button.bg-info:hover,
+button.bg-info:focus {
+  background-color: #117a8b !important;
+}
+
+.bg-warning {
+  background-color: #ffc107 !important;
+}
+
+a.bg-warning:hover, a.bg-warning:focus,
+button.bg-warning:hover,
+button.bg-warning:focus {
+  background-color: #d39e00 !important;
+}
+
+.bg-danger {
+  background-color: #dc3545 !important;
+}
+
+a.bg-danger:hover, a.bg-danger:focus,
+button.bg-danger:hover,
+button.bg-danger:focus {
+  background-color: #bd2130 !important;
+}
+
+.bg-light {
+  background-color: #f8f9fa !important;
+}
+
+a.bg-light:hover, a.bg-light:focus,
+button.bg-light:hover,
+button.bg-light:focus {
+  background-color: #dae0e5 !important;
+}
+
+.bg-dark {
+  background-color: #343a40 !important;
+}
+
+a.bg-dark:hover, a.bg-dark:focus,
+button.bg-dark:hover,
+button.bg-dark:focus {
+  background-color: #1d2124 !important;
+}
+
+.bg-white {
+  background-color: #fff !important;
+}
+
+.bg-transparent {
+  background-color: transparent !important;
+}
+
+.border {
+  border: 1px solid #dee2e6 !important;
+}
+
+.border-top {
+  border-top: 1px solid #dee2e6 !important;
+}
+
+.border-right {
+  border-right: 1px solid #dee2e6 !important;
+}
+
+.border-bottom {
+  border-bottom: 1px solid #dee2e6 !important;
+}
+
+.border-left {
+  border-left: 1px solid #dee2e6 !important;
+}
+
+.border-0 {
+  border: 0 !important;
+}
+
+.border-top-0 {
+  border-top: 0 !important;
+}
+
+.border-right-0 {
+  border-right: 0 !important;
+}
+
+.border-bottom-0 {
+  border-bottom: 0 !important;
+}
+
+.border-left-0 {
+  border-left: 0 !important;
+}
+
+.border-primary {
+  border-color: #007bff !important;
+}
+
+.border-secondary {
+  border-color: #6c757d !important;
+}
+
+.border-success {
+  border-color: #28a745 !important;
+}
+
+.border-info {
+  border-color: #17a2b8 !important;
+}
+
+.border-warning {
+  border-color: #ffc107 !important;
+}
+
+.border-danger {
+  border-color: #dc3545 !important;
+}
+
+.border-light {
+  border-color: #f8f9fa !important;
+}
+
+.border-dark {
+  border-color: #343a40 !important;
+}
+
+.border-white {
+  border-color: #fff !important;
+}
+
+.rounded {
+  border-radius: 0.25rem !important;
+}
+
+.rounded-top {
+  border-top-left-radius: 0.25rem !important;
+  border-top-right-radius: 0.25rem !important;
+}
+
+.rounded-right {
+  border-top-right-radius: 0.25rem !important;
+  border-bottom-right-radius: 0.25rem !important;
+}
+
+.rounded-bottom {
+  border-bottom-right-radius: 0.25rem !important;
+  border-bottom-left-radius: 0.25rem !important;
+}
+
+.rounded-left {
+  border-top-left-radius: 0.25rem !important;
+  border-bottom-left-radius: 0.25rem !important;
+}
+
+.rounded-circle {
+  border-radius: 50% !important;
+}
+
+.rounded-0 {
+  border-radius: 0 !important;
+}
+
+.clearfix::after {
+  display: block;
+  clear: both;
+  content: "";
+}
+
+.d-none {
+  display: none !important;
+}
+
+.d-inline {
+  display: inline !important;
+}
+
+.d-inline-block {
+  display: inline-block !important;
+}
+
+.d-block {
+  display: block !important;
+}
+
+.d-table {
+  display: table !important;
+}
+
+.d-table-row {
+  display: table-row !important;
+}
+
+.d-table-cell {
+  display: table-cell !important;
+}
+
+.d-flex {
+  display: -webkit-box !important;
+  display: -ms-flexbox !important;
+  display: flex !important;
+}
+
+.d-inline-flex {
+  display: -webkit-inline-box !important;
+  display: -ms-inline-flexbox !important;
+  display: inline-flex !important;
+}
+
+@media (min-width: 576px) {
+  .d-sm-none {
+    display: none !important;
+  }
+  .d-sm-inline {
+    display: inline !important;
+  }
+  .d-sm-inline-block {
+    display: inline-block !important;
+  }
+  .d-sm-block {
+    display: block !important;
+  }
+  .d-sm-table {
+    display: table !important;
+  }
+  .d-sm-table-row {
+    display: table-row !important;
+  }
+  .d-sm-table-cell {
+    display: table-cell !important;
+  }
+  .d-sm-flex {
+    display: -webkit-box !important;
+    display: -ms-flexbox !important;
+    display: flex !important;
+  }
+  .d-sm-inline-flex {
+    display: -webkit-inline-box !important;
+    display: -ms-inline-flexbox !important;
+    display: inline-flex !important;
+  }
+}
+
+@media (min-width: 768px) {
+  .d-md-none {
+    display: none !important;
+  }
+  .d-md-inline {
+    display: inline !important;
+  }
+  .d-md-inline-block {
+    display: inline-block !important;
+  }
+  .d-md-block {
+    display: block !important;
+  }
+  .d-md-table {
+    display: table !important;
+  }
+  .d-md-table-row {
+    display: table-row !important;
+  }
+  .d-md-table-cell {
+    display: table-cell !important;
+  }
+  .d-md-flex {
+    display: -webkit-box !important;
+    display: -ms-flexbox !important;
+    display: flex !important;
+  }
+  .d-md-inline-flex {
+    display: -webkit-inline-box !important;
+    display: -ms-inline-flexbox !important;
+    display: inline-flex !important;
+  }
+}
+
+@media (min-width: 992px) {
+  .d-lg-none {
+    display: none !important;
+  }
+  .d-lg-inline {
+    display: inline !important;
+  }
+  .d-lg-inline-block {
+    display: inline-block !important;
+  }
+  .d-lg-block {
+    display: block !important;
+  }
+  .d-lg-table {
+    display: table !important;
+  }
+  .d-lg-table-row {
+    display: table-row !important;
+  }
+  .d-lg-table-cell {
+    display: table-cell !important;
+  }
+  .d-lg-flex {
+    display: -webkit-box !important;
+    display: -ms-flexbox !important;
+    display: flex !important;
+  }
+  .d-lg-inline-flex {
+    display: -webkit-inline-box !important;
+    display: -ms-inline-flexbox !important;
+    display: inline-flex !important;
+  }
+}
+
+@media (min-width: 1200px) {
+  .d-xl-none {
+    display: none !important;
+  }
+  .d-xl-inline {
+    display: inline !important;
+  }
+  .d-xl-inline-block {
+    display: inline-block !important;
+  }
+  .d-xl-block {
+    display: block !important;
+  }
+  .d-xl-table {
+    display: table !important;
+  }
+  .d-xl-table-row {
+    display: table-row !important;
+  }
+  .d-xl-table-cell {
+    display: table-cell !important;
+  }
+  .d-xl-flex {
+    display: -webkit-box !important;
+    display: -ms-flexbox !important;
+    display: flex !important;
+  }
+  .d-xl-inline-flex {
+    display: -webkit-inline-box !important;
+    display: -ms-inline-flexbox !important;
+    display: inline-flex !important;
+  }
+}
+
+@media print {
+  .d-print-none {
+    display: none !important;
+  }
+  .d-print-inline {
+    display: inline !important;
+  }
+  .d-print-inline-block {
+    display: inline-block !important;
+  }
+  .d-print-block {
+    display: block !important;
+  }
+  .d-print-table {
+    display: table !important;
+  }
+  .d-print-table-row {
+    display: table-row !important;
+  }
+  .d-print-table-cell {
+    display: table-cell !important;
+  }
+  .d-print-flex {
+    display: -webkit-box !important;
+    display: -ms-flexbox !important;
+    display: flex !important;
+  }
+  .d-print-inline-flex {
+    display: -webkit-inline-box !important;
+    display: -ms-inline-flexbox !important;
+    display: inline-flex !important;
+  }
+}
+
+.embed-responsive {
+  position: relative;
+  display: block;
+  width: 100%;
+  padding: 0;
+  overflow: hidden;
+}
+
+.embed-responsive::before {
+  display: block;
+  content: "";
+}
+
+.embed-responsive .embed-responsive-item,
+.embed-responsive iframe,
+.embed-responsive embed,
+.embed-responsive object,
+.embed-responsive video {
+  position: absolute;
+  top: 0;
+  bottom: 0;
+  left: 0;
+  width: 100%;
+  height: 100%;
+  border: 0;
+}
+
+.embed-responsive-21by9::before {
+  padding-top: 42.857143%;
+}
+
+.embed-responsive-16by9::before {
+  padding-top: 56.25%;
+}
+
+.embed-responsive-4by3::before {
+  padding-top: 75%;
+}
+
+.embed-responsive-1by1::before {
+  padding-top: 100%;
+}
+
+.flex-row {
+  -webkit-box-orient: horizontal !important;
+  -webkit-box-direction: normal !important;
+  -ms-flex-direction: row !important;
+  flex-direction: row !important;
+}
+
+.flex-column {
+  -webkit-box-orient: vertical !important;
+  -webkit-box-direction: normal !important;
+  -ms-flex-direction: column !important;
+  flex-direction: column !important;
+}
+
+.flex-row-reverse {
+  -webkit-box-orient: horizontal !important;
+  -webkit-box-direction: reverse !important;
+  -ms-flex-direction: row-reverse !important;
+  flex-direction: row-reverse !important;
+}
+
+.flex-column-reverse {
+  -webkit-box-orient: vertical !important;
+  -webkit-box-direction: reverse !important;
+  -ms-flex-direction: column-reverse !important;
+  flex-direction: column-reverse !important;
+}
+
+.flex-wrap {
+  -ms-flex-wrap: wrap !important;
+  flex-wrap: wrap !important;
+}
+
+.flex-nowrap {
+  -ms-flex-wrap: nowrap !important;
+  flex-wrap: nowrap !important;
+}
+
+.flex-wrap-reverse {
+  -ms-flex-wrap: wrap-reverse !important;
+  flex-wrap: wrap-reverse !important;
+}
+
+.justify-content-start {
+  -webkit-box-pack: start !important;
+  -ms-flex-pack: start !important;
+  justify-content: flex-start !important;
+}
+
+.justify-content-end {
+  -webkit-box-pack: end !important;
+  -ms-flex-pack: end !important;
+  justify-content: flex-end !important;
+}
+
+.justify-content-center {
+  -webkit-box-pack: center !important;
+  -ms-flex-pack: center !important;
+  justify-content: center !important;
+}
+
+.justify-content-between {
+  -webkit-box-pack: justify !important;
+  -ms-flex-pack: justify !important;
+  justify-content: space-between !important;
+}
+
+.justify-content-around {
+  -ms-flex-pack: distribute !important;
+  justify-content: space-around !important;
+}
+
+.align-items-start {
+  -webkit-box-align: start !important;
+  -ms-flex-align: start !important;
+  align-items: flex-start !important;
+}
+
+.align-items-end {
+  -webkit-box-align: end !important;
+  -ms-flex-align: end !important;
+  align-items: flex-end !important;
+}
+
+.align-items-center {
+  -webkit-box-align: center !important;
+  -ms-flex-align: center !important;
+  align-items: center !important;
+}
+
+.align-items-baseline {
+  -webkit-box-align: baseline !important;
+  -ms-flex-align: baseline !important;
+  align-items: baseline !important;
+}
+
+.align-items-stretch {
+  -webkit-box-align: stretch !important;
+  -ms-flex-align: stretch !important;
+  align-items: stretch !important;
+}
+
+.align-content-start {
+  -ms-flex-line-pack: start !important;
+  align-content: flex-start !important;
+}
+
+.align-content-end {
+  -ms-flex-line-pack: end !important;
+  align-content: flex-end !important;
+}
+
+.align-content-center {
+  -ms-flex-line-pack: center !important;
+  align-content: center !important;
+}
+
+.align-content-between {
+  -ms-flex-line-pack: justify !important;
+  align-content: space-between !important;
+}
+
+.align-content-around {
+  -ms-flex-line-pack: distribute !important;
+  align-content: space-around !important;
+}
+
+.align-content-stretch {
+  -ms-flex-line-pack: stretch !important;
+  align-content: stretch !important;
+}
+
+.align-self-auto {
+  -ms-flex-item-align: auto !important;
+  align-self: auto !important;
+}
+
+.align-self-start {
+  -ms-flex-item-align: start !important;
+  align-self: flex-start !important;
+}
+
+.align-self-end {
+  -ms-flex-item-align: end !important;
+  align-self: flex-end !important;
+}
+
+.align-self-center {
+  -ms-flex-item-align: center !important;
+  align-self: center !important;
+}
+
+.align-self-baseline {
+  -ms-flex-item-align: baseline !important;
+  align-self: baseline !important;
+}
+
+.align-self-stretch {
+  -ms-flex-item-align: stretch !important;
+  align-self: stretch !important;
+}
+
+@media (min-width: 576px) {
+  .flex-sm-row {
+    -webkit-box-orient: horizontal !important;
+    -webkit-box-direction: normal !important;
+    -ms-flex-direction: row !important;
+    flex-direction: row !important;
+  }
+  .flex-sm-column {
+    -webkit-box-orient: vertical !important;
+    -webkit-box-direction: normal !important;
+    -ms-flex-direction: column !important;
+    flex-direction: column !important;
+  }
+  .flex-sm-row-reverse {
+    -webkit-box-orient: horizontal !important;
+    -webkit-box-direction: reverse !important;
+    -ms-flex-direction: row-reverse !important;
+    flex-direction: row-reverse !important;
+  }
+  .flex-sm-column-reverse {
+    -webkit-box-orient: vertical !important;
+    -webkit-box-direction: reverse !important;
+    -ms-flex-direction: column-reverse !important;
+    flex-direction: column-reverse !important;
+  }
+  .flex-sm-wrap {
+    -ms-flex-wrap: wrap !important;
+    flex-wrap: wrap !important;
+  }
+  .flex-sm-nowrap {
+    -ms-flex-wrap: nowrap !important;
+    flex-wrap: nowrap !important;
+  }
+  .flex-sm-wrap-reverse {
+    -ms-flex-wrap: wrap-reverse !important;
+    flex-wrap: wrap-reverse !important;
+  }
+  .justify-content-sm-start {
+    -webkit-box-pack: start !important;
+    -ms-flex-pack: start !important;
+    justify-content: flex-start !important;
+  }
+  .justify-content-sm-end {
+    -webkit-box-pack: end !important;
+    -ms-flex-pack: end !important;
+    justify-content: flex-end !important;
+  }
+  .justify-content-sm-center {
+    -webkit-box-pack: center !important;
+    -ms-flex-pack: center !important;
+    justify-content: center !important;
+  }
+  .justify-content-sm-between {
+    -webkit-box-pack: justify !important;
+    -ms-flex-pack: justify !important;
+    justify-content: space-between !important;
+  }
+  .justify-content-sm-around {
+    -ms-flex-pack: distribute !important;
+    justify-content: space-around !important;
+  }
+  .align-items-sm-start {
+    -webkit-box-align: start !important;
+    -ms-flex-align: start !important;
+    align-items: flex-start !important;
+  }
+  .align-items-sm-end {
+    -webkit-box-align: end !important;
+    -ms-flex-align: end !important;
+    align-items: flex-end !important;
+  }
+  .align-items-sm-center {
+    -webkit-box-align: center !important;
+    -ms-flex-align: center !important;
+    align-items: center !important;
+  }
+  .align-items-sm-baseline {
+    -webkit-box-align: baseline !important;
+    -ms-flex-align: baseline !important;
+    align-items: baseline !important;
+  }
+  .align-items-sm-stretch {
+    -webkit-box-align: stretch !important;
+    -ms-flex-align: stretch !important;
+    align-items: stretch !important;
+  }
+  .align-content-sm-start {
+    -ms-flex-line-pack: start !important;
+    align-content: flex-start !important;
+  }
+  .align-content-sm-end {
+    -ms-flex-line-pack: end !important;
+    align-content: flex-end !important;
+  }
+  .align-content-sm-center {
+    -ms-flex-line-pack: center !important;
+    align-content: center !important;
+  }
+  .align-content-sm-between {
+    -ms-flex-line-pack: justify !important;
+    align-content: space-between !important;
+  }
+  .align-content-sm-around {
+    -ms-flex-line-pack: distribute !important;
+    align-content: space-around !important;
+  }
+  .align-content-sm-stretch {
+    -ms-flex-line-pack: stretch !important;
+    align-content: stretch !important;
+  }
+  .align-self-sm-auto {
+    -ms-flex-item-align: auto !important;
+    align-self: auto !important;
+  }
+  .align-self-sm-start {
+    -ms-flex-item-align: start !important;
+    align-self: flex-start !important;
+  }
+  .align-self-sm-end {
+    -ms-flex-item-align: end !important;
+    align-self: flex-end !important;
+  }
+  .align-self-sm-center {
+    -ms-flex-item-align: center !important;
+    align-self: center !important;
+  }
+  .align-self-sm-baseline {
+    -ms-flex-item-align: baseline !important;
+    align-self: baseline !important;
+  }
+  .align-self-sm-stretch {
+    -ms-flex-item-align: stretch !important;
+    align-self: stretch !important;
+  }
+}
+
+@media (min-width: 768px) {
+  .flex-md-row {
+    -webkit-box-orient: horizontal !important;
+    -webkit-box-direction: normal !important;
+    -ms-flex-direction: row !important;
+    flex-direction: row !important;
+  }
+  .flex-md-column {
+    -webkit-box-orient: vertical !important;
+    -webkit-box-direction: normal !important;
+    -ms-flex-direction: column !important;
+    flex-direction: column !important;
+  }
+  .flex-md-row-reverse {
+    -webkit-box-orient: horizontal !important;
+    -webkit-box-direction: reverse !important;
+    -ms-flex-direction: row-reverse !important;
+    flex-direction: row-reverse !important;
+  }
+  .flex-md-column-reverse {
+    -webkit-box-orient: vertical !important;
+    -webkit-box-direction: reverse !important;
+    -ms-flex-direction: column-reverse !important;
+    flex-direction: column-reverse !important;
+  }
+  .flex-md-wrap {
+    -ms-flex-wrap: wrap !important;
+    flex-wrap: wrap !important;
+  }
+  .flex-md-nowrap {
+    -ms-flex-wrap: nowrap !important;
+    flex-wrap: nowrap !important;
+  }
+  .flex-md-wrap-reverse {
+    -ms-flex-wrap: wrap-reverse !important;
+    flex-wrap: wrap-reverse !important;
+  }
+  .justify-content-md-start {
+    -webkit-box-pack: start !important;
+    -ms-flex-pack: start !important;
+    justify-content: flex-start !important;
+  }
+  .justify-content-md-end {
+    -webkit-box-pack: end !important;
+    -ms-flex-pack: end !important;
+    justify-content: flex-end !important;
+  }
+  .justify-content-md-center {
+    -webkit-box-pack: center !important;
+    -ms-flex-pack: center !important;
+    justify-content: center !important;
+  }
+  .justify-content-md-between {
+    -webkit-box-pack: justify !important;
+    -ms-flex-pack: justify !important;
+    justify-content: space-between !important;
+  }
+  .justify-content-md-around {
+    -ms-flex-pack: distribute !important;
+    justify-content: space-around !important;
+  }
+  .align-items-md-start {
+    -webkit-box-align: start !important;
+    -ms-flex-align: start !important;
+    align-items: flex-start !important;
+  }
+  .align-items-md-end {
+    -webkit-box-align: end !important;
+    -ms-flex-align: end !important;
+    align-items: flex-end !important;
+  }
+  .align-items-md-center {
+    -webkit-box-align: center !important;
+    -ms-flex-align: center !important;
+    align-items: center !important;
+  }
+  .align-items-md-baseline {
+    -webkit-box-align: baseline !important;
+    -ms-flex-align: baseline !important;
+    align-items: baseline !important;
+  }
+  .align-items-md-stretch {
+    -webkit-box-align: stretch !important;
+    -ms-flex-align: stretch !important;
+    align-items: stretch !important;
+  }
+  .align-content-md-start {
+    -ms-flex-line-pack: start !important;
+    align-content: flex-start !important;
+  }
+  .align-content-md-end {
+    -ms-flex-line-pack: end !important;
+    align-content: flex-end !important;
+  }
+  .align-content-md-center {
+    -ms-flex-line-pack: center !important;
+    align-content: center !important;
+  }
+  .align-content-md-between {
+    -ms-flex-line-pack: justify !important;
+    align-content: space-between !important;
+  }
+  .align-content-md-around {
+    -ms-flex-line-pack: distribute !important;
+    align-content: space-around !important;
+  }
+  .align-content-md-stretch {
+    -ms-flex-line-pack: stretch !important;
+    align-content: stretch !important;
+  }
+  .align-self-md-auto {
+    -ms-flex-item-align: auto !important;
+    align-self: auto !important;
+  }
+  .align-self-md-start {
+    -ms-flex-item-align: start !important;
+    align-self: flex-start !important;
+  }
+  .align-self-md-end {
+    -ms-flex-item-align: end !important;
+    align-self: flex-end !important;
+  }
+  .align-self-md-center {
+    -ms-flex-item-align: center !important;
+    align-self: center !important;
+  }
+  .align-self-md-baseline {
+    -ms-flex-item-align: baseline !important;
+    align-self: baseline !important;
+  }
+  .align-self-md-stretch {
+    -ms-flex-item-align: stretch !important;
+    align-self: stretch !important;
+  }
+}
+
+@media (min-width: 992px) {
+  .flex-lg-row {
+    -webkit-box-orient: horizontal !important;
+    -webkit-box-direction: normal !important;
+    -ms-flex-direction: row !important;
+    flex-direction: row !important;
+  }
+  .flex-lg-column {
+    -webkit-box-orient: vertical !important;
+    -webkit-box-direction: normal !important;
+    -ms-flex-direction: column !important;
+    flex-direction: column !important;
+  }
+  .flex-lg-row-reverse {
+    -webkit-box-orient: horizontal !important;
+    -webkit-box-direction: reverse !important;
+    -ms-flex-direction: row-reverse !important;
+    flex-direction: row-reverse !important;
+  }
+  .flex-lg-column-reverse {
+    -webkit-box-orient: vertical !important;
+    -webkit-box-direction: reverse !important;
+    -ms-flex-direction: column-reverse !important;
+    flex-direction: column-reverse !important;
+  }
+  .flex-lg-wrap {
+    -ms-flex-wrap: wrap !important;
+    flex-wrap: wrap !important;
+  }
+  .flex-lg-nowrap {
+    -ms-flex-wrap: nowrap !important;
+    flex-wrap: nowrap !important;
+  }
+  .flex-lg-wrap-reverse {
+    -ms-flex-wrap: wrap-reverse !important;
+    flex-wrap: wrap-reverse !important;
+  }
+  .justify-content-lg-start {
+    -webkit-box-pack: start !important;
+    -ms-flex-pack: start !important;
+    justify-content: flex-start !important;
+  }
+  .justify-content-lg-end {
+    -webkit-box-pack: end !important;
+    -ms-flex-pack: end !important;
+    justify-content: flex-end !important;
+  }
+  .justify-content-lg-center {
+    -webkit-box-pack: center !important;
+    -ms-flex-pack: center !important;
+    justify-content: center !important;
+  }
+  .justify-content-lg-between {
+    -webkit-box-pack: justify !important;
+    -ms-flex-pack: justify !important;
+    justify-content: space-between !important;
+  }
+  .justify-content-lg-around {
+    -ms-flex-pack: distribute !important;
+    justify-content: space-around !important;
+  }
+  .align-items-lg-start {
+    -webkit-box-align: start !important;
+    -ms-flex-align: start !important;
+    align-items: flex-start !important;
+  }
+  .align-items-lg-end {
+    -webkit-box-align: end !important;
+    -ms-flex-align: end !important;
+    align-items: flex-end !important;
+  }
+  .align-items-lg-center {
+    -webkit-box-align: center !important;
+    -ms-flex-align: center !important;
+    align-items: center !important;
+  }
+  .align-items-lg-baseline {
+    -webkit-box-align: baseline !important;
+    -ms-flex-align: baseline !important;
+    align-items: baseline !important;
+  }
+  .align-items-lg-stretch {
+    -webkit-box-align: stretch !important;
+    -ms-flex-align: stretch !important;
+    align-items: stretch !important;
+  }
+  .align-content-lg-start {
+    -ms-flex-line-pack: start !important;
+    align-content: flex-start !important;
+  }
+  .align-content-lg-end {
+    -ms-flex-line-pack: end !important;
+    align-content: flex-end !important;
+  }
+  .align-content-lg-center {
+    -ms-flex-line-pack: center !important;
+    align-content: center !important;
+  }
+  .align-content-lg-between {
+    -ms-flex-line-pack: justify !important;
+    align-content: space-between !important;
+  }
+  .align-content-lg-around {
+    -ms-flex-line-pack: distribute !important;
+    align-content: space-around !important;
+  }
+  .align-content-lg-stretch {
+    -ms-flex-line-pack: stretch !important;
+    align-content: stretch !important;
+  }
+  .align-self-lg-auto {
+    -ms-flex-item-align: auto !important;
+    align-self: auto !important;
+  }
+  .align-self-lg-start {
+    -ms-flex-item-align: start !important;
+    align-self: flex-start !important;
+  }
+  .align-self-lg-end {
+    -ms-flex-item-align: end !important;
+    align-self: flex-end !important;
+  }
+  .align-self-lg-center {
+    -ms-flex-item-align: center !important;
+    align-self: center !important;
+  }
+  .align-self-lg-baseline {
+    -ms-flex-item-align: baseline !important;
+    align-self: baseline !important;
+  }
+  .align-self-lg-stretch {
+    -ms-flex-item-align: stretch !important;
+    align-self: stretch !important;
+  }
+}
+
+@media (min-width: 1200px) {
+  .flex-xl-row {
+    -webkit-box-orient: horizontal !important;
+    -webkit-box-direction: normal !important;
+    -ms-flex-direction: row !important;
+    flex-direction: row !important;
+  }
+  .flex-xl-column {
+    -webkit-box-orient: vertical !important;
+    -webkit-box-direction: normal !important;
+    -ms-flex-direction: column !important;
+    flex-direction: column !important;
+  }
+  .flex-xl-row-reverse {
+    -webkit-box-orient: horizontal !important;
+    -webkit-box-direction: reverse !important;
+    -ms-flex-direction: row-reverse !important;
+    flex-direction: row-reverse !important;
+  }
+  .flex-xl-column-reverse {
+    -webkit-box-orient: vertical !important;
+    -webkit-box-direction: reverse !important;
+    -ms-flex-direction: column-reverse !important;
+    flex-direction: column-reverse !important;
+  }
+  .flex-xl-wrap {
+    -ms-flex-wrap: wrap !important;
+    flex-wrap: wrap !important;
+  }
+  .flex-xl-nowrap {
+    -ms-flex-wrap: nowrap !important;
+    flex-wrap: nowrap !important;
+  }
+  .flex-xl-wrap-reverse {
+    -ms-flex-wrap: wrap-reverse !important;
+    flex-wrap: wrap-reverse !important;
+  }
+  .justify-content-xl-start {
+    -webkit-box-pack: start !important;
+    -ms-flex-pack: start !important;
+    justify-content: flex-start !important;
+  }
+  .justify-content-xl-end {
+    -webkit-box-pack: end !important;
+    -ms-flex-pack: end !important;
+    justify-content: flex-end !important;
+  }
+  .justify-content-xl-center {
+    -webkit-box-pack: center !important;
+    -ms-flex-pack: center !important;
+    justify-content: center !important;
+  }
+  .justify-content-xl-between {
+    -webkit-box-pack: justify !important;
+    -ms-flex-pack: justify !important;
+    justify-content: space-between !important;
+  }
+  .justify-content-xl-around {
+    -ms-flex-pack: distribute !important;
+    justify-content: space-around !important;
+  }
+  .align-items-xl-start {
+    -webkit-box-align: start !important;
+    -ms-flex-align: start !important;
+    align-items: flex-start !important;
+  }
+  .align-items-xl-end {
+    -webkit-box-align: end !important;
+    -ms-flex-align: end !important;
+    align-items: flex-end !important;
+  }
+  .align-items-xl-center {
+    -webkit-box-align: center !important;
+    -ms-flex-align: center !important;
+    align-items: center !important;
+  }
+  .align-items-xl-baseline {
+    -webkit-box-align: baseline !important;
+    -ms-flex-align: baseline !important;
+    align-items: baseline !important;
+  }
+  .align-items-xl-stretch {
+    -webkit-box-align: stretch !important;
+    -ms-flex-align: stretch !important;
+    align-items: stretch !important;
+  }
+  .align-content-xl-start {
+    -ms-flex-line-pack: start !important;
+    align-content: flex-start !important;
+  }
+  .align-content-xl-end {
+    -ms-flex-line-pack: end !important;
+    align-content: flex-end !important;
+  }
+  .align-content-xl-center {
+    -ms-flex-line-pack: center !important;
+    align-content: center !important;
+  }
+  .align-content-xl-between {
+    -ms-flex-line-pack: justify !important;
+    align-content: space-between !important;
+  }
+  .align-content-xl-around {
+    -ms-flex-line-pack: distribute !important;
+    align-content: space-around !important;
+  }
+  .align-content-xl-stretch {
+    -ms-flex-line-pack: stretch !important;
+    align-content: stretch !important;
+  }
+  .align-self-xl-auto {
+    -ms-flex-item-align: auto !important;
+    align-self: auto !important;
+  }
+  .align-self-xl-start {
+    -ms-flex-item-align: start !important;
+    align-self: flex-start !important;
+  }
+  .align-self-xl-end {
+    -ms-flex-item-align: end !important;
+    align-self: flex-end !important;
+  }
+  .align-self-xl-center {
+    -ms-flex-item-align: center !important;
+    align-self: center !important;
+  }
+  .align-self-xl-baseline {
+    -ms-flex-item-align: baseline !important;
+    align-self: baseline !important;
+  }
+  .align-self-xl-stretch {
+    -ms-flex-item-align: stretch !important;
+    align-self: stretch !important;
+  }
+}
+
+.float-left {
+  float: left !important;
+}
+
+.float-right {
+  float: right !important;
+}
+
+.float-none {
+  float: none !important;
+}
+
+@media (min-width: 576px) {
+  .float-sm-left {
+    float: left !important;
+  }
+  .float-sm-right {
+    float: right !important;
+  }
+  .float-sm-none {
+    float: none !important;
+  }
+}
+
+@media (min-width: 768px) {
+  .float-md-left {
+    float: left !important;
+  }
+  .float-md-right {
+    float: right !important;
+  }
+  .float-md-none {
+    float: none !important;
+  }
+}
+
+@media (min-width: 992px) {
+  .float-lg-left {
+    float: left !important;
+  }
+  .float-lg-right {
+    float: right !important;
+  }
+  .float-lg-none {
+    float: none !important;
+  }
+}
+
+@media (min-width: 1200px) {
+  .float-xl-left {
+    float: left !important;
+  }
+  .float-xl-right {
+    float: right !important;
+  }
+  .float-xl-none {
+    float: none !important;
+  }
+}
+
+.position-static {
+  position: static !important;
+}
+
+.position-relative {
+  position: relative !important;
+}
+
+.position-absolute {
+  position: absolute !important;
+}
+
+.position-fixed {
+  position: fixed !important;
+}
+
+.position-sticky {
+  position: -webkit-sticky !important;
+  position: sticky !important;
+}
+
+.fixed-top {
+  position: fixed;
+  top: 0;
+  right: 0;
+  left: 0;
+  z-index: 1030;
+}
+
+.fixed-bottom {
+  position: fixed;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: 1030;
+}
+
+@supports ((position: -webkit-sticky) or (position: sticky)) {
+  .sticky-top {
+    position: -webkit-sticky;
+    position: sticky;
+    top: 0;
+    z-index: 1020;
+  }
+}
+
+.sr-only {
+  position: absolute;
+  width: 1px;
+  height: 1px;
+  padding: 0;
+  overflow: hidden;
+  clip: rect(0, 0, 0, 0);
+  white-space: nowrap;
+  -webkit-clip-path: inset(50%);
+  clip-path: inset(50%);
+  border: 0;
+}
+
+.sr-only-focusable:active, .sr-only-focusable:focus {
+  position: static;
+  width: auto;
+  height: auto;
+  overflow: visible;
+  clip: auto;
+  white-space: normal;
+  -webkit-clip-path: none;
+  clip-path: none;
+}
+
+.w-25 {
+  width: 25% !important;
+}
+
+.w-50 {
+  width: 50% !important;
+}
+
+.w-75 {
+  width: 75% !important;
+}
+
+.w-100 {
+  width: 100% !important;
+}
+
+.h-25 {
+  height: 25% !important;
+}
+
+.h-50 {
+  height: 50% !important;
+}
+
+.h-75 {
+  height: 75% !important;
+}
+
+.h-100 {
+  height: 100% !important;
+}
+
+.mw-100 {
+  max-width: 100% !important;
+}
+
+.mh-100 {
+  max-height: 100% !important;
+}
+
+.m-0 {
+  margin: 0 !important;
+}
+
+.mt-0,
+.my-0 {
+  margin-top: 0 !important;
+}
+
+.mr-0,
+.mx-0 {
+  margin-right: 0 !important;
+}
+
+.mb-0,
+.my-0 {
+  margin-bottom: 0 !important;
+}
+
+.ml-0,
+.mx-0 {
+  margin-left: 0 !important;
+}
+
+.m-1 {
+  margin: 0.25rem !important;
+}
+
+.mt-1,
+.my-1 {
+  margin-top: 0.25rem !important;
+}
+
+.mr-1,
+.mx-1 {
+  margin-right: 0.25rem !important;
+}
+
+.mb-1,
+.my-1 {
+  margin-bottom: 0.25rem !important;
+}
+
+.ml-1,
+.mx-1 {
+  margin-left: 0.25rem !important;
+}
+
+.m-2 {
+  margin: 0.5rem !important;
+}
+
+.mt-2,
+.my-2 {
+  margin-top: 0.5rem !important;
+}
+
+.mr-2,
+.mx-2 {
+  margin-right: 0.5rem !important;
+}
+
+.mb-2,
+.my-2 {
+  margin-bottom: 0.5rem !important;
+}
+
+.ml-2,
+.mx-2 {
+  margin-left: 0.5rem !important;
+}
+
+.m-3 {
+  margin: 1rem !important;
+}
+
+.mt-3,
+.my-3 {
+  margin-top: 1rem !important;
+}
+
+.mr-3,
+.mx-3 {
+  margin-right: 1rem !important;
+}
+
+.mb-3,
+.my-3 {
+  margin-bottom: 1rem !important;
+}
+
+.ml-3,
+.mx-3 {
+  margin-left: 1rem !important;
+}
+
+.m-4 {
+  margin: 1.5rem !important;
+}
+
+.mt-4,
+.my-4 {
+  margin-top: 1.5rem !important;
+}
+
+.mr-4,
+.mx-4 {
+  margin-right: 1.5rem !important;
+}
+
+.mb-4,
+.my-4 {
+  margin-bottom: 1.5rem !important;
+}
+
+.ml-4,
+.mx-4 {
+  margin-left: 1.5rem !important;
+}
+
+.m-5 {
+  margin: 3rem !important;
+}
+
+.mt-5,
+.my-5 {
+  margin-top: 3rem !important;
+}
+
+.mr-5,
+.mx-5 {
+  margin-right: 3rem !important;
+}
+
+.mb-5,
+.my-5 {
+  margin-bottom: 3rem !important;
+}
+
+.ml-5,
+.mx-5 {
+  margin-left: 3rem !important;
+}
+
+.p-0 {
+  padding: 0 !important;
+}
+
+.pt-0,
+.py-0 {
+  padding-top: 0 !important;
+}
+
+.pr-0,
+.px-0 {
+  padding-right: 0 !important;
+}
+
+.pb-0,
+.py-0 {
+  padding-bottom: 0 !important;
+}
+
+.pl-0,
+.px-0 {
+  padding-left: 0 !important;
+}
+
+.p-1 {
+  padding: 0.25rem !important;
+}
+
+.pt-1,
+.py-1 {
+  padding-top: 0.25rem !important;
+}
+
+.pr-1,
+.px-1 {
+  padding-right: 0.25rem !important;
+}
+
+.pb-1,
+.py-1 {
+  padding-bottom: 0.25rem !important;
+}
+
+.pl-1,
+.px-1 {
+  padding-left: 0.25rem !important;
+}
+
+.p-2 {
+  padding: 0.5rem !important;
+}
+
+.pt-2,
+.py-2 {
+  padding-top: 0.5rem !important;
+}
+
+.pr-2,
+.px-2 {
+  padding-right: 0.5rem !important;
+}
+
+.pb-2,
+.py-2 {
+  padding-bottom: 0.5rem !important;
+}
+
+.pl-2,
+.px-2 {
+  padding-left: 0.5rem !important;
+}
+
+.p-3 {
+  padding: 1rem !important;
+}
+
+.pt-3,
+.py-3 {
+  padding-top: 1rem !important;
+}
+
+.pr-3,
+.px-3 {
+  padding-right: 1rem !important;
+}
+
+.pb-3,
+.py-3 {
+  padding-bottom: 1rem !important;
+}
+
+.pl-3,
+.px-3 {
+  padding-left: 1rem !important;
+}
+
+.p-4 {
+  padding: 1.5rem !important;
+}
+
+.pt-4,
+.py-4 {
+  padding-top: 1.5rem !important;
+}
+
+.pr-4,
+.px-4 {
+  padding-right: 1.5rem !important;
+}
+
+.pb-4,
+.py-4 {
+  padding-bottom: 1.5rem !important;
+}
+
+.pl-4,
+.px-4 {
+  padding-left: 1.5rem !important;
+}
+
+.p-5 {
+  padding: 3rem !important;
+}
+
+.pt-5,
+.py-5 {
+  padding-top: 3rem !important;
+}
+
+.pr-5,
+.px-5 {
+  padding-right: 3rem !important;
+}
+
+.pb-5,
+.py-5 {
+  padding-bottom: 3rem !important;
+}
+
+.pl-5,
+.px-5 {
+  padding-left: 3rem !important;
+}
+
+.m-auto {
+  margin: auto !important;
+}
+
+.mt-auto,
+.my-auto {
+  margin-top: auto !important;
+}
+
+.mr-auto,
+.mx-auto {
+  margin-right: auto !important;
+}
+
+.mb-auto,
+.my-auto {
+  margin-bottom: auto !important;
+}
+
+.ml-auto,
+.mx-auto {
+  margin-left: auto !important;
+}
+
+@media (min-width: 576px) {
+  .m-sm-0 {
+    margin: 0 !important;
+  }
+  .mt-sm-0,
+  .my-sm-0 {
+    margin-top: 0 !important;
+  }
+  .mr-sm-0,
+  .mx-sm-0 {
+    margin-right: 0 !important;
+  }
+  .mb-sm-0,
+  .my-sm-0 {
+    margin-bottom: 0 !important;
+  }
+  .ml-sm-0,
+  .mx-sm-0 {
+    margin-left: 0 !important;
+  }
+  .m-sm-1 {
+    margin: 0.25rem !important;
+  }
+  .mt-sm-1,
+  .my-sm-1 {
+    margin-top: 0.25rem !important;
+  }
+  .mr-sm-1,
+  .mx-sm-1 {
+    margin-right: 0.25rem !important;
+  }
+  .mb-sm-1,
+  .my-sm-1 {
+    margin-bottom: 0.25rem !important;
+  }
+  .ml-sm-1,
+  .mx-sm-1 {
+    margin-left: 0.25rem !important;
+  }
+  .m-sm-2 {
+    margin: 0.5rem !important;
+  }
+  .mt-sm-2,
+  .my-sm-2 {
+    margin-top: 0.5rem !important;
+  }
+  .mr-sm-2,
+  .mx-sm-2 {
+    margin-right: 0.5rem !important;
+  }
+  .mb-sm-2,
+  .my-sm-2 {
+    margin-bottom: 0.5rem !important;
+  }
+  .ml-sm-2,
+  .mx-sm-2 {
+    margin-left: 0.5rem !important;
+  }
+  .m-sm-3 {
+    margin: 1rem !important;
+  }
+  .mt-sm-3,
+  .my-sm-3 {
+    margin-top: 1rem !important;
+  }
+  .mr-sm-3,
+  .mx-sm-3 {
+    margin-right: 1rem !important;
+  }
+  .mb-sm-3,
+  .my-sm-3 {
+    margin-bottom: 1rem !important;
+  }
+  .ml-sm-3,
+  .mx-sm-3 {
+    margin-left: 1rem !important;
+  }
+  .m-sm-4 {
+    margin: 1.5rem !important;
+  }
+  .mt-sm-4,
+  .my-sm-4 {
+    margin-top: 1.5rem !important;
+  }
+  .mr-sm-4,
+  .mx-sm-4 {
+    margin-right: 1.5rem !important;
+  }
+  .mb-sm-4,
+  .my-sm-4 {
+    margin-bottom: 1.5rem !important;
+  }
+  .ml-sm-4,
+  .mx-sm-4 {
+    margin-left: 1.5rem !important;
+  }
+  .m-sm-5 {
+    margin: 3rem !important;
+  }
+  .mt-sm-5,
+  .my-sm-5 {
+    margin-top: 3rem !important;
+  }
+  .mr-sm-5,
+  .mx-sm-5 {
+    margin-right: 3rem !important;
+  }
+  .mb-sm-5,
+  .my-sm-5 {
+    margin-bottom: 3rem !important;
+  }
+  .ml-sm-5,
+  .mx-sm-5 {
+    margin-left: 3rem !important;
+  }
+  .p-sm-0 {
+    padding: 0 !important;
+  }
+  .pt-sm-0,
+  .py-sm-0 {
+    padding-top: 0 !important;
+  }
+  .pr-sm-0,
+  .px-sm-0 {
+    padding-right: 0 !important;
+  }
+  .pb-sm-0,
+  .py-sm-0 {
+    padding-bottom: 0 !important;
+  }
+  .pl-sm-0,
+  .px-sm-0 {
+    padding-left: 0 !important;
+  }
+  .p-sm-1 {
+    padding: 0.25rem !important;
+  }
+  .pt-sm-1,
+  .py-sm-1 {
+    padding-top: 0.25rem !important;
+  }
+  .pr-sm-1,
+  .px-sm-1 {
+    padding-right: 0.25rem !important;
+  }
+  .pb-sm-1,
+  .py-sm-1 {
+    padding-bottom: 0.25rem !important;
+  }
+  .pl-sm-1,
+  .px-sm-1 {
+    padding-left: 0.25rem !important;
+  }
+  .p-sm-2 {
+    padding: 0.5rem !important;
+  }
+  .pt-sm-2,
+  .py-sm-2 {
+    padding-top: 0.5rem !important;
+  }
+  .pr-sm-2,
+  .px-sm-2 {
+    padding-right: 0.5rem !important;
+  }
+  .pb-sm-2,
+  .py-sm-2 {
+    padding-bottom: 0.5rem !important;
+  }
+  .pl-sm-2,
+  .px-sm-2 {
+    padding-left: 0.5rem !important;
+  }
+  .p-sm-3 {
+    padding: 1rem !important;
+  }
+  .pt-sm-3,
+  .py-sm-3 {
+    padding-top: 1rem !important;
+  }
+  .pr-sm-3,
+  .px-sm-3 {
+    padding-right: 1rem !important;
+  }
+  .pb-sm-3,
+  .py-sm-3 {
+    padding-bottom: 1rem !important;
+  }
+  .pl-sm-3,
+  .px-sm-3 {
+    padding-left: 1rem !important;
+  }
+  .p-sm-4 {
+    padding: 1.5rem !important;
+  }
+  .pt-sm-4,
+  .py-sm-4 {
+    padding-top: 1.5rem !important;
+  }
+  .pr-sm-4,
+  .px-sm-4 {
+    padding-right: 1.5rem !important;
+  }
+  .pb-sm-4,
+  .py-sm-4 {
+    padding-bottom: 1.5rem !important;
+  }
+  .pl-sm-4,
+  .px-sm-4 {
+    padding-left: 1.5rem !important;
+  }
+  .p-sm-5 {
+    padding: 3rem !important;
+  }
+  .pt-sm-5,
+  .py-sm-5 {
+    padding-top: 3rem !important;
+  }
+  .pr-sm-5,
+  .px-sm-5 {
+    padding-right: 3rem !important;
+  }
+  .pb-sm-5,
+  .py-sm-5 {
+    padding-bottom: 3rem !important;
+  }
+  .pl-sm-5,
+  .px-sm-5 {
+    padding-left: 3rem !important;
+  }
+  .m-sm-auto {
+    margin: auto !important;
+  }
+  .mt-sm-auto,
+  .my-sm-auto {
+    margin-top: auto !important;
+  }
+  .mr-sm-auto,
+  .mx-sm-auto {
+    margin-right: auto !important;
+  }
+  .mb-sm-auto,
+  .my-sm-auto {
+    margin-bottom: auto !important;
+  }
+  .ml-sm-auto,
+  .mx-sm-auto {
+    margin-left: auto !important;
+  }
+}
+
+@media (min-width: 768px) {
+  .m-md-0 {
+    margin: 0 !important;
+  }
+  .mt-md-0,
+  .my-md-0 {
+    margin-top: 0 !important;
+  }
+  .mr-md-0,
+  .mx-md-0 {
+    margin-right: 0 !important;
+  }
+  .mb-md-0,
+  .my-md-0 {
+    margin-bottom: 0 !important;
+  }
+  .ml-md-0,
+  .mx-md-0 {
+    margin-left: 0 !important;
+  }
+  .m-md-1 {
+    margin: 0.25rem !important;
+  }
+  .mt-md-1,
+  .my-md-1 {
+    margin-top: 0.25rem !important;
+  }
+  .mr-md-1,
+  .mx-md-1 {
+    margin-right: 0.25rem !important;
+  }
+  .mb-md-1,
+  .my-md-1 {
+    margin-bottom: 0.25rem !important;
+  }
+  .ml-md-1,
+  .mx-md-1 {
+    margin-left: 0.25rem !important;
+  }
+  .m-md-2 {
+    margin: 0.5rem !important;
+  }
+  .mt-md-2,
+  .my-md-2 {
+    margin-top: 0.5rem !important;
+  }
+  .mr-md-2,
+  .mx-md-2 {
+    margin-right: 0.5rem !important;
+  }
+  .mb-md-2,
+  .my-md-2 {
+    margin-bottom: 0.5rem !important;
+  }
+  .ml-md-2,
+  .mx-md-2 {
+    margin-left: 0.5rem !important;
+  }
+  .m-md-3 {
+    margin: 1rem !important;
+  }
+  .mt-md-3,
+  .my-md-3 {
+    margin-top: 1rem !important;
+  }
+  .mr-md-3,
+  .mx-md-3 {
+    margin-right: 1rem !important;
+  }
+  .mb-md-3,
+  .my-md-3 {
+    margin-bottom: 1rem !important;
+  }
+  .ml-md-3,
+  .mx-md-3 {
+    margin-left: 1rem !important;
+  }
+  .m-md-4 {
+    margin: 1.5rem !important;
+  }
+  .mt-md-4,
+  .my-md-4 {
+    margin-top: 1.5rem !important;
+  }
+  .mr-md-4,
+  .mx-md-4 {
+    margin-right: 1.5rem !important;
+  }
+  .mb-md-4,
+  .my-md-4 {
+    margin-bottom: 1.5rem !important;
+  }
+  .ml-md-4,
+  .mx-md-4 {
+    margin-left: 1.5rem !important;
+  }
+  .m-md-5 {
+    margin: 3rem !important;
+  }
+  .mt-md-5,
+  .my-md-5 {
+    margin-top: 3rem !important;
+  }
+  .mr-md-5,
+  .mx-md-5 {
+    margin-right: 3rem !important;
+  }
+  .mb-md-5,
+  .my-md-5 {
+    margin-bottom: 3rem !important;
+  }
+  .ml-md-5,
+  .mx-md-5 {
+    margin-left: 3rem !important;
+  }
+  .p-md-0 {
+    padding: 0 !important;
+  }
+  .pt-md-0,
+  .py-md-0 {
+    padding-top: 0 !important;
+  }
+  .pr-md-0,
+  .px-md-0 {
+    padding-right: 0 !important;
+  }
+  .pb-md-0,
+  .py-md-0 {
+    padding-bottom: 0 !important;
+  }
+  .pl-md-0,
+  .px-md-0 {
+    padding-left: 0 !important;
+  }
+  .p-md-1 {
+    padding: 0.25rem !important;
+  }
+  .pt-md-1,
+  .py-md-1 {
+    padding-top: 0.25rem !important;
+  }
+  .pr-md-1,
+  .px-md-1 {
+    padding-right: 0.25rem !important;
+  }
+  .pb-md-1,
+  .py-md-1 {
+    padding-bottom: 0.25rem !important;
+  }
+  .pl-md-1,
+  .px-md-1 {
+    padding-left: 0.25rem !important;
+  }
+  .p-md-2 {
+    padding: 0.5rem !important;
+  }
+  .pt-md-2,
+  .py-md-2 {
+    padding-top: 0.5rem !important;
+  }
+  .pr-md-2,
+  .px-md-2 {
+    padding-right: 0.5rem !important;
+  }
+  .pb-md-2,
+  .py-md-2 {
+    padding-bottom: 0.5rem !important;
+  }
+  .pl-md-2,
+  .px-md-2 {
+    padding-left: 0.5rem !important;
+  }
+  .p-md-3 {
+    padding: 1rem !important;
+  }
+  .pt-md-3,
+  .py-md-3 {
+    padding-top: 1rem !important;
+  }
+  .pr-md-3,
+  .px-md-3 {
+    padding-right: 1rem !important;
+  }
+  .pb-md-3,
+  .py-md-3 {
+    padding-bottom: 1rem !important;
+  }
+  .pl-md-3,
+  .px-md-3 {
+    padding-left: 1rem !important;
+  }
+  .p-md-4 {
+    padding: 1.5rem !important;
+  }
+  .pt-md-4,
+  .py-md-4 {
+    padding-top: 1.5rem !important;
+  }
+  .pr-md-4,
+  .px-md-4 {
+    padding-right: 1.5rem !important;
+  }
+  .pb-md-4,
+  .py-md-4 {
+    padding-bottom: 1.5rem !important;
+  }
+  .pl-md-4,
+  .px-md-4 {
+    padding-left: 1.5rem !important;
+  }
+  .p-md-5 {
+    padding: 3rem !important;
+  }
+  .pt-md-5,
+  .py-md-5 {
+    padding-top: 3rem !important;
+  }
+  .pr-md-5,
+  .px-md-5 {
+    padding-right: 3rem !important;
+  }
+  .pb-md-5,
+  .py-md-5 {
+    padding-bottom: 3rem !important;
+  }
+  .pl-md-5,
+  .px-md-5 {
+    padding-left: 3rem !important;
+  }
+  .m-md-auto {
+    margin: auto !important;
+  }
+  .mt-md-auto,
+  .my-md-auto {
+    margin-top: auto !important;
+  }
+  .mr-md-auto,
+  .mx-md-auto {
+    margin-right: auto !important;
+  }
+  .mb-md-auto,
+  .my-md-auto {
+    margin-bottom: auto !important;
+  }
+  .ml-md-auto,
+  .mx-md-auto {
+    margin-left: auto !important;
+  }
+}
+
+@media (min-width: 992px) {
+  .m-lg-0 {
+    margin: 0 !important;
+  }
+  .mt-lg-0,
+  .my-lg-0 {
+    margin-top: 0 !important;
+  }
+  .mr-lg-0,
+  .mx-lg-0 {
+    margin-right: 0 !important;
+  }
+  .mb-lg-0,
+  .my-lg-0 {
+    margin-bottom: 0 !important;
+  }
+  .ml-lg-0,
+  .mx-lg-0 {
+    margin-left: 0 !important;
+  }
+  .m-lg-1 {
+    margin: 0.25rem !important;
+  }
+  .mt-lg-1,
+  .my-lg-1 {
+    margin-top: 0.25rem !important;
+  }
+  .mr-lg-1,
+  .mx-lg-1 {
+    margin-right: 0.25rem !important;
+  }
+  .mb-lg-1,
+  .my-lg-1 {
+    margin-bottom: 0.25rem !important;
+  }
+  .ml-lg-1,
+  .mx-lg-1 {
+    margin-left: 0.25rem !important;
+  }
+  .m-lg-2 {
+    margin: 0.5rem !important;
+  }
+  .mt-lg-2,
+  .my-lg-2 {
+    margin-top: 0.5rem !important;
+  }
+  .mr-lg-2,
+  .mx-lg-2 {
+    margin-right: 0.5rem !important;
+  }
+  .mb-lg-2,
+  .my-lg-2 {
+    margin-bottom: 0.5rem !important;
+  }
+  .ml-lg-2,
+  .mx-lg-2 {
+    margin-left: 0.5rem !important;
+  }
+  .m-lg-3 {
+    margin: 1rem !important;
+  }
+  .mt-lg-3,
+  .my-lg-3 {
+    margin-top: 1rem !important;
+  }
+  .mr-lg-3,
+  .mx-lg-3 {
+    margin-right: 1rem !important;
+  }
+  .mb-lg-3,
+  .my-lg-3 {
+    margin-bottom: 1rem !important;
+  }
+  .ml-lg-3,
+  .mx-lg-3 {
+    margin-left: 1rem !important;
+  }
+  .m-lg-4 {
+    margin: 1.5rem !important;
+  }
+  .mt-lg-4,
+  .my-lg-4 {
+    margin-top: 1.5rem !important;
+  }
+  .mr-lg-4,
+  .mx-lg-4 {
+    margin-right: 1.5rem !important;
+  }
+  .mb-lg-4,
+  .my-lg-4 {
+    margin-bottom: 1.5rem !important;
+  }
+  .ml-lg-4,
+  .mx-lg-4 {
+    margin-left: 1.5rem !important;
+  }
+  .m-lg-5 {
+    margin: 3rem !important;
+  }
+  .mt-lg-5,
+  .my-lg-5 {
+    margin-top: 3rem !important;
+  }
+  .mr-lg-5,
+  .mx-lg-5 {
+    margin-right: 3rem !important;
+  }
+  .mb-lg-5,
+  .my-lg-5 {
+    margin-bottom: 3rem !important;
+  }
+  .ml-lg-5,
+  .mx-lg-5 {
+    margin-left: 3rem !important;
+  }
+  .p-lg-0 {
+    padding: 0 !important;
+  }
+  .pt-lg-0,
+  .py-lg-0 {
+    padding-top: 0 !important;
+  }
+  .pr-lg-0,
+  .px-lg-0 {
+    padding-right: 0 !important;
+  }
+  .pb-lg-0,
+  .py-lg-0 {
+    padding-bottom: 0 !important;
+  }
+  .pl-lg-0,
+  .px-lg-0 {
+    padding-left: 0 !important;
+  }
+  .p-lg-1 {
+    padding: 0.25rem !important;
+  }
+  .pt-lg-1,
+  .py-lg-1 {
+    padding-top: 0.25rem !important;
+  }
+  .pr-lg-1,
+  .px-lg-1 {
+    padding-right: 0.25rem !important;
+  }
+  .pb-lg-1,
+  .py-lg-1 {
+    padding-bottom: 0.25rem !important;
+  }
+  .pl-lg-1,
+  .px-lg-1 {
+    padding-left: 0.25rem !important;
+  }
+  .p-lg-2 {
+    padding: 0.5rem !important;
+  }
+  .pt-lg-2,
+  .py-lg-2 {
+    padding-top: 0.5rem !important;
+  }
+  .pr-lg-2,
+  .px-lg-2 {
+    padding-right: 0.5rem !important;
+  }
+  .pb-lg-2,
+  .py-lg-2 {
+    padding-bottom: 0.5rem !important;
+  }
+  .pl-lg-2,
+  .px-lg-2 {
+    padding-left: 0.5rem !important;
+  }
+  .p-lg-3 {
+    padding: 1rem !important;
+  }
+  .pt-lg-3,
+  .py-lg-3 {
+    padding-top: 1rem !important;
+  }
+  .pr-lg-3,
+  .px-lg-3 {
+    padding-right: 1rem !important;
+  }
+  .pb-lg-3,
+  .py-lg-3 {
+    padding-bottom: 1rem !important;
+  }
+  .pl-lg-3,
+  .px-lg-3 {
+    padding-left: 1rem !important;
+  }
+  .p-lg-4 {
+    padding: 1.5rem !important;
+  }
+  .pt-lg-4,
+  .py-lg-4 {
+    padding-top: 1.5rem !important;
+  }
+  .pr-lg-4,
+  .px-lg-4 {
+    padding-right: 1.5rem !important;
+  }
+  .pb-lg-4,
+  .py-lg-4 {
+    padding-bottom: 1.5rem !important;
+  }
+  .pl-lg-4,
+  .px-lg-4 {
+    padding-left: 1.5rem !important;
+  }
+  .p-lg-5 {
+    padding: 3rem !important;
+  }
+  .pt-lg-5,
+  .py-lg-5 {
+    padding-top: 3rem !important;
+  }
+  .pr-lg-5,
+  .px-lg-5 {
+    padding-right: 3rem !important;
+  }
+  .pb-lg-5,
+  .py-lg-5 {
+    padding-bottom: 3rem !important;
+  }
+  .pl-lg-5,
+  .px-lg-5 {
+    padding-left: 3rem !important;
+  }
+  .m-lg-auto {
+    margin: auto !important;
+  }
+  .mt-lg-auto,
+  .my-lg-auto {
+    margin-top: auto !important;
+  }
+  .mr-lg-auto,
+  .mx-lg-auto {
+    margin-right: auto !important;
+  }
+  .mb-lg-auto,
+  .my-lg-auto {
+    margin-bottom: auto !important;
+  }
+  .ml-lg-auto,
+  .mx-lg-auto {
+    margin-left: auto !important;
+  }
+}
+
+@media (min-width: 1200px) {
+  .m-xl-0 {
+    margin: 0 !important;
+  }
+  .mt-xl-0,
+  .my-xl-0 {
+    margin-top: 0 !important;
+  }
+  .mr-xl-0,
+  .mx-xl-0 {
+    margin-right: 0 !important;
+  }
+  .mb-xl-0,
+  .my-xl-0 {
+    margin-bottom: 0 !important;
+  }
+  .ml-xl-0,
+  .mx-xl-0 {
+    margin-left: 0 !important;
+  }
+  .m-xl-1 {
+    margin: 0.25rem !important;
+  }
+  .mt-xl-1,
+  .my-xl-1 {
+    margin-top: 0.25rem !important;
+  }
+  .mr-xl-1,
+  .mx-xl-1 {
+    margin-right: 0.25rem !important;
+  }
+  .mb-xl-1,
+  .my-xl-1 {
+    margin-bottom: 0.25rem !important;
+  }
+  .ml-xl-1,
+  .mx-xl-1 {
+    margin-left: 0.25rem !important;
+  }
+  .m-xl-2 {
+    margin: 0.5rem !important;
+  }
+  .mt-xl-2,
+  .my-xl-2 {
+    margin-top: 0.5rem !important;
+  }
+  .mr-xl-2,
+  .mx-xl-2 {
+    margin-right: 0.5rem !important;
+  }
+  .mb-xl-2,
+  .my-xl-2 {
+    margin-bottom: 0.5rem !important;
+  }
+  .ml-xl-2,
+  .mx-xl-2 {
+    margin-left: 0.5rem !important;
+  }
+  .m-xl-3 {
+    margin: 1rem !important;
+  }
+  .mt-xl-3,
+  .my-xl-3 {
+    margin-top: 1rem !important;
+  }
+  .mr-xl-3,
+  .mx-xl-3 {
+    margin-right: 1rem !important;
+  }
+  .mb-xl-3,
+  .my-xl-3 {
+    margin-bottom: 1rem !important;
+  }
+  .ml-xl-3,
+  .mx-xl-3 {
+    margin-left: 1rem !important;
+  }
+  .m-xl-4 {
+    margin: 1.5rem !important;
+  }
+  .mt-xl-4,
+  .my-xl-4 {
+    margin-top: 1.5rem !important;
+  }
+  .mr-xl-4,
+  .mx-xl-4 {
+    margin-right: 1.5rem !important;
+  }
+  .mb-xl-4,
+  .my-xl-4 {
+    margin-bottom: 1.5rem !important;
+  }
+  .ml-xl-4,
+  .mx-xl-4 {
+    margin-left: 1.5rem !important;
+  }
+  .m-xl-5 {
+    margin: 3rem !important;
+  }
+  .mt-xl-5,
+  .my-xl-5 {
+    margin-top: 3rem !important;
+  }
+  .mr-xl-5,
+  .mx-xl-5 {
+    margin-right: 3rem !important;
+  }
+  .mb-xl-5,
+  .my-xl-5 {
+    margin-bottom: 3rem !important;
+  }
+  .ml-xl-5,
+  .mx-xl-5 {
+    margin-left: 3rem !important;
+  }
+  .p-xl-0 {
+    padding: 0 !important;
+  }
+  .pt-xl-0,
+  .py-xl-0 {
+    padding-top: 0 !important;
+  }
+  .pr-xl-0,
+  .px-xl-0 {
+    padding-right: 0 !important;
+  }
+  .pb-xl-0,
+  .py-xl-0 {
+    padding-bottom: 0 !important;
+  }
+  .pl-xl-0,
+  .px-xl-0 {
+    padding-left: 0 !important;
+  }
+  .p-xl-1 {
+    padding: 0.25rem !important;
+  }
+  .pt-xl-1,
+  .py-xl-1 {
+    padding-top: 0.25rem !important;
+  }
+  .pr-xl-1,
+  .px-xl-1 {
+    padding-right: 0.25rem !important;
+  }
+  .pb-xl-1,
+  .py-xl-1 {
+    padding-bottom: 0.25rem !important;
+  }
+  .pl-xl-1,
+  .px-xl-1 {
+    padding-left: 0.25rem !important;
+  }
+  .p-xl-2 {
+    padding: 0.5rem !important;
+  }
+  .pt-xl-2,
+  .py-xl-2 {
+    padding-top: 0.5rem !important;
+  }
+  .pr-xl-2,
+  .px-xl-2 {
+    padding-right: 0.5rem !important;
+  }
+  .pb-xl-2,
+  .py-xl-2 {
+    padding-bottom: 0.5rem !important;
+  }
+  .pl-xl-2,
+  .px-xl-2 {
+    padding-left: 0.5rem !important;
+  }
+  .p-xl-3 {
+    padding: 1rem !important;
+  }
+  .pt-xl-3,
+  .py-xl-3 {
+    padding-top: 1rem !important;
+  }
+  .pr-xl-3,
+  .px-xl-3 {
+    padding-right: 1rem !important;
+  }
+  .pb-xl-3,
+  .py-xl-3 {
+    padding-bottom: 1rem !important;
+  }
+  .pl-xl-3,
+  .px-xl-3 {
+    padding-left: 1rem !important;
+  }
+  .p-xl-4 {
+    padding: 1.5rem !important;
+  }
+  .pt-xl-4,
+  .py-xl-4 {
+    padding-top: 1.5rem !important;
+  }
+  .pr-xl-4,
+  .px-xl-4 {
+    padding-right: 1.5rem !important;
+  }
+  .pb-xl-4,
+  .py-xl-4 {
+    padding-bottom: 1.5rem !important;
+  }
+  .pl-xl-4,
+  .px-xl-4 {
+    padding-left: 1.5rem !important;
+  }
+  .p-xl-5 {
+    padding: 3rem !important;
+  }
+  .pt-xl-5,
+  .py-xl-5 {
+    padding-top: 3rem !important;
+  }
+  .pr-xl-5,
+  .px-xl-5 {
+    padding-right: 3rem !important;
+  }
+  .pb-xl-5,
+  .py-xl-5 {
+    padding-bottom: 3rem !important;
+  }
+  .pl-xl-5,
+  .px-xl-5 {
+    padding-left: 3rem !important;
+  }
+  .m-xl-auto {
+    margin: auto !important;
+  }
+  .mt-xl-auto,
+  .my-xl-auto {
+    margin-top: auto !important;
+  }
+  .mr-xl-auto,
+  .mx-xl-auto {
+    margin-right: auto !important;
+  }
+  .mb-xl-auto,
+  .my-xl-auto {
+    margin-bottom: auto !important;
+  }
+  .ml-xl-auto,
+  .mx-xl-auto {
+    margin-left: auto !important;
+  }
+}
+
+.text-justify {
+  text-align: justify !important;
+}
+
+.text-nowrap {
+  white-space: nowrap !important;
+}
+
+.text-truncate {
+  overflow: hidden;
+  text-overflow: ellipsis;
+  white-space: nowrap;
+}
+
+.text-left {
+  text-align: left !important;
+}
+
+.text-right {
+  text-align: right !important;
+}
+
+.text-center {
+  text-align: center !important;
+}
+
+@media (min-width: 576px) {
+  .text-sm-left {
+    text-align: left !important;
+  }
+  .text-sm-right {
+    text-align: right !important;
+  }
+  .text-sm-center {
+    text-align: center !important;
+  }
+}
+
+@media (min-width: 768px) {
+  .text-md-left {
+    text-align: left !important;
+  }
+  .text-md-right {
+    text-align: right !important;
+  }
+  .text-md-center {
+    text-align: center !important;
+  }
+}
+
+@media (min-width: 992px) {
+  .text-lg-left {
+    text-align: left !important;
+  }
+  .text-lg-right {
+    text-align: right !important;
+  }
+  .text-lg-center {
+    text-align: center !important;
+  }
+}
+
+@media (min-width: 1200px) {
+  .text-xl-left {
+    text-align: left !important;
+  }
+  .text-xl-right {
+    text-align: right !important;
+  }
+  .text-xl-center {
+    text-align: center !important;
+  }
+}
+
+.text-lowercase {
+  text-transform: lowercase !important;
+}
+
+.text-uppercase {
+  text-transform: uppercase !important;
+}
+
+.text-capitalize {
+  text-transform: capitalize !important;
+}
+
+.font-weight-light {
+  font-weight: 300 !important;
+}
+
+.font-weight-normal {
+  font-weight: 400 !important;
+}
+
+.font-weight-bold {
+  font-weight: 700 !important;
+}
+
+.font-italic {
+  font-style: italic !important;
+}
+
+.text-white {
+  color: #fff !important;
+}
+
+.text-primary {
+  color: #007bff !important;
+}
+
+a.text-primary:hover, a.text-primary:focus {
+  color: #0062cc !important;
+}
+
+.text-secondary {
+  color: #6c757d !important;
+}
+
+a.text-secondary:hover, a.text-secondary:focus {
+  color: #545b62 !important;
+}
+
+.text-success {
+  color: #28a745 !important;
+}
+
+a.text-success:hover, a.text-success:focus {
+  color: #1e7e34 !important;
+}
+
+.text-info {
+  color: #17a2b8 !important;
+}
+
+a.text-info:hover, a.text-info:focus {
+  color: #117a8b !important;
+}
+
+.text-warning {
+  color: #ffc107 !important;
+}
+
+a.text-warning:hover, a.text-warning:focus {
+  color: #d39e00 !important;
+}
+
+.text-danger {
+  color: #dc3545 !important;
+}
+
+a.text-danger:hover, a.text-danger:focus {
+  color: #bd2130 !important;
+}
+
+.text-light {
+  color: #f8f9fa !important;
+}
+
+a.text-light:hover, a.text-light:focus {
+  color: #dae0e5 !important;
+}
+
+.text-dark {
+  color: #343a40 !important;
+}
+
+a.text-dark:hover, a.text-dark:focus {
+  color: #1d2124 !important;
+}
+
+.text-muted {
+  color: #6c757d !important;
+}
+
+.text-hide {
+  font: 0/0 a;
+  color: transparent;
+  text-shadow: none;
+  background-color: transparent;
+  border: 0;
+}
+
+.visible {
+  visibility: visible !important;
+}
+
+.invisible {
+  visibility: hidden !important;
+}
+
+@media print {
+  *,
+  *::before,
+  *::after {
+    text-shadow: none !important;
+    box-shadow: none !important;
+  }
+  a:not(.btn) {
+    text-decoration: underline;
+  }
+  abbr[title]::after {
+    content: " (" attr(title) ")";
+  }
+  pre {
+    white-space: pre-wrap !important;
+  }
+  pre,
+  blockquote {
+    border: 1px solid #999;
+    page-break-inside: avoid;
+  }
+  thead {
+    display: table-header-group;
+  }
+  tr,
+  img {
+    page-break-inside: avoid;
+  }
+  p,
+  h2,
+  h3 {
+    orphans: 3;
+    widows: 3;
+  }
+  h2,
+  h3 {
+    page-break-after: avoid;
+  }
+  @page {
+    size: a3;
+  }
+  body {
+    min-width: 992px !important;
+  }
+  .container {
+    min-width: 992px !important;
+  }
+  .navbar {
+    display: none;
+  }
+  .badge {
+    border: 1px solid #000;
+  }
+  .table {
+    border-collapse: collapse !important;
+  }
+  .table td,
+  .table th {
+    background-color: #fff !important;
+  }
+  .table-bordered th,
+  .table-bordered td {
+    border: 1px solid #ddd !important;
+  }
+}
+/*# sourceMappingURL=bootstrap.css.map */
\ No newline at end of file
diff --git a/docs/lib/bootstrap/css/bootstrap.min.css b/docs/lib/bootstrap/css/bootstrap.min.css
new file mode 100644
index 0000000..6561b6f
--- /dev/null
+++ b/docs/lib/bootstrap/css/bootstrap.min.css
@@ -0,0 +1,7 @@
+/*!
+ * Bootstrap v4.0.0 (https://getbootstrap.com)
+ * Copyright 2011-2018 The Bootstrap Authors
+ * Copyright 2011-2018 Twitter, Inc.
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ */:root{--blue:#007bff;--indigo:#6610f2;--purple:#6f42c1;--pink:#e83e8c;--red:#dc3545;--orange:#fd7e14;--yellow:#ffc107;--green:#28a745;--teal:#20c997;--cyan:#17a2b8;--white:#fff;--gray:#6c757d;--gray-dark:#343a40;--primary:#007bff;--secondary:#6c757d;--success:#28a745;--info:#17a2b8;--warning:#ffc107;--danger:#dc3545;--light:#f8f9fa;--dark:#343a40;--breakpoint-xs:0;--breakpoint-sm:576px;--breakpoint-md:768px;--breakpoint-lg:992px;--breakpoint-xl:1200px;--font-family-sans-serif:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";--font-family-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace}*,::after,::before{box-sizing:border-box}html{font-family:sans-serif;line-height:1.15;-webkit-text-size-adjust:100%;-ms-text-size-adjust:100%;-ms-overflow-style:scrollbar;-webkit-tap-highlight-color:transparent}@-ms-viewport{width:device-width}article,aside,dialog,figcaption,figure,footer,header,hgroup,main,nav,section{display:block}body{margin:0;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";font-size:1rem;font-weight:400;line-height:1.5;color:#212529;text-align:left;background-color:#fff}[tabindex="-1"]:focus{outline:0!important}hr{box-sizing:content-box;height:0;overflow:visible}h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem}p{margin-top:0;margin-bottom:1rem}abbr[data-original-title],abbr[title]{text-decoration:underline;-webkit-text-decoration:underline dotted;text-decoration:underline dotted;cursor:help;border-bottom:0}address{margin-bottom:1rem;font-style:normal;line-height:inherit}dl,ol,ul{margin-top:0;margin-bottom:1rem}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}dfn{font-style:italic}b,strong{font-weight:bolder}small{font-size:80%}sub,sup{position:relative;font-size:75%;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:#007bff;text-decoration:none;background-color:transparent;-webkit-text-decoration-skip:objects}a:hover{color:#0056b3;text-decoration:underline}a:not([href]):not([tabindex]){color:inherit;text-decoration:none}a:not([href]):not([tabindex]):focus,a:not([href]):not([tabindex]):hover{color:inherit;text-decoration:none}a:not([href]):not([tabindex]):focus{outline:0}code,kbd,pre,samp{font-family:monospace,monospace;font-size:1em}pre{margin-top:0;margin-bottom:1rem;overflow:auto;-ms-overflow-style:scrollbar}figure{margin:0 0 1rem}img{vertical-align:middle;border-style:none}svg:not(:root){overflow:hidden}table{border-collapse:collapse}caption{padding-top:.75rem;padding-bottom:.75rem;color:#6c757d;text-align:left;caption-side:bottom}th{text-align:inherit}label{display:inline-block;margin-bottom:.5rem}button{border-radius:0}button:focus{outline:1px dotted;outline:5px auto -webkit-focus-ring-color}button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,input{overflow:visible}button,select{text-transform:none}[type=reset],[type=submit],button,html [type=button]{-webkit-appearance:button}[type=button]::-moz-focus-inner,[type=reset]::-moz-focus-inner,[type=submit]::-moz-focus-inner,button::-moz-focus-inner{padding:0;border-style:none}input[type=checkbox],input[type=radio]{box-sizing:border-box;padding:0}input[type=date],input[type=datetime-local],input[type=month],input[type=time]{-webkit-appearance:listbox}textarea{overflow:auto;resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{display:block;width:100%;max-width:100%;padding:0;margin-bottom:.5rem;font-size:1.5rem;line-height:inherit;color:inherit;white-space:normal}progress{vertical-align:baseline}[type=number]::-webkit-inner-spin-button,[type=number]::-webkit-outer-spin-button{height:auto}[type=search]{outline-offset:-2px;-webkit-appearance:none}[type=search]::-webkit-search-cancel-button,[type=search]::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}output{display:inline-block}summary{display:list-item;cursor:pointer}template{display:none}[hidden]{display:none!important}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{margin-bottom:.5rem;font-family:inherit;font-weight:500;line-height:1.2;color:inherit}.h1,h1{font-size:2.5rem}.h2,h2{font-size:2rem}.h3,h3{font-size:1.75rem}.h4,h4{font-size:1.5rem}.h5,h5{font-size:1.25rem}.h6,h6{font-size:1rem}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:6rem;font-weight:300;line-height:1.2}.display-2{font-size:5.5rem;font-weight:300;line-height:1.2}.display-3{font-size:4.5rem;font-weight:300;line-height:1.2}.display-4{font-size:3.5rem;font-weight:300;line-height:1.2}hr{margin-top:1rem;margin-bottom:1rem;border:0;border-top:1px solid rgba(0,0,0,.1)}.small,small{font-size:80%;font-weight:400}.mark,mark{padding:.2em;background-color:#fcf8e3}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:90%;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote-footer{display:block;font-size:80%;color:#6c757d}.blockquote-footer::before{content:"\2014 \00A0"}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:#fff;border:1px solid #dee2e6;border-radius:.25rem;max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:90%;color:#6c757d}code,kbd,pre,samp{font-family:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace}code{font-size:87.5%;color:#e83e8c;word-break:break-word}a>code{color:inherit}kbd{padding:.2rem .4rem;font-size:87.5%;color:#fff;background-color:#212529;border-radius:.2rem}kbd kbd{padding:0;font-size:100%;font-weight:700}pre{display:block;font-size:87.5%;color:#212529}pre code{font-size:inherit;color:inherit;word-break:normal}.pre-scrollable{max-height:340px;overflow-y:scroll}.container{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}@media (min-width:576px){.container{max-width:540px}}@media (min-width:768px){.container{max-width:720px}}@media (min-width:992px){.container{max-width:960px}}@media (min-width:1200px){.container{max-width:1140px}}.container-fluid{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}.row{display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-right:-15px;margin-left:-15px}.no-gutters{margin-right:0;margin-left:0}.no-gutters>.col,.no-gutters>[class*=col-]{padding-right:0;padding-left:0}.col,.col-1,.col-10,.col-11,.col-12,.col-2,.col-3,.col-4,.col-5,.col-6,.col-7,.col-8,.col-9,.col-auto,.col-lg,.col-lg-1,.col-lg-10,.col-lg-11,.col-lg-12,.col-lg-2,.col-lg-3,.col-lg-4,.col-lg-5,.col-lg-6,.col-lg-7,.col-lg-8,.col-lg-9,.col-lg-auto,.col-md,.col-md-1,.col-md-10,.col-md-11,.col-md-12,.col-md-2,.col-md-3,.col-md-4,.col-md-5,.col-md-6,.col-md-7,.col-md-8,.col-md-9,.col-md-auto,.col-sm,.col-sm-1,.col-sm-10,.col-sm-11,.col-sm-12,.col-sm-2,.col-sm-3,.col-sm-4,.col-sm-5,.col-sm-6,.col-sm-7,.col-sm-8,.col-sm-9,.col-sm-auto,.col-xl,.col-xl-1,.col-xl-10,.col-xl-11,.col-xl-12,.col-xl-2,.col-xl-3,.col-xl-4,.col-xl-5,.col-xl-6,.col-xl-7,.col-xl-8,.col-xl-9,.col-xl-auto{position:relative;width:100%;min-height:1px;padding-right:15px;padding-left:15px}.col{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-auto{-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-1{-webkit-box-flex:0;-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-2{-webkit-box-flex:0;-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-3{-webkit-box-flex:0;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-4{-webkit-box-flex:0;-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-5{-webkit-box-flex:0;-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-6{-webkit-box-flex:0;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-7{-webkit-box-flex:0;-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-8{-webkit-box-flex:0;-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-9{-webkit-box-flex:0;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-10{-webkit-box-flex:0;-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-11{-webkit-box-flex:0;-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-12{-webkit-box-flex:0;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-first{-webkit-box-ordinal-group:0;-ms-flex-order:-1;order:-1}.order-last{-webkit-box-ordinal-group:14;-ms-flex-order:13;order:13}.order-0{-webkit-box-ordinal-group:1;-ms-flex-order:0;order:0}.order-1{-webkit-box-ordinal-group:2;-ms-flex-order:1;order:1}.order-2{-webkit-box-ordinal-group:3;-ms-flex-order:2;order:2}.order-3{-webkit-box-ordinal-group:4;-ms-flex-order:3;order:3}.order-4{-webkit-box-ordinal-group:5;-ms-flex-order:4;order:4}.order-5{-webkit-box-ordinal-group:6;-ms-flex-order:5;order:5}.order-6{-webkit-box-ordinal-group:7;-ms-flex-order:6;order:6}.order-7{-webkit-box-ordinal-group:8;-ms-flex-order:7;order:7}.order-8{-webkit-box-ordinal-group:9;-ms-flex-order:8;order:8}.order-9{-webkit-box-ordinal-group:10;-ms-flex-order:9;order:9}.order-10{-webkit-box-ordinal-group:11;-ms-flex-order:10;order:10}.order-11{-webkit-box-ordinal-group:12;-ms-flex-order:11;order:11}.order-12{-webkit-box-ordinal-group:13;-ms-flex-order:12;order:12}.offset-1{margin-left:8.333333%}.offset-2{margin-left:16.666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.333333%}.offset-5{margin-left:41.666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.333333%}.offset-8{margin-left:66.666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.333333%}.offset-11{margin-left:91.666667%}@media (min-width:576px){.col-sm{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-sm-auto{-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-sm-1{-webkit-box-flex:0;-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-sm-2{-webkit-box-flex:0;-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-sm-3{-webkit-box-flex:0;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-sm-4{-webkit-box-flex:0;-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-sm-5{-webkit-box-flex:0;-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-sm-6{-webkit-box-flex:0;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-sm-7{-webkit-box-flex:0;-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-sm-8{-webkit-box-flex:0;-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-sm-9{-webkit-box-flex:0;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-sm-10{-webkit-box-flex:0;-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-sm-11{-webkit-box-flex:0;-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-sm-12{-webkit-box-flex:0;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-sm-first{-webkit-box-ordinal-group:0;-ms-flex-order:-1;order:-1}.order-sm-last{-webkit-box-ordinal-group:14;-ms-flex-order:13;order:13}.order-sm-0{-webkit-box-ordinal-group:1;-ms-flex-order:0;order:0}.order-sm-1{-webkit-box-ordinal-group:2;-ms-flex-order:1;order:1}.order-sm-2{-webkit-box-ordinal-group:3;-ms-flex-order:2;order:2}.order-sm-3{-webkit-box-ordinal-group:4;-ms-flex-order:3;order:3}.order-sm-4{-webkit-box-ordinal-group:5;-ms-flex-order:4;order:4}.order-sm-5{-webkit-box-ordinal-group:6;-ms-flex-order:5;order:5}.order-sm-6{-webkit-box-ordinal-group:7;-ms-flex-order:6;order:6}.order-sm-7{-webkit-box-ordinal-group:8;-ms-flex-order:7;order:7}.order-sm-8{-webkit-box-ordinal-group:9;-ms-flex-order:8;order:8}.order-sm-9{-webkit-box-ordinal-group:10;-ms-flex-order:9;order:9}.order-sm-10{-webkit-box-ordinal-group:11;-ms-flex-order:10;order:10}.order-sm-11{-webkit-box-ordinal-group:12;-ms-flex-order:11;order:11}.order-sm-12{-webkit-box-ordinal-group:13;-ms-flex-order:12;order:12}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.333333%}.offset-sm-2{margin-left:16.666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.333333%}.offset-sm-5{margin-left:41.666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.333333%}.offset-sm-8{margin-left:66.666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.333333%}.offset-sm-11{margin-left:91.666667%}}@media (min-width:768px){.col-md{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-md-auto{-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-md-1{-webkit-box-flex:0;-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-md-2{-webkit-box-flex:0;-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-md-3{-webkit-box-flex:0;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-md-4{-webkit-box-flex:0;-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-md-5{-webkit-box-flex:0;-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-md-6{-webkit-box-flex:0;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-md-7{-webkit-box-flex:0;-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-md-8{-webkit-box-flex:0;-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-md-9{-webkit-box-flex:0;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-md-10{-webkit-box-flex:0;-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-md-11{-webkit-box-flex:0;-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-md-12{-webkit-box-flex:0;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-md-first{-webkit-box-ordinal-group:0;-ms-flex-order:-1;order:-1}.order-md-last{-webkit-box-ordinal-group:14;-ms-flex-order:13;order:13}.order-md-0{-webkit-box-ordinal-group:1;-ms-flex-order:0;order:0}.order-md-1{-webkit-box-ordinal-group:2;-ms-flex-order:1;order:1}.order-md-2{-webkit-box-ordinal-group:3;-ms-flex-order:2;order:2}.order-md-3{-webkit-box-ordinal-group:4;-ms-flex-order:3;order:3}.order-md-4{-webkit-box-ordinal-group:5;-ms-flex-order:4;order:4}.order-md-5{-webkit-box-ordinal-group:6;-ms-flex-order:5;order:5}.order-md-6{-webkit-box-ordinal-group:7;-ms-flex-order:6;order:6}.order-md-7{-webkit-box-ordinal-group:8;-ms-flex-order:7;order:7}.order-md-8{-webkit-box-ordinal-group:9;-ms-flex-order:8;order:8}.order-md-9{-webkit-box-ordinal-group:10;-ms-flex-order:9;order:9}.order-md-10{-webkit-box-ordinal-group:11;-ms-flex-order:10;order:10}.order-md-11{-webkit-box-ordinal-group:12;-ms-flex-order:11;order:11}.order-md-12{-webkit-box-ordinal-group:13;-ms-flex-order:12;order:12}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.333333%}.offset-md-2{margin-left:16.666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.333333%}.offset-md-5{margin-left:41.666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.333333%}.offset-md-8{margin-left:66.666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.333333%}.offset-md-11{margin-left:91.666667%}}@media (min-width:992px){.col-lg{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-lg-auto{-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-lg-1{-webkit-box-flex:0;-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-lg-2{-webkit-box-flex:0;-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-lg-3{-webkit-box-flex:0;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-lg-4{-webkit-box-flex:0;-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-lg-5{-webkit-box-flex:0;-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-lg-6{-webkit-box-flex:0;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-lg-7{-webkit-box-flex:0;-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-lg-8{-webkit-box-flex:0;-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-lg-9{-webkit-box-flex:0;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-lg-10{-webkit-box-flex:0;-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-lg-11{-webkit-box-flex:0;-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-lg-12{-webkit-box-flex:0;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-lg-first{-webkit-box-ordinal-group:0;-ms-flex-order:-1;order:-1}.order-lg-last{-webkit-box-ordinal-group:14;-ms-flex-order:13;order:13}.order-lg-0{-webkit-box-ordinal-group:1;-ms-flex-order:0;order:0}.order-lg-1{-webkit-box-ordinal-group:2;-ms-flex-order:1;order:1}.order-lg-2{-webkit-box-ordinal-group:3;-ms-flex-order:2;order:2}.order-lg-3{-webkit-box-ordinal-group:4;-ms-flex-order:3;order:3}.order-lg-4{-webkit-box-ordinal-group:5;-ms-flex-order:4;order:4}.order-lg-5{-webkit-box-ordinal-group:6;-ms-flex-order:5;order:5}.order-lg-6{-webkit-box-ordinal-group:7;-ms-flex-order:6;order:6}.order-lg-7{-webkit-box-ordinal-group:8;-ms-flex-order:7;order:7}.order-lg-8{-webkit-box-ordinal-group:9;-ms-flex-order:8;order:8}.order-lg-9{-webkit-box-ordinal-group:10;-ms-flex-order:9;order:9}.order-lg-10{-webkit-box-ordinal-group:11;-ms-flex-order:10;order:10}.order-lg-11{-webkit-box-ordinal-group:12;-ms-flex-order:11;order:11}.order-lg-12{-webkit-box-ordinal-group:13;-ms-flex-order:12;order:12}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.333333%}.offset-lg-2{margin-left:16.666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.333333%}.offset-lg-5{margin-left:41.666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.333333%}.offset-lg-8{margin-left:66.666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.333333%}.offset-lg-11{margin-left:91.666667%}}@media (min-width:1200px){.col-xl{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-xl-auto{-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-xl-1{-webkit-box-flex:0;-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-xl-2{-webkit-box-flex:0;-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-xl-3{-webkit-box-flex:0;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-xl-4{-webkit-box-flex:0;-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-xl-5{-webkit-box-flex:0;-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-xl-6{-webkit-box-flex:0;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-xl-7{-webkit-box-flex:0;-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-xl-8{-webkit-box-flex:0;-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-xl-9{-webkit-box-flex:0;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-xl-10{-webkit-box-flex:0;-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-xl-11{-webkit-box-flex:0;-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-xl-12{-webkit-box-flex:0;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-xl-first{-webkit-box-ordinal-group:0;-ms-flex-order:-1;order:-1}.order-xl-last{-webkit-box-ordinal-group:14;-ms-flex-order:13;order:13}.order-xl-0{-webkit-box-ordinal-group:1;-ms-flex-order:0;order:0}.order-xl-1{-webkit-box-ordinal-group:2;-ms-flex-order:1;order:1}.order-xl-2{-webkit-box-ordinal-group:3;-ms-flex-order:2;order:2}.order-xl-3{-webkit-box-ordinal-group:4;-ms-flex-order:3;order:3}.order-xl-4{-webkit-box-ordinal-group:5;-ms-flex-order:4;order:4}.order-xl-5{-webkit-box-ordinal-group:6;-ms-flex-order:5;order:5}.order-xl-6{-webkit-box-ordinal-group:7;-ms-flex-order:6;order:6}.order-xl-7{-webkit-box-ordinal-group:8;-ms-flex-order:7;order:7}.order-xl-8{-webkit-box-ordinal-group:9;-ms-flex-order:8;order:8}.order-xl-9{-webkit-box-ordinal-group:10;-ms-flex-order:9;order:9}.order-xl-10{-webkit-box-ordinal-group:11;-ms-flex-order:10;order:10}.order-xl-11{-webkit-box-ordinal-group:12;-ms-flex-order:11;order:11}.order-xl-12{-webkit-box-ordinal-group:13;-ms-flex-order:12;order:12}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.333333%}.offset-xl-2{margin-left:16.666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.333333%}.offset-xl-5{margin-left:41.666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.333333%}.offset-xl-8{margin-left:66.666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.333333%}.offset-xl-11{margin-left:91.666667%}}.table{width:100%;max-width:100%;margin-bottom:1rem;background-color:transparent}.table td,.table th{padding:.75rem;vertical-align:top;border-top:1px solid #dee2e6}.table thead th{vertical-align:bottom;border-bottom:2px solid #dee2e6}.table tbody+tbody{border-top:2px solid #dee2e6}.table .table{background-color:#fff}.table-sm td,.table-sm th{padding:.3rem}.table-bordered{border:1px solid #dee2e6}.table-bordered td,.table-bordered th{border:1px solid #dee2e6}.table-bordered thead td,.table-bordered thead th{border-bottom-width:2px}.table-striped tbody tr:nth-of-type(odd){background-color:rgba(0,0,0,.05)}.table-hover tbody tr:hover{background-color:rgba(0,0,0,.075)}.table-primary,.table-primary>td,.table-primary>th{background-color:#b8daff}.table-hover .table-primary:hover{background-color:#9fcdff}.table-hover .table-primary:hover>td,.table-hover .table-primary:hover>th{background-color:#9fcdff}.table-secondary,.table-secondary>td,.table-secondary>th{background-color:#d6d8db}.table-hover .table-secondary:hover{background-color:#c8cbcf}.table-hover .table-secondary:hover>td,.table-hover .table-secondary:hover>th{background-color:#c8cbcf}.table-success,.table-success>td,.table-success>th{background-color:#c3e6cb}.table-hover .table-success:hover{background-color:#b1dfbb}.table-hover .table-success:hover>td,.table-hover .table-success:hover>th{background-color:#b1dfbb}.table-info,.table-info>td,.table-info>th{background-color:#bee5eb}.table-hover .table-info:hover{background-color:#abdde5}.table-hover .table-info:hover>td,.table-hover .table-info:hover>th{background-color:#abdde5}.table-warning,.table-warning>td,.table-warning>th{background-color:#ffeeba}.table-hover .table-warning:hover{background-color:#ffe8a1}.table-hover .table-warning:hover>td,.table-hover .table-warning:hover>th{background-color:#ffe8a1}.table-danger,.table-danger>td,.table-danger>th{background-color:#f5c6cb}.table-hover .table-danger:hover{background-color:#f1b0b7}.table-hover .table-danger:hover>td,.table-hover .table-danger:hover>th{background-color:#f1b0b7}.table-light,.table-light>td,.table-light>th{background-color:#fdfdfe}.table-hover .table-light:hover{background-color:#ececf6}.table-hover .table-light:hover>td,.table-hover .table-light:hover>th{background-color:#ececf6}.table-dark,.table-dark>td,.table-dark>th{background-color:#c6c8ca}.table-hover .table-dark:hover{background-color:#b9bbbe}.table-hover .table-dark:hover>td,.table-hover .table-dark:hover>th{background-color:#b9bbbe}.table-active,.table-active>td,.table-active>th{background-color:rgba(0,0,0,.075)}.table-hover .table-active:hover{background-color:rgba(0,0,0,.075)}.table-hover .table-active:hover>td,.table-hover .table-active:hover>th{background-color:rgba(0,0,0,.075)}.table .thead-dark th{color:#fff;background-color:#212529;border-color:#32383e}.table .thead-light th{color:#495057;background-color:#e9ecef;border-color:#dee2e6}.table-dark{color:#fff;background-color:#212529}.table-dark td,.table-dark th,.table-dark thead th{border-color:#32383e}.table-dark.table-bordered{border:0}.table-dark.table-striped tbody tr:nth-of-type(odd){background-color:rgba(255,255,255,.05)}.table-dark.table-hover tbody tr:hover{background-color:rgba(255,255,255,.075)}@media (max-width:575.98px){.table-responsive-sm{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-sm>.table-bordered{border:0}}@media (max-width:767.98px){.table-responsive-md{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-md>.table-bordered{border:0}}@media (max-width:991.98px){.table-responsive-lg{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-lg>.table-bordered{border:0}}@media (max-width:1199.98px){.table-responsive-xl{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-xl>.table-bordered{border:0}}.table-responsive{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive>.table-bordered{border:0}.form-control{display:block;width:100%;padding:.375rem .75rem;font-size:1rem;line-height:1.5;color:#495057;background-color:#fff;background-clip:padding-box;border:1px solid #ced4da;border-radius:.25rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}.form-control::-ms-expand{background-color:transparent;border:0}.form-control:focus{color:#495057;background-color:#fff;border-color:#80bdff;outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.form-control::-webkit-input-placeholder{color:#6c757d;opacity:1}.form-control::-moz-placeholder{color:#6c757d;opacity:1}.form-control:-ms-input-placeholder{color:#6c757d;opacity:1}.form-control::-ms-input-placeholder{color:#6c757d;opacity:1}.form-control::placeholder{color:#6c757d;opacity:1}.form-control:disabled,.form-control[readonly]{background-color:#e9ecef;opacity:1}select.form-control:not([size]):not([multiple]){height:calc(2.25rem + 2px)}select.form-control:focus::-ms-value{color:#495057;background-color:#fff}.form-control-file,.form-control-range{display:block;width:100%}.col-form-label{padding-top:calc(.375rem + 1px);padding-bottom:calc(.375rem + 1px);margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + 1px);padding-bottom:calc(.5rem + 1px);font-size:1.25rem;line-height:1.5}.col-form-label-sm{padding-top:calc(.25rem + 1px);padding-bottom:calc(.25rem + 1px);font-size:.875rem;line-height:1.5}.form-control-plaintext{display:block;width:100%;padding-top:.375rem;padding-bottom:.375rem;margin-bottom:0;line-height:1.5;background-color:transparent;border:solid transparent;border-width:1px 0}.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm,.input-group-lg>.form-control-plaintext.form-control,.input-group-lg>.input-group-append>.form-control-plaintext.btn,.input-group-lg>.input-group-append>.form-control-plaintext.input-group-text,.input-group-lg>.input-group-prepend>.form-control-plaintext.btn,.input-group-lg>.input-group-prepend>.form-control-plaintext.input-group-text,.input-group-sm>.form-control-plaintext.form-control,.input-group-sm>.input-group-append>.form-control-plaintext.btn,.input-group-sm>.input-group-append>.form-control-plaintext.input-group-text,.input-group-sm>.input-group-prepend>.form-control-plaintext.btn,.input-group-sm>.input-group-prepend>.form-control-plaintext.input-group-text{padding-right:0;padding-left:0}.form-control-sm,.input-group-sm>.form-control,.input-group-sm>.input-group-append>.btn,.input-group-sm>.input-group-append>.input-group-text,.input-group-sm>.input-group-prepend>.btn,.input-group-sm>.input-group-prepend>.input-group-text{padding:.25rem .5rem;font-size:.875rem;line-height:1.5;border-radius:.2rem}.input-group-sm>.input-group-append>select.btn:not([size]):not([multiple]),.input-group-sm>.input-group-append>select.input-group-text:not([size]):not([multiple]),.input-group-sm>.input-group-prepend>select.btn:not([size]):not([multiple]),.input-group-sm>.input-group-prepend>select.input-group-text:not([size]):not([multiple]),.input-group-sm>select.form-control:not([size]):not([multiple]),select.form-control-sm:not([size]):not([multiple]){height:calc(1.8125rem + 2px)}.form-control-lg,.input-group-lg>.form-control,.input-group-lg>.input-group-append>.btn,.input-group-lg>.input-group-append>.input-group-text,.input-group-lg>.input-group-prepend>.btn,.input-group-lg>.input-group-prepend>.input-group-text{padding:.5rem 1rem;font-size:1.25rem;line-height:1.5;border-radius:.3rem}.input-group-lg>.input-group-append>select.btn:not([size]):not([multiple]),.input-group-lg>.input-group-append>select.input-group-text:not([size]):not([multiple]),.input-group-lg>.input-group-prepend>select.btn:not([size]):not([multiple]),.input-group-lg>.input-group-prepend>select.input-group-text:not([size]):not([multiple]),.input-group-lg>select.form-control:not([size]):not([multiple]),select.form-control-lg:not([size]):not([multiple]){height:calc(2.875rem + 2px)}.form-group{margin-bottom:1rem}.form-text{display:block;margin-top:.25rem}.form-row{display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-right:-5px;margin-left:-5px}.form-row>.col,.form-row>[class*=col-]{padding-right:5px;padding-left:5px}.form-check{position:relative;display:block;padding-left:1.25rem}.form-check-input{position:absolute;margin-top:.3rem;margin-left:-1.25rem}.form-check-input:disabled~.form-check-label{color:#6c757d}.form-check-label{margin-bottom:0}.form-check-inline{display:-webkit-inline-box;display:-ms-inline-flexbox;display:inline-flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center;padding-left:0;margin-right:.75rem}.form-check-inline .form-check-input{position:static;margin-top:0;margin-right:.3125rem;margin-left:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:80%;color:#28a745}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.5rem;margin-top:.1rem;font-size:.875rem;line-height:1;color:#fff;background-color:rgba(40,167,69,.8);border-radius:.2rem}.custom-select.is-valid,.form-control.is-valid,.was-validated .custom-select:valid,.was-validated .form-control:valid{border-color:#28a745}.custom-select.is-valid:focus,.form-control.is-valid:focus,.was-validated .custom-select:valid:focus,.was-validated .form-control:valid:focus{border-color:#28a745;box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.custom-select.is-valid~.valid-feedback,.custom-select.is-valid~.valid-tooltip,.form-control.is-valid~.valid-feedback,.form-control.is-valid~.valid-tooltip,.was-validated .custom-select:valid~.valid-feedback,.was-validated .custom-select:valid~.valid-tooltip,.was-validated .form-control:valid~.valid-feedback,.was-validated .form-control:valid~.valid-tooltip{display:block}.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:#28a745}.form-check-input.is-valid~.valid-feedback,.form-check-input.is-valid~.valid-tooltip,.was-validated .form-check-input:valid~.valid-feedback,.was-validated .form-check-input:valid~.valid-tooltip{display:block}.custom-control-input.is-valid~.custom-control-label,.was-validated .custom-control-input:valid~.custom-control-label{color:#28a745}.custom-control-input.is-valid~.custom-control-label::before,.was-validated .custom-control-input:valid~.custom-control-label::before{background-color:#71dd8a}.custom-control-input.is-valid~.valid-feedback,.custom-control-input.is-valid~.valid-tooltip,.was-validated .custom-control-input:valid~.valid-feedback,.was-validated .custom-control-input:valid~.valid-tooltip{display:block}.custom-control-input.is-valid:checked~.custom-control-label::before,.was-validated .custom-control-input:valid:checked~.custom-control-label::before{background-color:#34ce57}.custom-control-input.is-valid:focus~.custom-control-label::before,.was-validated .custom-control-input:valid:focus~.custom-control-label::before{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(40,167,69,.25)}.custom-file-input.is-valid~.custom-file-label,.was-validated .custom-file-input:valid~.custom-file-label{border-color:#28a745}.custom-file-input.is-valid~.custom-file-label::before,.was-validated .custom-file-input:valid~.custom-file-label::before{border-color:inherit}.custom-file-input.is-valid~.valid-feedback,.custom-file-input.is-valid~.valid-tooltip,.was-validated .custom-file-input:valid~.valid-feedback,.was-validated .custom-file-input:valid~.valid-tooltip{display:block}.custom-file-input.is-valid:focus~.custom-file-label,.was-validated .custom-file-input:valid:focus~.custom-file-label{box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:80%;color:#dc3545}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.5rem;margin-top:.1rem;font-size:.875rem;line-height:1;color:#fff;background-color:rgba(220,53,69,.8);border-radius:.2rem}.custom-select.is-invalid,.form-control.is-invalid,.was-validated .custom-select:invalid,.was-validated .form-control:invalid{border-color:#dc3545}.custom-select.is-invalid:focus,.form-control.is-invalid:focus,.was-validated .custom-select:invalid:focus,.was-validated .form-control:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.custom-select.is-invalid~.invalid-feedback,.custom-select.is-invalid~.invalid-tooltip,.form-control.is-invalid~.invalid-feedback,.form-control.is-invalid~.invalid-tooltip,.was-validated .custom-select:invalid~.invalid-feedback,.was-validated .custom-select:invalid~.invalid-tooltip,.was-validated .form-control:invalid~.invalid-feedback,.was-validated .form-control:invalid~.invalid-tooltip{display:block}.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:#dc3545}.form-check-input.is-invalid~.invalid-feedback,.form-check-input.is-invalid~.invalid-tooltip,.was-validated .form-check-input:invalid~.invalid-feedback,.was-validated .form-check-input:invalid~.invalid-tooltip{display:block}.custom-control-input.is-invalid~.custom-control-label,.was-validated .custom-control-input:invalid~.custom-control-label{color:#dc3545}.custom-control-input.is-invalid~.custom-control-label::before,.was-validated .custom-control-input:invalid~.custom-control-label::before{background-color:#efa2a9}.custom-control-input.is-invalid~.invalid-feedback,.custom-control-input.is-invalid~.invalid-tooltip,.was-validated .custom-control-input:invalid~.invalid-feedback,.was-validated .custom-control-input:invalid~.invalid-tooltip{display:block}.custom-control-input.is-invalid:checked~.custom-control-label::before,.was-validated .custom-control-input:invalid:checked~.custom-control-label::before{background-color:#e4606d}.custom-control-input.is-invalid:focus~.custom-control-label::before,.was-validated .custom-control-input:invalid:focus~.custom-control-label::before{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(220,53,69,.25)}.custom-file-input.is-invalid~.custom-file-label,.was-validated .custom-file-input:invalid~.custom-file-label{border-color:#dc3545}.custom-file-input.is-invalid~.custom-file-label::before,.was-validated .custom-file-input:invalid~.custom-file-label::before{border-color:inherit}.custom-file-input.is-invalid~.invalid-feedback,.custom-file-input.is-invalid~.invalid-tooltip,.was-validated .custom-file-input:invalid~.invalid-feedback,.was-validated .custom-file-input:invalid~.invalid-tooltip{display:block}.custom-file-input.is-invalid:focus~.custom-file-label,.was-validated .custom-file-input:invalid:focus~.custom-file-label{box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.form-inline{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row wrap;flex-flow:row wrap;-webkit-box-align:center;-ms-flex-align:center;align-items:center}.form-inline .form-check{width:100%}@media (min-width:576px){.form-inline label{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:center;-ms-flex-pack:center;justify-content:center;margin-bottom:0}.form-inline .form-group{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row wrap;flex-flow:row wrap;-webkit-box-align:center;-ms-flex-align:center;align-items:center;margin-bottom:0}.form-inline .form-control{display:inline-block;width:auto;vertical-align:middle}.form-inline .form-control-plaintext{display:inline-block}.form-inline .input-group{width:auto}.form-inline .form-check{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:center;-ms-flex-pack:center;justify-content:center;width:auto;padding-left:0}.form-inline .form-check-input{position:relative;margin-top:0;margin-right:.25rem;margin-left:0}.form-inline .custom-control{-webkit-box-align:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:center;-ms-flex-pack:center;justify-content:center}.form-inline .custom-control-label{margin-bottom:0}}.btn{display:inline-block;font-weight:400;text-align:center;white-space:nowrap;vertical-align:middle;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;border:1px solid transparent;padding:.375rem .75rem;font-size:1rem;line-height:1.5;border-radius:.25rem;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}.btn:focus,.btn:hover{text-decoration:none}.btn.focus,.btn:focus{outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.btn.disabled,.btn:disabled{opacity:.65}.btn:not(:disabled):not(.disabled){cursor:pointer}.btn:not(:disabled):not(.disabled).active,.btn:not(:disabled):not(.disabled):active{background-image:none}a.btn.disabled,fieldset:disabled a.btn{pointer-events:none}.btn-primary{color:#fff;background-color:#007bff;border-color:#007bff}.btn-primary:hover{color:#fff;background-color:#0069d9;border-color:#0062cc}.btn-primary.focus,.btn-primary:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-primary.disabled,.btn-primary:disabled{color:#fff;background-color:#007bff;border-color:#007bff}.btn-primary:not(:disabled):not(.disabled).active,.btn-primary:not(:disabled):not(.disabled):active,.show>.btn-primary.dropdown-toggle{color:#fff;background-color:#0062cc;border-color:#005cbf}.btn-primary:not(:disabled):not(.disabled).active:focus,.btn-primary:not(:disabled):not(.disabled):active:focus,.show>.btn-primary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-secondary{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-secondary:hover{color:#fff;background-color:#5a6268;border-color:#545b62}.btn-secondary.focus,.btn-secondary:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-secondary.disabled,.btn-secondary:disabled{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-secondary:not(:disabled):not(.disabled).active,.btn-secondary:not(:disabled):not(.disabled):active,.show>.btn-secondary.dropdown-toggle{color:#fff;background-color:#545b62;border-color:#4e555b}.btn-secondary:not(:disabled):not(.disabled).active:focus,.btn-secondary:not(:disabled):not(.disabled):active:focus,.show>.btn-secondary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-success{color:#fff;background-color:#28a745;border-color:#28a745}.btn-success:hover{color:#fff;background-color:#218838;border-color:#1e7e34}.btn-success.focus,.btn-success:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-success.disabled,.btn-success:disabled{color:#fff;background-color:#28a745;border-color:#28a745}.btn-success:not(:disabled):not(.disabled).active,.btn-success:not(:disabled):not(.disabled):active,.show>.btn-success.dropdown-toggle{color:#fff;background-color:#1e7e34;border-color:#1c7430}.btn-success:not(:disabled):not(.disabled).active:focus,.btn-success:not(:disabled):not(.disabled):active:focus,.show>.btn-success.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-info{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-info:hover{color:#fff;background-color:#138496;border-color:#117a8b}.btn-info.focus,.btn-info:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-info.disabled,.btn-info:disabled{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-info:not(:disabled):not(.disabled).active,.btn-info:not(:disabled):not(.disabled):active,.show>.btn-info.dropdown-toggle{color:#fff;background-color:#117a8b;border-color:#10707f}.btn-info:not(:disabled):not(.disabled).active:focus,.btn-info:not(:disabled):not(.disabled):active:focus,.show>.btn-info.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-warning{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-warning:hover{color:#212529;background-color:#e0a800;border-color:#d39e00}.btn-warning.focus,.btn-warning:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-warning.disabled,.btn-warning:disabled{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-warning:not(:disabled):not(.disabled).active,.btn-warning:not(:disabled):not(.disabled):active,.show>.btn-warning.dropdown-toggle{color:#212529;background-color:#d39e00;border-color:#c69500}.btn-warning:not(:disabled):not(.disabled).active:focus,.btn-warning:not(:disabled):not(.disabled):active:focus,.show>.btn-warning.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-danger{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-danger:hover{color:#fff;background-color:#c82333;border-color:#bd2130}.btn-danger.focus,.btn-danger:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-danger.disabled,.btn-danger:disabled{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-danger:not(:disabled):not(.disabled).active,.btn-danger:not(:disabled):not(.disabled):active,.show>.btn-danger.dropdown-toggle{color:#fff;background-color:#bd2130;border-color:#b21f2d}.btn-danger:not(:disabled):not(.disabled).active:focus,.btn-danger:not(:disabled):not(.disabled):active:focus,.show>.btn-danger.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-light{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-light:hover{color:#212529;background-color:#e2e6ea;border-color:#dae0e5}.btn-light.focus,.btn-light:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-light.disabled,.btn-light:disabled{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-light:not(:disabled):not(.disabled).active,.btn-light:not(:disabled):not(.disabled):active,.show>.btn-light.dropdown-toggle{color:#212529;background-color:#dae0e5;border-color:#d3d9df}.btn-light:not(:disabled):not(.disabled).active:focus,.btn-light:not(:disabled):not(.disabled):active:focus,.show>.btn-light.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-dark{color:#fff;background-color:#343a40;border-color:#343a40}.btn-dark:hover{color:#fff;background-color:#23272b;border-color:#1d2124}.btn-dark.focus,.btn-dark:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-dark.disabled,.btn-dark:disabled{color:#fff;background-color:#343a40;border-color:#343a40}.btn-dark:not(:disabled):not(.disabled).active,.btn-dark:not(:disabled):not(.disabled):active,.show>.btn-dark.dropdown-toggle{color:#fff;background-color:#1d2124;border-color:#171a1d}.btn-dark:not(:disabled):not(.disabled).active:focus,.btn-dark:not(:disabled):not(.disabled):active:focus,.show>.btn-dark.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-outline-primary{color:#007bff;background-color:transparent;background-image:none;border-color:#007bff}.btn-outline-primary:hover{color:#fff;background-color:#007bff;border-color:#007bff}.btn-outline-primary.focus,.btn-outline-primary:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-outline-primary.disabled,.btn-outline-primary:disabled{color:#007bff;background-color:transparent}.btn-outline-primary:not(:disabled):not(.disabled).active,.btn-outline-primary:not(:disabled):not(.disabled):active,.show>.btn-outline-primary.dropdown-toggle{color:#fff;background-color:#007bff;border-color:#007bff}.btn-outline-primary:not(:disabled):not(.disabled).active:focus,.btn-outline-primary:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-primary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-outline-secondary{color:#6c757d;background-color:transparent;background-image:none;border-color:#6c757d}.btn-outline-secondary:hover{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-outline-secondary.focus,.btn-outline-secondary:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-outline-secondary.disabled,.btn-outline-secondary:disabled{color:#6c757d;background-color:transparent}.btn-outline-secondary:not(:disabled):not(.disabled).active,.btn-outline-secondary:not(:disabled):not(.disabled):active,.show>.btn-outline-secondary.dropdown-toggle{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-outline-secondary:not(:disabled):not(.disabled).active:focus,.btn-outline-secondary:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-secondary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-outline-success{color:#28a745;background-color:transparent;background-image:none;border-color:#28a745}.btn-outline-success:hover{color:#fff;background-color:#28a745;border-color:#28a745}.btn-outline-success.focus,.btn-outline-success:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-outline-success.disabled,.btn-outline-success:disabled{color:#28a745;background-color:transparent}.btn-outline-success:not(:disabled):not(.disabled).active,.btn-outline-success:not(:disabled):not(.disabled):active,.show>.btn-outline-success.dropdown-toggle{color:#fff;background-color:#28a745;border-color:#28a745}.btn-outline-success:not(:disabled):not(.disabled).active:focus,.btn-outline-success:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-success.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-outline-info{color:#17a2b8;background-color:transparent;background-image:none;border-color:#17a2b8}.btn-outline-info:hover{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-outline-info.focus,.btn-outline-info:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-outline-info.disabled,.btn-outline-info:disabled{color:#17a2b8;background-color:transparent}.btn-outline-info:not(:disabled):not(.disabled).active,.btn-outline-info:not(:disabled):not(.disabled):active,.show>.btn-outline-info.dropdown-toggle{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-outline-info:not(:disabled):not(.disabled).active:focus,.btn-outline-info:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-info.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-outline-warning{color:#ffc107;background-color:transparent;background-image:none;border-color:#ffc107}.btn-outline-warning:hover{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-outline-warning.focus,.btn-outline-warning:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-outline-warning.disabled,.btn-outline-warning:disabled{color:#ffc107;background-color:transparent}.btn-outline-warning:not(:disabled):not(.disabled).active,.btn-outline-warning:not(:disabled):not(.disabled):active,.show>.btn-outline-warning.dropdown-toggle{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-outline-warning:not(:disabled):not(.disabled).active:focus,.btn-outline-warning:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-warning.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-outline-danger{color:#dc3545;background-color:transparent;background-image:none;border-color:#dc3545}.btn-outline-danger:hover{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-outline-danger.focus,.btn-outline-danger:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-outline-danger.disabled,.btn-outline-danger:disabled{color:#dc3545;background-color:transparent}.btn-outline-danger:not(:disabled):not(.disabled).active,.btn-outline-danger:not(:disabled):not(.disabled):active,.show>.btn-outline-danger.dropdown-toggle{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-outline-danger:not(:disabled):not(.disabled).active:focus,.btn-outline-danger:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-danger.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-outline-light{color:#f8f9fa;background-color:transparent;background-image:none;border-color:#f8f9fa}.btn-outline-light:hover{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-outline-light.focus,.btn-outline-light:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-outline-light.disabled,.btn-outline-light:disabled{color:#f8f9fa;background-color:transparent}.btn-outline-light:not(:disabled):not(.disabled).active,.btn-outline-light:not(:disabled):not(.disabled):active,.show>.btn-outline-light.dropdown-toggle{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-outline-light:not(:disabled):not(.disabled).active:focus,.btn-outline-light:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-light.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-outline-dark{color:#343a40;background-color:transparent;background-image:none;border-color:#343a40}.btn-outline-dark:hover{color:#fff;background-color:#343a40;border-color:#343a40}.btn-outline-dark.focus,.btn-outline-dark:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-outline-dark.disabled,.btn-outline-dark:disabled{color:#343a40;background-color:transparent}.btn-outline-dark:not(:disabled):not(.disabled).active,.btn-outline-dark:not(:disabled):not(.disabled):active,.show>.btn-outline-dark.dropdown-toggle{color:#fff;background-color:#343a40;border-color:#343a40}.btn-outline-dark:not(:disabled):not(.disabled).active:focus,.btn-outline-dark:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-dark.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-link{font-weight:400;color:#007bff;background-color:transparent}.btn-link:hover{color:#0056b3;text-decoration:underline;background-color:transparent;border-color:transparent}.btn-link.focus,.btn-link:focus{text-decoration:underline;border-color:transparent;box-shadow:none}.btn-link.disabled,.btn-link:disabled{color:#6c757d}.btn-group-lg>.btn,.btn-lg{padding:.5rem 1rem;font-size:1.25rem;line-height:1.5;border-radius:.3rem}.btn-group-sm>.btn,.btn-sm{padding:.25rem .5rem;font-size:.875rem;line-height:1.5;border-radius:.2rem}.btn-block{display:block;width:100%}.btn-block+.btn-block{margin-top:.5rem}input[type=button].btn-block,input[type=reset].btn-block,input[type=submit].btn-block{width:100%}.fade{opacity:0;transition:opacity .15s linear}.fade.show{opacity:1}.collapse{display:none}.collapse.show{display:block}tr.collapse.show{display:table-row}tbody.collapse.show{display:table-row-group}.collapsing{position:relative;height:0;overflow:hidden;transition:height .35s ease}.dropdown,.dropup{position:relative}.dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{position:absolute;top:100%;left:0;z-index:1000;display:none;float:left;min-width:10rem;padding:.5rem 0;margin:.125rem 0 0;font-size:1rem;color:#212529;text-align:left;list-style:none;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.15);border-radius:.25rem}.dropup .dropdown-menu{margin-top:0;margin-bottom:.125rem}.dropup .dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropright .dropdown-menu{margin-top:0;margin-left:.125rem}.dropright .dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-bottom:.3em solid transparent;border-left:.3em solid}.dropright .dropdown-toggle:empty::after{margin-left:0}.dropright .dropdown-toggle::after{vertical-align:0}.dropleft .dropdown-menu{margin-top:0;margin-right:.125rem}.dropleft .dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:""}.dropleft .dropdown-toggle::after{display:none}.dropleft .dropdown-toggle::before{display:inline-block;width:0;height:0;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropleft .dropdown-toggle:empty::after{margin-left:0}.dropleft .dropdown-toggle::before{vertical-align:0}.dropdown-divider{height:0;margin:.5rem 0;overflow:hidden;border-top:1px solid #e9ecef}.dropdown-item{display:block;width:100%;padding:.25rem 1.5rem;clear:both;font-weight:400;color:#212529;text-align:inherit;white-space:nowrap;background-color:transparent;border:0}.dropdown-item:focus,.dropdown-item:hover{color:#16181b;text-decoration:none;background-color:#f8f9fa}.dropdown-item.active,.dropdown-item:active{color:#fff;text-decoration:none;background-color:#007bff}.dropdown-item.disabled,.dropdown-item:disabled{color:#6c757d;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:.5rem 1.5rem;margin-bottom:0;font-size:.875rem;color:#6c757d;white-space:nowrap}.btn-group,.btn-group-vertical{position:relative;display:-webkit-inline-box;display:-ms-inline-flexbox;display:inline-flex;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;-webkit-box-flex:0;-ms-flex:0 1 auto;flex:0 1 auto}.btn-group-vertical>.btn:hover,.btn-group>.btn:hover{z-index:1}.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus{z-index:1}.btn-group .btn+.btn,.btn-group .btn+.btn-group,.btn-group .btn-group+.btn,.btn-group .btn-group+.btn-group,.btn-group-vertical .btn+.btn,.btn-group-vertical .btn+.btn-group,.btn-group-vertical .btn-group+.btn,.btn-group-vertical .btn-group+.btn-group{margin-left:-1px}.btn-toolbar{display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-webkit-box-pack:start;-ms-flex-pack:start;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group>.btn:first-child{margin-left:0}.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after{margin-left:0}.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;-webkit-box-align:start;-ms-flex-align:start;align-items:flex-start;-webkit-box-pack:center;-ms-flex-pack:center;justify-content:center}.btn-group-vertical .btn,.btn-group-vertical .btn-group{width:100%}.btn-group-vertical>.btn+.btn,.btn-group-vertical>.btn+.btn-group,.btn-group-vertical>.btn-group+.btn,.btn-group-vertical>.btn-group+.btn-group{margin-top:-1px;margin-left:0}.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn:not(:first-child){border-top-left-radius:0;border-top-right-radius:0}.btn-group-toggle>.btn,.btn-group-toggle>.btn-group>.btn{margin-bottom:0}.btn-group-toggle>.btn input[type=checkbox],.btn-group-toggle>.btn input[type=radio],.btn-group-toggle>.btn-group>.btn input[type=checkbox],.btn-group-toggle>.btn-group>.btn input[type=radio]{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.input-group{position:relative;display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-webkit-box-align:stretch;-ms-flex-align:stretch;align-items:stretch;width:100%}.input-group>.custom-file,.input-group>.custom-select,.input-group>.form-control{position:relative;-webkit-box-flex:1;-ms-flex:1 1 auto;flex:1 1 auto;width:1%;margin-bottom:0}.input-group>.custom-file:focus,.input-group>.custom-select:focus,.input-group>.form-control:focus{z-index:3}.input-group>.custom-file+.custom-file,.input-group>.custom-file+.custom-select,.input-group>.custom-file+.form-control,.input-group>.custom-select+.custom-file,.input-group>.custom-select+.custom-select,.input-group>.custom-select+.form-control,.input-group>.form-control+.custom-file,.input-group>.form-control+.custom-select,.input-group>.form-control+.form-control{margin-left:-1px}.input-group>.custom-select:not(:last-child),.input-group>.form-control:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.custom-select:not(:first-child),.input-group>.form-control:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.custom-file{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center}.input-group>.custom-file:not(:last-child) .custom-file-label,.input-group>.custom-file:not(:last-child) .custom-file-label::before{border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.custom-file:not(:first-child) .custom-file-label,.input-group>.custom-file:not(:first-child) .custom-file-label::before{border-top-left-radius:0;border-bottom-left-radius:0}.input-group-append,.input-group-prepend{display:-webkit-box;display:-ms-flexbox;display:flex}.input-group-append .btn,.input-group-prepend .btn{position:relative;z-index:2}.input-group-append .btn+.btn,.input-group-append .btn+.input-group-text,.input-group-append .input-group-text+.btn,.input-group-append .input-group-text+.input-group-text,.input-group-prepend .btn+.btn,.input-group-prepend .btn+.input-group-text,.input-group-prepend .input-group-text+.btn,.input-group-prepend .input-group-text+.input-group-text{margin-left:-1px}.input-group-prepend{margin-right:-1px}.input-group-append{margin-left:-1px}.input-group-text{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center;padding:.375rem .75rem;margin-bottom:0;font-size:1rem;font-weight:400;line-height:1.5;color:#495057;text-align:center;white-space:nowrap;background-color:#e9ecef;border:1px solid #ced4da;border-radius:.25rem}.input-group-text input[type=checkbox],.input-group-text input[type=radio]{margin-top:0}.input-group>.input-group-append:last-child>.btn:not(:last-child):not(.dropdown-toggle),.input-group>.input-group-append:last-child>.input-group-text:not(:last-child),.input-group>.input-group-append:not(:last-child)>.btn,.input-group>.input-group-append:not(:last-child)>.input-group-text,.input-group>.input-group-prepend>.btn,.input-group>.input-group-prepend>.input-group-text{border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.input-group-append>.btn,.input-group>.input-group-append>.input-group-text,.input-group>.input-group-prepend:first-child>.btn:not(:first-child),.input-group>.input-group-prepend:first-child>.input-group-text:not(:first-child),.input-group>.input-group-prepend:not(:first-child)>.btn,.input-group>.input-group-prepend:not(:first-child)>.input-group-text{border-top-left-radius:0;border-bottom-left-radius:0}.custom-control{position:relative;display:block;min-height:1.5rem;padding-left:1.5rem}.custom-control-inline{display:-webkit-inline-box;display:-ms-inline-flexbox;display:inline-flex;margin-right:1rem}.custom-control-input{position:absolute;z-index:-1;opacity:0}.custom-control-input:checked~.custom-control-label::before{color:#fff;background-color:#007bff}.custom-control-input:focus~.custom-control-label::before{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-control-input:active~.custom-control-label::before{color:#fff;background-color:#b3d7ff}.custom-control-input:disabled~.custom-control-label{color:#6c757d}.custom-control-input:disabled~.custom-control-label::before{background-color:#e9ecef}.custom-control-label{margin-bottom:0}.custom-control-label::before{position:absolute;top:.25rem;left:0;display:block;width:1rem;height:1rem;pointer-events:none;content:"";-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;background-color:#dee2e6}.custom-control-label::after{position:absolute;top:.25rem;left:0;display:block;width:1rem;height:1rem;content:"";background-repeat:no-repeat;background-position:center center;background-size:50% 50%}.custom-checkbox .custom-control-label::before{border-radius:.25rem}.custom-checkbox .custom-control-input:checked~.custom-control-label::before{background-color:#007bff}.custom-checkbox .custom-control-input:checked~.custom-control-label::after{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E")}.custom-checkbox .custom-control-input:indeterminate~.custom-control-label::before{background-color:#007bff}.custom-checkbox .custom-control-input:indeterminate~.custom-control-label::after{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 4'%3E%3Cpath stroke='%23fff' d='M0 2h4'/%3E%3C/svg%3E")}.custom-checkbox .custom-control-input:disabled:checked~.custom-control-label::before{background-color:rgba(0,123,255,.5)}.custom-checkbox .custom-control-input:disabled:indeterminate~.custom-control-label::before{background-color:rgba(0,123,255,.5)}.custom-radio .custom-control-label::before{border-radius:50%}.custom-radio .custom-control-input:checked~.custom-control-label::before{background-color:#007bff}.custom-radio .custom-control-input:checked~.custom-control-label::after{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3E%3Ccircle r='3' fill='%23fff'/%3E%3C/svg%3E")}.custom-radio .custom-control-input:disabled:checked~.custom-control-label::before{background-color:rgba(0,123,255,.5)}.custom-select{display:inline-block;width:100%;height:calc(2.25rem + 2px);padding:.375rem 1.75rem .375rem .75rem;line-height:1.5;color:#495057;vertical-align:middle;background:#fff url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3E%3Cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3E%3C/svg%3E") no-repeat right .75rem center;background-size:8px 10px;border:1px solid #ced4da;border-radius:.25rem;-webkit-appearance:none;-moz-appearance:none;appearance:none}.custom-select:focus{border-color:#80bdff;outline:0;box-shadow:inset 0 1px 2px rgba(0,0,0,.075),0 0 5px rgba(128,189,255,.5)}.custom-select:focus::-ms-value{color:#495057;background-color:#fff}.custom-select[multiple],.custom-select[size]:not([size="1"]){height:auto;padding-right:.75rem;background-image:none}.custom-select:disabled{color:#6c757d;background-color:#e9ecef}.custom-select::-ms-expand{opacity:0}.custom-select-sm{height:calc(1.8125rem + 2px);padding-top:.375rem;padding-bottom:.375rem;font-size:75%}.custom-select-lg{height:calc(2.875rem + 2px);padding-top:.375rem;padding-bottom:.375rem;font-size:125%}.custom-file{position:relative;display:inline-block;width:100%;height:calc(2.25rem + 2px);margin-bottom:0}.custom-file-input{position:relative;z-index:2;width:100%;height:calc(2.25rem + 2px);margin:0;opacity:0}.custom-file-input:focus~.custom-file-control{border-color:#80bdff;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.custom-file-input:focus~.custom-file-control::before{border-color:#80bdff}.custom-file-input:lang(en)~.custom-file-label::after{content:"Browse"}.custom-file-label{position:absolute;top:0;right:0;left:0;z-index:1;height:calc(2.25rem + 2px);padding:.375rem .75rem;line-height:1.5;color:#495057;background-color:#fff;border:1px solid #ced4da;border-radius:.25rem}.custom-file-label::after{position:absolute;top:0;right:0;bottom:0;z-index:3;display:block;height:calc(calc(2.25rem + 2px) - 1px * 2);padding:.375rem .75rem;line-height:1.5;color:#495057;content:"Browse";background-color:#e9ecef;border-left:1px solid #ced4da;border-radius:0 .25rem .25rem 0}.nav{display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:.5rem 1rem}.nav-link:focus,.nav-link:hover{text-decoration:none}.nav-link.disabled{color:#6c757d}.nav-tabs{border-bottom:1px solid #dee2e6}.nav-tabs .nav-item{margin-bottom:-1px}.nav-tabs .nav-link{border:1px solid transparent;border-top-left-radius:.25rem;border-top-right-radius:.25rem}.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{border-color:#e9ecef #e9ecef #dee2e6}.nav-tabs .nav-link.disabled{color:#6c757d;background-color:transparent;border-color:transparent}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{color:#495057;background-color:#fff;border-color:#dee2e6 #dee2e6 #fff}.nav-tabs .dropdown-menu{margin-top:-1px;border-top-left-radius:0;border-top-right-radius:0}.nav-pills .nav-link{border-radius:.25rem}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:#fff;background-color:#007bff}.nav-fill .nav-item{-webkit-box-flex:1;-ms-flex:1 1 auto;flex:1 1 auto;text-align:center}.nav-justified .nav-item{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;text-align:center}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{position:relative;display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-webkit-box-align:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:justify;-ms-flex-pack:justify;justify-content:space-between;padding:.5rem 1rem}.navbar>.container,.navbar>.container-fluid{display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-webkit-box-align:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:justify;-ms-flex-pack:justify;justify-content:space-between}.navbar-brand{display:inline-block;padding-top:.3125rem;padding-bottom:.3125rem;margin-right:1rem;font-size:1.25rem;line-height:inherit;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{text-decoration:none}.navbar-nav{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link{padding-right:0;padding-left:0}.navbar-nav .dropdown-menu{position:static;float:none}.navbar-text{display:inline-block;padding-top:.5rem;padding-bottom:.5rem}.navbar-collapse{-ms-flex-preferred-size:100%;flex-basis:100%;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;-webkit-box-align:center;-ms-flex-align:center;align-items:center}.navbar-toggler{padding:.25rem .75rem;font-size:1.25rem;line-height:1;background-color:transparent;border:1px solid transparent;border-radius:.25rem}.navbar-toggler:focus,.navbar-toggler:hover{text-decoration:none}.navbar-toggler:not(:disabled):not(.disabled){cursor:pointer}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;content:"";background:no-repeat center center;background-size:100% 100%}@media (max-width:575.98px){.navbar-expand-sm>.container,.navbar-expand-sm>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:576px){.navbar-expand-sm{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row nowrap;flex-flow:row nowrap;-webkit-box-pack:start;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-sm .navbar-nav{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-direction:row;flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .dropdown-menu-right{right:0;left:auto}.navbar-expand-sm .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-sm>.container,.navbar-expand-sm>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-sm .navbar-collapse{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}.navbar-expand-sm .dropup .dropdown-menu{top:auto;bottom:100%}}@media (max-width:767.98px){.navbar-expand-md>.container,.navbar-expand-md>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:768px){.navbar-expand-md{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row nowrap;flex-flow:row nowrap;-webkit-box-pack:start;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-md .navbar-nav{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-direction:row;flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .dropdown-menu-right{right:0;left:auto}.navbar-expand-md .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-md>.container,.navbar-expand-md>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-md .navbar-collapse{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}.navbar-expand-md .dropup .dropdown-menu{top:auto;bottom:100%}}@media (max-width:991.98px){.navbar-expand-lg>.container,.navbar-expand-lg>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:992px){.navbar-expand-lg{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row nowrap;flex-flow:row nowrap;-webkit-box-pack:start;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-lg .navbar-nav{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-direction:row;flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .dropdown-menu-right{right:0;left:auto}.navbar-expand-lg .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-lg>.container,.navbar-expand-lg>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-lg .navbar-collapse{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}.navbar-expand-lg .dropup .dropdown-menu{top:auto;bottom:100%}}@media (max-width:1199.98px){.navbar-expand-xl>.container,.navbar-expand-xl>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:1200px){.navbar-expand-xl{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row nowrap;flex-flow:row nowrap;-webkit-box-pack:start;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-xl .navbar-nav{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-direction:row;flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .dropdown-menu-right{right:0;left:auto}.navbar-expand-xl .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-xl>.container,.navbar-expand-xl>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-xl .navbar-collapse{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}.navbar-expand-xl .dropup .dropdown-menu{top:auto;bottom:100%}}.navbar-expand{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row nowrap;flex-flow:row nowrap;-webkit-box-pack:start;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand>.container,.navbar-expand>.container-fluid{padding-right:0;padding-left:0}.navbar-expand .navbar-nav{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-direction:row;flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .dropdown-menu-right{right:0;left:auto}.navbar-expand .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand>.container,.navbar-expand>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand .navbar-collapse{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-expand .dropup .dropdown-menu{top:auto;bottom:100%}.navbar-light .navbar-brand{color:rgba(0,0,0,.9)}.navbar-light .navbar-brand:focus,.navbar-light .navbar-brand:hover{color:rgba(0,0,0,.9)}.navbar-light .navbar-nav .nav-link{color:rgba(0,0,0,.5)}.navbar-light .navbar-nav .nav-link:focus,.navbar-light .navbar-nav .nav-link:hover{color:rgba(0,0,0,.7)}.navbar-light .navbar-nav .nav-link.disabled{color:rgba(0,0,0,.3)}.navbar-light .navbar-nav .active>.nav-link,.navbar-light .navbar-nav .nav-link.active,.navbar-light .navbar-nav .nav-link.show,.navbar-light .navbar-nav .show>.nav-link{color:rgba(0,0,0,.9)}.navbar-light .navbar-toggler{color:rgba(0,0,0,.5);border-color:rgba(0,0,0,.1)}.navbar-light .navbar-toggler-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(0, 0, 0, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E")}.navbar-light .navbar-text{color:rgba(0,0,0,.5)}.navbar-light .navbar-text a{color:rgba(0,0,0,.9)}.navbar-light .navbar-text a:focus,.navbar-light .navbar-text a:hover{color:rgba(0,0,0,.9)}.navbar-dark .navbar-brand{color:#fff}.navbar-dark .navbar-brand:focus,.navbar-dark .navbar-brand:hover{color:#fff}.navbar-dark .navbar-nav .nav-link{color:rgba(255,255,255,.5)}.navbar-dark .navbar-nav .nav-link:focus,.navbar-dark .navbar-nav .nav-link:hover{color:rgba(255,255,255,.75)}.navbar-dark .navbar-nav .nav-link.disabled{color:rgba(255,255,255,.25)}.navbar-dark .navbar-nav .active>.nav-link,.navbar-dark .navbar-nav .nav-link.active,.navbar-dark .navbar-nav .nav-link.show,.navbar-dark .navbar-nav .show>.nav-link{color:#fff}.navbar-dark .navbar-toggler{color:rgba(255,255,255,.5);border-color:rgba(255,255,255,.1)}.navbar-dark .navbar-toggler-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(255, 255, 255, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E")}.navbar-dark .navbar-text{color:rgba(255,255,255,.5)}.navbar-dark .navbar-text a{color:#fff}.navbar-dark .navbar-text a:focus,.navbar-dark .navbar-text a:hover{color:#fff}.card{position:relative;display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;min-width:0;word-wrap:break-word;background-color:#fff;background-clip:border-box;border:1px solid rgba(0,0,0,.125);border-radius:.25rem}.card>hr{margin-right:0;margin-left:0}.card>.list-group:first-child .list-group-item:first-child{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.card>.list-group:last-child .list-group-item:last-child{border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.card-body{-webkit-box-flex:1;-ms-flex:1 1 auto;flex:1 1 auto;padding:1.25rem}.card-title{margin-bottom:.75rem}.card-subtitle{margin-top:-.375rem;margin-bottom:0}.card-text:last-child{margin-bottom:0}.card-link:hover{text-decoration:none}.card-link+.card-link{margin-left:1.25rem}.card-header{padding:.75rem 1.25rem;margin-bottom:0;background-color:rgba(0,0,0,.03);border-bottom:1px solid rgba(0,0,0,.125)}.card-header:first-child{border-radius:calc(.25rem - 1px) calc(.25rem - 1px) 0 0}.card-header+.list-group .list-group-item:first-child{border-top:0}.card-footer{padding:.75rem 1.25rem;background-color:rgba(0,0,0,.03);border-top:1px solid rgba(0,0,0,.125)}.card-footer:last-child{border-radius:0 0 calc(.25rem - 1px) calc(.25rem - 1px)}.card-header-tabs{margin-right:-.625rem;margin-bottom:-.75rem;margin-left:-.625rem;border-bottom:0}.card-header-pills{margin-right:-.625rem;margin-left:-.625rem}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1.25rem}.card-img{width:100%;border-radius:calc(.25rem - 1px)}.card-img-top{width:100%;border-top-left-radius:calc(.25rem - 1px);border-top-right-radius:calc(.25rem - 1px)}.card-img-bottom{width:100%;border-bottom-right-radius:calc(.25rem - 1px);border-bottom-left-radius:calc(.25rem - 1px)}.card-deck{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column}.card-deck .card{margin-bottom:15px}@media (min-width:576px){.card-deck{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row wrap;flex-flow:row wrap;margin-right:-15px;margin-left:-15px}.card-deck .card{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-flex:1;-ms-flex:1 0 0%;flex:1 0 0%;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;margin-right:15px;margin-bottom:0;margin-left:15px}}.card-group{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column}.card-group>.card{margin-bottom:15px}@media (min-width:576px){.card-group{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row wrap;flex-flow:row wrap}.card-group>.card{-webkit-box-flex:1;-ms-flex:1 0 0%;flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:first-child{border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:first-child .card-header,.card-group>.card:first-child .card-img-top{border-top-right-radius:0}.card-group>.card:first-child .card-footer,.card-group>.card:first-child .card-img-bottom{border-bottom-right-radius:0}.card-group>.card:last-child{border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:last-child .card-header,.card-group>.card:last-child .card-img-top{border-top-left-radius:0}.card-group>.card:last-child .card-footer,.card-group>.card:last-child .card-img-bottom{border-bottom-left-radius:0}.card-group>.card:only-child{border-radius:.25rem}.card-group>.card:only-child .card-header,.card-group>.card:only-child .card-img-top{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.card-group>.card:only-child .card-footer,.card-group>.card:only-child .card-img-bottom{border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.card-group>.card:not(:first-child):not(:last-child):not(:only-child){border-radius:0}.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-footer,.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-header,.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-img-bottom,.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-img-top{border-radius:0}}.card-columns .card{margin-bottom:.75rem}@media (min-width:576px){.card-columns{-webkit-column-count:3;-moz-column-count:3;column-count:3;-webkit-column-gap:1.25rem;-moz-column-gap:1.25rem;column-gap:1.25rem}.card-columns .card{display:inline-block;width:100%}}.breadcrumb{display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;padding:.75rem 1rem;margin-bottom:1rem;list-style:none;background-color:#e9ecef;border-radius:.25rem}.breadcrumb-item+.breadcrumb-item::before{display:inline-block;padding-right:.5rem;padding-left:.5rem;color:#6c757d;content:"/"}.breadcrumb-item+.breadcrumb-item:hover::before{text-decoration:underline}.breadcrumb-item+.breadcrumb-item:hover::before{text-decoration:none}.breadcrumb-item.active{color:#6c757d}.pagination{display:-webkit-box;display:-ms-flexbox;display:flex;padding-left:0;list-style:none;border-radius:.25rem}.page-link{position:relative;display:block;padding:.5rem .75rem;margin-left:-1px;line-height:1.25;color:#007bff;background-color:#fff;border:1px solid #dee2e6}.page-link:hover{color:#0056b3;text-decoration:none;background-color:#e9ecef;border-color:#dee2e6}.page-link:focus{z-index:2;outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.page-link:not(:disabled):not(.disabled){cursor:pointer}.page-item:first-child .page-link{margin-left:0;border-top-left-radius:.25rem;border-bottom-left-radius:.25rem}.page-item:last-child .page-link{border-top-right-radius:.25rem;border-bottom-right-radius:.25rem}.page-item.active .page-link{z-index:1;color:#fff;background-color:#007bff;border-color:#007bff}.page-item.disabled .page-link{color:#6c757d;pointer-events:none;cursor:auto;background-color:#fff;border-color:#dee2e6}.pagination-lg .page-link{padding:.75rem 1.5rem;font-size:1.25rem;line-height:1.5}.pagination-lg .page-item:first-child .page-link{border-top-left-radius:.3rem;border-bottom-left-radius:.3rem}.pagination-lg .page-item:last-child .page-link{border-top-right-radius:.3rem;border-bottom-right-radius:.3rem}.pagination-sm .page-link{padding:.25rem .5rem;font-size:.875rem;line-height:1.5}.pagination-sm .page-item:first-child .page-link{border-top-left-radius:.2rem;border-bottom-left-radius:.2rem}.pagination-sm .page-item:last-child .page-link{border-top-right-radius:.2rem;border-bottom-right-radius:.2rem}.badge{display:inline-block;padding:.25em .4em;font-size:75%;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.badge-pill{padding-right:.6em;padding-left:.6em;border-radius:10rem}.badge-primary{color:#fff;background-color:#007bff}.badge-primary[href]:focus,.badge-primary[href]:hover{color:#fff;text-decoration:none;background-color:#0062cc}.badge-secondary{color:#fff;background-color:#6c757d}.badge-secondary[href]:focus,.badge-secondary[href]:hover{color:#fff;text-decoration:none;background-color:#545b62}.badge-success{color:#fff;background-color:#28a745}.badge-success[href]:focus,.badge-success[href]:hover{color:#fff;text-decoration:none;background-color:#1e7e34}.badge-info{color:#fff;background-color:#17a2b8}.badge-info[href]:focus,.badge-info[href]:hover{color:#fff;text-decoration:none;background-color:#117a8b}.badge-warning{color:#212529;background-color:#ffc107}.badge-warning[href]:focus,.badge-warning[href]:hover{color:#212529;text-decoration:none;background-color:#d39e00}.badge-danger{color:#fff;background-color:#dc3545}.badge-danger[href]:focus,.badge-danger[href]:hover{color:#fff;text-decoration:none;background-color:#bd2130}.badge-light{color:#212529;background-color:#f8f9fa}.badge-light[href]:focus,.badge-light[href]:hover{color:#212529;text-decoration:none;background-color:#dae0e5}.badge-dark{color:#fff;background-color:#343a40}.badge-dark[href]:focus,.badge-dark[href]:hover{color:#fff;text-decoration:none;background-color:#1d2124}.jumbotron{padding:2rem 1rem;margin-bottom:2rem;background-color:#e9ecef;border-radius:.3rem}@media (min-width:576px){.jumbotron{padding:4rem 2rem}}.jumbotron-fluid{padding-right:0;padding-left:0;border-radius:0}.alert{position:relative;padding:.75rem 1.25rem;margin-bottom:1rem;border:1px solid transparent;border-radius:.25rem}.alert-heading{color:inherit}.alert-link{font-weight:700}.alert-dismissible{padding-right:4rem}.alert-dismissible .close{position:absolute;top:0;right:0;padding:.75rem 1.25rem;color:inherit}.alert-primary{color:#004085;background-color:#cce5ff;border-color:#b8daff}.alert-primary hr{border-top-color:#9fcdff}.alert-primary .alert-link{color:#002752}.alert-secondary{color:#383d41;background-color:#e2e3e5;border-color:#d6d8db}.alert-secondary hr{border-top-color:#c8cbcf}.alert-secondary .alert-link{color:#202326}.alert-success{color:#155724;background-color:#d4edda;border-color:#c3e6cb}.alert-success hr{border-top-color:#b1dfbb}.alert-success .alert-link{color:#0b2e13}.alert-info{color:#0c5460;background-color:#d1ecf1;border-color:#bee5eb}.alert-info hr{border-top-color:#abdde5}.alert-info .alert-link{color:#062c33}.alert-warning{color:#856404;background-color:#fff3cd;border-color:#ffeeba}.alert-warning hr{border-top-color:#ffe8a1}.alert-warning .alert-link{color:#533f03}.alert-danger{color:#721c24;background-color:#f8d7da;border-color:#f5c6cb}.alert-danger hr{border-top-color:#f1b0b7}.alert-danger .alert-link{color:#491217}.alert-light{color:#818182;background-color:#fefefe;border-color:#fdfdfe}.alert-light hr{border-top-color:#ececf6}.alert-light .alert-link{color:#686868}.alert-dark{color:#1b1e21;background-color:#d6d8d9;border-color:#c6c8ca}.alert-dark hr{border-top-color:#b9bbbe}.alert-dark .alert-link{color:#040505}@-webkit-keyframes progress-bar-stripes{from{background-position:1rem 0}to{background-position:0 0}}@keyframes progress-bar-stripes{from{background-position:1rem 0}to{background-position:0 0}}.progress{display:-webkit-box;display:-ms-flexbox;display:flex;height:1rem;overflow:hidden;font-size:.75rem;background-color:#e9ecef;border-radius:.25rem}.progress-bar{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;-webkit-box-pack:center;-ms-flex-pack:center;justify-content:center;color:#fff;text-align:center;background-color:#007bff;transition:width .6s ease}.progress-bar-striped{background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-size:1rem 1rem}.progress-bar-animated{-webkit-animation:progress-bar-stripes 1s linear infinite;animation:progress-bar-stripes 1s linear infinite}.media{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:start;-ms-flex-align:start;align-items:flex-start}.media-body{-webkit-box-flex:1;-ms-flex:1;flex:1}.list-group{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;padding-left:0;margin-bottom:0}.list-group-item-action{width:100%;color:#495057;text-align:inherit}.list-group-item-action:focus,.list-group-item-action:hover{color:#495057;text-decoration:none;background-color:#f8f9fa}.list-group-item-action:active{color:#212529;background-color:#e9ecef}.list-group-item{position:relative;display:block;padding:.75rem 1.25rem;margin-bottom:-1px;background-color:#fff;border:1px solid rgba(0,0,0,.125)}.list-group-item:first-child{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.list-group-item:last-child{margin-bottom:0;border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.list-group-item:focus,.list-group-item:hover{z-index:1;text-decoration:none}.list-group-item.disabled,.list-group-item:disabled{color:#6c757d;background-color:#fff}.list-group-item.active{z-index:2;color:#fff;background-color:#007bff;border-color:#007bff}.list-group-flush .list-group-item{border-right:0;border-left:0;border-radius:0}.list-group-flush:first-child .list-group-item:first-child{border-top:0}.list-group-flush:last-child .list-group-item:last-child{border-bottom:0}.list-group-item-primary{color:#004085;background-color:#b8daff}.list-group-item-primary.list-group-item-action:focus,.list-group-item-primary.list-group-item-action:hover{color:#004085;background-color:#9fcdff}.list-group-item-primary.list-group-item-action.active{color:#fff;background-color:#004085;border-color:#004085}.list-group-item-secondary{color:#383d41;background-color:#d6d8db}.list-group-item-secondary.list-group-item-action:focus,.list-group-item-secondary.list-group-item-action:hover{color:#383d41;background-color:#c8cbcf}.list-group-item-secondary.list-group-item-action.active{color:#fff;background-color:#383d41;border-color:#383d41}.list-group-item-success{color:#155724;background-color:#c3e6cb}.list-group-item-success.list-group-item-action:focus,.list-group-item-success.list-group-item-action:hover{color:#155724;background-color:#b1dfbb}.list-group-item-success.list-group-item-action.active{color:#fff;background-color:#155724;border-color:#155724}.list-group-item-info{color:#0c5460;background-color:#bee5eb}.list-group-item-info.list-group-item-action:focus,.list-group-item-info.list-group-item-action:hover{color:#0c5460;background-color:#abdde5}.list-group-item-info.list-group-item-action.active{color:#fff;background-color:#0c5460;border-color:#0c5460}.list-group-item-warning{color:#856404;background-color:#ffeeba}.list-group-item-warning.list-group-item-action:focus,.list-group-item-warning.list-group-item-action:hover{color:#856404;background-color:#ffe8a1}.list-group-item-warning.list-group-item-action.active{color:#fff;background-color:#856404;border-color:#856404}.list-group-item-danger{color:#721c24;background-color:#f5c6cb}.list-group-item-danger.list-group-item-action:focus,.list-group-item-danger.list-group-item-action:hover{color:#721c24;background-color:#f1b0b7}.list-group-item-danger.list-group-item-action.active{color:#fff;background-color:#721c24;border-color:#721c24}.list-group-item-light{color:#818182;background-color:#fdfdfe}.list-group-item-light.list-group-item-action:focus,.list-group-item-light.list-group-item-action:hover{color:#818182;background-color:#ececf6}.list-group-item-light.list-group-item-action.active{color:#fff;background-color:#818182;border-color:#818182}.list-group-item-dark{color:#1b1e21;background-color:#c6c8ca}.list-group-item-dark.list-group-item-action:focus,.list-group-item-dark.list-group-item-action:hover{color:#1b1e21;background-color:#b9bbbe}.list-group-item-dark.list-group-item-action.active{color:#fff;background-color:#1b1e21;border-color:#1b1e21}.close{float:right;font-size:1.5rem;font-weight:700;line-height:1;color:#000;text-shadow:0 1px 0 #fff;opacity:.5}.close:focus,.close:hover{color:#000;text-decoration:none;opacity:.75}.close:not(:disabled):not(.disabled){cursor:pointer}button.close{padding:0;background-color:transparent;border:0;-webkit-appearance:none}.modal-open{overflow:hidden}.modal{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1050;display:none;overflow:hidden;outline:0}.modal-open .modal{overflow-x:hidden;overflow-y:auto}.modal-dialog{position:relative;width:auto;margin:.5rem;pointer-events:none}.modal.fade .modal-dialog{transition:-webkit-transform .3s ease-out;transition:transform .3s ease-out;transition:transform .3s ease-out,-webkit-transform .3s ease-out;-webkit-transform:translate(0,-25%);transform:translate(0,-25%)}.modal.show .modal-dialog{-webkit-transform:translate(0,0);transform:translate(0,0)}.modal-dialog-centered{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center;min-height:calc(100% - (.5rem * 2))}.modal-content{position:relative;display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;width:100%;pointer-events:auto;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.2);border-radius:.3rem;outline:0}.modal-backdrop{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1040;background-color:#000}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:.5}.modal-header{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:start;-ms-flex-align:start;align-items:flex-start;-webkit-box-pack:justify;-ms-flex-pack:justify;justify-content:space-between;padding:1rem;border-bottom:1px solid #e9ecef;border-top-left-radius:.3rem;border-top-right-radius:.3rem}.modal-header .close{padding:1rem;margin:-1rem -1rem -1rem auto}.modal-title{margin-bottom:0;line-height:1.5}.modal-body{position:relative;-webkit-box-flex:1;-ms-flex:1 1 auto;flex:1 1 auto;padding:1rem}.modal-footer{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:end;-ms-flex-pack:end;justify-content:flex-end;padding:1rem;border-top:1px solid #e9ecef}.modal-footer>:not(:first-child){margin-left:.25rem}.modal-footer>:not(:last-child){margin-right:.25rem}.modal-scrollbar-measure{position:absolute;top:-9999px;width:50px;height:50px;overflow:scroll}@media (min-width:576px){.modal-dialog{max-width:500px;margin:1.75rem auto}.modal-dialog-centered{min-height:calc(100% - (1.75rem * 2))}.modal-sm{max-width:300px}}@media (min-width:992px){.modal-lg{max-width:800px}}.tooltip{position:absolute;z-index:1070;display:block;margin:0;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;white-space:normal;line-break:auto;font-size:.875rem;word-wrap:break-word;opacity:0}.tooltip.show{opacity:.9}.tooltip .arrow{position:absolute;display:block;width:.8rem;height:.4rem}.tooltip .arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-auto[x-placement^=top],.bs-tooltip-top{padding:.4rem 0}.bs-tooltip-auto[x-placement^=top] .arrow,.bs-tooltip-top .arrow{bottom:0}.bs-tooltip-auto[x-placement^=top] .arrow::before,.bs-tooltip-top .arrow::before{top:0;border-width:.4rem .4rem 0;border-top-color:#000}.bs-tooltip-auto[x-placement^=right],.bs-tooltip-right{padding:0 .4rem}.bs-tooltip-auto[x-placement^=right] .arrow,.bs-tooltip-right .arrow{left:0;width:.4rem;height:.8rem}.bs-tooltip-auto[x-placement^=right] .arrow::before,.bs-tooltip-right .arrow::before{right:0;border-width:.4rem .4rem .4rem 0;border-right-color:#000}.bs-tooltip-auto[x-placement^=bottom],.bs-tooltip-bottom{padding:.4rem 0}.bs-tooltip-auto[x-placement^=bottom] .arrow,.bs-tooltip-bottom .arrow{top:0}.bs-tooltip-auto[x-placement^=bottom] .arrow::before,.bs-tooltip-bottom .arrow::before{bottom:0;border-width:0 .4rem .4rem;border-bottom-color:#000}.bs-tooltip-auto[x-placement^=left],.bs-tooltip-left{padding:0 .4rem}.bs-tooltip-auto[x-placement^=left] .arrow,.bs-tooltip-left .arrow{right:0;width:.4rem;height:.8rem}.bs-tooltip-auto[x-placement^=left] .arrow::before,.bs-tooltip-left .arrow::before{left:0;border-width:.4rem 0 .4rem .4rem;border-left-color:#000}.tooltip-inner{max-width:200px;padding:.25rem .5rem;color:#fff;text-align:center;background-color:#000;border-radius:.25rem}.popover{position:absolute;top:0;left:0;z-index:1060;display:block;max-width:276px;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;white-space:normal;line-break:auto;font-size:.875rem;word-wrap:break-word;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.2);border-radius:.3rem}.popover .arrow{position:absolute;display:block;width:1rem;height:.5rem;margin:0 .3rem}.popover .arrow::after,.popover .arrow::before{position:absolute;display:block;content:"";border-color:transparent;border-style:solid}.bs-popover-auto[x-placement^=top],.bs-popover-top{margin-bottom:.5rem}.bs-popover-auto[x-placement^=top] .arrow,.bs-popover-top .arrow{bottom:calc((.5rem + 1px) * -1)}.bs-popover-auto[x-placement^=top] .arrow::after,.bs-popover-auto[x-placement^=top] .arrow::before,.bs-popover-top .arrow::after,.bs-popover-top .arrow::before{border-width:.5rem .5rem 0}.bs-popover-auto[x-placement^=top] .arrow::before,.bs-popover-top .arrow::before{bottom:0;border-top-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=top] .arrow::after,.bs-popover-top .arrow::after{bottom:1px;border-top-color:#fff}.bs-popover-auto[x-placement^=right],.bs-popover-right{margin-left:.5rem}.bs-popover-auto[x-placement^=right] .arrow,.bs-popover-right .arrow{left:calc((.5rem + 1px) * -1);width:.5rem;height:1rem;margin:.3rem 0}.bs-popover-auto[x-placement^=right] .arrow::after,.bs-popover-auto[x-placement^=right] .arrow::before,.bs-popover-right .arrow::after,.bs-popover-right .arrow::before{border-width:.5rem .5rem .5rem 0}.bs-popover-auto[x-placement^=right] .arrow::before,.bs-popover-right .arrow::before{left:0;border-right-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=right] .arrow::after,.bs-popover-right .arrow::after{left:1px;border-right-color:#fff}.bs-popover-auto[x-placement^=bottom],.bs-popover-bottom{margin-top:.5rem}.bs-popover-auto[x-placement^=bottom] .arrow,.bs-popover-bottom .arrow{top:calc((.5rem + 1px) * -1)}.bs-popover-auto[x-placement^=bottom] .arrow::after,.bs-popover-auto[x-placement^=bottom] .arrow::before,.bs-popover-bottom .arrow::after,.bs-popover-bottom .arrow::before{border-width:0 .5rem .5rem .5rem}.bs-popover-auto[x-placement^=bottom] .arrow::before,.bs-popover-bottom .arrow::before{top:0;border-bottom-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=bottom] .arrow::after,.bs-popover-bottom .arrow::after{top:1px;border-bottom-color:#fff}.bs-popover-auto[x-placement^=bottom] .popover-header::before,.bs-popover-bottom .popover-header::before{position:absolute;top:0;left:50%;display:block;width:1rem;margin-left:-.5rem;content:"";border-bottom:1px solid #f7f7f7}.bs-popover-auto[x-placement^=left],.bs-popover-left{margin-right:.5rem}.bs-popover-auto[x-placement^=left] .arrow,.bs-popover-left .arrow{right:calc((.5rem + 1px) * -1);width:.5rem;height:1rem;margin:.3rem 0}.bs-popover-auto[x-placement^=left] .arrow::after,.bs-popover-auto[x-placement^=left] .arrow::before,.bs-popover-left .arrow::after,.bs-popover-left .arrow::before{border-width:.5rem 0 .5rem .5rem}.bs-popover-auto[x-placement^=left] .arrow::before,.bs-popover-left .arrow::before{right:0;border-left-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=left] .arrow::after,.bs-popover-left .arrow::after{right:1px;border-left-color:#fff}.popover-header{padding:.5rem .75rem;margin-bottom:0;font-size:1rem;color:inherit;background-color:#f7f7f7;border-bottom:1px solid #ebebeb;border-top-left-radius:calc(.3rem - 1px);border-top-right-radius:calc(.3rem - 1px)}.popover-header:empty{display:none}.popover-body{padding:.5rem .75rem;color:#212529}.carousel{position:relative}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-item{position:relative;display:none;-webkit-box-align:center;-ms-flex-align:center;align-items:center;width:100%;transition:-webkit-transform .6s ease;transition:transform .6s ease;transition:transform .6s ease,-webkit-transform .6s ease;-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-perspective:1000px;perspective:1000px}.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block}.carousel-item-next,.carousel-item-prev{position:absolute;top:0}.carousel-item-next.carousel-item-left,.carousel-item-prev.carousel-item-right{-webkit-transform:translateX(0);transform:translateX(0)}@supports ((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.carousel-item-next.carousel-item-left,.carousel-item-prev.carousel-item-right{-webkit-transform:translate3d(0,0,0);transform:translate3d(0,0,0)}}.active.carousel-item-right,.carousel-item-next{-webkit-transform:translateX(100%);transform:translateX(100%)}@supports ((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.active.carousel-item-right,.carousel-item-next{-webkit-transform:translate3d(100%,0,0);transform:translate3d(100%,0,0)}}.active.carousel-item-left,.carousel-item-prev{-webkit-transform:translateX(-100%);transform:translateX(-100%)}@supports ((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.active.carousel-item-left,.carousel-item-prev{-webkit-transform:translate3d(-100%,0,0);transform:translate3d(-100%,0,0)}}.carousel-control-next,.carousel-control-prev{position:absolute;top:0;bottom:0;display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:center;-ms-flex-pack:center;justify-content:center;width:15%;color:#fff;text-align:center;opacity:.5}.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-next-icon,.carousel-control-prev-icon{display:inline-block;width:20px;height:20px;background:transparent no-repeat center center;background-size:100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M5.25 0l-4 4 4 4 1.5-1.5-2.5-2.5 2.5-2.5-1.5-1.5z'/%3E%3C/svg%3E")}.carousel-control-next-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M2.75 0l-1.5 1.5 2.5 2.5-2.5 2.5 1.5 1.5 4-4-4-4z'/%3E%3C/svg%3E")}.carousel-indicators{position:absolute;right:0;bottom:10px;left:0;z-index:15;display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-pack:center;-ms-flex-pack:center;justify-content:center;padding-left:0;margin-right:15%;margin-left:15%;list-style:none}.carousel-indicators li{position:relative;-webkit-box-flex:0;-ms-flex:0 1 auto;flex:0 1 auto;width:30px;height:3px;margin-right:3px;margin-left:3px;text-indent:-999px;background-color:rgba(255,255,255,.5)}.carousel-indicators li::before{position:absolute;top:-10px;left:0;display:inline-block;width:100%;height:10px;content:""}.carousel-indicators li::after{position:absolute;bottom:-10px;left:0;display:inline-block;width:100%;height:10px;content:""}.carousel-indicators .active{background-color:#fff}.carousel-caption{position:absolute;right:15%;bottom:20px;left:15%;z-index:10;padding-top:20px;padding-bottom:20px;color:#fff;text-align:center}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.bg-primary{background-color:#007bff!important}a.bg-primary:focus,a.bg-primary:hover,button.bg-primary:focus,button.bg-primary:hover{background-color:#0062cc!important}.bg-secondary{background-color:#6c757d!important}a.bg-secondary:focus,a.bg-secondary:hover,button.bg-secondary:focus,button.bg-secondary:hover{background-color:#545b62!important}.bg-success{background-color:#28a745!important}a.bg-success:focus,a.bg-success:hover,button.bg-success:focus,button.bg-success:hover{background-color:#1e7e34!important}.bg-info{background-color:#17a2b8!important}a.bg-info:focus,a.bg-info:hover,button.bg-info:focus,button.bg-info:hover{background-color:#117a8b!important}.bg-warning{background-color:#ffc107!important}a.bg-warning:focus,a.bg-warning:hover,button.bg-warning:focus,button.bg-warning:hover{background-color:#d39e00!important}.bg-danger{background-color:#dc3545!important}a.bg-danger:focus,a.bg-danger:hover,button.bg-danger:focus,button.bg-danger:hover{background-color:#bd2130!important}.bg-light{background-color:#f8f9fa!important}a.bg-light:focus,a.bg-light:hover,button.bg-light:focus,button.bg-light:hover{background-color:#dae0e5!important}.bg-dark{background-color:#343a40!important}a.bg-dark:focus,a.bg-dark:hover,button.bg-dark:focus,button.bg-dark:hover{background-color:#1d2124!important}.bg-white{background-color:#fff!important}.bg-transparent{background-color:transparent!important}.border{border:1px solid #dee2e6!important}.border-top{border-top:1px solid #dee2e6!important}.border-right{border-right:1px solid #dee2e6!important}.border-bottom{border-bottom:1px solid #dee2e6!important}.border-left{border-left:1px solid #dee2e6!important}.border-0{border:0!important}.border-top-0{border-top:0!important}.border-right-0{border-right:0!important}.border-bottom-0{border-bottom:0!important}.border-left-0{border-left:0!important}.border-primary{border-color:#007bff!important}.border-secondary{border-color:#6c757d!important}.border-success{border-color:#28a745!important}.border-info{border-color:#17a2b8!important}.border-warning{border-color:#ffc107!important}.border-danger{border-color:#dc3545!important}.border-light{border-color:#f8f9fa!important}.border-dark{border-color:#343a40!important}.border-white{border-color:#fff!important}.rounded{border-radius:.25rem!important}.rounded-top{border-top-left-radius:.25rem!important;border-top-right-radius:.25rem!important}.rounded-right{border-top-right-radius:.25rem!important;border-bottom-right-radius:.25rem!important}.rounded-bottom{border-bottom-right-radius:.25rem!important;border-bottom-left-radius:.25rem!important}.rounded-left{border-top-left-radius:.25rem!important;border-bottom-left-radius:.25rem!important}.rounded-circle{border-radius:50%!important}.rounded-0{border-radius:0!important}.clearfix::after{display:block;clear:both;content:""}.d-none{display:none!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}@media (min-width:576px){.d-sm-none{display:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-sm-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:768px){.d-md-none{display:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-md-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:992px){.d-lg-none{display:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-lg-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:1200px){.d-xl-none{display:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-xl-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}@media print{.d-print-none{display:none!important}.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-print-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}.embed-responsive{position:relative;display:block;width:100%;padding:0;overflow:hidden}.embed-responsive::before{display:block;content:""}.embed-responsive .embed-responsive-item,.embed-responsive embed,.embed-responsive iframe,.embed-responsive object,.embed-responsive video{position:absolute;top:0;bottom:0;left:0;width:100%;height:100%;border:0}.embed-responsive-21by9::before{padding-top:42.857143%}.embed-responsive-16by9::before{padding-top:56.25%}.embed-responsive-4by3::before{padding-top:75%}.embed-responsive-1by1::before{padding-top:100%}.flex-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.justify-content-start{-webkit-box-pack:start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-end{-webkit-box-pack:end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-center{-webkit-box-pack:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-between{-webkit-box-pack:justify!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-start{-webkit-box-align:start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-end{-webkit-box-align:end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-center{-webkit-box-align:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-baseline{-webkit-box-align:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-stretch{-webkit-box-align:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}@media (min-width:576px){.flex-sm-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-sm-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-sm-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-sm-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-sm-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-sm-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-sm-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.justify-content-sm-start{-webkit-box-pack:start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-sm-end{-webkit-box-pack:end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-sm-center{-webkit-box-pack:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-sm-between{-webkit-box-pack:justify!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-sm-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-sm-start{-webkit-box-align:start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-sm-end{-webkit-box-align:end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-sm-center{-webkit-box-align:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-sm-baseline{-webkit-box-align:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-sm-stretch{-webkit-box-align:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-sm-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-sm-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-sm-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-sm-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-sm-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-sm-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-sm-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-sm-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-sm-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-sm-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-sm-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-sm-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:768px){.flex-md-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-md-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-md-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-md-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-md-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-md-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-md-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.justify-content-md-start{-webkit-box-pack:start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-md-end{-webkit-box-pack:end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-md-center{-webkit-box-pack:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-md-between{-webkit-box-pack:justify!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-md-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-md-start{-webkit-box-align:start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-md-end{-webkit-box-align:end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-md-center{-webkit-box-align:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-md-baseline{-webkit-box-align:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-md-stretch{-webkit-box-align:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-md-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-md-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-md-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-md-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-md-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-md-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-md-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-md-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-md-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-md-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-md-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-md-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:992px){.flex-lg-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-lg-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-lg-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-lg-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-lg-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-lg-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-lg-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.justify-content-lg-start{-webkit-box-pack:start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-lg-end{-webkit-box-pack:end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-lg-center{-webkit-box-pack:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-lg-between{-webkit-box-pack:justify!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-lg-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-lg-start{-webkit-box-align:start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-lg-end{-webkit-box-align:end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-lg-center{-webkit-box-align:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-lg-baseline{-webkit-box-align:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-lg-stretch{-webkit-box-align:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-lg-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-lg-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-lg-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-lg-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-lg-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-lg-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-lg-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-lg-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-lg-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-lg-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-lg-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-lg-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:1200px){.flex-xl-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-xl-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-xl-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-xl-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-xl-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-xl-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-xl-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.justify-content-xl-start{-webkit-box-pack:start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-xl-end{-webkit-box-pack:end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-xl-center{-webkit-box-pack:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-xl-between{-webkit-box-pack:justify!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-xl-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-xl-start{-webkit-box-align:start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-xl-end{-webkit-box-align:end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-xl-center{-webkit-box-align:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-xl-baseline{-webkit-box-align:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-xl-stretch{-webkit-box-align:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-xl-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-xl-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-xl-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-xl-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-xl-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-xl-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-xl-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-xl-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-xl-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-xl-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-xl-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-xl-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}.float-left{float:left!important}.float-right{float:right!important}.float-none{float:none!important}@media (min-width:576px){.float-sm-left{float:left!important}.float-sm-right{float:right!important}.float-sm-none{float:none!important}}@media (min-width:768px){.float-md-left{float:left!important}.float-md-right{float:right!important}.float-md-none{float:none!important}}@media (min-width:992px){.float-lg-left{float:left!important}.float-lg-right{float:right!important}.float-lg-none{float:none!important}}@media (min-width:1200px){.float-xl-left{float:left!important}.float-xl-right{float:right!important}.float-xl-none{float:none!important}}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:-webkit-sticky!important;position:sticky!important}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}@supports ((position:-webkit-sticky) or (position:sticky)){.sticky-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}}.sr-only{position:absolute;width:1px;height:1px;padding:0;overflow:hidden;clip:rect(0,0,0,0);white-space:nowrap;-webkit-clip-path:inset(50%);clip-path:inset(50%);border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;overflow:visible;clip:auto;white-space:normal;-webkit-clip-path:none;clip-path:none}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.mw-100{max-width:100%!important}.mh-100{max-height:100%!important}.m-0{margin:0!important}.mt-0,.my-0{margin-top:0!important}.mr-0,.mx-0{margin-right:0!important}.mb-0,.my-0{margin-bottom:0!important}.ml-0,.mx-0{margin-left:0!important}.m-1{margin:.25rem!important}.mt-1,.my-1{margin-top:.25rem!important}.mr-1,.mx-1{margin-right:.25rem!important}.mb-1,.my-1{margin-bottom:.25rem!important}.ml-1,.mx-1{margin-left:.25rem!important}.m-2{margin:.5rem!important}.mt-2,.my-2{margin-top:.5rem!important}.mr-2,.mx-2{margin-right:.5rem!important}.mb-2,.my-2{margin-bottom:.5rem!important}.ml-2,.mx-2{margin-left:.5rem!important}.m-3{margin:1rem!important}.mt-3,.my-3{margin-top:1rem!important}.mr-3,.mx-3{margin-right:1rem!important}.mb-3,.my-3{margin-bottom:1rem!important}.ml-3,.mx-3{margin-left:1rem!important}.m-4{margin:1.5rem!important}.mt-4,.my-4{margin-top:1.5rem!important}.mr-4,.mx-4{margin-right:1.5rem!important}.mb-4,.my-4{margin-bottom:1.5rem!important}.ml-4,.mx-4{margin-left:1.5rem!important}.m-5{margin:3rem!important}.mt-5,.my-5{margin-top:3rem!important}.mr-5,.mx-5{margin-right:3rem!important}.mb-5,.my-5{margin-bottom:3rem!important}.ml-5,.mx-5{margin-left:3rem!important}.p-0{padding:0!important}.pt-0,.py-0{padding-top:0!important}.pr-0,.px-0{padding-right:0!important}.pb-0,.py-0{padding-bottom:0!important}.pl-0,.px-0{padding-left:0!important}.p-1{padding:.25rem!important}.pt-1,.py-1{padding-top:.25rem!important}.pr-1,.px-1{padding-right:.25rem!important}.pb-1,.py-1{padding-bottom:.25rem!important}.pl-1,.px-1{padding-left:.25rem!important}.p-2{padding:.5rem!important}.pt-2,.py-2{padding-top:.5rem!important}.pr-2,.px-2{padding-right:.5rem!important}.pb-2,.py-2{padding-bottom:.5rem!important}.pl-2,.px-2{padding-left:.5rem!important}.p-3{padding:1rem!important}.pt-3,.py-3{padding-top:1rem!important}.pr-3,.px-3{padding-right:1rem!important}.pb-3,.py-3{padding-bottom:1rem!important}.pl-3,.px-3{padding-left:1rem!important}.p-4{padding:1.5rem!important}.pt-4,.py-4{padding-top:1.5rem!important}.pr-4,.px-4{padding-right:1.5rem!important}.pb-4,.py-4{padding-bottom:1.5rem!important}.pl-4,.px-4{padding-left:1.5rem!important}.p-5{padding:3rem!important}.pt-5,.py-5{padding-top:3rem!important}.pr-5,.px-5{padding-right:3rem!important}.pb-5,.py-5{padding-bottom:3rem!important}.pl-5,.px-5{padding-left:3rem!important}.m-auto{margin:auto!important}.mt-auto,.my-auto{margin-top:auto!important}.mr-auto,.mx-auto{margin-right:auto!important}.mb-auto,.my-auto{margin-bottom:auto!important}.ml-auto,.mx-auto{margin-left:auto!important}@media (min-width:576px){.m-sm-0{margin:0!important}.mt-sm-0,.my-sm-0{margin-top:0!important}.mr-sm-0,.mx-sm-0{margin-right:0!important}.mb-sm-0,.my-sm-0{margin-bottom:0!important}.ml-sm-0,.mx-sm-0{margin-left:0!important}.m-sm-1{margin:.25rem!important}.mt-sm-1,.my-sm-1{margin-top:.25rem!important}.mr-sm-1,.mx-sm-1{margin-right:.25rem!important}.mb-sm-1,.my-sm-1{margin-bottom:.25rem!important}.ml-sm-1,.mx-sm-1{margin-left:.25rem!important}.m-sm-2{margin:.5rem!important}.mt-sm-2,.my-sm-2{margin-top:.5rem!important}.mr-sm-2,.mx-sm-2{margin-right:.5rem!important}.mb-sm-2,.my-sm-2{margin-bottom:.5rem!important}.ml-sm-2,.mx-sm-2{margin-left:.5rem!important}.m-sm-3{margin:1rem!important}.mt-sm-3,.my-sm-3{margin-top:1rem!important}.mr-sm-3,.mx-sm-3{margin-right:1rem!important}.mb-sm-3,.my-sm-3{margin-bottom:1rem!important}.ml-sm-3,.mx-sm-3{margin-left:1rem!important}.m-sm-4{margin:1.5rem!important}.mt-sm-4,.my-sm-4{margin-top:1.5rem!important}.mr-sm-4,.mx-sm-4{margin-right:1.5rem!important}.mb-sm-4,.my-sm-4{margin-bottom:1.5rem!important}.ml-sm-4,.mx-sm-4{margin-left:1.5rem!important}.m-sm-5{margin:3rem!important}.mt-sm-5,.my-sm-5{margin-top:3rem!important}.mr-sm-5,.mx-sm-5{margin-right:3rem!important}.mb-sm-5,.my-sm-5{margin-bottom:3rem!important}.ml-sm-5,.mx-sm-5{margin-left:3rem!important}.p-sm-0{padding:0!important}.pt-sm-0,.py-sm-0{padding-top:0!important}.pr-sm-0,.px-sm-0{padding-right:0!important}.pb-sm-0,.py-sm-0{padding-bottom:0!important}.pl-sm-0,.px-sm-0{padding-left:0!important}.p-sm-1{padding:.25rem!important}.pt-sm-1,.py-sm-1{padding-top:.25rem!important}.pr-sm-1,.px-sm-1{padding-right:.25rem!important}.pb-sm-1,.py-sm-1{padding-bottom:.25rem!important}.pl-sm-1,.px-sm-1{padding-left:.25rem!important}.p-sm-2{padding:.5rem!important}.pt-sm-2,.py-sm-2{padding-top:.5rem!important}.pr-sm-2,.px-sm-2{padding-right:.5rem!important}.pb-sm-2,.py-sm-2{padding-bottom:.5rem!important}.pl-sm-2,.px-sm-2{padding-left:.5rem!important}.p-sm-3{padding:1rem!important}.pt-sm-3,.py-sm-3{padding-top:1rem!important}.pr-sm-3,.px-sm-3{padding-right:1rem!important}.pb-sm-3,.py-sm-3{padding-bottom:1rem!important}.pl-sm-3,.px-sm-3{padding-left:1rem!important}.p-sm-4{padding:1.5rem!important}.pt-sm-4,.py-sm-4{padding-top:1.5rem!important}.pr-sm-4,.px-sm-4{padding-right:1.5rem!important}.pb-sm-4,.py-sm-4{padding-bottom:1.5rem!important}.pl-sm-4,.px-sm-4{padding-left:1.5rem!important}.p-sm-5{padding:3rem!important}.pt-sm-5,.py-sm-5{padding-top:3rem!important}.pr-sm-5,.px-sm-5{padding-right:3rem!important}.pb-sm-5,.py-sm-5{padding-bottom:3rem!important}.pl-sm-5,.px-sm-5{padding-left:3rem!important}.m-sm-auto{margin:auto!important}.mt-sm-auto,.my-sm-auto{margin-top:auto!important}.mr-sm-auto,.mx-sm-auto{margin-right:auto!important}.mb-sm-auto,.my-sm-auto{margin-bottom:auto!important}.ml-sm-auto,.mx-sm-auto{margin-left:auto!important}}@media (min-width:768px){.m-md-0{margin:0!important}.mt-md-0,.my-md-0{margin-top:0!important}.mr-md-0,.mx-md-0{margin-right:0!important}.mb-md-0,.my-md-0{margin-bottom:0!important}.ml-md-0,.mx-md-0{margin-left:0!important}.m-md-1{margin:.25rem!important}.mt-md-1,.my-md-1{margin-top:.25rem!important}.mr-md-1,.mx-md-1{margin-right:.25rem!important}.mb-md-1,.my-md-1{margin-bottom:.25rem!important}.ml-md-1,.mx-md-1{margin-left:.25rem!important}.m-md-2{margin:.5rem!important}.mt-md-2,.my-md-2{margin-top:.5rem!important}.mr-md-2,.mx-md-2{margin-right:.5rem!important}.mb-md-2,.my-md-2{margin-bottom:.5rem!important}.ml-md-2,.mx-md-2{margin-left:.5rem!important}.m-md-3{margin:1rem!important}.mt-md-3,.my-md-3{margin-top:1rem!important}.mr-md-3,.mx-md-3{margin-right:1rem!important}.mb-md-3,.my-md-3{margin-bottom:1rem!important}.ml-md-3,.mx-md-3{margin-left:1rem!important}.m-md-4{margin:1.5rem!important}.mt-md-4,.my-md-4{margin-top:1.5rem!important}.mr-md-4,.mx-md-4{margin-right:1.5rem!important}.mb-md-4,.my-md-4{margin-bottom:1.5rem!important}.ml-md-4,.mx-md-4{margin-left:1.5rem!important}.m-md-5{margin:3rem!important}.mt-md-5,.my-md-5{margin-top:3rem!important}.mr-md-5,.mx-md-5{margin-right:3rem!important}.mb-md-5,.my-md-5{margin-bottom:3rem!important}.ml-md-5,.mx-md-5{margin-left:3rem!important}.p-md-0{padding:0!important}.pt-md-0,.py-md-0{padding-top:0!important}.pr-md-0,.px-md-0{padding-right:0!important}.pb-md-0,.py-md-0{padding-bottom:0!important}.pl-md-0,.px-md-0{padding-left:0!important}.p-md-1{padding:.25rem!important}.pt-md-1,.py-md-1{padding-top:.25rem!important}.pr-md-1,.px-md-1{padding-right:.25rem!important}.pb-md-1,.py-md-1{padding-bottom:.25rem!important}.pl-md-1,.px-md-1{padding-left:.25rem!important}.p-md-2{padding:.5rem!important}.pt-md-2,.py-md-2{padding-top:.5rem!important}.pr-md-2,.px-md-2{padding-right:.5rem!important}.pb-md-2,.py-md-2{padding-bottom:.5rem!important}.pl-md-2,.px-md-2{padding-left:.5rem!important}.p-md-3{padding:1rem!important}.pt-md-3,.py-md-3{padding-top:1rem!important}.pr-md-3,.px-md-3{padding-right:1rem!important}.pb-md-3,.py-md-3{padding-bottom:1rem!important}.pl-md-3,.px-md-3{padding-left:1rem!important}.p-md-4{padding:1.5rem!important}.pt-md-4,.py-md-4{padding-top:1.5rem!important}.pr-md-4,.px-md-4{padding-right:1.5rem!important}.pb-md-4,.py-md-4{padding-bottom:1.5rem!important}.pl-md-4,.px-md-4{padding-left:1.5rem!important}.p-md-5{padding:3rem!important}.pt-md-5,.py-md-5{padding-top:3rem!important}.pr-md-5,.px-md-5{padding-right:3rem!important}.pb-md-5,.py-md-5{padding-bottom:3rem!important}.pl-md-5,.px-md-5{padding-left:3rem!important}.m-md-auto{margin:auto!important}.mt-md-auto,.my-md-auto{margin-top:auto!important}.mr-md-auto,.mx-md-auto{margin-right:auto!important}.mb-md-auto,.my-md-auto{margin-bottom:auto!important}.ml-md-auto,.mx-md-auto{margin-left:auto!important}}@media (min-width:992px){.m-lg-0{margin:0!important}.mt-lg-0,.my-lg-0{margin-top:0!important}.mr-lg-0,.mx-lg-0{margin-right:0!important}.mb-lg-0,.my-lg-0{margin-bottom:0!important}.ml-lg-0,.mx-lg-0{margin-left:0!important}.m-lg-1{margin:.25rem!important}.mt-lg-1,.my-lg-1{margin-top:.25rem!important}.mr-lg-1,.mx-lg-1{margin-right:.25rem!important}.mb-lg-1,.my-lg-1{margin-bottom:.25rem!important}.ml-lg-1,.mx-lg-1{margin-left:.25rem!important}.m-lg-2{margin:.5rem!important}.mt-lg-2,.my-lg-2{margin-top:.5rem!important}.mr-lg-2,.mx-lg-2{margin-right:.5rem!important}.mb-lg-2,.my-lg-2{margin-bottom:.5rem!important}.ml-lg-2,.mx-lg-2{margin-left:.5rem!important}.m-lg-3{margin:1rem!important}.mt-lg-3,.my-lg-3{margin-top:1rem!important}.mr-lg-3,.mx-lg-3{margin-right:1rem!important}.mb-lg-3,.my-lg-3{margin-bottom:1rem!important}.ml-lg-3,.mx-lg-3{margin-left:1rem!important}.m-lg-4{margin:1.5rem!important}.mt-lg-4,.my-lg-4{margin-top:1.5rem!important}.mr-lg-4,.mx-lg-4{margin-right:1.5rem!important}.mb-lg-4,.my-lg-4{margin-bottom:1.5rem!important}.ml-lg-4,.mx-lg-4{margin-left:1.5rem!important}.m-lg-5{margin:3rem!important}.mt-lg-5,.my-lg-5{margin-top:3rem!important}.mr-lg-5,.mx-lg-5{margin-right:3rem!important}.mb-lg-5,.my-lg-5{margin-bottom:3rem!important}.ml-lg-5,.mx-lg-5{margin-left:3rem!important}.p-lg-0{padding:0!important}.pt-lg-0,.py-lg-0{padding-top:0!important}.pr-lg-0,.px-lg-0{padding-right:0!important}.pb-lg-0,.py-lg-0{padding-bottom:0!important}.pl-lg-0,.px-lg-0{padding-left:0!important}.p-lg-1{padding:.25rem!important}.pt-lg-1,.py-lg-1{padding-top:.25rem!important}.pr-lg-1,.px-lg-1{padding-right:.25rem!important}.pb-lg-1,.py-lg-1{padding-bottom:.25rem!important}.pl-lg-1,.px-lg-1{padding-left:.25rem!important}.p-lg-2{padding:.5rem!important}.pt-lg-2,.py-lg-2{padding-top:.5rem!important}.pr-lg-2,.px-lg-2{padding-right:.5rem!important}.pb-lg-2,.py-lg-2{padding-bottom:.5rem!important}.pl-lg-2,.px-lg-2{padding-left:.5rem!important}.p-lg-3{padding:1rem!important}.pt-lg-3,.py-lg-3{padding-top:1rem!important}.pr-lg-3,.px-lg-3{padding-right:1rem!important}.pb-lg-3,.py-lg-3{padding-bottom:1rem!important}.pl-lg-3,.px-lg-3{padding-left:1rem!important}.p-lg-4{padding:1.5rem!important}.pt-lg-4,.py-lg-4{padding-top:1.5rem!important}.pr-lg-4,.px-lg-4{padding-right:1.5rem!important}.pb-lg-4,.py-lg-4{padding-bottom:1.5rem!important}.pl-lg-4,.px-lg-4{padding-left:1.5rem!important}.p-lg-5{padding:3rem!important}.pt-lg-5,.py-lg-5{padding-top:3rem!important}.pr-lg-5,.px-lg-5{padding-right:3rem!important}.pb-lg-5,.py-lg-5{padding-bottom:3rem!important}.pl-lg-5,.px-lg-5{padding-left:3rem!important}.m-lg-auto{margin:auto!important}.mt-lg-auto,.my-lg-auto{margin-top:auto!important}.mr-lg-auto,.mx-lg-auto{margin-right:auto!important}.mb-lg-auto,.my-lg-auto{margin-bottom:auto!important}.ml-lg-auto,.mx-lg-auto{margin-left:auto!important}}@media (min-width:1200px){.m-xl-0{margin:0!important}.mt-xl-0,.my-xl-0{margin-top:0!important}.mr-xl-0,.mx-xl-0{margin-right:0!important}.mb-xl-0,.my-xl-0{margin-bottom:0!important}.ml-xl-0,.mx-xl-0{margin-left:0!important}.m-xl-1{margin:.25rem!important}.mt-xl-1,.my-xl-1{margin-top:.25rem!important}.mr-xl-1,.mx-xl-1{margin-right:.25rem!important}.mb-xl-1,.my-xl-1{margin-bottom:.25rem!important}.ml-xl-1,.mx-xl-1{margin-left:.25rem!important}.m-xl-2{margin:.5rem!important}.mt-xl-2,.my-xl-2{margin-top:.5rem!important}.mr-xl-2,.mx-xl-2{margin-right:.5rem!important}.mb-xl-2,.my-xl-2{margin-bottom:.5rem!important}.ml-xl-2,.mx-xl-2{margin-left:.5rem!important}.m-xl-3{margin:1rem!important}.mt-xl-3,.my-xl-3{margin-top:1rem!important}.mr-xl-3,.mx-xl-3{margin-right:1rem!important}.mb-xl-3,.my-xl-3{margin-bottom:1rem!important}.ml-xl-3,.mx-xl-3{margin-left:1rem!important}.m-xl-4{margin:1.5rem!important}.mt-xl-4,.my-xl-4{margin-top:1.5rem!important}.mr-xl-4,.mx-xl-4{margin-right:1.5rem!important}.mb-xl-4,.my-xl-4{margin-bottom:1.5rem!important}.ml-xl-4,.mx-xl-4{margin-left:1.5rem!important}.m-xl-5{margin:3rem!important}.mt-xl-5,.my-xl-5{margin-top:3rem!important}.mr-xl-5,.mx-xl-5{margin-right:3rem!important}.mb-xl-5,.my-xl-5{margin-bottom:3rem!important}.ml-xl-5,.mx-xl-5{margin-left:3rem!important}.p-xl-0{padding:0!important}.pt-xl-0,.py-xl-0{padding-top:0!important}.pr-xl-0,.px-xl-0{padding-right:0!important}.pb-xl-0,.py-xl-0{padding-bottom:0!important}.pl-xl-0,.px-xl-0{padding-left:0!important}.p-xl-1{padding:.25rem!important}.pt-xl-1,.py-xl-1{padding-top:.25rem!important}.pr-xl-1,.px-xl-1{padding-right:.25rem!important}.pb-xl-1,.py-xl-1{padding-bottom:.25rem!important}.pl-xl-1,.px-xl-1{padding-left:.25rem!important}.p-xl-2{padding:.5rem!important}.pt-xl-2,.py-xl-2{padding-top:.5rem!important}.pr-xl-2,.px-xl-2{padding-right:.5rem!important}.pb-xl-2,.py-xl-2{padding-bottom:.5rem!important}.pl-xl-2,.px-xl-2{padding-left:.5rem!important}.p-xl-3{padding:1rem!important}.pt-xl-3,.py-xl-3{padding-top:1rem!important}.pr-xl-3,.px-xl-3{padding-right:1rem!important}.pb-xl-3,.py-xl-3{padding-bottom:1rem!important}.pl-xl-3,.px-xl-3{padding-left:1rem!important}.p-xl-4{padding:1.5rem!important}.pt-xl-4,.py-xl-4{padding-top:1.5rem!important}.pr-xl-4,.px-xl-4{padding-right:1.5rem!important}.pb-xl-4,.py-xl-4{padding-bottom:1.5rem!important}.pl-xl-4,.px-xl-4{padding-left:1.5rem!important}.p-xl-5{padding:3rem!important}.pt-xl-5,.py-xl-5{padding-top:3rem!important}.pr-xl-5,.px-xl-5{padding-right:3rem!important}.pb-xl-5,.py-xl-5{padding-bottom:3rem!important}.pl-xl-5,.px-xl-5{padding-left:3rem!important}.m-xl-auto{margin:auto!important}.mt-xl-auto,.my-xl-auto{margin-top:auto!important}.mr-xl-auto,.mx-xl-auto{margin-right:auto!important}.mb-xl-auto,.my-xl-auto{margin-bottom:auto!important}.ml-xl-auto,.mx-xl-auto{margin-left:auto!important}}.text-justify{text-align:justify!important}.text-nowrap{white-space:nowrap!important}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.text-left{text-align:left!important}.text-right{text-align:right!important}.text-center{text-align:center!important}@media (min-width:576px){.text-sm-left{text-align:left!important}.text-sm-right{text-align:right!important}.text-sm-center{text-align:center!important}}@media (min-width:768px){.text-md-left{text-align:left!important}.text-md-right{text-align:right!important}.text-md-center{text-align:center!important}}@media (min-width:992px){.text-lg-left{text-align:left!important}.text-lg-right{text-align:right!important}.text-lg-center{text-align:center!important}}@media (min-width:1200px){.text-xl-left{text-align:left!important}.text-xl-right{text-align:right!important}.text-xl-center{text-align:center!important}}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.font-weight-light{font-weight:300!important}.font-weight-normal{font-weight:400!important}.font-weight-bold{font-weight:700!important}.font-italic{font-style:italic!important}.text-white{color:#fff!important}.text-primary{color:#007bff!important}a.text-primary:focus,a.text-primary:hover{color:#0062cc!important}.text-secondary{color:#6c757d!important}a.text-secondary:focus,a.text-secondary:hover{color:#545b62!important}.text-success{color:#28a745!important}a.text-success:focus,a.text-success:hover{color:#1e7e34!important}.text-info{color:#17a2b8!important}a.text-info:focus,a.text-info:hover{color:#117a8b!important}.text-warning{color:#ffc107!important}a.text-warning:focus,a.text-warning:hover{color:#d39e00!important}.text-danger{color:#dc3545!important}a.text-danger:focus,a.text-danger:hover{color:#bd2130!important}.text-light{color:#f8f9fa!important}a.text-light:focus,a.text-light:hover{color:#dae0e5!important}.text-dark{color:#343a40!important}a.text-dark:focus,a.text-dark:hover{color:#1d2124!important}.text-muted{color:#6c757d!important}.text-hide{font:0/0 a;color:transparent;text-shadow:none;background-color:transparent;border:0}.visible{visibility:visible!important}.invisible{visibility:hidden!important}@media print{*,::after,::before{text-shadow:none!important;box-shadow:none!important}a:not(.btn){text-decoration:underline}abbr[title]::after{content:" (" attr(title) ")"}pre{white-space:pre-wrap!important}blockquote,pre{border:1px solid #999;page-break-inside:avoid}thead{display:table-header-group}img,tr{page-break-inside:avoid}h2,h3,p{orphans:3;widows:3}h2,h3{page-break-after:avoid}@page{size:a3}body{min-width:992px!important}.container{min-width:992px!important}.navbar{display:none}.badge{border:1px solid #000}.table{border-collapse:collapse!important}.table td,.table th{background-color:#fff!important}.table-bordered td,.table-bordered th{border:1px solid #ddd!important}}
+/*# sourceMappingURL=bootstrap.min.css.map */
\ No newline at end of file
diff --git a/docs/lib/bootstrap/js/bootstrap.bundle.min.js b/docs/lib/bootstrap/js/bootstrap.bundle.min.js
new file mode 100644
index 0000000..7d50e87
--- /dev/null
+++ b/docs/lib/bootstrap/js/bootstrap.bundle.min.js
@@ -0,0 +1,7 @@
+/*!
+  * Bootstrap v4.0.0 (https://getbootstrap.com)
+  * Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
+  * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+  */
+!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?e(exports,require("jquery")):"function"==typeof define&&define.amd?define(["exports","jquery"],e):e(t.bootstrap={},t.jQuery)}(this,function(t,e){"use strict";function n(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}function i(t,e,i){return e&&n(t.prototype,e),i&&n(t,i),t}function r(){return(r=Object.assign||function(t){for(var e=1;e<arguments.length;e++){var n=arguments[e];for(var i in n)Object.prototype.hasOwnProperty.call(n,i)&&(t[i]=n[i])}return t}).apply(this,arguments)}for(var o,s,a,l,c,h,f,u,d,p,g,m,_,v,E,y,b,T,C,w,I,A,D,S,O,N,k=function(t){var e=!1;function n(e){var n=this,r=!1;return t(this).one(i.TRANSITION_END,function(){r=!0}),setTimeout(function(){r||i.triggerTransitionEnd(n)},e),this}var i={TRANSITION_END:"bsTransitionEnd",getUID:function(t){do{t+=~~(1e6*Math.random())}while(document.getElementById(t));return t},getSelectorFromElement:function(e){var n,i=e.getAttribute("data-target");i&&"#"!==i||(i=e.getAttribute("href")||""),"#"===i.charAt(0)&&(n=i,i=n="function"==typeof t.escapeSelector?t.escapeSelector(n).substr(1):n.replace(/(:|\.|\[|\]|,|=|@)/g,"\\$1"));try{return t(document).find(i).length>0?i:null}catch(t){return null}},reflow:function(t){return t.offsetHeight},triggerTransitionEnd:function(n){t(n).trigger(e.end)},supportsTransitionEnd:function(){return Boolean(e)},isElement:function(t){return(t[0]||t).nodeType},typeCheckConfig:function(t,e,n){for(var r in n)if(Object.prototype.hasOwnProperty.call(n,r)){var o=n[r],s=e[r],a=s&&i.isElement(s)?"element":(l=s,{}.toString.call(l).match(/\s([a-zA-Z]+)/)[1].toLowerCase());if(!new RegExp(o).test(a))throw new Error(t.toUpperCase()+': Option "'+r+'" provided type "'+a+'" but expected type "'+o+'".')}var l}};return e=("undefined"==typeof window||!window.QUnit)&&{end:"transitionend"},t.fn.emulateTransitionEnd=n,i.supportsTransitionEnd()&&(t.event.special[i.TRANSITION_END]={bindType:e.end,delegateType:e.end,handle:function(e){if(t(e.target).is(this))return e.handleObj.handler.apply(this,arguments)}}),i}(e=e&&e.hasOwnProperty("default")?e.default:e),L=(s="alert",l="."+(a="bs.alert"),c=(o=e).fn[s],h={CLOSE:"close"+l,CLOSED:"closed"+l,CLICK_DATA_API:"click"+l+".data-api"},f="alert",u="fade",d="show",p=function(){function t(t){this._element=t}var e=t.prototype;return e.close=function(t){t=t||this._element;var e=this._getRootElement(t);this._triggerCloseEvent(e).isDefaultPrevented()||this._removeElement(e)},e.dispose=function(){o.removeData(this._element,a),this._element=null},e._getRootElement=function(t){var e=k.getSelectorFromElement(t),n=!1;return e&&(n=o(e)[0]),n||(n=o(t).closest("."+f)[0]),n},e._triggerCloseEvent=function(t){var e=o.Event(h.CLOSE);return o(t).trigger(e),e},e._removeElement=function(t){var e=this;o(t).removeClass(d),k.supportsTransitionEnd()&&o(t).hasClass(u)?o(t).one(k.TRANSITION_END,function(n){return e._destroyElement(t,n)}).emulateTransitionEnd(150):this._destroyElement(t)},e._destroyElement=function(t){o(t).detach().trigger(h.CLOSED).remove()},t._jQueryInterface=function(e){return this.each(function(){var n=o(this),i=n.data(a);i||(i=new t(this),n.data(a,i)),"close"===e&&i[e](this)})},t._handleDismiss=function(t){return function(e){e&&e.preventDefault(),t.close(this)}},i(t,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),t}(),o(document).on(h.CLICK_DATA_API,'[data-dismiss="alert"]',p._handleDismiss(new p)),o.fn[s]=p._jQueryInterface,o.fn[s].Constructor=p,o.fn[s].noConflict=function(){return o.fn[s]=c,p._jQueryInterface},p),P=(m="button",v="."+(_="bs.button"),E=".data-api",y=(g=e).fn[m],b="active",T="btn",C="focus",w='[data-toggle^="button"]',I='[data-toggle="buttons"]',A="input",D=".active",S=".btn",O={CLICK_DATA_API:"click"+v+E,FOCUS_BLUR_DATA_API:"focus"+v+E+" blur"+v+E},N=function(){function t(t){this._element=t}var e=t.prototype;return e.toggle=function(){var t=!0,e=!0,n=g(this._element).closest(I)[0];if(n){var i=g(this._element).find(A)[0];if(i){if("radio"===i.type)if(i.checked&&g(this._element).hasClass(b))t=!1;else{var r=g(n).find(D)[0];r&&g(r).removeClass(b)}if(t){if(i.hasAttribute("disabled")||n.hasAttribute("disabled")||i.classList.contains("disabled")||n.classList.contains("disabled"))return;i.checked=!g(this._element).hasClass(b),g(i).trigger("change")}i.focus(),e=!1}}e&&this._element.setAttribute("aria-pressed",!g(this._element).hasClass(b)),t&&g(this._element).toggleClass(b)},e.dispose=function(){g.removeData(this._element,_),this._element=null},t._jQueryInterface=function(e){return this.each(function(){var n=g(this).data(_);n||(n=new t(this),g(this).data(_,n)),"toggle"===e&&n[e]()})},i(t,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),t}(),g(document).on(O.CLICK_DATA_API,w,function(t){t.preventDefault();var e=t.target;g(e).hasClass(T)||(e=g(e).closest(S)),N._jQueryInterface.call(g(e),"toggle")}).on(O.FOCUS_BLUR_DATA_API,w,function(t){var e=g(t.target).closest(S)[0];g(e).toggleClass(C,/^focus(in)?$/.test(t.type))}),g.fn[m]=N._jQueryInterface,g.fn[m].Constructor=N,g.fn[m].noConflict=function(){return g.fn[m]=y,N._jQueryInterface},N),x=function(t){var e="carousel",n="bs.carousel",o="."+n,s=t.fn[e],a={interval:5e3,keyboard:!0,slide:!1,pause:"hover",wrap:!0},l={interval:"(number|boolean)",keyboard:"boolean",slide:"(boolean|string)",pause:"(string|boolean)",wrap:"boolean"},c="next",h="prev",f="left",u="right",d={SLIDE:"slide"+o,SLID:"slid"+o,KEYDOWN:"keydown"+o,MOUSEENTER:"mouseenter"+o,MOUSELEAVE:"mouseleave"+o,TOUCHEND:"touchend"+o,LOAD_DATA_API:"load"+o+".data-api",CLICK_DATA_API:"click"+o+".data-api"},p="carousel",g="active",m="slide",_="carousel-item-right",v="carousel-item-left",E="carousel-item-next",y="carousel-item-prev",b={ACTIVE:".active",ACTIVE_ITEM:".active.carousel-item",ITEM:".carousel-item",NEXT_PREV:".carousel-item-next, .carousel-item-prev",INDICATORS:".carousel-indicators",DATA_SLIDE:"[data-slide], [data-slide-to]",DATA_RIDE:'[data-ride="carousel"]'},T=function(){function s(e,n){this._items=null,this._interval=null,this._activeElement=null,this._isPaused=!1,this._isSliding=!1,this.touchTimeout=null,this._config=this._getConfig(n),this._element=t(e)[0],this._indicatorsElement=t(this._element).find(b.INDICATORS)[0],this._addEventListeners()}var T=s.prototype;return T.next=function(){this._isSliding||this._slide(c)},T.nextWhenVisible=function(){!document.hidden&&t(this._element).is(":visible")&&"hidden"!==t(this._element).css("visibility")&&this.next()},T.prev=function(){this._isSliding||this._slide(h)},T.pause=function(e){e||(this._isPaused=!0),t(this._element).find(b.NEXT_PREV)[0]&&k.supportsTransitionEnd()&&(k.triggerTransitionEnd(this._element),this.cycle(!0)),clearInterval(this._interval),this._interval=null},T.cycle=function(t){t||(this._isPaused=!1),this._interval&&(clearInterval(this._interval),this._interval=null),this._config.interval&&!this._isPaused&&(this._interval=setInterval((document.visibilityState?this.nextWhenVisible:this.next).bind(this),this._config.interval))},T.to=function(e){var n=this;this._activeElement=t(this._element).find(b.ACTIVE_ITEM)[0];var i=this._getItemIndex(this._activeElement);if(!(e>this._items.length-1||e<0))if(this._isSliding)t(this._element).one(d.SLID,function(){return n.to(e)});else{if(i===e)return this.pause(),void this.cycle();var r=e>i?c:h;this._slide(r,this._items[e])}},T.dispose=function(){t(this._element).off(o),t.removeData(this._element,n),this._items=null,this._config=null,this._element=null,this._interval=null,this._isPaused=null,this._isSliding=null,this._activeElement=null,this._indicatorsElement=null},T._getConfig=function(t){return t=r({},a,t),k.typeCheckConfig(e,t,l),t},T._addEventListeners=function(){var e=this;this._config.keyboard&&t(this._element).on(d.KEYDOWN,function(t){return e._keydown(t)}),"hover"===this._config.pause&&(t(this._element).on(d.MOUSEENTER,function(t){return e.pause(t)}).on(d.MOUSELEAVE,function(t){return e.cycle(t)}),"ontouchstart"in document.documentElement&&t(this._element).on(d.TOUCHEND,function(){e.pause(),e.touchTimeout&&clearTimeout(e.touchTimeout),e.touchTimeout=setTimeout(function(t){return e.cycle(t)},500+e._config.interval)}))},T._keydown=function(t){if(!/input|textarea/i.test(t.target.tagName))switch(t.which){case 37:t.preventDefault(),this.prev();break;case 39:t.preventDefault(),this.next()}},T._getItemIndex=function(e){return this._items=t.makeArray(t(e).parent().find(b.ITEM)),this._items.indexOf(e)},T._getItemByDirection=function(t,e){var n=t===c,i=t===h,r=this._getItemIndex(e),o=this._items.length-1;if((i&&0===r||n&&r===o)&&!this._config.wrap)return e;var s=(r+(t===h?-1:1))%this._items.length;return-1===s?this._items[this._items.length-1]:this._items[s]},T._triggerSlideEvent=function(e,n){var i=this._getItemIndex(e),r=this._getItemIndex(t(this._element).find(b.ACTIVE_ITEM)[0]),o=t.Event(d.SLIDE,{relatedTarget:e,direction:n,from:r,to:i});return t(this._element).trigger(o),o},T._setActiveIndicatorElement=function(e){if(this._indicatorsElement){t(this._indicatorsElement).find(b.ACTIVE).removeClass(g);var n=this._indicatorsElement.children[this._getItemIndex(e)];n&&t(n).addClass(g)}},T._slide=function(e,n){var i,r,o,s=this,a=t(this._element).find(b.ACTIVE_ITEM)[0],l=this._getItemIndex(a),h=n||a&&this._getItemByDirection(e,a),p=this._getItemIndex(h),T=Boolean(this._interval);if(e===c?(i=v,r=E,o=f):(i=_,r=y,o=u),h&&t(h).hasClass(g))this._isSliding=!1;else if(!this._triggerSlideEvent(h,o).isDefaultPrevented()&&a&&h){this._isSliding=!0,T&&this.pause(),this._setActiveIndicatorElement(h);var C=t.Event(d.SLID,{relatedTarget:h,direction:o,from:l,to:p});k.supportsTransitionEnd()&&t(this._element).hasClass(m)?(t(h).addClass(r),k.reflow(h),t(a).addClass(i),t(h).addClass(i),t(a).one(k.TRANSITION_END,function(){t(h).removeClass(i+" "+r).addClass(g),t(a).removeClass(g+" "+r+" "+i),s._isSliding=!1,setTimeout(function(){return t(s._element).trigger(C)},0)}).emulateTransitionEnd(600)):(t(a).removeClass(g),t(h).addClass(g),this._isSliding=!1,t(this._element).trigger(C)),T&&this.cycle()}},s._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n),o=r({},a,t(this).data());"object"==typeof e&&(o=r({},o,e));var l="string"==typeof e?e:o.slide;if(i||(i=new s(this,o),t(this).data(n,i)),"number"==typeof e)i.to(e);else if("string"==typeof l){if("undefined"==typeof i[l])throw new TypeError('No method named "'+l+'"');i[l]()}else o.interval&&(i.pause(),i.cycle())})},s._dataApiClickHandler=function(e){var i=k.getSelectorFromElement(this);if(i){var o=t(i)[0];if(o&&t(o).hasClass(p)){var a=r({},t(o).data(),t(this).data()),l=this.getAttribute("data-slide-to");l&&(a.interval=!1),s._jQueryInterface.call(t(o),a),l&&t(o).data(n).to(l),e.preventDefault()}}},i(s,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),s}();return t(document).on(d.CLICK_DATA_API,b.DATA_SLIDE,T._dataApiClickHandler),t(window).on(d.LOAD_DATA_API,function(){t(b.DATA_RIDE).each(function(){var e=t(this);T._jQueryInterface.call(e,e.data())})}),t.fn[e]=T._jQueryInterface,t.fn[e].Constructor=T,t.fn[e].noConflict=function(){return t.fn[e]=s,T._jQueryInterface},T}(e),R=function(t){var e="collapse",n="bs.collapse",o="."+n,s=t.fn[e],a={toggle:!0,parent:""},l={toggle:"boolean",parent:"(string|element)"},c={SHOW:"show"+o,SHOWN:"shown"+o,HIDE:"hide"+o,HIDDEN:"hidden"+o,CLICK_DATA_API:"click"+o+".data-api"},h="show",f="collapse",u="collapsing",d="collapsed",p="width",g="height",m={ACTIVES:".show, .collapsing",DATA_TOGGLE:'[data-toggle="collapse"]'},_=function(){function o(e,n){this._isTransitioning=!1,this._element=e,this._config=this._getConfig(n),this._triggerArray=t.makeArray(t('[data-toggle="collapse"][href="#'+e.id+'"],[data-toggle="collapse"][data-target="#'+e.id+'"]'));for(var i=t(m.DATA_TOGGLE),r=0;r<i.length;r++){var o=i[r],s=k.getSelectorFromElement(o);null!==s&&t(s).filter(e).length>0&&(this._selector=s,this._triggerArray.push(o))}this._parent=this._config.parent?this._getParent():null,this._config.parent||this._addAriaAndCollapsedClass(this._element,this._triggerArray),this._config.toggle&&this.toggle()}var s=o.prototype;return s.toggle=function(){t(this._element).hasClass(h)?this.hide():this.show()},s.show=function(){var e,i,r=this;if(!this._isTransitioning&&!t(this._element).hasClass(h)&&(this._parent&&0===(e=t.makeArray(t(this._parent).find(m.ACTIVES).filter('[data-parent="'+this._config.parent+'"]'))).length&&(e=null),!(e&&(i=t(e).not(this._selector).data(n))&&i._isTransitioning))){var s=t.Event(c.SHOW);if(t(this._element).trigger(s),!s.isDefaultPrevented()){e&&(o._jQueryInterface.call(t(e).not(this._selector),"hide"),i||t(e).data(n,null));var a=this._getDimension();t(this._element).removeClass(f).addClass(u),this._element.style[a]=0,this._triggerArray.length>0&&t(this._triggerArray).removeClass(d).attr("aria-expanded",!0),this.setTransitioning(!0);var l=function(){t(r._element).removeClass(u).addClass(f).addClass(h),r._element.style[a]="",r.setTransitioning(!1),t(r._element).trigger(c.SHOWN)};if(k.supportsTransitionEnd()){var p="scroll"+(a[0].toUpperCase()+a.slice(1));t(this._element).one(k.TRANSITION_END,l).emulateTransitionEnd(600),this._element.style[a]=this._element[p]+"px"}else l()}}},s.hide=function(){var e=this;if(!this._isTransitioning&&t(this._element).hasClass(h)){var n=t.Event(c.HIDE);if(t(this._element).trigger(n),!n.isDefaultPrevented()){var i=this._getDimension();if(this._element.style[i]=this._element.getBoundingClientRect()[i]+"px",k.reflow(this._element),t(this._element).addClass(u).removeClass(f).removeClass(h),this._triggerArray.length>0)for(var r=0;r<this._triggerArray.length;r++){var o=this._triggerArray[r],s=k.getSelectorFromElement(o);if(null!==s)t(s).hasClass(h)||t(o).addClass(d).attr("aria-expanded",!1)}this.setTransitioning(!0);var a=function(){e.setTransitioning(!1),t(e._element).removeClass(u).addClass(f).trigger(c.HIDDEN)};this._element.style[i]="",k.supportsTransitionEnd()?t(this._element).one(k.TRANSITION_END,a).emulateTransitionEnd(600):a()}}},s.setTransitioning=function(t){this._isTransitioning=t},s.dispose=function(){t.removeData(this._element,n),this._config=null,this._parent=null,this._element=null,this._triggerArray=null,this._isTransitioning=null},s._getConfig=function(t){return(t=r({},a,t)).toggle=Boolean(t.toggle),k.typeCheckConfig(e,t,l),t},s._getDimension=function(){return t(this._element).hasClass(p)?p:g},s._getParent=function(){var e=this,n=null;k.isElement(this._config.parent)?(n=this._config.parent,"undefined"!=typeof this._config.parent.jquery&&(n=this._config.parent[0])):n=t(this._config.parent)[0];var i='[data-toggle="collapse"][data-parent="'+this._config.parent+'"]';return t(n).find(i).each(function(t,n){e._addAriaAndCollapsedClass(o._getTargetFromElement(n),[n])}),n},s._addAriaAndCollapsedClass=function(e,n){if(e){var i=t(e).hasClass(h);n.length>0&&t(n).toggleClass(d,!i).attr("aria-expanded",i)}},o._getTargetFromElement=function(e){var n=k.getSelectorFromElement(e);return n?t(n)[0]:null},o._jQueryInterface=function(e){return this.each(function(){var i=t(this),s=i.data(n),l=r({},a,i.data(),"object"==typeof e&&e);if(!s&&l.toggle&&/show|hide/.test(e)&&(l.toggle=!1),s||(s=new o(this,l),i.data(n,s)),"string"==typeof e){if("undefined"==typeof s[e])throw new TypeError('No method named "'+e+'"');s[e]()}})},i(o,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),o}();return t(document).on(c.CLICK_DATA_API,m.DATA_TOGGLE,function(e){"A"===e.currentTarget.tagName&&e.preventDefault();var i=t(this),r=k.getSelectorFromElement(this);t(r).each(function(){var e=t(this),r=e.data(n)?"toggle":i.data();_._jQueryInterface.call(e,r)})}),t.fn[e]=_._jQueryInterface,t.fn[e].Constructor=_,t.fn[e].noConflict=function(){return t.fn[e]=s,_._jQueryInterface},_}(e),j="undefined"!=typeof window&&"undefined"!=typeof document,H=["Edge","Trident","Firefox"],M=0,W=0;W<H.length;W+=1)if(j&&navigator.userAgent.indexOf(H[W])>=0){M=1;break}var U=j&&window.Promise?function(t){var e=!1;return function(){e||(e=!0,window.Promise.resolve().then(function(){e=!1,t()}))}}:function(t){var e=!1;return function(){e||(e=!0,setTimeout(function(){e=!1,t()},M))}};function B(t){return t&&"[object Function]"==={}.toString.call(t)}function F(t,e){if(1!==t.nodeType)return[];var n=getComputedStyle(t,null);return e?n[e]:n}function K(t){return"HTML"===t.nodeName?t:t.parentNode||t.host}function V(t){if(!t)return document.body;switch(t.nodeName){case"HTML":case"BODY":return t.ownerDocument.body;case"#document":return t.body}var e=F(t),n=e.overflow,i=e.overflowX,r=e.overflowY;return/(auto|scroll)/.test(n+r+i)?t:V(K(t))}function Q(t){var e=t&&t.offsetParent,n=e&&e.nodeName;return n&&"BODY"!==n&&"HTML"!==n?-1!==["TD","TABLE"].indexOf(e.nodeName)&&"static"===F(e,"position")?Q(e):e:t?t.ownerDocument.documentElement:document.documentElement}function Y(t){return null!==t.parentNode?Y(t.parentNode):t}function G(t,e){if(!(t&&t.nodeType&&e&&e.nodeType))return document.documentElement;var n=t.compareDocumentPosition(e)&Node.DOCUMENT_POSITION_FOLLOWING,i=n?t:e,r=n?e:t,o=document.createRange();o.setStart(i,0),o.setEnd(r,0);var s,a,l=o.commonAncestorContainer;if(t!==l&&e!==l||i.contains(r))return"BODY"===(a=(s=l).nodeName)||"HTML"!==a&&Q(s.firstElementChild)!==s?Q(l):l;var c=Y(t);return c.host?G(c.host,e):G(t,Y(e).host)}function q(t){var e="top"===(arguments.length>1&&void 0!==arguments[1]?arguments[1]:"top")?"scrollTop":"scrollLeft",n=t.nodeName;if("BODY"===n||"HTML"===n){var i=t.ownerDocument.documentElement;return(t.ownerDocument.scrollingElement||i)[e]}return t[e]}function z(t,e){var n="x"===e?"Left":"Top",i="Left"===n?"Right":"Bottom";return parseFloat(t["border"+n+"Width"],10)+parseFloat(t["border"+i+"Width"],10)}var X=void 0,Z=function(){return void 0===X&&(X=-1!==navigator.appVersion.indexOf("MSIE 10")),X};function J(t,e,n,i){return Math.max(e["offset"+t],e["scroll"+t],n["client"+t],n["offset"+t],n["scroll"+t],Z()?n["offset"+t]+i["margin"+("Height"===t?"Top":"Left")]+i["margin"+("Height"===t?"Bottom":"Right")]:0)}function $(){var t=document.body,e=document.documentElement,n=Z()&&getComputedStyle(e);return{height:J("Height",t,e,n),width:J("Width",t,e,n)}}var tt=function(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")},et=function(){function t(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}return function(e,n,i){return n&&t(e.prototype,n),i&&t(e,i),e}}(),nt=function(t,e,n){return e in t?Object.defineProperty(t,e,{value:n,enumerable:!0,configurable:!0,writable:!0}):t[e]=n,t},it=Object.assign||function(t){for(var e=1;e<arguments.length;e++){var n=arguments[e];for(var i in n)Object.prototype.hasOwnProperty.call(n,i)&&(t[i]=n[i])}return t};function rt(t){return it({},t,{right:t.left+t.width,bottom:t.top+t.height})}function ot(t){var e={};if(Z())try{e=t.getBoundingClientRect();var n=q(t,"top"),i=q(t,"left");e.top+=n,e.left+=i,e.bottom+=n,e.right+=i}catch(t){}else e=t.getBoundingClientRect();var r={left:e.left,top:e.top,width:e.right-e.left,height:e.bottom-e.top},o="HTML"===t.nodeName?$():{},s=o.width||t.clientWidth||r.right-r.left,a=o.height||t.clientHeight||r.bottom-r.top,l=t.offsetWidth-s,c=t.offsetHeight-a;if(l||c){var h=F(t);l-=z(h,"x"),c-=z(h,"y"),r.width-=l,r.height-=c}return rt(r)}function st(t,e){var n=Z(),i="HTML"===e.nodeName,r=ot(t),o=ot(e),s=V(t),a=F(e),l=parseFloat(a.borderTopWidth,10),c=parseFloat(a.borderLeftWidth,10),h=rt({top:r.top-o.top-l,left:r.left-o.left-c,width:r.width,height:r.height});if(h.marginTop=0,h.marginLeft=0,!n&&i){var f=parseFloat(a.marginTop,10),u=parseFloat(a.marginLeft,10);h.top-=l-f,h.bottom-=l-f,h.left-=c-u,h.right-=c-u,h.marginTop=f,h.marginLeft=u}return(n?e.contains(s):e===s&&"BODY"!==s.nodeName)&&(h=function(t,e){var n=arguments.length>2&&void 0!==arguments[2]&&arguments[2],i=q(e,"top"),r=q(e,"left"),o=n?-1:1;return t.top+=i*o,t.bottom+=i*o,t.left+=r*o,t.right+=r*o,t}(h,e)),h}function at(t,e,n,i){var r,o,s,a,l,c,h,f={top:0,left:0},u=G(t,e);if("viewport"===i)o=(r=u).ownerDocument.documentElement,s=st(r,o),a=Math.max(o.clientWidth,window.innerWidth||0),l=Math.max(o.clientHeight,window.innerHeight||0),c=q(o),h=q(o,"left"),f=rt({top:c-s.top+s.marginTop,left:h-s.left+s.marginLeft,width:a,height:l});else{var d=void 0;"scrollParent"===i?"BODY"===(d=V(K(e))).nodeName&&(d=t.ownerDocument.documentElement):d="window"===i?t.ownerDocument.documentElement:i;var p=st(d,u);if("HTML"!==d.nodeName||function t(e){var n=e.nodeName;return"BODY"!==n&&"HTML"!==n&&("fixed"===F(e,"position")||t(K(e)))}(u))f=p;else{var g=$(),m=g.height,_=g.width;f.top+=p.top-p.marginTop,f.bottom=m+p.top,f.left+=p.left-p.marginLeft,f.right=_+p.left}}return f.left+=n,f.top+=n,f.right-=n,f.bottom-=n,f}function lt(t,e,n,i,r){var o=arguments.length>5&&void 0!==arguments[5]?arguments[5]:0;if(-1===t.indexOf("auto"))return t;var s=at(n,i,o,r),a={top:{width:s.width,height:e.top-s.top},right:{width:s.right-e.right,height:s.height},bottom:{width:s.width,height:s.bottom-e.bottom},left:{width:e.left-s.left,height:s.height}},l=Object.keys(a).map(function(t){return it({key:t},a[t],{area:(e=a[t],e.width*e.height)});var e}).sort(function(t,e){return e.area-t.area}),c=l.filter(function(t){var e=t.width,i=t.height;return e>=n.clientWidth&&i>=n.clientHeight}),h=c.length>0?c[0].key:l[0].key,f=t.split("-")[1];return h+(f?"-"+f:"")}function ct(t,e,n){return st(n,G(e,n))}function ht(t){var e=getComputedStyle(t),n=parseFloat(e.marginTop)+parseFloat(e.marginBottom),i=parseFloat(e.marginLeft)+parseFloat(e.marginRight);return{width:t.offsetWidth+i,height:t.offsetHeight+n}}function ft(t){var e={left:"right",right:"left",bottom:"top",top:"bottom"};return t.replace(/left|right|bottom|top/g,function(t){return e[t]})}function ut(t,e,n){n=n.split("-")[0];var i=ht(t),r={width:i.width,height:i.height},o=-1!==["right","left"].indexOf(n),s=o?"top":"left",a=o?"left":"top",l=o?"height":"width",c=o?"width":"height";return r[s]=e[s]+e[l]/2-i[l]/2,r[a]=n===a?e[a]-i[c]:e[ft(a)],r}function dt(t,e){return Array.prototype.find?t.find(e):t.filter(e)[0]}function pt(t,e,n){return(void 0===n?t:t.slice(0,function(t,e,n){if(Array.prototype.findIndex)return t.findIndex(function(t){return t[e]===n});var i=dt(t,function(t){return t[e]===n});return t.indexOf(i)}(t,"name",n))).forEach(function(t){t.function&&console.warn("`modifier.function` is deprecated, use `modifier.fn`!");var n=t.function||t.fn;t.enabled&&B(n)&&(e.offsets.popper=rt(e.offsets.popper),e.offsets.reference=rt(e.offsets.reference),e=n(e,t))}),e}function gt(t,e){return t.some(function(t){var n=t.name;return t.enabled&&n===e})}function mt(t){for(var e=[!1,"ms","Webkit","Moz","O"],n=t.charAt(0).toUpperCase()+t.slice(1),i=0;i<e.length-1;i++){var r=e[i],o=r?""+r+n:t;if("undefined"!=typeof document.body.style[o])return o}return null}function _t(t){var e=t.ownerDocument;return e?e.defaultView:window}function vt(t,e,n,i){n.updateBound=i,_t(t).addEventListener("resize",n.updateBound,{passive:!0});var r=V(t);return function t(e,n,i,r){var o="BODY"===e.nodeName,s=o?e.ownerDocument.defaultView:e;s.addEventListener(n,i,{passive:!0}),o||t(V(s.parentNode),n,i,r),r.push(s)}(r,"scroll",n.updateBound,n.scrollParents),n.scrollElement=r,n.eventsEnabled=!0,n}function Et(){var t,e;this.state.eventsEnabled&&(cancelAnimationFrame(this.scheduleUpdate),this.state=(t=this.reference,e=this.state,_t(t).removeEventListener("resize",e.updateBound),e.scrollParents.forEach(function(t){t.removeEventListener("scroll",e.updateBound)}),e.updateBound=null,e.scrollParents=[],e.scrollElement=null,e.eventsEnabled=!1,e))}function yt(t){return""!==t&&!isNaN(parseFloat(t))&&isFinite(t)}function bt(t,e){Object.keys(e).forEach(function(n){var i="";-1!==["width","height","top","right","bottom","left"].indexOf(n)&&yt(e[n])&&(i="px"),t.style[n]=e[n]+i})}function Tt(t,e,n){var i=dt(t,function(t){return t.name===e}),r=!!i&&t.some(function(t){return t.name===n&&t.enabled&&t.order<i.order});if(!r){var o="`"+e+"`",s="`"+n+"`";console.warn(s+" modifier is required by "+o+" modifier in order to work, be sure to include it before "+o+"!")}return r}var Ct=["auto-start","auto","auto-end","top-start","top","top-end","right-start","right","right-end","bottom-end","bottom","bottom-start","left-end","left","left-start"],wt=Ct.slice(3);function It(t){var e=arguments.length>1&&void 0!==arguments[1]&&arguments[1],n=wt.indexOf(t),i=wt.slice(n+1).concat(wt.slice(0,n));return e?i.reverse():i}var At={FLIP:"flip",CLOCKWISE:"clockwise",COUNTERCLOCKWISE:"counterclockwise"};function Dt(t,e,n,i){var r=[0,0],o=-1!==["right","left"].indexOf(i),s=t.split(/(\+|\-)/).map(function(t){return t.trim()}),a=s.indexOf(dt(s,function(t){return-1!==t.search(/,|\s/)}));s[a]&&-1===s[a].indexOf(",")&&console.warn("Offsets separated by white space(s) are deprecated, use a comma (,) instead.");var l=/\s*,\s*|\s+/,c=-1!==a?[s.slice(0,a).concat([s[a].split(l)[0]]),[s[a].split(l)[1]].concat(s.slice(a+1))]:[s];return(c=c.map(function(t,i){var r=(1===i?!o:o)?"height":"width",s=!1;return t.reduce(function(t,e){return""===t[t.length-1]&&-1!==["+","-"].indexOf(e)?(t[t.length-1]=e,s=!0,t):s?(t[t.length-1]+=e,s=!1,t):t.concat(e)},[]).map(function(t){return function(t,e,n,i){var r=t.match(/((?:\-|\+)?\d*\.?\d*)(.*)/),o=+r[1],s=r[2];if(!o)return t;if(0===s.indexOf("%")){var a=void 0;switch(s){case"%p":a=n;break;case"%":case"%r":default:a=i}return rt(a)[e]/100*o}if("vh"===s||"vw"===s)return("vh"===s?Math.max(document.documentElement.clientHeight,window.innerHeight||0):Math.max(document.documentElement.clientWidth,window.innerWidth||0))/100*o;return o}(t,r,e,n)})})).forEach(function(t,e){t.forEach(function(n,i){yt(n)&&(r[e]+=n*("-"===t[i-1]?-1:1))})}),r}var St={placement:"bottom",eventsEnabled:!0,removeOnDestroy:!1,onCreate:function(){},onUpdate:function(){},modifiers:{shift:{order:100,enabled:!0,fn:function(t){var e=t.placement,n=e.split("-")[0],i=e.split("-")[1];if(i){var r=t.offsets,o=r.reference,s=r.popper,a=-1!==["bottom","top"].indexOf(n),l=a?"left":"top",c=a?"width":"height",h={start:nt({},l,o[l]),end:nt({},l,o[l]+o[c]-s[c])};t.offsets.popper=it({},s,h[i])}return t}},offset:{order:200,enabled:!0,fn:function(t,e){var n=e.offset,i=t.placement,r=t.offsets,o=r.popper,s=r.reference,a=i.split("-")[0],l=void 0;return l=yt(+n)?[+n,0]:Dt(n,o,s,a),"left"===a?(o.top+=l[0],o.left-=l[1]):"right"===a?(o.top+=l[0],o.left+=l[1]):"top"===a?(o.left+=l[0],o.top-=l[1]):"bottom"===a&&(o.left+=l[0],o.top+=l[1]),t.popper=o,t},offset:0},preventOverflow:{order:300,enabled:!0,fn:function(t,e){var n=e.boundariesElement||Q(t.instance.popper);t.instance.reference===n&&(n=Q(n));var i=at(t.instance.popper,t.instance.reference,e.padding,n);e.boundaries=i;var r=e.priority,o=t.offsets.popper,s={primary:function(t){var n=o[t];return o[t]<i[t]&&!e.escapeWithReference&&(n=Math.max(o[t],i[t])),nt({},t,n)},secondary:function(t){var n="right"===t?"left":"top",r=o[n];return o[t]>i[t]&&!e.escapeWithReference&&(r=Math.min(o[n],i[t]-("right"===t?o.width:o.height))),nt({},n,r)}};return r.forEach(function(t){var e=-1!==["left","top"].indexOf(t)?"primary":"secondary";o=it({},o,s[e](t))}),t.offsets.popper=o,t},priority:["left","right","top","bottom"],padding:5,boundariesElement:"scrollParent"},keepTogether:{order:400,enabled:!0,fn:function(t){var e=t.offsets,n=e.popper,i=e.reference,r=t.placement.split("-")[0],o=Math.floor,s=-1!==["top","bottom"].indexOf(r),a=s?"right":"bottom",l=s?"left":"top",c=s?"width":"height";return n[a]<o(i[l])&&(t.offsets.popper[l]=o(i[l])-n[c]),n[l]>o(i[a])&&(t.offsets.popper[l]=o(i[a])),t}},arrow:{order:500,enabled:!0,fn:function(t,e){var n;if(!Tt(t.instance.modifiers,"arrow","keepTogether"))return t;var i=e.element;if("string"==typeof i){if(!(i=t.instance.popper.querySelector(i)))return t}else if(!t.instance.popper.contains(i))return console.warn("WARNING: `arrow.element` must be child of its popper element!"),t;var r=t.placement.split("-")[0],o=t.offsets,s=o.popper,a=o.reference,l=-1!==["left","right"].indexOf(r),c=l?"height":"width",h=l?"Top":"Left",f=h.toLowerCase(),u=l?"left":"top",d=l?"bottom":"right",p=ht(i)[c];a[d]-p<s[f]&&(t.offsets.popper[f]-=s[f]-(a[d]-p)),a[f]+p>s[d]&&(t.offsets.popper[f]+=a[f]+p-s[d]),t.offsets.popper=rt(t.offsets.popper);var g=a[f]+a[c]/2-p/2,m=F(t.instance.popper),_=parseFloat(m["margin"+h],10),v=parseFloat(m["border"+h+"Width"],10),E=g-t.offsets.popper[f]-_-v;return E=Math.max(Math.min(s[c]-p,E),0),t.arrowElement=i,t.offsets.arrow=(nt(n={},f,Math.round(E)),nt(n,u,""),n),t},element:"[x-arrow]"},flip:{order:600,enabled:!0,fn:function(t,e){if(gt(t.instance.modifiers,"inner"))return t;if(t.flipped&&t.placement===t.originalPlacement)return t;var n=at(t.instance.popper,t.instance.reference,e.padding,e.boundariesElement),i=t.placement.split("-")[0],r=ft(i),o=t.placement.split("-")[1]||"",s=[];switch(e.behavior){case At.FLIP:s=[i,r];break;case At.CLOCKWISE:s=It(i);break;case At.COUNTERCLOCKWISE:s=It(i,!0);break;default:s=e.behavior}return s.forEach(function(a,l){if(i!==a||s.length===l+1)return t;i=t.placement.split("-")[0],r=ft(i);var c,h=t.offsets.popper,f=t.offsets.reference,u=Math.floor,d="left"===i&&u(h.right)>u(f.left)||"right"===i&&u(h.left)<u(f.right)||"top"===i&&u(h.bottom)>u(f.top)||"bottom"===i&&u(h.top)<u(f.bottom),p=u(h.left)<u(n.left),g=u(h.right)>u(n.right),m=u(h.top)<u(n.top),_=u(h.bottom)>u(n.bottom),v="left"===i&&p||"right"===i&&g||"top"===i&&m||"bottom"===i&&_,E=-1!==["top","bottom"].indexOf(i),y=!!e.flipVariations&&(E&&"start"===o&&p||E&&"end"===o&&g||!E&&"start"===o&&m||!E&&"end"===o&&_);(d||v||y)&&(t.flipped=!0,(d||v)&&(i=s[l+1]),y&&(o="end"===(c=o)?"start":"start"===c?"end":c),t.placement=i+(o?"-"+o:""),t.offsets.popper=it({},t.offsets.popper,ut(t.instance.popper,t.offsets.reference,t.placement)),t=pt(t.instance.modifiers,t,"flip"))}),t},behavior:"flip",padding:5,boundariesElement:"viewport"},inner:{order:700,enabled:!1,fn:function(t){var e=t.placement,n=e.split("-")[0],i=t.offsets,r=i.popper,o=i.reference,s=-1!==["left","right"].indexOf(n),a=-1===["top","left"].indexOf(n);return r[s?"left":"top"]=o[n]-(a?r[s?"width":"height"]:0),t.placement=ft(e),t.offsets.popper=rt(r),t}},hide:{order:800,enabled:!0,fn:function(t){if(!Tt(t.instance.modifiers,"hide","preventOverflow"))return t;var e=t.offsets.reference,n=dt(t.instance.modifiers,function(t){return"preventOverflow"===t.name}).boundaries;if(e.bottom<n.top||e.left>n.right||e.top>n.bottom||e.right<n.left){if(!0===t.hide)return t;t.hide=!0,t.attributes["x-out-of-boundaries"]=""}else{if(!1===t.hide)return t;t.hide=!1,t.attributes["x-out-of-boundaries"]=!1}return t}},computeStyle:{order:850,enabled:!0,fn:function(t,e){var n=e.x,i=e.y,r=t.offsets.popper,o=dt(t.instance.modifiers,function(t){return"applyStyle"===t.name}).gpuAcceleration;void 0!==o&&console.warn("WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!");var s=void 0!==o?o:e.gpuAcceleration,a=ot(Q(t.instance.popper)),l={position:r.position},c={left:Math.floor(r.left),top:Math.floor(r.top),bottom:Math.floor(r.bottom),right:Math.floor(r.right)},h="bottom"===n?"top":"bottom",f="right"===i?"left":"right",u=mt("transform"),d=void 0,p=void 0;if(p="bottom"===h?-a.height+c.bottom:c.top,d="right"===f?-a.width+c.right:c.left,s&&u)l[u]="translate3d("+d+"px, "+p+"px, 0)",l[h]=0,l[f]=0,l.willChange="transform";else{var g="bottom"===h?-1:1,m="right"===f?-1:1;l[h]=p*g,l[f]=d*m,l.willChange=h+", "+f}var _={"x-placement":t.placement};return t.attributes=it({},_,t.attributes),t.styles=it({},l,t.styles),t.arrowStyles=it({},t.offsets.arrow,t.arrowStyles),t},gpuAcceleration:!0,x:"bottom",y:"right"},applyStyle:{order:900,enabled:!0,fn:function(t){var e,n;return bt(t.instance.popper,t.styles),e=t.instance.popper,n=t.attributes,Object.keys(n).forEach(function(t){!1!==n[t]?e.setAttribute(t,n[t]):e.removeAttribute(t)}),t.arrowElement&&Object.keys(t.arrowStyles).length&&bt(t.arrowElement,t.arrowStyles),t},onLoad:function(t,e,n,i,r){var o=ct(0,e,t),s=lt(n.placement,o,e,t,n.modifiers.flip.boundariesElement,n.modifiers.flip.padding);return e.setAttribute("x-placement",s),bt(e,{position:"absolute"}),n},gpuAcceleration:void 0}}},Ot=function(){function t(e,n){var i=this,r=arguments.length>2&&void 0!==arguments[2]?arguments[2]:{};tt(this,t),this.scheduleUpdate=function(){return requestAnimationFrame(i.update)},this.update=U(this.update.bind(this)),this.options=it({},t.Defaults,r),this.state={isDestroyed:!1,isCreated:!1,scrollParents:[]},this.reference=e&&e.jquery?e[0]:e,this.popper=n&&n.jquery?n[0]:n,this.options.modifiers={},Object.keys(it({},t.Defaults.modifiers,r.modifiers)).forEach(function(e){i.options.modifiers[e]=it({},t.Defaults.modifiers[e]||{},r.modifiers?r.modifiers[e]:{})}),this.modifiers=Object.keys(this.options.modifiers).map(function(t){return it({name:t},i.options.modifiers[t])}).sort(function(t,e){return t.order-e.order}),this.modifiers.forEach(function(t){t.enabled&&B(t.onLoad)&&t.onLoad(i.reference,i.popper,i.options,t,i.state)}),this.update();var o=this.options.eventsEnabled;o&&this.enableEventListeners(),this.state.eventsEnabled=o}return et(t,[{key:"update",value:function(){return function(){if(!this.state.isDestroyed){var t={instance:this,styles:{},arrowStyles:{},attributes:{},flipped:!1,offsets:{}};t.offsets.reference=ct(this.state,this.popper,this.reference),t.placement=lt(this.options.placement,t.offsets.reference,this.popper,this.reference,this.options.modifiers.flip.boundariesElement,this.options.modifiers.flip.padding),t.originalPlacement=t.placement,t.offsets.popper=ut(this.popper,t.offsets.reference,t.placement),t.offsets.popper.position="absolute",t=pt(this.modifiers,t),this.state.isCreated?this.options.onUpdate(t):(this.state.isCreated=!0,this.options.onCreate(t))}}.call(this)}},{key:"destroy",value:function(){return function(){return this.state.isDestroyed=!0,gt(this.modifiers,"applyStyle")&&(this.popper.removeAttribute("x-placement"),this.popper.style.left="",this.popper.style.position="",this.popper.style.top="",this.popper.style[mt("transform")]=""),this.disableEventListeners(),this.options.removeOnDestroy&&this.popper.parentNode.removeChild(this.popper),this}.call(this)}},{key:"enableEventListeners",value:function(){return function(){this.state.eventsEnabled||(this.state=vt(this.reference,this.options,this.state,this.scheduleUpdate))}.call(this)}},{key:"disableEventListeners",value:function(){return Et.call(this)}}]),t}();Ot.Utils=("undefined"!=typeof window?window:global).PopperUtils,Ot.placements=Ct,Ot.Defaults=St;var Nt=function(t){var e="dropdown",n="bs.dropdown",o="."+n,s=t.fn[e],a=new RegExp("38|40|27"),l={HIDE:"hide"+o,HIDDEN:"hidden"+o,SHOW:"show"+o,SHOWN:"shown"+o,CLICK:"click"+o,CLICK_DATA_API:"click"+o+".data-api",KEYDOWN_DATA_API:"keydown"+o+".data-api",KEYUP_DATA_API:"keyup"+o+".data-api"},c="disabled",h="show",f="dropup",u="dropright",d="dropleft",p="dropdown-menu-right",g="dropdown-menu-left",m="position-static",_='[data-toggle="dropdown"]',v=".dropdown form",E=".dropdown-menu",y=".navbar-nav",b=".dropdown-menu .dropdown-item:not(.disabled)",T="top-start",C="top-end",w="bottom-start",I="bottom-end",A="right-start",D="left-start",S={offset:0,flip:!0,boundary:"scrollParent"},O={offset:"(number|string|function)",flip:"boolean",boundary:"(string|element)"},N=function(){function s(t,e){this._element=t,this._popper=null,this._config=this._getConfig(e),this._menu=this._getMenuElement(),this._inNavbar=this._detectNavbar(),this._addEventListeners()}var v=s.prototype;return v.toggle=function(){if(!this._element.disabled&&!t(this._element).hasClass(c)){var e=s._getParentFromElement(this._element),n=t(this._menu).hasClass(h);if(s._clearMenus(),!n){var i={relatedTarget:this._element},r=t.Event(l.SHOW,i);if(t(e).trigger(r),!r.isDefaultPrevented()){if(!this._inNavbar){if("undefined"==typeof Ot)throw new TypeError("Bootstrap dropdown require Popper.js (https://popper.js.org)");var o=this._element;t(e).hasClass(f)&&(t(this._menu).hasClass(g)||t(this._menu).hasClass(p))&&(o=e),"scrollParent"!==this._config.boundary&&t(e).addClass(m),this._popper=new Ot(o,this._menu,this._getPopperConfig())}"ontouchstart"in document.documentElement&&0===t(e).closest(y).length&&t("body").children().on("mouseover",null,t.noop),this._element.focus(),this._element.setAttribute("aria-expanded",!0),t(this._menu).toggleClass(h),t(e).toggleClass(h).trigger(t.Event(l.SHOWN,i))}}}},v.dispose=function(){t.removeData(this._element,n),t(this._element).off(o),this._element=null,this._menu=null,null!==this._popper&&(this._popper.destroy(),this._popper=null)},v.update=function(){this._inNavbar=this._detectNavbar(),null!==this._popper&&this._popper.scheduleUpdate()},v._addEventListeners=function(){var e=this;t(this._element).on(l.CLICK,function(t){t.preventDefault(),t.stopPropagation(),e.toggle()})},v._getConfig=function(n){return n=r({},this.constructor.Default,t(this._element).data(),n),k.typeCheckConfig(e,n,this.constructor.DefaultType),n},v._getMenuElement=function(){if(!this._menu){var e=s._getParentFromElement(this._element);this._menu=t(e).find(E)[0]}return this._menu},v._getPlacement=function(){var e=t(this._element).parent(),n=w;return e.hasClass(f)?(n=T,t(this._menu).hasClass(p)&&(n=C)):e.hasClass(u)?n=A:e.hasClass(d)?n=D:t(this._menu).hasClass(p)&&(n=I),n},v._detectNavbar=function(){return t(this._element).closest(".navbar").length>0},v._getPopperConfig=function(){var t=this,e={};return"function"==typeof this._config.offset?e.fn=function(e){return e.offsets=r({},e.offsets,t._config.offset(e.offsets)||{}),e}:e.offset=this._config.offset,{placement:this._getPlacement(),modifiers:{offset:e,flip:{enabled:this._config.flip},preventOverflow:{boundariesElement:this._config.boundary}}}},s._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n);if(i||(i=new s(this,"object"==typeof e?e:null),t(this).data(n,i)),"string"==typeof e){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},s._clearMenus=function(e){if(!e||3!==e.which&&("keyup"!==e.type||9===e.which))for(var i=t.makeArray(t(_)),r=0;r<i.length;r++){var o=s._getParentFromElement(i[r]),a=t(i[r]).data(n),c={relatedTarget:i[r]};if(a){var f=a._menu;if(t(o).hasClass(h)&&!(e&&("click"===e.type&&/input|textarea/i.test(e.target.tagName)||"keyup"===e.type&&9===e.which)&&t.contains(o,e.target))){var u=t.Event(l.HIDE,c);t(o).trigger(u),u.isDefaultPrevented()||("ontouchstart"in document.documentElement&&t("body").children().off("mouseover",null,t.noop),i[r].setAttribute("aria-expanded","false"),t(f).removeClass(h),t(o).removeClass(h).trigger(t.Event(l.HIDDEN,c)))}}}},s._getParentFromElement=function(e){var n,i=k.getSelectorFromElement(e);return i&&(n=t(i)[0]),n||e.parentNode},s._dataApiKeydownHandler=function(e){if((/input|textarea/i.test(e.target.tagName)?!(32===e.which||27!==e.which&&(40!==e.which&&38!==e.which||t(e.target).closest(E).length)):a.test(e.which))&&(e.preventDefault(),e.stopPropagation(),!this.disabled&&!t(this).hasClass(c))){var n=s._getParentFromElement(this),i=t(n).hasClass(h);if((i||27===e.which&&32===e.which)&&(!i||27!==e.which&&32!==e.which)){var r=t(n).find(b).get();if(0!==r.length){var o=r.indexOf(e.target);38===e.which&&o>0&&o--,40===e.which&&o<r.length-1&&o++,o<0&&(o=0),r[o].focus()}}else{if(27===e.which){var l=t(n).find(_)[0];t(l).trigger("focus")}t(this).trigger("click")}}},i(s,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return S}},{key:"DefaultType",get:function(){return O}}]),s}();return t(document).on(l.KEYDOWN_DATA_API,_,N._dataApiKeydownHandler).on(l.KEYDOWN_DATA_API,E,N._dataApiKeydownHandler).on(l.CLICK_DATA_API+" "+l.KEYUP_DATA_API,N._clearMenus).on(l.CLICK_DATA_API,_,function(e){e.preventDefault(),e.stopPropagation(),N._jQueryInterface.call(t(this),"toggle")}).on(l.CLICK_DATA_API,v,function(t){t.stopPropagation()}),t.fn[e]=N._jQueryInterface,t.fn[e].Constructor=N,t.fn[e].noConflict=function(){return t.fn[e]=s,N._jQueryInterface},N}(e),kt=function(t){var e="bs.modal",n="."+e,o=t.fn.modal,s={backdrop:!0,keyboard:!0,focus:!0,show:!0},a={backdrop:"(boolean|string)",keyboard:"boolean",focus:"boolean",show:"boolean"},l={HIDE:"hide"+n,HIDDEN:"hidden"+n,SHOW:"show"+n,SHOWN:"shown"+n,FOCUSIN:"focusin"+n,RESIZE:"resize"+n,CLICK_DISMISS:"click.dismiss"+n,KEYDOWN_DISMISS:"keydown.dismiss"+n,MOUSEUP_DISMISS:"mouseup.dismiss"+n,MOUSEDOWN_DISMISS:"mousedown.dismiss"+n,CLICK_DATA_API:"click.bs.modal.data-api"},c="modal-scrollbar-measure",h="modal-backdrop",f="modal-open",u="fade",d="show",p={DIALOG:".modal-dialog",DATA_TOGGLE:'[data-toggle="modal"]',DATA_DISMISS:'[data-dismiss="modal"]',FIXED_CONTENT:".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",STICKY_CONTENT:".sticky-top",NAVBAR_TOGGLER:".navbar-toggler"},g=function(){function o(e,n){this._config=this._getConfig(n),this._element=e,this._dialog=t(e).find(p.DIALOG)[0],this._backdrop=null,this._isShown=!1,this._isBodyOverflowing=!1,this._ignoreBackdropClick=!1,this._originalBodyPadding=0,this._scrollbarWidth=0}var g=o.prototype;return g.toggle=function(t){return this._isShown?this.hide():this.show(t)},g.show=function(e){var n=this;if(!this._isTransitioning&&!this._isShown){k.supportsTransitionEnd()&&t(this._element).hasClass(u)&&(this._isTransitioning=!0);var i=t.Event(l.SHOW,{relatedTarget:e});t(this._element).trigger(i),this._isShown||i.isDefaultPrevented()||(this._isShown=!0,this._checkScrollbar(),this._setScrollbar(),this._adjustDialog(),t(document.body).addClass(f),this._setEscapeEvent(),this._setResizeEvent(),t(this._element).on(l.CLICK_DISMISS,p.DATA_DISMISS,function(t){return n.hide(t)}),t(this._dialog).on(l.MOUSEDOWN_DISMISS,function(){t(n._element).one(l.MOUSEUP_DISMISS,function(e){t(e.target).is(n._element)&&(n._ignoreBackdropClick=!0)})}),this._showBackdrop(function(){return n._showElement(e)}))}},g.hide=function(e){var n=this;if(e&&e.preventDefault(),!this._isTransitioning&&this._isShown){var i=t.Event(l.HIDE);if(t(this._element).trigger(i),this._isShown&&!i.isDefaultPrevented()){this._isShown=!1;var r=k.supportsTransitionEnd()&&t(this._element).hasClass(u);r&&(this._isTransitioning=!0),this._setEscapeEvent(),this._setResizeEvent(),t(document).off(l.FOCUSIN),t(this._element).removeClass(d),t(this._element).off(l.CLICK_DISMISS),t(this._dialog).off(l.MOUSEDOWN_DISMISS),r?t(this._element).one(k.TRANSITION_END,function(t){return n._hideModal(t)}).emulateTransitionEnd(300):this._hideModal()}}},g.dispose=function(){t.removeData(this._element,e),t(window,document,this._element,this._backdrop).off(n),this._config=null,this._element=null,this._dialog=null,this._backdrop=null,this._isShown=null,this._isBodyOverflowing=null,this._ignoreBackdropClick=null,this._scrollbarWidth=null},g.handleUpdate=function(){this._adjustDialog()},g._getConfig=function(t){return t=r({},s,t),k.typeCheckConfig("modal",t,a),t},g._showElement=function(e){var n=this,i=k.supportsTransitionEnd()&&t(this._element).hasClass(u);this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE||document.body.appendChild(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.scrollTop=0,i&&k.reflow(this._element),t(this._element).addClass(d),this._config.focus&&this._enforceFocus();var r=t.Event(l.SHOWN,{relatedTarget:e}),o=function(){n._config.focus&&n._element.focus(),n._isTransitioning=!1,t(n._element).trigger(r)};i?t(this._dialog).one(k.TRANSITION_END,o).emulateTransitionEnd(300):o()},g._enforceFocus=function(){var e=this;t(document).off(l.FOCUSIN).on(l.FOCUSIN,function(n){document!==n.target&&e._element!==n.target&&0===t(e._element).has(n.target).length&&e._element.focus()})},g._setEscapeEvent=function(){var e=this;this._isShown&&this._config.keyboard?t(this._element).on(l.KEYDOWN_DISMISS,function(t){27===t.which&&(t.preventDefault(),e.hide())}):this._isShown||t(this._element).off(l.KEYDOWN_DISMISS)},g._setResizeEvent=function(){var e=this;this._isShown?t(window).on(l.RESIZE,function(t){return e.handleUpdate(t)}):t(window).off(l.RESIZE)},g._hideModal=function(){var e=this;this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._isTransitioning=!1,this._showBackdrop(function(){t(document.body).removeClass(f),e._resetAdjustments(),e._resetScrollbar(),t(e._element).trigger(l.HIDDEN)})},g._removeBackdrop=function(){this._backdrop&&(t(this._backdrop).remove(),this._backdrop=null)},g._showBackdrop=function(e){var n=this,i=t(this._element).hasClass(u)?u:"";if(this._isShown&&this._config.backdrop){var r=k.supportsTransitionEnd()&&i;if(this._backdrop=document.createElement("div"),this._backdrop.className=h,i&&t(this._backdrop).addClass(i),t(this._backdrop).appendTo(document.body),t(this._element).on(l.CLICK_DISMISS,function(t){n._ignoreBackdropClick?n._ignoreBackdropClick=!1:t.target===t.currentTarget&&("static"===n._config.backdrop?n._element.focus():n.hide())}),r&&k.reflow(this._backdrop),t(this._backdrop).addClass(d),!e)return;if(!r)return void e();t(this._backdrop).one(k.TRANSITION_END,e).emulateTransitionEnd(150)}else if(!this._isShown&&this._backdrop){t(this._backdrop).removeClass(d);var o=function(){n._removeBackdrop(),e&&e()};k.supportsTransitionEnd()&&t(this._element).hasClass(u)?t(this._backdrop).one(k.TRANSITION_END,o).emulateTransitionEnd(150):o()}else e&&e()},g._adjustDialog=function(){var t=this._element.scrollHeight>document.documentElement.clientHeight;!this._isBodyOverflowing&&t&&(this._element.style.paddingLeft=this._scrollbarWidth+"px"),this._isBodyOverflowing&&!t&&(this._element.style.paddingRight=this._scrollbarWidth+"px")},g._resetAdjustments=function(){this._element.style.paddingLeft="",this._element.style.paddingRight=""},g._checkScrollbar=function(){var t=document.body.getBoundingClientRect();this._isBodyOverflowing=t.left+t.right<window.innerWidth,this._scrollbarWidth=this._getScrollbarWidth()},g._setScrollbar=function(){var e=this;if(this._isBodyOverflowing){t(p.FIXED_CONTENT).each(function(n,i){var r=t(i)[0].style.paddingRight,o=t(i).css("padding-right");t(i).data("padding-right",r).css("padding-right",parseFloat(o)+e._scrollbarWidth+"px")}),t(p.STICKY_CONTENT).each(function(n,i){var r=t(i)[0].style.marginRight,o=t(i).css("margin-right");t(i).data("margin-right",r).css("margin-right",parseFloat(o)-e._scrollbarWidth+"px")}),t(p.NAVBAR_TOGGLER).each(function(n,i){var r=t(i)[0].style.marginRight,o=t(i).css("margin-right");t(i).data("margin-right",r).css("margin-right",parseFloat(o)+e._scrollbarWidth+"px")});var n=document.body.style.paddingRight,i=t("body").css("padding-right");t("body").data("padding-right",n).css("padding-right",parseFloat(i)+this._scrollbarWidth+"px")}},g._resetScrollbar=function(){t(p.FIXED_CONTENT).each(function(e,n){var i=t(n).data("padding-right");"undefined"!=typeof i&&t(n).css("padding-right",i).removeData("padding-right")}),t(p.STICKY_CONTENT+", "+p.NAVBAR_TOGGLER).each(function(e,n){var i=t(n).data("margin-right");"undefined"!=typeof i&&t(n).css("margin-right",i).removeData("margin-right")});var e=t("body").data("padding-right");"undefined"!=typeof e&&t("body").css("padding-right",e).removeData("padding-right")},g._getScrollbarWidth=function(){var t=document.createElement("div");t.className=c,document.body.appendChild(t);var e=t.getBoundingClientRect().width-t.clientWidth;return document.body.removeChild(t),e},o._jQueryInterface=function(n,i){return this.each(function(){var s=t(this).data(e),a=r({},o.Default,t(this).data(),"object"==typeof n&&n);if(s||(s=new o(this,a),t(this).data(e,s)),"string"==typeof n){if("undefined"==typeof s[n])throw new TypeError('No method named "'+n+'"');s[n](i)}else a.show&&s.show(i)})},i(o,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return s}}]),o}();return t(document).on(l.CLICK_DATA_API,p.DATA_TOGGLE,function(n){var i,o=this,s=k.getSelectorFromElement(this);s&&(i=t(s)[0]);var a=t(i).data(e)?"toggle":r({},t(i).data(),t(this).data());"A"!==this.tagName&&"AREA"!==this.tagName||n.preventDefault();var c=t(i).one(l.SHOW,function(e){e.isDefaultPrevented()||c.one(l.HIDDEN,function(){t(o).is(":visible")&&o.focus()})});g._jQueryInterface.call(t(i),a,this)}),t.fn.modal=g._jQueryInterface,t.fn.modal.Constructor=g,t.fn.modal.noConflict=function(){return t.fn.modal=o,g._jQueryInterface},g}(e),Lt=function(t){var e="tooltip",n="bs.tooltip",o="."+n,s=t.fn[e],a=new RegExp("(^|\\s)bs-tooltip\\S+","g"),l={animation:"boolean",template:"string",title:"(string|element|function)",trigger:"string",delay:"(number|object)",html:"boolean",selector:"(string|boolean)",placement:"(string|function)",offset:"(number|string)",container:"(string|element|boolean)",fallbackPlacement:"(string|array)",boundary:"(string|element)"},c={AUTO:"auto",TOP:"top",RIGHT:"right",BOTTOM:"bottom",LEFT:"left"},h={animation:!0,template:'<div class="tooltip" role="tooltip"><div class="arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover focus",title:"",delay:0,html:!1,selector:!1,placement:"top",offset:0,container:!1,fallbackPlacement:"flip",boundary:"scrollParent"},f="show",u="out",d={HIDE:"hide"+o,HIDDEN:"hidden"+o,SHOW:"show"+o,SHOWN:"shown"+o,INSERTED:"inserted"+o,CLICK:"click"+o,FOCUSIN:"focusin"+o,FOCUSOUT:"focusout"+o,MOUSEENTER:"mouseenter"+o,MOUSELEAVE:"mouseleave"+o},p="fade",g="show",m=".tooltip-inner",_=".arrow",v="hover",E="focus",y="click",b="manual",T=function(){function s(t,e){if("undefined"==typeof Ot)throw new TypeError("Bootstrap tooltips require Popper.js (https://popper.js.org)");this._isEnabled=!0,this._timeout=0,this._hoverState="",this._activeTrigger={},this._popper=null,this.element=t,this.config=this._getConfig(e),this.tip=null,this._setListeners()}var T=s.prototype;return T.enable=function(){this._isEnabled=!0},T.disable=function(){this._isEnabled=!1},T.toggleEnabled=function(){this._isEnabled=!this._isEnabled},T.toggle=function(e){if(this._isEnabled)if(e){var n=this.constructor.DATA_KEY,i=t(e.currentTarget).data(n);i||(i=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(n,i)),i._activeTrigger.click=!i._activeTrigger.click,i._isWithActiveTrigger()?i._enter(null,i):i._leave(null,i)}else{if(t(this.getTipElement()).hasClass(g))return void this._leave(null,this);this._enter(null,this)}},T.dispose=function(){clearTimeout(this._timeout),t.removeData(this.element,this.constructor.DATA_KEY),t(this.element).off(this.constructor.EVENT_KEY),t(this.element).closest(".modal").off("hide.bs.modal"),this.tip&&t(this.tip).remove(),this._isEnabled=null,this._timeout=null,this._hoverState=null,this._activeTrigger=null,null!==this._popper&&this._popper.destroy(),this._popper=null,this.element=null,this.config=null,this.tip=null},T.show=function(){var e=this;if("none"===t(this.element).css("display"))throw new Error("Please use show on visible elements");var n=t.Event(this.constructor.Event.SHOW);if(this.isWithContent()&&this._isEnabled){t(this.element).trigger(n);var i=t.contains(this.element.ownerDocument.documentElement,this.element);if(n.isDefaultPrevented()||!i)return;var r=this.getTipElement(),o=k.getUID(this.constructor.NAME);r.setAttribute("id",o),this.element.setAttribute("aria-describedby",o),this.setContent(),this.config.animation&&t(r).addClass(p);var a="function"==typeof this.config.placement?this.config.placement.call(this,r,this.element):this.config.placement,l=this._getAttachment(a);this.addAttachmentClass(l);var c=!1===this.config.container?document.body:t(this.config.container);t(r).data(this.constructor.DATA_KEY,this),t.contains(this.element.ownerDocument.documentElement,this.tip)||t(r).appendTo(c),t(this.element).trigger(this.constructor.Event.INSERTED),this._popper=new Ot(this.element,r,{placement:l,modifiers:{offset:{offset:this.config.offset},flip:{behavior:this.config.fallbackPlacement},arrow:{element:_},preventOverflow:{boundariesElement:this.config.boundary}},onCreate:function(t){t.originalPlacement!==t.placement&&e._handlePopperPlacementChange(t)},onUpdate:function(t){e._handlePopperPlacementChange(t)}}),t(r).addClass(g),"ontouchstart"in document.documentElement&&t("body").children().on("mouseover",null,t.noop);var h=function(){e.config.animation&&e._fixTransition();var n=e._hoverState;e._hoverState=null,t(e.element).trigger(e.constructor.Event.SHOWN),n===u&&e._leave(null,e)};k.supportsTransitionEnd()&&t(this.tip).hasClass(p)?t(this.tip).one(k.TRANSITION_END,h).emulateTransitionEnd(s._TRANSITION_DURATION):h()}},T.hide=function(e){var n=this,i=this.getTipElement(),r=t.Event(this.constructor.Event.HIDE),o=function(){n._hoverState!==f&&i.parentNode&&i.parentNode.removeChild(i),n._cleanTipClass(),n.element.removeAttribute("aria-describedby"),t(n.element).trigger(n.constructor.Event.HIDDEN),null!==n._popper&&n._popper.destroy(),e&&e()};t(this.element).trigger(r),r.isDefaultPrevented()||(t(i).removeClass(g),"ontouchstart"in document.documentElement&&t("body").children().off("mouseover",null,t.noop),this._activeTrigger[y]=!1,this._activeTrigger[E]=!1,this._activeTrigger[v]=!1,k.supportsTransitionEnd()&&t(this.tip).hasClass(p)?t(i).one(k.TRANSITION_END,o).emulateTransitionEnd(150):o(),this._hoverState="")},T.update=function(){null!==this._popper&&this._popper.scheduleUpdate()},T.isWithContent=function(){return Boolean(this.getTitle())},T.addAttachmentClass=function(e){t(this.getTipElement()).addClass("bs-tooltip-"+e)},T.getTipElement=function(){return this.tip=this.tip||t(this.config.template)[0],this.tip},T.setContent=function(){var e=t(this.getTipElement());this.setElementContent(e.find(m),this.getTitle()),e.removeClass(p+" "+g)},T.setElementContent=function(e,n){var i=this.config.html;"object"==typeof n&&(n.nodeType||n.jquery)?i?t(n).parent().is(e)||e.empty().append(n):e.text(t(n).text()):e[i?"html":"text"](n)},T.getTitle=function(){var t=this.element.getAttribute("data-original-title");return t||(t="function"==typeof this.config.title?this.config.title.call(this.element):this.config.title),t},T._getAttachment=function(t){return c[t.toUpperCase()]},T._setListeners=function(){var e=this;this.config.trigger.split(" ").forEach(function(n){if("click"===n)t(e.element).on(e.constructor.Event.CLICK,e.config.selector,function(t){return e.toggle(t)});else if(n!==b){var i=n===v?e.constructor.Event.MOUSEENTER:e.constructor.Event.FOCUSIN,r=n===v?e.constructor.Event.MOUSELEAVE:e.constructor.Event.FOCUSOUT;t(e.element).on(i,e.config.selector,function(t){return e._enter(t)}).on(r,e.config.selector,function(t){return e._leave(t)})}t(e.element).closest(".modal").on("hide.bs.modal",function(){return e.hide()})}),this.config.selector?this.config=r({},this.config,{trigger:"manual",selector:""}):this._fixTitle()},T._fixTitle=function(){var t=typeof this.element.getAttribute("data-original-title");(this.element.getAttribute("title")||"string"!==t)&&(this.element.setAttribute("data-original-title",this.element.getAttribute("title")||""),this.element.setAttribute("title",""))},T._enter=function(e,n){var i=this.constructor.DATA_KEY;(n=n||t(e.currentTarget).data(i))||(n=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(i,n)),e&&(n._activeTrigger["focusin"===e.type?E:v]=!0),t(n.getTipElement()).hasClass(g)||n._hoverState===f?n._hoverState=f:(clearTimeout(n._timeout),n._hoverState=f,n.config.delay&&n.config.delay.show?n._timeout=setTimeout(function(){n._hoverState===f&&n.show()},n.config.delay.show):n.show())},T._leave=function(e,n){var i=this.constructor.DATA_KEY;(n=n||t(e.currentTarget).data(i))||(n=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(i,n)),e&&(n._activeTrigger["focusout"===e.type?E:v]=!1),n._isWithActiveTrigger()||(clearTimeout(n._timeout),n._hoverState=u,n.config.delay&&n.config.delay.hide?n._timeout=setTimeout(function(){n._hoverState===u&&n.hide()},n.config.delay.hide):n.hide())},T._isWithActiveTrigger=function(){for(var t in this._activeTrigger)if(this._activeTrigger[t])return!0;return!1},T._getConfig=function(n){return"number"==typeof(n=r({},this.constructor.Default,t(this.element).data(),n)).delay&&(n.delay={show:n.delay,hide:n.delay}),"number"==typeof n.title&&(n.title=n.title.toString()),"number"==typeof n.content&&(n.content=n.content.toString()),k.typeCheckConfig(e,n,this.constructor.DefaultType),n},T._getDelegateConfig=function(){var t={};if(this.config)for(var e in this.config)this.constructor.Default[e]!==this.config[e]&&(t[e]=this.config[e]);return t},T._cleanTipClass=function(){var e=t(this.getTipElement()),n=e.attr("class").match(a);null!==n&&n.length>0&&e.removeClass(n.join(""))},T._handlePopperPlacementChange=function(t){this._cleanTipClass(),this.addAttachmentClass(this._getAttachment(t.placement))},T._fixTransition=function(){var e=this.getTipElement(),n=this.config.animation;null===e.getAttribute("x-placement")&&(t(e).removeClass(p),this.config.animation=!1,this.hide(),this.show(),this.config.animation=n)},s._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n),r="object"==typeof e&&e;if((i||!/dispose|hide/.test(e))&&(i||(i=new s(this,r),t(this).data(n,i)),"string"==typeof e)){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},i(s,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return h}},{key:"NAME",get:function(){return e}},{key:"DATA_KEY",get:function(){return n}},{key:"Event",get:function(){return d}},{key:"EVENT_KEY",get:function(){return o}},{key:"DefaultType",get:function(){return l}}]),s}();return t.fn[e]=T._jQueryInterface,t.fn[e].Constructor=T,t.fn[e].noConflict=function(){return t.fn[e]=s,T._jQueryInterface},T}(e),Pt=function(t){var e="popover",n="bs.popover",o="."+n,s=t.fn[e],a=new RegExp("(^|\\s)bs-popover\\S+","g"),l=r({},Lt.Default,{placement:"right",trigger:"click",content:"",template:'<div class="popover" role="tooltip"><div class="arrow"></div><h3 class="popover-header"></h3><div class="popover-body"></div></div>'}),c=r({},Lt.DefaultType,{content:"(string|element|function)"}),h="fade",f="show",u=".popover-header",d=".popover-body",p={HIDE:"hide"+o,HIDDEN:"hidden"+o,SHOW:"show"+o,SHOWN:"shown"+o,INSERTED:"inserted"+o,CLICK:"click"+o,FOCUSIN:"focusin"+o,FOCUSOUT:"focusout"+o,MOUSEENTER:"mouseenter"+o,MOUSELEAVE:"mouseleave"+o},g=function(r){var s,g;function m(){return r.apply(this,arguments)||this}g=r,(s=m).prototype=Object.create(g.prototype),s.prototype.constructor=s,s.__proto__=g;var _=m.prototype;return _.isWithContent=function(){return this.getTitle()||this._getContent()},_.addAttachmentClass=function(e){t(this.getTipElement()).addClass("bs-popover-"+e)},_.getTipElement=function(){return this.tip=this.tip||t(this.config.template)[0],this.tip},_.setContent=function(){var e=t(this.getTipElement());this.setElementContent(e.find(u),this.getTitle());var n=this._getContent();"function"==typeof n&&(n=n.call(this.element)),this.setElementContent(e.find(d),n),e.removeClass(h+" "+f)},_._getContent=function(){return this.element.getAttribute("data-content")||this.config.content},_._cleanTipClass=function(){var e=t(this.getTipElement()),n=e.attr("class").match(a);null!==n&&n.length>0&&e.removeClass(n.join(""))},m._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n),r="object"==typeof e?e:null;if((i||!/destroy|hide/.test(e))&&(i||(i=new m(this,r),t(this).data(n,i)),"string"==typeof e)){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},i(m,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return l}},{key:"NAME",get:function(){return e}},{key:"DATA_KEY",get:function(){return n}},{key:"Event",get:function(){return p}},{key:"EVENT_KEY",get:function(){return o}},{key:"DefaultType",get:function(){return c}}]),m}(Lt);return t.fn[e]=g._jQueryInterface,t.fn[e].Constructor=g,t.fn[e].noConflict=function(){return t.fn[e]=s,g._jQueryInterface},g}(e),xt=function(t){var e="scrollspy",n="bs.scrollspy",o="."+n,s=t.fn[e],a={offset:10,method:"auto",target:""},l={offset:"number",method:"string",target:"(string|element)"},c={ACTIVATE:"activate"+o,SCROLL:"scroll"+o,LOAD_DATA_API:"load"+o+".data-api"},h="dropdown-item",f="active",u={DATA_SPY:'[data-spy="scroll"]',ACTIVE:".active",NAV_LIST_GROUP:".nav, .list-group",NAV_LINKS:".nav-link",NAV_ITEMS:".nav-item",LIST_ITEMS:".list-group-item",DROPDOWN:".dropdown",DROPDOWN_ITEMS:".dropdown-item",DROPDOWN_TOGGLE:".dropdown-toggle"},d="offset",p="position",g=function(){function s(e,n){var i=this;this._element=e,this._scrollElement="BODY"===e.tagName?window:e,this._config=this._getConfig(n),this._selector=this._config.target+" "+u.NAV_LINKS+","+this._config.target+" "+u.LIST_ITEMS+","+this._config.target+" "+u.DROPDOWN_ITEMS,this._offsets=[],this._targets=[],this._activeTarget=null,this._scrollHeight=0,t(this._scrollElement).on(c.SCROLL,function(t){return i._process(t)}),this.refresh(),this._process()}var g=s.prototype;return g.refresh=function(){var e=this,n=this._scrollElement===this._scrollElement.window?d:p,i="auto"===this._config.method?n:this._config.method,r=i===p?this._getScrollTop():0;this._offsets=[],this._targets=[],this._scrollHeight=this._getScrollHeight(),t.makeArray(t(this._selector)).map(function(e){var n,o=k.getSelectorFromElement(e);if(o&&(n=t(o)[0]),n){var s=n.getBoundingClientRect();if(s.width||s.height)return[t(n)[i]().top+r,o]}return null}).filter(function(t){return t}).sort(function(t,e){return t[0]-e[0]}).forEach(function(t){e._offsets.push(t[0]),e._targets.push(t[1])})},g.dispose=function(){t.removeData(this._element,n),t(this._scrollElement).off(o),this._element=null,this._scrollElement=null,this._config=null,this._selector=null,this._offsets=null,this._targets=null,this._activeTarget=null,this._scrollHeight=null},g._getConfig=function(n){if("string"!=typeof(n=r({},a,n)).target){var i=t(n.target).attr("id");i||(i=k.getUID(e),t(n.target).attr("id",i)),n.target="#"+i}return k.typeCheckConfig(e,n,l),n},g._getScrollTop=function(){return this._scrollElement===window?this._scrollElement.pageYOffset:this._scrollElement.scrollTop},g._getScrollHeight=function(){return this._scrollElement.scrollHeight||Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)},g._getOffsetHeight=function(){return this._scrollElement===window?window.innerHeight:this._scrollElement.getBoundingClientRect().height},g._process=function(){var t=this._getScrollTop()+this._config.offset,e=this._getScrollHeight(),n=this._config.offset+e-this._getOffsetHeight();if(this._scrollHeight!==e&&this.refresh(),t>=n){var i=this._targets[this._targets.length-1];this._activeTarget!==i&&this._activate(i)}else{if(this._activeTarget&&t<this._offsets[0]&&this._offsets[0]>0)return this._activeTarget=null,void this._clear();for(var r=this._offsets.length;r--;){this._activeTarget!==this._targets[r]&&t>=this._offsets[r]&&("undefined"==typeof this._offsets[r+1]||t<this._offsets[r+1])&&this._activate(this._targets[r])}}},g._activate=function(e){this._activeTarget=e,this._clear();var n=this._selector.split(",");n=n.map(function(t){return t+'[data-target="'+e+'"],'+t+'[href="'+e+'"]'});var i=t(n.join(","));i.hasClass(h)?(i.closest(u.DROPDOWN).find(u.DROPDOWN_TOGGLE).addClass(f),i.addClass(f)):(i.addClass(f),i.parents(u.NAV_LIST_GROUP).prev(u.NAV_LINKS+", "+u.LIST_ITEMS).addClass(f),i.parents(u.NAV_LIST_GROUP).prev(u.NAV_ITEMS).children(u.NAV_LINKS).addClass(f)),t(this._scrollElement).trigger(c.ACTIVATE,{relatedTarget:e})},g._clear=function(){t(this._selector).filter(u.ACTIVE).removeClass(f)},s._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n);if(i||(i=new s(this,"object"==typeof e&&e),t(this).data(n,i)),"string"==typeof e){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},i(s,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),s}();return t(window).on(c.LOAD_DATA_API,function(){for(var e=t.makeArray(t(u.DATA_SPY)),n=e.length;n--;){var i=t(e[n]);g._jQueryInterface.call(i,i.data())}}),t.fn[e]=g._jQueryInterface,t.fn[e].Constructor=g,t.fn[e].noConflict=function(){return t.fn[e]=s,g._jQueryInterface},g}(e),Rt=function(t){var e=".bs.tab",n=t.fn.tab,r={HIDE:"hide"+e,HIDDEN:"hidden"+e,SHOW:"show"+e,SHOWN:"shown"+e,CLICK_DATA_API:"click.bs.tab.data-api"},o="dropdown-menu",s="active",a="disabled",l="fade",c="show",h=".dropdown",f=".nav, .list-group",u=".active",d="> li > .active",p='[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',g=".dropdown-toggle",m="> .dropdown-menu .active",_=function(){function e(t){this._element=t}var n=e.prototype;return n.show=function(){var e=this;if(!(this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE&&t(this._element).hasClass(s)||t(this._element).hasClass(a))){var n,i,o=t(this._element).closest(f)[0],l=k.getSelectorFromElement(this._element);if(o){var c="UL"===o.nodeName?d:u;i=(i=t.makeArray(t(o).find(c)))[i.length-1]}var h=t.Event(r.HIDE,{relatedTarget:this._element}),p=t.Event(r.SHOW,{relatedTarget:i});if(i&&t(i).trigger(h),t(this._element).trigger(p),!p.isDefaultPrevented()&&!h.isDefaultPrevented()){l&&(n=t(l)[0]),this._activate(this._element,o);var g=function(){var n=t.Event(r.HIDDEN,{relatedTarget:e._element}),o=t.Event(r.SHOWN,{relatedTarget:i});t(i).trigger(n),t(e._element).trigger(o)};n?this._activate(n,n.parentNode,g):g()}}},n.dispose=function(){t.removeData(this._element,"bs.tab"),this._element=null},n._activate=function(e,n,i){var r=this,o=("UL"===n.nodeName?t(n).find(d):t(n).children(u))[0],s=i&&k.supportsTransitionEnd()&&o&&t(o).hasClass(l),a=function(){return r._transitionComplete(e,o,i)};o&&s?t(o).one(k.TRANSITION_END,a).emulateTransitionEnd(150):a()},n._transitionComplete=function(e,n,i){if(n){t(n).removeClass(c+" "+s);var r=t(n.parentNode).find(m)[0];r&&t(r).removeClass(s),"tab"===n.getAttribute("role")&&n.setAttribute("aria-selected",!1)}if(t(e).addClass(s),"tab"===e.getAttribute("role")&&e.setAttribute("aria-selected",!0),k.reflow(e),t(e).addClass(c),e.parentNode&&t(e.parentNode).hasClass(o)){var a=t(e).closest(h)[0];a&&t(a).find(g).addClass(s),e.setAttribute("aria-expanded",!0)}i&&i()},e._jQueryInterface=function(n){return this.each(function(){var i=t(this),r=i.data("bs.tab");if(r||(r=new e(this),i.data("bs.tab",r)),"string"==typeof n){if("undefined"==typeof r[n])throw new TypeError('No method named "'+n+'"');r[n]()}})},i(e,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),e}();return t(document).on(r.CLICK_DATA_API,p,function(e){e.preventDefault(),_._jQueryInterface.call(t(this),"show")}),t.fn.tab=_._jQueryInterface,t.fn.tab.Constructor=_,t.fn.tab.noConflict=function(){return t.fn.tab=n,_._jQueryInterface},_}(e);!function(t){if("undefined"==typeof t)throw new TypeError("Bootstrap's JavaScript requires jQuery. jQuery must be included before Bootstrap's JavaScript.");var e=t.fn.jquery.split(" ")[0].split(".");if(e[0]<2&&e[1]<9||1===e[0]&&9===e[1]&&e[2]<1||e[0]>=4)throw new Error("Bootstrap's JavaScript requires at least jQuery v1.9.1 but less than v4.0.0")}(e),t.Util=k,t.Alert=L,t.Button=P,t.Carousel=x,t.Collapse=R,t.Dropdown=Nt,t.Modal=kt,t.Popover=Pt,t.Scrollspy=xt,t.Tab=Rt,t.Tooltip=Lt,Object.defineProperty(t,"__esModule",{value:!0})});
+//# sourceMappingURL=bootstrap.bundle.min.js.map
\ No newline at end of file
diff --git a/docs/lib/bootstrap/js/bootstrap.min.js b/docs/lib/bootstrap/js/bootstrap.min.js
new file mode 100644
index 0000000..534d533
--- /dev/null
+++ b/docs/lib/bootstrap/js/bootstrap.min.js
@@ -0,0 +1,7 @@
+/*!
+  * Bootstrap v4.0.0 (https://getbootstrap.com)
+  * Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
+  * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+  */
+!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?e(exports,require("jquery"),require("popper.js")):"function"==typeof define&&define.amd?define(["exports","jquery","popper.js"],e):e(t.bootstrap={},t.jQuery,t.Popper)}(this,function(t,e,n){"use strict";function i(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}function s(t,e,n){return e&&i(t.prototype,e),n&&i(t,n),t}function r(){return(r=Object.assign||function(t){for(var e=1;e<arguments.length;e++){var n=arguments[e];for(var i in n)Object.prototype.hasOwnProperty.call(n,i)&&(t[i]=n[i])}return t}).apply(this,arguments)}e=e&&e.hasOwnProperty("default")?e.default:e,n=n&&n.hasOwnProperty("default")?n.default:n;var o,a,l,h,c,u,f,d,_,g,p,m,v,E,T,y,C,I,A,b,D,S,w,N,O,k,P=function(t){var e=!1;function n(e){var n=this,s=!1;return t(this).one(i.TRANSITION_END,function(){s=!0}),setTimeout(function(){s||i.triggerTransitionEnd(n)},e),this}var i={TRANSITION_END:"bsTransitionEnd",getUID:function(t){do{t+=~~(1e6*Math.random())}while(document.getElementById(t));return t},getSelectorFromElement:function(e){var n,i=e.getAttribute("data-target");i&&"#"!==i||(i=e.getAttribute("href")||""),"#"===i.charAt(0)&&(n=i,i=n="function"==typeof t.escapeSelector?t.escapeSelector(n).substr(1):n.replace(/(:|\.|\[|\]|,|=|@)/g,"\\$1"));try{return t(document).find(i).length>0?i:null}catch(t){return null}},reflow:function(t){return t.offsetHeight},triggerTransitionEnd:function(n){t(n).trigger(e.end)},supportsTransitionEnd:function(){return Boolean(e)},isElement:function(t){return(t[0]||t).nodeType},typeCheckConfig:function(t,e,n){for(var s in n)if(Object.prototype.hasOwnProperty.call(n,s)){var r=n[s],o=e[s],a=o&&i.isElement(o)?"element":(l=o,{}.toString.call(l).match(/\s([a-zA-Z]+)/)[1].toLowerCase());if(!new RegExp(r).test(a))throw new Error(t.toUpperCase()+': Option "'+s+'" provided type "'+a+'" but expected type "'+r+'".')}var l}};return e=("undefined"==typeof window||!window.QUnit)&&{end:"transitionend"},t.fn.emulateTransitionEnd=n,i.supportsTransitionEnd()&&(t.event.special[i.TRANSITION_END]={bindType:e.end,delegateType:e.end,handle:function(e){if(t(e.target).is(this))return e.handleObj.handler.apply(this,arguments)}}),i}(e),L=(a="alert",h="."+(l="bs.alert"),c=(o=e).fn[a],u={CLOSE:"close"+h,CLOSED:"closed"+h,CLICK_DATA_API:"click"+h+".data-api"},f="alert",d="fade",_="show",g=function(){function t(t){this._element=t}var e=t.prototype;return e.close=function(t){t=t||this._element;var e=this._getRootElement(t);this._triggerCloseEvent(e).isDefaultPrevented()||this._removeElement(e)},e.dispose=function(){o.removeData(this._element,l),this._element=null},e._getRootElement=function(t){var e=P.getSelectorFromElement(t),n=!1;return e&&(n=o(e)[0]),n||(n=o(t).closest("."+f)[0]),n},e._triggerCloseEvent=function(t){var e=o.Event(u.CLOSE);return o(t).trigger(e),e},e._removeElement=function(t){var e=this;o(t).removeClass(_),P.supportsTransitionEnd()&&o(t).hasClass(d)?o(t).one(P.TRANSITION_END,function(n){return e._destroyElement(t,n)}).emulateTransitionEnd(150):this._destroyElement(t)},e._destroyElement=function(t){o(t).detach().trigger(u.CLOSED).remove()},t._jQueryInterface=function(e){return this.each(function(){var n=o(this),i=n.data(l);i||(i=new t(this),n.data(l,i)),"close"===e&&i[e](this)})},t._handleDismiss=function(t){return function(e){e&&e.preventDefault(),t.close(this)}},s(t,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),t}(),o(document).on(u.CLICK_DATA_API,'[data-dismiss="alert"]',g._handleDismiss(new g)),o.fn[a]=g._jQueryInterface,o.fn[a].Constructor=g,o.fn[a].noConflict=function(){return o.fn[a]=c,g._jQueryInterface},g),R=(m="button",E="."+(v="bs.button"),T=".data-api",y=(p=e).fn[m],C="active",I="btn",A="focus",b='[data-toggle^="button"]',D='[data-toggle="buttons"]',S="input",w=".active",N=".btn",O={CLICK_DATA_API:"click"+E+T,FOCUS_BLUR_DATA_API:"focus"+E+T+" blur"+E+T},k=function(){function t(t){this._element=t}var e=t.prototype;return e.toggle=function(){var t=!0,e=!0,n=p(this._element).closest(D)[0];if(n){var i=p(this._element).find(S)[0];if(i){if("radio"===i.type)if(i.checked&&p(this._element).hasClass(C))t=!1;else{var s=p(n).find(w)[0];s&&p(s).removeClass(C)}if(t){if(i.hasAttribute("disabled")||n.hasAttribute("disabled")||i.classList.contains("disabled")||n.classList.contains("disabled"))return;i.checked=!p(this._element).hasClass(C),p(i).trigger("change")}i.focus(),e=!1}}e&&this._element.setAttribute("aria-pressed",!p(this._element).hasClass(C)),t&&p(this._element).toggleClass(C)},e.dispose=function(){p.removeData(this._element,v),this._element=null},t._jQueryInterface=function(e){return this.each(function(){var n=p(this).data(v);n||(n=new t(this),p(this).data(v,n)),"toggle"===e&&n[e]()})},s(t,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),t}(),p(document).on(O.CLICK_DATA_API,b,function(t){t.preventDefault();var e=t.target;p(e).hasClass(I)||(e=p(e).closest(N)),k._jQueryInterface.call(p(e),"toggle")}).on(O.FOCUS_BLUR_DATA_API,b,function(t){var e=p(t.target).closest(N)[0];p(e).toggleClass(A,/^focus(in)?$/.test(t.type))}),p.fn[m]=k._jQueryInterface,p.fn[m].Constructor=k,p.fn[m].noConflict=function(){return p.fn[m]=y,k._jQueryInterface},k),j=function(t){var e="carousel",n="bs.carousel",i="."+n,o=t.fn[e],a={interval:5e3,keyboard:!0,slide:!1,pause:"hover",wrap:!0},l={interval:"(number|boolean)",keyboard:"boolean",slide:"(boolean|string)",pause:"(string|boolean)",wrap:"boolean"},h="next",c="prev",u="left",f="right",d={SLIDE:"slide"+i,SLID:"slid"+i,KEYDOWN:"keydown"+i,MOUSEENTER:"mouseenter"+i,MOUSELEAVE:"mouseleave"+i,TOUCHEND:"touchend"+i,LOAD_DATA_API:"load"+i+".data-api",CLICK_DATA_API:"click"+i+".data-api"},_="carousel",g="active",p="slide",m="carousel-item-right",v="carousel-item-left",E="carousel-item-next",T="carousel-item-prev",y={ACTIVE:".active",ACTIVE_ITEM:".active.carousel-item",ITEM:".carousel-item",NEXT_PREV:".carousel-item-next, .carousel-item-prev",INDICATORS:".carousel-indicators",DATA_SLIDE:"[data-slide], [data-slide-to]",DATA_RIDE:'[data-ride="carousel"]'},C=function(){function o(e,n){this._items=null,this._interval=null,this._activeElement=null,this._isPaused=!1,this._isSliding=!1,this.touchTimeout=null,this._config=this._getConfig(n),this._element=t(e)[0],this._indicatorsElement=t(this._element).find(y.INDICATORS)[0],this._addEventListeners()}var C=o.prototype;return C.next=function(){this._isSliding||this._slide(h)},C.nextWhenVisible=function(){!document.hidden&&t(this._element).is(":visible")&&"hidden"!==t(this._element).css("visibility")&&this.next()},C.prev=function(){this._isSliding||this._slide(c)},C.pause=function(e){e||(this._isPaused=!0),t(this._element).find(y.NEXT_PREV)[0]&&P.supportsTransitionEnd()&&(P.triggerTransitionEnd(this._element),this.cycle(!0)),clearInterval(this._interval),this._interval=null},C.cycle=function(t){t||(this._isPaused=!1),this._interval&&(clearInterval(this._interval),this._interval=null),this._config.interval&&!this._isPaused&&(this._interval=setInterval((document.visibilityState?this.nextWhenVisible:this.next).bind(this),this._config.interval))},C.to=function(e){var n=this;this._activeElement=t(this._element).find(y.ACTIVE_ITEM)[0];var i=this._getItemIndex(this._activeElement);if(!(e>this._items.length-1||e<0))if(this._isSliding)t(this._element).one(d.SLID,function(){return n.to(e)});else{if(i===e)return this.pause(),void this.cycle();var s=e>i?h:c;this._slide(s,this._items[e])}},C.dispose=function(){t(this._element).off(i),t.removeData(this._element,n),this._items=null,this._config=null,this._element=null,this._interval=null,this._isPaused=null,this._isSliding=null,this._activeElement=null,this._indicatorsElement=null},C._getConfig=function(t){return t=r({},a,t),P.typeCheckConfig(e,t,l),t},C._addEventListeners=function(){var e=this;this._config.keyboard&&t(this._element).on(d.KEYDOWN,function(t){return e._keydown(t)}),"hover"===this._config.pause&&(t(this._element).on(d.MOUSEENTER,function(t){return e.pause(t)}).on(d.MOUSELEAVE,function(t){return e.cycle(t)}),"ontouchstart"in document.documentElement&&t(this._element).on(d.TOUCHEND,function(){e.pause(),e.touchTimeout&&clearTimeout(e.touchTimeout),e.touchTimeout=setTimeout(function(t){return e.cycle(t)},500+e._config.interval)}))},C._keydown=function(t){if(!/input|textarea/i.test(t.target.tagName))switch(t.which){case 37:t.preventDefault(),this.prev();break;case 39:t.preventDefault(),this.next()}},C._getItemIndex=function(e){return this._items=t.makeArray(t(e).parent().find(y.ITEM)),this._items.indexOf(e)},C._getItemByDirection=function(t,e){var n=t===h,i=t===c,s=this._getItemIndex(e),r=this._items.length-1;if((i&&0===s||n&&s===r)&&!this._config.wrap)return e;var o=(s+(t===c?-1:1))%this._items.length;return-1===o?this._items[this._items.length-1]:this._items[o]},C._triggerSlideEvent=function(e,n){var i=this._getItemIndex(e),s=this._getItemIndex(t(this._element).find(y.ACTIVE_ITEM)[0]),r=t.Event(d.SLIDE,{relatedTarget:e,direction:n,from:s,to:i});return t(this._element).trigger(r),r},C._setActiveIndicatorElement=function(e){if(this._indicatorsElement){t(this._indicatorsElement).find(y.ACTIVE).removeClass(g);var n=this._indicatorsElement.children[this._getItemIndex(e)];n&&t(n).addClass(g)}},C._slide=function(e,n){var i,s,r,o=this,a=t(this._element).find(y.ACTIVE_ITEM)[0],l=this._getItemIndex(a),c=n||a&&this._getItemByDirection(e,a),_=this._getItemIndex(c),C=Boolean(this._interval);if(e===h?(i=v,s=E,r=u):(i=m,s=T,r=f),c&&t(c).hasClass(g))this._isSliding=!1;else if(!this._triggerSlideEvent(c,r).isDefaultPrevented()&&a&&c){this._isSliding=!0,C&&this.pause(),this._setActiveIndicatorElement(c);var I=t.Event(d.SLID,{relatedTarget:c,direction:r,from:l,to:_});P.supportsTransitionEnd()&&t(this._element).hasClass(p)?(t(c).addClass(s),P.reflow(c),t(a).addClass(i),t(c).addClass(i),t(a).one(P.TRANSITION_END,function(){t(c).removeClass(i+" "+s).addClass(g),t(a).removeClass(g+" "+s+" "+i),o._isSliding=!1,setTimeout(function(){return t(o._element).trigger(I)},0)}).emulateTransitionEnd(600)):(t(a).removeClass(g),t(c).addClass(g),this._isSliding=!1,t(this._element).trigger(I)),C&&this.cycle()}},o._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n),s=r({},a,t(this).data());"object"==typeof e&&(s=r({},s,e));var l="string"==typeof e?e:s.slide;if(i||(i=new o(this,s),t(this).data(n,i)),"number"==typeof e)i.to(e);else if("string"==typeof l){if("undefined"==typeof i[l])throw new TypeError('No method named "'+l+'"');i[l]()}else s.interval&&(i.pause(),i.cycle())})},o._dataApiClickHandler=function(e){var i=P.getSelectorFromElement(this);if(i){var s=t(i)[0];if(s&&t(s).hasClass(_)){var a=r({},t(s).data(),t(this).data()),l=this.getAttribute("data-slide-to");l&&(a.interval=!1),o._jQueryInterface.call(t(s),a),l&&t(s).data(n).to(l),e.preventDefault()}}},s(o,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),o}();return t(document).on(d.CLICK_DATA_API,y.DATA_SLIDE,C._dataApiClickHandler),t(window).on(d.LOAD_DATA_API,function(){t(y.DATA_RIDE).each(function(){var e=t(this);C._jQueryInterface.call(e,e.data())})}),t.fn[e]=C._jQueryInterface,t.fn[e].Constructor=C,t.fn[e].noConflict=function(){return t.fn[e]=o,C._jQueryInterface},C}(e),H=function(t){var e="collapse",n="bs.collapse",i="."+n,o=t.fn[e],a={toggle:!0,parent:""},l={toggle:"boolean",parent:"(string|element)"},h={SHOW:"show"+i,SHOWN:"shown"+i,HIDE:"hide"+i,HIDDEN:"hidden"+i,CLICK_DATA_API:"click"+i+".data-api"},c="show",u="collapse",f="collapsing",d="collapsed",_="width",g="height",p={ACTIVES:".show, .collapsing",DATA_TOGGLE:'[data-toggle="collapse"]'},m=function(){function i(e,n){this._isTransitioning=!1,this._element=e,this._config=this._getConfig(n),this._triggerArray=t.makeArray(t('[data-toggle="collapse"][href="#'+e.id+'"],[data-toggle="collapse"][data-target="#'+e.id+'"]'));for(var i=t(p.DATA_TOGGLE),s=0;s<i.length;s++){var r=i[s],o=P.getSelectorFromElement(r);null!==o&&t(o).filter(e).length>0&&(this._selector=o,this._triggerArray.push(r))}this._parent=this._config.parent?this._getParent():null,this._config.parent||this._addAriaAndCollapsedClass(this._element,this._triggerArray),this._config.toggle&&this.toggle()}var o=i.prototype;return o.toggle=function(){t(this._element).hasClass(c)?this.hide():this.show()},o.show=function(){var e,s,r=this;if(!this._isTransitioning&&!t(this._element).hasClass(c)&&(this._parent&&0===(e=t.makeArray(t(this._parent).find(p.ACTIVES).filter('[data-parent="'+this._config.parent+'"]'))).length&&(e=null),!(e&&(s=t(e).not(this._selector).data(n))&&s._isTransitioning))){var o=t.Event(h.SHOW);if(t(this._element).trigger(o),!o.isDefaultPrevented()){e&&(i._jQueryInterface.call(t(e).not(this._selector),"hide"),s||t(e).data(n,null));var a=this._getDimension();t(this._element).removeClass(u).addClass(f),this._element.style[a]=0,this._triggerArray.length>0&&t(this._triggerArray).removeClass(d).attr("aria-expanded",!0),this.setTransitioning(!0);var l=function(){t(r._element).removeClass(f).addClass(u).addClass(c),r._element.style[a]="",r.setTransitioning(!1),t(r._element).trigger(h.SHOWN)};if(P.supportsTransitionEnd()){var _="scroll"+(a[0].toUpperCase()+a.slice(1));t(this._element).one(P.TRANSITION_END,l).emulateTransitionEnd(600),this._element.style[a]=this._element[_]+"px"}else l()}}},o.hide=function(){var e=this;if(!this._isTransitioning&&t(this._element).hasClass(c)){var n=t.Event(h.HIDE);if(t(this._element).trigger(n),!n.isDefaultPrevented()){var i=this._getDimension();if(this._element.style[i]=this._element.getBoundingClientRect()[i]+"px",P.reflow(this._element),t(this._element).addClass(f).removeClass(u).removeClass(c),this._triggerArray.length>0)for(var s=0;s<this._triggerArray.length;s++){var r=this._triggerArray[s],o=P.getSelectorFromElement(r);if(null!==o)t(o).hasClass(c)||t(r).addClass(d).attr("aria-expanded",!1)}this.setTransitioning(!0);var a=function(){e.setTransitioning(!1),t(e._element).removeClass(f).addClass(u).trigger(h.HIDDEN)};this._element.style[i]="",P.supportsTransitionEnd()?t(this._element).one(P.TRANSITION_END,a).emulateTransitionEnd(600):a()}}},o.setTransitioning=function(t){this._isTransitioning=t},o.dispose=function(){t.removeData(this._element,n),this._config=null,this._parent=null,this._element=null,this._triggerArray=null,this._isTransitioning=null},o._getConfig=function(t){return(t=r({},a,t)).toggle=Boolean(t.toggle),P.typeCheckConfig(e,t,l),t},o._getDimension=function(){return t(this._element).hasClass(_)?_:g},o._getParent=function(){var e=this,n=null;P.isElement(this._config.parent)?(n=this._config.parent,"undefined"!=typeof this._config.parent.jquery&&(n=this._config.parent[0])):n=t(this._config.parent)[0];var s='[data-toggle="collapse"][data-parent="'+this._config.parent+'"]';return t(n).find(s).each(function(t,n){e._addAriaAndCollapsedClass(i._getTargetFromElement(n),[n])}),n},o._addAriaAndCollapsedClass=function(e,n){if(e){var i=t(e).hasClass(c);n.length>0&&t(n).toggleClass(d,!i).attr("aria-expanded",i)}},i._getTargetFromElement=function(e){var n=P.getSelectorFromElement(e);return n?t(n)[0]:null},i._jQueryInterface=function(e){return this.each(function(){var s=t(this),o=s.data(n),l=r({},a,s.data(),"object"==typeof e&&e);if(!o&&l.toggle&&/show|hide/.test(e)&&(l.toggle=!1),o||(o=new i(this,l),s.data(n,o)),"string"==typeof e){if("undefined"==typeof o[e])throw new TypeError('No method named "'+e+'"');o[e]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),i}();return t(document).on(h.CLICK_DATA_API,p.DATA_TOGGLE,function(e){"A"===e.currentTarget.tagName&&e.preventDefault();var i=t(this),s=P.getSelectorFromElement(this);t(s).each(function(){var e=t(this),s=e.data(n)?"toggle":i.data();m._jQueryInterface.call(e,s)})}),t.fn[e]=m._jQueryInterface,t.fn[e].Constructor=m,t.fn[e].noConflict=function(){return t.fn[e]=o,m._jQueryInterface},m}(e),W=function(t){var e="dropdown",i="bs.dropdown",o="."+i,a=".data-api",l=t.fn[e],h=new RegExp("38|40|27"),c={HIDE:"hide"+o,HIDDEN:"hidden"+o,SHOW:"show"+o,SHOWN:"shown"+o,CLICK:"click"+o,CLICK_DATA_API:"click"+o+a,KEYDOWN_DATA_API:"keydown"+o+a,KEYUP_DATA_API:"keyup"+o+a},u="disabled",f="show",d="dropup",_="dropright",g="dropleft",p="dropdown-menu-right",m="dropdown-menu-left",v="position-static",E='[data-toggle="dropdown"]',T=".dropdown form",y=".dropdown-menu",C=".navbar-nav",I=".dropdown-menu .dropdown-item:not(.disabled)",A="top-start",b="top-end",D="bottom-start",S="bottom-end",w="right-start",N="left-start",O={offset:0,flip:!0,boundary:"scrollParent"},k={offset:"(number|string|function)",flip:"boolean",boundary:"(string|element)"},L=function(){function a(t,e){this._element=t,this._popper=null,this._config=this._getConfig(e),this._menu=this._getMenuElement(),this._inNavbar=this._detectNavbar(),this._addEventListeners()}var l=a.prototype;return l.toggle=function(){if(!this._element.disabled&&!t(this._element).hasClass(u)){var e=a._getParentFromElement(this._element),i=t(this._menu).hasClass(f);if(a._clearMenus(),!i){var s={relatedTarget:this._element},r=t.Event(c.SHOW,s);if(t(e).trigger(r),!r.isDefaultPrevented()){if(!this._inNavbar){if("undefined"==typeof n)throw new TypeError("Bootstrap dropdown require Popper.js (https://popper.js.org)");var o=this._element;t(e).hasClass(d)&&(t(this._menu).hasClass(m)||t(this._menu).hasClass(p))&&(o=e),"scrollParent"!==this._config.boundary&&t(e).addClass(v),this._popper=new n(o,this._menu,this._getPopperConfig())}"ontouchstart"in document.documentElement&&0===t(e).closest(C).length&&t("body").children().on("mouseover",null,t.noop),this._element.focus(),this._element.setAttribute("aria-expanded",!0),t(this._menu).toggleClass(f),t(e).toggleClass(f).trigger(t.Event(c.SHOWN,s))}}}},l.dispose=function(){t.removeData(this._element,i),t(this._element).off(o),this._element=null,this._menu=null,null!==this._popper&&(this._popper.destroy(),this._popper=null)},l.update=function(){this._inNavbar=this._detectNavbar(),null!==this._popper&&this._popper.scheduleUpdate()},l._addEventListeners=function(){var e=this;t(this._element).on(c.CLICK,function(t){t.preventDefault(),t.stopPropagation(),e.toggle()})},l._getConfig=function(n){return n=r({},this.constructor.Default,t(this._element).data(),n),P.typeCheckConfig(e,n,this.constructor.DefaultType),n},l._getMenuElement=function(){if(!this._menu){var e=a._getParentFromElement(this._element);this._menu=t(e).find(y)[0]}return this._menu},l._getPlacement=function(){var e=t(this._element).parent(),n=D;return e.hasClass(d)?(n=A,t(this._menu).hasClass(p)&&(n=b)):e.hasClass(_)?n=w:e.hasClass(g)?n=N:t(this._menu).hasClass(p)&&(n=S),n},l._detectNavbar=function(){return t(this._element).closest(".navbar").length>0},l._getPopperConfig=function(){var t=this,e={};return"function"==typeof this._config.offset?e.fn=function(e){return e.offsets=r({},e.offsets,t._config.offset(e.offsets)||{}),e}:e.offset=this._config.offset,{placement:this._getPlacement(),modifiers:{offset:e,flip:{enabled:this._config.flip},preventOverflow:{boundariesElement:this._config.boundary}}}},a._jQueryInterface=function(e){return this.each(function(){var n=t(this).data(i);if(n||(n=new a(this,"object"==typeof e?e:null),t(this).data(i,n)),"string"==typeof e){if("undefined"==typeof n[e])throw new TypeError('No method named "'+e+'"');n[e]()}})},a._clearMenus=function(e){if(!e||3!==e.which&&("keyup"!==e.type||9===e.which))for(var n=t.makeArray(t(E)),s=0;s<n.length;s++){var r=a._getParentFromElement(n[s]),o=t(n[s]).data(i),l={relatedTarget:n[s]};if(o){var h=o._menu;if(t(r).hasClass(f)&&!(e&&("click"===e.type&&/input|textarea/i.test(e.target.tagName)||"keyup"===e.type&&9===e.which)&&t.contains(r,e.target))){var u=t.Event(c.HIDE,l);t(r).trigger(u),u.isDefaultPrevented()||("ontouchstart"in document.documentElement&&t("body").children().off("mouseover",null,t.noop),n[s].setAttribute("aria-expanded","false"),t(h).removeClass(f),t(r).removeClass(f).trigger(t.Event(c.HIDDEN,l)))}}}},a._getParentFromElement=function(e){var n,i=P.getSelectorFromElement(e);return i&&(n=t(i)[0]),n||e.parentNode},a._dataApiKeydownHandler=function(e){if((/input|textarea/i.test(e.target.tagName)?!(32===e.which||27!==e.which&&(40!==e.which&&38!==e.which||t(e.target).closest(y).length)):h.test(e.which))&&(e.preventDefault(),e.stopPropagation(),!this.disabled&&!t(this).hasClass(u))){var n=a._getParentFromElement(this),i=t(n).hasClass(f);if((i||27===e.which&&32===e.which)&&(!i||27!==e.which&&32!==e.which)){var s=t(n).find(I).get();if(0!==s.length){var r=s.indexOf(e.target);38===e.which&&r>0&&r--,40===e.which&&r<s.length-1&&r++,r<0&&(r=0),s[r].focus()}}else{if(27===e.which){var o=t(n).find(E)[0];t(o).trigger("focus")}t(this).trigger("click")}}},s(a,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return O}},{key:"DefaultType",get:function(){return k}}]),a}();return t(document).on(c.KEYDOWN_DATA_API,E,L._dataApiKeydownHandler).on(c.KEYDOWN_DATA_API,y,L._dataApiKeydownHandler).on(c.CLICK_DATA_API+" "+c.KEYUP_DATA_API,L._clearMenus).on(c.CLICK_DATA_API,E,function(e){e.preventDefault(),e.stopPropagation(),L._jQueryInterface.call(t(this),"toggle")}).on(c.CLICK_DATA_API,T,function(t){t.stopPropagation()}),t.fn[e]=L._jQueryInterface,t.fn[e].Constructor=L,t.fn[e].noConflict=function(){return t.fn[e]=l,L._jQueryInterface},L}(e),M=function(t){var e="modal",n="bs.modal",i="."+n,o=t.fn.modal,a={backdrop:!0,keyboard:!0,focus:!0,show:!0},l={backdrop:"(boolean|string)",keyboard:"boolean",focus:"boolean",show:"boolean"},h={HIDE:"hide"+i,HIDDEN:"hidden"+i,SHOW:"show"+i,SHOWN:"shown"+i,FOCUSIN:"focusin"+i,RESIZE:"resize"+i,CLICK_DISMISS:"click.dismiss"+i,KEYDOWN_DISMISS:"keydown.dismiss"+i,MOUSEUP_DISMISS:"mouseup.dismiss"+i,MOUSEDOWN_DISMISS:"mousedown.dismiss"+i,CLICK_DATA_API:"click"+i+".data-api"},c="modal-scrollbar-measure",u="modal-backdrop",f="modal-open",d="fade",_="show",g={DIALOG:".modal-dialog",DATA_TOGGLE:'[data-toggle="modal"]',DATA_DISMISS:'[data-dismiss="modal"]',FIXED_CONTENT:".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",STICKY_CONTENT:".sticky-top",NAVBAR_TOGGLER:".navbar-toggler"},p=function(){function o(e,n){this._config=this._getConfig(n),this._element=e,this._dialog=t(e).find(g.DIALOG)[0],this._backdrop=null,this._isShown=!1,this._isBodyOverflowing=!1,this._ignoreBackdropClick=!1,this._originalBodyPadding=0,this._scrollbarWidth=0}var p=o.prototype;return p.toggle=function(t){return this._isShown?this.hide():this.show(t)},p.show=function(e){var n=this;if(!this._isTransitioning&&!this._isShown){P.supportsTransitionEnd()&&t(this._element).hasClass(d)&&(this._isTransitioning=!0);var i=t.Event(h.SHOW,{relatedTarget:e});t(this._element).trigger(i),this._isShown||i.isDefaultPrevented()||(this._isShown=!0,this._checkScrollbar(),this._setScrollbar(),this._adjustDialog(),t(document.body).addClass(f),this._setEscapeEvent(),this._setResizeEvent(),t(this._element).on(h.CLICK_DISMISS,g.DATA_DISMISS,function(t){return n.hide(t)}),t(this._dialog).on(h.MOUSEDOWN_DISMISS,function(){t(n._element).one(h.MOUSEUP_DISMISS,function(e){t(e.target).is(n._element)&&(n._ignoreBackdropClick=!0)})}),this._showBackdrop(function(){return n._showElement(e)}))}},p.hide=function(e){var n=this;if(e&&e.preventDefault(),!this._isTransitioning&&this._isShown){var i=t.Event(h.HIDE);if(t(this._element).trigger(i),this._isShown&&!i.isDefaultPrevented()){this._isShown=!1;var s=P.supportsTransitionEnd()&&t(this._element).hasClass(d);s&&(this._isTransitioning=!0),this._setEscapeEvent(),this._setResizeEvent(),t(document).off(h.FOCUSIN),t(this._element).removeClass(_),t(this._element).off(h.CLICK_DISMISS),t(this._dialog).off(h.MOUSEDOWN_DISMISS),s?t(this._element).one(P.TRANSITION_END,function(t){return n._hideModal(t)}).emulateTransitionEnd(300):this._hideModal()}}},p.dispose=function(){t.removeData(this._element,n),t(window,document,this._element,this._backdrop).off(i),this._config=null,this._element=null,this._dialog=null,this._backdrop=null,this._isShown=null,this._isBodyOverflowing=null,this._ignoreBackdropClick=null,this._scrollbarWidth=null},p.handleUpdate=function(){this._adjustDialog()},p._getConfig=function(t){return t=r({},a,t),P.typeCheckConfig(e,t,l),t},p._showElement=function(e){var n=this,i=P.supportsTransitionEnd()&&t(this._element).hasClass(d);this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE||document.body.appendChild(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.scrollTop=0,i&&P.reflow(this._element),t(this._element).addClass(_),this._config.focus&&this._enforceFocus();var s=t.Event(h.SHOWN,{relatedTarget:e}),r=function(){n._config.focus&&n._element.focus(),n._isTransitioning=!1,t(n._element).trigger(s)};i?t(this._dialog).one(P.TRANSITION_END,r).emulateTransitionEnd(300):r()},p._enforceFocus=function(){var e=this;t(document).off(h.FOCUSIN).on(h.FOCUSIN,function(n){document!==n.target&&e._element!==n.target&&0===t(e._element).has(n.target).length&&e._element.focus()})},p._setEscapeEvent=function(){var e=this;this._isShown&&this._config.keyboard?t(this._element).on(h.KEYDOWN_DISMISS,function(t){27===t.which&&(t.preventDefault(),e.hide())}):this._isShown||t(this._element).off(h.KEYDOWN_DISMISS)},p._setResizeEvent=function(){var e=this;this._isShown?t(window).on(h.RESIZE,function(t){return e.handleUpdate(t)}):t(window).off(h.RESIZE)},p._hideModal=function(){var e=this;this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._isTransitioning=!1,this._showBackdrop(function(){t(document.body).removeClass(f),e._resetAdjustments(),e._resetScrollbar(),t(e._element).trigger(h.HIDDEN)})},p._removeBackdrop=function(){this._backdrop&&(t(this._backdrop).remove(),this._backdrop=null)},p._showBackdrop=function(e){var n=this,i=t(this._element).hasClass(d)?d:"";if(this._isShown&&this._config.backdrop){var s=P.supportsTransitionEnd()&&i;if(this._backdrop=document.createElement("div"),this._backdrop.className=u,i&&t(this._backdrop).addClass(i),t(this._backdrop).appendTo(document.body),t(this._element).on(h.CLICK_DISMISS,function(t){n._ignoreBackdropClick?n._ignoreBackdropClick=!1:t.target===t.currentTarget&&("static"===n._config.backdrop?n._element.focus():n.hide())}),s&&P.reflow(this._backdrop),t(this._backdrop).addClass(_),!e)return;if(!s)return void e();t(this._backdrop).one(P.TRANSITION_END,e).emulateTransitionEnd(150)}else if(!this._isShown&&this._backdrop){t(this._backdrop).removeClass(_);var r=function(){n._removeBackdrop(),e&&e()};P.supportsTransitionEnd()&&t(this._element).hasClass(d)?t(this._backdrop).one(P.TRANSITION_END,r).emulateTransitionEnd(150):r()}else e&&e()},p._adjustDialog=function(){var t=this._element.scrollHeight>document.documentElement.clientHeight;!this._isBodyOverflowing&&t&&(this._element.style.paddingLeft=this._scrollbarWidth+"px"),this._isBodyOverflowing&&!t&&(this._element.style.paddingRight=this._scrollbarWidth+"px")},p._resetAdjustments=function(){this._element.style.paddingLeft="",this._element.style.paddingRight=""},p._checkScrollbar=function(){var t=document.body.getBoundingClientRect();this._isBodyOverflowing=t.left+t.right<window.innerWidth,this._scrollbarWidth=this._getScrollbarWidth()},p._setScrollbar=function(){var e=this;if(this._isBodyOverflowing){t(g.FIXED_CONTENT).each(function(n,i){var s=t(i)[0].style.paddingRight,r=t(i).css("padding-right");t(i).data("padding-right",s).css("padding-right",parseFloat(r)+e._scrollbarWidth+"px")}),t(g.STICKY_CONTENT).each(function(n,i){var s=t(i)[0].style.marginRight,r=t(i).css("margin-right");t(i).data("margin-right",s).css("margin-right",parseFloat(r)-e._scrollbarWidth+"px")}),t(g.NAVBAR_TOGGLER).each(function(n,i){var s=t(i)[0].style.marginRight,r=t(i).css("margin-right");t(i).data("margin-right",s).css("margin-right",parseFloat(r)+e._scrollbarWidth+"px")});var n=document.body.style.paddingRight,i=t("body").css("padding-right");t("body").data("padding-right",n).css("padding-right",parseFloat(i)+this._scrollbarWidth+"px")}},p._resetScrollbar=function(){t(g.FIXED_CONTENT).each(function(e,n){var i=t(n).data("padding-right");"undefined"!=typeof i&&t(n).css("padding-right",i).removeData("padding-right")}),t(g.STICKY_CONTENT+", "+g.NAVBAR_TOGGLER).each(function(e,n){var i=t(n).data("margin-right");"undefined"!=typeof i&&t(n).css("margin-right",i).removeData("margin-right")});var e=t("body").data("padding-right");"undefined"!=typeof e&&t("body").css("padding-right",e).removeData("padding-right")},p._getScrollbarWidth=function(){var t=document.createElement("div");t.className=c,document.body.appendChild(t);var e=t.getBoundingClientRect().width-t.clientWidth;return document.body.removeChild(t),e},o._jQueryInterface=function(e,i){return this.each(function(){var s=t(this).data(n),a=r({},o.Default,t(this).data(),"object"==typeof e&&e);if(s||(s=new o(this,a),t(this).data(n,s)),"string"==typeof e){if("undefined"==typeof s[e])throw new TypeError('No method named "'+e+'"');s[e](i)}else a.show&&s.show(i)})},s(o,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),o}();return t(document).on(h.CLICK_DATA_API,g.DATA_TOGGLE,function(e){var i,s=this,o=P.getSelectorFromElement(this);o&&(i=t(o)[0]);var a=t(i).data(n)?"toggle":r({},t(i).data(),t(this).data());"A"!==this.tagName&&"AREA"!==this.tagName||e.preventDefault();var l=t(i).one(h.SHOW,function(e){e.isDefaultPrevented()||l.one(h.HIDDEN,function(){t(s).is(":visible")&&s.focus()})});p._jQueryInterface.call(t(i),a,this)}),t.fn.modal=p._jQueryInterface,t.fn.modal.Constructor=p,t.fn.modal.noConflict=function(){return t.fn.modal=o,p._jQueryInterface},p}(e),U=function(t){var e="tooltip",i="bs.tooltip",o="."+i,a=t.fn[e],l=new RegExp("(^|\\s)bs-tooltip\\S+","g"),h={animation:"boolean",template:"string",title:"(string|element|function)",trigger:"string",delay:"(number|object)",html:"boolean",selector:"(string|boolean)",placement:"(string|function)",offset:"(number|string)",container:"(string|element|boolean)",fallbackPlacement:"(string|array)",boundary:"(string|element)"},c={AUTO:"auto",TOP:"top",RIGHT:"right",BOTTOM:"bottom",LEFT:"left"},u={animation:!0,template:'<div class="tooltip" role="tooltip"><div class="arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover focus",title:"",delay:0,html:!1,selector:!1,placement:"top",offset:0,container:!1,fallbackPlacement:"flip",boundary:"scrollParent"},f="show",d="out",_={HIDE:"hide"+o,HIDDEN:"hidden"+o,SHOW:"show"+o,SHOWN:"shown"+o,INSERTED:"inserted"+o,CLICK:"click"+o,FOCUSIN:"focusin"+o,FOCUSOUT:"focusout"+o,MOUSEENTER:"mouseenter"+o,MOUSELEAVE:"mouseleave"+o},g="fade",p="show",m=".tooltip-inner",v=".arrow",E="hover",T="focus",y="click",C="manual",I=function(){function a(t,e){if("undefined"==typeof n)throw new TypeError("Bootstrap tooltips require Popper.js (https://popper.js.org)");this._isEnabled=!0,this._timeout=0,this._hoverState="",this._activeTrigger={},this._popper=null,this.element=t,this.config=this._getConfig(e),this.tip=null,this._setListeners()}var I=a.prototype;return I.enable=function(){this._isEnabled=!0},I.disable=function(){this._isEnabled=!1},I.toggleEnabled=function(){this._isEnabled=!this._isEnabled},I.toggle=function(e){if(this._isEnabled)if(e){var n=this.constructor.DATA_KEY,i=t(e.currentTarget).data(n);i||(i=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(n,i)),i._activeTrigger.click=!i._activeTrigger.click,i._isWithActiveTrigger()?i._enter(null,i):i._leave(null,i)}else{if(t(this.getTipElement()).hasClass(p))return void this._leave(null,this);this._enter(null,this)}},I.dispose=function(){clearTimeout(this._timeout),t.removeData(this.element,this.constructor.DATA_KEY),t(this.element).off(this.constructor.EVENT_KEY),t(this.element).closest(".modal").off("hide.bs.modal"),this.tip&&t(this.tip).remove(),this._isEnabled=null,this._timeout=null,this._hoverState=null,this._activeTrigger=null,null!==this._popper&&this._popper.destroy(),this._popper=null,this.element=null,this.config=null,this.tip=null},I.show=function(){var e=this;if("none"===t(this.element).css("display"))throw new Error("Please use show on visible elements");var i=t.Event(this.constructor.Event.SHOW);if(this.isWithContent()&&this._isEnabled){t(this.element).trigger(i);var s=t.contains(this.element.ownerDocument.documentElement,this.element);if(i.isDefaultPrevented()||!s)return;var r=this.getTipElement(),o=P.getUID(this.constructor.NAME);r.setAttribute("id",o),this.element.setAttribute("aria-describedby",o),this.setContent(),this.config.animation&&t(r).addClass(g);var l="function"==typeof this.config.placement?this.config.placement.call(this,r,this.element):this.config.placement,h=this._getAttachment(l);this.addAttachmentClass(h);var c=!1===this.config.container?document.body:t(this.config.container);t(r).data(this.constructor.DATA_KEY,this),t.contains(this.element.ownerDocument.documentElement,this.tip)||t(r).appendTo(c),t(this.element).trigger(this.constructor.Event.INSERTED),this._popper=new n(this.element,r,{placement:h,modifiers:{offset:{offset:this.config.offset},flip:{behavior:this.config.fallbackPlacement},arrow:{element:v},preventOverflow:{boundariesElement:this.config.boundary}},onCreate:function(t){t.originalPlacement!==t.placement&&e._handlePopperPlacementChange(t)},onUpdate:function(t){e._handlePopperPlacementChange(t)}}),t(r).addClass(p),"ontouchstart"in document.documentElement&&t("body").children().on("mouseover",null,t.noop);var u=function(){e.config.animation&&e._fixTransition();var n=e._hoverState;e._hoverState=null,t(e.element).trigger(e.constructor.Event.SHOWN),n===d&&e._leave(null,e)};P.supportsTransitionEnd()&&t(this.tip).hasClass(g)?t(this.tip).one(P.TRANSITION_END,u).emulateTransitionEnd(a._TRANSITION_DURATION):u()}},I.hide=function(e){var n=this,i=this.getTipElement(),s=t.Event(this.constructor.Event.HIDE),r=function(){n._hoverState!==f&&i.parentNode&&i.parentNode.removeChild(i),n._cleanTipClass(),n.element.removeAttribute("aria-describedby"),t(n.element).trigger(n.constructor.Event.HIDDEN),null!==n._popper&&n._popper.destroy(),e&&e()};t(this.element).trigger(s),s.isDefaultPrevented()||(t(i).removeClass(p),"ontouchstart"in document.documentElement&&t("body").children().off("mouseover",null,t.noop),this._activeTrigger[y]=!1,this._activeTrigger[T]=!1,this._activeTrigger[E]=!1,P.supportsTransitionEnd()&&t(this.tip).hasClass(g)?t(i).one(P.TRANSITION_END,r).emulateTransitionEnd(150):r(),this._hoverState="")},I.update=function(){null!==this._popper&&this._popper.scheduleUpdate()},I.isWithContent=function(){return Boolean(this.getTitle())},I.addAttachmentClass=function(e){t(this.getTipElement()).addClass("bs-tooltip-"+e)},I.getTipElement=function(){return this.tip=this.tip||t(this.config.template)[0],this.tip},I.setContent=function(){var e=t(this.getTipElement());this.setElementContent(e.find(m),this.getTitle()),e.removeClass(g+" "+p)},I.setElementContent=function(e,n){var i=this.config.html;"object"==typeof n&&(n.nodeType||n.jquery)?i?t(n).parent().is(e)||e.empty().append(n):e.text(t(n).text()):e[i?"html":"text"](n)},I.getTitle=function(){var t=this.element.getAttribute("data-original-title");return t||(t="function"==typeof this.config.title?this.config.title.call(this.element):this.config.title),t},I._getAttachment=function(t){return c[t.toUpperCase()]},I._setListeners=function(){var e=this;this.config.trigger.split(" ").forEach(function(n){if("click"===n)t(e.element).on(e.constructor.Event.CLICK,e.config.selector,function(t){return e.toggle(t)});else if(n!==C){var i=n===E?e.constructor.Event.MOUSEENTER:e.constructor.Event.FOCUSIN,s=n===E?e.constructor.Event.MOUSELEAVE:e.constructor.Event.FOCUSOUT;t(e.element).on(i,e.config.selector,function(t){return e._enter(t)}).on(s,e.config.selector,function(t){return e._leave(t)})}t(e.element).closest(".modal").on("hide.bs.modal",function(){return e.hide()})}),this.config.selector?this.config=r({},this.config,{trigger:"manual",selector:""}):this._fixTitle()},I._fixTitle=function(){var t=typeof this.element.getAttribute("data-original-title");(this.element.getAttribute("title")||"string"!==t)&&(this.element.setAttribute("data-original-title",this.element.getAttribute("title")||""),this.element.setAttribute("title",""))},I._enter=function(e,n){var i=this.constructor.DATA_KEY;(n=n||t(e.currentTarget).data(i))||(n=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(i,n)),e&&(n._activeTrigger["focusin"===e.type?T:E]=!0),t(n.getTipElement()).hasClass(p)||n._hoverState===f?n._hoverState=f:(clearTimeout(n._timeout),n._hoverState=f,n.config.delay&&n.config.delay.show?n._timeout=setTimeout(function(){n._hoverState===f&&n.show()},n.config.delay.show):n.show())},I._leave=function(e,n){var i=this.constructor.DATA_KEY;(n=n||t(e.currentTarget).data(i))||(n=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(i,n)),e&&(n._activeTrigger["focusout"===e.type?T:E]=!1),n._isWithActiveTrigger()||(clearTimeout(n._timeout),n._hoverState=d,n.config.delay&&n.config.delay.hide?n._timeout=setTimeout(function(){n._hoverState===d&&n.hide()},n.config.delay.hide):n.hide())},I._isWithActiveTrigger=function(){for(var t in this._activeTrigger)if(this._activeTrigger[t])return!0;return!1},I._getConfig=function(n){return"number"==typeof(n=r({},this.constructor.Default,t(this.element).data(),n)).delay&&(n.delay={show:n.delay,hide:n.delay}),"number"==typeof n.title&&(n.title=n.title.toString()),"number"==typeof n.content&&(n.content=n.content.toString()),P.typeCheckConfig(e,n,this.constructor.DefaultType),n},I._getDelegateConfig=function(){var t={};if(this.config)for(var e in this.config)this.constructor.Default[e]!==this.config[e]&&(t[e]=this.config[e]);return t},I._cleanTipClass=function(){var e=t(this.getTipElement()),n=e.attr("class").match(l);null!==n&&n.length>0&&e.removeClass(n.join(""))},I._handlePopperPlacementChange=function(t){this._cleanTipClass(),this.addAttachmentClass(this._getAttachment(t.placement))},I._fixTransition=function(){var e=this.getTipElement(),n=this.config.animation;null===e.getAttribute("x-placement")&&(t(e).removeClass(g),this.config.animation=!1,this.hide(),this.show(),this.config.animation=n)},a._jQueryInterface=function(e){return this.each(function(){var n=t(this).data(i),s="object"==typeof e&&e;if((n||!/dispose|hide/.test(e))&&(n||(n=new a(this,s),t(this).data(i,n)),"string"==typeof e)){if("undefined"==typeof n[e])throw new TypeError('No method named "'+e+'"');n[e]()}})},s(a,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return u}},{key:"NAME",get:function(){return e}},{key:"DATA_KEY",get:function(){return i}},{key:"Event",get:function(){return _}},{key:"EVENT_KEY",get:function(){return o}},{key:"DefaultType",get:function(){return h}}]),a}();return t.fn[e]=I._jQueryInterface,t.fn[e].Constructor=I,t.fn[e].noConflict=function(){return t.fn[e]=a,I._jQueryInterface},I}(e),x=function(t){var e="popover",n="bs.popover",i="."+n,o=t.fn[e],a=new RegExp("(^|\\s)bs-popover\\S+","g"),l=r({},U.Default,{placement:"right",trigger:"click",content:"",template:'<div class="popover" role="tooltip"><div class="arrow"></div><h3 class="popover-header"></h3><div class="popover-body"></div></div>'}),h=r({},U.DefaultType,{content:"(string|element|function)"}),c="fade",u="show",f=".popover-header",d=".popover-body",_={HIDE:"hide"+i,HIDDEN:"hidden"+i,SHOW:"show"+i,SHOWN:"shown"+i,INSERTED:"inserted"+i,CLICK:"click"+i,FOCUSIN:"focusin"+i,FOCUSOUT:"focusout"+i,MOUSEENTER:"mouseenter"+i,MOUSELEAVE:"mouseleave"+i},g=function(r){var o,g;function p(){return r.apply(this,arguments)||this}g=r,(o=p).prototype=Object.create(g.prototype),o.prototype.constructor=o,o.__proto__=g;var m=p.prototype;return m.isWithContent=function(){return this.getTitle()||this._getContent()},m.addAttachmentClass=function(e){t(this.getTipElement()).addClass("bs-popover-"+e)},m.getTipElement=function(){return this.tip=this.tip||t(this.config.template)[0],this.tip},m.setContent=function(){var e=t(this.getTipElement());this.setElementContent(e.find(f),this.getTitle());var n=this._getContent();"function"==typeof n&&(n=n.call(this.element)),this.setElementContent(e.find(d),n),e.removeClass(c+" "+u)},m._getContent=function(){return this.element.getAttribute("data-content")||this.config.content},m._cleanTipClass=function(){var e=t(this.getTipElement()),n=e.attr("class").match(a);null!==n&&n.length>0&&e.removeClass(n.join(""))},p._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n),s="object"==typeof e?e:null;if((i||!/destroy|hide/.test(e))&&(i||(i=new p(this,s),t(this).data(n,i)),"string"==typeof e)){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},s(p,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return l}},{key:"NAME",get:function(){return e}},{key:"DATA_KEY",get:function(){return n}},{key:"Event",get:function(){return _}},{key:"EVENT_KEY",get:function(){return i}},{key:"DefaultType",get:function(){return h}}]),p}(U);return t.fn[e]=g._jQueryInterface,t.fn[e].Constructor=g,t.fn[e].noConflict=function(){return t.fn[e]=o,g._jQueryInterface},g}(e),K=function(t){var e="scrollspy",n="bs.scrollspy",i="."+n,o=t.fn[e],a={offset:10,method:"auto",target:""},l={offset:"number",method:"string",target:"(string|element)"},h={ACTIVATE:"activate"+i,SCROLL:"scroll"+i,LOAD_DATA_API:"load"+i+".data-api"},c="dropdown-item",u="active",f={DATA_SPY:'[data-spy="scroll"]',ACTIVE:".active",NAV_LIST_GROUP:".nav, .list-group",NAV_LINKS:".nav-link",NAV_ITEMS:".nav-item",LIST_ITEMS:".list-group-item",DROPDOWN:".dropdown",DROPDOWN_ITEMS:".dropdown-item",DROPDOWN_TOGGLE:".dropdown-toggle"},d="offset",_="position",g=function(){function o(e,n){var i=this;this._element=e,this._scrollElement="BODY"===e.tagName?window:e,this._config=this._getConfig(n),this._selector=this._config.target+" "+f.NAV_LINKS+","+this._config.target+" "+f.LIST_ITEMS+","+this._config.target+" "+f.DROPDOWN_ITEMS,this._offsets=[],this._targets=[],this._activeTarget=null,this._scrollHeight=0,t(this._scrollElement).on(h.SCROLL,function(t){return i._process(t)}),this.refresh(),this._process()}var g=o.prototype;return g.refresh=function(){var e=this,n=this._scrollElement===this._scrollElement.window?d:_,i="auto"===this._config.method?n:this._config.method,s=i===_?this._getScrollTop():0;this._offsets=[],this._targets=[],this._scrollHeight=this._getScrollHeight(),t.makeArray(t(this._selector)).map(function(e){var n,r=P.getSelectorFromElement(e);if(r&&(n=t(r)[0]),n){var o=n.getBoundingClientRect();if(o.width||o.height)return[t(n)[i]().top+s,r]}return null}).filter(function(t){return t}).sort(function(t,e){return t[0]-e[0]}).forEach(function(t){e._offsets.push(t[0]),e._targets.push(t[1])})},g.dispose=function(){t.removeData(this._element,n),t(this._scrollElement).off(i),this._element=null,this._scrollElement=null,this._config=null,this._selector=null,this._offsets=null,this._targets=null,this._activeTarget=null,this._scrollHeight=null},g._getConfig=function(n){if("string"!=typeof(n=r({},a,n)).target){var i=t(n.target).attr("id");i||(i=P.getUID(e),t(n.target).attr("id",i)),n.target="#"+i}return P.typeCheckConfig(e,n,l),n},g._getScrollTop=function(){return this._scrollElement===window?this._scrollElement.pageYOffset:this._scrollElement.scrollTop},g._getScrollHeight=function(){return this._scrollElement.scrollHeight||Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)},g._getOffsetHeight=function(){return this._scrollElement===window?window.innerHeight:this._scrollElement.getBoundingClientRect().height},g._process=function(){var t=this._getScrollTop()+this._config.offset,e=this._getScrollHeight(),n=this._config.offset+e-this._getOffsetHeight();if(this._scrollHeight!==e&&this.refresh(),t>=n){var i=this._targets[this._targets.length-1];this._activeTarget!==i&&this._activate(i)}else{if(this._activeTarget&&t<this._offsets[0]&&this._offsets[0]>0)return this._activeTarget=null,void this._clear();for(var s=this._offsets.length;s--;){this._activeTarget!==this._targets[s]&&t>=this._offsets[s]&&("undefined"==typeof this._offsets[s+1]||t<this._offsets[s+1])&&this._activate(this._targets[s])}}},g._activate=function(e){this._activeTarget=e,this._clear();var n=this._selector.split(",");n=n.map(function(t){return t+'[data-target="'+e+'"],'+t+'[href="'+e+'"]'});var i=t(n.join(","));i.hasClass(c)?(i.closest(f.DROPDOWN).find(f.DROPDOWN_TOGGLE).addClass(u),i.addClass(u)):(i.addClass(u),i.parents(f.NAV_LIST_GROUP).prev(f.NAV_LINKS+", "+f.LIST_ITEMS).addClass(u),i.parents(f.NAV_LIST_GROUP).prev(f.NAV_ITEMS).children(f.NAV_LINKS).addClass(u)),t(this._scrollElement).trigger(h.ACTIVATE,{relatedTarget:e})},g._clear=function(){t(this._selector).filter(f.ACTIVE).removeClass(u)},o._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n);if(i||(i=new o(this,"object"==typeof e&&e),t(this).data(n,i)),"string"==typeof e){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},s(o,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),o}();return t(window).on(h.LOAD_DATA_API,function(){for(var e=t.makeArray(t(f.DATA_SPY)),n=e.length;n--;){var i=t(e[n]);g._jQueryInterface.call(i,i.data())}}),t.fn[e]=g._jQueryInterface,t.fn[e].Constructor=g,t.fn[e].noConflict=function(){return t.fn[e]=o,g._jQueryInterface},g}(e),V=function(t){var e="bs.tab",n="."+e,i=t.fn.tab,r={HIDE:"hide"+n,HIDDEN:"hidden"+n,SHOW:"show"+n,SHOWN:"shown"+n,CLICK_DATA_API:"click.bs.tab.data-api"},o="dropdown-menu",a="active",l="disabled",h="fade",c="show",u=".dropdown",f=".nav, .list-group",d=".active",_="> li > .active",g='[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',p=".dropdown-toggle",m="> .dropdown-menu .active",v=function(){function n(t){this._element=t}var i=n.prototype;return i.show=function(){var e=this;if(!(this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE&&t(this._element).hasClass(a)||t(this._element).hasClass(l))){var n,i,s=t(this._element).closest(f)[0],o=P.getSelectorFromElement(this._element);if(s){var h="UL"===s.nodeName?_:d;i=(i=t.makeArray(t(s).find(h)))[i.length-1]}var c=t.Event(r.HIDE,{relatedTarget:this._element}),u=t.Event(r.SHOW,{relatedTarget:i});if(i&&t(i).trigger(c),t(this._element).trigger(u),!u.isDefaultPrevented()&&!c.isDefaultPrevented()){o&&(n=t(o)[0]),this._activate(this._element,s);var g=function(){var n=t.Event(r.HIDDEN,{relatedTarget:e._element}),s=t.Event(r.SHOWN,{relatedTarget:i});t(i).trigger(n),t(e._element).trigger(s)};n?this._activate(n,n.parentNode,g):g()}}},i.dispose=function(){t.removeData(this._element,e),this._element=null},i._activate=function(e,n,i){var s=this,r=("UL"===n.nodeName?t(n).find(_):t(n).children(d))[0],o=i&&P.supportsTransitionEnd()&&r&&t(r).hasClass(h),a=function(){return s._transitionComplete(e,r,i)};r&&o?t(r).one(P.TRANSITION_END,a).emulateTransitionEnd(150):a()},i._transitionComplete=function(e,n,i){if(n){t(n).removeClass(c+" "+a);var s=t(n.parentNode).find(m)[0];s&&t(s).removeClass(a),"tab"===n.getAttribute("role")&&n.setAttribute("aria-selected",!1)}if(t(e).addClass(a),"tab"===e.getAttribute("role")&&e.setAttribute("aria-selected",!0),P.reflow(e),t(e).addClass(c),e.parentNode&&t(e.parentNode).hasClass(o)){var r=t(e).closest(u)[0];r&&t(r).find(p).addClass(a),e.setAttribute("aria-expanded",!0)}i&&i()},n._jQueryInterface=function(i){return this.each(function(){var s=t(this),r=s.data(e);if(r||(r=new n(this),s.data(e,r)),"string"==typeof i){if("undefined"==typeof r[i])throw new TypeError('No method named "'+i+'"');r[i]()}})},s(n,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),n}();return t(document).on(r.CLICK_DATA_API,g,function(e){e.preventDefault(),v._jQueryInterface.call(t(this),"show")}),t.fn.tab=v._jQueryInterface,t.fn.tab.Constructor=v,t.fn.tab.noConflict=function(){return t.fn.tab=i,v._jQueryInterface},v}(e);!function(t){if("undefined"==typeof t)throw new TypeError("Bootstrap's JavaScript requires jQuery. jQuery must be included before Bootstrap's JavaScript.");var e=t.fn.jquery.split(" ")[0].split(".");if(e[0]<2&&e[1]<9||1===e[0]&&9===e[1]&&e[2]<1||e[0]>=4)throw new Error("Bootstrap's JavaScript requires at least jQuery v1.9.1 but less than v4.0.0")}(e),t.Util=P,t.Alert=L,t.Button=R,t.Carousel=j,t.Collapse=H,t.Dropdown=W,t.Modal=M,t.Popover=x,t.Scrollspy=K,t.Tab=V,t.Tooltip=U,Object.defineProperty(t,"__esModule",{value:!0})});
+//# sourceMappingURL=bootstrap.min.js.map
\ No newline at end of file
diff --git a/docs/lib/easing/easing.js b/docs/lib/easing/easing.js
new file mode 100644
index 0000000..3b9c776
--- /dev/null
+++ b/docs/lib/easing/easing.js
@@ -0,0 +1,168 @@
+/*
+ * jQuery Easing v1.4.1 - http://gsgd.co.uk/sandbox/jquery/easing/
+ * Open source under the BSD License.
+ * Copyright © 2008 George McGinley Smith
+ * All rights reserved.
+ * https://raw.github.com/gdsmith/jquery-easing/master/LICENSE
+*/
+
+(function (factory) {
+	if (typeof define === "function" && define.amd) {
+		define(['jquery'], function ($) {
+			return factory($);
+		});
+	} else if (typeof module === "object" && typeof module.exports === "object") {
+		exports = factory(require('jquery'));
+	} else {
+		factory(jQuery);
+	}
+})(function($){
+
+// Preserve the original jQuery "swing" easing as "jswing"
+if (typeof $.easing !== 'undefined') {
+	$.easing['jswing'] = $.easing['swing'];
+}
+
+var pow = Math.pow,
+	sqrt = Math.sqrt,
+	sin = Math.sin,
+	cos = Math.cos,
+	PI = Math.PI,
+	c1 = 1.70158,
+	c2 = c1 * 1.525,
+	c3 = c1 + 1,
+	c4 = ( 2 * PI ) / 3,
+	c5 = ( 2 * PI ) / 4.5;
+
+// x is the fraction of animation progress, in the range 0..1
+function bounceOut(x) {
+	var n1 = 7.5625,
+		d1 = 2.75;
+	if ( x < 1/d1 ) {
+		return n1*x*x;
+	} else if ( x < 2/d1 ) {
+		return n1*(x-=(1.5/d1))*x + .75;
+	} else if ( x < 2.5/d1 ) {
+		return n1*(x-=(2.25/d1))*x + .9375;
+	} else {
+		return n1*(x-=(2.625/d1))*x + .984375;
+	}
+}
+
+$.extend( $.easing,
+{
+	def: 'easeOutQuad',
+	swing: function (x) {
+		return $.easing[$.easing.def](x);
+	},
+	easeInQuad: function (x) {
+		return x * x;
+	},
+	easeOutQuad: function (x) {
+		return 1 - ( 1 - x ) * ( 1 - x );
+	},
+	easeInOutQuad: function (x) {
+		return x < 0.5 ?
+			2 * x * x :
+			1 - pow( -2 * x + 2, 2 ) / 2;
+	},
+	easeInCubic: function (x) {
+		return x * x * x;
+	},
+	easeOutCubic: function (x) {
+		return 1 - pow( 1 - x, 3 );
+	},
+	easeInOutCubic: function (x) {
+		return x < 0.5 ?
+			4 * x * x * x :
+			1 - pow( -2 * x + 2, 3 ) / 2;
+	},
+	easeInQuart: function (x) {
+		return x * x * x * x;
+	},
+	easeOutQuart: function (x) {
+		return 1 - pow( 1 - x, 4 );
+	},
+	easeInOutQuart: function (x) {
+		return x < 0.5 ?
+			8 * x * x * x * x :
+			1 - pow( -2 * x + 2, 4 ) / 2;
+	},
+	easeInQuint: function (x) {
+		return x * x * x * x * x;
+	},
+	easeOutQuint: function (x) {
+		return 1 - pow( 1 - x, 5 );
+	},
+	easeInOutQuint: function (x) {
+		return x < 0.5 ?
+			16 * x * x * x * x * x :
+			1 - pow( -2 * x + 2, 5 ) / 2;
+	},
+	easeInSine: function (x) {
+		return 1 - cos( x * PI/2 );
+	},
+	easeOutSine: function (x) {
+		return sin( x * PI/2 );
+	},
+	easeInOutSine: function (x) {
+		return -( cos( PI * x ) - 1 ) / 2;
+	},
+	easeInExpo: function (x) {
+		return x === 0 ? 0 : pow( 2, 10 * x - 10 );
+	},
+	easeOutExpo: function (x) {
+		return x === 1 ? 1 : 1 - pow( 2, -10 * x );
+	},
+	easeInOutExpo: function (x) {
+		return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ?
+			pow( 2, 20 * x - 10 ) / 2 :
+			( 2 - pow( 2, -20 * x + 10 ) ) / 2;
+	},
+	easeInCirc: function (x) {
+		return 1 - sqrt( 1 - pow( x, 2 ) );
+	},
+	easeOutCirc: function (x) {
+		return sqrt( 1 - pow( x - 1, 2 ) );
+	},
+	easeInOutCirc: function (x) {
+		return x < 0.5 ?
+			( 1 - sqrt( 1 - pow( 2 * x, 2 ) ) ) / 2 :
+			( sqrt( 1 - pow( -2 * x + 2, 2 ) ) + 1 ) / 2;
+	},
+	easeInElastic: function (x) {
+		return x === 0 ? 0 : x === 1 ? 1 :
+			-pow( 2, 10 * x - 10 ) * sin( ( x * 10 - 10.75 ) * c4 );
+	},
+	easeOutElastic: function (x) {
+		return x === 0 ? 0 : x === 1 ? 1 :
+			pow( 2, -10 * x ) * sin( ( x * 10 - 0.75 ) * c4 ) + 1;
+	},
+	easeInOutElastic: function (x) {
+		return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ?
+			-( pow( 2, 20 * x - 10 ) * sin( ( 20 * x - 11.125 ) * c5 )) / 2 :
+			pow( 2, -20 * x + 10 ) * sin( ( 20 * x - 11.125 ) * c5 ) / 2 + 1;
+	},
+	easeInBack: function (x) {
+		return c3 * x * x * x - c1 * x * x;
+	},
+	easeOutBack: function (x) {
+		return 1 + c3 * pow( x - 1, 3 ) + c1 * pow( x - 1, 2 );
+	},
+	easeInOutBack: function (x) {
+		return x < 0.5 ?
+			( pow( 2 * x, 2 ) * ( ( c2 + 1 ) * 2 * x - c2 ) ) / 2 :
+			( pow( 2 * x - 2, 2 ) *( ( c2 + 1 ) * ( x * 2 - 2 ) + c2 ) + 2 ) / 2;
+	},
+	easeInBounce: function (x) {
+		return 1 - bounceOut( 1 - x );
+	},
+	easeOutBounce: bounceOut,
+	easeInOutBounce: function (x) {
+		return x < 0.5 ?
+			( 1 - bounceOut( 1 - 2 * x ) ) / 2 :
+			( 1 + bounceOut( 2 * x - 1 ) ) / 2;
+	}
+});
+
+});
diff --git a/docs/lib/easing/easing.min.js b/docs/lib/easing/easing.min.js
new file mode 100644
index 0000000..fc7dae4
--- /dev/null
+++ b/docs/lib/easing/easing.min.js
@@ -0,0 +1 @@
+!function(n){"function"==typeof define&&define.amd?define(["jquery"],function(e){return n(e)}):"object"==typeof module&&"object"==typeof module.exports?exports=n(require("jquery")):n(jQuery)}(function(n){function e(n){var e=7.5625,t=2.75;return n<1/t?e*n*n:n<2/t?e*(n-=1.5/t)*n+.75:n<2.5/t?e*(n-=2.25/t)*n+.9375:e*(n-=2.625/t)*n+.984375}void 0!==n.easing&&(n.easing.jswing=n.easing.swing);var t=Math.pow,u=Math.sqrt,r=Math.sin,i=Math.cos,a=Math.PI,c=1.70158,o=1.525*c,s=2*a/3,f=2*a/4.5;n.extend(n.easing,{def:"easeOutQuad",swing:function(e){return n.easing[n.easing.def](e)},easeInQuad:function(n){return n*n},easeOutQuad:function(n){return 1-(1-n)*(1-n)},easeInOutQuad:function(n){return n<.5?2*n*n:1-t(-2*n+2,2)/2},easeInCubic:function(n){return n*n*n},easeOutCubic:function(n){return 1-t(1-n,3)},easeInOutCubic:function(n){return n<.5?4*n*n*n:1-t(-2*n+2,3)/2},easeInQuart:function(n){return n*n*n*n},easeOutQuart:function(n){return 1-t(1-n,4)},easeInOutQuart:function(n){return n<.5?8*n*n*n*n:1-t(-2*n+2,4)/2},easeInQuint:function(n){return n*n*n*n*n},easeOutQuint:function(n){return 1-t(1-n,5)},easeInOutQuint:function(n){return n<.5?16*n*n*n*n*n:1-t(-2*n+2,5)/2},easeInSine:function(n){return 1-i(n*a/2)},easeOutSine:function(n){return r(n*a/2)},easeInOutSine:function(n){return-(i(a*n)-1)/2},easeInExpo:function(n){return 0===n?0:t(2,10*n-10)},easeOutExpo:function(n){return 1===n?1:1-t(2,-10*n)},easeInOutExpo:function(n){return 0===n?0:1===n?1:n<.5?t(2,20*n-10)/2:(2-t(2,-20*n+10))/2},easeInCirc:function(n){return 1-u(1-t(n,2))},easeOutCirc:function(n){return u(1-t(n-1,2))},easeInOutCirc:function(n){return n<.5?(1-u(1-t(2*n,2)))/2:(u(1-t(-2*n+2,2))+1)/2},easeInElastic:function(n){return 0===n?0:1===n?1:-t(2,10*n-10)*r((10*n-10.75)*s)},easeOutElastic:function(n){return 0===n?0:1===n?1:t(2,-10*n)*r((10*n-.75)*s)+1},easeInOutElastic:function(n){return 0===n?0:1===n?1:n<.5?-(t(2,20*n-10)*r((20*n-11.125)*f))/2:t(2,-20*n+10)*r((20*n-11.125)*f)/2+1},easeInBack:function(n){return(c+1)*n*n*n-c*n*n},easeOutBack:function(n){return 1+(c+1)*t(n-1,3)+c*t(n-1,2)},easeInOutBack:function(n){return n<.5?t(2*n,2)*(7.189819*n-o)/2:(t(2*n-2,2)*((o+1)*(2*n-2)+o)+2)/2},easeInBounce:function(n){return 1-e(1-n)},easeOutBounce:e,easeInOutBounce:function(n){return n<.5?(1-e(1-2*n))/2:(1+e(2*n-1))/2}})});
diff --git a/docs/lib/font-awesome/css/font-awesome.css b/docs/lib/font-awesome/css/font-awesome.css
new file mode 100644
index 0000000..ee906a8
--- /dev/null
+++ b/docs/lib/font-awesome/css/font-awesome.css
@@ -0,0 +1,2337 @@
+/*!
+ *  Font Awesome 4.7.0 by @davegandy - http://fontawesome.io - @fontawesome
+ *  License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License)
+ */
+/* FONT PATH
+ * -------------------------- */
+@font-face {
+  font-family: 'FontAwesome';
+  src: url('../fonts/fontawesome-webfont.eot?v=4.7.0');
+  src: url('../fonts/fontawesome-webfont.eot?#iefix&v=4.7.0') format('embedded-opentype'), url('../fonts/fontawesome-webfont.woff2?v=4.7.0') format('woff2'), url('../fonts/fontawesome-webfont.woff?v=4.7.0') format('woff'), url('../fonts/fontawesome-webfont.ttf?v=4.7.0') format('truetype'), url('../fonts/fontawesome-webfont.svg?v=4.7.0#fontawesomeregular') format('svg');
+  font-weight: normal;
+  font-style: normal;
+}
+.fa {
+  display: inline-block;
+  font: normal normal normal 14px/1 FontAwesome;
+  font-size: inherit;
+  text-rendering: auto;
+  -webkit-font-smoothing: antialiased;
+  -moz-osx-font-smoothing: grayscale;
+}
+/* makes the font 33% larger relative to the icon container */
+.fa-lg {
+  font-size: 1.33333333em;
+  line-height: 0.75em;
+  vertical-align: -15%;
+}
+.fa-2x {
+  font-size: 2em;
+}
+.fa-3x {
+  font-size: 3em;
+}
+.fa-4x {
+  font-size: 4em;
+}
+.fa-5x {
+  font-size: 5em;
+}
+.fa-fw {
+  width: 1.28571429em;
+  text-align: center;
+}
+.fa-ul {
+  padding-left: 0;
+  margin-left: 2.14285714em;
+  list-style-type: none;
+}
+.fa-ul > li {
+  position: relative;
+}
+.fa-li {
+  position: absolute;
+  left: -2.14285714em;
+  width: 2.14285714em;
+  top: 0.14285714em;
+  text-align: center;
+}
+.fa-li.fa-lg {
+  left: -1.85714286em;
+}
+.fa-border {
+  padding: .2em .25em .15em;
+  border: solid 0.08em #eeeeee;
+  border-radius: .1em;
+}
+.fa-pull-left {
+  float: left;
+}
+.fa-pull-right {
+  float: right;
+}
+.fa.fa-pull-left {
+  margin-right: .3em;
+}
+.fa.fa-pull-right {
+  margin-left: .3em;
+}
+/* Deprecated as of 4.4.0 */
+.pull-right {
+  float: right;
+}
+.pull-left {
+  float: left;
+}
+.fa.pull-left {
+  margin-right: .3em;
+}
+.fa.pull-right {
+  margin-left: .3em;
+}
+.fa-spin {
+  -webkit-animation: fa-spin 2s infinite linear;
+  animation: fa-spin 2s infinite linear;
+}
+.fa-pulse {
+  -webkit-animation: fa-spin 1s infinite steps(8);
+  animation: fa-spin 1s infinite steps(8);
+}
+@-webkit-keyframes fa-spin {
+  0% {
+    -webkit-transform: rotate(0deg);
+    transform: rotate(0deg);
+  }
+  100% {
+    -webkit-transform: rotate(359deg);
+    transform: rotate(359deg);
+  }
+}
+@keyframes fa-spin {
+  0% {
+    -webkit-transform: rotate(0deg);
+    transform: rotate(0deg);
+  }
+  100% {
+    -webkit-transform: rotate(359deg);
+    transform: rotate(359deg);
+  }
+}
+.fa-rotate-90 {
+  -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=1)";
+  -webkit-transform: rotate(90deg);
+  -ms-transform: rotate(90deg);
+  transform: rotate(90deg);
+}
+.fa-rotate-180 {
+  -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=2)";
+  -webkit-transform: rotate(180deg);
+  -ms-transform: rotate(180deg);
+  transform: rotate(180deg);
+}
+.fa-rotate-270 {
+  -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=3)";
+  -webkit-transform: rotate(270deg);
+  -ms-transform: rotate(270deg);
+  transform: rotate(270deg);
+}
+.fa-flip-horizontal {
+  -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)";
+  -webkit-transform: scale(-1, 1);
+  -ms-transform: scale(-1, 1);
+  transform: scale(-1, 1);
+}
+.fa-flip-vertical {
+  -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)";
+  -webkit-transform: scale(1, -1);
+  -ms-transform: scale(1, -1);
+  transform: scale(1, -1);
+}
+:root .fa-rotate-90,
+:root .fa-rotate-180,
+:root .fa-rotate-270,
+:root .fa-flip-horizontal,
+:root .fa-flip-vertical {
+  filter: none;
+}
+.fa-stack {
+  position: relative;
+  display: inline-block;
+  width: 2em;
+  height: 2em;
+  line-height: 2em;
+  vertical-align: middle;
+}
+.fa-stack-1x,
+.fa-stack-2x {
+  position: absolute;
+  left: 0;
+  width: 100%;
+  text-align: center;
+}
+.fa-stack-1x {
+  line-height: inherit;
+}
+.fa-stack-2x {
+  font-size: 2em;
+}
+.fa-inverse {
+  color: #ffffff;
+}
+/* Font Awesome uses the Unicode Private Use Area (PUA) to ensure screen
+   readers do not read off random characters that represent icons */
+.fa-glass:before {
+  content: "\f000";
+}
+.fa-music:before {
+  content: "\f001";
+}
+.fa-search:before {
+  content: "\f002";
+}
+.fa-envelope-o:before {
+  content: "\f003";
+}
+.fa-heart:before {
+  content: "\f004";
+}
+.fa-star:before {
+  content: "\f005";
+}
+.fa-star-o:before {
+  content: "\f006";
+}
+.fa-user:before {
+  content: "\f007";
+}
+.fa-film:before {
+  content: "\f008";
+}
+.fa-th-large:before {
+  content: "\f009";
+}
+.fa-th:before {
+  content: "\f00a";
+}
+.fa-th-list:before {
+  content: "\f00b";
+}
+.fa-check:before {
+  content: "\f00c";
+}
+.fa-remove:before,
+.fa-close:before,
+.fa-times:before {
+  content: "\f00d";
+}
+.fa-search-plus:before {
+  content: "\f00e";
+}
+.fa-search-minus:before {
+  content: "\f010";
+}
+.fa-power-off:before {
+  content: "\f011";
+}
+.fa-signal:before {
+  content: "\f012";
+}
+.fa-gear:before,
+.fa-cog:before {
+  content: "\f013";
+}
+.fa-trash-o:before {
+  content: "\f014";
+}
+.fa-home:before {
+  content: "\f015";
+}
+.fa-file-o:before {
+  content: "\f016";
+}
+.fa-clock-o:before {
+  content: "\f017";
+}
+.fa-road:before {
+  content: "\f018";
+}
+.fa-download:before {
+  content: "\f019";
+}
+.fa-arrow-circle-o-down:before {
+  content: "\f01a";
+}
+.fa-arrow-circle-o-up:before {
+  content: "\f01b";
+}
+.fa-inbox:before {
+  content: "\f01c";
+}
+.fa-play-circle-o:before {
+  content: "\f01d";
+}
+.fa-rotate-right:before,
+.fa-repeat:before {
+  content: "\f01e";
+}
+.fa-refresh:before {
+  content: "\f021";
+}
+.fa-list-alt:before {
+  content: "\f022";
+}
+.fa-lock:before {
+  content: "\f023";
+}
+.fa-flag:before {
+  content: "\f024";
+}
+.fa-headphones:before {
+  content: "\f025";
+}
+.fa-volume-off:before {
+  content: "\f026";
+}
+.fa-volume-down:before {
+  content: "\f027";
+}
+.fa-volume-up:before {
+  content: "\f028";
+}
+.fa-qrcode:before {
+  content: "\f029";
+}
+.fa-barcode:before {
+  content: "\f02a";
+}
+.fa-tag:before {
+  content: "\f02b";
+}
+.fa-tags:before {
+  content: "\f02c";
+}
+.fa-book:before {
+  content: "\f02d";
+}
+.fa-bookmark:before {
+  content: "\f02e";
+}
+.fa-print:before {
+  content: "\f02f";
+}
+.fa-camera:before {
+  content: "\f030";
+}
+.fa-font:before {
+  content: "\f031";
+}
+.fa-bold:before {
+  content: "\f032";
+}
+.fa-italic:before {
+  content: "\f033";
+}
+.fa-text-height:before {
+  content: "\f034";
+}
+.fa-text-width:before {
+  content: "\f035";
+}
+.fa-align-left:before {
+  content: "\f036";
+}
+.fa-align-center:before {
+  content: "\f037";
+}
+.fa-align-right:before {
+  content: "\f038";
+}
+.fa-align-justify:before {
+  content: "\f039";
+}
+.fa-list:before {
+  content: "\f03a";
+}
+.fa-dedent:before,
+.fa-outdent:before {
+  content: "\f03b";
+}
+.fa-indent:before {
+  content: "\f03c";
+}
+.fa-video-camera:before {
+  content: "\f03d";
+}
+.fa-photo:before,
+.fa-image:before,
+.fa-picture-o:before {
+  content: "\f03e";
+}
+.fa-pencil:before {
+  content: "\f040";
+}
+.fa-map-marker:before {
+  content: "\f041";
+}
+.fa-adjust:before {
+  content: "\f042";
+}
+.fa-tint:before {
+  content: "\f043";
+}
+.fa-edit:before,
+.fa-pencil-square-o:before {
+  content: "\f044";
+}
+.fa-share-square-o:before {
+  content: "\f045";
+}
+.fa-check-square-o:before {
+  content: "\f046";
+}
+.fa-arrows:before {
+  content: "\f047";
+}
+.fa-step-backward:before {
+  content: "\f048";
+}
+.fa-fast-backward:before {
+  content: "\f049";
+}
+.fa-backward:before {
+  content: "\f04a";
+}
+.fa-play:before {
+  content: "\f04b";
+}
+.fa-pause:before {
+  content: "\f04c";
+}
+.fa-stop:before {
+  content: "\f04d";
+}
+.fa-forward:before {
+  content: "\f04e";
+}
+.fa-fast-forward:before {
+  content: "\f050";
+}
+.fa-step-forward:before {
+  content: "\f051";
+}
+.fa-eject:before {
+  content: "\f052";
+}
+.fa-chevron-left:before {
+  content: "\f053";
+}
+.fa-chevron-right:before {
+  content: "\f054";
+}
+.fa-plus-circle:before {
+  content: "\f055";
+}
+.fa-minus-circle:before {
+  content: "\f056";
+}
+.fa-times-circle:before {
+  content: "\f057";
+}
+.fa-check-circle:before {
+  content: "\f058";
+}
+.fa-question-circle:before {
+  content: "\f059";
+}
+.fa-info-circle:before {
+  content: "\f05a";
+}
+.fa-crosshairs:before {
+  content: "\f05b";
+}
+.fa-times-circle-o:before {
+  content: "\f05c";
+}
+.fa-check-circle-o:before {
+  content: "\f05d";
+}
+.fa-ban:before {
+  content: "\f05e";
+}
+.fa-arrow-left:before {
+  content: "\f060";
+}
+.fa-arrow-right:before {
+  content: "\f061";
+}
+.fa-arrow-up:before {
+  content: "\f062";
+}
+.fa-arrow-down:before {
+  content: "\f063";
+}
+.fa-mail-forward:before,
+.fa-share:before {
+  content: "\f064";
+}
+.fa-expand:before {
+  content: "\f065";
+}
+.fa-compress:before {
+  content: "\f066";
+}
+.fa-plus:before {
+  content: "\f067";
+}
+.fa-minus:before {
+  content: "\f068";
+}
+.fa-asterisk:before {
+  content: "\f069";
+}
+.fa-exclamation-circle:before {
+  content: "\f06a";
+}
+.fa-gift:before {
+  content: "\f06b";
+}
+.fa-leaf:before {
+  content: "\f06c";
+}
+.fa-fire:before {
+  content: "\f06d";
+}
+.fa-eye:before {
+  content: "\f06e";
+}
+.fa-eye-slash:before {
+  content: "\f070";
+}
+.fa-warning:before,
+.fa-exclamation-triangle:before {
+  content: "\f071";
+}
+.fa-plane:before {
+  content: "\f072";
+}
+.fa-calendar:before {
+  content: "\f073";
+}
+.fa-random:before {
+  content: "\f074";
+}
+.fa-comment:before {
+  content: "\f075";
+}
+.fa-magnet:before {
+  content: "\f076";
+}
+.fa-chevron-up:before {
+  content: "\f077";
+}
+.fa-chevron-down:before {
+  content: "\f078";
+}
+.fa-retweet:before {
+  content: "\f079";
+}
+.fa-shopping-cart:before {
+  content: "\f07a";
+}
+.fa-folder:before {
+  content: "\f07b";
+}
+.fa-folder-open:before {
+  content: "\f07c";
+}
+.fa-arrows-v:before {
+  content: "\f07d";
+}
+.fa-arrows-h:before {
+  content: "\f07e";
+}
+.fa-bar-chart-o:before,
+.fa-bar-chart:before {
+  content: "\f080";
+}
+.fa-twitter-square:before {
+  content: "\f081";
+}
+.fa-facebook-square:before {
+  content: "\f082";
+}
+.fa-camera-retro:before {
+  content: "\f083";
+}
+.fa-key:before {
+  content: "\f084";
+}
+.fa-gears:before,
+.fa-cogs:before {
+  content: "\f085";
+}
+.fa-comments:before {
+  content: "\f086";
+}
+.fa-thumbs-o-up:before {
+  content: "\f087";
+}
+.fa-thumbs-o-down:before {
+  content: "\f088";
+}
+.fa-star-half:before {
+  content: "\f089";
+}
+.fa-heart-o:before {
+  content: "\f08a";
+}
+.fa-sign-out:before {
+  content: "\f08b";
+}
+.fa-linkedin-square:before {
+  content: "\f08c";
+}
+.fa-thumb-tack:before {
+  content: "\f08d";
+}
+.fa-external-link:before {
+  content: "\f08e";
+}
+.fa-sign-in:before {
+  content: "\f090";
+}
+.fa-trophy:before {
+  content: "\f091";
+}
+.fa-github-square:before {
+  content: "\f092";
+}
+.fa-upload:before {
+  content: "\f093";
+}
+.fa-lemon-o:before {
+  content: "\f094";
+}
+.fa-phone:before {
+  content: "\f095";
+}
+.fa-square-o:before {
+  content: "\f096";
+}
+.fa-bookmark-o:before {
+  content: "\f097";
+}
+.fa-phone-square:before {
+  content: "\f098";
+}
+.fa-twitter:before {
+  content: "\f099";
+}
+.fa-facebook-f:before,
+.fa-facebook:before {
+  content: "\f09a";
+}
+.fa-github:before {
+  content: "\f09b";
+}
+.fa-unlock:before {
+  content: "\f09c";
+}
+.fa-credit-card:before {
+  content: "\f09d";
+}
+.fa-feed:before,
+.fa-rss:before {
+  content: "\f09e";
+}
+.fa-hdd-o:before {
+  content: "\f0a0";
+}
+.fa-bullhorn:before {
+  content: "\f0a1";
+}
+.fa-bell:before {
+  content: "\f0f3";
+}
+.fa-certificate:before {
+  content: "\f0a3";
+}
+.fa-hand-o-right:before {
+  content: "\f0a4";
+}
+.fa-hand-o-left:before {
+  content: "\f0a5";
+}
+.fa-hand-o-up:before {
+  content: "\f0a6";
+}
+.fa-hand-o-down:before {
+  content: "\f0a7";
+}
+.fa-arrow-circle-left:before {
+  content: "\f0a8";
+}
+.fa-arrow-circle-right:before {
+  content: "\f0a9";
+}
+.fa-arrow-circle-up:before {
+  content: "\f0aa";
+}
+.fa-arrow-circle-down:before {
+  content: "\f0ab";
+}
+.fa-globe:before {
+  content: "\f0ac";
+}
+.fa-wrench:before {
+  content: "\f0ad";
+}
+.fa-tasks:before {
+  content: "\f0ae";
+}
+.fa-filter:before {
+  content: "\f0b0";
+}
+.fa-briefcase:before {
+  content: "\f0b1";
+}
+.fa-arrows-alt:before {
+  content: "\f0b2";
+}
+.fa-group:before,
+.fa-users:before {
+  content: "\f0c0";
+}
+.fa-chain:before,
+.fa-link:before {
+  content: "\f0c1";
+}
+.fa-cloud:before {
+  content: "\f0c2";
+}
+.fa-flask:before {
+  content: "\f0c3";
+}
+.fa-cut:before,
+.fa-scissors:before {
+  content: "\f0c4";
+}
+.fa-copy:before,
+.fa-files-o:before {
+  content: "\f0c5";
+}
+.fa-paperclip:before {
+  content: "\f0c6";
+}
+.fa-save:before,
+.fa-floppy-o:before {
+  content: "\f0c7";
+}
+.fa-square:before {
+  content: "\f0c8";
+}
+.fa-navicon:before,
+.fa-reorder:before,
+.fa-bars:before {
+  content: "\f0c9";
+}
+.fa-list-ul:before {
+  content: "\f0ca";
+}
+.fa-list-ol:before {
+  content: "\f0cb";
+}
+.fa-strikethrough:before {
+  content: "\f0cc";
+}
+.fa-underline:before {
+  content: "\f0cd";
+}
+.fa-table:before {
+  content: "\f0ce";
+}
+.fa-magic:before {
+  content: "\f0d0";
+}
+.fa-truck:before {
+  content: "\f0d1";
+}
+.fa-pinterest:before {
+  content: "\f0d2";
+}
+.fa-pinterest-square:before {
+  content: "\f0d3";
+}
+.fa-google-plus-square:before {
+  content: "\f0d4";
+}
+.fa-google-plus:before {
+  content: "\f0d5";
+}
+.fa-money:before {
+  content: "\f0d6";
+}
+.fa-caret-down:before {
+  content: "\f0d7";
+}
+.fa-caret-up:before {
+  content: "\f0d8";
+}
+.fa-caret-left:before {
+  content: "\f0d9";
+}
+.fa-caret-right:before {
+  content: "\f0da";
+}
+.fa-columns:before {
+  content: "\f0db";
+}
+.fa-unsorted:before,
+.fa-sort:before {
+  content: "\f0dc";
+}
+.fa-sort-down:before,
+.fa-sort-desc:before {
+  content: "\f0dd";
+}
+.fa-sort-up:before,
+.fa-sort-asc:before {
+  content: "\f0de";
+}
+.fa-envelope:before {
+  content: "\f0e0";
+}
+.fa-linkedin:before {
+  content: "\f0e1";
+}
+.fa-rotate-left:before,
+.fa-undo:before {
+  content: "\f0e2";
+}
+.fa-legal:before,
+.fa-gavel:before {
+  content: "\f0e3";
+}
+.fa-dashboard:before,
+.fa-tachometer:before {
+  content: "\f0e4";
+}
+.fa-comment-o:before {
+  content: "\f0e5";
+}
+.fa-comments-o:before {
+  content: "\f0e6";
+}
+.fa-flash:before,
+.fa-bolt:before {
+  content: "\f0e7";
+}
+.fa-sitemap:before {
+  content: "\f0e8";
+}
+.fa-umbrella:before {
+  content: "\f0e9";
+}
+.fa-paste:before,
+.fa-clipboard:before {
+  content: "\f0ea";
+}
+.fa-lightbulb-o:before {
+  content: "\f0eb";
+}
+.fa-exchange:before {
+  content: "\f0ec";
+}
+.fa-cloud-download:before {
+  content: "\f0ed";
+}
+.fa-cloud-upload:before {
+  content: "\f0ee";
+}
+.fa-user-md:before {
+  content: "\f0f0";
+}
+.fa-stethoscope:before {
+  content: "\f0f1";
+}
+.fa-suitcase:before {
+  content: "\f0f2";
+}
+.fa-bell-o:before {
+  content: "\f0a2";
+}
+.fa-coffee:before {
+  content: "\f0f4";
+}
+.fa-cutlery:before {
+  content: "\f0f5";
+}
+.fa-file-text-o:before {
+  content: "\f0f6";
+}
+.fa-building-o:before {
+  content: "\f0f7";
+}
+.fa-hospital-o:before {
+  content: "\f0f8";
+}
+.fa-ambulance:before {
+  content: "\f0f9";
+}
+.fa-medkit:before {
+  content: "\f0fa";
+}
+.fa-fighter-jet:before {
+  content: "\f0fb";
+}
+.fa-beer:before {
+  content: "\f0fc";
+}
+.fa-h-square:before {
+  content: "\f0fd";
+}
+.fa-plus-square:before {
+  content: "\f0fe";
+}
+.fa-angle-double-left:before {
+  content: "\f100";
+}
+.fa-angle-double-right:before {
+  content: "\f101";
+}
+.fa-angle-double-up:before {
+  content: "\f102";
+}
+.fa-angle-double-down:before {
+  content: "\f103";
+}
+.fa-angle-left:before {
+  content: "\f104";
+}
+.fa-angle-right:before {
+  content: "\f105";
+}
+.fa-angle-up:before {
+  content: "\f106";
+}
+.fa-angle-down:before {
+  content: "\f107";
+}
+.fa-desktop:before {
+  content: "\f108";
+}
+.fa-laptop:before {
+  content: "\f109";
+}
+.fa-tablet:before {
+  content: "\f10a";
+}
+.fa-mobile-phone:before,
+.fa-mobile:before {
+  content: "\f10b";
+}
+.fa-circle-o:before {
+  content: "\f10c";
+}
+.fa-quote-left:before {
+  content: "\f10d";
+}
+.fa-quote-right:before {
+  content: "\f10e";
+}
+.fa-spinner:before {
+  content: "\f110";
+}
+.fa-circle:before {
+  content: "\f111";
+}
+.fa-mail-reply:before,
+.fa-reply:before {
+  content: "\f112";
+}
+.fa-github-alt:before {
+  content: "\f113";
+}
+.fa-folder-o:before {
+  content: "\f114";
+}
+.fa-folder-open-o:before {
+  content: "\f115";
+}
+.fa-smile-o:before {
+  content: "\f118";
+}
+.fa-frown-o:before {
+  content: "\f119";
+}
+.fa-meh-o:before {
+  content: "\f11a";
+}
+.fa-gamepad:before {
+  content: "\f11b";
+}
+.fa-keyboard-o:before {
+  content: "\f11c";
+}
+.fa-flag-o:before {
+  content: "\f11d";
+}
+.fa-flag-checkered:before {
+  content: "\f11e";
+}
+.fa-terminal:before {
+  content: "\f120";
+}
+.fa-code:before {
+  content: "\f121";
+}
+.fa-mail-reply-all:before,
+.fa-reply-all:before {
+  content: "\f122";
+}
+.fa-star-half-empty:before,
+.fa-star-half-full:before,
+.fa-star-half-o:before {
+  content: "\f123";
+}
+.fa-location-arrow:before {
+  content: "\f124";
+}
+.fa-crop:before {
+  content: "\f125";
+}
+.fa-code-fork:before {
+  content: "\f126";
+}
+.fa-unlink:before,
+.fa-chain-broken:before {
+  content: "\f127";
+}
+.fa-question:before {
+  content: "\f128";
+}
+.fa-info:before {
+  content: "\f129";
+}
+.fa-exclamation:before {
+  content: "\f12a";
+}
+.fa-superscript:before {
+  content: "\f12b";
+}
+.fa-subscript:before {
+  content: "\f12c";
+}
+.fa-eraser:before {
+  content: "\f12d";
+}
+.fa-puzzle-piece:before {
+  content: "\f12e";
+}
+.fa-microphone:before {
+  content: "\f130";
+}
+.fa-microphone-slash:before {
+  content: "\f131";
+}
+.fa-shield:before {
+  content: "\f132";
+}
+.fa-calendar-o:before {
+  content: "\f133";
+}
+.fa-fire-extinguisher:before {
+  content: "\f134";
+}
+.fa-rocket:before {
+  content: "\f135";
+}
+.fa-maxcdn:before {
+  content: "\f136";
+}
+.fa-chevron-circle-left:before {
+  content: "\f137";
+}
+.fa-chevron-circle-right:before {
+  content: "\f138";
+}
+.fa-chevron-circle-up:before {
+  content: "\f139";
+}
+.fa-chevron-circle-down:before {
+  content: "\f13a";
+}
+.fa-html5:before {
+  content: "\f13b";
+}
+.fa-css3:before {
+  content: "\f13c";
+}
+.fa-anchor:before {
+  content: "\f13d";
+}
+.fa-unlock-alt:before {
+  content: "\f13e";
+}
+.fa-bullseye:before {
+  content: "\f140";
+}
+.fa-ellipsis-h:before {
+  content: "\f141";
+}
+.fa-ellipsis-v:before {
+  content: "\f142";
+}
+.fa-rss-square:before {
+  content: "\f143";
+}
+.fa-play-circle:before {
+  content: "\f144";
+}
+.fa-ticket:before {
+  content: "\f145";
+}
+.fa-minus-square:before {
+  content: "\f146";
+}
+.fa-minus-square-o:before {
+  content: "\f147";
+}
+.fa-level-up:before {
+  content: "\f148";
+}
+.fa-level-down:before {
+  content: "\f149";
+}
+.fa-check-square:before {
+  content: "\f14a";
+}
+.fa-pencil-square:before {
+  content: "\f14b";
+}
+.fa-external-link-square:before {
+  content: "\f14c";
+}
+.fa-share-square:before {
+  content: "\f14d";
+}
+.fa-compass:before {
+  content: "\f14e";
+}
+.fa-toggle-down:before,
+.fa-caret-square-o-down:before {
+  content: "\f150";
+}
+.fa-toggle-up:before,
+.fa-caret-square-o-up:before {
+  content: "\f151";
+}
+.fa-toggle-right:before,
+.fa-caret-square-o-right:before {
+  content: "\f152";
+}
+.fa-euro:before,
+.fa-eur:before {
+  content: "\f153";
+}
+.fa-gbp:before {
+  content: "\f154";
+}
+.fa-dollar:before,
+.fa-usd:before {
+  content: "\f155";
+}
+.fa-rupee:before,
+.fa-inr:before {
+  content: "\f156";
+}
+.fa-cny:before,
+.fa-rmb:before,
+.fa-yen:before,
+.fa-jpy:before {
+  content: "\f157";
+}
+.fa-ruble:before,
+.fa-rouble:before,
+.fa-rub:before {
+  content: "\f158";
+}
+.fa-won:before,
+.fa-krw:before {
+  content: "\f159";
+}
+.fa-bitcoin:before,
+.fa-btc:before {
+  content: "\f15a";
+}
+.fa-file:before {
+  content: "\f15b";
+}
+.fa-file-text:before {
+  content: "\f15c";
+}
+.fa-sort-alpha-asc:before {
+  content: "\f15d";
+}
+.fa-sort-alpha-desc:before {
+  content: "\f15e";
+}
+.fa-sort-amount-asc:before {
+  content: "\f160";
+}
+.fa-sort-amount-desc:before {
+  content: "\f161";
+}
+.fa-sort-numeric-asc:before {
+  content: "\f162";
+}
+.fa-sort-numeric-desc:before {
+  content: "\f163";
+}
+.fa-thumbs-up:before {
+  content: "\f164";
+}
+.fa-thumbs-down:before {
+  content: "\f165";
+}
+.fa-youtube-square:before {
+  content: "\f166";
+}
+.fa-youtube:before {
+  content: "\f167";
+}
+.fa-xing:before {
+  content: "\f168";
+}
+.fa-xing-square:before {
+  content: "\f169";
+}
+.fa-youtube-play:before {
+  content: "\f16a";
+}
+.fa-dropbox:before {
+  content: "\f16b";
+}
+.fa-stack-overflow:before {
+  content: "\f16c";
+}
+.fa-instagram:before {
+  content: "\f16d";
+}
+.fa-flickr:before {
+  content: "\f16e";
+}
+.fa-adn:before {
+  content: "\f170";
+}
+.fa-bitbucket:before {
+  content: "\f171";
+}
+.fa-bitbucket-square:before {
+  content: "\f172";
+}
+.fa-tumblr:before {
+  content: "\f173";
+}
+.fa-tumblr-square:before {
+  content: "\f174";
+}
+.fa-long-arrow-down:before {
+  content: "\f175";
+}
+.fa-long-arrow-up:before {
+  content: "\f176";
+}
+.fa-long-arrow-left:before {
+  content: "\f177";
+}
+.fa-long-arrow-right:before {
+  content: "\f178";
+}
+.fa-apple:before {
+  content: "\f179";
+}
+.fa-windows:before {
+  content: "\f17a";
+}
+.fa-android:before {
+  content: "\f17b";
+}
+.fa-linux:before {
+  content: "\f17c";
+}
+.fa-dribbble:before {
+  content: "\f17d";
+}
+.fa-skype:before {
+  content: "\f17e";
+}
+.fa-foursquare:before {
+  content: "\f180";
+}
+.fa-trello:before {
+  content: "\f181";
+}
+.fa-female:before {
+  content: "\f182";
+}
+.fa-male:before {
+  content: "\f183";
+}
+.fa-gittip:before,
+.fa-gratipay:before {
+  content: "\f184";
+}
+.fa-sun-o:before {
+  content: "\f185";
+}
+.fa-moon-o:before {
+  content: "\f186";
+}
+.fa-archive:before {
+  content: "\f187";
+}
+.fa-bug:before {
+  content: "\f188";
+}
+.fa-vk:before {
+  content: "\f189";
+}
+.fa-weibo:before {
+  content: "\f18a";
+}
+.fa-renren:before {
+  content: "\f18b";
+}
+.fa-pagelines:before {
+  content: "\f18c";
+}
+.fa-stack-exchange:before {
+  content: "\f18d";
+}
+.fa-arrow-circle-o-right:before {
+  content: "\f18e";
+}
+.fa-arrow-circle-o-left:before {
+  content: "\f190";
+}
+.fa-toggle-left:before,
+.fa-caret-square-o-left:before {
+  content: "\f191";
+}
+.fa-dot-circle-o:before {
+  content: "\f192";
+}
+.fa-wheelchair:before {
+  content: "\f193";
+}
+.fa-vimeo-square:before {
+  content: "\f194";
+}
+.fa-turkish-lira:before,
+.fa-try:before {
+  content: "\f195";
+}
+.fa-plus-square-o:before {
+  content: "\f196";
+}
+.fa-space-shuttle:before {
+  content: "\f197";
+}
+.fa-slack:before {
+  content: "\f198";
+}
+.fa-envelope-square:before {
+  content: "\f199";
+}
+.fa-wordpress:before {
+  content: "\f19a";
+}
+.fa-openid:before {
+  content: "\f19b";
+}
+.fa-institution:before,
+.fa-bank:before,
+.fa-university:before {
+  content: "\f19c";
+}
+.fa-mortar-board:before,
+.fa-graduation-cap:before {
+  content: "\f19d";
+}
+.fa-yahoo:before {
+  content: "\f19e";
+}
+.fa-google:before {
+  content: "\f1a0";
+}
+.fa-reddit:before {
+  content: "\f1a1";
+}
+.fa-reddit-square:before {
+  content: "\f1a2";
+}
+.fa-stumbleupon-circle:before {
+  content: "\f1a3";
+}
+.fa-stumbleupon:before {
+  content: "\f1a4";
+}
+.fa-delicious:before {
+  content: "\f1a5";
+}
+.fa-digg:before {
+  content: "\f1a6";
+}
+.fa-pied-piper-pp:before {
+  content: "\f1a7";
+}
+.fa-pied-piper-alt:before {
+  content: "\f1a8";
+}
+.fa-drupal:before {
+  content: "\f1a9";
+}
+.fa-joomla:before {
+  content: "\f1aa";
+}
+.fa-language:before {
+  content: "\f1ab";
+}
+.fa-fax:before {
+  content: "\f1ac";
+}
+.fa-building:before {
+  content: "\f1ad";
+}
+.fa-child:before {
+  content: "\f1ae";
+}
+.fa-paw:before {
+  content: "\f1b0";
+}
+.fa-spoon:before {
+  content: "\f1b1";
+}
+.fa-cube:before {
+  content: "\f1b2";
+}
+.fa-cubes:before {
+  content: "\f1b3";
+}
+.fa-behance:before {
+  content: "\f1b4";
+}
+.fa-behance-square:before {
+  content: "\f1b5";
+}
+.fa-steam:before {
+  content: "\f1b6";
+}
+.fa-steam-square:before {
+  content: "\f1b7";
+}
+.fa-recycle:before {
+  content: "\f1b8";
+}
+.fa-automobile:before,
+.fa-car:before {
+  content: "\f1b9";
+}
+.fa-cab:before,
+.fa-taxi:before {
+  content: "\f1ba";
+}
+.fa-tree:before {
+  content: "\f1bb";
+}
+.fa-spotify:before {
+  content: "\f1bc";
+}
+.fa-deviantart:before {
+  content: "\f1bd";
+}
+.fa-soundcloud:before {
+  content: "\f1be";
+}
+.fa-database:before {
+  content: "\f1c0";
+}
+.fa-file-pdf-o:before {
+  content: "\f1c1";
+}
+.fa-file-word-o:before {
+  content: "\f1c2";
+}
+.fa-file-excel-o:before {
+  content: "\f1c3";
+}
+.fa-file-powerpoint-o:before {
+  content: "\f1c4";
+}
+.fa-file-photo-o:before,
+.fa-file-picture-o:before,
+.fa-file-image-o:before {
+  content: "\f1c5";
+}
+.fa-file-zip-o:before,
+.fa-file-archive-o:before {
+  content: "\f1c6";
+}
+.fa-file-sound-o:before,
+.fa-file-audio-o:before {
+  content: "\f1c7";
+}
+.fa-file-movie-o:before,
+.fa-file-video-o:before {
+  content: "\f1c8";
+}
+.fa-file-code-o:before {
+  content: "\f1c9";
+}
+.fa-vine:before {
+  content: "\f1ca";
+}
+.fa-codepen:before {
+  content: "\f1cb";
+}
+.fa-jsfiddle:before {
+  content: "\f1cc";
+}
+.fa-life-bouy:before,
+.fa-life-buoy:before,
+.fa-life-saver:before,
+.fa-support:before,
+.fa-life-ring:before {
+  content: "\f1cd";
+}
+.fa-circle-o-notch:before {
+  content: "\f1ce";
+}
+.fa-ra:before,
+.fa-resistance:before,
+.fa-rebel:before {
+  content: "\f1d0";
+}
+.fa-ge:before,
+.fa-empire:before {
+  content: "\f1d1";
+}
+.fa-git-square:before {
+  content: "\f1d2";
+}
+.fa-git:before {
+  content: "\f1d3";
+}
+.fa-y-combinator-square:before,
+.fa-yc-square:before,
+.fa-hacker-news:before {
+  content: "\f1d4";
+}
+.fa-tencent-weibo:before {
+  content: "\f1d5";
+}
+.fa-qq:before {
+  content: "\f1d6";
+}
+.fa-wechat:before,
+.fa-weixin:before {
+  content: "\f1d7";
+}
+.fa-send:before,
+.fa-paper-plane:before {
+  content: "\f1d8";
+}
+.fa-send-o:before,
+.fa-paper-plane-o:before {
+  content: "\f1d9";
+}
+.fa-history:before {
+  content: "\f1da";
+}
+.fa-circle-thin:before {
+  content: "\f1db";
+}
+.fa-header:before {
+  content: "\f1dc";
+}
+.fa-paragraph:before {
+  content: "\f1dd";
+}
+.fa-sliders:before {
+  content: "\f1de";
+}
+.fa-share-alt:before {
+  content: "\f1e0";
+}
+.fa-share-alt-square:before {
+  content: "\f1e1";
+}
+.fa-bomb:before {
+  content: "\f1e2";
+}
+.fa-soccer-ball-o:before,
+.fa-futbol-o:before {
+  content: "\f1e3";
+}
+.fa-tty:before {
+  content: "\f1e4";
+}
+.fa-binoculars:before {
+  content: "\f1e5";
+}
+.fa-plug:before {
+  content: "\f1e6";
+}
+.fa-slideshare:before {
+  content: "\f1e7";
+}
+.fa-twitch:before {
+  content: "\f1e8";
+}
+.fa-yelp:before {
+  content: "\f1e9";
+}
+.fa-newspaper-o:before {
+  content: "\f1ea";
+}
+.fa-wifi:before {
+  content: "\f1eb";
+}
+.fa-calculator:before {
+  content: "\f1ec";
+}
+.fa-paypal:before {
+  content: "\f1ed";
+}
+.fa-google-wallet:before {
+  content: "\f1ee";
+}
+.fa-cc-visa:before {
+  content: "\f1f0";
+}
+.fa-cc-mastercard:before {
+  content: "\f1f1";
+}
+.fa-cc-discover:before {
+  content: "\f1f2";
+}
+.fa-cc-amex:before {
+  content: "\f1f3";
+}
+.fa-cc-paypal:before {
+  content: "\f1f4";
+}
+.fa-cc-stripe:before {
+  content: "\f1f5";
+}
+.fa-bell-slash:before {
+  content: "\f1f6";
+}
+.fa-bell-slash-o:before {
+  content: "\f1f7";
+}
+.fa-trash:before {
+  content: "\f1f8";
+}
+.fa-copyright:before {
+  content: "\f1f9";
+}
+.fa-at:before {
+  content: "\f1fa";
+}
+.fa-eyedropper:before {
+  content: "\f1fb";
+}
+.fa-paint-brush:before {
+  content: "\f1fc";
+}
+.fa-birthday-cake:before {
+  content: "\f1fd";
+}
+.fa-area-chart:before {
+  content: "\f1fe";
+}
+.fa-pie-chart:before {
+  content: "\f200";
+}
+.fa-line-chart:before {
+  content: "\f201";
+}
+.fa-lastfm:before {
+  content: "\f202";
+}
+.fa-lastfm-square:before {
+  content: "\f203";
+}
+.fa-toggle-off:before {
+  content: "\f204";
+}
+.fa-toggle-on:before {
+  content: "\f205";
+}
+.fa-bicycle:before {
+  content: "\f206";
+}
+.fa-bus:before {
+  content: "\f207";
+}
+.fa-ioxhost:before {
+  content: "\f208";
+}
+.fa-angellist:before {
+  content: "\f209";
+}
+.fa-cc:before {
+  content: "\f20a";
+}
+.fa-shekel:before,
+.fa-sheqel:before,
+.fa-ils:before {
+  content: "\f20b";
+}
+.fa-meanpath:before {
+  content: "\f20c";
+}
+.fa-buysellads:before {
+  content: "\f20d";
+}
+.fa-connectdevelop:before {
+  content: "\f20e";
+}
+.fa-dashcube:before {
+  content: "\f210";
+}
+.fa-forumbee:before {
+  content: "\f211";
+}
+.fa-leanpub:before {
+  content: "\f212";
+}
+.fa-sellsy:before {
+  content: "\f213";
+}
+.fa-shirtsinbulk:before {
+  content: "\f214";
+}
+.fa-simplybuilt:before {
+  content: "\f215";
+}
+.fa-skyatlas:before {
+  content: "\f216";
+}
+.fa-cart-plus:before {
+  content: "\f217";
+}
+.fa-cart-arrow-down:before {
+  content: "\f218";
+}
+.fa-diamond:before {
+  content: "\f219";
+}
+.fa-ship:before {
+  content: "\f21a";
+}
+.fa-user-secret:before {
+  content: "\f21b";
+}
+.fa-motorcycle:before {
+  content: "\f21c";
+}
+.fa-street-view:before {
+  content: "\f21d";
+}
+.fa-heartbeat:before {
+  content: "\f21e";
+}
+.fa-venus:before {
+  content: "\f221";
+}
+.fa-mars:before {
+  content: "\f222";
+}
+.fa-mercury:before {
+  content: "\f223";
+}
+.fa-intersex:before,
+.fa-transgender:before {
+  content: "\f224";
+}
+.fa-transgender-alt:before {
+  content: "\f225";
+}
+.fa-venus-double:before {
+  content: "\f226";
+}
+.fa-mars-double:before {
+  content: "\f227";
+}
+.fa-venus-mars:before {
+  content: "\f228";
+}
+.fa-mars-stroke:before {
+  content: "\f229";
+}
+.fa-mars-stroke-v:before {
+  content: "\f22a";
+}
+.fa-mars-stroke-h:before {
+  content: "\f22b";
+}
+.fa-neuter:before {
+  content: "\f22c";
+}
+.fa-genderless:before {
+  content: "\f22d";
+}
+.fa-facebook-official:before {
+  content: "\f230";
+}
+.fa-pinterest-p:before {
+  content: "\f231";
+}
+.fa-whatsapp:before {
+  content: "\f232";
+}
+.fa-server:before {
+  content: "\f233";
+}
+.fa-user-plus:before {
+  content: "\f234";
+}
+.fa-user-times:before {
+  content: "\f235";
+}
+.fa-hotel:before,
+.fa-bed:before {
+  content: "\f236";
+}
+.fa-viacoin:before {
+  content: "\f237";
+}
+.fa-train:before {
+  content: "\f238";
+}
+.fa-subway:before {
+  content: "\f239";
+}
+.fa-medium:before {
+  content: "\f23a";
+}
+.fa-yc:before,
+.fa-y-combinator:before {
+  content: "\f23b";
+}
+.fa-optin-monster:before {
+  content: "\f23c";
+}
+.fa-opencart:before {
+  content: "\f23d";
+}
+.fa-expeditedssl:before {
+  content: "\f23e";
+}
+.fa-battery-4:before,
+.fa-battery:before,
+.fa-battery-full:before {
+  content: "\f240";
+}
+.fa-battery-3:before,
+.fa-battery-three-quarters:before {
+  content: "\f241";
+}
+.fa-battery-2:before,
+.fa-battery-half:before {
+  content: "\f242";
+}
+.fa-battery-1:before,
+.fa-battery-quarter:before {
+  content: "\f243";
+}
+.fa-battery-0:before,
+.fa-battery-empty:before {
+  content: "\f244";
+}
+.fa-mouse-pointer:before {
+  content: "\f245";
+}
+.fa-i-cursor:before {
+  content: "\f246";
+}
+.fa-object-group:before {
+  content: "\f247";
+}
+.fa-object-ungroup:before {
+  content: "\f248";
+}
+.fa-sticky-note:before {
+  content: "\f249";
+}
+.fa-sticky-note-o:before {
+  content: "\f24a";
+}
+.fa-cc-jcb:before {
+  content: "\f24b";
+}
+.fa-cc-diners-club:before {
+  content: "\f24c";
+}
+.fa-clone:before {
+  content: "\f24d";
+}
+.fa-balance-scale:before {
+  content: "\f24e";
+}
+.fa-hourglass-o:before {
+  content: "\f250";
+}
+.fa-hourglass-1:before,
+.fa-hourglass-start:before {
+  content: "\f251";
+}
+.fa-hourglass-2:before,
+.fa-hourglass-half:before {
+  content: "\f252";
+}
+.fa-hourglass-3:before,
+.fa-hourglass-end:before {
+  content: "\f253";
+}
+.fa-hourglass:before {
+  content: "\f254";
+}
+.fa-hand-grab-o:before,
+.fa-hand-rock-o:before {
+  content: "\f255";
+}
+.fa-hand-stop-o:before,
+.fa-hand-paper-o:before {
+  content: "\f256";
+}
+.fa-hand-scissors-o:before {
+  content: "\f257";
+}
+.fa-hand-lizard-o:before {
+  content: "\f258";
+}
+.fa-hand-spock-o:before {
+  content: "\f259";
+}
+.fa-hand-pointer-o:before {
+  content: "\f25a";
+}
+.fa-hand-peace-o:before {
+  content: "\f25b";
+}
+.fa-trademark:before {
+  content: "\f25c";
+}
+.fa-registered:before {
+  content: "\f25d";
+}
+.fa-creative-commons:before {
+  content: "\f25e";
+}
+.fa-gg:before {
+  content: "\f260";
+}
+.fa-gg-circle:before {
+  content: "\f261";
+}
+.fa-tripadvisor:before {
+  content: "\f262";
+}
+.fa-odnoklassniki:before {
+  content: "\f263";
+}
+.fa-odnoklassniki-square:before {
+  content: "\f264";
+}
+.fa-get-pocket:before {
+  content: "\f265";
+}
+.fa-wikipedia-w:before {
+  content: "\f266";
+}
+.fa-safari:before {
+  content: "\f267";
+}
+.fa-chrome:before {
+  content: "\f268";
+}
+.fa-firefox:before {
+  content: "\f269";
+}
+.fa-opera:before {
+  content: "\f26a";
+}
+.fa-internet-explorer:before {
+  content: "\f26b";
+}
+.fa-tv:before,
+.fa-television:before {
+  content: "\f26c";
+}
+.fa-contao:before {
+  content: "\f26d";
+}
+.fa-500px:before {
+  content: "\f26e";
+}
+.fa-amazon:before {
+  content: "\f270";
+}
+.fa-calendar-plus-o:before {
+  content: "\f271";
+}
+.fa-calendar-minus-o:before {
+  content: "\f272";
+}
+.fa-calendar-times-o:before {
+  content: "\f273";
+}
+.fa-calendar-check-o:before {
+  content: "\f274";
+}
+.fa-industry:before {
+  content: "\f275";
+}
+.fa-map-pin:before {
+  content: "\f276";
+}
+.fa-map-signs:before {
+  content: "\f277";
+}
+.fa-map-o:before {
+  content: "\f278";
+}
+.fa-map:before {
+  content: "\f279";
+}
+.fa-commenting:before {
+  content: "\f27a";
+}
+.fa-commenting-o:before {
+  content: "\f27b";
+}
+.fa-houzz:before {
+  content: "\f27c";
+}
+.fa-vimeo:before {
+  content: "\f27d";
+}
+.fa-black-tie:before {
+  content: "\f27e";
+}
+.fa-fonticons:before {
+  content: "\f280";
+}
+.fa-reddit-alien:before {
+  content: "\f281";
+}
+.fa-edge:before {
+  content: "\f282";
+}
+.fa-credit-card-alt:before {
+  content: "\f283";
+}
+.fa-codiepie:before {
+  content: "\f284";
+}
+.fa-modx:before {
+  content: "\f285";
+}
+.fa-fort-awesome:before {
+  content: "\f286";
+}
+.fa-usb:before {
+  content: "\f287";
+}
+.fa-product-hunt:before {
+  content: "\f288";
+}
+.fa-mixcloud:before {
+  content: "\f289";
+}
+.fa-scribd:before {
+  content: "\f28a";
+}
+.fa-pause-circle:before {
+  content: "\f28b";
+}
+.fa-pause-circle-o:before {
+  content: "\f28c";
+}
+.fa-stop-circle:before {
+  content: "\f28d";
+}
+.fa-stop-circle-o:before {
+  content: "\f28e";
+}
+.fa-shopping-bag:before {
+  content: "\f290";
+}
+.fa-shopping-basket:before {
+  content: "\f291";
+}
+.fa-hashtag:before {
+  content: "\f292";
+}
+.fa-bluetooth:before {
+  content: "\f293";
+}
+.fa-bluetooth-b:before {
+  content: "\f294";
+}
+.fa-percent:before {
+  content: "\f295";
+}
+.fa-gitlab:before {
+  content: "\f296";
+}
+.fa-wpbeginner:before {
+  content: "\f297";
+}
+.fa-wpforms:before {
+  content: "\f298";
+}
+.fa-envira:before {
+  content: "\f299";
+}
+.fa-universal-access:before {
+  content: "\f29a";
+}
+.fa-wheelchair-alt:before {
+  content: "\f29b";
+}
+.fa-question-circle-o:before {
+  content: "\f29c";
+}
+.fa-blind:before {
+  content: "\f29d";
+}
+.fa-audio-description:before {
+  content: "\f29e";
+}
+.fa-volume-control-phone:before {
+  content: "\f2a0";
+}
+.fa-braille:before {
+  content: "\f2a1";
+}
+.fa-assistive-listening-systems:before {
+  content: "\f2a2";
+}
+.fa-asl-interpreting:before,
+.fa-american-sign-language-interpreting:before {
+  content: "\f2a3";
+}
+.fa-deafness:before,
+.fa-hard-of-hearing:before,
+.fa-deaf:before {
+  content: "\f2a4";
+}
+.fa-glide:before {
+  content: "\f2a5";
+}
+.fa-glide-g:before {
+  content: "\f2a6";
+}
+.fa-signing:before,
+.fa-sign-language:before {
+  content: "\f2a7";
+}
+.fa-low-vision:before {
+  content: "\f2a8";
+}
+.fa-viadeo:before {
+  content: "\f2a9";
+}
+.fa-viadeo-square:before {
+  content: "\f2aa";
+}
+.fa-snapchat:before {
+  content: "\f2ab";
+}
+.fa-snapchat-ghost:before {
+  content: "\f2ac";
+}
+.fa-snapchat-square:before {
+  content: "\f2ad";
+}
+.fa-pied-piper:before {
+  content: "\f2ae";
+}
+.fa-first-order:before {
+  content: "\f2b0";
+}
+.fa-yoast:before {
+  content: "\f2b1";
+}
+.fa-themeisle:before {
+  content: "\f2b2";
+}
+.fa-google-plus-circle:before,
+.fa-google-plus-official:before {
+  content: "\f2b3";
+}
+.fa-fa:before,
+.fa-font-awesome:before {
+  content: "\f2b4";
+}
+.fa-handshake-o:before {
+  content: "\f2b5";
+}
+.fa-envelope-open:before {
+  content: "\f2b6";
+}
+.fa-envelope-open-o:before {
+  content: "\f2b7";
+}
+.fa-linode:before {
+  content: "\f2b8";
+}
+.fa-address-book:before {
+  content: "\f2b9";
+}
+.fa-address-book-o:before {
+  content: "\f2ba";
+}
+.fa-vcard:before,
+.fa-address-card:before {
+  content: "\f2bb";
+}
+.fa-vcard-o:before,
+.fa-address-card-o:before {
+  content: "\f2bc";
+}
+.fa-user-circle:before {
+  content: "\f2bd";
+}
+.fa-user-circle-o:before {
+  content: "\f2be";
+}
+.fa-user-o:before {
+  content: "\f2c0";
+}
+.fa-id-badge:before {
+  content: "\f2c1";
+}
+.fa-drivers-license:before,
+.fa-id-card:before {
+  content: "\f2c2";
+}
+.fa-drivers-license-o:before,
+.fa-id-card-o:before {
+  content: "\f2c3";
+}
+.fa-quora:before {
+  content: "\f2c4";
+}
+.fa-free-code-camp:before {
+  content: "\f2c5";
+}
+.fa-telegram:before {
+  content: "\f2c6";
+}
+.fa-thermometer-4:before,
+.fa-thermometer:before,
+.fa-thermometer-full:before {
+  content: "\f2c7";
+}
+.fa-thermometer-3:before,
+.fa-thermometer-three-quarters:before {
+  content: "\f2c8";
+}
+.fa-thermometer-2:before,
+.fa-thermometer-half:before {
+  content: "\f2c9";
+}
+.fa-thermometer-1:before,
+.fa-thermometer-quarter:before {
+  content: "\f2ca";
+}
+.fa-thermometer-0:before,
+.fa-thermometer-empty:before {
+  content: "\f2cb";
+}
+.fa-shower:before {
+  content: "\f2cc";
+}
+.fa-bathtub:before,
+.fa-s15:before,
+.fa-bath:before {
+  content: "\f2cd";
+}
+.fa-podcast:before {
+  content: "\f2ce";
+}
+.fa-window-maximize:before {
+  content: "\f2d0";
+}
+.fa-window-minimize:before {
+  content: "\f2d1";
+}
+.fa-window-restore:before {
+  content: "\f2d2";
+}
+.fa-times-rectangle:before,
+.fa-window-close:before {
+  content: "\f2d3";
+}
+.fa-times-rectangle-o:before,
+.fa-window-close-o:before {
+  content: "\f2d4";
+}
+.fa-bandcamp:before {
+  content: "\f2d5";
+}
+.fa-grav:before {
+  content: "\f2d6";
+}
+.fa-etsy:before {
+  content: "\f2d7";
+}
+.fa-imdb:before {
+  content: "\f2d8";
+}
+.fa-ravelry:before {
+  content: "\f2d9";
+}
+.fa-eercast:before {
+  content: "\f2da";
+}
+.fa-microchip:before {
+  content: "\f2db";
+}
+.fa-snowflake-o:before {
+  content: "\f2dc";
+}
+.fa-superpowers:before {
+  content: "\f2dd";
+}
+.fa-wpexplorer:before {
+  content: "\f2de";
+}
+.fa-meetup:before {
+  content: "\f2e0";
+}
+.sr-only {
+  position: absolute;
+  width: 1px;
+  height: 1px;
+  padding: 0;
+  margin: -1px;
+  overflow: hidden;
+  clip: rect(0, 0, 0, 0);
+  border: 0;
+}
+.sr-only-focusable:active,
+.sr-only-focusable:focus {
+  position: static;
+  width: auto;
+  height: auto;
+  margin: 0;
+  overflow: visible;
+  clip: auto;
+}
diff --git a/docs/lib/font-awesome/css/font-awesome.min.css b/docs/lib/font-awesome/css/font-awesome.min.css
new file mode 100644
index 0000000..540440c
--- /dev/null
+++ b/docs/lib/font-awesome/css/font-awesome.min.css
@@ -0,0 +1,4 @@
+/*!
+ *  Font Awesome 4.7.0 by @davegandy - http://fontawesome.io - @fontawesome
+ *  License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License)
+ */@font-face{font-family:'FontAwesome';src:url('../fonts/fontawesome-webfont.eot?v=4.7.0');src:url('../fonts/fontawesome-webfont.eot?#iefix&v=4.7.0') format('embedded-opentype'),url('../fonts/fontawesome-webfont.woff2?v=4.7.0') format('woff2'),url('../fonts/fontawesome-webfont.woff?v=4.7.0') format('woff'),url('../fonts/fontawesome-webfont.ttf?v=4.7.0') format('truetype'),url('../fonts/fontawesome-webfont.svg?v=4.7.0#fontawesomeregular') format('svg');font-weight:normal;font-style:normal}.fa{display:inline-block;font:normal normal normal 14px/1 FontAwesome;font-size:inherit;text-rendering:auto;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}.fa-lg{font-size:1.33333333em;line-height:.75em;vertical-align:-15%}.fa-2x{font-size:2em}.fa-3x{font-size:3em}.fa-4x{font-size:4em}.fa-5x{font-size:5em}.fa-fw{width:1.28571429em;text-align:center}.fa-ul{padding-left:0;margin-left:2.14285714em;list-style-type:none}.fa-ul>li{position:relative}.fa-li{position:absolute;left:-2.14285714em;width:2.14285714em;top:.14285714em;text-align:center}.fa-li.fa-lg{left:-1.85714286em}.fa-border{padding:.2em .25em .15em;border:solid .08em #eee;border-radius:.1em}.fa-pull-left{float:left}.fa-pull-right{float:right}.fa.fa-pull-left{margin-right:.3em}.fa.fa-pull-right{margin-left:.3em}.pull-right{float:right}.pull-left{float:left}.fa.pull-left{margin-right:.3em}.fa.pull-right{margin-left:.3em}.fa-spin{-webkit-animation:fa-spin 2s infinite linear;animation:fa-spin 2s infinite linear}.fa-pulse{-webkit-animation:fa-spin 1s infinite steps(8);animation:fa-spin 1s infinite steps(8)}@-webkit-keyframes fa-spin{0%{-webkit-transform:rotate(0deg);transform:rotate(0deg)}100%{-webkit-transform:rotate(359deg);transform:rotate(359deg)}}@keyframes fa-spin{0%{-webkit-transform:rotate(0deg);transform:rotate(0deg)}100%{-webkit-transform:rotate(359deg);transform:rotate(359deg)}}.fa-rotate-90{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=1)";-webkit-transform:rotate(90deg);-ms-transform:rotate(90deg);transform:rotate(90deg)}.fa-rotate-180{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=2)";-webkit-transform:rotate(180deg);-ms-transform:rotate(180deg);transform:rotate(180deg)}.fa-rotate-270{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=3)";-webkit-transform:rotate(270deg);-ms-transform:rotate(270deg);transform:rotate(270deg)}.fa-flip-horizontal{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)";-webkit-transform:scale(-1, 1);-ms-transform:scale(-1, 1);transform:scale(-1, 1)}.fa-flip-vertical{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)";-webkit-transform:scale(1, -1);-ms-transform:scale(1, -1);transform:scale(1, -1)}:root .fa-rotate-90,:root .fa-rotate-180,:root .fa-rotate-270,:root .fa-flip-horizontal,:root .fa-flip-vertical{filter:none}.fa-stack{position:relative;display:inline-block;width:2em;height:2em;line-height:2em;vertical-align:middle}.fa-stack-1x,.fa-stack-2x{position:absolute;left:0;width:100%;text-align:center}.fa-stack-1x{line-height:inherit}.fa-stack-2x{font-size:2em}.fa-inverse{color:#fff}.fa-glass:before{content:"\f000"}.fa-music:before{content:"\f001"}.fa-search:before{content:"\f002"}.fa-envelope-o:before{content:"\f003"}.fa-heart:before{content:"\f004"}.fa-star:before{content:"\f005"}.fa-star-o:before{content:"\f006"}.fa-user:before{content:"\f007"}.fa-film:before{content:"\f008"}.fa-th-large:before{content:"\f009"}.fa-th:before{content:"\f00a"}.fa-th-list:before{content:"\f00b"}.fa-check:before{content:"\f00c"}.fa-remove:before,.fa-close:before,.fa-times:before{content:"\f00d"}.fa-search-plus:before{content:"\f00e"}.fa-search-minus:before{content:"\f010"}.fa-power-off:before{content:"\f011"}.fa-signal:before{content:"\f012"}.fa-gear:before,.fa-cog:before{content:"\f013"}.fa-trash-o:before{content:"\f014"}.fa-home:before{content:"\f015"}.fa-file-o:before{content:"\f016"}.fa-clock-o:before{content:"\f017"}.fa-road:before{content:"\f018"}.fa-download:before{content:"\f019"}.fa-arrow-circle-o-down:before{content:"\f01a"}.fa-arrow-circle-o-up:before{content:"\f01b"}.fa-inbox:before{content:"\f01c"}.fa-play-circle-o:before{content:"\f01d"}.fa-rotate-right:before,.fa-repeat:before{content:"\f01e"}.fa-refresh:before{content:"\f021"}.fa-list-alt:before{content:"\f022"}.fa-lock:before{content:"\f023"}.fa-flag:before{content:"\f024"}.fa-headphones:before{content:"\f025"}.fa-volume-off:before{content:"\f026"}.fa-volume-down:before{content:"\f027"}.fa-volume-up:before{content:"\f028"}.fa-qrcode:before{content:"\f029"}.fa-barcode:before{content:"\f02a"}.fa-tag:before{content:"\f02b"}.fa-tags:before{content:"\f02c"}.fa-book:before{content:"\f02d"}.fa-bookmark:before{content:"\f02e"}.fa-print:before{content:"\f02f"}.fa-camera:before{content:"\f030"}.fa-font:before{content:"\f031"}.fa-bold:before{content:"\f032"}.fa-italic:before{content:"\f033"}.fa-text-height:before{content:"\f034"}.fa-text-width:before{content:"\f035"}.fa-align-left:before{content:"\f036"}.fa-align-center:before{content:"\f037"}.fa-align-right:before{content:"\f038"}.fa-align-justify:before{content:"\f039"}.fa-list:before{content:"\f03a"}.fa-dedent:before,.fa-outdent:before{content:"\f03b"}.fa-indent:before{content:"\f03c"}.fa-video-camera:before{content:"\f03d"}.fa-photo:before,.fa-image:before,.fa-picture-o:before{content:"\f03e"}.fa-pencil:before{content:"\f040"}.fa-map-marker:before{content:"\f041"}.fa-adjust:before{content:"\f042"}.fa-tint:before{content:"\f043"}.fa-edit:before,.fa-pencil-square-o:before{content:"\f044"}.fa-share-square-o:before{content:"\f045"}.fa-check-square-o:before{content:"\f046"}.fa-arrows:before{content:"\f047"}.fa-step-backward:before{content:"\f048"}.fa-fast-backward:before{content:"\f049"}.fa-backward:before{content:"\f04a"}.fa-play:before{content:"\f04b"}.fa-pause:before{content:"\f04c"}.fa-stop:before{content:"\f04d"}.fa-forward:before{content:"\f04e"}.fa-fast-forward:before{content:"\f050"}.fa-step-forward:before{content:"\f051"}.fa-eject:before{content:"\f052"}.fa-chevron-left:before{content:"\f053"}.fa-chevron-right:before{content:"\f054"}.fa-plus-circle:before{content:"\f055"}.fa-minus-circle:before{content:"\f056"}.fa-times-circle:before{content:"\f057"}.fa-check-circle:before{content:"\f058"}.fa-question-circle:before{content:"\f059"}.fa-info-circle:before{content:"\f05a"}.fa-crosshairs:before{content:"\f05b"}.fa-times-circle-o:before{content:"\f05c"}.fa-check-circle-o:before{content:"\f05d"}.fa-ban:before{content:"\f05e"}.fa-arrow-left:before{content:"\f060"}.fa-arrow-right:before{content:"\f061"}.fa-arrow-up:before{content:"\f062"}.fa-arrow-down:before{content:"\f063"}.fa-mail-forward:before,.fa-share:before{content:"\f064"}.fa-expand:before{content:"\f065"}.fa-compress:before{content:"\f066"}.fa-plus:before{content:"\f067"}.fa-minus:before{content:"\f068"}.fa-asterisk:before{content:"\f069"}.fa-exclamation-circle:before{content:"\f06a"}.fa-gift:before{content:"\f06b"}.fa-leaf:before{content:"\f06c"}.fa-fire:before{content:"\f06d"}.fa-eye:before{content:"\f06e"}.fa-eye-slash:before{content:"\f070"}.fa-warning:before,.fa-exclamation-triangle:before{content:"\f071"}.fa-plane:before{content:"\f072"}.fa-calendar:before{content:"\f073"}.fa-random:before{content:"\f074"}.fa-comment:before{content:"\f075"}.fa-magnet:before{content:"\f076"}.fa-chevron-up:before{content:"\f077"}.fa-chevron-down:before{content:"\f078"}.fa-retweet:before{content:"\f079"}.fa-shopping-cart:before{content:"\f07a"}.fa-folder:before{content:"\f07b"}.fa-folder-open:before{content:"\f07c"}.fa-arrows-v:before{content:"\f07d"}.fa-arrows-h:before{content:"\f07e"}.fa-bar-chart-o:before,.fa-bar-chart:before{content:"\f080"}.fa-twitter-square:before{content:"\f081"}.fa-facebook-square:before{content:"\f082"}.fa-camera-retro:before{content:"\f083"}.fa-key:before{content:"\f084"}.fa-gears:before,.fa-cogs:before{content:"\f085"}.fa-comments:before{content:"\f086"}.fa-thumbs-o-up:before{content:"\f087"}.fa-thumbs-o-down:before{content:"\f088"}.fa-star-half:before{content:"\f089"}.fa-heart-o:before{content:"\f08a"}.fa-sign-out:before{content:"\f08b"}.fa-linkedin-square:before{content:"\f08c"}.fa-thumb-tack:before{content:"\f08d"}.fa-external-link:before{content:"\f08e"}.fa-sign-in:before{content:"\f090"}.fa-trophy:before{content:"\f091"}.fa-github-square:before{content:"\f092"}.fa-upload:before{content:"\f093"}.fa-lemon-o:before{content:"\f094"}.fa-phone:before{content:"\f095"}.fa-square-o:before{content:"\f096"}.fa-bookmark-o:before{content:"\f097"}.fa-phone-square:before{content:"\f098"}.fa-twitter:before{content:"\f099"}.fa-facebook-f:before,.fa-facebook:before{content:"\f09a"}.fa-github:before{content:"\f09b"}.fa-unlock:before{content:"\f09c"}.fa-credit-card:before{content:"\f09d"}.fa-feed:before,.fa-rss:before{content:"\f09e"}.fa-hdd-o:before{content:"\f0a0"}.fa-bullhorn:before{content:"\f0a1"}.fa-bell:before{content:"\f0f3"}.fa-certificate:before{content:"\f0a3"}.fa-hand-o-right:before{content:"\f0a4"}.fa-hand-o-left:before{content:"\f0a5"}.fa-hand-o-up:before{content:"\f0a6"}.fa-hand-o-down:before{content:"\f0a7"}.fa-arrow-circle-left:before{content:"\f0a8"}.fa-arrow-circle-right:before{content:"\f0a9"}.fa-arrow-circle-up:before{content:"\f0aa"}.fa-arrow-circle-down:before{content:"\f0ab"}.fa-globe:before{content:"\f0ac"}.fa-wrench:before{content:"\f0ad"}.fa-tasks:before{content:"\f0ae"}.fa-filter:before{content:"\f0b0"}.fa-briefcase:before{content:"\f0b1"}.fa-arrows-alt:before{content:"\f0b2"}.fa-group:before,.fa-users:before{content:"\f0c0"}.fa-chain:before,.fa-link:before{content:"\f0c1"}.fa-cloud:before{content:"\f0c2"}.fa-flask:before{content:"\f0c3"}.fa-cut:before,.fa-scissors:before{content:"\f0c4"}.fa-copy:before,.fa-files-o:before{content:"\f0c5"}.fa-paperclip:before{content:"\f0c6"}.fa-save:before,.fa-floppy-o:before{content:"\f0c7"}.fa-square:before{content:"\f0c8"}.fa-navicon:before,.fa-reorder:before,.fa-bars:before{content:"\f0c9"}.fa-list-ul:before{content:"\f0ca"}.fa-list-ol:before{content:"\f0cb"}.fa-strikethrough:before{content:"\f0cc"}.fa-underline:before{content:"\f0cd"}.fa-table:before{content:"\f0ce"}.fa-magic:before{content:"\f0d0"}.fa-truck:before{content:"\f0d1"}.fa-pinterest:before{content:"\f0d2"}.fa-pinterest-square:before{content:"\f0d3"}.fa-google-plus-square:before{content:"\f0d4"}.fa-google-plus:before{content:"\f0d5"}.fa-money:before{content:"\f0d6"}.fa-caret-down:before{content:"\f0d7"}.fa-caret-up:before{content:"\f0d8"}.fa-caret-left:before{content:"\f0d9"}.fa-caret-right:before{content:"\f0da"}.fa-columns:before{content:"\f0db"}.fa-unsorted:before,.fa-sort:before{content:"\f0dc"}.fa-sort-down:before,.fa-sort-desc:before{content:"\f0dd"}.fa-sort-up:before,.fa-sort-asc:before{content:"\f0de"}.fa-envelope:before{content:"\f0e0"}.fa-linkedin:before{content:"\f0e1"}.fa-rotate-left:before,.fa-undo:before{content:"\f0e2"}.fa-legal:before,.fa-gavel:before{content:"\f0e3"}.fa-dashboard:before,.fa-tachometer:before{content:"\f0e4"}.fa-comment-o:before{content:"\f0e5"}.fa-comments-o:before{content:"\f0e6"}.fa-flash:before,.fa-bolt:before{content:"\f0e7"}.fa-sitemap:before{content:"\f0e8"}.fa-umbrella:before{content:"\f0e9"}.fa-paste:before,.fa-clipboard:before{content:"\f0ea"}.fa-lightbulb-o:before{content:"\f0eb"}.fa-exchange:before{content:"\f0ec"}.fa-cloud-download:before{content:"\f0ed"}.fa-cloud-upload:before{content:"\f0ee"}.fa-user-md:before{content:"\f0f0"}.fa-stethoscope:before{content:"\f0f1"}.fa-suitcase:before{content:"\f0f2"}.fa-bell-o:before{content:"\f0a2"}.fa-coffee:before{content:"\f0f4"}.fa-cutlery:before{content:"\f0f5"}.fa-file-text-o:before{content:"\f0f6"}.fa-building-o:before{content:"\f0f7"}.fa-hospital-o:before{content:"\f0f8"}.fa-ambulance:before{content:"\f0f9"}.fa-medkit:before{content:"\f0fa"}.fa-fighter-jet:before{content:"\f0fb"}.fa-beer:before{content:"\f0fc"}.fa-h-square:before{content:"\f0fd"}.fa-plus-square:before{content:"\f0fe"}.fa-angle-double-left:before{content:"\f100"}.fa-angle-double-right:before{content:"\f101"}.fa-angle-double-up:before{content:"\f102"}.fa-angle-double-down:before{content:"\f103"}.fa-angle-left:before{content:"\f104"}.fa-angle-right:before{content:"\f105"}.fa-angle-up:before{content:"\f106"}.fa-angle-down:before{content:"\f107"}.fa-desktop:before{content:"\f108"}.fa-laptop:before{content:"\f109"}.fa-tablet:before{content:"\f10a"}.fa-mobile-phone:before,.fa-mobile:before{content:"\f10b"}.fa-circle-o:before{content:"\f10c"}.fa-quote-left:before{content:"\f10d"}.fa-quote-right:before{content:"\f10e"}.fa-spinner:before{content:"\f110"}.fa-circle:before{content:"\f111"}.fa-mail-reply:before,.fa-reply:before{content:"\f112"}.fa-github-alt:before{content:"\f113"}.fa-folder-o:before{content:"\f114"}.fa-folder-open-o:before{content:"\f115"}.fa-smile-o:before{content:"\f118"}.fa-frown-o:before{content:"\f119"}.fa-meh-o:before{content:"\f11a"}.fa-gamepad:before{content:"\f11b"}.fa-keyboard-o:before{content:"\f11c"}.fa-flag-o:before{content:"\f11d"}.fa-flag-checkered:before{content:"\f11e"}.fa-terminal:before{content:"\f120"}.fa-code:before{content:"\f121"}.fa-mail-reply-all:before,.fa-reply-all:before{content:"\f122"}.fa-star-half-empty:before,.fa-star-half-full:before,.fa-star-half-o:before{content:"\f123"}.fa-location-arrow:before{content:"\f124"}.fa-crop:before{content:"\f125"}.fa-code-fork:before{content:"\f126"}.fa-unlink:before,.fa-chain-broken:before{content:"\f127"}.fa-question:before{content:"\f128"}.fa-info:before{content:"\f129"}.fa-exclamation:before{content:"\f12a"}.fa-superscript:before{content:"\f12b"}.fa-subscript:before{content:"\f12c"}.fa-eraser:before{content:"\f12d"}.fa-puzzle-piece:before{content:"\f12e"}.fa-microphone:before{content:"\f130"}.fa-microphone-slash:before{content:"\f131"}.fa-shield:before{content:"\f132"}.fa-calendar-o:before{content:"\f133"}.fa-fire-extinguisher:before{content:"\f134"}.fa-rocket:before{content:"\f135"}.fa-maxcdn:before{content:"\f136"}.fa-chevron-circle-left:before{content:"\f137"}.fa-chevron-circle-right:before{content:"\f138"}.fa-chevron-circle-up:before{content:"\f139"}.fa-chevron-circle-down:before{content:"\f13a"}.fa-html5:before{content:"\f13b"}.fa-css3:before{content:"\f13c"}.fa-anchor:before{content:"\f13d"}.fa-unlock-alt:before{content:"\f13e"}.fa-bullseye:before{content:"\f140"}.fa-ellipsis-h:before{content:"\f141"}.fa-ellipsis-v:before{content:"\f142"}.fa-rss-square:before{content:"\f143"}.fa-play-circle:before{content:"\f144"}.fa-ticket:before{content:"\f145"}.fa-minus-square:before{content:"\f146"}.fa-minus-square-o:before{content:"\f147"}.fa-level-up:before{content:"\f148"}.fa-level-down:before{content:"\f149"}.fa-check-square:before{content:"\f14a"}.fa-pencil-square:before{content:"\f14b"}.fa-external-link-square:before{content:"\f14c"}.fa-share-square:before{content:"\f14d"}.fa-compass:before{content:"\f14e"}.fa-toggle-down:before,.fa-caret-square-o-down:before{content:"\f150"}.fa-toggle-up:before,.fa-caret-square-o-up:before{content:"\f151"}.fa-toggle-right:before,.fa-caret-square-o-right:before{content:"\f152"}.fa-euro:before,.fa-eur:before{content:"\f153"}.fa-gbp:before{content:"\f154"}.fa-dollar:before,.fa-usd:before{content:"\f155"}.fa-rupee:before,.fa-inr:before{content:"\f156"}.fa-cny:before,.fa-rmb:before,.fa-yen:before,.fa-jpy:before{content:"\f157"}.fa-ruble:before,.fa-rouble:before,.fa-rub:before{content:"\f158"}.fa-won:before,.fa-krw:before{content:"\f159"}.fa-bitcoin:before,.fa-btc:before{content:"\f15a"}.fa-file:before{content:"\f15b"}.fa-file-text:before{content:"\f15c"}.fa-sort-alpha-asc:before{content:"\f15d"}.fa-sort-alpha-desc:before{content:"\f15e"}.fa-sort-amount-asc:before{content:"\f160"}.fa-sort-amount-desc:before{content:"\f161"}.fa-sort-numeric-asc:before{content:"\f162"}.fa-sort-numeric-desc:before{content:"\f163"}.fa-thumbs-up:before{content:"\f164"}.fa-thumbs-down:before{content:"\f165"}.fa-youtube-square:before{content:"\f166"}.fa-youtube:before{content:"\f167"}.fa-xing:before{content:"\f168"}.fa-xing-square:before{content:"\f169"}.fa-youtube-play:before{content:"\f16a"}.fa-dropbox:before{content:"\f16b"}.fa-stack-overflow:before{content:"\f16c"}.fa-instagram:before{content:"\f16d"}.fa-flickr:before{content:"\f16e"}.fa-adn:before{content:"\f170"}.fa-bitbucket:before{content:"\f171"}.fa-bitbucket-square:before{content:"\f172"}.fa-tumblr:before{content:"\f173"}.fa-tumblr-square:before{content:"\f174"}.fa-long-arrow-down:before{content:"\f175"}.fa-long-arrow-up:before{content:"\f176"}.fa-long-arrow-left:before{content:"\f177"}.fa-long-arrow-right:before{content:"\f178"}.fa-apple:before{content:"\f179"}.fa-windows:before{content:"\f17a"}.fa-android:before{content:"\f17b"}.fa-linux:before{content:"\f17c"}.fa-dribbble:before{content:"\f17d"}.fa-skype:before{content:"\f17e"}.fa-foursquare:before{content:"\f180"}.fa-trello:before{content:"\f181"}.fa-female:before{content:"\f182"}.fa-male:before{content:"\f183"}.fa-gittip:before,.fa-gratipay:before{content:"\f184"}.fa-sun-o:before{content:"\f185"}.fa-moon-o:before{content:"\f186"}.fa-archive:before{content:"\f187"}.fa-bug:before{content:"\f188"}.fa-vk:before{content:"\f189"}.fa-weibo:before{content:"\f18a"}.fa-renren:before{content:"\f18b"}.fa-pagelines:before{content:"\f18c"}.fa-stack-exchange:before{content:"\f18d"}.fa-arrow-circle-o-right:before{content:"\f18e"}.fa-arrow-circle-o-left:before{content:"\f190"}.fa-toggle-left:before,.fa-caret-square-o-left:before{content:"\f191"}.fa-dot-circle-o:before{content:"\f192"}.fa-wheelchair:before{content:"\f193"}.fa-vimeo-square:before{content:"\f194"}.fa-turkish-lira:before,.fa-try:before{content:"\f195"}.fa-plus-square-o:before{content:"\f196"}.fa-space-shuttle:before{content:"\f197"}.fa-slack:before{content:"\f198"}.fa-envelope-square:before{content:"\f199"}.fa-wordpress:before{content:"\f19a"}.fa-openid:before{content:"\f19b"}.fa-institution:before,.fa-bank:before,.fa-university:before{content:"\f19c"}.fa-mortar-board:before,.fa-graduation-cap:before{content:"\f19d"}.fa-yahoo:before{content:"\f19e"}.fa-google:before{content:"\f1a0"}.fa-reddit:before{content:"\f1a1"}.fa-reddit-square:before{content:"\f1a2"}.fa-stumbleupon-circle:before{content:"\f1a3"}.fa-stumbleupon:before{content:"\f1a4"}.fa-delicious:before{content:"\f1a5"}.fa-digg:before{content:"\f1a6"}.fa-pied-piper-pp:before{content:"\f1a7"}.fa-pied-piper-alt:before{content:"\f1a8"}.fa-drupal:before{content:"\f1a9"}.fa-joomla:before{content:"\f1aa"}.fa-language:before{content:"\f1ab"}.fa-fax:before{content:"\f1ac"}.fa-building:before{content:"\f1ad"}.fa-child:before{content:"\f1ae"}.fa-paw:before{content:"\f1b0"}.fa-spoon:before{content:"\f1b1"}.fa-cube:before{content:"\f1b2"}.fa-cubes:before{content:"\f1b3"}.fa-behance:before{content:"\f1b4"}.fa-behance-square:before{content:"\f1b5"}.fa-steam:before{content:"\f1b6"}.fa-steam-square:before{content:"\f1b7"}.fa-recycle:before{content:"\f1b8"}.fa-automobile:before,.fa-car:before{content:"\f1b9"}.fa-cab:before,.fa-taxi:before{content:"\f1ba"}.fa-tree:before{content:"\f1bb"}.fa-spotify:before{content:"\f1bc"}.fa-deviantart:before{content:"\f1bd"}.fa-soundcloud:before{content:"\f1be"}.fa-database:before{content:"\f1c0"}.fa-file-pdf-o:before{content:"\f1c1"}.fa-file-word-o:before{content:"\f1c2"}.fa-file-excel-o:before{content:"\f1c3"}.fa-file-powerpoint-o:before{content:"\f1c4"}.fa-file-photo-o:before,.fa-file-picture-o:before,.fa-file-image-o:before{content:"\f1c5"}.fa-file-zip-o:before,.fa-file-archive-o:before{content:"\f1c6"}.fa-file-sound-o:before,.fa-file-audio-o:before{content:"\f1c7"}.fa-file-movie-o:before,.fa-file-video-o:before{content:"\f1c8"}.fa-file-code-o:before{content:"\f1c9"}.fa-vine:before{content:"\f1ca"}.fa-codepen:before{content:"\f1cb"}.fa-jsfiddle:before{content:"\f1cc"}.fa-life-bouy:before,.fa-life-buoy:before,.fa-life-saver:before,.fa-support:before,.fa-life-ring:before{content:"\f1cd"}.fa-circle-o-notch:before{content:"\f1ce"}.fa-ra:before,.fa-resistance:before,.fa-rebel:before{content:"\f1d0"}.fa-ge:before,.fa-empire:before{content:"\f1d1"}.fa-git-square:before{content:"\f1d2"}.fa-git:before{content:"\f1d3"}.fa-y-combinator-square:before,.fa-yc-square:before,.fa-hacker-news:before{content:"\f1d4"}.fa-tencent-weibo:before{content:"\f1d5"}.fa-qq:before{content:"\f1d6"}.fa-wechat:before,.fa-weixin:before{content:"\f1d7"}.fa-send:before,.fa-paper-plane:before{content:"\f1d8"}.fa-send-o:before,.fa-paper-plane-o:before{content:"\f1d9"}.fa-history:before{content:"\f1da"}.fa-circle-thin:before{content:"\f1db"}.fa-header:before{content:"\f1dc"}.fa-paragraph:before{content:"\f1dd"}.fa-sliders:before{content:"\f1de"}.fa-share-alt:before{content:"\f1e0"}.fa-share-alt-square:before{content:"\f1e1"}.fa-bomb:before{content:"\f1e2"}.fa-soccer-ball-o:before,.fa-futbol-o:before{content:"\f1e3"}.fa-tty:before{content:"\f1e4"}.fa-binoculars:before{content:"\f1e5"}.fa-plug:before{content:"\f1e6"}.fa-slideshare:before{content:"\f1e7"}.fa-twitch:before{content:"\f1e8"}.fa-yelp:before{content:"\f1e9"}.fa-newspaper-o:before{content:"\f1ea"}.fa-wifi:before{content:"\f1eb"}.fa-calculator:before{content:"\f1ec"}.fa-paypal:before{content:"\f1ed"}.fa-google-wallet:before{content:"\f1ee"}.fa-cc-visa:before{content:"\f1f0"}.fa-cc-mastercard:before{content:"\f1f1"}.fa-cc-discover:before{content:"\f1f2"}.fa-cc-amex:before{content:"\f1f3"}.fa-cc-paypal:before{content:"\f1f4"}.fa-cc-stripe:before{content:"\f1f5"}.fa-bell-slash:before{content:"\f1f6"}.fa-bell-slash-o:before{content:"\f1f7"}.fa-trash:before{content:"\f1f8"}.fa-copyright:before{content:"\f1f9"}.fa-at:before{content:"\f1fa"}.fa-eyedropper:before{content:"\f1fb"}.fa-paint-brush:before{content:"\f1fc"}.fa-birthday-cake:before{content:"\f1fd"}.fa-area-chart:before{content:"\f1fe"}.fa-pie-chart:before{content:"\f200"}.fa-line-chart:before{content:"\f201"}.fa-lastfm:before{content:"\f202"}.fa-lastfm-square:before{content:"\f203"}.fa-toggle-off:before{content:"\f204"}.fa-toggle-on:before{content:"\f205"}.fa-bicycle:before{content:"\f206"}.fa-bus:before{content:"\f207"}.fa-ioxhost:before{content:"\f208"}.fa-angellist:before{content:"\f209"}.fa-cc:before{content:"\f20a"}.fa-shekel:before,.fa-sheqel:before,.fa-ils:before{content:"\f20b"}.fa-meanpath:before{content:"\f20c"}.fa-buysellads:before{content:"\f20d"}.fa-connectdevelop:before{content:"\f20e"}.fa-dashcube:before{content:"\f210"}.fa-forumbee:before{content:"\f211"}.fa-leanpub:before{content:"\f212"}.fa-sellsy:before{content:"\f213"}.fa-shirtsinbulk:before{content:"\f214"}.fa-simplybuilt:before{content:"\f215"}.fa-skyatlas:before{content:"\f216"}.fa-cart-plus:before{content:"\f217"}.fa-cart-arrow-down:before{content:"\f218"}.fa-diamond:before{content:"\f219"}.fa-ship:before{content:"\f21a"}.fa-user-secret:before{content:"\f21b"}.fa-motorcycle:before{content:"\f21c"}.fa-street-view:before{content:"\f21d"}.fa-heartbeat:before{content:"\f21e"}.fa-venus:before{content:"\f221"}.fa-mars:before{content:"\f222"}.fa-mercury:before{content:"\f223"}.fa-intersex:before,.fa-transgender:before{content:"\f224"}.fa-transgender-alt:before{content:"\f225"}.fa-venus-double:before{content:"\f226"}.fa-mars-double:before{content:"\f227"}.fa-venus-mars:before{content:"\f228"}.fa-mars-stroke:before{content:"\f229"}.fa-mars-stroke-v:before{content:"\f22a"}.fa-mars-stroke-h:before{content:"\f22b"}.fa-neuter:before{content:"\f22c"}.fa-genderless:before{content:"\f22d"}.fa-facebook-official:before{content:"\f230"}.fa-pinterest-p:before{content:"\f231"}.fa-whatsapp:before{content:"\f232"}.fa-server:before{content:"\f233"}.fa-user-plus:before{content:"\f234"}.fa-user-times:before{content:"\f235"}.fa-hotel:before,.fa-bed:before{content:"\f236"}.fa-viacoin:before{content:"\f237"}.fa-train:before{content:"\f238"}.fa-subway:before{content:"\f239"}.fa-medium:before{content:"\f23a"}.fa-yc:before,.fa-y-combinator:before{content:"\f23b"}.fa-optin-monster:before{content:"\f23c"}.fa-opencart:before{content:"\f23d"}.fa-expeditedssl:before{content:"\f23e"}.fa-battery-4:before,.fa-battery:before,.fa-battery-full:before{content:"\f240"}.fa-battery-3:before,.fa-battery-three-quarters:before{content:"\f241"}.fa-battery-2:before,.fa-battery-half:before{content:"\f242"}.fa-battery-1:before,.fa-battery-quarter:before{content:"\f243"}.fa-battery-0:before,.fa-battery-empty:before{content:"\f244"}.fa-mouse-pointer:before{content:"\f245"}.fa-i-cursor:before{content:"\f246"}.fa-object-group:before{content:"\f247"}.fa-object-ungroup:before{content:"\f248"}.fa-sticky-note:before{content:"\f249"}.fa-sticky-note-o:before{content:"\f24a"}.fa-cc-jcb:before{content:"\f24b"}.fa-cc-diners-club:before{content:"\f24c"}.fa-clone:before{content:"\f24d"}.fa-balance-scale:before{content:"\f24e"}.fa-hourglass-o:before{content:"\f250"}.fa-hourglass-1:before,.fa-hourglass-start:before{content:"\f251"}.fa-hourglass-2:before,.fa-hourglass-half:before{content:"\f252"}.fa-hourglass-3:before,.fa-hourglass-end:before{content:"\f253"}.fa-hourglass:before{content:"\f254"}.fa-hand-grab-o:before,.fa-hand-rock-o:before{content:"\f255"}.fa-hand-stop-o:before,.fa-hand-paper-o:before{content:"\f256"}.fa-hand-scissors-o:before{content:"\f257"}.fa-hand-lizard-o:before{content:"\f258"}.fa-hand-spock-o:before{content:"\f259"}.fa-hand-pointer-o:before{content:"\f25a"}.fa-hand-peace-o:before{content:"\f25b"}.fa-trademark:before{content:"\f25c"}.fa-registered:before{content:"\f25d"}.fa-creative-commons:before{content:"\f25e"}.fa-gg:before{content:"\f260"}.fa-gg-circle:before{content:"\f261"}.fa-tripadvisor:before{content:"\f262"}.fa-odnoklassniki:before{content:"\f263"}.fa-odnoklassniki-square:before{content:"\f264"}.fa-get-pocket:before{content:"\f265"}.fa-wikipedia-w:before{content:"\f266"}.fa-safari:before{content:"\f267"}.fa-chrome:before{content:"\f268"}.fa-firefox:before{content:"\f269"}.fa-opera:before{content:"\f26a"}.fa-internet-explorer:before{content:"\f26b"}.fa-tv:before,.fa-television:before{content:"\f26c"}.fa-contao:before{content:"\f26d"}.fa-500px:before{content:"\f26e"}.fa-amazon:before{content:"\f270"}.fa-calendar-plus-o:before{content:"\f271"}.fa-calendar-minus-o:before{content:"\f272"}.fa-calendar-times-o:before{content:"\f273"}.fa-calendar-check-o:before{content:"\f274"}.fa-industry:before{content:"\f275"}.fa-map-pin:before{content:"\f276"}.fa-map-signs:before{content:"\f277"}.fa-map-o:before{content:"\f278"}.fa-map:before{content:"\f279"}.fa-commenting:before{content:"\f27a"}.fa-commenting-o:before{content:"\f27b"}.fa-houzz:before{content:"\f27c"}.fa-vimeo:before{content:"\f27d"}.fa-black-tie:before{content:"\f27e"}.fa-fonticons:before{content:"\f280"}.fa-reddit-alien:before{content:"\f281"}.fa-edge:before{content:"\f282"}.fa-credit-card-alt:before{content:"\f283"}.fa-codiepie:before{content:"\f284"}.fa-modx:before{content:"\f285"}.fa-fort-awesome:before{content:"\f286"}.fa-usb:before{content:"\f287"}.fa-product-hunt:before{content:"\f288"}.fa-mixcloud:before{content:"\f289"}.fa-scribd:before{content:"\f28a"}.fa-pause-circle:before{content:"\f28b"}.fa-pause-circle-o:before{content:"\f28c"}.fa-stop-circle:before{content:"\f28d"}.fa-stop-circle-o:before{content:"\f28e"}.fa-shopping-bag:before{content:"\f290"}.fa-shopping-basket:before{content:"\f291"}.fa-hashtag:before{content:"\f292"}.fa-bluetooth:before{content:"\f293"}.fa-bluetooth-b:before{content:"\f294"}.fa-percent:before{content:"\f295"}.fa-gitlab:before{content:"\f296"}.fa-wpbeginner:before{content:"\f297"}.fa-wpforms:before{content:"\f298"}.fa-envira:before{content:"\f299"}.fa-universal-access:before{content:"\f29a"}.fa-wheelchair-alt:before{content:"\f29b"}.fa-question-circle-o:before{content:"\f29c"}.fa-blind:before{content:"\f29d"}.fa-audio-description:before{content:"\f29e"}.fa-volume-control-phone:before{content:"\f2a0"}.fa-braille:before{content:"\f2a1"}.fa-assistive-listening-systems:before{content:"\f2a2"}.fa-asl-interpreting:before,.fa-american-sign-language-interpreting:before{content:"\f2a3"}.fa-deafness:before,.fa-hard-of-hearing:before,.fa-deaf:before{content:"\f2a4"}.fa-glide:before{content:"\f2a5"}.fa-glide-g:before{content:"\f2a6"}.fa-signing:before,.fa-sign-language:before{content:"\f2a7"}.fa-low-vision:before{content:"\f2a8"}.fa-viadeo:before{content:"\f2a9"}.fa-viadeo-square:before{content:"\f2aa"}.fa-snapchat:before{content:"\f2ab"}.fa-snapchat-ghost:before{content:"\f2ac"}.fa-snapchat-square:before{content:"\f2ad"}.fa-pied-piper:before{content:"\f2ae"}.fa-first-order:before{content:"\f2b0"}.fa-yoast:before{content:"\f2b1"}.fa-themeisle:before{content:"\f2b2"}.fa-google-plus-circle:before,.fa-google-plus-official:before{content:"\f2b3"}.fa-fa:before,.fa-font-awesome:before{content:"\f2b4"}.fa-handshake-o:before{content:"\f2b5"}.fa-envelope-open:before{content:"\f2b6"}.fa-envelope-open-o:before{content:"\f2b7"}.fa-linode:before{content:"\f2b8"}.fa-address-book:before{content:"\f2b9"}.fa-address-book-o:before{content:"\f2ba"}.fa-vcard:before,.fa-address-card:before{content:"\f2bb"}.fa-vcard-o:before,.fa-address-card-o:before{content:"\f2bc"}.fa-user-circle:before{content:"\f2bd"}.fa-user-circle-o:before{content:"\f2be"}.fa-user-o:before{content:"\f2c0"}.fa-id-badge:before{content:"\f2c1"}.fa-drivers-license:before,.fa-id-card:before{content:"\f2c2"}.fa-drivers-license-o:before,.fa-id-card-o:before{content:"\f2c3"}.fa-quora:before{content:"\f2c4"}.fa-free-code-camp:before{content:"\f2c5"}.fa-telegram:before{content:"\f2c6"}.fa-thermometer-4:before,.fa-thermometer:before,.fa-thermometer-full:before{content:"\f2c7"}.fa-thermometer-3:before,.fa-thermometer-three-quarters:before{content:"\f2c8"}.fa-thermometer-2:before,.fa-thermometer-half:before{content:"\f2c9"}.fa-thermometer-1:before,.fa-thermometer-quarter:before{content:"\f2ca"}.fa-thermometer-0:before,.fa-thermometer-empty:before{content:"\f2cb"}.fa-shower:before{content:"\f2cc"}.fa-bathtub:before,.fa-s15:before,.fa-bath:before{content:"\f2cd"}.fa-podcast:before{content:"\f2ce"}.fa-window-maximize:before{content:"\f2d0"}.fa-window-minimize:before{content:"\f2d1"}.fa-window-restore:before{content:"\f2d2"}.fa-times-rectangle:before,.fa-window-close:before{content:"\f2d3"}.fa-times-rectangle-o:before,.fa-window-close-o:before{content:"\f2d4"}.fa-bandcamp:before{content:"\f2d5"}.fa-grav:before{content:"\f2d6"}.fa-etsy:before{content:"\f2d7"}.fa-imdb:before{content:"\f2d8"}.fa-ravelry:before{content:"\f2d9"}.fa-eercast:before{content:"\f2da"}.fa-microchip:before{content:"\f2db"}.fa-snowflake-o:before{content:"\f2dc"}.fa-superpowers:before{content:"\f2dd"}.fa-wpexplorer:before{content:"\f2de"}.fa-meetup:before{content:"\f2e0"}.sr-only{position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0, 0, 0, 0);border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;margin:0;overflow:visible;clip:auto}
diff --git a/docs/lib/font-awesome/fonts/FontAwesome.otf b/docs/lib/font-awesome/fonts/FontAwesome.otf
new file mode 100644
index 0000000..401ec0f
Binary files /dev/null and b/docs/lib/font-awesome/fonts/FontAwesome.otf differ
diff --git a/docs/lib/font-awesome/fonts/fontawesome-webfont.eot b/docs/lib/font-awesome/fonts/fontawesome-webfont.eot
new file mode 100644
index 0000000..e9f60ca
Binary files /dev/null and b/docs/lib/font-awesome/fonts/fontawesome-webfont.eot differ
diff --git a/docs/lib/font-awesome/fonts/fontawesome-webfont.svg b/docs/lib/font-awesome/fonts/fontawesome-webfont.svg
new file mode 100644
index 0000000..855c845
--- /dev/null
+++ b/docs/lib/font-awesome/fonts/fontawesome-webfont.svg
@@ -0,0 +1,2671 @@
+<?xml version="1.0" standalone="no"?>
+<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" >
+<svg>
+<metadata>
+Created by FontForge 20120731 at Mon Oct 24 17:37:40 2016
+ By ,,,
+Copyright Dave Gandy 2016. All rights reserved.
+</metadata>
+<defs>
+<font id="FontAwesome" horiz-adv-x="1536" >
+  <font-face 
+    font-family="FontAwesome"
+    font-weight="400"
+    font-stretch="normal"
+    units-per-em="1792"
+    panose-1="0 0 0 0 0 0 0 0 0 0"
+    ascent="1536"
+    descent="-256"
+    bbox="-1.02083 -256.962 2304.6 1537.02"
+    underline-thickness="0"
+    underline-position="0"
+    unicode-range="U+0020-F500"
+  />
+<missing-glyph horiz-adv-x="896" 
+d="M224 112h448v1312h-448v-1312zM112 0v1536h672v-1536h-672z" />
+    <glyph glyph-name=".notdef" horiz-adv-x="896" 
+d="M224 112h448v1312h-448v-1312zM112 0v1536h672v-1536h-672z" />
+    <glyph glyph-name=".null" horiz-adv-x="0" 
+ />
+    <glyph glyph-name="nonmarkingreturn" horiz-adv-x="597" 
+ />
+    <glyph glyph-name="space" unicode=" " horiz-adv-x="448" 
+ />
+    <glyph glyph-name="dieresis" unicode="&#xa8;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="copyright" unicode="&#xa9;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="registered" unicode="&#xae;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="acute" unicode="&#xb4;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="AE" unicode="&#xc6;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="Oslash" unicode="&#xd8;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="trademark" unicode="&#x2122;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="infinity" unicode="&#x221e;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="notequal" unicode="&#x2260;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="glass" unicode="&#xf000;" horiz-adv-x="1792" 
+d="M1699 1350q0 -35 -43 -78l-632 -632v-768h320q26 0 45 -19t19 -45t-19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45t45 19h320v768l-632 632q-43 43 -43 78q0 23 18 36.5t38 17.5t43 4h1408q23 0 43 -4t38 -17.5t18 -36.5z" />
+    <glyph glyph-name="music" unicode="&#xf001;" 
+d="M1536 1312v-1120q0 -50 -34 -89t-86 -60.5t-103.5 -32t-96.5 -10.5t-96.5 10.5t-103.5 32t-86 60.5t-34 89t34 89t86 60.5t103.5 32t96.5 10.5q105 0 192 -39v537l-768 -237v-709q0 -50 -34 -89t-86 -60.5t-103.5 -32t-96.5 -10.5t-96.5 10.5t-103.5 32t-86 60.5t-34 89
+t34 89t86 60.5t103.5 32t96.5 10.5q105 0 192 -39v967q0 31 19 56.5t49 35.5l832 256q12 4 28 4q40 0 68 -28t28 -68z" />
+    <glyph glyph-name="search" unicode="&#xf002;" horiz-adv-x="1664" 
+d="M1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5zM1664 -128q0 -52 -38 -90t-90 -38q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5
+t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z" />
+    <glyph glyph-name="envelope" unicode="&#xf003;" horiz-adv-x="1792" 
+d="M1664 32v768q-32 -36 -69 -66q-268 -206 -426 -338q-51 -43 -83 -67t-86.5 -48.5t-102.5 -24.5h-1h-1q-48 0 -102.5 24.5t-86.5 48.5t-83 67q-158 132 -426 338q-37 30 -69 66v-768q0 -13 9.5 -22.5t22.5 -9.5h1472q13 0 22.5 9.5t9.5 22.5zM1664 1083v11v13.5t-0.5 13
+t-3 12.5t-5.5 9t-9 7.5t-14 2.5h-1472q-13 0 -22.5 -9.5t-9.5 -22.5q0 -168 147 -284q193 -152 401 -317q6 -5 35 -29.5t46 -37.5t44.5 -31.5t50.5 -27.5t43 -9h1h1q20 0 43 9t50.5 27.5t44.5 31.5t46 37.5t35 29.5q208 165 401 317q54 43 100.5 115.5t46.5 131.5z
+M1792 1120v-1088q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1472q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="heart" unicode="&#xf004;" horiz-adv-x="1792" 
+d="M896 -128q-26 0 -44 18l-624 602q-10 8 -27.5 26t-55.5 65.5t-68 97.5t-53.5 121t-23.5 138q0 220 127 344t351 124q62 0 126.5 -21.5t120 -58t95.5 -68.5t76 -68q36 36 76 68t95.5 68.5t120 58t126.5 21.5q224 0 351 -124t127 -344q0 -221 -229 -450l-623 -600
+q-18 -18 -44 -18z" />
+    <glyph glyph-name="star" unicode="&#xf005;" horiz-adv-x="1664" 
+d="M1664 889q0 -22 -26 -48l-363 -354l86 -500q1 -7 1 -20q0 -21 -10.5 -35.5t-30.5 -14.5q-19 0 -40 12l-449 236l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41t49 -41l225 -455
+l502 -73q56 -9 56 -46z" />
+    <glyph glyph-name="star_empty" unicode="&#xf006;" horiz-adv-x="1664" 
+d="M1137 532l306 297l-422 62l-189 382l-189 -382l-422 -62l306 -297l-73 -421l378 199l377 -199zM1664 889q0 -22 -26 -48l-363 -354l86 -500q1 -7 1 -20q0 -50 -41 -50q-19 0 -40 12l-449 236l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500
+l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41t49 -41l225 -455l502 -73q56 -9 56 -46z" />
+    <glyph glyph-name="user" unicode="&#xf007;" horiz-adv-x="1280" 
+d="M1280 137q0 -109 -62.5 -187t-150.5 -78h-854q-88 0 -150.5 78t-62.5 187q0 85 8.5 160.5t31.5 152t58.5 131t94 89t134.5 34.5q131 -128 313 -128t313 128q76 0 134.5 -34.5t94 -89t58.5 -131t31.5 -152t8.5 -160.5zM1024 1024q0 -159 -112.5 -271.5t-271.5 -112.5
+t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5z" />
+    <glyph glyph-name="film" unicode="&#xf008;" horiz-adv-x="1920" 
+d="M384 -64v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM384 320v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM384 704v128q0 26 -19 45t-45 19h-128
+q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1408 -64v512q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-512q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM384 1088v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45
+t45 -19h128q26 0 45 19t19 45zM1792 -64v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1408 704v512q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-512q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM1792 320v128
+q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1792 704v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1792 1088v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19
+t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1920 1248v-1344q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1344q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="th_large" unicode="&#xf009;" horiz-adv-x="1664" 
+d="M768 512v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM768 1280v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM1664 512v-384q0 -52 -38 -90t-90 -38
+h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM1664 1280v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="th" unicode="&#xf00a;" horiz-adv-x="1792" 
+d="M512 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 288v-192q0 -40 -28 -68t-68 -28h-320
+q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28
+h320q40 0 68 -28t28 -68zM1792 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 800v-192
+q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68z" />
+    <glyph glyph-name="th_list" unicode="&#xf00b;" horiz-adv-x="1792" 
+d="M512 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 288v-192q0 -40 -28 -68t-68 -28h-960
+q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h960q40 0 68 -28t28 -68zM512 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 800v-192q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v192q0 40 28 68t68 28
+h960q40 0 68 -28t28 -68zM1792 1312v-192q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h960q40 0 68 -28t28 -68z" />
+    <glyph glyph-name="ok" unicode="&#xf00c;" horiz-adv-x="1792" 
+d="M1671 970q0 -40 -28 -68l-724 -724l-136 -136q-28 -28 -68 -28t-68 28l-136 136l-362 362q-28 28 -28 68t28 68l136 136q28 28 68 28t68 -28l294 -295l656 657q28 28 68 28t68 -28l136 -136q28 -28 28 -68z" />
+    <glyph glyph-name="remove" unicode="&#xf00d;" horiz-adv-x="1408" 
+d="M1298 214q0 -40 -28 -68l-136 -136q-28 -28 -68 -28t-68 28l-294 294l-294 -294q-28 -28 -68 -28t-68 28l-136 136q-28 28 -28 68t28 68l294 294l-294 294q-28 28 -28 68t28 68l136 136q28 28 68 28t68 -28l294 -294l294 294q28 28 68 28t68 -28l136 -136q28 -28 28 -68
+t-28 -68l-294 -294l294 -294q28 -28 28 -68z" />
+    <glyph glyph-name="zoom_in" unicode="&#xf00e;" horiz-adv-x="1664" 
+d="M1024 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-224v-224q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v224h-224q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h224v224q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5v-224h224
+q13 0 22.5 -9.5t9.5 -22.5zM1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5zM1664 -128q0 -53 -37.5 -90.5t-90.5 -37.5q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5
+t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z" />
+    <glyph glyph-name="zoom_out" unicode="&#xf010;" horiz-adv-x="1664" 
+d="M1024 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-576q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h576q13 0 22.5 -9.5t9.5 -22.5zM1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5z
+M1664 -128q0 -53 -37.5 -90.5t-90.5 -37.5q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z
+" />
+    <glyph glyph-name="off" unicode="&#xf011;" 
+d="M1536 640q0 -156 -61 -298t-164 -245t-245 -164t-298 -61t-298 61t-245 164t-164 245t-61 298q0 182 80.5 343t226.5 270q43 32 95.5 25t83.5 -50q32 -42 24.5 -94.5t-49.5 -84.5q-98 -74 -151.5 -181t-53.5 -228q0 -104 40.5 -198.5t109.5 -163.5t163.5 -109.5
+t198.5 -40.5t198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5q0 121 -53.5 228t-151.5 181q-42 32 -49.5 84.5t24.5 94.5q31 43 84 50t95 -25q146 -109 226.5 -270t80.5 -343zM896 1408v-640q0 -52 -38 -90t-90 -38t-90 38t-38 90v640q0 52 38 90t90 38t90 -38t38 -90z" />
+    <glyph glyph-name="signal" unicode="&#xf012;" horiz-adv-x="1792" 
+d="M256 96v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM640 224v-320q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v320q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1024 480v-576q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23
+v576q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1408 864v-960q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v960q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1792 1376v-1472q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v1472q0 14 9 23t23 9h192q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="cog" unicode="&#xf013;" 
+d="M1024 640q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1536 749v-222q0 -12 -8 -23t-20 -13l-185 -28q-19 -54 -39 -91q35 -50 107 -138q10 -12 10 -25t-9 -23q-27 -37 -99 -108t-94 -71q-12 0 -26 9l-138 108q-44 -23 -91 -38
+q-16 -136 -29 -186q-7 -28 -36 -28h-222q-14 0 -24.5 8.5t-11.5 21.5l-28 184q-49 16 -90 37l-141 -107q-10 -9 -25 -9q-14 0 -25 11q-126 114 -165 168q-7 10 -7 23q0 12 8 23q15 21 51 66.5t54 70.5q-27 50 -41 99l-183 27q-13 2 -21 12.5t-8 23.5v222q0 12 8 23t19 13
+l186 28q14 46 39 92q-40 57 -107 138q-10 12 -10 24q0 10 9 23q26 36 98.5 107.5t94.5 71.5q13 0 26 -10l138 -107q44 23 91 38q16 136 29 186q7 28 36 28h222q14 0 24.5 -8.5t11.5 -21.5l28 -184q49 -16 90 -37l142 107q9 9 24 9q13 0 25 -10q129 -119 165 -170q7 -8 7 -22
+q0 -12 -8 -23q-15 -21 -51 -66.5t-54 -70.5q26 -50 41 -98l183 -28q13 -2 21 -12.5t8 -23.5z" />
+    <glyph glyph-name="trash" unicode="&#xf014;" horiz-adv-x="1408" 
+d="M512 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM768 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1024 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576
+q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1152 76v948h-896v-948q0 -22 7 -40.5t14.5 -27t10.5 -8.5h832q3 0 10.5 8.5t14.5 27t7 40.5zM480 1152h448l-48 117q-7 9 -17 11h-317q-10 -2 -17 -11zM1408 1120v-64q0 -14 -9 -23t-23 -9h-96v-948q0 -83 -47 -143.5t-113 -60.5h-832
+q-66 0 -113 58.5t-47 141.5v952h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h309l70 167q15 37 54 63t79 26h320q40 0 79 -26t54 -63l70 -167h309q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="home" unicode="&#xf015;" horiz-adv-x="1664" 
+d="M1408 544v-480q0 -26 -19 -45t-45 -19h-384v384h-256v-384h-384q-26 0 -45 19t-19 45v480q0 1 0.5 3t0.5 3l575 474l575 -474q1 -2 1 -6zM1631 613l-62 -74q-8 -9 -21 -11h-3q-13 0 -21 7l-692 577l-692 -577q-12 -8 -24 -7q-13 2 -21 11l-62 74q-8 10 -7 23.5t11 21.5
+l719 599q32 26 76 26t76 -26l244 -204v195q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-408l219 -182q10 -8 11 -21.5t-7 -23.5z" />
+    <glyph glyph-name="file_alt" unicode="&#xf016;" 
+d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z
+" />
+    <glyph glyph-name="time" unicode="&#xf017;" 
+d="M896 992v-448q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h224v352q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640
+q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="road" unicode="&#xf018;" horiz-adv-x="1920" 
+d="M1111 540v4l-24 320q-1 13 -11 22.5t-23 9.5h-186q-13 0 -23 -9.5t-11 -22.5l-24 -320v-4q-1 -12 8 -20t21 -8h244q12 0 21 8t8 20zM1870 73q0 -73 -46 -73h-704q13 0 22 9.5t8 22.5l-20 256q-1 13 -11 22.5t-23 9.5h-272q-13 0 -23 -9.5t-11 -22.5l-20 -256
+q-1 -13 8 -22.5t22 -9.5h-704q-46 0 -46 73q0 54 26 116l417 1044q8 19 26 33t38 14h339q-13 0 -23 -9.5t-11 -22.5l-15 -192q-1 -14 8 -23t22 -9h166q13 0 22 9t8 23l-15 192q-1 13 -11 22.5t-23 9.5h339q20 0 38 -14t26 -33l417 -1044q26 -62 26 -116z" />
+    <glyph glyph-name="download_alt" unicode="&#xf019;" horiz-adv-x="1664" 
+d="M1280 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 416v-320q0 -40 -28 -68t-68 -28h-1472q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h465l135 -136
+q58 -56 136 -56t136 56l136 136h464q40 0 68 -28t28 -68zM1339 985q17 -41 -14 -70l-448 -448q-18 -19 -45 -19t-45 19l-448 448q-31 29 -14 70q17 39 59 39h256v448q0 26 19 45t45 19h256q26 0 45 -19t19 -45v-448h256q42 0 59 -39z" />
+    <glyph glyph-name="download" unicode="&#xf01a;" 
+d="M1120 608q0 -12 -10 -24l-319 -319q-11 -9 -23 -9t-23 9l-320 320q-15 16 -7 35q8 20 30 20h192v352q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-352h192q14 0 23 -9t9 -23zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273
+t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="upload" unicode="&#xf01b;" 
+d="M1118 660q-8 -20 -30 -20h-192v-352q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v352h-192q-14 0 -23 9t-9 23q0 12 10 24l319 319q11 9 23 9t23 -9l320 -320q15 -16 7 -35zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198
+t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="inbox" unicode="&#xf01c;" 
+d="M1023 576h316q-1 3 -2.5 8.5t-2.5 7.5l-212 496h-708l-212 -496q-1 -3 -2.5 -8.5t-2.5 -7.5h316l95 -192h320zM1536 546v-482q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v482q0 62 25 123l238 552q10 25 36.5 42t52.5 17h832q26 0 52.5 -17t36.5 -42l238 -552
+q25 -61 25 -123z" />
+    <glyph glyph-name="play_circle" unicode="&#xf01d;" 
+d="M1184 640q0 -37 -32 -55l-544 -320q-15 -9 -32 -9q-16 0 -32 8q-32 19 -32 56v640q0 37 32 56q33 18 64 -1l544 -320q32 -18 32 -55zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640
+q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="repeat" unicode="&#xf01e;" 
+d="M1536 1280v-448q0 -26 -19 -45t-45 -19h-448q-42 0 -59 40q-17 39 14 69l138 138q-148 137 -349 137q-104 0 -198.5 -40.5t-163.5 -109.5t-109.5 -163.5t-40.5 -198.5t40.5 -198.5t109.5 -163.5t163.5 -109.5t198.5 -40.5q119 0 225 52t179 147q7 10 23 12q15 0 25 -9
+l137 -138q9 -8 9.5 -20.5t-7.5 -22.5q-109 -132 -264 -204.5t-327 -72.5q-156 0 -298 61t-245 164t-164 245t-61 298t61 298t164 245t245 164t298 61q147 0 284.5 -55.5t244.5 -156.5l130 129q29 31 70 14q39 -17 39 -59z" />
+    <glyph glyph-name="refresh" unicode="&#xf021;" 
+d="M1511 480q0 -5 -1 -7q-64 -268 -268 -434.5t-478 -166.5q-146 0 -282.5 55t-243.5 157l-129 -129q-19 -19 -45 -19t-45 19t-19 45v448q0 26 19 45t45 19h448q26 0 45 -19t19 -45t-19 -45l-137 -137q71 -66 161 -102t187 -36q134 0 250 65t186 179q11 17 53 117
+q8 23 30 23h192q13 0 22.5 -9.5t9.5 -22.5zM1536 1280v-448q0 -26 -19 -45t-45 -19h-448q-26 0 -45 19t-19 45t19 45l138 138q-148 137 -349 137q-134 0 -250 -65t-186 -179q-11 -17 -53 -117q-8 -23 -30 -23h-199q-13 0 -22.5 9.5t-9.5 22.5v7q65 268 270 434.5t480 166.5
+q146 0 284 -55.5t245 -156.5l130 129q19 19 45 19t45 -19t19 -45z" />
+    <glyph glyph-name="list_alt" unicode="&#xf022;" horiz-adv-x="1792" 
+d="M384 352v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 608v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M384 864v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1536 352v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5t9.5 -22.5z
+M1536 608v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5t9.5 -22.5zM1536 864v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5
+t9.5 -22.5zM1664 160v832q0 13 -9.5 22.5t-22.5 9.5h-1472q-13 0 -22.5 -9.5t-9.5 -22.5v-832q0 -13 9.5 -22.5t22.5 -9.5h1472q13 0 22.5 9.5t9.5 22.5zM1792 1248v-1088q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1472q66 0 113 -47
+t47 -113z" />
+    <glyph glyph-name="lock" unicode="&#xf023;" horiz-adv-x="1152" 
+d="M320 768h512v192q0 106 -75 181t-181 75t-181 -75t-75 -181v-192zM1152 672v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h32v192q0 184 132 316t316 132t316 -132t132 -316v-192h32q40 0 68 -28t28 -68z" />
+    <glyph glyph-name="flag" unicode="&#xf024;" horiz-adv-x="1792" 
+d="M320 1280q0 -72 -64 -110v-1266q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v1266q-64 38 -64 110q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -25 -12.5 -38.5t-39.5 -27.5q-215 -116 -369 -116q-61 0 -123.5 22t-108.5 48
+t-115.5 48t-142.5 22q-192 0 -464 -146q-17 -9 -33 -9q-26 0 -45 19t-19 45v742q0 32 31 55q21 14 79 43q236 120 421 120q107 0 200 -29t219 -88q38 -19 88 -19q54 0 117.5 21t110 47t88 47t54.5 21q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="headphones" unicode="&#xf025;" horiz-adv-x="1664" 
+d="M1664 650q0 -166 -60 -314l-20 -49l-185 -33q-22 -83 -90.5 -136.5t-156.5 -53.5v-32q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-32q71 0 130 -35.5t93 -95.5l68 12q29 95 29 193q0 148 -88 279t-236.5 209t-315.5 78
+t-315.5 -78t-236.5 -209t-88 -279q0 -98 29 -193l68 -12q34 60 93 95.5t130 35.5v32q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v32q-88 0 -156.5 53.5t-90.5 136.5l-185 33l-20 49q-60 148 -60 314q0 151 67 291t179 242.5
+t266 163.5t320 61t320 -61t266 -163.5t179 -242.5t67 -291z" />
+    <glyph glyph-name="volume_off" unicode="&#xf026;" horiz-adv-x="768" 
+d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45z" />
+    <glyph glyph-name="volume_down" unicode="&#xf027;" horiz-adv-x="1152" 
+d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45zM1152 640q0 -76 -42.5 -141.5t-112.5 -93.5q-10 -5 -25 -5q-26 0 -45 18.5t-19 45.5q0 21 12 35.5t29 25t34 23t29 36
+t12 56.5t-12 56.5t-29 36t-34 23t-29 25t-12 35.5q0 27 19 45.5t45 18.5q15 0 25 -5q70 -27 112.5 -93t42.5 -142z" />
+    <glyph glyph-name="volume_up" unicode="&#xf028;" horiz-adv-x="1664" 
+d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45zM1152 640q0 -76 -42.5 -141.5t-112.5 -93.5q-10 -5 -25 -5q-26 0 -45 18.5t-19 45.5q0 21 12 35.5t29 25t34 23t29 36
+t12 56.5t-12 56.5t-29 36t-34 23t-29 25t-12 35.5q0 27 19 45.5t45 18.5q15 0 25 -5q70 -27 112.5 -93t42.5 -142zM1408 640q0 -153 -85 -282.5t-225 -188.5q-13 -5 -25 -5q-27 0 -46 19t-19 45q0 39 39 59q56 29 76 44q74 54 115.5 135.5t41.5 173.5t-41.5 173.5
+t-115.5 135.5q-20 15 -76 44q-39 20 -39 59q0 26 19 45t45 19q13 0 26 -5q140 -59 225 -188.5t85 -282.5zM1664 640q0 -230 -127 -422.5t-338 -283.5q-13 -5 -26 -5q-26 0 -45 19t-19 45q0 36 39 59q7 4 22.5 10.5t22.5 10.5q46 25 82 51q123 91 192 227t69 289t-69 289
+t-192 227q-36 26 -82 51q-7 4 -22.5 10.5t-22.5 10.5q-39 23 -39 59q0 26 19 45t45 19q13 0 26 -5q211 -91 338 -283.5t127 -422.5z" />
+    <glyph glyph-name="qrcode" unicode="&#xf029;" horiz-adv-x="1408" 
+d="M384 384v-128h-128v128h128zM384 1152v-128h-128v128h128zM1152 1152v-128h-128v128h128zM128 129h384v383h-384v-383zM128 896h384v384h-384v-384zM896 896h384v384h-384v-384zM640 640v-640h-640v640h640zM1152 128v-128h-128v128h128zM1408 128v-128h-128v128h128z
+M1408 640v-384h-384v128h-128v-384h-128v640h384v-128h128v128h128zM640 1408v-640h-640v640h640zM1408 1408v-640h-640v640h640z" />
+    <glyph glyph-name="barcode" unicode="&#xf02a;" horiz-adv-x="1792" 
+d="M63 0h-63v1408h63v-1408zM126 1h-32v1407h32v-1407zM220 1h-31v1407h31v-1407zM377 1h-31v1407h31v-1407zM534 1h-62v1407h62v-1407zM660 1h-31v1407h31v-1407zM723 1h-31v1407h31v-1407zM786 1h-31v1407h31v-1407zM943 1h-63v1407h63v-1407zM1100 1h-63v1407h63v-1407z
+M1226 1h-63v1407h63v-1407zM1352 1h-63v1407h63v-1407zM1446 1h-63v1407h63v-1407zM1635 1h-94v1407h94v-1407zM1698 1h-32v1407h32v-1407zM1792 0h-63v1408h63v-1408z" />
+    <glyph glyph-name="tag" unicode="&#xf02b;" 
+d="M448 1088q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1515 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-53 0 -90 37l-715 716q-38 37 -64.5 101t-26.5 117v416q0 52 38 90t90 38h416q53 0 117 -26.5t102 -64.5
+l715 -714q37 -39 37 -91z" />
+    <glyph glyph-name="tags" unicode="&#xf02c;" horiz-adv-x="1920" 
+d="M448 1088q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1515 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-53 0 -90 37l-715 716q-38 37 -64.5 101t-26.5 117v416q0 52 38 90t90 38h416q53 0 117 -26.5t102 -64.5
+l715 -714q37 -39 37 -91zM1899 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-36 0 -59 14t-53 45l470 470q37 37 37 90q0 52 -37 91l-715 714q-38 38 -102 64.5t-117 26.5h224q53 0 117 -26.5t102 -64.5l715 -714q37 -39 37 -91z" />
+    <glyph glyph-name="book" unicode="&#xf02d;" horiz-adv-x="1664" 
+d="M1639 1058q40 -57 18 -129l-275 -906q-19 -64 -76.5 -107.5t-122.5 -43.5h-923q-77 0 -148.5 53.5t-99.5 131.5q-24 67 -2 127q0 4 3 27t4 37q1 8 -3 21.5t-3 19.5q2 11 8 21t16.5 23.5t16.5 23.5q23 38 45 91.5t30 91.5q3 10 0.5 30t-0.5 28q3 11 17 28t17 23
+q21 36 42 92t25 90q1 9 -2.5 32t0.5 28q4 13 22 30.5t22 22.5q19 26 42.5 84.5t27.5 96.5q1 8 -3 25.5t-2 26.5q2 8 9 18t18 23t17 21q8 12 16.5 30.5t15 35t16 36t19.5 32t26.5 23.5t36 11.5t47.5 -5.5l-1 -3q38 9 51 9h761q74 0 114 -56t18 -130l-274 -906
+q-36 -119 -71.5 -153.5t-128.5 -34.5h-869q-27 0 -38 -15q-11 -16 -1 -43q24 -70 144 -70h923q29 0 56 15.5t35 41.5l300 987q7 22 5 57q38 -15 59 -43zM575 1056q-4 -13 2 -22.5t20 -9.5h608q13 0 25.5 9.5t16.5 22.5l21 64q4 13 -2 22.5t-20 9.5h-608q-13 0 -25.5 -9.5
+t-16.5 -22.5zM492 800q-4 -13 2 -22.5t20 -9.5h608q13 0 25.5 9.5t16.5 22.5l21 64q4 13 -2 22.5t-20 9.5h-608q-13 0 -25.5 -9.5t-16.5 -22.5z" />
+    <glyph glyph-name="bookmark" unicode="&#xf02e;" horiz-adv-x="1280" 
+d="M1164 1408q23 0 44 -9q33 -13 52.5 -41t19.5 -62v-1289q0 -34 -19.5 -62t-52.5 -41q-19 -8 -44 -8q-48 0 -83 32l-441 424l-441 -424q-36 -33 -83 -33q-23 0 -44 9q-33 13 -52.5 41t-19.5 62v1289q0 34 19.5 62t52.5 41q21 9 44 9h1048z" />
+    <glyph glyph-name="print" unicode="&#xf02f;" horiz-adv-x="1664" 
+d="M384 0h896v256h-896v-256zM384 640h896v384h-160q-40 0 -68 28t-28 68v160h-640v-640zM1536 576q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 576v-416q0 -13 -9.5 -22.5t-22.5 -9.5h-224v-160q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68
+v160h-224q-13 0 -22.5 9.5t-9.5 22.5v416q0 79 56.5 135.5t135.5 56.5h64v544q0 40 28 68t68 28h672q40 0 88 -20t76 -48l152 -152q28 -28 48 -76t20 -88v-256h64q79 0 135.5 -56.5t56.5 -135.5z" />
+    <glyph glyph-name="camera" unicode="&#xf030;" horiz-adv-x="1920" 
+d="M960 864q119 0 203.5 -84.5t84.5 -203.5t-84.5 -203.5t-203.5 -84.5t-203.5 84.5t-84.5 203.5t84.5 203.5t203.5 84.5zM1664 1280q106 0 181 -75t75 -181v-896q0 -106 -75 -181t-181 -75h-1408q-106 0 -181 75t-75 181v896q0 106 75 181t181 75h224l51 136
+q19 49 69.5 84.5t103.5 35.5h512q53 0 103.5 -35.5t69.5 -84.5l51 -136h224zM960 128q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" />
+    <glyph glyph-name="font" unicode="&#xf031;" horiz-adv-x="1664" 
+d="M725 977l-170 -450q33 0 136.5 -2t160.5 -2q19 0 57 2q-87 253 -184 452zM0 -128l2 79q23 7 56 12.5t57 10.5t49.5 14.5t44.5 29t31 50.5l237 616l280 724h75h53q8 -14 11 -21l205 -480q33 -78 106 -257.5t114 -274.5q15 -34 58 -144.5t72 -168.5q20 -45 35 -57
+q19 -15 88 -29.5t84 -20.5q6 -38 6 -57q0 -5 -0.5 -13.5t-0.5 -12.5q-63 0 -190 8t-191 8q-76 0 -215 -7t-178 -8q0 43 4 78l131 28q1 0 12.5 2.5t15.5 3.5t14.5 4.5t15 6.5t11 8t9 11t2.5 14q0 16 -31 96.5t-72 177.5t-42 100l-450 2q-26 -58 -76.5 -195.5t-50.5 -162.5
+q0 -22 14 -37.5t43.5 -24.5t48.5 -13.5t57 -8.5t41 -4q1 -19 1 -58q0 -9 -2 -27q-58 0 -174.5 10t-174.5 10q-8 0 -26.5 -4t-21.5 -4q-80 -14 -188 -14z" />
+    <glyph glyph-name="bold" unicode="&#xf032;" horiz-adv-x="1408" 
+d="M555 15q74 -32 140 -32q376 0 376 335q0 114 -41 180q-27 44 -61.5 74t-67.5 46.5t-80.5 25t-84 10.5t-94.5 2q-73 0 -101 -10q0 -53 -0.5 -159t-0.5 -158q0 -8 -1 -67.5t-0.5 -96.5t4.5 -83.5t12 -66.5zM541 761q42 -7 109 -7q82 0 143 13t110 44.5t74.5 89.5t25.5 142
+q0 70 -29 122.5t-79 82t-108 43.5t-124 14q-50 0 -130 -13q0 -50 4 -151t4 -152q0 -27 -0.5 -80t-0.5 -79q0 -46 1 -69zM0 -128l2 94q15 4 85 16t106 27q7 12 12.5 27t8.5 33.5t5.5 32.5t3 37.5t0.5 34v35.5v30q0 982 -22 1025q-4 8 -22 14.5t-44.5 11t-49.5 7t-48.5 4.5
+t-30.5 3l-4 83q98 2 340 11.5t373 9.5q23 0 68 -0.5t68 -0.5q70 0 136.5 -13t128.5 -42t108 -71t74 -104.5t28 -137.5q0 -52 -16.5 -95.5t-39 -72t-64.5 -57.5t-73 -45t-84 -40q154 -35 256.5 -134t102.5 -248q0 -100 -35 -179.5t-93.5 -130.5t-138 -85.5t-163.5 -48.5
+t-176 -14q-44 0 -132 3t-132 3q-106 0 -307 -11t-231 -12z" />
+    <glyph glyph-name="italic" unicode="&#xf033;" horiz-adv-x="1024" 
+d="M0 -126l17 85q22 7 61.5 16.5t72 19t59.5 23.5q28 35 41 101q1 7 62 289t114 543.5t52 296.5v25q-24 13 -54.5 18.5t-69.5 8t-58 5.5l19 103q33 -2 120 -6.5t149.5 -7t120.5 -2.5q48 0 98.5 2.5t121 7t98.5 6.5q-5 -39 -19 -89q-30 -10 -101.5 -28.5t-108.5 -33.5
+q-8 -19 -14 -42.5t-9 -40t-7.5 -45.5t-6.5 -42q-27 -148 -87.5 -419.5t-77.5 -355.5q-2 -9 -13 -58t-20 -90t-16 -83.5t-6 -57.5l1 -18q17 -4 185 -31q-3 -44 -16 -99q-11 0 -32.5 -1.5t-32.5 -1.5q-29 0 -87 10t-86 10q-138 2 -206 2q-51 0 -143 -9t-121 -11z" />
+    <glyph glyph-name="text_height" unicode="&#xf034;" horiz-adv-x="1792" 
+d="M1744 128q33 0 42 -18.5t-11 -44.5l-126 -162q-20 -26 -49 -26t-49 26l-126 162q-20 26 -11 44.5t42 18.5h80v1024h-80q-33 0 -42 18.5t11 44.5l126 162q20 26 49 26t49 -26l126 -162q20 -26 11 -44.5t-42 -18.5h-80v-1024h80zM81 1407l54 -27q12 -5 211 -5q44 0 132 2
+t132 2q36 0 107.5 -0.5t107.5 -0.5h293q6 0 21 -0.5t20.5 0t16 3t17.5 9t15 17.5l42 1q4 0 14 -0.5t14 -0.5q2 -112 2 -336q0 -80 -5 -109q-39 -14 -68 -18q-25 44 -54 128q-3 9 -11 48t-14.5 73.5t-7.5 35.5q-6 8 -12 12.5t-15.5 6t-13 2.5t-18 0.5t-16.5 -0.5
+q-17 0 -66.5 0.5t-74.5 0.5t-64 -2t-71 -6q-9 -81 -8 -136q0 -94 2 -388t2 -455q0 -16 -2.5 -71.5t0 -91.5t12.5 -69q40 -21 124 -42.5t120 -37.5q5 -40 5 -50q0 -14 -3 -29l-34 -1q-76 -2 -218 8t-207 10q-50 0 -151 -9t-152 -9q-3 51 -3 52v9q17 27 61.5 43t98.5 29t78 27
+q19 42 19 383q0 101 -3 303t-3 303v117q0 2 0.5 15.5t0.5 25t-1 25.5t-3 24t-5 14q-11 12 -162 12q-33 0 -93 -12t-80 -26q-19 -13 -34 -72.5t-31.5 -111t-42.5 -53.5q-42 26 -56 44v383z" />
+    <glyph glyph-name="text_width" unicode="&#xf035;" 
+d="M81 1407l54 -27q12 -5 211 -5q44 0 132 2t132 2q70 0 246.5 1t304.5 0.5t247 -4.5q33 -1 56 31l42 1q4 0 14 -0.5t14 -0.5q2 -112 2 -336q0 -80 -5 -109q-39 -14 -68 -18q-25 44 -54 128q-3 9 -11 47.5t-15 73.5t-7 36q-10 13 -27 19q-5 2 -66 2q-30 0 -93 1t-103 1
+t-94 -2t-96 -7q-9 -81 -8 -136l1 -152v52q0 -55 1 -154t1.5 -180t0.5 -153q0 -16 -2.5 -71.5t0 -91.5t12.5 -69q40 -21 124 -42.5t120 -37.5q5 -40 5 -50q0 -14 -3 -29l-34 -1q-76 -2 -218 8t-207 10q-50 0 -151 -9t-152 -9q-3 51 -3 52v9q17 27 61.5 43t98.5 29t78 27
+q7 16 11.5 74t6 145.5t1.5 155t-0.5 153.5t-0.5 89q0 7 -2.5 21.5t-2.5 22.5q0 7 0.5 44t1 73t0 76.5t-3 67.5t-6.5 32q-11 12 -162 12q-41 0 -163 -13.5t-138 -24.5q-19 -12 -34 -71.5t-31.5 -111.5t-42.5 -54q-42 26 -56 44v383zM1310 125q12 0 42 -19.5t57.5 -41.5
+t59.5 -49t36 -30q26 -21 26 -49t-26 -49q-4 -3 -36 -30t-59.5 -49t-57.5 -41.5t-42 -19.5q-13 0 -20.5 10.5t-10 28.5t-2.5 33.5t1.5 33t1.5 19.5h-1024q0 -2 1.5 -19.5t1.5 -33t-2.5 -33.5t-10 -28.5t-20.5 -10.5q-12 0 -42 19.5t-57.5 41.5t-59.5 49t-36 30q-26 21 -26 49
+t26 49q4 3 36 30t59.5 49t57.5 41.5t42 19.5q13 0 20.5 -10.5t10 -28.5t2.5 -33.5t-1.5 -33t-1.5 -19.5h1024q0 2 -1.5 19.5t-1.5 33t2.5 33.5t10 28.5t20.5 10.5z" />
+    <glyph glyph-name="align_left" unicode="&#xf036;" horiz-adv-x="1792" 
+d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1408 576v-128q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1280q26 0 45 -19t19 -45zM1664 960v-128q0 -26 -19 -45
+t-45 -19h-1536q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1536q26 0 45 -19t19 -45zM1280 1344v-128q0 -26 -19 -45t-45 -19h-1152q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="align_center" unicode="&#xf037;" horiz-adv-x="1792" 
+d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1408 576v-128q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h896q26 0 45 -19t19 -45zM1664 960v-128q0 -26 -19 -45t-45 -19
+h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1280 1344v-128q0 -26 -19 -45t-45 -19h-640q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h640q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="align_right" unicode="&#xf038;" horiz-adv-x="1792" 
+d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 576v-128q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1280q26 0 45 -19t19 -45zM1792 960v-128q0 -26 -19 -45
+t-45 -19h-1536q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1536q26 0 45 -19t19 -45zM1792 1344v-128q0 -26 -19 -45t-45 -19h-1152q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="align_justify" unicode="&#xf039;" horiz-adv-x="1792" 
+d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 576v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 960v-128q0 -26 -19 -45
+t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 1344v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="list" unicode="&#xf03a;" horiz-adv-x="1792" 
+d="M256 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM256 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5
+t9.5 -22.5zM256 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1344
+q13 0 22.5 -9.5t9.5 -22.5zM256 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5
+t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192
+q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5z" />
+    <glyph glyph-name="indent_left" unicode="&#xf03b;" horiz-adv-x="1792" 
+d="M384 992v-576q0 -13 -9.5 -22.5t-22.5 -9.5q-14 0 -23 9l-288 288q-9 9 -9 23t9 23l288 288q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5
+t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088
+q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5t9.5 -22.5z" />
+    <glyph glyph-name="indent_right" unicode="&#xf03c;" horiz-adv-x="1792" 
+d="M352 704q0 -14 -9 -23l-288 -288q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v576q0 13 9.5 22.5t22.5 9.5q14 0 23 -9l288 -288q9 -9 9 -23zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5
+t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088
+q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5t9.5 -22.5z" />
+    <glyph glyph-name="facetime_video" unicode="&#xf03d;" horiz-adv-x="1792" 
+d="M1792 1184v-1088q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-403 403v-166q0 -119 -84.5 -203.5t-203.5 -84.5h-704q-119 0 -203.5 84.5t-84.5 203.5v704q0 119 84.5 203.5t203.5 84.5h704q119 0 203.5 -84.5t84.5 -203.5v-165l403 402q18 19 45 19q12 0 25 -5
+q39 -17 39 -59z" />
+    <glyph glyph-name="picture" unicode="&#xf03e;" horiz-adv-x="1920" 
+d="M640 960q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1664 576v-448h-1408v192l320 320l160 -160l512 512zM1760 1280h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-1216q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5v1216
+q0 13 -9.5 22.5t-22.5 9.5zM1920 1248v-1216q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="pencil" unicode="&#xf040;" 
+d="M363 0l91 91l-235 235l-91 -91v-107h128v-128h107zM886 928q0 22 -22 22q-10 0 -17 -7l-542 -542q-7 -7 -7 -17q0 -22 22 -22q10 0 17 7l542 542q7 7 7 17zM832 1120l416 -416l-832 -832h-416v416zM1515 1024q0 -53 -37 -90l-166 -166l-416 416l166 165q36 38 90 38
+q53 0 91 -38l235 -234q37 -39 37 -91z" />
+    <glyph glyph-name="map_marker" unicode="&#xf041;" horiz-adv-x="1024" 
+d="M768 896q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1024 896q0 -109 -33 -179l-364 -774q-16 -33 -47.5 -52t-67.5 -19t-67.5 19t-46.5 52l-365 774q-33 70 -33 179q0 212 150 362t362 150t362 -150t150 -362z" />
+    <glyph glyph-name="adjust" unicode="&#xf042;" 
+d="M768 96v1088q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="tint" unicode="&#xf043;" horiz-adv-x="1024" 
+d="M512 384q0 36 -20 69q-1 1 -15.5 22.5t-25.5 38t-25 44t-21 50.5q-4 16 -21 16t-21 -16q-7 -23 -21 -50.5t-25 -44t-25.5 -38t-15.5 -22.5q-20 -33 -20 -69q0 -53 37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1024 512q0 -212 -150 -362t-362 -150t-362 150t-150 362
+q0 145 81 275q6 9 62.5 90.5t101 151t99.5 178t83 201.5q9 30 34 47t51 17t51.5 -17t33.5 -47q28 -93 83 -201.5t99.5 -178t101 -151t62.5 -90.5q81 -127 81 -275z" />
+    <glyph glyph-name="edit" unicode="&#xf044;" horiz-adv-x="1792" 
+d="M888 352l116 116l-152 152l-116 -116v-56h96v-96h56zM1328 1072q-16 16 -33 -1l-350 -350q-17 -17 -1 -33t33 1l350 350q17 17 1 33zM1408 478v-190q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832
+q63 0 117 -25q15 -7 18 -23q3 -17 -9 -29l-49 -49q-14 -14 -32 -8q-23 6 -45 6h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v126q0 13 9 22l64 64q15 15 35 7t20 -29zM1312 1216l288 -288l-672 -672h-288v288zM1756 1084l-92 -92
+l-288 288l92 92q28 28 68 28t68 -28l152 -152q28 -28 28 -68t-28 -68z" />
+    <glyph glyph-name="share" unicode="&#xf045;" horiz-adv-x="1664" 
+d="M1408 547v-259q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h255v0q13 0 22.5 -9.5t9.5 -22.5q0 -27 -26 -32q-77 -26 -133 -60q-10 -4 -16 -4h-112q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832
+q66 0 113 47t47 113v214q0 19 18 29q28 13 54 37q16 16 35 8q21 -9 21 -29zM1645 1043l-384 -384q-18 -19 -45 -19q-12 0 -25 5q-39 17 -39 59v192h-160q-323 0 -438 -131q-119 -137 -74 -473q3 -23 -20 -34q-8 -2 -12 -2q-16 0 -26 13q-10 14 -21 31t-39.5 68.5t-49.5 99.5
+t-38.5 114t-17.5 122q0 49 3.5 91t14 90t28 88t47 81.5t68.5 74t94.5 61.5t124.5 48.5t159.5 30.5t196.5 11h160v192q0 42 39 59q13 5 25 5q26 0 45 -19l384 -384q19 -19 19 -45t-19 -45z" />
+    <glyph glyph-name="check" unicode="&#xf046;" horiz-adv-x="1664" 
+d="M1408 606v-318q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q63 0 117 -25q15 -7 18 -23q3 -17 -9 -29l-49 -49q-10 -10 -23 -10q-3 0 -9 2q-23 6 -45 6h-832q-66 0 -113 -47t-47 -113v-832
+q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v254q0 13 9 22l64 64q10 10 23 10q6 0 12 -3q20 -8 20 -29zM1639 1095l-814 -814q-24 -24 -57 -24t-57 24l-430 430q-24 24 -24 57t24 57l110 110q24 24 57 24t57 -24l263 -263l647 647q24 24 57 24t57 -24l110 -110
+q24 -24 24 -57t-24 -57z" />
+    <glyph glyph-name="move" unicode="&#xf047;" horiz-adv-x="1792" 
+d="M1792 640q0 -26 -19 -45l-256 -256q-19 -19 -45 -19t-45 19t-19 45v128h-384v-384h128q26 0 45 -19t19 -45t-19 -45l-256 -256q-19 -19 -45 -19t-45 19l-256 256q-19 19 -19 45t19 45t45 19h128v384h-384v-128q0 -26 -19 -45t-45 -19t-45 19l-256 256q-19 19 -19 45
+t19 45l256 256q19 19 45 19t45 -19t19 -45v-128h384v384h-128q-26 0 -45 19t-19 45t19 45l256 256q19 19 45 19t45 -19l256 -256q19 -19 19 -45t-19 -45t-45 -19h-128v-384h384v128q0 26 19 45t45 19t45 -19l256 -256q19 -19 19 -45z" />
+    <glyph glyph-name="step_backward" unicode="&#xf048;" horiz-adv-x="1024" 
+d="M979 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-678q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-678q4 10 13 19z" />
+    <glyph glyph-name="fast_backward" unicode="&#xf049;" horiz-adv-x="1792" 
+d="M1747 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-710q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-678q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-678q4 10 13 19l710 710
+q19 19 32 13t13 -32v-710q4 10 13 19z" />
+    <glyph glyph-name="backward" unicode="&#xf04a;" horiz-adv-x="1664" 
+d="M1619 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-710q0 -26 -13 -32t-32 13l-710 710q-19 19 -19 45t19 45l710 710q19 19 32 13t13 -32v-710q4 10 13 19z" />
+    <glyph glyph-name="play" unicode="&#xf04b;" horiz-adv-x="1408" 
+d="M1384 609l-1328 -738q-23 -13 -39.5 -3t-16.5 36v1472q0 26 16.5 36t39.5 -3l1328 -738q23 -13 23 -31t-23 -31z" />
+    <glyph glyph-name="pause" unicode="&#xf04c;" 
+d="M1536 1344v-1408q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h512q26 0 45 -19t19 -45zM640 1344v-1408q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h512q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="stop" unicode="&#xf04d;" 
+d="M1536 1344v-1408q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="forward" unicode="&#xf04e;" horiz-adv-x="1664" 
+d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q9 -9 13 -19v710q0 26 13 32t32 -13l710 -710q19 -19 19 -45t-19 -45l-710 -710q-19 -19 -32 -13t-13 32v710q-4 -10 -13 -19z" />
+    <glyph glyph-name="fast_forward" unicode="&#xf050;" horiz-adv-x="1792" 
+d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q9 -9 13 -19v710q0 26 13 32t32 -13l710 -710q9 -9 13 -19v678q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-1408q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v678q-4 -10 -13 -19l-710 -710
+q-19 -19 -32 -13t-13 32v710q-4 -10 -13 -19z" />
+    <glyph glyph-name="step_forward" unicode="&#xf051;" horiz-adv-x="1024" 
+d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q9 -9 13 -19v678q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-1408q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v678q-4 -10 -13 -19z" />
+    <glyph glyph-name="eject" unicode="&#xf052;" horiz-adv-x="1538" 
+d="M14 557l710 710q19 19 45 19t45 -19l710 -710q19 -19 13 -32t-32 -13h-1472q-26 0 -32 13t13 32zM1473 0h-1408q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1408q26 0 45 -19t19 -45v-256q0 -26 -19 -45t-45 -19z" />
+    <glyph glyph-name="chevron_left" unicode="&#xf053;" horiz-adv-x="1280" 
+d="M1171 1235l-531 -531l531 -531q19 -19 19 -45t-19 -45l-166 -166q-19 -19 -45 -19t-45 19l-742 742q-19 19 -19 45t19 45l742 742q19 19 45 19t45 -19l166 -166q19 -19 19 -45t-19 -45z" />
+    <glyph glyph-name="chevron_right" unicode="&#xf054;" horiz-adv-x="1280" 
+d="M1107 659l-742 -742q-19 -19 -45 -19t-45 19l-166 166q-19 19 -19 45t19 45l531 531l-531 531q-19 19 -19 45t19 45l166 166q19 19 45 19t45 -19l742 -742q19 -19 19 -45t-19 -45z" />
+    <glyph glyph-name="plus_sign" unicode="&#xf055;" 
+d="M1216 576v128q0 26 -19 45t-45 19h-256v256q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-256h-256q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h256v-256q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v256h256q26 0 45 19t19 45zM1536 640q0 -209 -103 -385.5
+t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="minus_sign" unicode="&#xf056;" 
+d="M1216 576v128q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5
+t103 -385.5z" />
+    <glyph glyph-name="remove_sign" unicode="&#xf057;" 
+d="M1149 414q0 26 -19 45l-181 181l181 181q19 19 19 45q0 27 -19 46l-90 90q-19 19 -46 19q-26 0 -45 -19l-181 -181l-181 181q-19 19 -45 19q-27 0 -46 -19l-90 -90q-19 -19 -19 -46q0 -26 19 -45l181 -181l-181 -181q-19 -19 -19 -45q0 -27 19 -46l90 -90q19 -19 46 -19
+q26 0 45 19l181 181l181 -181q19 -19 45 -19q27 0 46 19l90 90q19 19 19 46zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="ok_sign" unicode="&#xf058;" 
+d="M1284 802q0 28 -18 46l-91 90q-19 19 -45 19t-45 -19l-408 -407l-226 226q-19 19 -45 19t-45 -19l-91 -90q-18 -18 -18 -46q0 -27 18 -45l362 -362q19 -19 45 -19q27 0 46 19l543 543q18 18 18 45zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103
+t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="question_sign" unicode="&#xf059;" 
+d="M896 160v192q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h192q14 0 23 9t9 23zM1152 832q0 88 -55.5 163t-138.5 116t-170 41q-243 0 -371 -213q-15 -24 8 -42l132 -100q7 -6 19 -6q16 0 25 12q53 68 86 92q34 24 86 24q48 0 85.5 -26t37.5 -59
+q0 -38 -20 -61t-68 -45q-63 -28 -115.5 -86.5t-52.5 -125.5v-36q0 -14 9 -23t23 -9h192q14 0 23 9t9 23q0 19 21.5 49.5t54.5 49.5q32 18 49 28.5t46 35t44.5 48t28 60.5t12.5 81zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5
+t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="info_sign" unicode="&#xf05a;" 
+d="M1024 160v160q0 14 -9 23t-23 9h-96v512q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23t23 -9h96v-320h-96q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23t23 -9h448q14 0 23 9t9 23zM896 1056v160q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23
+t23 -9h192q14 0 23 9t9 23zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="screenshot" unicode="&#xf05b;" 
+d="M1197 512h-109q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h109q-32 108 -112.5 188.5t-188.5 112.5v-109q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v109q-108 -32 -188.5 -112.5t-112.5 -188.5h109q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-109
+q32 -108 112.5 -188.5t188.5 -112.5v109q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-109q108 32 188.5 112.5t112.5 188.5zM1536 704v-128q0 -26 -19 -45t-45 -19h-143q-37 -161 -154.5 -278.5t-278.5 -154.5v-143q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v143
+q-161 37 -278.5 154.5t-154.5 278.5h-143q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h143q37 161 154.5 278.5t278.5 154.5v143q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-143q161 -37 278.5 -154.5t154.5 -278.5h143q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="remove_circle" unicode="&#xf05c;" 
+d="M1097 457l-146 -146q-10 -10 -23 -10t-23 10l-137 137l-137 -137q-10 -10 -23 -10t-23 10l-146 146q-10 10 -10 23t10 23l137 137l-137 137q-10 10 -10 23t10 23l146 146q10 10 23 10t23 -10l137 -137l137 137q10 10 23 10t23 -10l146 -146q10 -10 10 -23t-10 -23
+l-137 -137l137 -137q10 -10 10 -23t-10 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5
+t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="ok_circle" unicode="&#xf05d;" 
+d="M1171 723l-422 -422q-19 -19 -45 -19t-45 19l-294 294q-19 19 -19 45t19 45l102 102q19 19 45 19t45 -19l147 -147l275 275q19 19 45 19t45 -19l102 -102q19 -19 19 -45t-19 -45zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198
+t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="ban_circle" unicode="&#xf05e;" 
+d="M1312 643q0 161 -87 295l-754 -753q137 -89 297 -89q111 0 211.5 43.5t173.5 116.5t116 174.5t43 212.5zM313 344l755 754q-135 91 -300 91q-148 0 -273 -73t-198 -199t-73 -274q0 -162 89 -299zM1536 643q0 -157 -61 -300t-163.5 -246t-245 -164t-298.5 -61t-298.5 61
+t-245 164t-163.5 246t-61 300t61 299.5t163.5 245.5t245 164t298.5 61t298.5 -61t245 -164t163.5 -245.5t61 -299.5z" />
+    <glyph glyph-name="arrow_left" unicode="&#xf060;" 
+d="M1536 640v-128q0 -53 -32.5 -90.5t-84.5 -37.5h-704l293 -294q38 -36 38 -90t-38 -90l-75 -76q-37 -37 -90 -37q-52 0 -91 37l-651 652q-37 37 -37 90q0 52 37 91l651 650q38 38 91 38q52 0 90 -38l75 -74q38 -38 38 -91t-38 -91l-293 -293h704q52 0 84.5 -37.5
+t32.5 -90.5z" />
+    <glyph glyph-name="arrow_right" unicode="&#xf061;" 
+d="M1472 576q0 -54 -37 -91l-651 -651q-39 -37 -91 -37q-51 0 -90 37l-75 75q-38 38 -38 91t38 91l293 293h-704q-52 0 -84.5 37.5t-32.5 90.5v128q0 53 32.5 90.5t84.5 37.5h704l-293 294q-38 36 -38 90t38 90l75 75q38 38 90 38q53 0 91 -38l651 -651q37 -35 37 -90z" />
+    <glyph glyph-name="arrow_up" unicode="&#xf062;" horiz-adv-x="1664" 
+d="M1611 565q0 -51 -37 -90l-75 -75q-38 -38 -91 -38q-54 0 -90 38l-294 293v-704q0 -52 -37.5 -84.5t-90.5 -32.5h-128q-53 0 -90.5 32.5t-37.5 84.5v704l-294 -293q-36 -38 -90 -38t-90 38l-75 75q-38 38 -38 90q0 53 38 91l651 651q35 37 90 37q54 0 91 -37l651 -651
+q37 -39 37 -91z" />
+    <glyph glyph-name="arrow_down" unicode="&#xf063;" horiz-adv-x="1664" 
+d="M1611 704q0 -53 -37 -90l-651 -652q-39 -37 -91 -37q-53 0 -90 37l-651 652q-38 36 -38 90q0 53 38 91l74 75q39 37 91 37q53 0 90 -37l294 -294v704q0 52 38 90t90 38h128q52 0 90 -38t38 -90v-704l294 294q37 37 90 37q52 0 91 -37l75 -75q37 -39 37 -91z" />
+    <glyph glyph-name="share_alt" unicode="&#xf064;" horiz-adv-x="1792" 
+d="M1792 896q0 -26 -19 -45l-512 -512q-19 -19 -45 -19t-45 19t-19 45v256h-224q-98 0 -175.5 -6t-154 -21.5t-133 -42.5t-105.5 -69.5t-80 -101t-48.5 -138.5t-17.5 -181q0 -55 5 -123q0 -6 2.5 -23.5t2.5 -26.5q0 -15 -8.5 -25t-23.5 -10q-16 0 -28 17q-7 9 -13 22
+t-13.5 30t-10.5 24q-127 285 -127 451q0 199 53 333q162 403 875 403h224v256q0 26 19 45t45 19t45 -19l512 -512q19 -19 19 -45z" />
+    <glyph glyph-name="resize_full" unicode="&#xf065;" 
+d="M755 480q0 -13 -10 -23l-332 -332l144 -144q19 -19 19 -45t-19 -45t-45 -19h-448q-26 0 -45 19t-19 45v448q0 26 19 45t45 19t45 -19l144 -144l332 332q10 10 23 10t23 -10l114 -114q10 -10 10 -23zM1536 1344v-448q0 -26 -19 -45t-45 -19t-45 19l-144 144l-332 -332
+q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l332 332l-144 144q-19 19 -19 45t19 45t45 19h448q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="resize_small" unicode="&#xf066;" 
+d="M768 576v-448q0 -26 -19 -45t-45 -19t-45 19l-144 144l-332 -332q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l332 332l-144 144q-19 19 -19 45t19 45t45 19h448q26 0 45 -19t19 -45zM1523 1248q0 -13 -10 -23l-332 -332l144 -144q19 -19 19 -45t-19 -45
+t-45 -19h-448q-26 0 -45 19t-19 45v448q0 26 19 45t45 19t45 -19l144 -144l332 332q10 10 23 10t23 -10l114 -114q10 -10 10 -23z" />
+    <glyph glyph-name="plus" unicode="&#xf067;" horiz-adv-x="1408" 
+d="M1408 800v-192q0 -40 -28 -68t-68 -28h-416v-416q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v416h-416q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h416v416q0 40 28 68t68 28h192q40 0 68 -28t28 -68v-416h416q40 0 68 -28t28 -68z" />
+    <glyph glyph-name="minus" unicode="&#xf068;" horiz-adv-x="1408" 
+d="M1408 800v-192q0 -40 -28 -68t-68 -28h-1216q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h1216q40 0 68 -28t28 -68z" />
+    <glyph glyph-name="asterisk" unicode="&#xf069;" horiz-adv-x="1664" 
+d="M1482 486q46 -26 59.5 -77.5t-12.5 -97.5l-64 -110q-26 -46 -77.5 -59.5t-97.5 12.5l-266 153v-307q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v307l-266 -153q-46 -26 -97.5 -12.5t-77.5 59.5l-64 110q-26 46 -12.5 97.5t59.5 77.5l266 154l-266 154
+q-46 26 -59.5 77.5t12.5 97.5l64 110q26 46 77.5 59.5t97.5 -12.5l266 -153v307q0 52 38 90t90 38h128q52 0 90 -38t38 -90v-307l266 153q46 26 97.5 12.5t77.5 -59.5l64 -110q26 -46 12.5 -97.5t-59.5 -77.5l-266 -154z" />
+    <glyph glyph-name="exclamation_sign" unicode="&#xf06a;" 
+d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM896 161v190q0 14 -9 23.5t-22 9.5h-192q-13 0 -23 -10t-10 -23v-190q0 -13 10 -23t23 -10h192
+q13 0 22 9.5t9 23.5zM894 505l18 621q0 12 -10 18q-10 8 -24 8h-220q-14 0 -24 -8q-10 -6 -10 -18l17 -621q0 -10 10 -17.5t24 -7.5h185q14 0 23.5 7.5t10.5 17.5z" />
+    <glyph glyph-name="gift" unicode="&#xf06b;" 
+d="M928 180v56v468v192h-320v-192v-468v-56q0 -25 18 -38.5t46 -13.5h192q28 0 46 13.5t18 38.5zM472 1024h195l-126 161q-26 31 -69 31q-40 0 -68 -28t-28 -68t28 -68t68 -28zM1160 1120q0 40 -28 68t-68 28q-43 0 -69 -31l-125 -161h194q40 0 68 28t28 68zM1536 864v-320
+q0 -14 -9 -23t-23 -9h-96v-416q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28t-28 68v416h-96q-14 0 -23 9t-9 23v320q0 14 9 23t23 9h440q-93 0 -158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5q107 0 168 -77l128 -165l128 165q61 77 168 77q93 0 158.5 -65.5t65.5 -158.5
+t-65.5 -158.5t-158.5 -65.5h440q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="leaf" unicode="&#xf06c;" horiz-adv-x="1792" 
+d="M1280 832q0 26 -19 45t-45 19q-172 0 -318 -49.5t-259.5 -134t-235.5 -219.5q-19 -21 -19 -45q0 -26 19 -45t45 -19q24 0 45 19q27 24 74 71t67 66q137 124 268.5 176t313.5 52q26 0 45 19t19 45zM1792 1030q0 -95 -20 -193q-46 -224 -184.5 -383t-357.5 -268
+q-214 -108 -438 -108q-148 0 -286 47q-15 5 -88 42t-96 37q-16 0 -39.5 -32t-45 -70t-52.5 -70t-60 -32q-43 0 -63.5 17.5t-45.5 59.5q-2 4 -6 11t-5.5 10t-3 9.5t-1.5 13.5q0 35 31 73.5t68 65.5t68 56t31 48q0 4 -14 38t-16 44q-9 51 -9 104q0 115 43.5 220t119 184.5
+t170.5 139t204 95.5q55 18 145 25.5t179.5 9t178.5 6t163.5 24t113.5 56.5l29.5 29.5t29.5 28t27 20t36.5 16t43.5 4.5q39 0 70.5 -46t47.5 -112t24 -124t8 -96z" />
+    <glyph glyph-name="fire" unicode="&#xf06d;" horiz-adv-x="1408" 
+d="M1408 -160v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1152 896q0 -78 -24.5 -144t-64 -112.5t-87.5 -88t-96 -77.5t-87.5 -72t-64 -81.5t-24.5 -96.5q0 -96 67 -224l-4 1l1 -1
+q-90 41 -160 83t-138.5 100t-113.5 122.5t-72.5 150.5t-27.5 184q0 78 24.5 144t64 112.5t87.5 88t96 77.5t87.5 72t64 81.5t24.5 96.5q0 94 -66 224l3 -1l-1 1q90 -41 160 -83t138.5 -100t113.5 -122.5t72.5 -150.5t27.5 -184z" />
+    <glyph glyph-name="eye_open" unicode="&#xf06e;" horiz-adv-x="1792" 
+d="M1664 576q-152 236 -381 353q61 -104 61 -225q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 121 61 225q-229 -117 -381 -353q133 -205 333.5 -326.5t434.5 -121.5t434.5 121.5t333.5 326.5zM944 960q0 20 -14 34t-34 14q-125 0 -214.5 -89.5
+t-89.5 -214.5q0 -20 14 -34t34 -14t34 14t14 34q0 86 61 147t147 61q20 0 34 14t14 34zM1792 576q0 -34 -20 -69q-140 -230 -376.5 -368.5t-499.5 -138.5t-499.5 139t-376.5 368q-20 35 -20 69t20 69q140 229 376.5 368t499.5 139t499.5 -139t376.5 -368q20 -35 20 -69z" />
+    <glyph glyph-name="eye_close" unicode="&#xf070;" horiz-adv-x="1792" 
+d="M555 201l78 141q-87 63 -136 159t-49 203q0 121 61 225q-229 -117 -381 -353q167 -258 427 -375zM944 960q0 20 -14 34t-34 14q-125 0 -214.5 -89.5t-89.5 -214.5q0 -20 14 -34t34 -14t34 14t14 34q0 86 61 147t147 61q20 0 34 14t14 34zM1307 1151q0 -7 -1 -9
+q-106 -189 -316 -567t-315 -566l-49 -89q-10 -16 -28 -16q-12 0 -134 70q-16 10 -16 28q0 12 44 87q-143 65 -263.5 173t-208.5 245q-20 31 -20 69t20 69q153 235 380 371t496 136q89 0 180 -17l54 97q10 16 28 16q5 0 18 -6t31 -15.5t33 -18.5t31.5 -18.5t19.5 -11.5
+q16 -10 16 -27zM1344 704q0 -139 -79 -253.5t-209 -164.5l280 502q8 -45 8 -84zM1792 576q0 -35 -20 -69q-39 -64 -109 -145q-150 -172 -347.5 -267t-419.5 -95l74 132q212 18 392.5 137t301.5 307q-115 179 -282 294l63 112q95 -64 182.5 -153t144.5 -184q20 -34 20 -69z
+" />
+    <glyph glyph-name="warning_sign" unicode="&#xf071;" horiz-adv-x="1792" 
+d="M1024 161v190q0 14 -9.5 23.5t-22.5 9.5h-192q-13 0 -22.5 -9.5t-9.5 -23.5v-190q0 -14 9.5 -23.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 23.5zM1022 535l18 459q0 12 -10 19q-13 11 -24 11h-220q-11 0 -24 -11q-10 -7 -10 -21l17 -457q0 -10 10 -16.5t24 -6.5h185
+q14 0 23.5 6.5t10.5 16.5zM1008 1469l768 -1408q35 -63 -2 -126q-17 -29 -46.5 -46t-63.5 -17h-1536q-34 0 -63.5 17t-46.5 46q-37 63 -2 126l768 1408q17 31 47 49t65 18t65 -18t47 -49z" />
+    <glyph glyph-name="plane" unicode="&#xf072;" horiz-adv-x="1408" 
+d="M1376 1376q44 -52 12 -148t-108 -172l-161 -161l160 -696q5 -19 -12 -33l-128 -96q-7 -6 -19 -6q-4 0 -7 1q-15 3 -21 16l-279 508l-259 -259l53 -194q5 -17 -8 -31l-96 -96q-9 -9 -23 -9h-2q-15 2 -24 13l-189 252l-252 189q-11 7 -13 23q-1 13 9 25l96 97q9 9 23 9
+q6 0 8 -1l194 -53l259 259l-508 279q-14 8 -17 24q-2 16 9 27l128 128q14 13 30 8l665 -159l160 160q76 76 172 108t148 -12z" />
+    <glyph glyph-name="calendar" unicode="&#xf073;" horiz-adv-x="1664" 
+d="M128 -128h288v288h-288v-288zM480 -128h320v288h-320v-288zM128 224h288v320h-288v-320zM480 224h320v320h-320v-320zM128 608h288v288h-288v-288zM864 -128h320v288h-320v-288zM480 608h320v288h-320v-288zM1248 -128h288v288h-288v-288zM864 224h320v320h-320v-320z
+M512 1088v288q0 13 -9.5 22.5t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-288q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1248 224h288v320h-288v-320zM864 608h320v288h-320v-288zM1248 608h288v288h-288v-288zM1280 1088v288q0 13 -9.5 22.5t-22.5 9.5h-64
+q-13 0 -22.5 -9.5t-9.5 -22.5v-288q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1664 1152v-1280q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47
+h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="random" unicode="&#xf074;" horiz-adv-x="1792" 
+d="M666 1055q-60 -92 -137 -273q-22 45 -37 72.5t-40.5 63.5t-51 56.5t-63 35t-81.5 14.5h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224q250 0 410 -225zM1792 256q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v192q-32 0 -85 -0.5t-81 -1t-73 1
+t-71 5t-64 10.5t-63 18.5t-58 28.5t-59 40t-55 53.5t-56 69.5q59 93 136 273q22 -45 37 -72.5t40.5 -63.5t51 -56.5t63 -35t81.5 -14.5h256v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23zM1792 1152q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5
+v192h-256q-48 0 -87 -15t-69 -45t-51 -61.5t-45 -77.5q-32 -62 -78 -171q-29 -66 -49.5 -111t-54 -105t-64 -100t-74 -83t-90 -68.5t-106.5 -42t-128 -16.5h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224q48 0 87 15t69 45t51 61.5t45 77.5q32 62 78 171q29 66 49.5 111
+t54 105t64 100t74 83t90 68.5t106.5 42t128 16.5h256v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23z" />
+    <glyph glyph-name="comment" unicode="&#xf075;" horiz-adv-x="1792" 
+d="M1792 640q0 -174 -120 -321.5t-326 -233t-450 -85.5q-70 0 -145 8q-198 -175 -460 -242q-49 -14 -114 -22q-17 -2 -30.5 9t-17.5 29v1q-3 4 -0.5 12t2 10t4.5 9.5l6 9t7 8.5t8 9q7 8 31 34.5t34.5 38t31 39.5t32.5 51t27 59t26 76q-157 89 -247.5 220t-90.5 281
+q0 130 71 248.5t191 204.5t286 136.5t348 50.5q244 0 450 -85.5t326 -233t120 -321.5z" />
+    <glyph glyph-name="magnet" unicode="&#xf076;" 
+d="M1536 704v-128q0 -201 -98.5 -362t-274 -251.5t-395.5 -90.5t-395.5 90.5t-274 251.5t-98.5 362v128q0 26 19 45t45 19h384q26 0 45 -19t19 -45v-128q0 -52 23.5 -90t53.5 -57t71 -30t64 -13t44 -2t44 2t64 13t71 30t53.5 57t23.5 90v128q0 26 19 45t45 19h384
+q26 0 45 -19t19 -45zM512 1344v-384q0 -26 -19 -45t-45 -19h-384q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h384q26 0 45 -19t19 -45zM1536 1344v-384q0 -26 -19 -45t-45 -19h-384q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h384q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="chevron_up" unicode="&#xf077;" horiz-adv-x="1792" 
+d="M1683 205l-166 -165q-19 -19 -45 -19t-45 19l-531 531l-531 -531q-19 -19 -45 -19t-45 19l-166 165q-19 19 -19 45.5t19 45.5l742 741q19 19 45 19t45 -19l742 -741q19 -19 19 -45.5t-19 -45.5z" />
+    <glyph glyph-name="chevron_down" unicode="&#xf078;" horiz-adv-x="1792" 
+d="M1683 728l-742 -741q-19 -19 -45 -19t-45 19l-742 741q-19 19 -19 45.5t19 45.5l166 165q19 19 45 19t45 -19l531 -531l531 531q19 19 45 19t45 -19l166 -165q19 -19 19 -45.5t-19 -45.5z" />
+    <glyph glyph-name="retweet" unicode="&#xf079;" horiz-adv-x="1920" 
+d="M1280 32q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-8 0 -13.5 2t-9 7t-5.5 8t-3 11.5t-1 11.5v13v11v160v416h-192q-26 0 -45 19t-19 45q0 24 15 41l320 384q19 22 49 22t49 -22l320 -384q15 -17 15 -41q0 -26 -19 -45t-45 -19h-192v-384h576q16 0 25 -11l160 -192q7 -10 7 -21
+zM1920 448q0 -24 -15 -41l-320 -384q-20 -23 -49 -23t-49 23l-320 384q-15 17 -15 41q0 26 19 45t45 19h192v384h-576q-16 0 -25 12l-160 192q-7 9 -7 20q0 13 9.5 22.5t22.5 9.5h960q8 0 13.5 -2t9 -7t5.5 -8t3 -11.5t1 -11.5v-13v-11v-160v-416h192q26 0 45 -19t19 -45z
+" />
+    <glyph glyph-name="shopping_cart" unicode="&#xf07a;" horiz-adv-x="1664" 
+d="M640 0q0 -52 -38 -90t-90 -38t-90 38t-38 90t38 90t90 38t90 -38t38 -90zM1536 0q0 -52 -38 -90t-90 -38t-90 38t-38 90t38 90t90 38t90 -38t38 -90zM1664 1088v-512q0 -24 -16.5 -42.5t-40.5 -21.5l-1044 -122q13 -60 13 -70q0 -16 -24 -64h920q26 0 45 -19t19 -45
+t-19 -45t-45 -19h-1024q-26 0 -45 19t-19 45q0 11 8 31.5t16 36t21.5 40t15.5 29.5l-177 823h-204q-26 0 -45 19t-19 45t19 45t45 19h256q16 0 28.5 -6.5t19.5 -15.5t13 -24.5t8 -26t5.5 -29.5t4.5 -26h1201q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="folder_close" unicode="&#xf07b;" horiz-adv-x="1664" 
+d="M1664 928v-704q0 -92 -66 -158t-158 -66h-1216q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h672q92 0 158 -66t66 -158z" />
+    <glyph glyph-name="folder_open" unicode="&#xf07c;" horiz-adv-x="1920" 
+d="M1879 584q0 -31 -31 -66l-336 -396q-43 -51 -120.5 -86.5t-143.5 -35.5h-1088q-34 0 -60.5 13t-26.5 43q0 31 31 66l336 396q43 51 120.5 86.5t143.5 35.5h1088q34 0 60.5 -13t26.5 -43zM1536 928v-160h-832q-94 0 -197 -47.5t-164 -119.5l-337 -396l-5 -6q0 4 -0.5 12.5
+t-0.5 12.5v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h544q92 0 158 -66t66 -158z" />
+    <glyph glyph-name="resize_vertical" unicode="&#xf07d;" horiz-adv-x="768" 
+d="M704 1216q0 -26 -19 -45t-45 -19h-128v-1024h128q26 0 45 -19t19 -45t-19 -45l-256 -256q-19 -19 -45 -19t-45 19l-256 256q-19 19 -19 45t19 45t45 19h128v1024h-128q-26 0 -45 19t-19 45t19 45l256 256q19 19 45 19t45 -19l256 -256q19 -19 19 -45z" />
+    <glyph glyph-name="resize_horizontal" unicode="&#xf07e;" horiz-adv-x="1792" 
+d="M1792 640q0 -26 -19 -45l-256 -256q-19 -19 -45 -19t-45 19t-19 45v128h-1024v-128q0 -26 -19 -45t-45 -19t-45 19l-256 256q-19 19 -19 45t19 45l256 256q19 19 45 19t45 -19t19 -45v-128h1024v128q0 26 19 45t45 19t45 -19l256 -256q19 -19 19 -45z" />
+    <glyph glyph-name="bar_chart" unicode="&#xf080;" horiz-adv-x="2048" 
+d="M640 640v-512h-256v512h256zM1024 1152v-1024h-256v1024h256zM2048 0v-128h-2048v1536h128v-1408h1920zM1408 896v-768h-256v768h256zM1792 1280v-1152h-256v1152h256z" />
+    <glyph glyph-name="twitter_sign" unicode="&#xf081;" 
+d="M1280 926q-56 -25 -121 -34q68 40 93 117q-65 -38 -134 -51q-61 66 -153 66q-87 0 -148.5 -61.5t-61.5 -148.5q0 -29 5 -48q-129 7 -242 65t-192 155q-29 -50 -29 -106q0 -114 91 -175q-47 1 -100 26v-2q0 -75 50 -133.5t123 -72.5q-29 -8 -51 -8q-13 0 -39 4
+q21 -63 74.5 -104t121.5 -42q-116 -90 -261 -90q-26 0 -50 3q148 -94 322 -94q112 0 210 35.5t168 95t120.5 137t75 162t24.5 168.5q0 18 -1 27q63 45 105 109zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5
+t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="facebook_sign" unicode="&#xf082;" 
+d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-188v595h199l30 232h-229v148q0 56 23.5 84t91.5 28l122 1v207q-63 9 -178 9q-136 0 -217.5 -80t-81.5 -226v-171h-200v-232h200v-595h-532q-119 0 -203.5 84.5t-84.5 203.5v960
+q0 119 84.5 203.5t203.5 84.5h960z" />
+    <glyph glyph-name="camera_retro" unicode="&#xf083;" horiz-adv-x="1792" 
+d="M928 704q0 14 -9 23t-23 9q-66 0 -113 -47t-47 -113q0 -14 9 -23t23 -9t23 9t9 23q0 40 28 68t68 28q14 0 23 9t9 23zM1152 574q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM128 0h1536v128h-1536v-128zM1280 574q0 159 -112.5 271.5
+t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5zM256 1216h384v128h-384v-128zM128 1024h1536v118v138h-828l-64 -128h-644v-128zM1792 1280v-1280q0 -53 -37.5 -90.5t-90.5 -37.5h-1536q-53 0 -90.5 37.5t-37.5 90.5v1280
+q0 53 37.5 90.5t90.5 37.5h1536q53 0 90.5 -37.5t37.5 -90.5z" />
+    <glyph glyph-name="key" unicode="&#xf084;" horiz-adv-x="1792" 
+d="M832 1024q0 80 -56 136t-136 56t-136 -56t-56 -136q0 -42 19 -83q-41 19 -83 19q-80 0 -136 -56t-56 -136t56 -136t136 -56t136 56t56 136q0 42 -19 83q41 -19 83 -19q80 0 136 56t56 136zM1683 320q0 -17 -49 -66t-66 -49q-9 0 -28.5 16t-36.5 33t-38.5 40t-24.5 26
+l-96 -96l220 -220q28 -28 28 -68q0 -42 -39 -81t-81 -39q-40 0 -68 28l-671 671q-176 -131 -365 -131q-163 0 -265.5 102.5t-102.5 265.5q0 160 95 313t248 248t313 95q163 0 265.5 -102.5t102.5 -265.5q0 -189 -131 -365l355 -355l96 96q-3 3 -26 24.5t-40 38.5t-33 36.5
+t-16 28.5q0 17 49 66t66 49q13 0 23 -10q6 -6 46 -44.5t82 -79.5t86.5 -86t73 -78t28.5 -41z" />
+    <glyph glyph-name="cogs" unicode="&#xf085;" horiz-adv-x="1920" 
+d="M896 640q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1664 128q0 52 -38 90t-90 38t-90 -38t-38 -90q0 -53 37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1664 1152q0 52 -38 90t-90 38t-90 -38t-38 -90q0 -53 37.5 -90.5t90.5 -37.5
+t90.5 37.5t37.5 90.5zM1280 731v-185q0 -10 -7 -19.5t-16 -10.5l-155 -24q-11 -35 -32 -76q34 -48 90 -115q7 -11 7 -20q0 -12 -7 -19q-23 -30 -82.5 -89.5t-78.5 -59.5q-11 0 -21 7l-115 90q-37 -19 -77 -31q-11 -108 -23 -155q-7 -24 -30 -24h-186q-11 0 -20 7.5t-10 17.5
+l-23 153q-34 10 -75 31l-118 -89q-7 -7 -20 -7q-11 0 -21 8q-144 133 -144 160q0 9 7 19q10 14 41 53t47 61q-23 44 -35 82l-152 24q-10 1 -17 9.5t-7 19.5v185q0 10 7 19.5t16 10.5l155 24q11 35 32 76q-34 48 -90 115q-7 11 -7 20q0 12 7 20q22 30 82 89t79 59q11 0 21 -7
+l115 -90q34 18 77 32q11 108 23 154q7 24 30 24h186q11 0 20 -7.5t10 -17.5l23 -153q34 -10 75 -31l118 89q8 7 20 7q11 0 21 -8q144 -133 144 -160q0 -8 -7 -19q-12 -16 -42 -54t-45 -60q23 -48 34 -82l152 -23q10 -2 17 -10.5t7 -19.5zM1920 198v-140q0 -16 -149 -31
+q-12 -27 -30 -52q51 -113 51 -138q0 -4 -4 -7q-122 -71 -124 -71q-8 0 -46 47t-52 68q-20 -2 -30 -2t-30 2q-14 -21 -52 -68t-46 -47q-2 0 -124 71q-4 3 -4 7q0 25 51 138q-18 25 -30 52q-149 15 -149 31v140q0 16 149 31q13 29 30 52q-51 113 -51 138q0 4 4 7q4 2 35 20
+t59 34t30 16q8 0 46 -46.5t52 -67.5q20 2 30 2t30 -2q51 71 92 112l6 2q4 0 124 -70q4 -3 4 -7q0 -25 -51 -138q17 -23 30 -52q149 -15 149 -31zM1920 1222v-140q0 -16 -149 -31q-12 -27 -30 -52q51 -113 51 -138q0 -4 -4 -7q-122 -71 -124 -71q-8 0 -46 47t-52 68
+q-20 -2 -30 -2t-30 2q-14 -21 -52 -68t-46 -47q-2 0 -124 71q-4 3 -4 7q0 25 51 138q-18 25 -30 52q-149 15 -149 31v140q0 16 149 31q13 29 30 52q-51 113 -51 138q0 4 4 7q4 2 35 20t59 34t30 16q8 0 46 -46.5t52 -67.5q20 2 30 2t30 -2q51 71 92 112l6 2q4 0 124 -70
+q4 -3 4 -7q0 -25 -51 -138q17 -23 30 -52q149 -15 149 -31z" />
+    <glyph glyph-name="comments" unicode="&#xf086;" horiz-adv-x="1792" 
+d="M1408 768q0 -139 -94 -257t-256.5 -186.5t-353.5 -68.5q-86 0 -176 16q-124 -88 -278 -128q-36 -9 -86 -16h-3q-11 0 -20.5 8t-11.5 21q-1 3 -1 6.5t0.5 6.5t2 6l2.5 5t3.5 5.5t4 5t4.5 5t4 4.5q5 6 23 25t26 29.5t22.5 29t25 38.5t20.5 44q-124 72 -195 177t-71 224
+q0 139 94 257t256.5 186.5t353.5 68.5t353.5 -68.5t256.5 -186.5t94 -257zM1792 512q0 -120 -71 -224.5t-195 -176.5q10 -24 20.5 -44t25 -38.5t22.5 -29t26 -29.5t23 -25q1 -1 4 -4.5t4.5 -5t4 -5t3.5 -5.5l2.5 -5t2 -6t0.5 -6.5t-1 -6.5q-3 -14 -13 -22t-22 -7
+q-50 7 -86 16q-154 40 -278 128q-90 -16 -176 -16q-271 0 -472 132q58 -4 88 -4q161 0 309 45t264 129q125 92 192 212t67 254q0 77 -23 152q129 -71 204 -178t75 -230z" />
+    <glyph glyph-name="thumbs_up_alt" unicode="&#xf087;" 
+d="M256 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 768q0 51 -39 89.5t-89 38.5h-352q0 58 48 159.5t48 160.5q0 98 -32 145t-128 47q-26 -26 -38 -85t-30.5 -125.5t-59.5 -109.5q-22 -23 -77 -91q-4 -5 -23 -30t-31.5 -41t-34.5 -42.5
+t-40 -44t-38.5 -35.5t-40 -27t-35.5 -9h-32v-640h32q13 0 31.5 -3t33 -6.5t38 -11t35 -11.5t35.5 -12.5t29 -10.5q211 -73 342 -73h121q192 0 192 167q0 26 -5 56q30 16 47.5 52.5t17.5 73.5t-18 69q53 50 53 119q0 25 -10 55.5t-25 47.5q32 1 53.5 47t21.5 81zM1536 769
+q0 -89 -49 -163q9 -33 9 -69q0 -77 -38 -144q3 -21 3 -43q0 -101 -60 -178q1 -139 -85 -219.5t-227 -80.5h-36h-93q-96 0 -189.5 22.5t-216.5 65.5q-116 40 -138 40h-288q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5h274q36 24 137 155q58 75 107 128
+q24 25 35.5 85.5t30.5 126.5t62 108q39 37 90 37q84 0 151 -32.5t102 -101.5t35 -186q0 -93 -48 -192h176q104 0 180 -76t76 -179z" />
+    <glyph glyph-name="thumbs_down_alt" unicode="&#xf088;" 
+d="M256 1088q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 512q0 35 -21.5 81t-53.5 47q15 17 25 47.5t10 55.5q0 69 -53 119q18 31 18 69q0 37 -17.5 73.5t-47.5 52.5q5 30 5 56q0 85 -49 126t-136 41h-128q-131 0 -342 -73q-5 -2 -29 -10.5
+t-35.5 -12.5t-35 -11.5t-38 -11t-33 -6.5t-31.5 -3h-32v-640h32q16 0 35.5 -9t40 -27t38.5 -35.5t40 -44t34.5 -42.5t31.5 -41t23 -30q55 -68 77 -91q41 -43 59.5 -109.5t30.5 -125.5t38 -85q96 0 128 47t32 145q0 59 -48 160.5t-48 159.5h352q50 0 89 38.5t39 89.5z
+M1536 511q0 -103 -76 -179t-180 -76h-176q48 -99 48 -192q0 -118 -35 -186q-35 -69 -102 -101.5t-151 -32.5q-51 0 -90 37q-34 33 -54 82t-25.5 90.5t-17.5 84.5t-31 64q-48 50 -107 127q-101 131 -137 155h-274q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5
+h288q22 0 138 40q128 44 223 66t200 22h112q140 0 226.5 -79t85.5 -216v-5q60 -77 60 -178q0 -22 -3 -43q38 -67 38 -144q0 -36 -9 -69q49 -73 49 -163z" />
+    <glyph glyph-name="star_half" unicode="&#xf089;" horiz-adv-x="896" 
+d="M832 1504v-1339l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41z" />
+    <glyph glyph-name="heart_empty" unicode="&#xf08a;" horiz-adv-x="1792" 
+d="M1664 940q0 81 -21.5 143t-55 98.5t-81.5 59.5t-94 31t-98 8t-112 -25.5t-110.5 -64t-86.5 -72t-60 -61.5q-18 -22 -49 -22t-49 22q-24 28 -60 61.5t-86.5 72t-110.5 64t-112 25.5t-98 -8t-94 -31t-81.5 -59.5t-55 -98.5t-21.5 -143q0 -168 187 -355l581 -560l580 559
+q188 188 188 356zM1792 940q0 -221 -229 -450l-623 -600q-18 -18 -44 -18t-44 18l-624 602q-10 8 -27.5 26t-55.5 65.5t-68 97.5t-53.5 121t-23.5 138q0 220 127 344t351 124q62 0 126.5 -21.5t120 -58t95.5 -68.5t76 -68q36 36 76 68t95.5 68.5t120 58t126.5 21.5
+q224 0 351 -124t127 -344z" />
+    <glyph glyph-name="signout" unicode="&#xf08b;" horiz-adv-x="1664" 
+d="M640 96q0 -4 1 -20t0.5 -26.5t-3 -23.5t-10 -19.5t-20.5 -6.5h-320q-119 0 -203.5 84.5t-84.5 203.5v704q0 119 84.5 203.5t203.5 84.5h320q13 0 22.5 -9.5t9.5 -22.5q0 -4 1 -20t0.5 -26.5t-3 -23.5t-10 -19.5t-20.5 -6.5h-320q-66 0 -113 -47t-47 -113v-704
+q0 -66 47 -113t113 -47h288h11h13t11.5 -1t11.5 -3t8 -5.5t7 -9t2 -13.5zM1568 640q0 -26 -19 -45l-544 -544q-19 -19 -45 -19t-45 19t-19 45v288h-448q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h448v288q0 26 19 45t45 19t45 -19l544 -544q19 -19 19 -45z" />
+    <glyph glyph-name="linkedin_sign" unicode="&#xf08c;" 
+d="M237 122h231v694h-231v-694zM483 1030q-1 52 -36 86t-93 34t-94.5 -34t-36.5 -86q0 -51 35.5 -85.5t92.5 -34.5h1q59 0 95 34.5t36 85.5zM1068 122h231v398q0 154 -73 233t-193 79q-136 0 -209 -117h2v101h-231q3 -66 0 -694h231v388q0 38 7 56q15 35 45 59.5t74 24.5
+q116 0 116 -157v-371zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="pushpin" unicode="&#xf08d;" horiz-adv-x="1152" 
+d="M480 672v448q0 14 -9 23t-23 9t-23 -9t-9 -23v-448q0 -14 9 -23t23 -9t23 9t9 23zM1152 320q0 -26 -19 -45t-45 -19h-429l-51 -483q-2 -12 -10.5 -20.5t-20.5 -8.5h-1q-27 0 -32 27l-76 485h-404q-26 0 -45 19t-19 45q0 123 78.5 221.5t177.5 98.5v512q-52 0 -90 38
+t-38 90t38 90t90 38h640q52 0 90 -38t38 -90t-38 -90t-90 -38v-512q99 0 177.5 -98.5t78.5 -221.5z" />
+    <glyph glyph-name="external_link" unicode="&#xf08e;" horiz-adv-x="1792" 
+d="M1408 608v-320q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h704q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-704q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v320
+q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1792 1472v-512q0 -26 -19 -45t-45 -19t-45 19l-176 176l-652 -652q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l652 652l-176 176q-19 19 -19 45t19 45t45 19h512q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="signin" unicode="&#xf090;" 
+d="M1184 640q0 -26 -19 -45l-544 -544q-19 -19 -45 -19t-45 19t-19 45v288h-448q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h448v288q0 26 19 45t45 19t45 -19l544 -544q19 -19 19 -45zM1536 992v-704q0 -119 -84.5 -203.5t-203.5 -84.5h-320q-13 0 -22.5 9.5t-9.5 22.5
+q0 4 -1 20t-0.5 26.5t3 23.5t10 19.5t20.5 6.5h320q66 0 113 47t47 113v704q0 66 -47 113t-113 47h-288h-11h-13t-11.5 1t-11.5 3t-8 5.5t-7 9t-2 13.5q0 4 -1 20t-0.5 26.5t3 23.5t10 19.5t20.5 6.5h320q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="trophy" unicode="&#xf091;" horiz-adv-x="1664" 
+d="M458 653q-74 162 -74 371h-256v-96q0 -78 94.5 -162t235.5 -113zM1536 928v96h-256q0 -209 -74 -371q141 29 235.5 113t94.5 162zM1664 1056v-128q0 -71 -41.5 -143t-112 -130t-173 -97.5t-215.5 -44.5q-42 -54 -95 -95q-38 -34 -52.5 -72.5t-14.5 -89.5q0 -54 30.5 -91
+t97.5 -37q75 0 133.5 -45.5t58.5 -114.5v-64q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v64q0 69 58.5 114.5t133.5 45.5q67 0 97.5 37t30.5 91q0 51 -14.5 89.5t-52.5 72.5q-53 41 -95 95q-113 5 -215.5 44.5t-173 97.5t-112 130t-41.5 143v128q0 40 28 68t68 28h288v96
+q0 66 47 113t113 47h576q66 0 113 -47t47 -113v-96h288q40 0 68 -28t28 -68z" />
+    <glyph glyph-name="github_sign" unicode="&#xf092;" 
+d="M519 336q4 6 -3 13q-9 7 -14 2q-4 -6 3 -13q9 -7 14 -2zM491 377q-5 7 -12 4q-6 -4 0 -12q7 -8 12 -5q6 4 0 13zM450 417q2 4 -5 8q-7 2 -8 -2q-3 -5 4 -8q8 -2 9 2zM471 394q2 1 1.5 4.5t-3.5 5.5q-6 7 -10 3t1 -11q6 -6 11 -2zM557 319q2 7 -9 11q-9 3 -13 -4
+q-2 -7 9 -11q9 -3 13 4zM599 316q0 8 -12 8q-10 0 -10 -8t11 -8t11 8zM638 323q-2 7 -13 5t-9 -9q2 -8 12 -6t10 10zM1280 640q0 212 -150 362t-362 150t-362 -150t-150 -362q0 -167 98 -300.5t252 -185.5q18 -3 26.5 5t8.5 20q0 52 -1 95q-6 -1 -15.5 -2.5t-35.5 -2t-48 4
+t-43.5 20t-29.5 41.5q-23 59 -57 74q-2 1 -4.5 3.5l-8 8t-7 9.5t4 7.5t19.5 3.5q6 0 15 -2t30 -15.5t33 -35.5q16 -28 37.5 -42t43.5 -14t38 3.5t30 9.5q7 47 33 69q-49 6 -86 18.5t-73 39t-55.5 76t-19.5 119.5q0 79 53 137q-24 62 5 136q19 6 54.5 -7.5t60.5 -29.5l26 -16
+q58 17 128 17t128 -17q11 7 28.5 18t55.5 26t57 9q29 -74 5 -136q53 -58 53 -137q0 -57 -14 -100.5t-35.5 -70t-53.5 -44.5t-62.5 -26t-68.5 -12q35 -31 35 -95q0 -40 -0.5 -89t-0.5 -51q0 -12 8.5 -20t26.5 -5q154 52 252 185.5t98 300.5zM1536 1120v-960
+q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="upload_alt" unicode="&#xf093;" horiz-adv-x="1664" 
+d="M1280 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 288v-320q0 -40 -28 -68t-68 -28h-1472q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h427q21 -56 70.5 -92
+t110.5 -36h256q61 0 110.5 36t70.5 92h427q40 0 68 -28t28 -68zM1339 936q-17 -40 -59 -40h-256v-448q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v448h-256q-42 0 -59 40q-17 39 14 69l448 448q18 19 45 19t45 -19l448 -448q31 -30 14 -69z" />
+    <glyph glyph-name="lemon" unicode="&#xf094;" 
+d="M1407 710q0 44 -7 113.5t-18 96.5q-12 30 -17 44t-9 36.5t-4 48.5q0 23 5 68.5t5 67.5q0 37 -10 55q-4 1 -13 1q-19 0 -58 -4.5t-59 -4.5q-60 0 -176 24t-175 24q-43 0 -94.5 -11.5t-85 -23.5t-89.5 -34q-137 -54 -202 -103q-96 -73 -159.5 -189.5t-88 -236t-24.5 -248.5
+q0 -40 12.5 -120t12.5 -121q0 -23 -11 -66.5t-11 -65.5t12 -36.5t34 -14.5q24 0 72.5 11t73.5 11q57 0 169.5 -15.5t169.5 -15.5q181 0 284 36q129 45 235.5 152.5t166 245.5t59.5 275zM1535 712q0 -165 -70 -327.5t-196 -288t-281 -180.5q-124 -44 -326 -44
+q-57 0 -170 14.5t-169 14.5q-24 0 -72.5 -14.5t-73.5 -14.5q-73 0 -123.5 55.5t-50.5 128.5q0 24 11 68t11 67q0 40 -12.5 120.5t-12.5 121.5q0 111 18 217.5t54.5 209.5t100.5 194t150 156q78 59 232 120q194 78 316 78q60 0 175.5 -24t173.5 -24q19 0 57 5t58 5
+q81 0 118 -50.5t37 -134.5q0 -23 -5 -68t-5 -68q0 -13 2 -25t3.5 -16.5t7.5 -20.5t8 -20q16 -40 25 -118.5t9 -136.5z" />
+    <glyph glyph-name="phone" unicode="&#xf095;" horiz-adv-x="1408" 
+d="M1408 296q0 -27 -10 -70.5t-21 -68.5q-21 -50 -122 -106q-94 -51 -186 -51q-27 0 -53 3.5t-57.5 12.5t-47 14.5t-55.5 20.5t-49 18q-98 35 -175 83q-127 79 -264 216t-216 264q-48 77 -83 175q-3 9 -18 49t-20.5 55.5t-14.5 47t-12.5 57.5t-3.5 53q0 92 51 186
+q56 101 106 122q25 11 68.5 21t70.5 10q14 0 21 -3q18 -6 53 -76q11 -19 30 -54t35 -63.5t31 -53.5q3 -4 17.5 -25t21.5 -35.5t7 -28.5q0 -20 -28.5 -50t-62 -55t-62 -53t-28.5 -46q0 -9 5 -22.5t8.5 -20.5t14 -24t11.5 -19q76 -137 174 -235t235 -174q2 -1 19 -11.5t24 -14
+t20.5 -8.5t22.5 -5q18 0 46 28.5t53 62t55 62t50 28.5q14 0 28.5 -7t35.5 -21.5t25 -17.5q25 -15 53.5 -31t63.5 -35t54 -30q70 -35 76 -53q3 -7 3 -21z" />
+    <glyph glyph-name="check_empty" unicode="&#xf096;" horiz-adv-x="1408" 
+d="M1120 1280h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v832q0 66 -47 113t-113 47zM1408 1120v-832q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832
+q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="bookmark_empty" unicode="&#xf097;" horiz-adv-x="1280" 
+d="M1152 1280h-1024v-1242l423 406l89 85l89 -85l423 -406v1242zM1164 1408q23 0 44 -9q33 -13 52.5 -41t19.5 -62v-1289q0 -34 -19.5 -62t-52.5 -41q-19 -8 -44 -8q-48 0 -83 32l-441 424l-441 -424q-36 -33 -83 -33q-23 0 -44 9q-33 13 -52.5 41t-19.5 62v1289
+q0 34 19.5 62t52.5 41q21 9 44 9h1048z" />
+    <glyph glyph-name="phone_sign" unicode="&#xf098;" 
+d="M1280 343q0 11 -2 16t-18 16.5t-40.5 25t-47.5 26.5t-45.5 25t-28.5 15q-5 3 -19 13t-25 15t-21 5q-15 0 -36.5 -20.5t-39.5 -45t-38.5 -45t-33.5 -20.5q-7 0 -16.5 3.5t-15.5 6.5t-17 9.5t-14 8.5q-99 55 -170 126.5t-127 170.5q-2 3 -8.5 14t-9.5 17t-6.5 15.5
+t-3.5 16.5q0 13 20.5 33.5t45 38.5t45 39.5t20.5 36.5q0 10 -5 21t-15 25t-13 19q-3 6 -15 28.5t-25 45.5t-26.5 47.5t-25 40.5t-16.5 18t-16 2q-48 0 -101 -22q-46 -21 -80 -94.5t-34 -130.5q0 -16 2.5 -34t5 -30.5t9 -33t10 -29.5t12.5 -33t11 -30q60 -164 216.5 -320.5
+t320.5 -216.5q6 -2 30 -11t33 -12.5t29.5 -10t33 -9t30.5 -5t34 -2.5q57 0 130.5 34t94.5 80q22 53 22 101zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z
+" />
+    <glyph glyph-name="twitter" unicode="&#xf099;" horiz-adv-x="1664" 
+d="M1620 1128q-67 -98 -162 -167q1 -14 1 -42q0 -130 -38 -259.5t-115.5 -248.5t-184.5 -210.5t-258 -146t-323 -54.5q-271 0 -496 145q35 -4 78 -4q225 0 401 138q-105 2 -188 64.5t-114 159.5q33 -5 61 -5q43 0 85 11q-112 23 -185.5 111.5t-73.5 205.5v4q68 -38 146 -41
+q-66 44 -105 115t-39 154q0 88 44 163q121 -149 294.5 -238.5t371.5 -99.5q-8 38 -8 74q0 134 94.5 228.5t228.5 94.5q140 0 236 -102q109 21 205 78q-37 -115 -142 -178q93 10 186 50z" />
+    <glyph glyph-name="facebook" unicode="&#xf09a;" horiz-adv-x="1024" 
+d="M959 1524v-264h-157q-86 0 -116 -36t-30 -108v-189h293l-39 -296h-254v-759h-306v759h-255v296h255v218q0 186 104 288.5t277 102.5q147 0 228 -12z" />
+    <glyph glyph-name="github" unicode="&#xf09b;" 
+d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5q0 -251 -146.5 -451.5t-378.5 -277.5q-27 -5 -40 7t-13 30q0 3 0.5 76.5t0.5 134.5q0 97 -52 142q57 6 102.5 18t94 39t81 66.5t53 105t20.5 150.5q0 119 -79 206q37 91 -8 204q-28 9 -81 -11t-92 -44l-38 -24
+q-93 26 -192 26t-192 -26q-16 11 -42.5 27t-83.5 38.5t-85 13.5q-45 -113 -8 -204q-79 -87 -79 -206q0 -85 20.5 -150t52.5 -105t80.5 -67t94 -39t102.5 -18q-39 -36 -49 -103q-21 -10 -45 -15t-57 -5t-65.5 21.5t-55.5 62.5q-19 32 -48.5 52t-49.5 24l-20 3q-21 0 -29 -4.5
+t-5 -11.5t9 -14t13 -12l7 -5q22 -10 43.5 -38t31.5 -51l10 -23q13 -38 44 -61.5t67 -30t69.5 -7t55.5 3.5l23 4q0 -38 0.5 -88.5t0.5 -54.5q0 -18 -13 -30t-40 -7q-232 77 -378.5 277.5t-146.5 451.5q0 209 103 385.5t279.5 279.5t385.5 103zM291 305q3 7 -7 12
+q-10 3 -13 -2q-3 -7 7 -12q9 -6 13 2zM322 271q7 5 -2 16q-10 9 -16 3q-7 -5 2 -16q10 -10 16 -3zM352 226q9 7 0 19q-8 13 -17 6q-9 -5 0 -18t17 -7zM394 184q8 8 -4 19q-12 12 -20 3q-9 -8 4 -19q12 -12 20 -3zM451 159q3 11 -13 16q-15 4 -19 -7t13 -15q15 -6 19 6z
+M514 154q0 13 -17 11q-16 0 -16 -11q0 -13 17 -11q16 0 16 11zM572 164q-2 11 -18 9q-16 -3 -14 -15t18 -8t14 14z" />
+    <glyph glyph-name="unlock" unicode="&#xf09c;" horiz-adv-x="1664" 
+d="M1664 960v-256q0 -26 -19 -45t-45 -19h-64q-26 0 -45 19t-19 45v256q0 106 -75 181t-181 75t-181 -75t-75 -181v-192h96q40 0 68 -28t28 -68v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h672v192q0 185 131.5 316.5t316.5 131.5
+t316.5 -131.5t131.5 -316.5z" />
+    <glyph glyph-name="credit_card" unicode="&#xf09d;" horiz-adv-x="1920" 
+d="M1760 1408q66 0 113 -47t47 -113v-1216q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1600zM160 1280q-13 0 -22.5 -9.5t-9.5 -22.5v-224h1664v224q0 13 -9.5 22.5t-22.5 9.5h-1600zM1760 0q13 0 22.5 9.5t9.5 22.5v608h-1664v-608
+q0 -13 9.5 -22.5t22.5 -9.5h1600zM256 128v128h256v-128h-256zM640 128v128h384v-128h-384z" />
+    <glyph glyph-name="rss" unicode="&#xf09e;" horiz-adv-x="1408" 
+d="M384 192q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM896 69q2 -28 -17 -48q-18 -21 -47 -21h-135q-25 0 -43 16.5t-20 41.5q-22 229 -184.5 391.5t-391.5 184.5q-25 2 -41.5 20t-16.5 43v135q0 29 21 47q17 17 43 17h5q160 -13 306 -80.5
+t259 -181.5q114 -113 181.5 -259t80.5 -306zM1408 67q2 -27 -18 -47q-18 -20 -46 -20h-143q-26 0 -44.5 17.5t-19.5 42.5q-12 215 -101 408.5t-231.5 336t-336 231.5t-408.5 102q-25 1 -42.5 19.5t-17.5 43.5v143q0 28 20 46q18 18 44 18h3q262 -13 501.5 -120t425.5 -294
+q187 -186 294 -425.5t120 -501.5z" />
+    <glyph glyph-name="hdd" unicode="&#xf0a0;" 
+d="M1040 320q0 -33 -23.5 -56.5t-56.5 -23.5t-56.5 23.5t-23.5 56.5t23.5 56.5t56.5 23.5t56.5 -23.5t23.5 -56.5zM1296 320q0 -33 -23.5 -56.5t-56.5 -23.5t-56.5 23.5t-23.5 56.5t23.5 56.5t56.5 23.5t56.5 -23.5t23.5 -56.5zM1408 160v320q0 13 -9.5 22.5t-22.5 9.5
+h-1216q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h1216q13 0 22.5 9.5t9.5 22.5zM178 640h1180l-157 482q-4 13 -16 21.5t-26 8.5h-782q-14 0 -26 -8.5t-16 -21.5zM1536 480v-320q0 -66 -47 -113t-113 -47h-1216q-66 0 -113 47t-47 113v320q0 25 16 75
+l197 606q17 53 63 86t101 33h782q55 0 101 -33t63 -86l197 -606q16 -50 16 -75z" />
+    <glyph glyph-name="bullhorn" unicode="&#xf0a1;" horiz-adv-x="1792" 
+d="M1664 896q53 0 90.5 -37.5t37.5 -90.5t-37.5 -90.5t-90.5 -37.5v-384q0 -52 -38 -90t-90 -38q-417 347 -812 380q-58 -19 -91 -66t-31 -100.5t40 -92.5q-20 -33 -23 -65.5t6 -58t33.5 -55t48 -50t61.5 -50.5q-29 -58 -111.5 -83t-168.5 -11.5t-132 55.5q-7 23 -29.5 87.5
+t-32 94.5t-23 89t-15 101t3.5 98.5t22 110.5h-122q-66 0 -113 47t-47 113v192q0 66 47 113t113 47h480q435 0 896 384q52 0 90 -38t38 -90v-384zM1536 292v954q-394 -302 -768 -343v-270q377 -42 768 -341z" />
+    <glyph glyph-name="bell" unicode="&#xf0a2;" horiz-adv-x="1792" 
+d="M912 -160q0 16 -16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5q16 0 16 16zM246 128h1300q-266 300 -266 832q0 51 -24 105t-69 103t-121.5 80.5t-169.5 31.5t-169.5 -31.5t-121.5 -80.5t-69 -103t-24 -105q0 -532 -266 -832z
+M1728 128q0 -52 -38 -90t-90 -38h-448q0 -106 -75 -181t-181 -75t-181 75t-75 181h-448q-52 0 -90 38t-38 90q50 42 91 88t85 119.5t74.5 158.5t50 206t19.5 260q0 152 117 282.5t307 158.5q-8 19 -8 39q0 40 28 68t68 28t68 -28t28 -68q0 -20 -8 -39q190 -28 307 -158.5
+t117 -282.5q0 -139 19.5 -260t50 -206t74.5 -158.5t85 -119.5t91 -88z" />
+    <glyph glyph-name="certificate" unicode="&#xf0a3;" 
+d="M1376 640l138 -135q30 -28 20 -70q-12 -41 -52 -51l-188 -48l53 -186q12 -41 -19 -70q-29 -31 -70 -19l-186 53l-48 -188q-10 -40 -51 -52q-12 -2 -19 -2q-31 0 -51 22l-135 138l-135 -138q-28 -30 -70 -20q-41 11 -51 52l-48 188l-186 -53q-41 -12 -70 19q-31 29 -19 70
+l53 186l-188 48q-40 10 -52 51q-10 42 20 70l138 135l-138 135q-30 28 -20 70q12 41 52 51l188 48l-53 186q-12 41 19 70q29 31 70 19l186 -53l48 188q10 41 51 51q41 12 70 -19l135 -139l135 139q29 30 70 19q41 -10 51 -51l48 -188l186 53q41 12 70 -19q31 -29 19 -70
+l-53 -186l188 -48q40 -10 52 -51q10 -42 -20 -70z" />
+    <glyph glyph-name="hand_right" unicode="&#xf0a4;" horiz-adv-x="1792" 
+d="M256 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 768q0 51 -39 89.5t-89 38.5h-576q0 20 15 48.5t33 55t33 68t15 84.5q0 67 -44.5 97.5t-115.5 30.5q-24 0 -90 -139q-24 -44 -37 -65q-40 -64 -112 -145q-71 -81 -101 -106
+q-69 -57 -140 -57h-32v-640h32q72 0 167 -32t193.5 -64t179.5 -32q189 0 189 167q0 26 -5 56q30 16 47.5 52.5t17.5 73.5t-18 69q53 50 53 119q0 25 -10 55.5t-25 47.5h331q52 0 90 38t38 90zM1792 769q0 -105 -75.5 -181t-180.5 -76h-169q-4 -62 -37 -119q3 -21 3 -43
+q0 -101 -60 -178q1 -139 -85 -219.5t-227 -80.5q-133 0 -322 69q-164 59 -223 59h-288q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5h288q10 0 21.5 4.5t23.5 14t22.5 18t24 22.5t20.5 21.5t19 21.5t14 17q65 74 100 129q13 21 33 62t37 72t40.5 63t55 49.5
+t69.5 17.5q125 0 206.5 -67t81.5 -189q0 -68 -22 -128h374q104 0 180 -76t76 -179z" />
+    <glyph glyph-name="hand_left" unicode="&#xf0a5;" horiz-adv-x="1792" 
+d="M1376 128h32v640h-32q-35 0 -67.5 12t-62.5 37t-50 46t-49 54q-8 9 -12 14q-72 81 -112 145q-14 22 -38 68q-1 3 -10.5 22.5t-18.5 36t-20 35.5t-21.5 30.5t-18.5 11.5q-71 0 -115.5 -30.5t-44.5 -97.5q0 -43 15 -84.5t33 -68t33 -55t15 -48.5h-576q-50 0 -89 -38.5
+t-39 -89.5q0 -52 38 -90t90 -38h331q-15 -17 -25 -47.5t-10 -55.5q0 -69 53 -119q-18 -32 -18 -69t17.5 -73.5t47.5 -52.5q-4 -24 -4 -56q0 -85 48.5 -126t135.5 -41q84 0 183 32t194 64t167 32zM1664 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45z
+M1792 768v-640q0 -53 -37.5 -90.5t-90.5 -37.5h-288q-59 0 -223 -59q-190 -69 -317 -69q-142 0 -230 77.5t-87 217.5l1 5q-61 76 -61 178q0 22 3 43q-33 57 -37 119h-169q-105 0 -180.5 76t-75.5 181q0 103 76 179t180 76h374q-22 60 -22 128q0 122 81.5 189t206.5 67
+q38 0 69.5 -17.5t55 -49.5t40.5 -63t37 -72t33 -62q35 -55 100 -129q2 -3 14 -17t19 -21.5t20.5 -21.5t24 -22.5t22.5 -18t23.5 -14t21.5 -4.5h288q53 0 90.5 -37.5t37.5 -90.5z" />
+    <glyph glyph-name="hand_up" unicode="&#xf0a6;" 
+d="M1280 -64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 700q0 189 -167 189q-26 0 -56 -5q-16 30 -52.5 47.5t-73.5 17.5t-69 -18q-50 53 -119 53q-25 0 -55.5 -10t-47.5 -25v331q0 52 -38 90t-90 38q-51 0 -89.5 -39t-38.5 -89v-576
+q-20 0 -48.5 15t-55 33t-68 33t-84.5 15q-67 0 -97.5 -44.5t-30.5 -115.5q0 -24 139 -90q44 -24 65 -37q64 -40 145 -112q81 -71 106 -101q57 -69 57 -140v-32h640v32q0 72 32 167t64 193.5t32 179.5zM1536 705q0 -133 -69 -322q-59 -164 -59 -223v-288q0 -53 -37.5 -90.5
+t-90.5 -37.5h-640q-53 0 -90.5 37.5t-37.5 90.5v288q0 10 -4.5 21.5t-14 23.5t-18 22.5t-22.5 24t-21.5 20.5t-21.5 19t-17 14q-74 65 -129 100q-21 13 -62 33t-72 37t-63 40.5t-49.5 55t-17.5 69.5q0 125 67 206.5t189 81.5q68 0 128 -22v374q0 104 76 180t179 76
+q105 0 181 -75.5t76 -180.5v-169q62 -4 119 -37q21 3 43 3q101 0 178 -60q139 1 219.5 -85t80.5 -227z" />
+    <glyph glyph-name="hand_down" unicode="&#xf0a7;" 
+d="M1408 576q0 84 -32 183t-64 194t-32 167v32h-640v-32q0 -35 -12 -67.5t-37 -62.5t-46 -50t-54 -49q-9 -8 -14 -12q-81 -72 -145 -112q-22 -14 -68 -38q-3 -1 -22.5 -10.5t-36 -18.5t-35.5 -20t-30.5 -21.5t-11.5 -18.5q0 -71 30.5 -115.5t97.5 -44.5q43 0 84.5 15t68 33
+t55 33t48.5 15v-576q0 -50 38.5 -89t89.5 -39q52 0 90 38t38 90v331q46 -35 103 -35q69 0 119 53q32 -18 69 -18t73.5 17.5t52.5 47.5q24 -4 56 -4q85 0 126 48.5t41 135.5zM1280 1344q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 580
+q0 -142 -77.5 -230t-217.5 -87l-5 1q-76 -61 -178 -61q-22 0 -43 3q-54 -30 -119 -37v-169q0 -105 -76 -180.5t-181 -75.5q-103 0 -179 76t-76 180v374q-54 -22 -128 -22q-121 0 -188.5 81.5t-67.5 206.5q0 38 17.5 69.5t49.5 55t63 40.5t72 37t62 33q55 35 129 100
+q3 2 17 14t21.5 19t21.5 20.5t22.5 24t18 22.5t14 23.5t4.5 21.5v288q0 53 37.5 90.5t90.5 37.5h640q53 0 90.5 -37.5t37.5 -90.5v-288q0 -59 59 -223q69 -190 69 -317z" />
+    <glyph glyph-name="circle_arrow_left" unicode="&#xf0a8;" 
+d="M1280 576v128q0 26 -19 45t-45 19h-502l189 189q19 19 19 45t-19 45l-91 91q-18 18 -45 18t-45 -18l-362 -362l-91 -91q-18 -18 -18 -45t18 -45l91 -91l362 -362q18 -18 45 -18t45 18l91 91q18 18 18 45t-18 45l-189 189h502q26 0 45 19t19 45zM1536 640
+q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="circle_arrow_right" unicode="&#xf0a9;" 
+d="M1285 640q0 27 -18 45l-91 91l-362 362q-18 18 -45 18t-45 -18l-91 -91q-18 -18 -18 -45t18 -45l189 -189h-502q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h502l-189 -189q-19 -19 -19 -45t19 -45l91 -91q18 -18 45 -18t45 18l362 362l91 91q18 18 18 45zM1536 640
+q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="circle_arrow_up" unicode="&#xf0aa;" 
+d="M1284 641q0 27 -18 45l-362 362l-91 91q-18 18 -45 18t-45 -18l-91 -91l-362 -362q-18 -18 -18 -45t18 -45l91 -91q18 -18 45 -18t45 18l189 189v-502q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v502l189 -189q19 -19 45 -19t45 19l91 91q18 18 18 45zM1536 640
+q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="circle_arrow_down" unicode="&#xf0ab;" 
+d="M1284 639q0 27 -18 45l-91 91q-18 18 -45 18t-45 -18l-189 -189v502q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-502l-189 189q-19 19 -45 19t-45 -19l-91 -91q-18 -18 -18 -45t18 -45l362 -362l91 -91q18 -18 45 -18t45 18l91 91l362 362q18 18 18 45zM1536 640
+q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="globe" unicode="&#xf0ac;" 
+d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM1042 887q-2 -1 -9.5 -9.5t-13.5 -9.5q2 0 4.5 5t5 11t3.5 7q6 7 22 15q14 6 52 12q34 8 51 -11
+q-2 2 9.5 13t14.5 12q3 2 15 4.5t15 7.5l2 22q-12 -1 -17.5 7t-6.5 21q0 -2 -6 -8q0 7 -4.5 8t-11.5 -1t-9 -1q-10 3 -15 7.5t-8 16.5t-4 15q-2 5 -9.5 11t-9.5 10q-1 2 -2.5 5.5t-3 6.5t-4 5.5t-5.5 2.5t-7 -5t-7.5 -10t-4.5 -5q-3 2 -6 1.5t-4.5 -1t-4.5 -3t-5 -3.5
+q-3 -2 -8.5 -3t-8.5 -2q15 5 -1 11q-10 4 -16 3q9 4 7.5 12t-8.5 14h5q-1 4 -8.5 8.5t-17.5 8.5t-13 6q-8 5 -34 9.5t-33 0.5q-5 -6 -4.5 -10.5t4 -14t3.5 -12.5q1 -6 -5.5 -13t-6.5 -12q0 -7 14 -15.5t10 -21.5q-3 -8 -16 -16t-16 -12q-5 -8 -1.5 -18.5t10.5 -16.5
+q2 -2 1.5 -4t-3.5 -4.5t-5.5 -4t-6.5 -3.5l-3 -2q-11 -5 -20.5 6t-13.5 26q-7 25 -16 30q-23 8 -29 -1q-5 13 -41 26q-25 9 -58 4q6 1 0 15q-7 15 -19 12q3 6 4 17.5t1 13.5q3 13 12 23q1 1 7 8.5t9.5 13.5t0.5 6q35 -4 50 11q5 5 11.5 17t10.5 17q9 6 14 5.5t14.5 -5.5
+t14.5 -5q14 -1 15.5 11t-7.5 20q12 -1 3 17q-4 7 -8 9q-12 4 -27 -5q-8 -4 2 -8q-1 1 -9.5 -10.5t-16.5 -17.5t-16 5q-1 1 -5.5 13.5t-9.5 13.5q-8 0 -16 -15q3 8 -11 15t-24 8q19 12 -8 27q-7 4 -20.5 5t-19.5 -4q-5 -7 -5.5 -11.5t5 -8t10.5 -5.5t11.5 -4t8.5 -3
+q14 -10 8 -14q-2 -1 -8.5 -3.5t-11.5 -4.5t-6 -4q-3 -4 0 -14t-2 -14q-5 5 -9 17.5t-7 16.5q7 -9 -25 -6l-10 1q-4 0 -16 -2t-20.5 -1t-13.5 8q-4 8 0 20q1 4 4 2q-4 3 -11 9.5t-10 8.5q-46 -15 -94 -41q6 -1 12 1q5 2 13 6.5t10 5.5q34 14 42 7l5 5q14 -16 20 -25
+q-7 4 -30 1q-20 -6 -22 -12q7 -12 5 -18q-4 3 -11.5 10t-14.5 11t-15 5q-16 0 -22 -1q-146 -80 -235 -222q7 -7 12 -8q4 -1 5 -9t2.5 -11t11.5 3q9 -8 3 -19q1 1 44 -27q19 -17 21 -21q3 -11 -10 -18q-1 2 -9 9t-9 4q-3 -5 0.5 -18.5t10.5 -12.5q-7 0 -9.5 -16t-2.5 -35.5
+t-1 -23.5l2 -1q-3 -12 5.5 -34.5t21.5 -19.5q-13 -3 20 -43q6 -8 8 -9q3 -2 12 -7.5t15 -10t10 -10.5q4 -5 10 -22.5t14 -23.5q-2 -6 9.5 -20t10.5 -23q-1 0 -2.5 -1t-2.5 -1q3 -7 15.5 -14t15.5 -13q1 -3 2 -10t3 -11t8 -2q2 20 -24 62q-15 25 -17 29q-3 5 -5.5 15.5
+t-4.5 14.5q2 0 6 -1.5t8.5 -3.5t7.5 -4t2 -3q-3 -7 2 -17.5t12 -18.5t17 -19t12 -13q6 -6 14 -19.5t0 -13.5q9 0 20 -10.5t17 -19.5q5 -8 8 -26t5 -24q2 -7 8.5 -13.5t12.5 -9.5l16 -8t13 -7q5 -2 18.5 -10.5t21.5 -11.5q10 -4 16 -4t14.5 2.5t13.5 3.5q15 2 29 -15t21 -21
+q36 -19 55 -11q-2 -1 0.5 -7.5t8 -15.5t9 -14.5t5.5 -8.5q5 -6 18 -15t18 -15q6 4 7 9q-3 -8 7 -20t18 -10q14 3 14 32q-31 -15 -49 18q0 1 -2.5 5.5t-4 8.5t-2.5 8.5t0 7.5t5 3q9 0 10 3.5t-2 12.5t-4 13q-1 8 -11 20t-12 15q-5 -9 -16 -8t-16 9q0 -1 -1.5 -5.5t-1.5 -6.5
+q-13 0 -15 1q1 3 2.5 17.5t3.5 22.5q1 4 5.5 12t7.5 14.5t4 12.5t-4.5 9.5t-17.5 2.5q-19 -1 -26 -20q-1 -3 -3 -10.5t-5 -11.5t-9 -7q-7 -3 -24 -2t-24 5q-13 8 -22.5 29t-9.5 37q0 10 2.5 26.5t3 25t-5.5 24.5q3 2 9 9.5t10 10.5q2 1 4.5 1.5t4.5 0t4 1.5t3 6q-1 1 -4 3
+q-3 3 -4 3q7 -3 28.5 1.5t27.5 -1.5q15 -11 22 2q0 1 -2.5 9.5t-0.5 13.5q5 -27 29 -9q3 -3 15.5 -5t17.5 -5q3 -2 7 -5.5t5.5 -4.5t5 0.5t8.5 6.5q10 -14 12 -24q11 -40 19 -44q7 -3 11 -2t4.5 9.5t0 14t-1.5 12.5l-1 8v18l-1 8q-15 3 -18.5 12t1.5 18.5t15 18.5q1 1 8 3.5
+t15.5 6.5t12.5 8q21 19 15 35q7 0 11 9q-1 0 -5 3t-7.5 5t-4.5 2q9 5 2 16q5 3 7.5 11t7.5 10q9 -12 21 -2q8 8 1 16q5 7 20.5 10.5t18.5 9.5q7 -2 8 2t1 12t3 12q4 5 15 9t13 5l17 11q3 4 0 4q18 -2 31 11q10 11 -6 20q3 6 -3 9.5t-15 5.5q3 1 11.5 0.5t10.5 1.5
+q15 10 -7 16q-17 5 -43 -12zM879 10q206 36 351 189q-3 3 -12.5 4.5t-12.5 3.5q-18 7 -24 8q1 7 -2.5 13t-8 9t-12.5 8t-11 7q-2 2 -7 6t-7 5.5t-7.5 4.5t-8.5 2t-10 -1l-3 -1q-3 -1 -5.5 -2.5t-5.5 -3t-4 -3t0 -2.5q-21 17 -36 22q-5 1 -11 5.5t-10.5 7t-10 1.5t-11.5 -7
+q-5 -5 -6 -15t-2 -13q-7 5 0 17.5t2 18.5q-3 6 -10.5 4.5t-12 -4.5t-11.5 -8.5t-9 -6.5t-8.5 -5.5t-8.5 -7.5q-3 -4 -6 -12t-5 -11q-2 4 -11.5 6.5t-9.5 5.5q2 -10 4 -35t5 -38q7 -31 -12 -48q-27 -25 -29 -40q-4 -22 12 -26q0 -7 -8 -20.5t-7 -21.5q0 -6 2 -16z" />
+    <glyph glyph-name="wrench" unicode="&#xf0ad;" horiz-adv-x="1664" 
+d="M384 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1028 484l-682 -682q-37 -37 -90 -37q-52 0 -91 37l-106 108q-38 36 -38 90q0 53 38 91l681 681q39 -98 114.5 -173.5t173.5 -114.5zM1662 919q0 -39 -23 -106q-47 -134 -164.5 -217.5
+t-258.5 -83.5q-185 0 -316.5 131.5t-131.5 316.5t131.5 316.5t316.5 131.5q58 0 121.5 -16.5t107.5 -46.5q16 -11 16 -28t-16 -28l-293 -169v-224l193 -107q5 3 79 48.5t135.5 81t70.5 35.5q15 0 23.5 -10t8.5 -25z" />
+    <glyph glyph-name="tasks" unicode="&#xf0ae;" horiz-adv-x="1792" 
+d="M1024 128h640v128h-640v-128zM640 640h1024v128h-1024v-128zM1280 1152h384v128h-384v-128zM1792 320v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 832v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19
+t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 1344v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="filter" unicode="&#xf0b0;" horiz-adv-x="1408" 
+d="M1403 1241q17 -41 -14 -70l-493 -493v-742q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-256 256q-19 19 -19 45v486l-493 493q-31 29 -14 70q17 39 59 39h1280q42 0 59 -39z" />
+    <glyph glyph-name="briefcase" unicode="&#xf0b1;" horiz-adv-x="1792" 
+d="M640 1280h512v128h-512v-128zM1792 640v-480q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v480h672v-160q0 -26 19 -45t45 -19h320q26 0 45 19t19 45v160h672zM1024 640v-128h-256v128h256zM1792 1120v-384h-1792v384q0 66 47 113t113 47h352v160q0 40 28 68
+t68 28h576q40 0 68 -28t28 -68v-160h352q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="fullscreen" unicode="&#xf0b2;" 
+d="M1283 995l-355 -355l355 -355l144 144q29 31 70 14q39 -17 39 -59v-448q0 -26 -19 -45t-45 -19h-448q-42 0 -59 40q-17 39 14 69l144 144l-355 355l-355 -355l144 -144q31 -30 14 -69q-17 -40 -59 -40h-448q-26 0 -45 19t-19 45v448q0 42 40 59q39 17 69 -14l144 -144
+l355 355l-355 355l-144 -144q-19 -19 -45 -19q-12 0 -24 5q-40 17 -40 59v448q0 26 19 45t45 19h448q42 0 59 -40q17 -39 -14 -69l-144 -144l355 -355l355 355l-144 144q-31 30 -14 69q17 40 59 40h448q26 0 45 -19t19 -45v-448q0 -42 -39 -59q-13 -5 -25 -5q-26 0 -45 19z
+" />
+    <glyph glyph-name="group" unicode="&#xf0c0;" horiz-adv-x="1920" 
+d="M593 640q-162 -5 -265 -128h-134q-82 0 -138 40.5t-56 118.5q0 353 124 353q6 0 43.5 -21t97.5 -42.5t119 -21.5q67 0 133 23q-5 -37 -5 -66q0 -139 81 -256zM1664 3q0 -120 -73 -189.5t-194 -69.5h-874q-121 0 -194 69.5t-73 189.5q0 53 3.5 103.5t14 109t26.5 108.5
+t43 97.5t62 81t85.5 53.5t111.5 20q10 0 43 -21.5t73 -48t107 -48t135 -21.5t135 21.5t107 48t73 48t43 21.5q61 0 111.5 -20t85.5 -53.5t62 -81t43 -97.5t26.5 -108.5t14 -109t3.5 -103.5zM640 1280q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75
+t75 -181zM1344 896q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5zM1920 671q0 -78 -56 -118.5t-138 -40.5h-134q-103 123 -265 128q81 117 81 256q0 29 -5 66q66 -23 133 -23q59 0 119 21.5t97.5 42.5
+t43.5 21q124 0 124 -353zM1792 1280q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181z" />
+    <glyph glyph-name="link" unicode="&#xf0c1;" horiz-adv-x="1664" 
+d="M1456 320q0 40 -28 68l-208 208q-28 28 -68 28q-42 0 -72 -32q3 -3 19 -18.5t21.5 -21.5t15 -19t13 -25.5t3.5 -27.5q0 -40 -28 -68t-68 -28q-15 0 -27.5 3.5t-25.5 13t-19 15t-21.5 21.5t-18.5 19q-33 -31 -33 -73q0 -40 28 -68l206 -207q27 -27 68 -27q40 0 68 26
+l147 146q28 28 28 67zM753 1025q0 40 -28 68l-206 207q-28 28 -68 28q-39 0 -68 -27l-147 -146q-28 -28 -28 -67q0 -40 28 -68l208 -208q27 -27 68 -27q42 0 72 31q-3 3 -19 18.5t-21.5 21.5t-15 19t-13 25.5t-3.5 27.5q0 40 28 68t68 28q15 0 27.5 -3.5t25.5 -13t19 -15
+t21.5 -21.5t18.5 -19q33 31 33 73zM1648 320q0 -120 -85 -203l-147 -146q-83 -83 -203 -83q-121 0 -204 85l-206 207q-83 83 -83 203q0 123 88 209l-88 88q-86 -88 -208 -88q-120 0 -204 84l-208 208q-84 84 -84 204t85 203l147 146q83 83 203 83q121 0 204 -85l206 -207
+q83 -83 83 -203q0 -123 -88 -209l88 -88q86 88 208 88q120 0 204 -84l208 -208q84 -84 84 -204z" />
+    <glyph glyph-name="cloud" unicode="&#xf0c2;" horiz-adv-x="1920" 
+d="M1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088q-185 0 -316.5 131.5t-131.5 316.5q0 132 71 241.5t187 163.5q-2 28 -2 43q0 212 150 362t362 150q158 0 286.5 -88t187.5 -230q70 62 166 62q106 0 181 -75t75 -181q0 -75 -41 -138q129 -30 213 -134.5t84 -239.5z
+" />
+    <glyph glyph-name="beaker" unicode="&#xf0c3;" horiz-adv-x="1664" 
+d="M1527 88q56 -89 21.5 -152.5t-140.5 -63.5h-1152q-106 0 -140.5 63.5t21.5 152.5l503 793v399h-64q-26 0 -45 19t-19 45t19 45t45 19h512q26 0 45 -19t19 -45t-19 -45t-45 -19h-64v-399zM748 813l-272 -429h712l-272 429l-20 31v37v399h-128v-399v-37z" />
+    <glyph glyph-name="cut" unicode="&#xf0c4;" horiz-adv-x="1792" 
+d="M960 640q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1260 576l507 -398q28 -20 25 -56q-5 -35 -35 -51l-128 -64q-13 -7 -29 -7q-17 0 -31 8l-690 387l-110 -66q-8 -4 -12 -5q14 -49 10 -97q-7 -77 -56 -147.5t-132 -123.5q-132 -84 -277 -84
+q-136 0 -222 78q-90 84 -79 207q7 76 56 147t131 124q132 84 278 84q83 0 151 -31q9 13 22 22l122 73l-122 73q-13 9 -22 22q-68 -31 -151 -31q-146 0 -278 84q-82 53 -131 124t-56 147q-5 59 15.5 113t63.5 93q85 79 222 79q145 0 277 -84q83 -52 132 -123t56 -148
+q4 -48 -10 -97q4 -1 12 -5l110 -66l690 387q14 8 31 8q16 0 29 -7l128 -64q30 -16 35 -51q3 -36 -25 -56zM579 836q46 42 21 108t-106 117q-92 59 -192 59q-74 0 -113 -36q-46 -42 -21 -108t106 -117q92 -59 192 -59q74 0 113 36zM494 91q81 51 106 117t-21 108
+q-39 36 -113 36q-100 0 -192 -59q-81 -51 -106 -117t21 -108q39 -36 113 -36q100 0 192 59zM672 704l96 -58v11q0 36 33 56l14 8l-79 47l-26 -26q-3 -3 -10 -11t-12 -12q-2 -2 -4 -3.5t-3 -2.5zM896 480l96 -32l736 576l-128 64l-768 -431v-113l-160 -96l9 -8q2 -2 7 -6
+q4 -4 11 -12t11 -12l26 -26zM1600 64l128 64l-520 408l-177 -138q-2 -3 -13 -7z" />
+    <glyph glyph-name="copy" unicode="&#xf0c5;" horiz-adv-x="1792" 
+d="M1696 1152q40 0 68 -28t28 -68v-1216q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v288h-544q-40 0 -68 28t-28 68v672q0 40 20 88t48 76l408 408q28 28 76 48t88 20h416q40 0 68 -28t28 -68v-328q68 40 128 40h416zM1152 939l-299 -299h299v299zM512 1323l-299 -299
+h299v299zM708 676l316 316v416h-384v-416q0 -40 -28 -68t-68 -28h-416v-640h512v256q0 40 20 88t48 76zM1664 -128v1152h-384v-416q0 -40 -28 -68t-68 -28h-416v-640h896z" />
+    <glyph glyph-name="paper_clip" unicode="&#xf0c6;" horiz-adv-x="1408" 
+d="M1404 151q0 -117 -79 -196t-196 -79q-135 0 -235 100l-777 776q-113 115 -113 271q0 159 110 270t269 111q158 0 273 -113l605 -606q10 -10 10 -22q0 -16 -30.5 -46.5t-46.5 -30.5q-13 0 -23 10l-606 607q-79 77 -181 77q-106 0 -179 -75t-73 -181q0 -105 76 -181
+l776 -777q63 -63 145 -63q64 0 106 42t42 106q0 82 -63 145l-581 581q-26 24 -60 24q-29 0 -48 -19t-19 -48q0 -32 25 -59l410 -410q10 -10 10 -22q0 -16 -31 -47t-47 -31q-12 0 -22 10l-410 410q-63 61 -63 149q0 82 57 139t139 57q88 0 149 -63l581 -581q100 -98 100 -235
+z" />
+    <glyph glyph-name="save" unicode="&#xf0c7;" 
+d="M384 0h768v384h-768v-384zM1280 0h128v896q0 14 -10 38.5t-20 34.5l-281 281q-10 10 -34 20t-39 10v-416q0 -40 -28 -68t-68 -28h-576q-40 0 -68 28t-28 68v416h-128v-1280h128v416q0 40 28 68t68 28h832q40 0 68 -28t28 -68v-416zM896 928v320q0 13 -9.5 22.5t-22.5 9.5
+h-192q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 22.5zM1536 896v-928q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h928q40 0 88 -20t76 -48l280 -280q28 -28 48 -76t20 -88z" />
+    <glyph glyph-name="sign_blank" unicode="&#xf0c8;" 
+d="M1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="reorder" unicode="&#xf0c9;" 
+d="M1536 192v-128q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1536 704v-128q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1536 1216v-128q0 -26 -19 -45
+t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="ul" unicode="&#xf0ca;" horiz-adv-x="1792" 
+d="M384 128q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM384 640q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5
+t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5zM384 1152q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1792 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z
+M1792 1248v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z" />
+    <glyph glyph-name="ol" unicode="&#xf0cb;" horiz-adv-x="1792" 
+d="M381 -84q0 -80 -54.5 -126t-135.5 -46q-106 0 -172 66l57 88q49 -45 106 -45q29 0 50.5 14.5t21.5 42.5q0 64 -105 56l-26 56q8 10 32.5 43.5t42.5 54t37 38.5v1q-16 0 -48.5 -1t-48.5 -1v-53h-106v152h333v-88l-95 -115q51 -12 81 -49t30 -88zM383 543v-159h-362
+q-6 36 -6 54q0 51 23.5 93t56.5 68t66 47.5t56.5 43.5t23.5 45q0 25 -14.5 38.5t-39.5 13.5q-46 0 -81 -58l-85 59q24 51 71.5 79.5t105.5 28.5q73 0 123 -41.5t50 -112.5q0 -50 -34 -91.5t-75 -64.5t-75.5 -50.5t-35.5 -52.5h127v60h105zM1792 224v-192q0 -13 -9.5 -22.5
+t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 14 9 23t23 9h1216q13 0 22.5 -9.5t9.5 -22.5zM384 1123v-99h-335v99h107q0 41 0.5 121.5t0.5 121.5v12h-2q-8 -17 -50 -54l-71 76l136 127h106v-404h108zM1792 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216
+q-13 0 -22.5 9.5t-9.5 22.5v192q0 14 9 23t23 9h1216q13 0 22.5 -9.5t9.5 -22.5zM1792 1248v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z" />
+    <glyph glyph-name="strikethrough" unicode="&#xf0cc;" horiz-adv-x="1792" 
+d="M1760 640q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1728q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h1728zM483 704q-28 35 -51 80q-48 98 -48 188q0 181 134 309q133 127 393 127q50 0 167 -19q66 -12 177 -48q10 -38 21 -118q14 -123 14 -183q0 -18 -5 -45l-12 -3l-84 6
+l-14 2q-50 149 -103 205q-88 91 -210 91q-114 0 -182 -59q-67 -58 -67 -146q0 -73 66 -140t279 -129q69 -20 173 -66q58 -28 95 -52h-743zM990 448h411q7 -39 7 -92q0 -111 -41 -212q-23 -56 -71 -104q-37 -35 -109 -81q-80 -48 -153 -66q-80 -21 -203 -21q-114 0 -195 23
+l-140 40q-57 16 -72 28q-8 8 -8 22v13q0 108 -2 156q-1 30 0 68l2 37v44l102 2q15 -34 30 -71t22.5 -56t12.5 -27q35 -57 80 -94q43 -36 105 -57q59 -22 132 -22q64 0 139 27q77 26 122 86q47 61 47 129q0 84 -81 157q-34 29 -137 71z" />
+    <glyph glyph-name="underline" unicode="&#xf0cd;" 
+d="M48 1313q-37 2 -45 4l-3 88q13 1 40 1q60 0 112 -4q132 -7 166 -7q86 0 168 3q116 4 146 5q56 0 86 2l-1 -14l2 -64v-9q-60 -9 -124 -9q-60 0 -79 -25q-13 -14 -13 -132q0 -13 0.5 -32.5t0.5 -25.5l1 -229l14 -280q6 -124 51 -202q35 -59 96 -92q88 -47 177 -47
+q104 0 191 28q56 18 99 51q48 36 65 64q36 56 53 114q21 73 21 229q0 79 -3.5 128t-11 122.5t-13.5 159.5l-4 59q-5 67 -24 88q-34 35 -77 34l-100 -2l-14 3l2 86h84l205 -10q76 -3 196 10l18 -2q6 -38 6 -51q0 -7 -4 -31q-45 -12 -84 -13q-73 -11 -79 -17q-15 -15 -15 -41
+q0 -7 1.5 -27t1.5 -31q8 -19 22 -396q6 -195 -15 -304q-15 -76 -41 -122q-38 -65 -112 -123q-75 -57 -182 -89q-109 -33 -255 -33q-167 0 -284 46q-119 47 -179 122q-61 76 -83 195q-16 80 -16 237v333q0 188 -17 213q-25 36 -147 39zM1536 -96v64q0 14 -9 23t-23 9h-1472
+q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h1472q14 0 23 9t9 23z" />
+    <glyph glyph-name="table" unicode="&#xf0ce;" horiz-adv-x="1664" 
+d="M512 160v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM512 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 160v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23
+v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM512 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 160v192
+q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192
+q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1664 1248v-1088q0 -66 -47 -113t-113 -47h-1344q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1344q66 0 113 -47t47 -113
+z" />
+    <glyph glyph-name="magic" unicode="&#xf0d0;" horiz-adv-x="1664" 
+d="M1190 955l293 293l-107 107l-293 -293zM1637 1248q0 -27 -18 -45l-1286 -1286q-18 -18 -45 -18t-45 18l-198 198q-18 18 -18 45t18 45l1286 1286q18 18 45 18t45 -18l198 -198q18 -18 18 -45zM286 1438l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98zM636 1276
+l196 -60l-196 -60l-60 -196l-60 196l-196 60l196 60l60 196zM1566 798l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98zM926 1438l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98z" />
+    <glyph glyph-name="truck" unicode="&#xf0d1;" horiz-adv-x="1792" 
+d="M640 128q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM256 640h384v256h-158q-13 0 -22 -9l-195 -195q-9 -9 -9 -22v-30zM1536 128q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM1792 1216v-1024q0 -15 -4 -26.5t-13.5 -18.5
+t-16.5 -11.5t-23.5 -6t-22.5 -2t-25.5 0t-22.5 0.5q0 -106 -75 -181t-181 -75t-181 75t-75 181h-384q0 -106 -75 -181t-181 -75t-181 75t-75 181h-64q-3 0 -22.5 -0.5t-25.5 0t-22.5 2t-23.5 6t-16.5 11.5t-13.5 18.5t-4 26.5q0 26 19 45t45 19v320q0 8 -0.5 35t0 38
+t2.5 34.5t6.5 37t14 30.5t22.5 30l198 198q19 19 50.5 32t58.5 13h160v192q0 26 19 45t45 19h1024q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="pinterest" unicode="&#xf0d2;" 
+d="M1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103q-111 0 -218 32q59 93 78 164q9 34 54 211q20 -39 73 -67.5t114 -28.5q121 0 216 68.5t147 188.5t52 270q0 114 -59.5 214t-172.5 163t-255 63q-105 0 -196 -29t-154.5 -77t-109 -110.5t-67 -129.5t-21.5 -134
+q0 -104 40 -183t117 -111q30 -12 38 20q2 7 8 31t8 30q6 23 -11 43q-51 61 -51 151q0 151 104.5 259.5t273.5 108.5q151 0 235.5 -82t84.5 -213q0 -170 -68.5 -289t-175.5 -119q-61 0 -98 43.5t-23 104.5q8 35 26.5 93.5t30 103t11.5 75.5q0 50 -27 83t-77 33
+q-62 0 -105 -57t-43 -142q0 -73 25 -122l-99 -418q-17 -70 -13 -177q-206 91 -333 281t-127 423q0 209 103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="pinterest_sign" unicode="&#xf0d3;" 
+d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-725q85 122 108 210q9 34 53 209q21 -39 73.5 -67t112.5 -28q181 0 295.5 147.5t114.5 373.5q0 84 -35 162.5t-96.5 139t-152.5 97t-197 36.5q-104 0 -194.5 -28.5t-153 -76.5
+t-107.5 -109.5t-66.5 -128t-21.5 -132.5q0 -102 39.5 -180t116.5 -110q13 -5 23.5 0t14.5 19q10 44 15 61q6 23 -11 42q-50 62 -50 150q0 150 103.5 256.5t270.5 106.5q149 0 232.5 -81t83.5 -210q0 -168 -67.5 -286t-173.5 -118q-60 0 -97 43.5t-23 103.5q8 34 26.5 92.5
+t29.5 102t11 74.5q0 49 -26.5 81.5t-75.5 32.5q-61 0 -103.5 -56.5t-42.5 -139.5q0 -72 24 -121l-98 -414q-24 -100 -7 -254h-183q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960z" />
+    <glyph glyph-name="google_plus_sign" unicode="&#xf0d4;" 
+d="M917 631q0 26 -6 64h-362v-132h217q-3 -24 -16.5 -50t-37.5 -53t-66.5 -44.5t-96.5 -17.5q-99 0 -169 71t-70 171t70 171t169 71q92 0 153 -59l104 101q-108 100 -257 100q-160 0 -272 -112.5t-112 -271.5t112 -271.5t272 -112.5q165 0 266.5 105t101.5 270zM1262 585
+h109v110h-109v110h-110v-110h-110v-110h110v-110h110v110zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="google_plus" unicode="&#xf0d5;" horiz-adv-x="2304" 
+d="M1437 623q0 -208 -87 -370.5t-248 -254t-369 -91.5q-149 0 -285 58t-234 156t-156 234t-58 285t58 285t156 234t234 156t285 58q286 0 491 -192l-199 -191q-117 113 -292 113q-123 0 -227.5 -62t-165.5 -168.5t-61 -232.5t61 -232.5t165.5 -168.5t227.5 -62
+q83 0 152.5 23t114.5 57.5t78.5 78.5t49 83t21.5 74h-416v252h692q12 -63 12 -122zM2304 745v-210h-209v-209h-210v209h-209v210h209v209h210v-209h209z" />
+    <glyph glyph-name="money" unicode="&#xf0d6;" horiz-adv-x="1920" 
+d="M768 384h384v96h-128v448h-114l-148 -137l77 -80q42 37 55 57h2v-288h-128v-96zM1280 640q0 -70 -21 -142t-59.5 -134t-101.5 -101t-138 -39t-138 39t-101.5 101t-59.5 134t-21 142t21 142t59.5 134t101.5 101t138 39t138 -39t101.5 -101t59.5 -134t21 -142zM1792 384
+v512q-106 0 -181 75t-75 181h-1152q0 -106 -75 -181t-181 -75v-512q106 0 181 -75t75 -181h1152q0 106 75 181t181 75zM1920 1216v-1152q0 -26 -19 -45t-45 -19h-1792q-26 0 -45 19t-19 45v1152q0 26 19 45t45 19h1792q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="caret_down" unicode="&#xf0d7;" horiz-adv-x="1024" 
+d="M1024 832q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="caret_up" unicode="&#xf0d8;" horiz-adv-x="1024" 
+d="M1024 320q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" />
+    <glyph glyph-name="caret_left" unicode="&#xf0d9;" horiz-adv-x="640" 
+d="M640 1088v-896q0 -26 -19 -45t-45 -19t-45 19l-448 448q-19 19 -19 45t19 45l448 448q19 19 45 19t45 -19t19 -45z" />
+    <glyph glyph-name="caret_right" unicode="&#xf0da;" horiz-adv-x="640" 
+d="M576 640q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19t-19 45v896q0 26 19 45t45 19t45 -19l448 -448q19 -19 19 -45z" />
+    <glyph glyph-name="columns" unicode="&#xf0db;" horiz-adv-x="1664" 
+d="M160 0h608v1152h-640v-1120q0 -13 9.5 -22.5t22.5 -9.5zM1536 32v1120h-640v-1152h608q13 0 22.5 9.5t9.5 22.5zM1664 1248v-1216q0 -66 -47 -113t-113 -47h-1344q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1344q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="sort" unicode="&#xf0dc;" horiz-adv-x="1024" 
+d="M1024 448q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45zM1024 832q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" />
+    <glyph glyph-name="sort_down" unicode="&#xf0dd;" horiz-adv-x="1024" 
+d="M1024 448q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="sort_up" unicode="&#xf0de;" horiz-adv-x="1024" 
+d="M1024 832q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" />
+    <glyph glyph-name="envelope_alt" unicode="&#xf0e0;" horiz-adv-x="1792" 
+d="M1792 826v-794q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v794q44 -49 101 -87q362 -246 497 -345q57 -42 92.5 -65.5t94.5 -48t110 -24.5h1h1q51 0 110 24.5t94.5 48t92.5 65.5q170 123 498 345q57 39 100 87zM1792 1120q0 -79 -49 -151t-122 -123
+q-376 -261 -468 -325q-10 -7 -42.5 -30.5t-54 -38t-52 -32.5t-57.5 -27t-50 -9h-1h-1q-23 0 -50 9t-57.5 27t-52 32.5t-54 38t-42.5 30.5q-91 64 -262 182.5t-205 142.5q-62 42 -117 115.5t-55 136.5q0 78 41.5 130t118.5 52h1472q65 0 112.5 -47t47.5 -113z" />
+    <glyph glyph-name="linkedin" unicode="&#xf0e1;" 
+d="M349 911v-991h-330v991h330zM370 1217q1 -73 -50.5 -122t-135.5 -49h-2q-82 0 -132 49t-50 122q0 74 51.5 122.5t134.5 48.5t133 -48.5t51 -122.5zM1536 488v-568h-329v530q0 105 -40.5 164.5t-126.5 59.5q-63 0 -105.5 -34.5t-63.5 -85.5q-11 -30 -11 -81v-553h-329
+q2 399 2 647t-1 296l-1 48h329v-144h-2q20 32 41 56t56.5 52t87 43.5t114.5 15.5q171 0 275 -113.5t104 -332.5z" />
+    <glyph glyph-name="undo" unicode="&#xf0e2;" 
+d="M1536 640q0 -156 -61 -298t-164 -245t-245 -164t-298 -61q-172 0 -327 72.5t-264 204.5q-7 10 -6.5 22.5t8.5 20.5l137 138q10 9 25 9q16 -2 23 -12q73 -95 179 -147t225 -52q104 0 198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5t-40.5 198.5t-109.5 163.5
+t-163.5 109.5t-198.5 40.5q-98 0 -188 -35.5t-160 -101.5l137 -138q31 -30 14 -69q-17 -40 -59 -40h-448q-26 0 -45 19t-19 45v448q0 42 40 59q39 17 69 -14l130 -129q107 101 244.5 156.5t284.5 55.5q156 0 298 -61t245 -164t164 -245t61 -298z" />
+    <glyph glyph-name="legal" unicode="&#xf0e3;" horiz-adv-x="1792" 
+d="M1771 0q0 -53 -37 -90l-107 -108q-39 -37 -91 -37q-53 0 -90 37l-363 364q-38 36 -38 90q0 53 43 96l-256 256l-126 -126q-14 -14 -34 -14t-34 14q2 -2 12.5 -12t12.5 -13t10 -11.5t10 -13.5t6 -13.5t5.5 -16.5t1.5 -18q0 -38 -28 -68q-3 -3 -16.5 -18t-19 -20.5
+t-18.5 -16.5t-22 -15.5t-22 -9t-26 -4.5q-40 0 -68 28l-408 408q-28 28 -28 68q0 13 4.5 26t9 22t15.5 22t16.5 18.5t20.5 19t18 16.5q30 28 68 28q10 0 18 -1.5t16.5 -5.5t13.5 -6t13.5 -10t11.5 -10t13 -12.5t12 -12.5q-14 14 -14 34t14 34l348 348q14 14 34 14t34 -14
+q-2 2 -12.5 12t-12.5 13t-10 11.5t-10 13.5t-6 13.5t-5.5 16.5t-1.5 18q0 38 28 68q3 3 16.5 18t19 20.5t18.5 16.5t22 15.5t22 9t26 4.5q40 0 68 -28l408 -408q28 -28 28 -68q0 -13 -4.5 -26t-9 -22t-15.5 -22t-16.5 -18.5t-20.5 -19t-18 -16.5q-30 -28 -68 -28
+q-10 0 -18 1.5t-16.5 5.5t-13.5 6t-13.5 10t-11.5 10t-13 12.5t-12 12.5q14 -14 14 -34t-14 -34l-126 -126l256 -256q43 43 96 43q52 0 91 -37l363 -363q37 -39 37 -91z" />
+    <glyph glyph-name="dashboard" unicode="&#xf0e4;" horiz-adv-x="1792" 
+d="M384 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM576 832q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1004 351l101 382q6 26 -7.5 48.5t-38.5 29.5
+t-48 -6.5t-30 -39.5l-101 -382q-60 -5 -107 -43.5t-63 -98.5q-20 -77 20 -146t117 -89t146 20t89 117q16 60 -6 117t-72 91zM1664 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1024 1024q0 53 -37.5 90.5
+t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1472 832q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1792 384q0 -261 -141 -483q-19 -29 -54 -29h-1402q-35 0 -54 29
+q-141 221 -141 483q0 182 71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" />
+    <glyph glyph-name="comment_alt" unicode="&#xf0e5;" horiz-adv-x="1792" 
+d="M896 1152q-204 0 -381.5 -69.5t-282 -187.5t-104.5 -255q0 -112 71.5 -213.5t201.5 -175.5l87 -50l-27 -96q-24 -91 -70 -172q152 63 275 171l43 38l57 -6q69 -8 130 -8q204 0 381.5 69.5t282 187.5t104.5 255t-104.5 255t-282 187.5t-381.5 69.5zM1792 640
+q0 -174 -120 -321.5t-326 -233t-450 -85.5q-70 0 -145 8q-198 -175 -460 -242q-49 -14 -114 -22h-5q-15 0 -27 10.5t-16 27.5v1q-3 4 -0.5 12t2 10t4.5 9.5l6 9t7 8.5t8 9q7 8 31 34.5t34.5 38t31 39.5t32.5 51t27 59t26 76q-157 89 -247.5 220t-90.5 281q0 174 120 321.5
+t326 233t450 85.5t450 -85.5t326 -233t120 -321.5z" />
+    <glyph glyph-name="comments_alt" unicode="&#xf0e6;" horiz-adv-x="1792" 
+d="M704 1152q-153 0 -286 -52t-211.5 -141t-78.5 -191q0 -82 53 -158t149 -132l97 -56l-35 -84q34 20 62 39l44 31l53 -10q78 -14 153 -14q153 0 286 52t211.5 141t78.5 191t-78.5 191t-211.5 141t-286 52zM704 1280q191 0 353.5 -68.5t256.5 -186.5t94 -257t-94 -257
+t-256.5 -186.5t-353.5 -68.5q-86 0 -176 16q-124 -88 -278 -128q-36 -9 -86 -16h-3q-11 0 -20.5 8t-11.5 21q-1 3 -1 6.5t0.5 6.5t2 6l2.5 5t3.5 5.5t4 5t4.5 5t4 4.5q5 6 23 25t26 29.5t22.5 29t25 38.5t20.5 44q-124 72 -195 177t-71 224q0 139 94 257t256.5 186.5
+t353.5 68.5zM1526 111q10 -24 20.5 -44t25 -38.5t22.5 -29t26 -29.5t23 -25q1 -1 4 -4.5t4.5 -5t4 -5t3.5 -5.5l2.5 -5t2 -6t0.5 -6.5t-1 -6.5q-3 -14 -13 -22t-22 -7q-50 7 -86 16q-154 40 -278 128q-90 -16 -176 -16q-271 0 -472 132q58 -4 88 -4q161 0 309 45t264 129
+q125 92 192 212t67 254q0 77 -23 152q129 -71 204 -178t75 -230q0 -120 -71 -224.5t-195 -176.5z" />
+    <glyph glyph-name="bolt" unicode="&#xf0e7;" horiz-adv-x="896" 
+d="M885 970q18 -20 7 -44l-540 -1157q-13 -25 -42 -25q-4 0 -14 2q-17 5 -25.5 19t-4.5 30l197 808l-406 -101q-4 -1 -12 -1q-18 0 -31 11q-18 15 -13 39l201 825q4 14 16 23t28 9h328q19 0 32 -12.5t13 -29.5q0 -8 -5 -18l-171 -463l396 98q8 2 12 2q19 0 34 -15z" />
+    <glyph glyph-name="sitemap" unicode="&#xf0e8;" horiz-adv-x="1792" 
+d="M1792 288v-320q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192h-512v-192h96q40 0 68 -28t28 -68v-320q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192h-512v-192h96q40 0 68 -28t28 -68v-320
+q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192q0 52 38 90t90 38h512v192h-96q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h320q40 0 68 -28t28 -68v-320q0 -40 -28 -68t-68 -28h-96v-192h512q52 0 90 -38t38 -90v-192h96q40 0 68 -28t28 -68
+z" />
+    <glyph glyph-name="umbrella" unicode="&#xf0e9;" horiz-adv-x="1664" 
+d="M896 708v-580q0 -104 -76 -180t-180 -76t-180 76t-76 180q0 26 19 45t45 19t45 -19t19 -45q0 -50 39 -89t89 -39t89 39t39 89v580q33 11 64 11t64 -11zM1664 681q0 -13 -9.5 -22.5t-22.5 -9.5q-11 0 -23 10q-49 46 -93 69t-102 23q-68 0 -128 -37t-103 -97
+q-7 -10 -17.5 -28t-14.5 -24q-11 -17 -28 -17q-18 0 -29 17q-4 6 -14.5 24t-17.5 28q-43 60 -102.5 97t-127.5 37t-127.5 -37t-102.5 -97q-7 -10 -17.5 -28t-14.5 -24q-11 -17 -29 -17q-17 0 -28 17q-4 6 -14.5 24t-17.5 28q-43 60 -103 97t-128 37q-58 0 -102 -23t-93 -69
+q-12 -10 -23 -10q-13 0 -22.5 9.5t-9.5 22.5q0 5 1 7q45 183 172.5 319.5t298 204.5t360.5 68q140 0 274.5 -40t246.5 -113.5t194.5 -187t115.5 -251.5q1 -2 1 -7zM896 1408v-98q-42 2 -64 2t-64 -2v98q0 26 19 45t45 19t45 -19t19 -45z" />
+    <glyph glyph-name="paste" unicode="&#xf0ea;" horiz-adv-x="1792" 
+d="M768 -128h896v640h-416q-40 0 -68 28t-28 68v416h-384v-1152zM1024 1312v64q0 13 -9.5 22.5t-22.5 9.5h-704q-13 0 -22.5 -9.5t-9.5 -22.5v-64q0 -13 9.5 -22.5t22.5 -9.5h704q13 0 22.5 9.5t9.5 22.5zM1280 640h299l-299 299v-299zM1792 512v-672q0 -40 -28 -68t-68 -28
+h-960q-40 0 -68 28t-28 68v160h-544q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h1088q40 0 68 -28t28 -68v-328q21 -13 36 -28l408 -408q28 -28 48 -76t20 -88z" />
+    <glyph glyph-name="light_bulb" unicode="&#xf0eb;" horiz-adv-x="1024" 
+d="M736 960q0 -13 -9.5 -22.5t-22.5 -9.5t-22.5 9.5t-9.5 22.5q0 46 -54 71t-106 25q-13 0 -22.5 9.5t-9.5 22.5t9.5 22.5t22.5 9.5q50 0 99.5 -16t87 -54t37.5 -90zM896 960q0 72 -34.5 134t-90 101.5t-123 62t-136.5 22.5t-136.5 -22.5t-123 -62t-90 -101.5t-34.5 -134
+q0 -101 68 -180q10 -11 30.5 -33t30.5 -33q128 -153 141 -298h228q13 145 141 298q10 11 30.5 33t30.5 33q68 79 68 180zM1024 960q0 -155 -103 -268q-45 -49 -74.5 -87t-59.5 -95.5t-34 -107.5q47 -28 47 -82q0 -37 -25 -64q25 -27 25 -64q0 -52 -45 -81q13 -23 13 -47
+q0 -46 -31.5 -71t-77.5 -25q-20 -44 -60 -70t-87 -26t-87 26t-60 70q-46 0 -77.5 25t-31.5 71q0 24 13 47q-45 29 -45 81q0 37 25 64q-25 27 -25 64q0 54 47 82q-4 50 -34 107.5t-59.5 95.5t-74.5 87q-103 113 -103 268q0 99 44.5 184.5t117 142t164 89t186.5 32.5
+t186.5 -32.5t164 -89t117 -142t44.5 -184.5z" />
+    <glyph glyph-name="exchange" unicode="&#xf0ec;" horiz-adv-x="1792" 
+d="M1792 352v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5q-12 0 -24 10l-319 320q-9 9 -9 22q0 14 9 23l320 320q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5v-192h1376q13 0 22.5 -9.5t9.5 -22.5zM1792 896q0 -14 -9 -23l-320 -320q-9 -9 -23 -9
+q-13 0 -22.5 9.5t-9.5 22.5v192h-1376q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1376v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23z" />
+    <glyph glyph-name="cloud_download" unicode="&#xf0ed;" horiz-adv-x="1920" 
+d="M1280 608q0 14 -9 23t-23 9h-224v352q0 13 -9.5 22.5t-22.5 9.5h-192q-13 0 -22.5 -9.5t-9.5 -22.5v-352h-224q-13 0 -22.5 -9.5t-9.5 -22.5q0 -14 9 -23l352 -352q9 -9 23 -9t23 9l351 351q10 12 10 24zM1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088
+q-185 0 -316.5 131.5t-131.5 316.5q0 130 70 240t188 165q-2 30 -2 43q0 212 150 362t362 150q156 0 285.5 -87t188.5 -231q71 62 166 62q106 0 181 -75t75 -181q0 -76 -41 -138q130 -31 213.5 -135.5t83.5 -238.5z" />
+    <glyph glyph-name="cloud_upload" unicode="&#xf0ee;" horiz-adv-x="1920" 
+d="M1280 672q0 14 -9 23l-352 352q-9 9 -23 9t-23 -9l-351 -351q-10 -12 -10 -24q0 -14 9 -23t23 -9h224v-352q0 -13 9.5 -22.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 22.5v352h224q13 0 22.5 9.5t9.5 22.5zM1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088
+q-185 0 -316.5 131.5t-131.5 316.5q0 130 70 240t188 165q-2 30 -2 43q0 212 150 362t362 150q156 0 285.5 -87t188.5 -231q71 62 166 62q106 0 181 -75t75 -181q0 -76 -41 -138q130 -31 213.5 -135.5t83.5 -238.5z" />
+    <glyph glyph-name="user_md" unicode="&#xf0f0;" horiz-adv-x="1408" 
+d="M384 192q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45t45 19t45 -19t19 -45zM1408 131q0 -121 -73 -190t-194 -69h-874q-121 0 -194 69t-73 190q0 68 5.5 131t24 138t47.5 132.5t81 103t120 60.5q-22 -52 -22 -120v-203q-58 -20 -93 -70t-35 -111q0 -80 56 -136t136 -56
+t136 56t56 136q0 61 -35.5 111t-92.5 70v203q0 62 25 93q132 -104 295 -104t295 104q25 -31 25 -93v-64q-106 0 -181 -75t-75 -181v-89q-32 -29 -32 -71q0 -40 28 -68t68 -28t68 28t28 68q0 42 -32 71v89q0 52 38 90t90 38t90 -38t38 -90v-89q-32 -29 -32 -71q0 -40 28 -68
+t68 -28t68 28t28 68q0 42 -32 71v89q0 68 -34.5 127.5t-93.5 93.5q0 10 0.5 42.5t0 48t-2.5 41.5t-7 47t-13 40q68 -15 120 -60.5t81 -103t47.5 -132.5t24 -138t5.5 -131zM1088 1024q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5
+t271.5 -112.5t112.5 -271.5z" />
+    <glyph glyph-name="stethoscope" unicode="&#xf0f1;" horiz-adv-x="1408" 
+d="M1280 832q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 832q0 -62 -35.5 -111t-92.5 -70v-395q0 -159 -131.5 -271.5t-316.5 -112.5t-316.5 112.5t-131.5 271.5v132q-164 20 -274 128t-110 252v512q0 26 19 45t45 19q6 0 16 -2q17 30 47 48
+t65 18q53 0 90.5 -37.5t37.5 -90.5t-37.5 -90.5t-90.5 -37.5q-33 0 -64 18v-402q0 -106 94 -181t226 -75t226 75t94 181v402q-31 -18 -64 -18q-53 0 -90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5q35 0 65 -18t47 -48q10 2 16 2q26 0 45 -19t19 -45v-512q0 -144 -110 -252
+t-274 -128v-132q0 -106 94 -181t226 -75t226 75t94 181v395q-57 21 -92.5 70t-35.5 111q0 80 56 136t136 56t136 -56t56 -136z" />
+    <glyph glyph-name="suitcase" unicode="&#xf0f2;" horiz-adv-x="1792" 
+d="M640 1152h512v128h-512v-128zM288 1152v-1280h-64q-92 0 -158 66t-66 158v832q0 92 66 158t158 66h64zM1408 1152v-1280h-1024v1280h128v160q0 40 28 68t68 28h576q40 0 68 -28t28 -68v-160h128zM1792 928v-832q0 -92 -66 -158t-158 -66h-64v1280h64q92 0 158 -66
+t66 -158z" />
+    <glyph glyph-name="bell_alt" unicode="&#xf0f3;" horiz-adv-x="1792" 
+d="M912 -160q0 16 -16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5q16 0 16 16zM1728 128q0 -52 -38 -90t-90 -38h-448q0 -106 -75 -181t-181 -75t-181 75t-75 181h-448q-52 0 -90 38t-38 90q50 42 91 88t85 119.5t74.5 158.5
+t50 206t19.5 260q0 152 117 282.5t307 158.5q-8 19 -8 39q0 40 28 68t68 28t68 -28t28 -68q0 -20 -8 -39q190 -28 307 -158.5t117 -282.5q0 -139 19.5 -260t50 -206t74.5 -158.5t85 -119.5t91 -88z" />
+    <glyph glyph-name="coffee" unicode="&#xf0f4;" horiz-adv-x="1920" 
+d="M1664 896q0 80 -56 136t-136 56h-64v-384h64q80 0 136 56t56 136zM0 128h1792q0 -106 -75 -181t-181 -75h-1280q-106 0 -181 75t-75 181zM1856 896q0 -159 -112.5 -271.5t-271.5 -112.5h-64v-32q0 -92 -66 -158t-158 -66h-704q-92 0 -158 66t-66 158v736q0 26 19 45
+t45 19h1152q159 0 271.5 -112.5t112.5 -271.5z" />
+    <glyph glyph-name="food" unicode="&#xf0f5;" horiz-adv-x="1408" 
+d="M640 1472v-640q0 -61 -35.5 -111t-92.5 -70v-779q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v779q-57 20 -92.5 70t-35.5 111v640q0 26 19 45t45 19t45 -19t19 -45v-416q0 -26 19 -45t45 -19t45 19t19 45v416q0 26 19 45t45 19t45 -19t19 -45v-416q0 -26 19 -45
+t45 -19t45 19t19 45v416q0 26 19 45t45 19t45 -19t19 -45zM1408 1472v-1600q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v512h-224q-13 0 -22.5 9.5t-9.5 22.5v800q0 132 94 226t226 94h256q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="file_text_alt" unicode="&#xf0f6;" 
+d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z
+M384 736q0 14 9 23t23 9h704q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-704q-14 0 -23 9t-9 23v64zM1120 512q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-704q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h704zM1120 256q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-704
+q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h704z" />
+    <glyph glyph-name="building" unicode="&#xf0f7;" horiz-adv-x="1408" 
+d="M384 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M640 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M1152 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M640 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M1152 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M640 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M1152 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M640 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M896 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M896 -128h384v1536h-1152v-1536h384v224q0 13 9.5 22.5t22.5 9.5h320q13 0 22.5 -9.5t9.5 -22.5v-224zM1408 1472v-1664q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v1664q0 26 19 45t45 19h1280q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="hospital" unicode="&#xf0f8;" horiz-adv-x="1408" 
+d="M384 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M640 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M1152 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M640 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M896 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M896 -128h384v1152h-256v-32q0 -40 -28 -68t-68 -28h-448q-40 0 -68 28t-28 68v32h-256v-1152h384v224q0 13 9.5 22.5t22.5 9.5h320q13 0 22.5 -9.5t9.5 -22.5v-224zM896 1056v320q0 13 -9.5 22.5t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-96h-128v96q0 13 -9.5 22.5
+t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5v96h128v-96q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1408 1088v-1280q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v1280q0 26 19 45t45 19h320
+v288q0 40 28 68t68 28h448q40 0 68 -28t28 -68v-288h320q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="ambulance" unicode="&#xf0f9;" horiz-adv-x="1920" 
+d="M640 128q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM256 640h384v256h-158q-14 -2 -22 -9l-195 -195q-7 -12 -9 -22v-30zM1536 128q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5
+t90.5 37.5t37.5 90.5zM1664 800v192q0 14 -9 23t-23 9h-224v224q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-224h-224q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h224v-224q0 -14 9 -23t23 -9h192q14 0 23 9t9 23v224h224q14 0 23 9t9 23zM1920 1344v-1152
+q0 -26 -19 -45t-45 -19h-192q0 -106 -75 -181t-181 -75t-181 75t-75 181h-384q0 -106 -75 -181t-181 -75t-181 75t-75 181h-128q-26 0 -45 19t-19 45t19 45t45 19v416q0 26 13 58t32 51l198 198q19 19 51 32t58 13h160v320q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="medkit" unicode="&#xf0fa;" horiz-adv-x="1792" 
+d="M1280 416v192q0 14 -9 23t-23 9h-224v224q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-224h-224q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h224v-224q0 -14 9 -23t23 -9h192q14 0 23 9t9 23v224h224q14 0 23 9t9 23zM640 1152h512v128h-512v-128zM256 1152v-1280h-32
+q-92 0 -158 66t-66 158v832q0 92 66 158t158 66h32zM1440 1152v-1280h-1088v1280h160v160q0 40 28 68t68 28h576q40 0 68 -28t28 -68v-160h160zM1792 928v-832q0 -92 -66 -158t-158 -66h-32v1280h32q92 0 158 -66t66 -158z" />
+    <glyph glyph-name="fighter_jet" unicode="&#xf0fb;" horiz-adv-x="1920" 
+d="M1920 576q-1 -32 -288 -96l-352 -32l-224 -64h-64l-293 -352h69q26 0 45 -4.5t19 -11.5t-19 -11.5t-45 -4.5h-96h-160h-64v32h64v416h-160l-192 -224h-96l-32 32v192h32v32h128v8l-192 24v128l192 24v8h-128v32h-32v192l32 32h96l192 -224h160v416h-64v32h64h160h96
+q26 0 45 -4.5t19 -11.5t-19 -11.5t-45 -4.5h-69l293 -352h64l224 -64l352 -32q128 -28 200 -52t80 -34z" />
+    <glyph glyph-name="beer" unicode="&#xf0fc;" horiz-adv-x="1664" 
+d="M640 640v384h-256v-256q0 -53 37.5 -90.5t90.5 -37.5h128zM1664 192v-192h-1152v192l128 192h-128q-159 0 -271.5 112.5t-112.5 271.5v320l-64 64l32 128h480l32 128h960l32 -192l-64 -32v-800z" />
+    <glyph glyph-name="h_sign" unicode="&#xf0fd;" 
+d="M1280 192v896q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-320h-512v320q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-896q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v320h512v-320q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1536 1120v-960
+q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="f0fe" unicode="&#xf0fe;" 
+d="M1280 576v128q0 26 -19 45t-45 19h-320v320q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-320h-320q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h320v-320q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v320h320q26 0 45 19t19 45zM1536 1120v-960
+q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="double_angle_left" unicode="&#xf100;" horiz-adv-x="1024" 
+d="M627 160q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23zM1011 160q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23
+t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23z" />
+    <glyph glyph-name="double_angle_right" unicode="&#xf101;" horiz-adv-x="1024" 
+d="M595 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23zM979 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23
+l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
+    <glyph glyph-name="double_angle_up" unicode="&#xf102;" horiz-adv-x="1152" 
+d="M1075 224q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23zM1075 608q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393
+q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
+    <glyph glyph-name="double_angle_down" unicode="&#xf103;" horiz-adv-x="1152" 
+d="M1075 672q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23zM1075 1056q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23
+t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" />
+    <glyph glyph-name="angle_left" unicode="&#xf104;" horiz-adv-x="640" 
+d="M627 992q0 -13 -10 -23l-393 -393l393 -393q10 -10 10 -23t-10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" />
+    <glyph glyph-name="angle_right" unicode="&#xf105;" horiz-adv-x="640" 
+d="M595 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
+    <glyph glyph-name="angle_up" unicode="&#xf106;" horiz-adv-x="1152" 
+d="M1075 352q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
+    <glyph glyph-name="angle_down" unicode="&#xf107;" horiz-adv-x="1152" 
+d="M1075 800q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" />
+    <glyph glyph-name="desktop" unicode="&#xf108;" horiz-adv-x="1920" 
+d="M1792 544v832q0 13 -9.5 22.5t-22.5 9.5h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-832q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5zM1920 1376v-1088q0 -66 -47 -113t-113 -47h-544q0 -37 16 -77.5t32 -71t16 -43.5q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19
+t-19 45q0 14 16 44t32 70t16 78h-544q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="laptop" unicode="&#xf109;" horiz-adv-x="1920" 
+d="M416 256q-66 0 -113 47t-47 113v704q0 66 47 113t113 47h1088q66 0 113 -47t47 -113v-704q0 -66 -47 -113t-113 -47h-1088zM384 1120v-704q0 -13 9.5 -22.5t22.5 -9.5h1088q13 0 22.5 9.5t9.5 22.5v704q0 13 -9.5 22.5t-22.5 9.5h-1088q-13 0 -22.5 -9.5t-9.5 -22.5z
+M1760 192h160v-96q0 -40 -47 -68t-113 -28h-1600q-66 0 -113 28t-47 68v96h160h1600zM1040 96q16 0 16 16t-16 16h-160q-16 0 -16 -16t16 -16h160z" />
+    <glyph glyph-name="tablet" unicode="&#xf10a;" horiz-adv-x="1152" 
+d="M640 128q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1024 288v960q0 13 -9.5 22.5t-22.5 9.5h-832q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h832q13 0 22.5 9.5t9.5 22.5zM1152 1248v-1088q0 -66 -47 -113t-113 -47h-832
+q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h832q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="mobile_phone" unicode="&#xf10b;" horiz-adv-x="768" 
+d="M464 128q0 33 -23.5 56.5t-56.5 23.5t-56.5 -23.5t-23.5 -56.5t23.5 -56.5t56.5 -23.5t56.5 23.5t23.5 56.5zM672 288v704q0 13 -9.5 22.5t-22.5 9.5h-512q-13 0 -22.5 -9.5t-9.5 -22.5v-704q0 -13 9.5 -22.5t22.5 -9.5h512q13 0 22.5 9.5t9.5 22.5zM480 1136
+q0 16 -16 16h-160q-16 0 -16 -16t16 -16h160q16 0 16 16zM768 1152v-1024q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v1024q0 52 38 90t90 38h512q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="circle_blank" unicode="&#xf10c;" 
+d="M768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103
+t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="quote_left" unicode="&#xf10d;" horiz-adv-x="1664" 
+d="M768 576v-384q0 -80 -56 -136t-136 -56h-384q-80 0 -136 56t-56 136v704q0 104 40.5 198.5t109.5 163.5t163.5 109.5t198.5 40.5h64q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-64q-106 0 -181 -75t-75 -181v-32q0 -40 28 -68t68 -28h224q80 0 136 -56t56 -136z
+M1664 576v-384q0 -80 -56 -136t-136 -56h-384q-80 0 -136 56t-56 136v704q0 104 40.5 198.5t109.5 163.5t163.5 109.5t198.5 40.5h64q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-64q-106 0 -181 -75t-75 -181v-32q0 -40 28 -68t68 -28h224q80 0 136 -56t56 -136z" />
+    <glyph glyph-name="quote_right" unicode="&#xf10e;" horiz-adv-x="1664" 
+d="M768 1216v-704q0 -104 -40.5 -198.5t-109.5 -163.5t-163.5 -109.5t-198.5 -40.5h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64q106 0 181 75t75 181v32q0 40 -28 68t-68 28h-224q-80 0 -136 56t-56 136v384q0 80 56 136t136 56h384q80 0 136 -56t56 -136zM1664 1216
+v-704q0 -104 -40.5 -198.5t-109.5 -163.5t-163.5 -109.5t-198.5 -40.5h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64q106 0 181 75t75 181v32q0 40 -28 68t-68 28h-224q-80 0 -136 56t-56 136v384q0 80 56 136t136 56h384q80 0 136 -56t56 -136z" />
+    <glyph glyph-name="spinner" unicode="&#xf110;" horiz-adv-x="1792" 
+d="M526 142q0 -53 -37.5 -90.5t-90.5 -37.5q-52 0 -90 38t-38 90q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1024 -64q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM320 640q0 -53 -37.5 -90.5t-90.5 -37.5
+t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1522 142q0 -52 -38 -90t-90 -38q-53 0 -90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM558 1138q0 -66 -47 -113t-113 -47t-113 47t-47 113t47 113t113 47t113 -47t47 -113z
+M1728 640q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1088 1344q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1618 1138q0 -93 -66 -158.5t-158 -65.5q-93 0 -158.5 65.5t-65.5 158.5
+q0 92 65.5 158t158.5 66q92 0 158 -66t66 -158z" />
+    <glyph glyph-name="circle" unicode="&#xf111;" 
+d="M1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="reply" unicode="&#xf112;" horiz-adv-x="1792" 
+d="M1792 416q0 -166 -127 -451q-3 -7 -10.5 -24t-13.5 -30t-13 -22q-12 -17 -28 -17q-15 0 -23.5 10t-8.5 25q0 9 2.5 26.5t2.5 23.5q5 68 5 123q0 101 -17.5 181t-48.5 138.5t-80 101t-105.5 69.5t-133 42.5t-154 21.5t-175.5 6h-224v-256q0 -26 -19 -45t-45 -19t-45 19
+l-512 512q-19 19 -19 45t19 45l512 512q19 19 45 19t45 -19t19 -45v-256h224q713 0 875 -403q53 -134 53 -333z" />
+    <glyph glyph-name="github_alt" unicode="&#xf113;" horiz-adv-x="1664" 
+d="M640 320q0 -40 -12.5 -82t-43 -76t-72.5 -34t-72.5 34t-43 76t-12.5 82t12.5 82t43 76t72.5 34t72.5 -34t43 -76t12.5 -82zM1280 320q0 -40 -12.5 -82t-43 -76t-72.5 -34t-72.5 34t-43 76t-12.5 82t12.5 82t43 76t72.5 34t72.5 -34t43 -76t12.5 -82zM1440 320
+q0 120 -69 204t-187 84q-41 0 -195 -21q-71 -11 -157 -11t-157 11q-152 21 -195 21q-118 0 -187 -84t-69 -204q0 -88 32 -153.5t81 -103t122 -60t140 -29.5t149 -7h168q82 0 149 7t140 29.5t122 60t81 103t32 153.5zM1664 496q0 -207 -61 -331q-38 -77 -105.5 -133t-141 -86
+t-170 -47.5t-171.5 -22t-167 -4.5q-78 0 -142 3t-147.5 12.5t-152.5 30t-137 51.5t-121 81t-86 115q-62 123 -62 331q0 237 136 396q-27 82 -27 170q0 116 51 218q108 0 190 -39.5t189 -123.5q147 35 309 35q148 0 280 -32q105 82 187 121t189 39q51 -102 51 -218
+q0 -87 -27 -168q136 -160 136 -398z" />
+    <glyph glyph-name="folder_close_alt" unicode="&#xf114;" horiz-adv-x="1664" 
+d="M1536 224v704q0 40 -28 68t-68 28h-704q-40 0 -68 28t-28 68v64q0 40 -28 68t-68 28h-320q-40 0 -68 -28t-28 -68v-960q0 -40 28 -68t68 -28h1216q40 0 68 28t28 68zM1664 928v-704q0 -92 -66 -158t-158 -66h-1216q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320
+q92 0 158 -66t66 -158v-32h672q92 0 158 -66t66 -158z" />
+    <glyph glyph-name="folder_open_alt" unicode="&#xf115;" horiz-adv-x="1920" 
+d="M1781 605q0 35 -53 35h-1088q-40 0 -85.5 -21.5t-71.5 -52.5l-294 -363q-18 -24 -18 -40q0 -35 53 -35h1088q40 0 86 22t71 53l294 363q18 22 18 39zM640 768h768v160q0 40 -28 68t-68 28h-576q-40 0 -68 28t-28 68v64q0 40 -28 68t-68 28h-320q-40 0 -68 -28t-28 -68
+v-853l256 315q44 53 116 87.5t140 34.5zM1909 605q0 -62 -46 -120l-295 -363q-43 -53 -116 -87.5t-140 -34.5h-1088q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h544q92 0 158 -66t66 -158v-160h192q54 0 99 -24.5t67 -70.5q15 -32 15 -68z
+" />
+    <glyph glyph-name="expand_alt" unicode="&#xf116;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="collapse_alt" unicode="&#xf117;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="smile" unicode="&#xf118;" 
+d="M1134 461q-37 -121 -138 -195t-228 -74t-228 74t-138 195q-8 25 4 48.5t38 31.5q25 8 48.5 -4t31.5 -38q25 -80 92.5 -129.5t151.5 -49.5t151.5 49.5t92.5 129.5q8 26 32 38t49 4t37 -31.5t4 -48.5zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5
+t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5
+t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="frown" unicode="&#xf119;" 
+d="M1134 307q8 -25 -4 -48.5t-37 -31.5t-49 4t-32 38q-25 80 -92.5 129.5t-151.5 49.5t-151.5 -49.5t-92.5 -129.5q-8 -26 -31.5 -38t-48.5 -4q-26 8 -38 31.5t-4 48.5q37 121 138 195t228 74t228 -74t138 -195zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5
+t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204
+t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="meh" unicode="&#xf11a;" 
+d="M1152 448q0 -26 -19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h640q26 0 45 -19t19 -45zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5
+t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640
+q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="gamepad" unicode="&#xf11b;" horiz-adv-x="1920" 
+d="M832 448v128q0 14 -9 23t-23 9h-192v192q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-192h-192q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h192v-192q0 -14 9 -23t23 -9h128q14 0 23 9t9 23v192h192q14 0 23 9t9 23zM1408 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5
+t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1664 640q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1920 512q0 -212 -150 -362t-362 -150q-192 0 -338 128h-220q-146 -128 -338 -128q-212 0 -362 150
+t-150 362t150 362t362 150h896q212 0 362 -150t150 -362z" />
+    <glyph glyph-name="keyboard" unicode="&#xf11c;" horiz-adv-x="1920" 
+d="M384 368v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM512 624v-96q0 -16 -16 -16h-224q-16 0 -16 16v96q0 16 16 16h224q16 0 16 -16zM384 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1408 368v-96q0 -16 -16 -16
+h-864q-16 0 -16 16v96q0 16 16 16h864q16 0 16 -16zM768 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM640 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1024 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16
+h96q16 0 16 -16zM896 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1280 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1664 368v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1152 880v-96
+q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1408 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1664 880v-352q0 -16 -16 -16h-224q-16 0 -16 16v96q0 16 16 16h112v240q0 16 16 16h96q16 0 16 -16zM1792 128v896h-1664v-896
+h1664zM1920 1024v-896q0 -53 -37.5 -90.5t-90.5 -37.5h-1664q-53 0 -90.5 37.5t-37.5 90.5v896q0 53 37.5 90.5t90.5 37.5h1664q53 0 90.5 -37.5t37.5 -90.5z" />
+    <glyph glyph-name="flag_alt" unicode="&#xf11d;" horiz-adv-x="1792" 
+d="M1664 491v616q-169 -91 -306 -91q-82 0 -145 32q-100 49 -184 76.5t-178 27.5q-173 0 -403 -127v-599q245 113 433 113q55 0 103.5 -7.5t98 -26t77 -31t82.5 -39.5l28 -14q44 -22 101 -22q120 0 293 92zM320 1280q0 -35 -17.5 -64t-46.5 -46v-1266q0 -14 -9 -23t-23 -9
+h-64q-14 0 -23 9t-9 23v1266q-29 17 -46.5 46t-17.5 64q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -39 -35 -57q-10 -5 -17 -9q-218 -116 -369 -116q-88 0 -158 35l-28 14q-64 33 -99 48t-91 29t-114 14q-102 0 -235.5 -44t-228.5 -102
+q-15 -9 -33 -9q-16 0 -32 8q-32 19 -32 56v742q0 35 31 55q35 21 78.5 42.5t114 52t152.5 49.5t155 19q112 0 209 -31t209 -86q38 -19 89 -19q122 0 310 112q22 12 31 17q31 16 62 -2q31 -20 31 -55z" />
+    <glyph glyph-name="flag_checkered" unicode="&#xf11e;" horiz-adv-x="1792" 
+d="M832 536v192q-181 -16 -384 -117v-185q205 96 384 110zM832 954v197q-172 -8 -384 -126v-189q215 111 384 118zM1664 491v184q-235 -116 -384 -71v224q-20 6 -39 15q-5 3 -33 17t-34.5 17t-31.5 15t-34.5 15.5t-32.5 13t-36 12.5t-35 8.5t-39.5 7.5t-39.5 4t-44 2
+q-23 0 -49 -3v-222h19q102 0 192.5 -29t197.5 -82q19 -9 39 -15v-188q42 -17 91 -17q120 0 293 92zM1664 918v189q-169 -91 -306 -91q-45 0 -78 8v-196q148 -42 384 90zM320 1280q0 -35 -17.5 -64t-46.5 -46v-1266q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v1266
+q-29 17 -46.5 46t-17.5 64q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -39 -35 -57q-10 -5 -17 -9q-218 -116 -369 -116q-88 0 -158 35l-28 14q-64 33 -99 48t-91 29t-114 14q-102 0 -235.5 -44t-228.5 -102q-15 -9 -33 -9q-16 0 -32 8
+q-32 19 -32 56v742q0 35 31 55q35 21 78.5 42.5t114 52t152.5 49.5t155 19q112 0 209 -31t209 -86q38 -19 89 -19q122 0 310 112q22 12 31 17q31 16 62 -2q31 -20 31 -55z" />
+    <glyph glyph-name="terminal" unicode="&#xf120;" horiz-adv-x="1664" 
+d="M585 553l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23t-10 -23zM1664 96v-64q0 -14 -9 -23t-23 -9h-960q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h960q14 0 23 -9
+t9 -23z" />
+    <glyph glyph-name="code" unicode="&#xf121;" horiz-adv-x="1920" 
+d="M617 137l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23t-10 -23zM1208 1204l-373 -1291q-4 -13 -15.5 -19.5t-23.5 -2.5l-62 17q-13 4 -19.5 15.5t-2.5 24.5
+l373 1291q4 13 15.5 19.5t23.5 2.5l62 -17q13 -4 19.5 -15.5t2.5 -24.5zM1865 553l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23t-10 -23z" />
+    <glyph glyph-name="reply_all" unicode="&#xf122;" horiz-adv-x="1792" 
+d="M640 454v-70q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-512 512q-19 19 -19 45t19 45l512 512q29 31 70 14q39 -17 39 -59v-69l-397 -398q-19 -19 -19 -45t19 -45zM1792 416q0 -58 -17 -133.5t-38.5 -138t-48 -125t-40.5 -90.5l-20 -40q-8 -17 -28 -17q-6 0 -9 1
+q-25 8 -23 34q43 400 -106 565q-64 71 -170.5 110.5t-267.5 52.5v-251q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-512 512q-19 19 -19 45t19 45l512 512q29 31 70 14q39 -17 39 -59v-262q411 -28 599 -221q169 -173 169 -509z" />
+    <glyph glyph-name="star_half_empty" unicode="&#xf123;" horiz-adv-x="1664" 
+d="M1186 579l257 250l-356 52l-66 10l-30 60l-159 322v-963l59 -31l318 -168l-60 355l-12 66zM1638 841l-363 -354l86 -500q5 -33 -6 -51.5t-34 -18.5q-17 0 -40 12l-449 236l-449 -236q-23 -12 -40 -12q-23 0 -34 18.5t-6 51.5l86 500l-364 354q-32 32 -23 59.5t54 34.5
+l502 73l225 455q20 41 49 41q28 0 49 -41l225 -455l502 -73q45 -7 54 -34.5t-24 -59.5z" />
+    <glyph glyph-name="location_arrow" unicode="&#xf124;" horiz-adv-x="1408" 
+d="M1401 1187l-640 -1280q-17 -35 -57 -35q-5 0 -15 2q-22 5 -35.5 22.5t-13.5 39.5v576h-576q-22 0 -39.5 13.5t-22.5 35.5t4 42t29 30l1280 640q13 7 29 7q27 0 45 -19q15 -14 18.5 -34.5t-6.5 -39.5z" />
+    <glyph glyph-name="crop" unicode="&#xf125;" horiz-adv-x="1664" 
+d="M557 256h595v595zM512 301l595 595h-595v-595zM1664 224v-192q0 -14 -9 -23t-23 -9h-224v-224q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v224h-864q-14 0 -23 9t-9 23v864h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224v224q0 14 9 23t23 9h192q14 0 23 -9t9 -23
+v-224h851l246 247q10 9 23 9t23 -9q9 -10 9 -23t-9 -23l-247 -246v-851h224q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="code_fork" unicode="&#xf126;" horiz-adv-x="1024" 
+d="M288 64q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM288 1216q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM928 1088q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1024 1088q0 -52 -26 -96.5t-70 -69.5
+q-2 -287 -226 -414q-67 -38 -203 -81q-128 -40 -169.5 -71t-41.5 -100v-26q44 -25 70 -69.5t26 -96.5q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 52 26 96.5t70 69.5v820q-44 25 -70 69.5t-26 96.5q0 80 56 136t136 56t136 -56t56 -136q0 -52 -26 -96.5t-70 -69.5v-497
+q54 26 154 57q55 17 87.5 29.5t70.5 31t59 39.5t40.5 51t28 69.5t8.5 91.5q-44 25 -70 69.5t-26 96.5q0 80 56 136t136 56t136 -56t56 -136z" />
+    <glyph glyph-name="unlink" unicode="&#xf127;" horiz-adv-x="1664" 
+d="M439 265l-256 -256q-11 -9 -23 -9t-23 9q-9 10 -9 23t9 23l256 256q10 9 23 9t23 -9q9 -10 9 -23t-9 -23zM608 224v-320q0 -14 -9 -23t-23 -9t-23 9t-9 23v320q0 14 9 23t23 9t23 -9t9 -23zM384 448q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23t9 23t23 9h320
+q14 0 23 -9t9 -23zM1648 320q0 -120 -85 -203l-147 -146q-83 -83 -203 -83q-121 0 -204 85l-334 335q-21 21 -42 56l239 18l273 -274q27 -27 68 -27.5t68 26.5l147 146q28 28 28 67q0 40 -28 68l-274 275l18 239q35 -21 56 -42l336 -336q84 -86 84 -204zM1031 1044l-239 -18
+l-273 274q-28 28 -68 28q-39 0 -68 -27l-147 -146q-28 -28 -28 -67q0 -40 28 -68l274 -274l-18 -240q-35 21 -56 42l-336 336q-84 86 -84 204q0 120 85 203l147 146q83 83 203 83q121 0 204 -85l334 -335q21 -21 42 -56zM1664 960q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9
+t-9 23t9 23t23 9h320q14 0 23 -9t9 -23zM1120 1504v-320q0 -14 -9 -23t-23 -9t-23 9t-9 23v320q0 14 9 23t23 9t23 -9t9 -23zM1527 1353l-256 -256q-11 -9 -23 -9t-23 9q-9 10 -9 23t9 23l256 256q10 9 23 9t23 -9q9 -10 9 -23t-9 -23z" />
+    <glyph glyph-name="question" unicode="&#xf128;" horiz-adv-x="1024" 
+d="M704 280v-240q0 -16 -12 -28t-28 -12h-240q-16 0 -28 12t-12 28v240q0 16 12 28t28 12h240q16 0 28 -12t12 -28zM1020 880q0 -54 -15.5 -101t-35 -76.5t-55 -59.5t-57.5 -43.5t-61 -35.5q-41 -23 -68.5 -65t-27.5 -67q0 -17 -12 -32.5t-28 -15.5h-240q-15 0 -25.5 18.5
+t-10.5 37.5v45q0 83 65 156.5t143 108.5q59 27 84 56t25 76q0 42 -46.5 74t-107.5 32q-65 0 -108 -29q-35 -25 -107 -115q-13 -16 -31 -16q-12 0 -25 8l-164 125q-13 10 -15.5 25t5.5 28q160 266 464 266q80 0 161 -31t146 -83t106 -127.5t41 -158.5z" />
+    <glyph glyph-name="_279" unicode="&#xf129;" horiz-adv-x="640" 
+d="M640 192v-128q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64v384h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h384q26 0 45 -19t19 -45v-576h64q26 0 45 -19t19 -45zM512 1344v-192q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v192
+q0 26 19 45t45 19h256q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="exclamation" unicode="&#xf12a;" horiz-adv-x="640" 
+d="M512 288v-224q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v224q0 26 19 45t45 19h256q26 0 45 -19t19 -45zM542 1344l-28 -768q-1 -26 -20.5 -45t-45.5 -19h-256q-26 0 -45.5 19t-20.5 45l-28 768q-1 26 17.5 45t44.5 19h320q26 0 44.5 -19t17.5 -45z" />
+    <glyph glyph-name="superscript" unicode="&#xf12b;" 
+d="M897 167v-167h-248l-159 252l-24 42q-8 9 -11 21h-3q-1 -3 -2.5 -6.5t-3.5 -8t-3 -6.5q-10 -20 -25 -44l-155 -250h-258v167h128l197 291l-185 272h-137v168h276l139 -228q2 -4 23 -42q8 -9 11 -21h3q3 9 11 21l25 42l140 228h257v-168h-125l-184 -267l204 -296h109z
+M1534 846v-206h-514l-3 27q-4 28 -4 46q0 64 26 117t65 86.5t84 65t84 54.5t65 54t26 64q0 38 -29.5 62.5t-70.5 24.5q-51 0 -97 -39q-14 -11 -36 -38l-105 92q26 37 63 66q83 65 188 65q110 0 178 -59.5t68 -158.5q0 -56 -24.5 -103t-62 -76.5t-81.5 -58.5t-82 -50.5
+t-65.5 -51.5t-30.5 -63h232v80h126z" />
+    <glyph glyph-name="subscript" unicode="&#xf12c;" 
+d="M897 167v-167h-248l-159 252l-24 42q-8 9 -11 21h-3q-1 -3 -2.5 -6.5t-3.5 -8t-3 -6.5q-10 -20 -25 -44l-155 -250h-258v167h128l197 291l-185 272h-137v168h276l139 -228q2 -4 23 -42q8 -9 11 -21h3q3 9 11 21l25 42l140 228h257v-168h-125l-184 -267l204 -296h109z
+M1536 -50v-206h-514l-4 27q-3 45 -3 46q0 64 26 117t65 86.5t84 65t84 54.5t65 54t26 64q0 38 -29.5 62.5t-70.5 24.5q-51 0 -97 -39q-14 -11 -36 -38l-105 92q26 37 63 66q80 65 188 65q110 0 178 -59.5t68 -158.5q0 -66 -34.5 -118.5t-84 -86t-99.5 -62.5t-87 -63t-41 -73
+h232v80h126z" />
+    <glyph glyph-name="_283" unicode="&#xf12d;" horiz-adv-x="1920" 
+d="M896 128l336 384h-768l-336 -384h768zM1909 1205q15 -34 9.5 -71.5t-30.5 -65.5l-896 -1024q-38 -44 -96 -44h-768q-38 0 -69.5 20.5t-47.5 54.5q-15 34 -9.5 71.5t30.5 65.5l896 1024q38 44 96 44h768q38 0 69.5 -20.5t47.5 -54.5z" />
+    <glyph glyph-name="puzzle_piece" unicode="&#xf12e;" horiz-adv-x="1664" 
+d="M1664 438q0 -81 -44.5 -135t-123.5 -54q-41 0 -77.5 17.5t-59 38t-56.5 38t-71 17.5q-110 0 -110 -124q0 -39 16 -115t15 -115v-5q-22 0 -33 -1q-34 -3 -97.5 -11.5t-115.5 -13.5t-98 -5q-61 0 -103 26.5t-42 83.5q0 37 17.5 71t38 56.5t38 59t17.5 77.5q0 79 -54 123.5
+t-135 44.5q-84 0 -143 -45.5t-59 -127.5q0 -43 15 -83t33.5 -64.5t33.5 -53t15 -50.5q0 -45 -46 -89q-37 -35 -117 -35q-95 0 -245 24q-9 2 -27.5 4t-27.5 4l-13 2q-1 0 -3 1q-2 0 -2 1v1024q2 -1 17.5 -3.5t34 -5t21.5 -3.5q150 -24 245 -24q80 0 117 35q46 44 46 89
+q0 22 -15 50.5t-33.5 53t-33.5 64.5t-15 83q0 82 59 127.5t144 45.5q80 0 134 -44.5t54 -123.5q0 -41 -17.5 -77.5t-38 -59t-38 -56.5t-17.5 -71q0 -57 42 -83.5t103 -26.5q64 0 180 15t163 17v-2q-1 -2 -3.5 -17.5t-5 -34t-3.5 -21.5q-24 -150 -24 -245q0 -80 35 -117
+q44 -46 89 -46q22 0 50.5 15t53 33.5t64.5 33.5t83 15q82 0 127.5 -59t45.5 -143z" />
+    <glyph glyph-name="microphone" unicode="&#xf130;" horiz-adv-x="1152" 
+d="M1152 832v-128q0 -221 -147.5 -384.5t-364.5 -187.5v-132h256q26 0 45 -19t19 -45t-19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h256v132q-217 24 -364.5 187.5t-147.5 384.5v128q0 26 19 45t45 19t45 -19t19 -45v-128q0 -185 131.5 -316.5t316.5 -131.5
+t316.5 131.5t131.5 316.5v128q0 26 19 45t45 19t45 -19t19 -45zM896 1216v-512q0 -132 -94 -226t-226 -94t-226 94t-94 226v512q0 132 94 226t226 94t226 -94t94 -226z" />
+    <glyph glyph-name="microphone_off" unicode="&#xf131;" horiz-adv-x="1408" 
+d="M271 591l-101 -101q-42 103 -42 214v128q0 26 19 45t45 19t45 -19t19 -45v-128q0 -53 15 -113zM1385 1193l-361 -361v-128q0 -132 -94 -226t-226 -94q-55 0 -109 19l-96 -96q97 -51 205 -51q185 0 316.5 131.5t131.5 316.5v128q0 26 19 45t45 19t45 -19t19 -45v-128
+q0 -221 -147.5 -384.5t-364.5 -187.5v-132h256q26 0 45 -19t19 -45t-19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h256v132q-125 13 -235 81l-254 -254q-10 -10 -23 -10t-23 10l-82 82q-10 10 -10 23t10 23l1234 1234q10 10 23 10t23 -10l82 -82q10 -10 10 -23
+t-10 -23zM1005 1325l-621 -621v512q0 132 94 226t226 94q102 0 184.5 -59t116.5 -152z" />
+    <glyph glyph-name="shield" unicode="&#xf132;" horiz-adv-x="1280" 
+d="M1088 576v640h-448v-1137q119 63 213 137q235 184 235 360zM1280 1344v-768q0 -86 -33.5 -170.5t-83 -150t-118 -127.5t-126.5 -103t-121 -77.5t-89.5 -49.5t-42.5 -20q-12 -6 -26 -6t-26 6q-16 7 -42.5 20t-89.5 49.5t-121 77.5t-126.5 103t-118 127.5t-83 150
+t-33.5 170.5v768q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="calendar_empty" unicode="&#xf133;" horiz-adv-x="1664" 
+d="M128 -128h1408v1024h-1408v-1024zM512 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1280 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1664 1152v-1280
+q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="fire_extinguisher" unicode="&#xf134;" horiz-adv-x="1408" 
+d="M512 1344q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 1376v-320q0 -16 -12 -25q-8 -7 -20 -7q-4 0 -7 1l-448 96q-11 2 -18 11t-7 20h-256v-102q111 -23 183.5 -111t72.5 -203v-800q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v800
+q0 106 62.5 190.5t161.5 114.5v111h-32q-59 0 -115 -23.5t-91.5 -53t-66 -66.5t-40.5 -53.5t-14 -24.5q-17 -35 -57 -35q-16 0 -29 7q-23 12 -31.5 37t3.5 49q5 10 14.5 26t37.5 53.5t60.5 70t85 67t108.5 52.5q-25 42 -25 86q0 66 47 113t113 47t113 -47t47 -113
+q0 -33 -14 -64h302q0 11 7 20t18 11l448 96q3 1 7 1q12 0 20 -7q12 -9 12 -25z" />
+    <glyph glyph-name="rocket" unicode="&#xf135;" horiz-adv-x="1664" 
+d="M1440 1088q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1664 1376q0 -249 -75.5 -430.5t-253.5 -360.5q-81 -80 -195 -176l-20 -379q-2 -16 -16 -26l-384 -224q-7 -4 -16 -4q-12 0 -23 9l-64 64q-13 14 -8 32l85 276l-281 281l-276 -85q-3 -1 -9 -1
+q-14 0 -23 9l-64 64q-17 19 -5 39l224 384q10 14 26 16l379 20q96 114 176 195q188 187 358 258t431 71q14 0 24 -9.5t10 -22.5z" />
+    <glyph glyph-name="maxcdn" unicode="&#xf136;" horiz-adv-x="1792" 
+d="M1745 763l-164 -763h-334l178 832q13 56 -15 88q-27 33 -83 33h-169l-204 -953h-334l204 953h-286l-204 -953h-334l204 953l-153 327h1276q101 0 189.5 -40.5t147.5 -113.5q60 -73 81 -168.5t0 -194.5z" />
+    <glyph glyph-name="chevron_sign_left" unicode="&#xf137;" 
+d="M909 141l102 102q19 19 19 45t-19 45l-307 307l307 307q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-454 -454q-19 -19 -19 -45t19 -45l454 -454q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5
+t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="chevron_sign_right" unicode="&#xf138;" 
+d="M717 141l454 454q19 19 19 45t-19 45l-454 454q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l307 -307l-307 -307q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5
+t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="chevron_sign_up" unicode="&#xf139;" 
+d="M1165 397l102 102q19 19 19 45t-19 45l-454 454q-19 19 -45 19t-45 -19l-454 -454q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19l307 307l307 -307q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5
+t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="chevron_sign_down" unicode="&#xf13a;" 
+d="M813 237l454 454q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-307 -307l-307 307q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l454 -454q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5
+t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="html5" unicode="&#xf13b;" horiz-adv-x="1408" 
+d="M1130 939l16 175h-884l47 -534h612l-22 -228l-197 -53l-196 53l-13 140h-175l22 -278l362 -100h4v1l359 99l50 544h-644l-15 181h674zM0 1408h1408l-128 -1438l-578 -162l-574 162z" />
+    <glyph glyph-name="css3" unicode="&#xf13c;" horiz-adv-x="1792" 
+d="M275 1408h1505l-266 -1333l-804 -267l-698 267l71 356h297l-29 -147l422 -161l486 161l68 339h-1208l58 297h1209l38 191h-1208z" />
+    <glyph glyph-name="anchor" unicode="&#xf13d;" horiz-adv-x="1792" 
+d="M960 1280q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1792 352v-352q0 -22 -20 -30q-8 -2 -12 -2q-12 0 -23 9l-93 93q-119 -143 -318.5 -226.5t-429.5 -83.5t-429.5 83.5t-318.5 226.5l-93 -93q-9 -9 -23 -9q-4 0 -12 2q-20 8 -20 30v352
+q0 14 9 23t23 9h352q22 0 30 -20q8 -19 -7 -35l-100 -100q67 -91 189.5 -153.5t271.5 -82.5v647h-192q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h192v163q-58 34 -93 92.5t-35 128.5q0 106 75 181t181 75t181 -75t75 -181q0 -70 -35 -128.5t-93 -92.5v-163h192q26 0 45 -19
+t19 -45v-128q0 -26 -19 -45t-45 -19h-192v-647q149 20 271.5 82.5t189.5 153.5l-100 100q-15 16 -7 35q8 20 30 20h352q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="unlock_alt" unicode="&#xf13e;" horiz-adv-x="1152" 
+d="M1056 768q40 0 68 -28t28 -68v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h32v320q0 185 131.5 316.5t316.5 131.5t316.5 -131.5t131.5 -316.5q0 -26 -19 -45t-45 -19h-64q-26 0 -45 19t-19 45q0 106 -75 181t-181 75t-181 -75t-75 -181
+v-320h736z" />
+    <glyph glyph-name="bullseye" unicode="&#xf140;" 
+d="M1024 640q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM1152 640q0 159 -112.5 271.5t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5zM1280 640q0 -212 -150 -362t-362 -150t-362 150
+t-150 362t150 362t362 150t362 -150t150 -362zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640
+q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="ellipsis_horizontal" unicode="&#xf141;" horiz-adv-x="1408" 
+d="M384 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM896 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM1408 800v-192q0 -40 -28 -68t-68 -28h-192
+q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68z" />
+    <glyph glyph-name="ellipsis_vertical" unicode="&#xf142;" horiz-adv-x="384" 
+d="M384 288v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM384 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM384 1312v-192q0 -40 -28 -68t-68 -28h-192
+q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68z" />
+    <glyph glyph-name="_303" unicode="&#xf143;" 
+d="M512 256q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM863 162q-13 233 -176.5 396.5t-396.5 176.5q-14 1 -24 -9t-10 -23v-128q0 -13 8.5 -22t21.5 -10q154 -11 264 -121t121 -264q1 -13 10 -21.5t22 -8.5h128
+q13 0 23 10t9 24zM1247 161q-5 154 -56 297.5t-139.5 260t-205 205t-260 139.5t-297.5 56q-14 1 -23 -9q-10 -10 -10 -23v-128q0 -13 9 -22t22 -10q204 -7 378 -111.5t278.5 -278.5t111.5 -378q1 -13 10 -22t22 -9h128q13 0 23 10q11 9 9 23zM1536 1120v-960
+q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="play_sign" unicode="&#xf144;" 
+d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM1152 585q32 18 32 55t-32 55l-544 320q-31 19 -64 1q-32 -19 -32 -56v-640q0 -37 32 -56
+q16 -8 32 -8q17 0 32 9z" />
+    <glyph glyph-name="ticket" unicode="&#xf145;" horiz-adv-x="1792" 
+d="M1024 1084l316 -316l-572 -572l-316 316zM813 105l618 618q19 19 19 45t-19 45l-362 362q-18 18 -45 18t-45 -18l-618 -618q-19 -19 -19 -45t19 -45l362 -362q18 -18 45 -18t45 18zM1702 742l-907 -908q-37 -37 -90.5 -37t-90.5 37l-126 126q56 56 56 136t-56 136
+t-136 56t-136 -56l-125 126q-37 37 -37 90.5t37 90.5l907 906q37 37 90.5 37t90.5 -37l125 -125q-56 -56 -56 -136t56 -136t136 -56t136 56l126 -125q37 -37 37 -90.5t-37 -90.5z" />
+    <glyph glyph-name="minus_sign_alt" unicode="&#xf146;" 
+d="M1280 576v128q0 26 -19 45t-45 19h-896q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h896q26 0 45 19t19 45zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5
+t84.5 -203.5z" />
+    <glyph glyph-name="check_minus" unicode="&#xf147;" horiz-adv-x="1408" 
+d="M1152 736v-64q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h832q14 0 23 -9t9 -23zM1280 288v832q0 66 -47 113t-113 47h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113zM1408 1120v-832q0 -119 -84.5 -203.5
+t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="level_up" unicode="&#xf148;" horiz-adv-x="1024" 
+d="M1018 933q-18 -37 -58 -37h-192v-864q0 -14 -9 -23t-23 -9h-704q-21 0 -29 18q-8 20 4 35l160 192q9 11 25 11h320v640h-192q-40 0 -58 37q-17 37 9 68l320 384q18 22 49 22t49 -22l320 -384q27 -32 9 -68z" />
+    <glyph glyph-name="level_down" unicode="&#xf149;" horiz-adv-x="1024" 
+d="M32 1280h704q13 0 22.5 -9.5t9.5 -23.5v-863h192q40 0 58 -37t-9 -69l-320 -384q-18 -22 -49 -22t-49 22l-320 384q-26 31 -9 69q18 37 58 37h192v640h-320q-14 0 -25 11l-160 192q-13 14 -4 34q9 19 29 19z" />
+    <glyph glyph-name="check_sign" unicode="&#xf14a;" 
+d="M685 237l614 614q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-467 -467l-211 211q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l358 -358q19 -19 45 -19t45 19zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5
+t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="edit_sign" unicode="&#xf14b;" 
+d="M404 428l152 -152l-52 -52h-56v96h-96v56zM818 818q14 -13 -3 -30l-291 -291q-17 -17 -30 -3q-14 13 3 30l291 291q17 17 30 3zM544 128l544 544l-288 288l-544 -544v-288h288zM1152 736l92 92q28 28 28 68t-28 68l-152 152q-28 28 -68 28t-68 -28l-92 -92zM1536 1120
+v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="_312" unicode="&#xf14c;" 
+d="M1280 608v480q0 26 -19 45t-45 19h-480q-42 0 -59 -39q-17 -41 14 -70l144 -144l-534 -534q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19l534 534l144 -144q18 -19 45 -19q12 0 25 5q39 17 39 59zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960
+q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="share_sign" unicode="&#xf14d;" 
+d="M1005 435l352 352q19 19 19 45t-19 45l-352 352q-30 31 -69 14q-40 -17 -40 -59v-160q-119 0 -216 -19.5t-162.5 -51t-114 -79t-76.5 -95.5t-44.5 -109t-21.5 -111.5t-5 -110.5q0 -181 167 -404q11 -12 25 -12q7 0 13 3q22 9 19 33q-44 354 62 473q46 52 130 75.5
+t224 23.5v-160q0 -42 40 -59q12 -5 24 -5q26 0 45 19zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="compass" unicode="&#xf14e;" 
+d="M640 448l256 128l-256 128v-256zM1024 1039v-542l-512 -256v542zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103
+t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="collapse" unicode="&#xf150;" 
+d="M1145 861q18 -35 -5 -66l-320 -448q-19 -27 -52 -27t-52 27l-320 448q-23 31 -5 66q17 35 57 35h640q40 0 57 -35zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5zM1536 1120
+v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="collapse_top" unicode="&#xf151;" 
+d="M1145 419q-17 -35 -57 -35h-640q-40 0 -57 35q-18 35 5 66l320 448q19 27 52 27t52 -27l320 -448q23 -31 5 -66zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5zM1536 1120v-960
+q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="_317" unicode="&#xf152;" 
+d="M1088 640q0 -33 -27 -52l-448 -320q-31 -23 -66 -5q-35 17 -35 57v640q0 40 35 57q35 18 66 -5l448 -320q27 -19 27 -52zM1280 160v960q0 14 -9 23t-23 9h-960q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h960q14 0 23 9t9 23zM1536 1120v-960q0 -119 -84.5 -203.5
+t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="eur" unicode="&#xf153;" horiz-adv-x="1024" 
+d="M976 229l35 -159q3 -12 -3 -22.5t-17 -14.5l-5 -1q-4 -2 -10.5 -3.5t-16 -4.5t-21.5 -5.5t-25.5 -5t-30 -5t-33.5 -4.5t-36.5 -3t-38.5 -1q-234 0 -409 130.5t-238 351.5h-95q-13 0 -22.5 9.5t-9.5 22.5v113q0 13 9.5 22.5t22.5 9.5h66q-2 57 1 105h-67q-14 0 -23 9
+t-9 23v114q0 14 9 23t23 9h98q67 210 243.5 338t400.5 128q102 0 194 -23q11 -3 20 -15q6 -11 3 -24l-43 -159q-3 -13 -14 -19.5t-24 -2.5l-4 1q-4 1 -11.5 2.5l-17.5 3.5t-22.5 3.5t-26 3t-29 2.5t-29.5 1q-126 0 -226 -64t-150 -176h468q16 0 25 -12q10 -12 7 -26
+l-24 -114q-5 -26 -32 -26h-488q-3 -37 0 -105h459q15 0 25 -12q9 -12 6 -27l-24 -112q-2 -11 -11 -18.5t-20 -7.5h-387q48 -117 149.5 -185.5t228.5 -68.5q18 0 36 1.5t33.5 3.5t29.5 4.5t24.5 5t18.5 4.5l12 3l5 2q13 5 26 -2q12 -7 15 -21z" />
+    <glyph glyph-name="gbp" unicode="&#xf154;" horiz-adv-x="1024" 
+d="M1020 399v-367q0 -14 -9 -23t-23 -9h-956q-14 0 -23 9t-9 23v150q0 13 9.5 22.5t22.5 9.5h97v383h-95q-14 0 -23 9.5t-9 22.5v131q0 14 9 23t23 9h95v223q0 171 123.5 282t314.5 111q185 0 335 -125q9 -8 10 -20.5t-7 -22.5l-103 -127q-9 -11 -22 -12q-13 -2 -23 7
+q-5 5 -26 19t-69 32t-93 18q-85 0 -137 -47t-52 -123v-215h305q13 0 22.5 -9t9.5 -23v-131q0 -13 -9.5 -22.5t-22.5 -9.5h-305v-379h414v181q0 13 9 22.5t23 9.5h162q14 0 23 -9.5t9 -22.5z" />
+    <glyph glyph-name="usd" unicode="&#xf155;" horiz-adv-x="1024" 
+d="M978 351q0 -153 -99.5 -263.5t-258.5 -136.5v-175q0 -14 -9 -23t-23 -9h-135q-13 0 -22.5 9.5t-9.5 22.5v175q-66 9 -127.5 31t-101.5 44.5t-74 48t-46.5 37.5t-17.5 18q-17 21 -2 41l103 135q7 10 23 12q15 2 24 -9l2 -2q113 -99 243 -125q37 -8 74 -8q81 0 142.5 43
+t61.5 122q0 28 -15 53t-33.5 42t-58.5 37.5t-66 32t-80 32.5q-39 16 -61.5 25t-61.5 26.5t-62.5 31t-56.5 35.5t-53.5 42.5t-43.5 49t-35.5 58t-21 66.5t-8.5 78q0 138 98 242t255 134v180q0 13 9.5 22.5t22.5 9.5h135q14 0 23 -9t9 -23v-176q57 -6 110.5 -23t87 -33.5
+t63.5 -37.5t39 -29t15 -14q17 -18 5 -38l-81 -146q-8 -15 -23 -16q-14 -3 -27 7q-3 3 -14.5 12t-39 26.5t-58.5 32t-74.5 26t-85.5 11.5q-95 0 -155 -43t-60 -111q0 -26 8.5 -48t29.5 -41.5t39.5 -33t56 -31t60.5 -27t70 -27.5q53 -20 81 -31.5t76 -35t75.5 -42.5t62 -50
+t53 -63.5t31.5 -76.5t13 -94z" />
+    <glyph glyph-name="inr" unicode="&#xf156;" horiz-adv-x="898" 
+d="M898 1066v-102q0 -14 -9 -23t-23 -9h-168q-23 -144 -129 -234t-276 -110q167 -178 459 -536q14 -16 4 -34q-8 -18 -29 -18h-195q-16 0 -25 12q-306 367 -498 571q-9 9 -9 22v127q0 13 9.5 22.5t22.5 9.5h112q132 0 212.5 43t102.5 125h-427q-14 0 -23 9t-9 23v102
+q0 14 9 23t23 9h413q-57 113 -268 113h-145q-13 0 -22.5 9.5t-9.5 22.5v133q0 14 9 23t23 9h832q14 0 23 -9t9 -23v-102q0 -14 -9 -23t-23 -9h-233q47 -61 64 -144h171q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="jpy" unicode="&#xf157;" horiz-adv-x="1027" 
+d="M603 0h-172q-13 0 -22.5 9t-9.5 23v330h-288q-13 0 -22.5 9t-9.5 23v103q0 13 9.5 22.5t22.5 9.5h288v85h-288q-13 0 -22.5 9t-9.5 23v104q0 13 9.5 22.5t22.5 9.5h214l-321 578q-8 16 0 32q10 16 28 16h194q19 0 29 -18l215 -425q19 -38 56 -125q10 24 30.5 68t27.5 61
+l191 420q8 19 29 19h191q17 0 27 -16q9 -14 1 -31l-313 -579h215q13 0 22.5 -9.5t9.5 -22.5v-104q0 -14 -9.5 -23t-22.5 -9h-290v-85h290q13 0 22.5 -9.5t9.5 -22.5v-103q0 -14 -9.5 -23t-22.5 -9h-290v-330q0 -13 -9.5 -22.5t-22.5 -9.5z" />
+    <glyph glyph-name="rub" unicode="&#xf158;" horiz-adv-x="1280" 
+d="M1043 971q0 100 -65 162t-171 62h-320v-448h320q106 0 171 62t65 162zM1280 971q0 -193 -126.5 -315t-326.5 -122h-340v-118h505q14 0 23 -9t9 -23v-128q0 -14 -9 -23t-23 -9h-505v-192q0 -14 -9.5 -23t-22.5 -9h-167q-14 0 -23 9t-9 23v192h-224q-14 0 -23 9t-9 23v128
+q0 14 9 23t23 9h224v118h-224q-14 0 -23 9t-9 23v149q0 13 9 22.5t23 9.5h224v629q0 14 9 23t23 9h539q200 0 326.5 -122t126.5 -315z" />
+    <glyph glyph-name="krw" unicode="&#xf159;" horiz-adv-x="1792" 
+d="M514 341l81 299h-159l75 -300q1 -1 1 -3t1 -3q0 1 0.5 3.5t0.5 3.5zM630 768l35 128h-292l32 -128h225zM822 768h139l-35 128h-70zM1271 340l78 300h-162l81 -299q0 -1 0.5 -3.5t1.5 -3.5q0 1 0.5 3t0.5 3zM1382 768l33 128h-297l34 -128h230zM1792 736v-64q0 -14 -9 -23
+t-23 -9h-213l-164 -616q-7 -24 -31 -24h-159q-24 0 -31 24l-166 616h-209l-167 -616q-7 -24 -31 -24h-159q-11 0 -19.5 7t-10.5 17l-160 616h-208q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h175l-33 128h-142q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h109l-89 344q-5 15 5 28
+q10 12 26 12h137q26 0 31 -24l90 -360h359l97 360q7 24 31 24h126q24 0 31 -24l98 -360h365l93 360q5 24 31 24h137q16 0 26 -12q10 -13 5 -28l-91 -344h111q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-145l-34 -128h179q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="btc" unicode="&#xf15a;" horiz-adv-x="1280" 
+d="M1167 896q18 -182 -131 -258q117 -28 175 -103t45 -214q-7 -71 -32.5 -125t-64.5 -89t-97 -58.5t-121.5 -34.5t-145.5 -15v-255h-154v251q-80 0 -122 1v-252h-154v255q-18 0 -54 0.5t-55 0.5h-200l31 183h111q50 0 58 51v402h16q-6 1 -16 1v287q-13 68 -89 68h-111v164
+l212 -1q64 0 97 1v252h154v-247q82 2 122 2v245h154v-252q79 -7 140 -22.5t113 -45t82.5 -78t36.5 -114.5zM952 351q0 36 -15 64t-37 46t-57.5 30.5t-65.5 18.5t-74 9t-69 3t-64.5 -1t-47.5 -1v-338q8 0 37 -0.5t48 -0.5t53 1.5t58.5 4t57 8.5t55.5 14t47.5 21t39.5 30
+t24.5 40t9.5 51zM881 827q0 33 -12.5 58.5t-30.5 42t-48 28t-55 16.5t-61.5 8t-58 2.5t-54 -1t-39.5 -0.5v-307q5 0 34.5 -0.5t46.5 0t50 2t55 5.5t51.5 11t48.5 18.5t37 27t27 38.5t9 51z" />
+    <glyph glyph-name="file" unicode="&#xf15b;" 
+d="M1024 1024v472q22 -14 36 -28l408 -408q14 -14 28 -36h-472zM896 992q0 -40 28 -68t68 -28h544v-1056q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h800v-544z" />
+    <glyph glyph-name="file_text" unicode="&#xf15c;" 
+d="M1468 1060q14 -14 28 -36h-472v472q22 -14 36 -28zM992 896h544v-1056q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h800v-544q0 -40 28 -68t68 -28zM1152 160v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704
+q14 0 23 9t9 23zM1152 416v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704q14 0 23 9t9 23zM1152 672v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704q14 0 23 9t9 23z" />
+    <glyph glyph-name="sort_by_alphabet" unicode="&#xf15d;" horiz-adv-x="1664" 
+d="M1191 1128h177l-72 218l-12 47q-2 16 -2 20h-4l-3 -20q0 -1 -3.5 -18t-7.5 -29zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1572 -23
+v-233h-584v90l369 529q12 18 21 27l11 9v3q-2 0 -6.5 -0.5t-7.5 -0.5q-12 -3 -30 -3h-232v-115h-120v229h567v-89l-369 -530q-6 -8 -21 -26l-11 -11v-2l14 2q9 2 30 2h248v119h121zM1661 874v-106h-288v106h75l-47 144h-243l-47 -144h75v-106h-287v106h70l230 662h162
+l230 -662h70z" />
+    <glyph glyph-name="_329" unicode="&#xf15e;" horiz-adv-x="1664" 
+d="M1191 104h177l-72 218l-12 47q-2 16 -2 20h-4l-3 -20q0 -1 -3.5 -18t-7.5 -29zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1661 -150
+v-106h-288v106h75l-47 144h-243l-47 -144h75v-106h-287v106h70l230 662h162l230 -662h70zM1572 1001v-233h-584v90l369 529q12 18 21 27l11 9v3q-2 0 -6.5 -0.5t-7.5 -0.5q-12 -3 -30 -3h-232v-115h-120v229h567v-89l-369 -530q-6 -8 -21 -26l-11 -10v-3l14 3q9 1 30 1h248
+v119h121z" />
+    <glyph glyph-name="sort_by_attributes" unicode="&#xf160;" horiz-adv-x="1792" 
+d="M736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1792 -32v-192q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h832
+q14 0 23 -9t9 -23zM1600 480v-192q0 -14 -9 -23t-23 -9h-640q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h640q14 0 23 -9t9 -23zM1408 992v-192q0 -14 -9 -23t-23 -9h-448q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h448q14 0 23 -9t9 -23zM1216 1504v-192q0 -14 -9 -23t-23 -9h-256
+q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h256q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="sort_by_attributes_alt" unicode="&#xf161;" horiz-adv-x="1792" 
+d="M1216 -32v-192q0 -14 -9 -23t-23 -9h-256q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h256q14 0 23 -9t9 -23zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192
+q14 0 23 -9t9 -23zM1408 480v-192q0 -14 -9 -23t-23 -9h-448q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h448q14 0 23 -9t9 -23zM1600 992v-192q0 -14 -9 -23t-23 -9h-640q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h640q14 0 23 -9t9 -23zM1792 1504v-192q0 -14 -9 -23t-23 -9h-832
+q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h832q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="sort_by_order" unicode="&#xf162;" 
+d="M1346 223q0 63 -44 116t-103 53q-52 0 -83 -37t-31 -94t36.5 -95t104.5 -38q50 0 85 27t35 68zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23
+zM1486 165q0 -62 -13 -121.5t-41 -114t-68 -95.5t-98.5 -65.5t-127.5 -24.5q-62 0 -108 16q-24 8 -42 15l39 113q15 -7 31 -11q37 -13 75 -13q84 0 134.5 58.5t66.5 145.5h-2q-21 -23 -61.5 -37t-84.5 -14q-106 0 -173 71.5t-67 172.5q0 105 72 178t181 73q123 0 205 -94.5
+t82 -252.5zM1456 882v-114h-469v114h167v432q0 7 0.5 19t0.5 17v16h-2l-7 -12q-8 -13 -26 -31l-62 -58l-82 86l192 185h123v-654h165z" />
+    <glyph glyph-name="sort_by_order_alt" unicode="&#xf163;" 
+d="M1346 1247q0 63 -44 116t-103 53q-52 0 -83 -37t-31 -94t36.5 -95t104.5 -38q50 0 85 27t35 68zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9
+t9 -23zM1456 -142v-114h-469v114h167v432q0 7 0.5 19t0.5 17v16h-2l-7 -12q-8 -13 -26 -31l-62 -58l-82 86l192 185h123v-654h165zM1486 1189q0 -62 -13 -121.5t-41 -114t-68 -95.5t-98.5 -65.5t-127.5 -24.5q-62 0 -108 16q-24 8 -42 15l39 113q15 -7 31 -11q37 -13 75 -13
+q84 0 134.5 58.5t66.5 145.5h-2q-21 -23 -61.5 -37t-84.5 -14q-106 0 -173 71.5t-67 172.5q0 105 72 178t181 73q123 0 205 -94.5t82 -252.5z" />
+    <glyph glyph-name="_334" unicode="&#xf164;" horiz-adv-x="1664" 
+d="M256 192q0 26 -19 45t-45 19q-27 0 -45.5 -19t-18.5 -45q0 -27 18.5 -45.5t45.5 -18.5q26 0 45 18.5t19 45.5zM416 704v-640q0 -26 -19 -45t-45 -19h-288q-26 0 -45 19t-19 45v640q0 26 19 45t45 19h288q26 0 45 -19t19 -45zM1600 704q0 -86 -55 -149q15 -44 15 -76
+q3 -76 -43 -137q17 -56 0 -117q-15 -57 -54 -94q9 -112 -49 -181q-64 -76 -197 -78h-36h-76h-17q-66 0 -144 15.5t-121.5 29t-120.5 39.5q-123 43 -158 44q-26 1 -45 19.5t-19 44.5v641q0 25 18 43.5t43 20.5q24 2 76 59t101 121q68 87 101 120q18 18 31 48t17.5 48.5
+t13.5 60.5q7 39 12.5 61t19.5 52t34 50q19 19 45 19q46 0 82.5 -10.5t60 -26t40 -40.5t24 -45t12 -50t5 -45t0.5 -39q0 -38 -9.5 -76t-19 -60t-27.5 -56q-3 -6 -10 -18t-11 -22t-8 -24h277q78 0 135 -57t57 -135z" />
+    <glyph glyph-name="_335" unicode="&#xf165;" horiz-adv-x="1664" 
+d="M256 960q0 -26 -19 -45t-45 -19q-27 0 -45.5 19t-18.5 45q0 27 18.5 45.5t45.5 18.5q26 0 45 -18.5t19 -45.5zM416 448v640q0 26 -19 45t-45 19h-288q-26 0 -45 -19t-19 -45v-640q0 -26 19 -45t45 -19h288q26 0 45 19t19 45zM1545 597q55 -61 55 -149q-1 -78 -57.5 -135
+t-134.5 -57h-277q4 -14 8 -24t11 -22t10 -18q18 -37 27 -57t19 -58.5t10 -76.5q0 -24 -0.5 -39t-5 -45t-12 -50t-24 -45t-40 -40.5t-60 -26t-82.5 -10.5q-26 0 -45 19q-20 20 -34 50t-19.5 52t-12.5 61q-9 42 -13.5 60.5t-17.5 48.5t-31 48q-33 33 -101 120q-49 64 -101 121
+t-76 59q-25 2 -43 20.5t-18 43.5v641q0 26 19 44.5t45 19.5q35 1 158 44q77 26 120.5 39.5t121.5 29t144 15.5h17h76h36q133 -2 197 -78q58 -69 49 -181q39 -37 54 -94q17 -61 0 -117q46 -61 43 -137q0 -32 -15 -76z" />
+    <glyph glyph-name="youtube_sign" unicode="&#xf166;" 
+d="M919 233v157q0 50 -29 50q-17 0 -33 -16v-224q16 -16 33 -16q29 0 29 49zM1103 355h66v34q0 51 -33 51t-33 -51v-34zM532 621v-70h-80v-423h-74v423h-78v70h232zM733 495v-367h-67v40q-39 -45 -76 -45q-33 0 -42 28q-6 17 -6 54v290h66v-270q0 -24 1 -26q1 -15 15 -15
+q20 0 42 31v280h67zM985 384v-146q0 -52 -7 -73q-12 -42 -53 -42q-35 0 -68 41v-36h-67v493h67v-161q32 40 68 40q41 0 53 -42q7 -21 7 -74zM1236 255v-9q0 -29 -2 -43q-3 -22 -15 -40q-27 -40 -80 -40q-52 0 -81 38q-21 27 -21 86v129q0 59 20 86q29 38 80 38t78 -38
+q21 -29 21 -86v-76h-133v-65q0 -51 34 -51q24 0 30 26q0 1 0.5 7t0.5 16.5v21.5h68zM785 1079v-156q0 -51 -32 -51t-32 51v156q0 52 32 52t32 -52zM1318 366q0 177 -19 260q-10 44 -43 73.5t-76 34.5q-136 15 -412 15q-275 0 -411 -15q-44 -5 -76.5 -34.5t-42.5 -73.5
+q-20 -87 -20 -260q0 -176 20 -260q10 -43 42.5 -73t75.5 -35q137 -15 412 -15t412 15q43 5 75.5 35t42.5 73q20 84 20 260zM563 1017l90 296h-75l-51 -195l-53 195h-78q7 -23 23 -69l24 -69q35 -103 46 -158v-201h74v201zM852 936v130q0 58 -21 87q-29 38 -78 38
+q-51 0 -78 -38q-21 -29 -21 -87v-130q0 -58 21 -87q27 -38 78 -38q49 0 78 38q21 27 21 87zM1033 816h67v370h-67v-283q-22 -31 -42 -31q-15 0 -16 16q-1 2 -1 26v272h-67v-293q0 -37 6 -55q11 -27 43 -27q36 0 77 45v-40zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5
+h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="youtube" unicode="&#xf167;" 
+d="M971 292v-211q0 -67 -39 -67q-23 0 -45 22v301q22 22 45 22q39 0 39 -67zM1309 291v-46h-90v46q0 68 45 68t45 -68zM343 509h107v94h-312v-94h105v-569h100v569zM631 -60h89v494h-89v-378q-30 -42 -57 -42q-18 0 -21 21q-1 3 -1 35v364h-89v-391q0 -49 8 -73
+q12 -37 58 -37q48 0 102 61v-54zM1060 88v197q0 73 -9 99q-17 56 -71 56q-50 0 -93 -54v217h-89v-663h89v48q45 -55 93 -55q54 0 71 55q9 27 9 100zM1398 98v13h-91q0 -51 -2 -61q-7 -36 -40 -36q-46 0 -46 69v87h179v103q0 79 -27 116q-39 51 -106 51q-68 0 -107 -51
+q-28 -37 -28 -116v-173q0 -79 29 -116q39 -51 108 -51q72 0 108 53q18 27 21 54q2 9 2 58zM790 1011v210q0 69 -43 69t-43 -69v-210q0 -70 43 -70t43 70zM1509 260q0 -234 -26 -350q-14 -59 -58 -99t-102 -46q-184 -21 -555 -21t-555 21q-58 6 -102.5 46t-57.5 99
+q-26 112 -26 350q0 234 26 350q14 59 58 99t103 47q183 20 554 20t555 -20q58 -7 102.5 -47t57.5 -99q26 -112 26 -350zM511 1536h102l-121 -399v-271h-100v271q-14 74 -61 212q-37 103 -65 187h106l71 -263zM881 1203v-175q0 -81 -28 -118q-38 -51 -106 -51q-67 0 -105 51
+q-28 38 -28 118v175q0 80 28 117q38 51 105 51q68 0 106 -51q28 -37 28 -117zM1216 1365v-499h-91v55q-53 -62 -103 -62q-46 0 -59 37q-8 24 -8 75v394h91v-367q0 -33 1 -35q3 -22 21 -22q27 0 57 43v381h91z" />
+    <glyph glyph-name="xing" unicode="&#xf168;" horiz-adv-x="1408" 
+d="M597 869q-10 -18 -257 -456q-27 -46 -65 -46h-239q-21 0 -31 17t0 36l253 448q1 0 0 1l-161 279q-12 22 -1 37q9 15 32 15h239q40 0 66 -45zM1403 1511q11 -16 0 -37l-528 -934v-1l336 -615q11 -20 1 -37q-10 -15 -32 -15h-239q-42 0 -66 45l-339 622q18 32 531 942
+q25 45 64 45h241q22 0 31 -15z" />
+    <glyph glyph-name="xing_sign" unicode="&#xf169;" 
+d="M685 771q0 1 -126 222q-21 34 -52 34h-184q-18 0 -26 -11q-7 -12 1 -29l125 -216v-1l-196 -346q-9 -14 0 -28q8 -13 24 -13h185q31 0 50 36zM1309 1268q-7 12 -24 12h-187q-30 0 -49 -35l-411 -729q1 -2 262 -481q20 -35 52 -35h184q18 0 25 12q8 13 -1 28l-260 476v1
+l409 723q8 16 0 28zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="youtube_play" unicode="&#xf16a;" horiz-adv-x="1792" 
+d="M711 408l484 250l-484 253v-503zM896 1270q168 0 324.5 -4.5t229.5 -9.5l73 -4q1 0 17 -1.5t23 -3t23.5 -4.5t28.5 -8t28 -13t31 -19.5t29 -26.5q6 -6 15.5 -18.5t29 -58.5t26.5 -101q8 -64 12.5 -136.5t5.5 -113.5v-40v-136q1 -145 -18 -290q-7 -55 -25 -99.5t-32 -61.5
+l-14 -17q-14 -15 -29 -26.5t-31 -19t-28 -12.5t-28.5 -8t-24 -4.5t-23 -3t-16.5 -1.5q-251 -19 -627 -19q-207 2 -359.5 6.5t-200.5 7.5l-49 4l-36 4q-36 5 -54.5 10t-51 21t-56.5 41q-6 6 -15.5 18.5t-29 58.5t-26.5 101q-8 64 -12.5 136.5t-5.5 113.5v40v136
+q-1 145 18 290q7 55 25 99.5t32 61.5l14 17q14 15 29 26.5t31 19.5t28 13t28.5 8t23.5 4.5t23 3t17 1.5q251 18 627 18z" />
+    <glyph glyph-name="dropbox" unicode="&#xf16b;" horiz-adv-x="1792" 
+d="M402 829l494 -305l-342 -285l-490 319zM1388 274v-108l-490 -293v-1l-1 1l-1 -1v1l-489 293v108l147 -96l342 284v2l1 -1l1 1v-2l343 -284zM554 1418l342 -285l-494 -304l-338 270zM1390 829l338 -271l-489 -319l-343 285zM1239 1418l489 -319l-338 -270l-494 304z" />
+    <glyph glyph-name="stackexchange" unicode="&#xf16c;" 
+d="M1289 -96h-1118v480h-160v-640h1438v640h-160v-480zM347 428l33 157l783 -165l-33 -156zM450 802l67 146l725 -339l-67 -145zM651 1158l102 123l614 -513l-102 -123zM1048 1536l477 -641l-128 -96l-477 641zM330 65v159h800v-159h-800z" />
+    <glyph glyph-name="instagram" unicode="&#xf16d;" 
+d="M1024 640q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1162 640q0 -164 -115 -279t-279 -115t-279 115t-115 279t115 279t279 115t279 -115t115 -279zM1270 1050q0 -38 -27 -65t-65 -27t-65 27t-27 65t27 65t65 27t65 -27t27 -65zM768 1270
+q-7 0 -76.5 0.5t-105.5 0t-96.5 -3t-103 -10t-71.5 -18.5q-50 -20 -88 -58t-58 -88q-11 -29 -18.5 -71.5t-10 -103t-3 -96.5t0 -105.5t0.5 -76.5t-0.5 -76.5t0 -105.5t3 -96.5t10 -103t18.5 -71.5q20 -50 58 -88t88 -58q29 -11 71.5 -18.5t103 -10t96.5 -3t105.5 0t76.5 0.5
+t76.5 -0.5t105.5 0t96.5 3t103 10t71.5 18.5q50 20 88 58t58 88q11 29 18.5 71.5t10 103t3 96.5t0 105.5t-0.5 76.5t0.5 76.5t0 105.5t-3 96.5t-10 103t-18.5 71.5q-20 50 -58 88t-88 58q-29 11 -71.5 18.5t-103 10t-96.5 3t-105.5 0t-76.5 -0.5zM1536 640q0 -229 -5 -317
+q-10 -208 -124 -322t-322 -124q-88 -5 -317 -5t-317 5q-208 10 -322 124t-124 322q-5 88 -5 317t5 317q10 208 124 322t322 124q88 5 317 5t317 -5q208 -10 322 -124t124 -322q5 -88 5 -317z" />
+    <glyph glyph-name="flickr" unicode="&#xf16e;" 
+d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960zM698 640q0 88 -62 150t-150 62t-150 -62t-62 -150t62 -150t150 -62t150 62t62 150zM1262 640q0 88 -62 150
+t-150 62t-150 -62t-62 -150t62 -150t150 -62t150 62t62 150z" />
+    <glyph glyph-name="adn" unicode="&#xf170;" 
+d="M768 914l201 -306h-402zM1133 384h94l-459 691l-459 -691h94l104 160h522zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="f171" unicode="&#xf171;" horiz-adv-x="1408" 
+d="M815 677q8 -63 -50.5 -101t-111.5 -6q-39 17 -53.5 58t-0.5 82t52 58q36 18 72.5 12t64 -35.5t27.5 -67.5zM926 698q-14 107 -113 164t-197 13q-63 -28 -100.5 -88.5t-34.5 -129.5q4 -91 77.5 -155t165.5 -56q91 8 152 84t50 168zM1165 1240q-20 27 -56 44.5t-58 22
+t-71 12.5q-291 47 -566 -2q-43 -7 -66 -12t-55 -22t-50 -43q30 -28 76 -45.5t73.5 -22t87.5 -11.5q228 -29 448 -1q63 8 89.5 12t72.5 21.5t75 46.5zM1222 205q-8 -26 -15.5 -76.5t-14 -84t-28.5 -70t-58 -56.5q-86 -48 -189.5 -71.5t-202 -22t-201.5 18.5q-46 8 -81.5 18
+t-76.5 27t-73 43.5t-52 61.5q-25 96 -57 292l6 16l18 9q223 -148 506.5 -148t507.5 148q21 -6 24 -23t-5 -45t-8 -37zM1403 1166q-26 -167 -111 -655q-5 -30 -27 -56t-43.5 -40t-54.5 -31q-252 -126 -610 -88q-248 27 -394 139q-15 12 -25.5 26.5t-17 35t-9 34t-6 39.5
+t-5.5 35q-9 50 -26.5 150t-28 161.5t-23.5 147.5t-22 158q3 26 17.5 48.5t31.5 37.5t45 30t46 22.5t48 18.5q125 46 313 64q379 37 676 -50q155 -46 215 -122q16 -20 16.5 -51t-5.5 -54z" />
+    <glyph glyph-name="bitbucket_sign" unicode="&#xf172;" 
+d="M848 666q0 43 -41 66t-77 1q-43 -20 -42.5 -72.5t43.5 -70.5q39 -23 81 4t36 72zM928 682q8 -66 -36 -121t-110 -61t-119 40t-56 113q-2 49 25.5 93t72.5 64q70 31 141.5 -10t81.5 -118zM1100 1073q-20 -21 -53.5 -34t-53 -16t-63.5 -8q-155 -20 -324 0q-44 6 -63 9.5
+t-52.5 16t-54.5 32.5q13 19 36 31t40 15.5t47 8.5q198 35 408 1q33 -5 51 -8.5t43 -16t39 -31.5zM1142 327q0 7 5.5 26.5t3 32t-17.5 16.5q-161 -106 -365 -106t-366 106l-12 -6l-5 -12q26 -154 41 -210q47 -81 204 -108q249 -46 428 53q34 19 49 51.5t22.5 85.5t12.5 71z
+M1272 1020q9 53 -8 75q-43 55 -155 88q-216 63 -487 36q-132 -12 -226 -46q-38 -15 -59.5 -25t-47 -34t-29.5 -54q8 -68 19 -138t29 -171t24 -137q1 -5 5 -31t7 -36t12 -27t22 -28q105 -80 284 -100q259 -28 440 63q24 13 39.5 23t31 29t19.5 40q48 267 80 473zM1536 1120
+v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="tumblr" unicode="&#xf173;" horiz-adv-x="1024" 
+d="M944 207l80 -237q-23 -35 -111 -66t-177 -32q-104 -2 -190.5 26t-142.5 74t-95 106t-55.5 120t-16.5 118v544h-168v215q72 26 129 69.5t91 90t58 102t34 99t15 88.5q1 5 4.5 8.5t7.5 3.5h244v-424h333v-252h-334v-518q0 -30 6.5 -56t22.5 -52.5t49.5 -41.5t81.5 -14
+q78 2 134 29z" />
+    <glyph glyph-name="tumblr_sign" unicode="&#xf174;" 
+d="M1136 75l-62 183q-44 -22 -103 -22q-36 -1 -62 10.5t-38.5 31.5t-17.5 40.5t-5 43.5v398h257v194h-256v326h-188q-8 0 -9 -10q-5 -44 -17.5 -87t-39 -95t-77 -95t-118.5 -68v-165h130v-418q0 -57 21.5 -115t65 -111t121 -85.5t176.5 -30.5q69 1 136.5 25t85.5 50z
+M1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="long_arrow_down" unicode="&#xf175;" horiz-adv-x="768" 
+d="M765 237q8 -19 -5 -35l-350 -384q-10 -10 -23 -10q-14 0 -24 10l-355 384q-13 16 -5 35q9 19 29 19h224v1248q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1248h224q21 0 29 -19z" />
+    <glyph glyph-name="long_arrow_up" unicode="&#xf176;" horiz-adv-x="768" 
+d="M765 1043q-9 -19 -29 -19h-224v-1248q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v1248h-224q-21 0 -29 19t5 35l350 384q10 10 23 10q14 0 24 -10l355 -384q13 -16 5 -35z" />
+    <glyph glyph-name="long_arrow_left" unicode="&#xf177;" horiz-adv-x="1792" 
+d="M1792 736v-192q0 -14 -9 -23t-23 -9h-1248v-224q0 -21 -19 -29t-35 5l-384 350q-10 10 -10 23q0 14 10 24l384 354q16 14 35 6q19 -9 19 -29v-224h1248q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="long_arrow_right" unicode="&#xf178;" horiz-adv-x="1792" 
+d="M1728 643q0 -14 -10 -24l-384 -354q-16 -14 -35 -6q-19 9 -19 29v224h-1248q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h1248v224q0 21 19 29t35 -5l384 -350q10 -10 10 -23z" />
+    <glyph glyph-name="apple" unicode="&#xf179;" horiz-adv-x="1408" 
+d="M1393 321q-39 -125 -123 -250q-129 -196 -257 -196q-49 0 -140 32q-86 32 -151 32q-61 0 -142 -33q-81 -34 -132 -34q-152 0 -301 259q-147 261 -147 503q0 228 113 374q113 144 284 144q72 0 177 -30q104 -30 138 -30q45 0 143 34q102 34 173 34q119 0 213 -65
+q52 -36 104 -100q-79 -67 -114 -118q-65 -94 -65 -207q0 -124 69 -223t158 -126zM1017 1494q0 -61 -29 -136q-30 -75 -93 -138q-54 -54 -108 -72q-37 -11 -104 -17q3 149 78 257q74 107 250 148q1 -3 2.5 -11t2.5 -11q0 -4 0.5 -10t0.5 -10z" />
+    <glyph glyph-name="windows" unicode="&#xf17a;" horiz-adv-x="1664" 
+d="M682 530v-651l-682 94v557h682zM682 1273v-659h-682v565zM1664 530v-786l-907 125v661h907zM1664 1408v-794h-907v669z" />
+    <glyph glyph-name="android" unicode="&#xf17b;" horiz-adv-x="1408" 
+d="M493 1053q16 0 27.5 11.5t11.5 27.5t-11.5 27.5t-27.5 11.5t-27 -11.5t-11 -27.5t11 -27.5t27 -11.5zM915 1053q16 0 27 11.5t11 27.5t-11 27.5t-27 11.5t-27.5 -11.5t-11.5 -27.5t11.5 -27.5t27.5 -11.5zM103 869q42 0 72 -30t30 -72v-430q0 -43 -29.5 -73t-72.5 -30
+t-73 30t-30 73v430q0 42 30 72t73 30zM1163 850v-666q0 -46 -32 -78t-77 -32h-75v-227q0 -43 -30 -73t-73 -30t-73 30t-30 73v227h-138v-227q0 -43 -30 -73t-73 -30q-42 0 -72 30t-30 73l-1 227h-74q-46 0 -78 32t-32 78v666h918zM931 1255q107 -55 171 -153.5t64 -215.5
+h-925q0 117 64 215.5t172 153.5l-71 131q-7 13 5 20q13 6 20 -6l72 -132q95 42 201 42t201 -42l72 132q7 12 20 6q12 -7 5 -20zM1408 767v-430q0 -43 -30 -73t-73 -30q-42 0 -72 30t-30 73v430q0 43 30 72.5t72 29.5q43 0 73 -29.5t30 -72.5z" />
+    <glyph glyph-name="linux" unicode="&#xf17c;" 
+d="M663 1125q-11 -1 -15.5 -10.5t-8.5 -9.5q-5 -1 -5 5q0 12 19 15h10zM750 1111q-4 -1 -11.5 6.5t-17.5 4.5q24 11 32 -2q3 -6 -3 -9zM399 684q-4 1 -6 -3t-4.5 -12.5t-5.5 -13.5t-10 -13q-10 -11 -1 -12q4 -1 12.5 7t12.5 18q1 3 2 7t2 6t1.5 4.5t0.5 4v3t-1 2.5t-3 2z
+M1254 325q0 18 -55 42q4 15 7.5 27.5t5 26t3 21.5t0.5 22.5t-1 19.5t-3.5 22t-4 20.5t-5 25t-5.5 26.5q-10 48 -47 103t-72 75q24 -20 57 -83q87 -162 54 -278q-11 -40 -50 -42q-31 -4 -38.5 18.5t-8 83.5t-11.5 107q-9 39 -19.5 69t-19.5 45.5t-15.5 24.5t-13 15t-7.5 7
+q-14 62 -31 103t-29.5 56t-23.5 33t-15 40q-4 21 6 53.5t4.5 49.5t-44.5 25q-15 3 -44.5 18t-35.5 16q-8 1 -11 26t8 51t36 27q37 3 51 -30t4 -58q-11 -19 -2 -26.5t30 -0.5q13 4 13 36v37q-5 30 -13.5 50t-21 30.5t-23.5 15t-27 7.5q-107 -8 -89 -134q0 -15 -1 -15
+q-9 9 -29.5 10.5t-33 -0.5t-15.5 5q1 57 -16 90t-45 34q-27 1 -41.5 -27.5t-16.5 -59.5q-1 -15 3.5 -37t13 -37.5t15.5 -13.5q10 3 16 14q4 9 -7 8q-7 0 -15.5 14.5t-9.5 33.5q-1 22 9 37t34 14q17 0 27 -21t9.5 -39t-1.5 -22q-22 -15 -31 -29q-8 -12 -27.5 -23.5
+t-20.5 -12.5q-13 -14 -15.5 -27t7.5 -18q14 -8 25 -19.5t16 -19t18.5 -13t35.5 -6.5q47 -2 102 15q2 1 23 7t34.5 10.5t29.5 13t21 17.5q9 14 20 8q5 -3 6.5 -8.5t-3 -12t-16.5 -9.5q-20 -6 -56.5 -21.5t-45.5 -19.5q-44 -19 -70 -23q-25 -5 -79 2q-10 2 -9 -2t17 -19
+q25 -23 67 -22q17 1 36 7t36 14t33.5 17.5t30 17t24.5 12t17.5 2.5t8.5 -11q0 -2 -1 -4.5t-4 -5t-6 -4.5t-8.5 -5t-9 -4.5t-10 -5t-9.5 -4.5q-28 -14 -67.5 -44t-66.5 -43t-49 -1q-21 11 -63 73q-22 31 -25 22q-1 -3 -1 -10q0 -25 -15 -56.5t-29.5 -55.5t-21 -58t11.5 -63
+q-23 -6 -62.5 -90t-47.5 -141q-2 -18 -1.5 -69t-5.5 -59q-8 -24 -29 -3q-32 31 -36 94q-2 28 4 56q4 19 -1 18q-2 -1 -4 -5q-36 -65 10 -166q5 -12 25 -28t24 -20q20 -23 104 -90.5t93 -76.5q16 -15 17.5 -38t-14 -43t-45.5 -23q8 -15 29 -44.5t28 -54t7 -70.5q46 24 7 92
+q-4 8 -10.5 16t-9.5 12t-2 6q3 5 13 9.5t20 -2.5q46 -52 166 -36q133 15 177 87q23 38 34 30q12 -6 10 -52q-1 -25 -23 -92q-9 -23 -6 -37.5t24 -15.5q3 19 14.5 77t13.5 90q2 21 -6.5 73.5t-7.5 97t23 70.5q15 18 51 18q1 37 34.5 53t72.5 10.5t60 -22.5zM626 1152
+q3 17 -2.5 30t-11.5 15q-9 2 -9 -7q2 -5 5 -6q10 0 7 -15q-3 -20 8 -20q3 0 3 3zM1045 955q-2 8 -6.5 11.5t-13 5t-14.5 5.5q-5 3 -9.5 8t-7 8t-5.5 6.5t-4 4t-4 -1.5q-14 -16 7 -43.5t39 -31.5q9 -1 14.5 8t3.5 20zM867 1168q0 11 -5 19.5t-11 12.5t-9 3q-6 0 -8 -2t0 -4
+t5 -3q14 -4 18 -31q0 -3 8 2q2 2 2 3zM921 1401q0 2 -2.5 5t-9 7t-9.5 6q-15 15 -24 15q-9 -1 -11.5 -7.5t-1 -13t-0.5 -12.5q-1 -4 -6 -10.5t-6 -9t3 -8.5q4 -3 8 0t11 9t15 9q1 1 9 1t15 2t9 7zM1486 60q20 -12 31 -24.5t12 -24t-2.5 -22.5t-15.5 -22t-23.5 -19.5
+t-30 -18.5t-31.5 -16.5t-32 -15.5t-27 -13q-38 -19 -85.5 -56t-75.5 -64q-17 -16 -68 -19.5t-89 14.5q-18 9 -29.5 23.5t-16.5 25.5t-22 19.5t-47 9.5q-44 1 -130 1q-19 0 -57 -1.5t-58 -2.5q-44 -1 -79.5 -15t-53.5 -30t-43.5 -28.5t-53.5 -11.5q-29 1 -111 31t-146 43
+q-19 4 -51 9.5t-50 9t-39.5 9.5t-33.5 14.5t-17 19.5q-10 23 7 66.5t18 54.5q1 16 -4 40t-10 42.5t-4.5 36.5t10.5 27q14 12 57 14t60 12q30 18 42 35t12 51q21 -73 -32 -106q-32 -20 -83 -15q-34 3 -43 -10q-13 -15 5 -57q2 -6 8 -18t8.5 -18t4.5 -17t1 -22q0 -15 -17 -49
+t-14 -48q3 -17 37 -26q20 -6 84.5 -18.5t99.5 -20.5q24 -6 74 -22t82.5 -23t55.5 -4q43 6 64.5 28t23 48t-7.5 58.5t-19 52t-20 36.5q-121 190 -169 242q-68 74 -113 40q-11 -9 -15 15q-3 16 -2 38q1 29 10 52t24 47t22 42q8 21 26.5 72t29.5 78t30 61t39 54
+q110 143 124 195q-12 112 -16 310q-2 90 24 151.5t106 104.5q39 21 104 21q53 1 106 -13.5t89 -41.5q57 -42 91.5 -121.5t29.5 -147.5q-5 -95 30 -214q34 -113 133 -218q55 -59 99.5 -163t59.5 -191q8 -49 5 -84.5t-12 -55.5t-20 -22q-10 -2 -23.5 -19t-27 -35.5
+t-40.5 -33.5t-61 -14q-18 1 -31.5 5t-22.5 13.5t-13.5 15.5t-11.5 20.5t-9 19.5q-22 37 -41 30t-28 -49t7 -97q20 -70 1 -195q-10 -65 18 -100.5t73 -33t85 35.5q59 49 89.5 66.5t103.5 42.5q53 18 77 36.5t18.5 34.5t-25 28.5t-51.5 23.5q-33 11 -49.5 48t-15 72.5
+t15.5 47.5q1 -31 8 -56.5t14.5 -40.5t20.5 -28.5t21 -19t21.5 -13t16.5 -9.5z" />
+    <glyph glyph-name="dribble" unicode="&#xf17d;" 
+d="M1024 36q-42 241 -140 498h-2l-2 -1q-16 -6 -43 -16.5t-101 -49t-137 -82t-131 -114.5t-103 -148l-15 11q184 -150 418 -150q132 0 256 52zM839 643q-21 49 -53 111q-311 -93 -673 -93q-1 -7 -1 -21q0 -124 44 -236.5t124 -201.5q50 89 123.5 166.5t142.5 124.5t130.5 81
+t99.5 48l37 13q4 1 13 3.5t13 4.5zM732 855q-120 213 -244 378q-138 -65 -234 -186t-128 -272q302 0 606 80zM1416 536q-210 60 -409 29q87 -239 128 -469q111 75 185 189.5t96 250.5zM611 1277q-1 0 -2 -1q1 1 2 1zM1201 1132q-185 164 -433 164q-76 0 -155 -19
+q131 -170 246 -382q69 26 130 60.5t96.5 61.5t65.5 57t37.5 40.5zM1424 647q-3 232 -149 410l-1 -1q-9 -12 -19 -24.5t-43.5 -44.5t-71 -60.5t-100 -65t-131.5 -64.5q25 -53 44 -95q2 -5 6.5 -17t7.5 -17q36 5 74.5 7t73.5 2t69 -1.5t64 -4t56.5 -5.5t48 -6.5t36.5 -6
+t25 -4.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="skype" unicode="&#xf17e;" 
+d="M1173 473q0 50 -19.5 91.5t-48.5 68.5t-73 49t-82.5 34t-87.5 23l-104 24q-30 7 -44 10.5t-35 11.5t-30 16t-16.5 21t-7.5 30q0 77 144 77q43 0 77 -12t54 -28.5t38 -33.5t40 -29t48 -12q47 0 75.5 32t28.5 77q0 55 -56 99.5t-142 67.5t-182 23q-68 0 -132 -15.5
+t-119.5 -47t-89 -87t-33.5 -128.5q0 -61 19 -106.5t56 -75.5t80 -48.5t103 -32.5l146 -36q90 -22 112 -36q32 -20 32 -60q0 -39 -40 -64.5t-105 -25.5q-51 0 -91.5 16t-65 38.5t-45.5 45t-46 38.5t-54 16q-50 0 -75.5 -30t-25.5 -75q0 -92 122 -157.5t291 -65.5
+q73 0 140 18.5t122.5 53.5t88.5 93.5t33 131.5zM1536 256q0 -159 -112.5 -271.5t-271.5 -112.5q-130 0 -234 80q-77 -16 -150 -16q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5q0 73 16 150q-80 104 -80 234q0 159 112.5 271.5t271.5 112.5q130 0 234 -80
+q77 16 150 16q143 0 273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -73 -16 -150q80 -104 80 -234z" />
+    <glyph glyph-name="foursquare" unicode="&#xf180;" horiz-adv-x="1280" 
+d="M1000 1102l37 194q5 23 -9 40t-35 17h-712q-23 0 -38.5 -17t-15.5 -37v-1101q0 -7 6 -1l291 352q23 26 38 33.5t48 7.5h239q22 0 37 14.5t18 29.5q24 130 37 191q4 21 -11.5 40t-36.5 19h-294q-29 0 -48 19t-19 48v42q0 29 19 47.5t48 18.5h346q18 0 35 13.5t20 29.5z
+M1227 1324q-15 -73 -53.5 -266.5t-69.5 -350t-35 -173.5q-6 -22 -9 -32.5t-14 -32.5t-24.5 -33t-38.5 -21t-58 -10h-271q-13 0 -22 -10q-8 -9 -426 -494q-22 -25 -58.5 -28.5t-48.5 5.5q-55 22 -55 98v1410q0 55 38 102.5t120 47.5h888q95 0 127 -53t10 -159zM1227 1324
+l-158 -790q4 17 35 173.5t69.5 350t53.5 266.5z" />
+    <glyph glyph-name="trello" unicode="&#xf181;" 
+d="M704 192v1024q0 14 -9 23t-23 9h-480q-14 0 -23 -9t-9 -23v-1024q0 -14 9 -23t23 -9h480q14 0 23 9t9 23zM1376 576v640q0 14 -9 23t-23 9h-480q-14 0 -23 -9t-9 -23v-640q0 -14 9 -23t23 -9h480q14 0 23 9t9 23zM1536 1344v-1408q0 -26 -19 -45t-45 -19h-1408
+q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="female" unicode="&#xf182;" horiz-adv-x="1280" 
+d="M1280 480q0 -40 -28 -68t-68 -28q-51 0 -80 43l-227 341h-45v-132l247 -411q9 -15 9 -33q0 -26 -19 -45t-45 -19h-192v-272q0 -46 -33 -79t-79 -33h-160q-46 0 -79 33t-33 79v272h-192q-26 0 -45 19t-19 45q0 18 9 33l247 411v132h-45l-227 -341q-29 -43 -80 -43
+q-40 0 -68 28t-28 68q0 29 16 53l256 384q73 107 176 107h384q103 0 176 -107l256 -384q16 -24 16 -53zM864 1280q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5z" />
+    <glyph glyph-name="male" unicode="&#xf183;" horiz-adv-x="1024" 
+d="M1024 832v-416q0 -40 -28 -68t-68 -28t-68 28t-28 68v352h-64v-912q0 -46 -33 -79t-79 -33t-79 33t-33 79v464h-64v-464q0 -46 -33 -79t-79 -33t-79 33t-33 79v912h-64v-352q0 -40 -28 -68t-68 -28t-68 28t-28 68v416q0 80 56 136t136 56h640q80 0 136 -56t56 -136z
+M736 1280q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5z" />
+    <glyph glyph-name="gittip" unicode="&#xf184;" 
+d="M773 234l350 473q16 22 24.5 59t-6 85t-61.5 79q-40 26 -83 25.5t-73.5 -17.5t-54.5 -45q-36 -40 -96 -40q-59 0 -95 40q-24 28 -54.5 45t-73.5 17.5t-84 -25.5q-46 -31 -60.5 -79t-6 -85t24.5 -59zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103
+t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="sun" unicode="&#xf185;" horiz-adv-x="1792" 
+d="M1472 640q0 117 -45.5 223.5t-123 184t-184 123t-223.5 45.5t-223.5 -45.5t-184 -123t-123 -184t-45.5 -223.5t45.5 -223.5t123 -184t184 -123t223.5 -45.5t223.5 45.5t184 123t123 184t45.5 223.5zM1748 363q-4 -15 -20 -20l-292 -96v-306q0 -16 -13 -26q-15 -10 -29 -4
+l-292 94l-180 -248q-10 -13 -26 -13t-26 13l-180 248l-292 -94q-14 -6 -29 4q-13 10 -13 26v306l-292 96q-16 5 -20 20q-5 17 4 29l180 248l-180 248q-9 13 -4 29q4 15 20 20l292 96v306q0 16 13 26q15 10 29 4l292 -94l180 248q9 12 26 12t26 -12l180 -248l292 94
+q14 6 29 -4q13 -10 13 -26v-306l292 -96q16 -5 20 -20q5 -16 -4 -29l-180 -248l180 -248q9 -12 4 -29z" />
+    <glyph glyph-name="_366" unicode="&#xf186;" 
+d="M1262 233q-54 -9 -110 -9q-182 0 -337 90t-245 245t-90 337q0 192 104 357q-201 -60 -328.5 -229t-127.5 -384q0 -130 51 -248.5t136.5 -204t204 -136.5t248.5 -51q144 0 273.5 61.5t220.5 171.5zM1465 318q-94 -203 -283.5 -324.5t-413.5 -121.5q-156 0 -298 61
+t-245 164t-164 245t-61 298q0 153 57.5 292.5t156 241.5t235.5 164.5t290 68.5q44 2 61 -39q18 -41 -15 -72q-86 -78 -131.5 -181.5t-45.5 -218.5q0 -148 73 -273t198 -198t273 -73q118 0 228 51q41 18 72 -13q14 -14 17.5 -34t-4.5 -38z" />
+    <glyph glyph-name="archive" unicode="&#xf187;" horiz-adv-x="1792" 
+d="M1088 704q0 26 -19 45t-45 19h-256q-26 0 -45 -19t-19 -45t19 -45t45 -19h256q26 0 45 19t19 45zM1664 896v-960q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v960q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1728 1344v-256q0 -26 -19 -45t-45 -19h-1536
+q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1536q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="bug" unicode="&#xf188;" horiz-adv-x="1664" 
+d="M1632 576q0 -26 -19 -45t-45 -19h-224q0 -171 -67 -290l208 -209q19 -19 19 -45t-19 -45q-18 -19 -45 -19t-45 19l-198 197q-5 -5 -15 -13t-42 -28.5t-65 -36.5t-82 -29t-97 -13v896h-128v-896q-51 0 -101.5 13.5t-87 33t-66 39t-43.5 32.5l-15 14l-183 -207
+q-20 -21 -48 -21q-24 0 -43 16q-19 18 -20.5 44.5t15.5 46.5l202 227q-58 114 -58 274h-224q-26 0 -45 19t-19 45t19 45t45 19h224v294l-173 173q-19 19 -19 45t19 45t45 19t45 -19l173 -173h844l173 173q19 19 45 19t45 -19t19 -45t-19 -45l-173 -173v-294h224q26 0 45 -19
+t19 -45zM1152 1152h-640q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5z" />
+    <glyph glyph-name="vk" unicode="&#xf189;" horiz-adv-x="1920" 
+d="M1917 1016q23 -64 -150 -294q-24 -32 -65 -85q-40 -51 -55 -72t-30.5 -49.5t-12 -42t13 -34.5t32.5 -43t57 -53q4 -2 5 -4q141 -131 191 -221q3 -5 6.5 -12.5t7 -26.5t-0.5 -34t-25 -27.5t-59 -12.5l-256 -4q-24 -5 -56 5t-52 22l-20 12q-30 21 -70 64t-68.5 77.5t-61 58
+t-56.5 15.5q-3 -1 -8 -3.5t-17 -14.5t-21.5 -29.5t-17 -52t-6.5 -77.5q0 -15 -3.5 -27.5t-7.5 -18.5l-4 -5q-18 -19 -53 -22h-115q-71 -4 -146 16.5t-131.5 53t-103 66t-70.5 57.5l-25 24q-10 10 -27.5 30t-71.5 91t-106 151t-122.5 211t-130.5 272q-6 16 -6 27t3 16l4 6
+q15 19 57 19l274 2q12 -2 23 -6.5t16 -8.5l5 -3q16 -11 24 -32q20 -50 46 -103.5t41 -81.5l16 -29q29 -60 56 -104t48.5 -68.5t41.5 -38.5t34 -14t27 5q2 1 5 5t12 22t13.5 47t9.5 81t0 125q-2 40 -9 73t-14 46l-6 12q-25 34 -85 43q-13 2 5 24q16 19 38 30q53 26 239 24
+q82 -1 135 -13q20 -5 33.5 -13.5t20.5 -24t10.5 -32t3.5 -45.5t-1 -55t-2.5 -70.5t-1.5 -82.5q0 -11 -1 -42t-0.5 -48t3.5 -40.5t11.5 -39t22.5 -24.5q8 -2 17 -4t26 11t38 34.5t52 67t68 107.5q60 104 107 225q4 10 10 17.5t11 10.5l4 3l5 2.5t13 3t20 0.5l288 2
+q39 5 64 -2.5t31 -16.5z" />
+    <glyph glyph-name="weibo" unicode="&#xf18a;" horiz-adv-x="1792" 
+d="M675 252q21 34 11 69t-45 50q-34 14 -73 1t-60 -46q-22 -34 -13 -68.5t43 -50.5t74.5 -2.5t62.5 47.5zM769 373q8 13 3.5 26.5t-17.5 18.5q-14 5 -28.5 -0.5t-21.5 -18.5q-17 -31 13 -45q14 -5 29 0.5t22 18.5zM943 266q-45 -102 -158 -150t-224 -12
+q-107 34 -147.5 126.5t6.5 187.5q47 93 151.5 139t210.5 19q111 -29 158.5 -119.5t2.5 -190.5zM1255 426q-9 96 -89 170t-208.5 109t-274.5 21q-223 -23 -369.5 -141.5t-132.5 -264.5q9 -96 89 -170t208.5 -109t274.5 -21q223 23 369.5 141.5t132.5 264.5zM1563 422
+q0 -68 -37 -139.5t-109 -137t-168.5 -117.5t-226 -83t-270.5 -31t-275 33.5t-240.5 93t-171.5 151t-65 199.5q0 115 69.5 245t197.5 258q169 169 341.5 236t246.5 -7q65 -64 20 -209q-4 -14 -1 -20t10 -7t14.5 0.5t13.5 3.5l6 2q139 59 246 59t153 -61q45 -63 0 -178
+q-2 -13 -4.5 -20t4.5 -12.5t12 -7.5t17 -6q57 -18 103 -47t80 -81.5t34 -116.5zM1489 1046q42 -47 54.5 -108.5t-6.5 -117.5q-8 -23 -29.5 -34t-44.5 -4q-23 8 -34 29.5t-4 44.5q20 63 -24 111t-107 35q-24 -5 -45 8t-25 37q-5 24 8 44.5t37 25.5q60 13 119 -5.5t101 -65.5z
+M1670 1209q87 -96 112.5 -222.5t-13.5 -241.5q-9 -27 -34 -40t-52 -4t-40 34t-5 52q28 82 10 172t-80 158q-62 69 -148 95.5t-173 8.5q-28 -6 -52 9.5t-30 43.5t9.5 51.5t43.5 29.5q123 26 244 -11.5t208 -134.5z" />
+    <glyph glyph-name="renren" unicode="&#xf18b;" 
+d="M1133 -34q-171 -94 -368 -94q-196 0 -367 94q138 87 235.5 211t131.5 268q35 -144 132.5 -268t235.5 -211zM638 1394v-485q0 -252 -126.5 -459.5t-330.5 -306.5q-181 215 -181 495q0 187 83.5 349.5t229.5 269.5t325 137zM1536 638q0 -280 -181 -495
+q-204 99 -330.5 306.5t-126.5 459.5v485q179 -30 325 -137t229.5 -269.5t83.5 -349.5z" />
+    <glyph glyph-name="_372" unicode="&#xf18c;" horiz-adv-x="1408" 
+d="M1402 433q-32 -80 -76 -138t-91 -88.5t-99 -46.5t-101.5 -14.5t-96.5 8.5t-86.5 22t-69.5 27.5t-46 22.5l-17 10q-113 -228 -289.5 -359.5t-384.5 -132.5q-19 0 -32 13t-13 32t13 31.5t32 12.5q173 1 322.5 107.5t251.5 294.5q-36 -14 -72 -23t-83 -13t-91 2.5t-93 28.5
+t-92 59t-84.5 100t-74.5 146q114 47 214 57t167.5 -7.5t124.5 -56.5t88.5 -77t56.5 -82q53 131 79 291q-7 -1 -18 -2.5t-46.5 -2.5t-69.5 0.5t-81.5 10t-88.5 23t-84 42.5t-75 65t-54.5 94.5t-28.5 127.5q70 28 133.5 36.5t112.5 -1t92 -30t73.5 -50t56 -61t42 -63t27.5 -56
+t16 -39.5l4 -16q12 122 12 195q-8 6 -21.5 16t-49 44.5t-63.5 71.5t-54 93t-33 112.5t12 127t70 138.5q73 -25 127.5 -61.5t84.5 -76.5t48 -85t20.5 -89t-0.5 -85.5t-13 -76.5t-19 -62t-17 -42l-7 -15q1 -4 1 -50t-1 -72q3 7 10 18.5t30.5 43t50.5 58t71 55.5t91.5 44.5
+t112 14.5t132.5 -24q-2 -78 -21.5 -141.5t-50 -104.5t-69.5 -71.5t-81.5 -45.5t-84.5 -24t-80 -9.5t-67.5 1t-46.5 4.5l-17 3q-23 -147 -73 -283q6 7 18 18.5t49.5 41t77.5 52.5t99.5 42t117.5 20t129 -23.5t137 -77.5z" />
+    <glyph glyph-name="stack_exchange" unicode="&#xf18d;" horiz-adv-x="1280" 
+d="M1259 283v-66q0 -85 -57.5 -144.5t-138.5 -59.5h-57l-260 -269v269h-529q-81 0 -138.5 59.5t-57.5 144.5v66h1238zM1259 609v-255h-1238v255h1238zM1259 937v-255h-1238v255h1238zM1259 1077v-67h-1238v67q0 84 57.5 143.5t138.5 59.5h846q81 0 138.5 -59.5t57.5 -143.5z
+" />
+    <glyph glyph-name="_374" unicode="&#xf18e;" 
+d="M1152 640q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v192h-352q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h352v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198
+t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="arrow_circle_alt_left" unicode="&#xf190;" 
+d="M1152 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-352v-192q0 -14 -9 -23t-23 -9q-12 0 -24 10l-319 319q-9 9 -9 23t9 23l320 320q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5v-192h352q13 0 22.5 -9.5t9.5 -22.5zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198
+t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="_376" unicode="&#xf191;" 
+d="M1024 960v-640q0 -26 -19 -45t-45 -19q-20 0 -37 12l-448 320q-27 19 -27 52t27 52l448 320q17 12 37 12q26 0 45 -19t19 -45zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5z
+M1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="dot_circle_alt" unicode="&#xf192;" 
+d="M1024 640q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5
+t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="_378" unicode="&#xf193;" horiz-adv-x="1664" 
+d="M1023 349l102 -204q-58 -179 -210 -290t-339 -111q-156 0 -288.5 77.5t-210 210t-77.5 288.5q0 181 104.5 330t274.5 211l17 -131q-122 -54 -195 -165.5t-73 -244.5q0 -185 131.5 -316.5t316.5 -131.5q126 0 232.5 65t165 175.5t49.5 236.5zM1571 249l58 -114l-256 -128
+q-13 -7 -29 -7q-40 0 -57 35l-239 477h-472q-24 0 -42.5 16.5t-21.5 40.5l-96 779q-2 17 6 42q14 51 57 82.5t97 31.5q66 0 113 -47t47 -113q0 -69 -52 -117.5t-120 -41.5l37 -289h423v-128h-407l16 -128h455q40 0 57 -35l228 -455z" />
+    <glyph glyph-name="vimeo_square" unicode="&#xf194;" 
+d="M1292 898q10 216 -161 222q-231 8 -312 -261q44 19 82 19q85 0 74 -96q-4 -57 -74 -167t-105 -110q-43 0 -82 169q-13 54 -45 255q-30 189 -160 177q-59 -7 -164 -100l-81 -72l-81 -72l52 -67q76 52 87 52q57 0 107 -179q15 -55 45 -164.5t45 -164.5q68 -179 164 -179
+q157 0 383 294q220 283 226 444zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="_380" unicode="&#xf195;" horiz-adv-x="1152" 
+d="M1152 704q0 -191 -94.5 -353t-256.5 -256.5t-353 -94.5h-160q-14 0 -23 9t-9 23v611l-215 -66q-3 -1 -9 -1q-10 0 -19 6q-13 10 -13 26v128q0 23 23 31l233 71v93l-215 -66q-3 -1 -9 -1q-10 0 -19 6q-13 10 -13 26v128q0 23 23 31l233 71v250q0 14 9 23t23 9h160
+q14 0 23 -9t9 -23v-181l375 116q15 5 28 -5t13 -26v-128q0 -23 -23 -31l-393 -121v-93l375 116q15 5 28 -5t13 -26v-128q0 -23 -23 -31l-393 -121v-487q188 13 318 151t130 328q0 14 9 23t23 9h160q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="plus_square_o" unicode="&#xf196;" horiz-adv-x="1408" 
+d="M1152 736v-64q0 -14 -9 -23t-23 -9h-352v-352q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v352h-352q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h352v352q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-352h352q14 0 23 -9t9 -23zM1280 288v832q0 66 -47 113t-113 47h-832
+q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113zM1408 1120v-832q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="_382" unicode="&#xf197;" horiz-adv-x="2176" 
+d="M620 416q-110 -64 -268 -64h-128v64h-64q-13 0 -22.5 23.5t-9.5 56.5q0 24 7 49q-58 2 -96.5 10.5t-38.5 20.5t38.5 20.5t96.5 10.5q-7 25 -7 49q0 33 9.5 56.5t22.5 23.5h64v64h128q158 0 268 -64h1113q42 -7 106.5 -18t80.5 -14q89 -15 150 -40.5t83.5 -47.5t22.5 -40
+t-22.5 -40t-83.5 -47.5t-150 -40.5q-16 -3 -80.5 -14t-106.5 -18h-1113zM1739 668q53 -36 53 -92t-53 -92l81 -30q68 48 68 122t-68 122zM625 400h1015q-217 -38 -456 -80q-57 0 -113 -24t-83 -48l-28 -24l-288 -288q-26 -26 -70.5 -45t-89.5 -19h-96l-93 464h29
+q157 0 273 64zM352 816h-29l93 464h96q46 0 90 -19t70 -45l288 -288q4 -4 11 -10.5t30.5 -23t48.5 -29t61.5 -23t72.5 -10.5l456 -80h-1015q-116 64 -273 64z" />
+    <glyph glyph-name="_383" unicode="&#xf198;" horiz-adv-x="1664" 
+d="M1519 760q62 0 103.5 -40.5t41.5 -101.5q0 -97 -93 -130l-172 -59l56 -167q7 -21 7 -47q0 -59 -42 -102t-101 -43q-47 0 -85.5 27t-53.5 72l-55 165l-310 -106l55 -164q8 -24 8 -47q0 -59 -42 -102t-102 -43q-47 0 -85 27t-53 72l-55 163l-153 -53q-29 -9 -50 -9
+q-61 0 -101.5 40t-40.5 101q0 47 27.5 85t71.5 53l156 53l-105 313l-156 -54q-26 -8 -48 -8q-60 0 -101 40.5t-41 100.5q0 47 27.5 85t71.5 53l157 53l-53 159q-8 24 -8 47q0 60 42 102.5t102 42.5q47 0 85 -27t53 -72l54 -160l310 105l-54 160q-8 24 -8 47q0 59 42.5 102
+t101.5 43q47 0 85.5 -27.5t53.5 -71.5l53 -161l162 55q21 6 43 6q60 0 102.5 -39.5t42.5 -98.5q0 -45 -30 -81.5t-74 -51.5l-157 -54l105 -316l164 56q24 8 46 8zM725 498l310 105l-105 315l-310 -107z" />
+    <glyph glyph-name="_384" unicode="&#xf199;" 
+d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960zM1280 352v436q-31 -35 -64 -55q-34 -22 -132.5 -85t-151.5 -99q-98 -69 -164 -69v0v0q-66 0 -164 69
+q-47 32 -142 92.5t-142 92.5q-12 8 -33 27t-31 27v-436q0 -40 28 -68t68 -28h832q40 0 68 28t28 68zM1280 925q0 41 -27.5 70t-68.5 29h-832q-40 0 -68 -28t-28 -68q0 -37 30.5 -76.5t67.5 -64.5q47 -32 137.5 -89t129.5 -83q3 -2 17 -11.5t21 -14t21 -13t23.5 -13
+t21.5 -9.5t22.5 -7.5t20.5 -2.5t20.5 2.5t22.5 7.5t21.5 9.5t23.5 13t21 13t21 14t17 11.5l267 174q35 23 66.5 62.5t31.5 73.5z" />
+    <glyph glyph-name="_385" unicode="&#xf19a;" horiz-adv-x="1792" 
+d="M127 640q0 163 67 313l367 -1005q-196 95 -315 281t-119 411zM1415 679q0 -19 -2.5 -38.5t-10 -49.5t-11.5 -44t-17.5 -59t-17.5 -58l-76 -256l-278 826q46 3 88 8q19 2 26 18.5t-2.5 31t-28.5 13.5l-205 -10q-75 1 -202 10q-12 1 -20.5 -5t-11.5 -15t-1.5 -18.5t9 -16.5
+t19.5 -8l80 -8l120 -328l-168 -504l-280 832q46 3 88 8q19 2 26 18.5t-2.5 31t-28.5 13.5l-205 -10q-7 0 -23 0.5t-26 0.5q105 160 274.5 253.5t367.5 93.5q147 0 280.5 -53t238.5 -149h-10q-55 0 -92 -40.5t-37 -95.5q0 -12 2 -24t4 -21.5t8 -23t9 -21t12 -22.5t12.5 -21
+t14.5 -24t14 -23q63 -107 63 -212zM909 573l237 -647q1 -6 5 -11q-126 -44 -255 -44q-112 0 -217 32zM1570 1009q95 -174 95 -369q0 -209 -104 -385.5t-279 -278.5l235 678q59 169 59 276q0 42 -6 79zM896 1536q182 0 348 -71t286 -191t191 -286t71 -348t-71 -348t-191 -286
+t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71zM896 -215q173 0 331.5 68t273 182.5t182.5 273t68 331.5t-68 331.5t-182.5 273t-273 182.5t-331.5 68t-331.5 -68t-273 -182.5t-182.5 -273t-68 -331.5t68 -331.5t182.5 -273
+t273 -182.5t331.5 -68z" />
+    <glyph glyph-name="_386" unicode="&#xf19b;" horiz-adv-x="1792" 
+d="M1086 1536v-1536l-272 -128q-228 20 -414 102t-293 208.5t-107 272.5q0 140 100.5 263.5t275 205.5t391.5 108v-172q-217 -38 -356.5 -150t-139.5 -255q0 -152 154.5 -267t388.5 -145v1360zM1755 954l37 -390l-525 114l147 83q-119 70 -280 99v172q277 -33 481 -157z" />
+    <glyph glyph-name="_387" unicode="&#xf19c;" horiz-adv-x="2048" 
+d="M960 1536l960 -384v-128h-128q0 -26 -20.5 -45t-48.5 -19h-1526q-28 0 -48.5 19t-20.5 45h-128v128zM256 896h256v-768h128v768h256v-768h128v768h256v-768h128v768h256v-768h59q28 0 48.5 -19t20.5 -45v-64h-1664v64q0 26 20.5 45t48.5 19h59v768zM1851 -64
+q28 0 48.5 -19t20.5 -45v-128h-1920v128q0 26 20.5 45t48.5 19h1782z" />
+    <glyph glyph-name="_388" unicode="&#xf19d;" horiz-adv-x="2304" 
+d="M1774 700l18 -316q4 -69 -82 -128t-235 -93.5t-323 -34.5t-323 34.5t-235 93.5t-82 128l18 316l574 -181q22 -7 48 -7t48 7zM2304 1024q0 -23 -22 -31l-1120 -352q-4 -1 -10 -1t-10 1l-652 206q-43 -34 -71 -111.5t-34 -178.5q63 -36 63 -109q0 -69 -58 -107l58 -433
+q2 -14 -8 -25q-9 -11 -24 -11h-192q-15 0 -24 11q-10 11 -8 25l58 433q-58 38 -58 107q0 73 65 111q11 207 98 330l-333 104q-22 8 -22 31t22 31l1120 352q4 1 10 1t10 -1l1120 -352q22 -8 22 -31z" />
+    <glyph glyph-name="_389" unicode="&#xf19e;" 
+d="M859 579l13 -707q-62 11 -105 11q-41 0 -105 -11l13 707q-40 69 -168.5 295.5t-216.5 374.5t-181 287q58 -15 108 -15q44 0 111 15q63 -111 133.5 -229.5t167 -276.5t138.5 -227q37 61 109.5 177.5t117.5 190t105 176t107 189.5q54 -14 107 -14q56 0 114 14v0
+q-28 -39 -60 -88.5t-49.5 -78.5t-56.5 -96t-49 -84q-146 -248 -353 -610z" />
+    <glyph glyph-name="uniF1A0" unicode="&#xf1a0;" 
+d="M768 750h725q12 -67 12 -128q0 -217 -91 -387.5t-259.5 -266.5t-386.5 -96q-157 0 -299 60.5t-245 163.5t-163.5 245t-60.5 299t60.5 299t163.5 245t245 163.5t299 60.5q300 0 515 -201l-209 -201q-123 119 -306 119q-129 0 -238.5 -65t-173.5 -176.5t-64 -243.5
+t64 -243.5t173.5 -176.5t238.5 -65q87 0 160 24t120 60t82 82t51.5 87t22.5 78h-436v264z" />
+    <glyph glyph-name="f1a1" unicode="&#xf1a1;" horiz-adv-x="1792" 
+d="M1095 369q16 -16 0 -31q-62 -62 -199 -62t-199 62q-16 15 0 31q6 6 15 6t15 -6q48 -49 169 -49q120 0 169 49q6 6 15 6t15 -6zM788 550q0 -37 -26 -63t-63 -26t-63.5 26t-26.5 63q0 38 26.5 64t63.5 26t63 -26.5t26 -63.5zM1183 550q0 -37 -26.5 -63t-63.5 -26t-63 26
+t-26 63t26 63.5t63 26.5t63.5 -26t26.5 -64zM1434 670q0 49 -35 84t-85 35t-86 -36q-130 90 -311 96l63 283l200 -45q0 -37 26 -63t63 -26t63.5 26.5t26.5 63.5t-26.5 63.5t-63.5 26.5q-54 0 -80 -50l-221 49q-19 5 -25 -16l-69 -312q-180 -7 -309 -97q-35 37 -87 37
+q-50 0 -85 -35t-35 -84q0 -35 18.5 -64t49.5 -44q-6 -27 -6 -56q0 -142 140 -243t337 -101q198 0 338 101t140 243q0 32 -7 57q30 15 48 43.5t18 63.5zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191
+t348 71t348 -71t286 -191t191 -286t71 -348z" />
+    <glyph glyph-name="_392" unicode="&#xf1a2;" 
+d="M939 407q13 -13 0 -26q-53 -53 -171 -53t-171 53q-13 13 0 26q5 6 13 6t13 -6q42 -42 145 -42t145 42q5 6 13 6t13 -6zM676 563q0 -31 -23 -54t-54 -23t-54 23t-23 54q0 32 22.5 54.5t54.5 22.5t54.5 -22.5t22.5 -54.5zM1014 563q0 -31 -23 -54t-54 -23t-54 23t-23 54
+q0 32 22.5 54.5t54.5 22.5t54.5 -22.5t22.5 -54.5zM1229 666q0 42 -30 72t-73 30q-42 0 -73 -31q-113 78 -267 82l54 243l171 -39q1 -32 23.5 -54t53.5 -22q32 0 54.5 22.5t22.5 54.5t-22.5 54.5t-54.5 22.5q-48 0 -69 -43l-189 42q-17 5 -21 -13l-60 -268q-154 -6 -265 -83
+q-30 32 -74 32q-43 0 -73 -30t-30 -72q0 -30 16 -55t42 -38q-5 -25 -5 -48q0 -122 120 -208.5t289 -86.5q170 0 290 86.5t120 208.5q0 25 -6 49q25 13 40.5 37.5t15.5 54.5zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960
+q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="_393" unicode="&#xf1a3;" 
+d="M866 697l90 27v62q0 79 -58 135t-138 56t-138 -55.5t-58 -134.5v-283q0 -20 -14 -33.5t-33 -13.5t-32.5 13.5t-13.5 33.5v120h-151v-122q0 -82 57.5 -139t139.5 -57q81 0 138.5 56.5t57.5 136.5v280q0 19 13.5 33t33.5 14q19 0 32.5 -14t13.5 -33v-54zM1199 502v122h-150
+v-126q0 -20 -13.5 -33.5t-33.5 -13.5q-19 0 -32.5 14t-13.5 33v123l-90 -26l-60 28v-123q0 -80 58 -137t139 -57t138.5 57t57.5 139zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103
+t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="f1a4" unicode="&#xf1a4;" horiz-adv-x="1920" 
+d="M1062 824v118q0 42 -30 72t-72 30t-72 -30t-30 -72v-612q0 -175 -126 -299t-303 -124q-178 0 -303.5 125.5t-125.5 303.5v266h328v-262q0 -43 30 -72.5t72 -29.5t72 29.5t30 72.5v620q0 171 126.5 292t301.5 121q176 0 302 -122t126 -294v-136l-195 -58zM1592 602h328
+v-266q0 -178 -125.5 -303.5t-303.5 -125.5q-177 0 -303 124.5t-126 300.5v268l131 -61l195 58v-270q0 -42 30 -71.5t72 -29.5t72 29.5t30 71.5v275z" />
+    <glyph glyph-name="_395" unicode="&#xf1a5;" 
+d="M1472 160v480h-704v704h-480q-93 0 -158.5 -65.5t-65.5 -158.5v-480h704v-704h480q93 0 158.5 65.5t65.5 158.5zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5
+t84.5 -203.5z" />
+    <glyph glyph-name="_396" unicode="&#xf1a6;" horiz-adv-x="2048" 
+d="M328 1254h204v-983h-532v697h328v286zM328 435v369h-123v-369h123zM614 968v-697h205v697h-205zM614 1254v-204h205v204h-205zM901 968h533v-942h-533v163h328v82h-328v697zM1229 435v369h-123v-369h123zM1516 968h532v-942h-532v163h327v82h-327v697zM1843 435v369h-123
+v-369h123z" />
+    <glyph glyph-name="_397" unicode="&#xf1a7;" 
+d="M1046 516q0 -64 -38 -109t-91 -45q-43 0 -70 15v277q28 17 70 17q53 0 91 -45.5t38 -109.5zM703 944q0 -64 -38 -109.5t-91 -45.5q-43 0 -70 15v277q28 17 70 17q53 0 91 -45t38 -109zM1265 513q0 134 -88 229t-213 95q-20 0 -39 -3q-23 -78 -78 -136q-87 -95 -211 -101
+v-636l211 41v206q51 -19 117 -19q125 0 213 95t88 229zM922 940q0 134 -88.5 229t-213.5 95q-74 0 -141 -36h-186v-840l211 41v206q55 -19 116 -19q125 0 213.5 95t88.5 229zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960
+q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="_398" unicode="&#xf1a8;" horiz-adv-x="2038" 
+d="M1222 607q75 3 143.5 -20.5t118 -58.5t101 -94.5t84 -108t75.5 -120.5q33 -56 78.5 -109t75.5 -80.5t99 -88.5q-48 -30 -108.5 -57.5t-138.5 -59t-114 -47.5q-44 37 -74 115t-43.5 164.5t-33 180.5t-42.5 168.5t-72.5 123t-122.5 48.5l-10 -2l-6 -4q4 -5 13 -14
+q6 -5 28 -23.5t25.5 -22t19 -18t18 -20.5t11.5 -21t10.5 -27.5t4.5 -31t4 -40.5l1 -33q1 -26 -2.5 -57.5t-7.5 -52t-12.5 -58.5t-11.5 -53q-35 1 -101 -9.5t-98 -10.5q-39 0 -72 10q-2 16 -2 47q0 74 3 96q2 13 31.5 41.5t57 59t26.5 51.5q-24 2 -43 -24
+q-36 -53 -111.5 -99.5t-136.5 -46.5q-25 0 -75.5 63t-106.5 139.5t-84 96.5q-6 4 -27 30q-482 -112 -513 -112q-16 0 -28 11t-12 27q0 15 8.5 26.5t22.5 14.5l486 106q-8 14 -8 25t5.5 17.5t16 11.5t20 7t23 4.5t18.5 4.5q4 1 15.5 7.5t17.5 6.5q15 0 28 -16t20 -33
+q163 37 172 37q17 0 29.5 -11t12.5 -28q0 -15 -8.5 -26t-23.5 -14l-182 -40l-1 -16q-1 -26 81.5 -117.5t104.5 -91.5q47 0 119 80t72 129q0 36 -23.5 53t-51 18.5t-51 11.5t-23.5 34q0 16 10 34l-68 19q43 44 43 117q0 26 -5 58q82 16 144 16q44 0 71.5 -1.5t48.5 -8.5
+t31 -13.5t20.5 -24.5t15.5 -33.5t17 -47.5t24 -60l50 25q-3 -40 -23 -60t-42.5 -21t-40 -6.5t-16.5 -20.5zM1282 842q-5 5 -13.5 15.5t-12 14.5t-10.5 11.5t-10 10.5l-8 8t-8.5 7.5t-8 5t-8.5 4.5q-7 3 -14.5 5t-20.5 2.5t-22 0.5h-32.5h-37.5q-126 0 -217 -43
+q16 30 36 46.5t54 29.5t65.5 36t46 36.5t50 55t43.5 50.5q12 -9 28 -31.5t32 -36.5t38 -13l12 1v-76l22 -1q247 95 371 190q28 21 50 39t42.5 37.5t33 31t29.5 34t24 31t24.5 37t23 38t27 47.5t29.5 53l7 9q-2 -53 -43 -139q-79 -165 -205 -264t-306 -142q-14 -3 -42 -7.5
+t-50 -9.5t-39 -14q3 -19 24.5 -46t21.5 -34q0 -11 -26 -30zM1061 -79q39 26 131.5 47.5t146.5 21.5q9 0 22.5 -15.5t28 -42.5t26 -50t24 -51t14.5 -33q-121 -45 -244 -45q-61 0 -125 11zM822 568l48 12l109 -177l-73 -48zM1323 51q3 -15 3 -16q0 -7 -17.5 -14.5t-46 -13
+t-54 -9.5t-53.5 -7.5t-32 -4.5l-7 43q21 2 60.5 8.5t72 10t60.5 3.5h14zM866 679l-96 -20l-6 17q10 1 32.5 7t34.5 6q19 0 35 -10zM1061 45h31l10 -83l-41 -12v95zM1950 1535v1v-1zM1950 1535l-1 -5l-2 -2l1 3zM1950 1535l1 1z" />
+    <glyph glyph-name="_399" unicode="&#xf1a9;" 
+d="M1167 -50q-5 19 -24 5q-30 -22 -87 -39t-131 -17q-129 0 -193 49q-5 4 -13 4q-11 0 -26 -12q-7 -6 -7.5 -16t7.5 -20q34 -32 87.5 -46t102.5 -12.5t99 4.5q41 4 84.5 20.5t65 30t28.5 20.5q12 12 7 29zM1128 65q-19 47 -39 61q-23 15 -76 15q-47 0 -71 -10
+q-29 -12 -78 -56q-26 -24 -12 -44q9 -8 17.5 -4.5t31.5 23.5q3 2 10.5 8.5t10.5 8.5t10 7t11.5 7t12.5 5t15 4.5t16.5 2.5t20.5 1q27 0 44.5 -7.5t23 -14.5t13.5 -22q10 -17 12.5 -20t12.5 1q23 12 14 34zM1483 346q0 22 -5 44.5t-16.5 45t-34 36.5t-52.5 14
+q-33 0 -97 -41.5t-129 -83.5t-101 -42q-27 -1 -63.5 19t-76 49t-83.5 58t-100 49t-111 19q-115 -1 -197 -78.5t-84 -178.5q-2 -112 74 -164q29 -20 62.5 -28.5t103.5 -8.5q57 0 132 32.5t134 71t120 70.5t93 31q26 -1 65 -31.5t71.5 -67t68 -67.5t55.5 -32q35 -3 58.5 14
+t55.5 63q28 41 42.5 101t14.5 106zM1536 506q0 -164 -62 -304.5t-166 -236t-242.5 -149.5t-290.5 -54t-293 57.5t-247.5 157t-170.5 241.5t-64 302q0 89 19.5 172.5t49 145.5t70.5 118.5t78.5 94t78.5 69.5t64.5 46.5t42.5 24.5q14 8 51 26.5t54.5 28.5t48 30t60.5 44
+q36 28 58 72.5t30 125.5q129 -155 186 -193q44 -29 130 -68t129 -66q21 -13 39 -25t60.5 -46.5t76 -70.5t75 -95t69 -122t47 -148.5t19.5 -177.5z" />
+    <glyph glyph-name="_400" unicode="&#xf1aa;" 
+d="M1070 463l-160 -160l-151 -152l-30 -30q-65 -64 -151.5 -87t-171.5 -2q-16 -70 -72 -115t-129 -45q-85 0 -145 60.5t-60 145.5q0 72 44.5 128t113.5 72q-22 86 1 173t88 152l12 12l151 -152l-11 -11q-37 -37 -37 -89t37 -90q37 -37 89 -37t89 37l30 30l151 152l161 160z
+M729 1145l12 -12l-152 -152l-12 12q-37 37 -89 37t-89 -37t-37 -89.5t37 -89.5l29 -29l152 -152l160 -160l-151 -152l-161 160l-151 152l-30 30q-68 67 -90 159.5t5 179.5q-70 15 -115 71t-45 129q0 85 60 145.5t145 60.5q76 0 133.5 -49t69.5 -123q84 20 169.5 -3.5
+t149.5 -87.5zM1536 78q0 -85 -60 -145.5t-145 -60.5q-74 0 -131 47t-71 118q-86 -28 -179.5 -6t-161.5 90l-11 12l151 152l12 -12q37 -37 89 -37t89 37t37 89t-37 89l-30 30l-152 152l-160 160l152 152l160 -160l152 -152l29 -30q64 -64 87.5 -150.5t2.5 -171.5
+q76 -11 126.5 -68.5t50.5 -134.5zM1534 1202q0 -77 -51 -135t-127 -69q26 -85 3 -176.5t-90 -158.5l-12 -12l-151 152l12 12q37 37 37 89t-37 89t-89 37t-89 -37l-30 -30l-152 -152l-160 -160l-152 152l161 160l152 152l29 30q67 67 159 89.5t178 -3.5q11 75 68.5 126
+t135.5 51q85 0 145 -60.5t60 -145.5z" />
+    <glyph glyph-name="f1ab" unicode="&#xf1ab;" 
+d="M654 458q-1 -3 -12.5 0.5t-31.5 11.5l-20 9q-44 20 -87 49q-7 5 -41 31.5t-38 28.5q-67 -103 -134 -181q-81 -95 -105 -110q-4 -2 -19.5 -4t-18.5 0q6 4 82 92q21 24 85.5 115t78.5 118q17 30 51 98.5t36 77.5q-8 1 -110 -33q-8 -2 -27.5 -7.5t-34.5 -9.5t-17 -5
+q-2 -2 -2 -10.5t-1 -9.5q-5 -10 -31 -15q-23 -7 -47 0q-18 4 -28 21q-4 6 -5 23q6 2 24.5 5t29.5 6q58 16 105 32q100 35 102 35q10 2 43 19.5t44 21.5q9 3 21.5 8t14.5 5.5t6 -0.5q2 -12 -1 -33q0 -2 -12.5 -27t-26.5 -53.5t-17 -33.5q-25 -50 -77 -131l64 -28
+q12 -6 74.5 -32t67.5 -28q4 -1 10.5 -25.5t4.5 -30.5zM449 944q3 -15 -4 -28q-12 -23 -50 -38q-30 -12 -60 -12q-26 3 -49 26q-14 15 -18 41l1 3q3 -3 19.5 -5t26.5 0t58 16q36 12 55 14q17 0 21 -17zM1147 815l63 -227l-139 42zM39 15l694 232v1032l-694 -233v-1031z
+M1280 332l102 -31l-181 657l-100 31l-216 -536l102 -31l45 110l211 -65zM777 1294l573 -184v380zM1088 -29l158 -13l-54 -160l-40 66q-130 -83 -276 -108q-58 -12 -91 -12h-84q-79 0 -199.5 39t-183.5 85q-8 7 -8 16q0 8 5 13.5t13 5.5q4 0 18 -7.5t30.5 -16.5t20.5 -11
+q73 -37 159.5 -61.5t157.5 -24.5q95 0 167 14.5t157 50.5q15 7 30.5 15.5t34 19t28.5 16.5zM1536 1050v-1079l-774 246q-14 -6 -375 -127.5t-368 -121.5q-13 0 -18 13q0 1 -1 3v1078q3 9 4 10q5 6 20 11q107 36 149 50v384l558 -198q2 0 160.5 55t316 108.5t161.5 53.5
+q20 0 20 -21v-418z" />
+    <glyph glyph-name="_402" unicode="&#xf1ac;" horiz-adv-x="1792" 
+d="M288 1152q66 0 113 -47t47 -113v-1088q0 -66 -47 -113t-113 -47h-128q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h128zM1664 989q58 -34 93 -93t35 -128v-768q0 -106 -75 -181t-181 -75h-864q-66 0 -113 47t-47 113v1536q0 40 28 68t68 28h672q40 0 88 -20t76 -48
+l152 -152q28 -28 48 -76t20 -88v-163zM928 0v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM928 256v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM928 512v128q0 14 -9 23
+t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1184 0v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1184 256v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128
+q14 0 23 9t9 23zM1184 512v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1440 0v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1440 256v128q0 14 -9 23t-23 9h-128
+q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1440 512v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1536 896v256h-160q-40 0 -68 28t-28 68v160h-640v-512h896z" />
+    <glyph glyph-name="_403" unicode="&#xf1ad;" 
+d="M1344 1536q26 0 45 -19t19 -45v-1664q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v1664q0 26 19 45t45 19h1280zM512 1248v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM512 992v-64q0 -14 9 -23t23 -9h64q14 0 23 9
+t9 23v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM512 736v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM512 480v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM384 160v64
+q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM384 416v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM384 672v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64
+q14 0 23 9t9 23zM384 928v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM384 1184v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM896 -96v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9
+t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM896 416v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM896 672v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM896 928v64
+q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM896 1184v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1152 160v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64
+q14 0 23 9t9 23zM1152 416v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1152 672v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1152 928v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9
+t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1152 1184v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23z" />
+    <glyph glyph-name="_404" unicode="&#xf1ae;" horiz-adv-x="1280" 
+d="M1188 988l-292 -292v-824q0 -46 -33 -79t-79 -33t-79 33t-33 79v384h-64v-384q0 -46 -33 -79t-79 -33t-79 33t-33 79v824l-292 292q-28 28 -28 68t28 68q29 28 68.5 28t67.5 -28l228 -228h368l228 228q28 28 68 28t68 -28q28 -29 28 -68.5t-28 -67.5zM864 1152
+q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5z" />
+    <glyph glyph-name="uniF1B1" unicode="&#xf1b0;" horiz-adv-x="1664" 
+d="M780 1064q0 -60 -19 -113.5t-63 -92.5t-105 -39q-76 0 -138 57.5t-92 135.5t-30 151q0 60 19 113.5t63 92.5t105 39q77 0 138.5 -57.5t91.5 -135t30 -151.5zM438 581q0 -80 -42 -139t-119 -59q-76 0 -141.5 55.5t-100.5 133.5t-35 152q0 80 42 139.5t119 59.5
+q76 0 141.5 -55.5t100.5 -134t35 -152.5zM832 608q118 0 255 -97.5t229 -237t92 -254.5q0 -46 -17 -76.5t-48.5 -45t-64.5 -20t-76 -5.5q-68 0 -187.5 45t-182.5 45q-66 0 -192.5 -44.5t-200.5 -44.5q-183 0 -183 146q0 86 56 191.5t139.5 192.5t187.5 146t193 59zM1071 819
+q-61 0 -105 39t-63 92.5t-19 113.5q0 74 30 151.5t91.5 135t138.5 57.5q61 0 105 -39t63 -92.5t19 -113.5q0 -73 -30 -151t-92 -135.5t-138 -57.5zM1503 923q77 0 119 -59.5t42 -139.5q0 -74 -35 -152t-100.5 -133.5t-141.5 -55.5q-77 0 -119 59t-42 139q0 74 35 152.5
+t100.5 134t141.5 55.5z" />
+    <glyph glyph-name="_406" unicode="&#xf1b1;" horiz-adv-x="768" 
+d="M704 1008q0 -145 -57 -243.5t-152 -135.5l45 -821q2 -26 -16 -45t-44 -19h-192q-26 0 -44 19t-16 45l45 821q-95 37 -152 135.5t-57 243.5q0 128 42.5 249.5t117.5 200t160 78.5t160 -78.5t117.5 -200t42.5 -249.5z" />
+    <glyph glyph-name="_407" unicode="&#xf1b2;" horiz-adv-x="1792" 
+d="M896 -93l640 349v636l-640 -233v-752zM832 772l698 254l-698 254l-698 -254zM1664 1024v-768q0 -35 -18 -65t-49 -47l-704 -384q-28 -16 -61 -16t-61 16l-704 384q-31 17 -49 47t-18 65v768q0 40 23 73t61 47l704 256q22 8 44 8t44 -8l704 -256q38 -14 61 -47t23 -73z
+" />
+    <glyph glyph-name="_408" unicode="&#xf1b3;" horiz-adv-x="2304" 
+d="M640 -96l384 192v314l-384 -164v-342zM576 358l404 173l-404 173l-404 -173zM1664 -96l384 192v314l-384 -164v-342zM1600 358l404 173l-404 173l-404 -173zM1152 651l384 165v266l-384 -164v-267zM1088 1030l441 189l-441 189l-441 -189zM2176 512v-416q0 -36 -19 -67
+t-52 -47l-448 -224q-25 -14 -57 -14t-57 14l-448 224q-4 2 -7 4q-2 -2 -7 -4l-448 -224q-25 -14 -57 -14t-57 14l-448 224q-33 16 -52 47t-19 67v416q0 38 21.5 70t56.5 48l434 186v400q0 38 21.5 70t56.5 48l448 192q23 10 50 10t50 -10l448 -192q35 -16 56.5 -48t21.5 -70
+v-400l434 -186q36 -16 57 -48t21 -70z" />
+    <glyph glyph-name="_409" unicode="&#xf1b4;" horiz-adv-x="2048" 
+d="M1848 1197h-511v-124h511v124zM1596 771q-90 0 -146 -52.5t-62 -142.5h408q-18 195 -200 195zM1612 186q63 0 122 32t76 87h221q-100 -307 -427 -307q-214 0 -340.5 132t-126.5 347q0 208 130.5 345.5t336.5 137.5q138 0 240.5 -68t153 -179t50.5 -248q0 -17 -2 -47h-658
+q0 -111 57.5 -171.5t166.5 -60.5zM277 236h296q205 0 205 167q0 180 -199 180h-302v-347zM277 773h281q78 0 123.5 36.5t45.5 113.5q0 144 -190 144h-260v-294zM0 1282h594q87 0 155 -14t126.5 -47.5t90 -96.5t31.5 -154q0 -181 -172 -263q114 -32 172 -115t58 -204
+q0 -75 -24.5 -136.5t-66 -103.5t-98.5 -71t-121 -42t-134 -13h-611v1260z" />
+    <glyph glyph-name="_410" unicode="&#xf1b5;" 
+d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960zM499 1041h-371v-787h382q117 0 197 57.5t80 170.5q0 158 -143 200q107 52 107 164q0 57 -19.5 96.5
+t-56.5 60.5t-79 29.5t-97 8.5zM477 723h-176v184h163q119 0 119 -90q0 -94 -106 -94zM486 388h-185v217h189q124 0 124 -113q0 -104 -128 -104zM1136 356q-68 0 -104 38t-36 107h411q1 10 1 30q0 132 -74.5 220.5t-203.5 88.5q-128 0 -210 -86t-82 -216q0 -135 79 -217
+t213 -82q205 0 267 191h-138q-11 -34 -47.5 -54t-75.5 -20zM1126 722q113 0 124 -122h-254q4 56 39 89t91 33zM964 988h319v-77h-319v77z" />
+    <glyph glyph-name="_411" unicode="&#xf1b6;" horiz-adv-x="1792" 
+d="M1582 954q0 -101 -71.5 -172.5t-172.5 -71.5t-172.5 71.5t-71.5 172.5t71.5 172.5t172.5 71.5t172.5 -71.5t71.5 -172.5zM812 212q0 104 -73 177t-177 73q-27 0 -54 -6l104 -42q77 -31 109.5 -106.5t1.5 -151.5q-31 -77 -107 -109t-152 -1q-21 8 -62 24.5t-61 24.5
+q32 -60 91 -96.5t130 -36.5q104 0 177 73t73 177zM1642 953q0 126 -89.5 215.5t-215.5 89.5q-127 0 -216.5 -89.5t-89.5 -215.5q0 -127 89.5 -216t216.5 -89q126 0 215.5 89t89.5 216zM1792 953q0 -189 -133.5 -322t-321.5 -133l-437 -319q-12 -129 -109 -218t-229 -89
+q-121 0 -214 76t-118 192l-230 92v429l389 -157q79 48 173 48q13 0 35 -2l284 407q2 187 135.5 319t320.5 132q188 0 321.5 -133.5t133.5 -321.5z" />
+    <glyph glyph-name="_412" unicode="&#xf1b7;" 
+d="M1242 889q0 80 -57 136.5t-137 56.5t-136.5 -57t-56.5 -136q0 -80 56.5 -136.5t136.5 -56.5t137 56.5t57 136.5zM632 301q0 -83 -58 -140.5t-140 -57.5q-56 0 -103 29t-72 77q52 -20 98 -40q60 -24 120 1.5t85 86.5q24 60 -1.5 120t-86.5 84l-82 33q22 5 42 5
+q82 0 140 -57.5t58 -140.5zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v153l172 -69q20 -92 93.5 -152t168.5 -60q104 0 181 70t87 173l345 252q150 0 255.5 105.5t105.5 254.5q0 150 -105.5 255.5t-255.5 105.5
+q-148 0 -253 -104.5t-107 -252.5l-225 -322q-9 1 -28 1q-75 0 -137 -37l-297 119v468q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5zM1289 887q0 -100 -71 -170.5t-171 -70.5t-170.5 70.5t-70.5 170.5t70.5 171t170.5 71q101 0 171.5 -70.5t70.5 -171.5z
+" />
+    <glyph glyph-name="_413" unicode="&#xf1b8;" horiz-adv-x="1792" 
+d="M836 367l-15 -368l-2 -22l-420 29q-36 3 -67 31.5t-47 65.5q-11 27 -14.5 55t4 65t12 55t21.5 64t19 53q78 -12 509 -28zM449 953l180 -379l-147 92q-63 -72 -111.5 -144.5t-72.5 -125t-39.5 -94.5t-18.5 -63l-4 -21l-190 357q-17 26 -18 56t6 47l8 18q35 63 114 188
+l-140 86zM1680 436l-188 -359q-12 -29 -36.5 -46.5t-43.5 -20.5l-18 -4q-71 -7 -219 -12l8 -164l-230 367l211 362l7 -173q170 -16 283 -5t170 33zM895 1360q-47 -63 -265 -435l-317 187l-19 12l225 356q20 31 60 45t80 10q24 -2 48.5 -12t42 -21t41.5 -33t36 -34.5
+t36 -39.5t32 -35zM1550 1053l212 -363q18 -37 12.5 -76t-27.5 -74q-13 -20 -33 -37t-38 -28t-48.5 -22t-47 -16t-51.5 -14t-46 -12q-34 72 -265 436l313 195zM1407 1279l142 83l-220 -373l-419 20l151 86q-34 89 -75 166t-75.5 123.5t-64.5 80t-47 46.5l-17 13l405 -1
+q31 3 58 -10.5t39 -28.5l11 -15q39 -61 112 -190z" />
+    <glyph glyph-name="_414" unicode="&#xf1b9;" horiz-adv-x="2048" 
+d="M480 448q0 66 -47 113t-113 47t-113 -47t-47 -113t47 -113t113 -47t113 47t47 113zM516 768h1016l-89 357q-2 8 -14 17.5t-21 9.5h-768q-9 0 -21 -9.5t-14 -17.5zM1888 448q0 66 -47 113t-113 47t-113 -47t-47 -113t47 -113t113 -47t113 47t47 113zM2048 544v-384
+q0 -14 -9 -23t-23 -9h-96v-128q0 -80 -56 -136t-136 -56t-136 56t-56 136v128h-1024v-128q0 -80 -56 -136t-136 -56t-136 56t-56 136v128h-96q-14 0 -23 9t-9 23v384q0 93 65.5 158.5t158.5 65.5h28l105 419q23 94 104 157.5t179 63.5h768q98 0 179 -63.5t104 -157.5
+l105 -419h28q93 0 158.5 -65.5t65.5 -158.5z" />
+    <glyph glyph-name="_415" unicode="&#xf1ba;" horiz-adv-x="2048" 
+d="M1824 640q93 0 158.5 -65.5t65.5 -158.5v-384q0 -14 -9 -23t-23 -9h-96v-64q0 -80 -56 -136t-136 -56t-136 56t-56 136v64h-1024v-64q0 -80 -56 -136t-136 -56t-136 56t-56 136v64h-96q-14 0 -23 9t-9 23v384q0 93 65.5 158.5t158.5 65.5h28l105 419q23 94 104 157.5
+t179 63.5h128v224q0 14 9 23t23 9h448q14 0 23 -9t9 -23v-224h128q98 0 179 -63.5t104 -157.5l105 -419h28zM320 160q66 0 113 47t47 113t-47 113t-113 47t-113 -47t-47 -113t47 -113t113 -47zM516 640h1016l-89 357q-2 8 -14 17.5t-21 9.5h-768q-9 0 -21 -9.5t-14 -17.5z
+M1728 160q66 0 113 47t47 113t-47 113t-113 47t-113 -47t-47 -113t47 -113t113 -47z" />
+    <glyph glyph-name="_416" unicode="&#xf1bb;" 
+d="M1504 64q0 -26 -19 -45t-45 -19h-462q1 -17 6 -87.5t5 -108.5q0 -25 -18 -42.5t-43 -17.5h-320q-25 0 -43 17.5t-18 42.5q0 38 5 108.5t6 87.5h-462q-26 0 -45 19t-19 45t19 45l402 403h-229q-26 0 -45 19t-19 45t19 45l402 403h-197q-26 0 -45 19t-19 45t19 45l384 384
+q19 19 45 19t45 -19l384 -384q19 -19 19 -45t-19 -45t-45 -19h-197l402 -403q19 -19 19 -45t-19 -45t-45 -19h-229l402 -403q19 -19 19 -45z" />
+    <glyph glyph-name="_417" unicode="&#xf1bc;" 
+d="M1127 326q0 32 -30 51q-193 115 -447 115q-133 0 -287 -34q-42 -9 -42 -52q0 -20 13.5 -34.5t35.5 -14.5q5 0 37 8q132 27 243 27q226 0 397 -103q19 -11 33 -11q19 0 33 13.5t14 34.5zM1223 541q0 40 -35 61q-237 141 -548 141q-153 0 -303 -42q-48 -13 -48 -64
+q0 -25 17.5 -42.5t42.5 -17.5q7 0 37 8q122 33 251 33q279 0 488 -124q24 -13 38 -13q25 0 42.5 17.5t17.5 42.5zM1331 789q0 47 -40 70q-126 73 -293 110.5t-343 37.5q-204 0 -364 -47q-23 -7 -38.5 -25.5t-15.5 -48.5q0 -31 20.5 -52t51.5 -21q11 0 40 8q133 37 307 37
+q159 0 309.5 -34t253.5 -95q21 -12 40 -12q29 0 50.5 20.5t21.5 51.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="_418" unicode="&#xf1bd;" horiz-adv-x="1024" 
+d="M1024 1233l-303 -582l24 -31h279v-415h-507l-44 -30l-142 -273l-30 -30h-301v303l303 583l-24 30h-279v415h507l44 30l142 273l30 30h301v-303z" />
+    <glyph glyph-name="_419" unicode="&#xf1be;" horiz-adv-x="2304" 
+d="M784 164l16 241l-16 523q-1 10 -7.5 17t-16.5 7q-9 0 -16 -7t-7 -17l-14 -523l14 -241q1 -10 7.5 -16.5t15.5 -6.5q22 0 24 23zM1080 193l11 211l-12 586q0 16 -13 24q-8 5 -16 5t-16 -5q-13 -8 -13 -24l-1 -6l-10 -579q0 -1 11 -236v-1q0 -10 6 -17q9 -11 23 -11
+q11 0 20 9q9 7 9 20zM35 533l20 -128l-20 -126q-2 -9 -9 -9t-9 9l-17 126l17 128q2 9 9 9t9 -9zM121 612l26 -207l-26 -203q-2 -9 -10 -9q-9 0 -9 10l-23 202l23 207q0 9 9 9q8 0 10 -9zM401 159zM213 650l25 -245l-25 -237q0 -11 -11 -11q-10 0 -12 11l-21 237l21 245
+q2 12 12 12q11 0 11 -12zM307 657l23 -252l-23 -244q-2 -13 -14 -13q-13 0 -13 13l-21 244l21 252q0 13 13 13q12 0 14 -13zM401 639l21 -234l-21 -246q-2 -16 -16 -16q-6 0 -10.5 4.5t-4.5 11.5l-20 246l20 234q0 6 4.5 10.5t10.5 4.5q14 0 16 -15zM784 164zM495 785
+l21 -380l-21 -246q0 -7 -5 -12.5t-12 -5.5q-16 0 -18 18l-18 246l18 380q2 18 18 18q7 0 12 -5.5t5 -12.5zM589 871l19 -468l-19 -244q0 -8 -5.5 -13.5t-13.5 -5.5q-18 0 -20 19l-16 244l16 468q2 19 20 19q8 0 13.5 -5.5t5.5 -13.5zM687 911l18 -506l-18 -242
+q-2 -21 -22 -21q-19 0 -21 21l-16 242l16 506q0 9 6.5 15.5t14.5 6.5q9 0 15 -6.5t7 -15.5zM1079 169v0v0v0zM881 915l15 -510l-15 -239q0 -10 -7.5 -17.5t-17.5 -7.5t-17 7t-8 18l-14 239l14 510q0 11 7.5 18t17.5 7t17.5 -7t7.5 -18zM980 896l14 -492l-14 -236
+q0 -11 -8 -19t-19 -8t-19 8t-9 19l-12 236l12 492q1 12 9 20t19 8t18.5 -8t8.5 -20zM1192 404l-14 -231v0q0 -13 -9 -22t-22 -9t-22 9t-10 22l-6 114l-6 117l12 636v3q2 15 12 24q9 7 20 7q8 0 15 -5q14 -8 16 -26zM2304 423q0 -117 -83 -199.5t-200 -82.5h-786
+q-13 2 -22 11t-9 22v899q0 23 28 33q85 34 181 34q195 0 338 -131.5t160 -323.5q53 22 110 22q117 0 200 -83t83 -201z" />
+    <glyph glyph-name="uniF1C0" unicode="&#xf1c0;" 
+d="M768 768q237 0 443 43t325 127v-170q0 -69 -103 -128t-280 -93.5t-385 -34.5t-385 34.5t-280 93.5t-103 128v170q119 -84 325 -127t443 -43zM768 0q237 0 443 43t325 127v-170q0 -69 -103 -128t-280 -93.5t-385 -34.5t-385 34.5t-280 93.5t-103 128v170q119 -84 325 -127
+t443 -43zM768 384q237 0 443 43t325 127v-170q0 -69 -103 -128t-280 -93.5t-385 -34.5t-385 34.5t-280 93.5t-103 128v170q119 -84 325 -127t443 -43zM768 1536q208 0 385 -34.5t280 -93.5t103 -128v-128q0 -69 -103 -128t-280 -93.5t-385 -34.5t-385 34.5t-280 93.5
+t-103 128v128q0 69 103 128t280 93.5t385 34.5z" />
+    <glyph glyph-name="uniF1C1" unicode="&#xf1c1;" 
+d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z
+M894 465q33 -26 84 -56q59 7 117 7q147 0 177 -49q16 -22 2 -52q0 -1 -1 -2l-2 -2v-1q-6 -38 -71 -38q-48 0 -115 20t-130 53q-221 -24 -392 -83q-153 -262 -242 -262q-15 0 -28 7l-24 12q-1 1 -6 5q-10 10 -6 36q9 40 56 91.5t132 96.5q14 9 23 -6q2 -2 2 -4q52 85 107 197
+q68 136 104 262q-24 82 -30.5 159.5t6.5 127.5q11 40 42 40h21h1q23 0 35 -15q18 -21 9 -68q-2 -6 -4 -8q1 -3 1 -8v-30q-2 -123 -14 -192q55 -164 146 -238zM318 54q52 24 137 158q-51 -40 -87.5 -84t-49.5 -74zM716 974q-15 -42 -2 -132q1 7 7 44q0 3 7 43q1 4 4 8
+q-1 1 -1 2q-1 2 -1 3q-1 22 -13 36q0 -1 -1 -2v-2zM592 313q135 54 284 81q-2 1 -13 9.5t-16 13.5q-76 67 -127 176q-27 -86 -83 -197q-30 -56 -45 -83zM1238 329q-24 24 -140 24q76 -28 124 -28q14 0 18 1q0 1 -2 3z" />
+    <glyph glyph-name="_422" unicode="&#xf1c2;" 
+d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z
+M233 768v-107h70l164 -661h159l128 485q7 20 10 46q2 16 2 24h4l3 -24q1 -3 3.5 -20t5.5 -26l128 -485h159l164 661h70v107h-300v-107h90l-99 -438q-5 -20 -7 -46l-2 -21h-4q0 3 -0.5 6.5t-1.5 8t-1 6.5q-1 5 -4 21t-5 25l-144 545h-114l-144 -545q-2 -9 -4.5 -24.5
+t-3.5 -21.5l-4 -21h-4l-2 21q-2 26 -7 46l-99 438h90v107h-300z" />
+    <glyph glyph-name="_423" unicode="&#xf1c3;" 
+d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z
+M429 106v-106h281v106h-75l103 161q5 7 10 16.5t7.5 13.5t3.5 4h2q1 -4 5 -10q2 -4 4.5 -7.5t6 -8t6.5 -8.5l107 -161h-76v-106h291v106h-68l-192 273l195 282h67v107h-279v-107h74l-103 -159q-4 -7 -10 -16.5t-9 -13.5l-2 -3h-2q-1 4 -5 10q-6 11 -17 23l-106 159h76v107
+h-290v-107h68l189 -272l-194 -283h-68z" />
+    <glyph glyph-name="_424" unicode="&#xf1c4;" 
+d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z
+M416 106v-106h327v106h-93v167h137q76 0 118 15q67 23 106.5 87t39.5 146q0 81 -37 141t-100 87q-48 19 -130 19h-368v-107h92v-555h-92zM769 386h-119v268h120q52 0 83 -18q56 -33 56 -115q0 -89 -62 -120q-31 -15 -78 -15z" />
+    <glyph glyph-name="_425" unicode="&#xf1c5;" 
+d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z
+M1280 320v-320h-1024v192l192 192l128 -128l384 384zM448 512q-80 0 -136 56t-56 136t56 136t136 56t136 -56t56 -136t-56 -136t-136 -56z" />
+    <glyph glyph-name="_426" unicode="&#xf1c6;" 
+d="M640 1152v128h-128v-128h128zM768 1024v128h-128v-128h128zM640 896v128h-128v-128h128zM768 768v128h-128v-128h128zM1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400
+v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-128v-128h-128v128h-512v-1536h1280zM781 593l107 -349q8 -27 8 -52q0 -83 -72.5 -137.5t-183.5 -54.5t-183.5 54.5t-72.5 137.5q0 25 8 52q21 63 120 396v128h128v-128h79
+q22 0 39 -13t23 -34zM640 128q53 0 90.5 19t37.5 45t-37.5 45t-90.5 19t-90.5 -19t-37.5 -45t37.5 -45t90.5 -19z" />
+    <glyph glyph-name="_427" unicode="&#xf1c7;" 
+d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z
+M620 686q20 -8 20 -30v-544q0 -22 -20 -30q-8 -2 -12 -2q-12 0 -23 9l-166 167h-131q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h131l166 167q16 15 35 7zM1037 -3q31 0 50 24q129 159 129 363t-129 363q-16 21 -43 24t-47 -14q-21 -17 -23.5 -43.5t14.5 -47.5
+q100 -123 100 -282t-100 -282q-17 -21 -14.5 -47.5t23.5 -42.5q18 -15 40 -15zM826 145q27 0 47 20q87 93 87 219t-87 219q-18 19 -45 20t-46 -17t-20 -44.5t18 -46.5q52 -57 52 -131t-52 -131q-19 -20 -18 -46.5t20 -44.5q20 -17 44 -17z" />
+    <glyph glyph-name="_428" unicode="&#xf1c8;" 
+d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z
+M768 768q52 0 90 -38t38 -90v-384q0 -52 -38 -90t-90 -38h-384q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h384zM1260 766q20 -8 20 -30v-576q0 -22 -20 -30q-8 -2 -12 -2q-14 0 -23 9l-265 266v90l265 266q9 9 23 9q4 0 12 -2z" />
+    <glyph glyph-name="_429" unicode="&#xf1c9;" 
+d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z
+M480 768q8 11 21 12.5t24 -6.5l51 -38q11 -8 12.5 -21t-6.5 -24l-182 -243l182 -243q8 -11 6.5 -24t-12.5 -21l-51 -38q-11 -8 -24 -6.5t-21 12.5l-226 301q-14 19 0 38zM1282 467q14 -19 0 -38l-226 -301q-8 -11 -21 -12.5t-24 6.5l-51 38q-11 8 -12.5 21t6.5 24l182 243
+l-182 243q-8 11 -6.5 24t12.5 21l51 38q11 8 24 6.5t21 -12.5zM662 6q-13 2 -20.5 13t-5.5 24l138 831q2 13 13 20.5t24 5.5l63 -10q13 -2 20.5 -13t5.5 -24l-138 -831q-2 -13 -13 -20.5t-24 -5.5z" />
+    <glyph glyph-name="_430" unicode="&#xf1ca;" 
+d="M1497 709v-198q-101 -23 -198 -23q-65 -136 -165.5 -271t-181.5 -215.5t-128 -106.5q-80 -45 -162 3q-28 17 -60.5 43.5t-85 83.5t-102.5 128.5t-107.5 184t-105.5 244t-91.5 314.5t-70.5 390h283q26 -218 70 -398.5t104.5 -317t121.5 -235.5t140 -195q169 169 287 406
+q-142 72 -223 220t-81 333q0 192 104 314.5t284 122.5q178 0 273 -105.5t95 -297.5q0 -159 -58 -286q-7 -1 -19.5 -3t-46 -2t-63 6t-62 25.5t-50.5 51.5q31 103 31 184q0 87 -29 132t-79 45q-53 0 -85 -49.5t-32 -140.5q0 -186 105 -293.5t267 -107.5q62 0 121 14z" />
+    <glyph glyph-name="_431" unicode="&#xf1cb;" horiz-adv-x="1792" 
+d="M216 367l603 -402v359l-334 223zM154 511l193 129l-193 129v-258zM973 -35l603 402l-269 180l-334 -223v-359zM896 458l272 182l-272 182l-272 -182zM485 733l334 223v359l-603 -402zM1445 640l193 -129v258zM1307 733l269 180l-603 402v-359zM1792 913v-546
+q0 -41 -34 -64l-819 -546q-21 -13 -43 -13t-43 13l-819 546q-34 23 -34 64v546q0 41 34 64l819 546q21 13 43 13t43 -13l819 -546q34 -23 34 -64z" />
+    <glyph glyph-name="_432" unicode="&#xf1cc;" horiz-adv-x="2048" 
+d="M1800 764q111 -46 179.5 -145.5t68.5 -221.5q0 -164 -118 -280.5t-285 -116.5q-4 0 -11.5 0.5t-10.5 0.5h-1209h-1h-2h-5q-170 10 -288 125.5t-118 280.5q0 110 55 203t147 147q-12 39 -12 82q0 115 82 196t199 81q95 0 172 -58q75 154 222.5 248t326.5 94
+q166 0 306 -80.5t221.5 -218.5t81.5 -301q0 -6 -0.5 -18t-0.5 -18zM468 498q0 -122 84 -193t208 -71q137 0 240 99q-16 20 -47.5 56.5t-43.5 50.5q-67 -65 -144 -65q-55 0 -93.5 33.5t-38.5 87.5q0 53 38.5 87t91.5 34q44 0 84.5 -21t73 -55t65 -75t69 -82t77 -75t97 -55
+t121.5 -21q121 0 204.5 71.5t83.5 190.5q0 121 -84 192t-207 71q-143 0 -241 -97l93 -108q66 64 142 64q52 0 92 -33t40 -84q0 -57 -37 -91.5t-94 -34.5q-43 0 -82.5 21t-72 55t-65.5 75t-69.5 82t-77.5 75t-96.5 55t-118.5 21q-122 0 -207 -70.5t-85 -189.5z" />
+    <glyph glyph-name="_433" unicode="&#xf1cd;" horiz-adv-x="1792" 
+d="M896 1536q182 0 348 -71t286 -191t191 -286t71 -348t-71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71zM896 1408q-190 0 -361 -90l194 -194q82 28 167 28t167 -28l194 194q-171 90 -361 90zM218 279l194 194
+q-28 82 -28 167t28 167l-194 194q-90 -171 -90 -361t90 -361zM896 -128q190 0 361 90l-194 194q-82 -28 -167 -28t-167 28l-194 -194q171 -90 361 -90zM896 256q159 0 271.5 112.5t112.5 271.5t-112.5 271.5t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5
+t271.5 -112.5zM1380 473l194 -194q90 171 90 361t-90 361l-194 -194q28 -82 28 -167t-28 -167z" />
+    <glyph glyph-name="_434" unicode="&#xf1ce;" horiz-adv-x="1792" 
+d="M1760 640q0 -176 -68.5 -336t-184 -275.5t-275.5 -184t-336 -68.5t-336 68.5t-275.5 184t-184 275.5t-68.5 336q0 213 97 398.5t265 305.5t374 151v-228q-221 -45 -366.5 -221t-145.5 -406q0 -130 51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5
+t136.5 204t51 248.5q0 230 -145.5 406t-366.5 221v228q206 -31 374 -151t265 -305.5t97 -398.5z" />
+    <glyph glyph-name="uniF1D0" unicode="&#xf1d0;" horiz-adv-x="1792" 
+d="M19 662q8 217 116 406t305 318h5q0 -1 -1 -3q-8 -8 -28 -33.5t-52 -76.5t-60 -110.5t-44.5 -135.5t-14 -150.5t39 -157.5t108.5 -154q50 -50 102 -69.5t90.5 -11.5t69.5 23.5t47 32.5l16 16q39 51 53 116.5t6.5 122.5t-21 107t-26.5 80l-14 29q-10 25 -30.5 49.5t-43 41
+t-43.5 29.5t-35 19l-13 6l104 115q39 -17 78 -52t59 -61l19 -27q1 48 -18.5 103.5t-40.5 87.5l-20 31l161 183l160 -181q-33 -46 -52.5 -102.5t-22.5 -90.5l-4 -33q22 37 61.5 72.5t67.5 52.5l28 17l103 -115q-44 -14 -85 -50t-60 -65l-19 -29q-31 -56 -48 -133.5t-7 -170
+t57 -156.5q33 -45 77.5 -60.5t85 -5.5t76 26.5t57.5 33.5l21 16q60 53 96.5 115t48.5 121.5t10 121.5t-18 118t-37 107.5t-45.5 93t-45 72t-34.5 47.5l-13 17q-14 13 -7 13l10 -3q40 -29 62.5 -46t62 -50t64 -58t58.5 -65t55.5 -77t45.5 -88t38 -103t23.5 -117t10.5 -136
+q3 -259 -108 -465t-312 -321t-456 -115q-185 0 -351 74t-283.5 198t-184 293t-60.5 353z" />
+    <glyph glyph-name="uniF1D1" unicode="&#xf1d1;" horiz-adv-x="1792" 
+d="M874 -102v-66q-208 6 -385 109.5t-283 275.5l58 34q29 -49 73 -99l65 57q148 -168 368 -212l-17 -86q65 -12 121 -13zM276 428l-83 -28q22 -60 49 -112l-57 -33q-98 180 -98 385t98 385l57 -33q-30 -56 -49 -112l82 -28q-35 -100 -35 -212q0 -109 36 -212zM1528 251
+l58 -34q-106 -172 -283 -275.5t-385 -109.5v66q56 1 121 13l-17 86q220 44 368 212l65 -57q44 50 73 99zM1377 805l-233 -80q14 -42 14 -85t-14 -85l232 -80q-31 -92 -98 -169l-185 162q-57 -67 -147 -85l48 -241q-52 -10 -98 -10t-98 10l48 241q-90 18 -147 85l-185 -162
+q-67 77 -98 169l232 80q-14 42 -14 85t14 85l-233 80q33 93 99 169l185 -162q59 68 147 86l-48 240q44 10 98 10t98 -10l-48 -240q88 -18 147 -86l185 162q66 -76 99 -169zM874 1448v-66q-65 -2 -121 -13l17 -86q-220 -42 -368 -211l-65 56q-38 -42 -73 -98l-57 33
+q106 172 282 275.5t385 109.5zM1705 640q0 -205 -98 -385l-57 33q27 52 49 112l-83 28q36 103 36 212q0 112 -35 212l82 28q-19 56 -49 112l57 33q98 -180 98 -385zM1585 1063l-57 -33q-35 56 -73 98l-65 -56q-148 169 -368 211l17 86q-56 11 -121 13v66q209 -6 385 -109.5
+t282 -275.5zM1748 640q0 173 -67.5 331t-181.5 272t-272 181.5t-331 67.5t-331 -67.5t-272 -181.5t-181.5 -272t-67.5 -331t67.5 -331t181.5 -272t272 -181.5t331 -67.5t331 67.5t272 181.5t181.5 272t67.5 331zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71
+t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" />
+    <glyph glyph-name="uniF1D2" unicode="&#xf1d2;" 
+d="M582 228q0 -66 -93 -66q-107 0 -107 63q0 64 98 64q102 0 102 -61zM546 694q0 -85 -74 -85q-77 0 -77 84q0 90 77 90q36 0 55 -25.5t19 -63.5zM712 769v125q-78 -29 -135 -29q-50 29 -110 29q-86 0 -145 -57t-59 -143q0 -50 29.5 -102t73.5 -67v-3q-38 -17 -38 -85
+q0 -53 41 -77v-3q-113 -37 -113 -139q0 -45 20 -78.5t54 -51t72 -25.5t81 -8q224 0 224 188q0 67 -48 99t-126 46q-27 5 -51.5 20.5t-24.5 39.5q0 44 49 52q77 15 122 70t45 134q0 24 -10 52q37 9 49 13zM771 350h137q-2 27 -2 82v387q0 46 2 69h-137q3 -23 3 -71v-392
+q0 -50 -3 -75zM1280 366v121q-30 -21 -68 -21q-53 0 -53 82v225h52q9 0 26.5 -1t26.5 -1v117h-105q0 82 3 102h-140q4 -24 4 -55v-47h-60v-117q36 3 37 3q3 0 11 -0.5t12 -0.5v-2h-2v-217q0 -37 2.5 -64t11.5 -56.5t24.5 -48.5t43.5 -31t66 -12q64 0 108 24zM924 1072
+q0 36 -24 63.5t-60 27.5t-60.5 -27t-24.5 -64q0 -36 25 -62.5t60 -26.5t59.5 27t24.5 62zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="_438" unicode="&#xf1d3;" horiz-adv-x="1792" 
+d="M595 22q0 100 -165 100q-158 0 -158 -104q0 -101 172 -101q151 0 151 105zM536 777q0 61 -30 102t-89 41q-124 0 -124 -145q0 -135 124 -135q119 0 119 137zM805 1101v-202q-36 -12 -79 -22q16 -43 16 -84q0 -127 -73 -216.5t-197 -112.5q-40 -8 -59.5 -27t-19.5 -58
+q0 -31 22.5 -51.5t58 -32t78.5 -22t86 -25.5t78.5 -37.5t58 -64t22.5 -98.5q0 -304 -363 -304q-69 0 -130 12.5t-116 41t-87.5 82t-32.5 127.5q0 165 182 225v4q-67 41 -67 126q0 109 63 137v4q-72 24 -119.5 108.5t-47.5 165.5q0 139 95 231.5t235 92.5q96 0 178 -47
+q98 0 218 47zM1123 220h-222q4 45 4 134v609q0 94 -4 128h222q-4 -33 -4 -124v-613q0 -89 4 -134zM1724 442v-196q-71 -39 -174 -39q-62 0 -107 20t-70 50t-39.5 78t-18.5 92t-4 103v351h2v4q-7 0 -19 1t-18 1q-21 0 -59 -6v190h96v76q0 54 -6 89h227q-6 -41 -6 -165h171
+v-190q-15 0 -43.5 2t-42.5 2h-85v-365q0 -131 87 -131q61 0 109 33zM1148 1389q0 -58 -39 -101.5t-96 -43.5q-58 0 -98 43.5t-40 101.5q0 59 39.5 103t98.5 44q58 0 96.5 -44.5t38.5 -102.5z" />
+    <glyph glyph-name="_439" unicode="&#xf1d4;" 
+d="M809 532l266 499h-112l-157 -312q-24 -48 -44 -92l-42 92l-155 312h-120l263 -493v-324h101v318zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="uniF1D5" unicode="&#xf1d5;" horiz-adv-x="1280" 
+d="M842 964q0 -80 -57 -136.5t-136 -56.5q-60 0 -111 35q-62 -67 -115 -146q-247 -371 -202 -859q1 -22 -12.5 -38.5t-34.5 -18.5h-5q-20 0 -35 13.5t-17 33.5q-14 126 -3.5 247.5t29.5 217t54 186t69 155.5t74 125q61 90 132 165q-16 35 -16 77q0 80 56.5 136.5t136.5 56.5
+t136.5 -56.5t56.5 -136.5zM1223 953q0 -158 -78 -292t-212.5 -212t-292.5 -78q-64 0 -131 14q-21 5 -32.5 23.5t-6.5 39.5q5 20 23 31.5t39 7.5q51 -13 108 -13q97 0 186 38t153 102t102 153t38 186t-38 186t-102 153t-153 102t-186 38t-186 -38t-153 -102t-102 -153
+t-38 -186q0 -114 52 -218q10 -20 3.5 -40t-25.5 -30t-39.5 -3t-30.5 26q-64 123 -64 265q0 119 46.5 227t124.5 186t186 124t226 46q158 0 292.5 -78t212.5 -212.5t78 -292.5z" />
+    <glyph glyph-name="uniF1D6" unicode="&#xf1d6;" horiz-adv-x="1792" 
+d="M270 730q-8 19 -8 52q0 20 11 49t24 45q-1 22 7.5 53t22.5 43q0 139 92.5 288.5t217.5 209.5q139 66 324 66q133 0 266 -55q49 -21 90 -48t71 -56t55 -68t42 -74t32.5 -84.5t25.5 -89.5t22 -98l1 -5q55 -83 55 -150q0 -14 -9 -40t-9 -38q0 -1 1.5 -3.5t3.5 -5t2 -3.5
+q77 -114 120.5 -214.5t43.5 -208.5q0 -43 -19.5 -100t-55.5 -57q-9 0 -19.5 7.5t-19 17.5t-19 26t-16 26.5t-13.5 26t-9 17.5q-1 1 -3 1l-5 -4q-59 -154 -132 -223q20 -20 61.5 -38.5t69 -41.5t35.5 -65q-2 -4 -4 -16t-7 -18q-64 -97 -302 -97q-53 0 -110.5 9t-98 20
+t-104.5 30q-15 5 -23 7q-14 4 -46 4.5t-40 1.5q-41 -45 -127.5 -65t-168.5 -20q-35 0 -69 1.5t-93 9t-101 20.5t-74.5 40t-32.5 64q0 40 10 59.5t41 48.5q11 2 40.5 13t49.5 12q4 0 14 2q2 2 2 4l-2 3q-48 11 -108 105.5t-73 156.5l-5 3q-4 0 -12 -20q-18 -41 -54.5 -74.5
+t-77.5 -37.5h-1q-4 0 -6 4.5t-5 5.5q-23 54 -23 100q0 275 252 466z" />
+    <glyph glyph-name="uniF1D7" unicode="&#xf1d7;" horiz-adv-x="2048" 
+d="M580 1075q0 41 -25 66t-66 25q-43 0 -76 -25.5t-33 -65.5q0 -39 33 -64.5t76 -25.5q41 0 66 24.5t25 65.5zM1323 568q0 28 -25.5 50t-65.5 22q-27 0 -49.5 -22.5t-22.5 -49.5q0 -28 22.5 -50.5t49.5 -22.5q40 0 65.5 22t25.5 51zM1087 1075q0 41 -24.5 66t-65.5 25
+q-43 0 -76 -25.5t-33 -65.5q0 -39 33 -64.5t76 -25.5q41 0 65.5 24.5t24.5 65.5zM1722 568q0 28 -26 50t-65 22q-27 0 -49.5 -22.5t-22.5 -49.5q0 -28 22.5 -50.5t49.5 -22.5q39 0 65 22t26 51zM1456 965q-31 4 -70 4q-169 0 -311 -77t-223.5 -208.5t-81.5 -287.5
+q0 -78 23 -152q-35 -3 -68 -3q-26 0 -50 1.5t-55 6.5t-44.5 7t-54.5 10.5t-50 10.5l-253 -127l72 218q-290 203 -290 490q0 169 97.5 311t264 223.5t363.5 81.5q176 0 332.5 -66t262 -182.5t136.5 -260.5zM2048 404q0 -117 -68.5 -223.5t-185.5 -193.5l55 -181l-199 109
+q-150 -37 -218 -37q-169 0 -311 70.5t-223.5 191.5t-81.5 264t81.5 264t223.5 191.5t311 70.5q161 0 303 -70.5t227.5 -192t85.5 -263.5z" />
+    <glyph glyph-name="_443" unicode="&#xf1d8;" horiz-adv-x="1792" 
+d="M1764 1525q33 -24 27 -64l-256 -1536q-5 -29 -32 -45q-14 -8 -31 -8q-11 0 -24 5l-453 185l-242 -295q-18 -23 -49 -23q-13 0 -22 4q-19 7 -30.5 23.5t-11.5 36.5v349l864 1059l-1069 -925l-395 162q-37 14 -40 55q-2 40 32 59l1664 960q15 9 32 9q20 0 36 -11z" />
+    <glyph glyph-name="_444" unicode="&#xf1d9;" horiz-adv-x="1792" 
+d="M1764 1525q33 -24 27 -64l-256 -1536q-5 -29 -32 -45q-14 -8 -31 -8q-11 0 -24 5l-527 215l-298 -327q-18 -21 -47 -21q-14 0 -23 4q-19 7 -30 23.5t-11 36.5v452l-472 193q-37 14 -40 55q-3 39 32 59l1664 960q35 21 68 -2zM1422 26l221 1323l-1434 -827l336 -137
+l863 639l-478 -797z" />
+    <glyph glyph-name="_445" unicode="&#xf1da;" 
+d="M1536 640q0 -156 -61 -298t-164 -245t-245 -164t-298 -61q-172 0 -327 72.5t-264 204.5q-7 10 -6.5 22.5t8.5 20.5l137 138q10 9 25 9q16 -2 23 -12q73 -95 179 -147t225 -52q104 0 198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5t-40.5 198.5t-109.5 163.5
+t-163.5 109.5t-198.5 40.5q-98 0 -188 -35.5t-160 -101.5l137 -138q31 -30 14 -69q-17 -40 -59 -40h-448q-26 0 -45 19t-19 45v448q0 42 40 59q39 17 69 -14l130 -129q107 101 244.5 156.5t284.5 55.5q156 0 298 -61t245 -164t164 -245t61 -298zM896 928v-448q0 -14 -9 -23
+t-23 -9h-320q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h224v352q0 14 9 23t23 9h64q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="_446" unicode="&#xf1db;" 
+d="M768 1280q-130 0 -248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5t-51 248.5t-136.5 204t-204 136.5t-248.5 51zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103
+t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="_447" unicode="&#xf1dc;" horiz-adv-x="1792" 
+d="M1682 -128q-44 0 -132.5 3.5t-133.5 3.5q-44 0 -132 -3.5t-132 -3.5q-24 0 -37 20.5t-13 45.5q0 31 17 46t39 17t51 7t45 15q33 21 33 140l-1 391q0 21 -1 31q-13 4 -50 4h-675q-38 0 -51 -4q-1 -10 -1 -31l-1 -371q0 -142 37 -164q16 -10 48 -13t57 -3.5t45 -15
+t20 -45.5q0 -26 -12.5 -48t-36.5 -22q-47 0 -139.5 3.5t-138.5 3.5q-43 0 -128 -3.5t-127 -3.5q-23 0 -35.5 21t-12.5 45q0 30 15.5 45t36 17.5t47.5 7.5t42 15q33 23 33 143l-1 57v813q0 3 0.5 26t0 36.5t-1.5 38.5t-3.5 42t-6.5 36.5t-11 31.5t-16 18q-15 10 -45 12t-53 2
+t-41 14t-18 45q0 26 12 48t36 22q46 0 138.5 -3.5t138.5 -3.5q42 0 126.5 3.5t126.5 3.5q25 0 37.5 -22t12.5 -48q0 -30 -17 -43.5t-38.5 -14.5t-49.5 -4t-43 -13q-35 -21 -35 -160l1 -320q0 -21 1 -32q13 -3 39 -3h699q25 0 38 3q1 11 1 32l1 320q0 139 -35 160
+q-18 11 -58.5 12.5t-66 13t-25.5 49.5q0 26 12.5 48t37.5 22q44 0 132 -3.5t132 -3.5q43 0 129 3.5t129 3.5q25 0 37.5 -22t12.5 -48q0 -30 -17.5 -44t-40 -14.5t-51.5 -3t-44 -12.5q-35 -23 -35 -161l1 -943q0 -119 34 -140q16 -10 46 -13.5t53.5 -4.5t41.5 -15.5t18 -44.5
+q0 -26 -12 -48t-36 -22z" />
+    <glyph glyph-name="_448" unicode="&#xf1dd;" horiz-adv-x="1280" 
+d="M1278 1347v-73q0 -29 -18.5 -61t-42.5 -32q-50 0 -54 -1q-26 -6 -32 -31q-3 -11 -3 -64v-1152q0 -25 -18 -43t-43 -18h-108q-25 0 -43 18t-18 43v1218h-143v-1218q0 -25 -17.5 -43t-43.5 -18h-108q-26 0 -43.5 18t-17.5 43v496q-147 12 -245 59q-126 58 -192 179
+q-64 117 -64 259q0 166 88 286q88 118 209 159q111 37 417 37h479q25 0 43 -18t18 -43z" />
+    <glyph glyph-name="_449" unicode="&#xf1de;" 
+d="M352 128v-128h-352v128h352zM704 256q26 0 45 -19t19 -45v-256q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h256zM864 640v-128h-864v128h864zM224 1152v-128h-224v128h224zM1536 128v-128h-736v128h736zM576 1280q26 0 45 -19t19 -45v-256
+q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h256zM1216 768q26 0 45 -19t19 -45v-256q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h256zM1536 640v-128h-224v128h224zM1536 1152v-128h-864v128h864z" />
+    <glyph glyph-name="uniF1E0" unicode="&#xf1e0;" 
+d="M1216 512q133 0 226.5 -93.5t93.5 -226.5t-93.5 -226.5t-226.5 -93.5t-226.5 93.5t-93.5 226.5q0 12 2 34l-360 180q-92 -86 -218 -86q-133 0 -226.5 93.5t-93.5 226.5t93.5 226.5t226.5 93.5q126 0 218 -86l360 180q-2 22 -2 34q0 133 93.5 226.5t226.5 93.5
+t226.5 -93.5t93.5 -226.5t-93.5 -226.5t-226.5 -93.5q-126 0 -218 86l-360 -180q2 -22 2 -34t-2 -34l360 -180q92 86 218 86z" />
+    <glyph glyph-name="_451" unicode="&#xf1e1;" 
+d="M1280 341q0 88 -62.5 151t-150.5 63q-84 0 -145 -58l-241 120q2 16 2 23t-2 23l241 120q61 -58 145 -58q88 0 150.5 63t62.5 151t-62.5 150.5t-150.5 62.5t-151 -62.5t-63 -150.5q0 -7 2 -23l-241 -120q-62 57 -145 57q-88 0 -150.5 -62.5t-62.5 -150.5t62.5 -150.5
+t150.5 -62.5q83 0 145 57l241 -120q-2 -16 -2 -23q0 -88 63 -150.5t151 -62.5t150.5 62.5t62.5 150.5zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="_452" unicode="&#xf1e2;" horiz-adv-x="1792" 
+d="M571 947q-10 25 -34 35t-49 0q-108 -44 -191 -127t-127 -191q-10 -25 0 -49t35 -34q13 -5 24 -5q42 0 60 40q34 84 98.5 148.5t148.5 98.5q25 11 35 35t0 49zM1513 1303l46 -46l-244 -243l68 -68q19 -19 19 -45.5t-19 -45.5l-64 -64q89 -161 89 -343q0 -143 -55.5 -273.5
+t-150 -225t-225 -150t-273.5 -55.5t-273.5 55.5t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5q182 0 343 -89l64 64q19 19 45.5 19t45.5 -19l68 -68zM1521 1359q-10 -10 -22 -10q-13 0 -23 10l-91 90q-9 10 -9 23t9 23q10 9 23 9t23 -9l90 -91
+q10 -9 10 -22.5t-10 -22.5zM1751 1129q-11 -9 -23 -9t-23 9l-90 91q-10 9 -10 22.5t10 22.5q9 10 22.5 10t22.5 -10l91 -90q9 -10 9 -23t-9 -23zM1792 1312q0 -14 -9 -23t-23 -9h-96q-14 0 -23 9t-9 23t9 23t23 9h96q14 0 23 -9t9 -23zM1600 1504v-96q0 -14 -9 -23t-23 -9
+t-23 9t-9 23v96q0 14 9 23t23 9t23 -9t9 -23zM1751 1449l-91 -90q-10 -10 -22 -10q-13 0 -23 10q-10 9 -10 22.5t10 22.5l90 91q10 9 23 9t23 -9q9 -10 9 -23t-9 -23z" />
+    <glyph glyph-name="_453" unicode="&#xf1e3;" horiz-adv-x="1792" 
+d="M609 720l287 208l287 -208l-109 -336h-355zM896 1536q182 0 348 -71t286 -191t191 -286t71 -348t-71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71zM1515 186q149 203 149 454v3l-102 -89l-240 224l63 323
+l134 -12q-150 206 -389 282l53 -124l-287 -159l-287 159l53 124q-239 -76 -389 -282l135 12l62 -323l-240 -224l-102 89v-3q0 -251 149 -454l30 132l326 -40l139 -298l-116 -69q117 -39 240 -39t240 39l-116 69l139 298l326 40z" />
+    <glyph glyph-name="_454" unicode="&#xf1e4;" horiz-adv-x="1792" 
+d="M448 224v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM256 608v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM832 224v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23
+v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM640 608v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM66 768q-28 0 -47 19t-19 46v129h514v-129q0 -27 -19 -46t-46 -19h-383zM1216 224v-192q0 -14 -9 -23t-23 -9h-192
+q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1024 608v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1600 224v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23
+zM1408 608v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1792 1016v-13h-514v10q0 104 -382 102q-382 -1 -382 -102v-10h-514v13q0 17 8.5 43t34 64t65.5 75.5t110.5 76t160 67.5t224 47.5t293.5 18.5t293 -18.5t224 -47.5
+t160.5 -67.5t110.5 -76t65.5 -75.5t34 -64t8.5 -43zM1792 608v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1792 962v-129q0 -27 -19 -46t-46 -19h-384q-27 0 -46 19t-19 46v129h514z" />
+    <glyph glyph-name="_455" unicode="&#xf1e5;" horiz-adv-x="1792" 
+d="M704 1216v-768q0 -26 -19 -45t-45 -19v-576q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v512l249 873q7 23 31 23h424zM1024 1216v-704h-256v704h256zM1792 320v-512q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v576q-26 0 -45 19t-19 45v768h424q24 0 31 -23z
+M736 1504v-224h-352v224q0 14 9 23t23 9h288q14 0 23 -9t9 -23zM1408 1504v-224h-352v224q0 14 9 23t23 9h288q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="_456" unicode="&#xf1e6;" horiz-adv-x="1792" 
+d="M1755 1083q37 -38 37 -90.5t-37 -90.5l-401 -400l150 -150l-160 -160q-163 -163 -389.5 -186.5t-411.5 100.5l-362 -362h-181v181l362 362q-124 185 -100.5 411.5t186.5 389.5l160 160l150 -150l400 401q38 37 91 37t90 -37t37 -90.5t-37 -90.5l-400 -401l234 -234
+l401 400q38 37 91 37t90 -37z" />
+    <glyph glyph-name="_457" unicode="&#xf1e7;" horiz-adv-x="1792" 
+d="M873 796q0 -83 -63.5 -142.5t-152.5 -59.5t-152.5 59.5t-63.5 142.5q0 84 63.5 143t152.5 59t152.5 -59t63.5 -143zM1375 796q0 -83 -63 -142.5t-153 -59.5q-89 0 -152.5 59.5t-63.5 142.5q0 84 63.5 143t152.5 59q90 0 153 -59t63 -143zM1600 616v667q0 87 -32 123.5
+t-111 36.5h-1112q-83 0 -112.5 -34t-29.5 -126v-673q43 -23 88.5 -40t81 -28t81 -18.5t71 -11t70 -4t58.5 -0.5t56.5 2t44.5 2q68 1 95 -27q6 -6 10 -9q26 -25 61 -51q7 91 118 87q5 0 36.5 -1.5t43 -2t45.5 -1t53 1t54.5 4.5t61 8.5t62 13.5t67 19.5t67.5 27t72 34.5z
+M1763 621q-121 -149 -372 -252q84 -285 -23 -465q-66 -113 -183 -148q-104 -32 -182 15q-86 51 -82 164l-1 326v1q-8 2 -24.5 6t-23.5 5l-1 -338q4 -114 -83 -164q-79 -47 -183 -15q-117 36 -182 150q-105 180 -22 463q-251 103 -372 252q-25 37 -4 63t60 -1q4 -2 11.5 -7
+t10.5 -8v694q0 72 47 123t114 51h1257q67 0 114 -51t47 -123v-694l21 15q39 27 60 1t-4 -63z" />
+    <glyph glyph-name="_458" unicode="&#xf1e8;" horiz-adv-x="1792" 
+d="M896 1102v-434h-145v434h145zM1294 1102v-434h-145v434h145zM1294 342l253 254v795h-1194v-1049h326v-217l217 217h398zM1692 1536v-1013l-434 -434h-326l-217 -217h-217v217h-398v1158l109 289h1483z" />
+    <glyph glyph-name="_459" unicode="&#xf1e9;" 
+d="M773 217v-127q-1 -292 -6 -305q-12 -32 -51 -40q-54 -9 -181.5 38t-162.5 89q-13 15 -17 36q-1 12 4 26q4 10 34 47t181 216q1 0 60 70q15 19 39.5 24.5t49.5 -3.5q24 -10 37.5 -29t12.5 -42zM624 468q-3 -55 -52 -70l-120 -39q-275 -88 -292 -88q-35 2 -54 36
+q-12 25 -17 75q-8 76 1 166.5t30 124.5t56 32q13 0 202 -77q71 -29 115 -47l84 -34q23 -9 35.5 -30.5t11.5 -48.5zM1450 171q-7 -54 -91.5 -161t-135.5 -127q-37 -14 -63 7q-14 10 -184 287l-47 77q-14 21 -11.5 46t19.5 46q35 43 83 26q1 -1 119 -40q203 -66 242 -79.5
+t47 -20.5q28 -22 22 -61zM778 803q5 -102 -54 -122q-58 -17 -114 71l-378 598q-8 35 19 62q41 43 207.5 89.5t224.5 31.5q40 -10 49 -45q3 -18 22 -305.5t24 -379.5zM1440 695q3 -39 -26 -59q-15 -10 -329 -86q-67 -15 -91 -23l1 2q-23 -6 -46 4t-37 32q-30 47 0 87
+q1 1 75 102q125 171 150 204t34 39q28 19 65 2q48 -23 123 -133.5t81 -167.5v-3z" />
+    <glyph glyph-name="_460" unicode="&#xf1ea;" horiz-adv-x="2048" 
+d="M1024 1024h-384v-384h384v384zM1152 384v-128h-640v128h640zM1152 1152v-640h-640v640h640zM1792 384v-128h-512v128h512zM1792 640v-128h-512v128h512zM1792 896v-128h-512v128h512zM1792 1152v-128h-512v128h512zM256 192v960h-128v-960q0 -26 19 -45t45 -19t45 19
+t19 45zM1920 192v1088h-1536v-1088q0 -33 -11 -64h1483q26 0 45 19t19 45zM2048 1408v-1216q0 -80 -56 -136t-136 -56h-1664q-80 0 -136 56t-56 136v1088h256v128h1792z" />
+    <glyph glyph-name="_461" unicode="&#xf1eb;" horiz-adv-x="2048" 
+d="M1024 13q-20 0 -93 73.5t-73 93.5q0 32 62.5 54t103.5 22t103.5 -22t62.5 -54q0 -20 -73 -93.5t-93 -73.5zM1294 284q-2 0 -40 25t-101.5 50t-128.5 25t-128.5 -25t-101 -50t-40.5 -25q-18 0 -93.5 75t-75.5 93q0 13 10 23q78 77 196 121t233 44t233 -44t196 -121
+q10 -10 10 -23q0 -18 -75.5 -93t-93.5 -75zM1567 556q-11 0 -23 8q-136 105 -252 154.5t-268 49.5q-85 0 -170.5 -22t-149 -53t-113.5 -62t-79 -53t-31 -22q-17 0 -92 75t-75 93q0 12 10 22q132 132 320 205t380 73t380 -73t320 -205q10 -10 10 -22q0 -18 -75 -93t-92 -75z
+M1838 827q-11 0 -22 9q-179 157 -371.5 236.5t-420.5 79.5t-420.5 -79.5t-371.5 -236.5q-11 -9 -22 -9q-17 0 -92.5 75t-75.5 93q0 13 10 23q187 186 445 288t527 102t527 -102t445 -288q10 -10 10 -23q0 -18 -75.5 -93t-92.5 -75z" />
+    <glyph glyph-name="_462" unicode="&#xf1ec;" horiz-adv-x="1792" 
+d="M384 0q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM768 0q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM384 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5
+t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1152 0q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM768 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5
+t37.5 90.5zM384 768q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1152 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM768 768q0 53 -37.5 90.5t-90.5 37.5
+t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1536 0v384q0 52 -38 90t-90 38t-90 -38t-38 -90v-384q0 -52 38 -90t90 -38t90 38t38 90zM1152 768q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5z
+M1536 1088v256q0 26 -19 45t-45 19h-1280q-26 0 -45 -19t-19 -45v-256q0 -26 19 -45t45 -19h1280q26 0 45 19t19 45zM1536 768q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1664 1408v-1536q0 -52 -38 -90t-90 -38
+h-1408q-52 0 -90 38t-38 90v1536q0 52 38 90t90 38h1408q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="_463" unicode="&#xf1ed;" 
+d="M1519 890q18 -84 -4 -204q-87 -444 -565 -444h-44q-25 0 -44 -16.5t-24 -42.5l-4 -19l-55 -346l-2 -15q-5 -26 -24.5 -42.5t-44.5 -16.5h-251q-21 0 -33 15t-9 36q9 56 26.5 168t26.5 168t27 167.5t27 167.5q5 37 43 37h131q133 -2 236 21q175 39 287 144q102 95 155 246
+q24 70 35 133q1 6 2.5 7.5t3.5 1t6 -3.5q79 -59 98 -162zM1347 1172q0 -107 -46 -236q-80 -233 -302 -315q-113 -40 -252 -42q0 -1 -90 -1l-90 1q-100 0 -118 -96q-2 -8 -85 -530q-1 -10 -12 -10h-295q-22 0 -36.5 16.5t-11.5 38.5l232 1471q5 29 27.5 48t51.5 19h598
+q34 0 97.5 -13t111.5 -32q107 -41 163.5 -123t56.5 -196z" />
+    <glyph glyph-name="_464" unicode="&#xf1ee;" horiz-adv-x="1792" 
+d="M441 864q33 0 52 -26q266 -364 362 -774h-446q-127 441 -367 749q-12 16 -3 33.5t29 17.5h373zM1000 507q-49 -199 -125 -393q-79 310 -256 594q40 221 44 449q211 -340 337 -650zM1099 1216q235 -324 384.5 -698.5t184.5 -773.5h-451q-41 665 -553 1472h435zM1792 640
+q0 -424 -101 -812q-67 560 -359 1083q-25 301 -106 584q-4 16 5.5 28.5t25.5 12.5h359q21 0 38.5 -13t22.5 -33q115 -409 115 -850z" />
+    <glyph glyph-name="uniF1F0" unicode="&#xf1f0;" horiz-adv-x="2304" 
+d="M1975 546h-138q14 37 66 179l3 9q4 10 10 26t9 26l12 -55zM531 611l-58 295q-11 54 -75 54h-268l-2 -13q311 -79 403 -336zM710 960l-162 -438l-17 89q-26 70 -85 129.5t-131 88.5l135 -510h175l261 641h-176zM849 318h166l104 642h-166zM1617 944q-69 27 -149 27
+q-123 0 -201 -59t-79 -153q-1 -102 145 -174q48 -23 67 -41t19 -39q0 -30 -30 -46t-69 -16q-86 0 -156 33l-22 11l-23 -144q74 -34 185 -34q130 -1 208.5 59t80.5 160q0 106 -140 174q-49 25 -71 42t-22 38q0 22 24.5 38.5t70.5 16.5q70 1 124 -24l15 -8zM2042 960h-128
+q-65 0 -87 -54l-246 -588h174l35 96h212q5 -22 20 -96h154zM2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h2048q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="_466" unicode="&#xf1f1;" horiz-adv-x="2304" 
+d="M1119 1195q-128 85 -281 85q-103 0 -197.5 -40.5t-162.5 -108.5t-108.5 -162t-40.5 -197q0 -104 40.5 -198t108.5 -162t162 -108.5t198 -40.5q153 0 281 85q-131 107 -178 265.5t0.5 316.5t177.5 265zM1152 1171q-126 -99 -172 -249.5t-0.5 -300.5t172.5 -249
+q127 99 172.5 249t-0.5 300.5t-172 249.5zM1185 1195q130 -107 177.5 -265.5t0.5 -317t-178 -264.5q128 -85 281 -85q104 0 198 40.5t162 108.5t108.5 162t40.5 198q0 103 -40.5 197t-108.5 162t-162.5 108.5t-197.5 40.5q-153 0 -281 -85zM1926 473h7v3h-17v-3h7v-17h3v17z
+M1955 456h4v20h-5l-6 -13l-6 13h-5v-20h3v15l6 -13h4l5 13v-15zM1947 16v-2h-2h-3v3h3h2v-1zM1947 7h3l-4 5h2l1 1q1 1 1 3t-1 3l-1 1h-3h-6v-13h3v5h1zM685 75q0 19 11 31t30 12q18 0 29 -12.5t11 -30.5q0 -19 -11 -31t-29 -12q-19 0 -30 12t-11 31zM1158 119q30 0 35 -32
+h-70q5 32 35 32zM1514 75q0 19 11 31t29 12t29.5 -12.5t11.5 -30.5q0 -19 -11 -31t-30 -12q-18 0 -29 12t-11 31zM1786 75q0 18 11.5 30.5t29.5 12.5t29.5 -12.5t11.5 -30.5q0 -19 -11.5 -31t-29.5 -12t-29.5 12.5t-11.5 30.5zM1944 3q-2 0 -4 1q-1 0 -3 2t-2 3q-1 2 -1 4
+q0 3 1 4q0 2 2 4l1 1q2 0 2 1q2 1 4 1q3 0 4 -1l4 -2l2 -4v-1q1 -2 1 -3l-1 -1v-3t-1 -1l-1 -2q-2 -2 -4 -2q-1 -1 -4 -1zM599 7h30v85q0 24 -14.5 38.5t-39.5 15.5q-32 0 -47 -24q-14 24 -45 24q-24 0 -39 -20v16h-30v-135h30v75q0 36 33 36q30 0 30 -36v-75h29v75
+q0 36 33 36q30 0 30 -36v-75zM765 7h29v68v67h-29v-16q-17 20 -43 20q-29 0 -48 -20t-19 -51t19 -51t48 -20q28 0 43 20v-17zM943 48q0 34 -47 40l-14 2q-23 4 -23 14q0 15 25 15q23 0 43 -11l12 24q-22 14 -55 14q-26 0 -41 -12t-15 -32q0 -33 47 -39l13 -2q24 -4 24 -14
+q0 -17 -31 -17q-25 0 -45 14l-13 -23q25 -17 58 -17q29 0 45.5 12t16.5 32zM1073 14l-8 25q-13 -7 -26 -7q-19 0 -19 22v61h48v27h-48v41h-30v-41h-28v-27h28v-61q0 -50 47 -50q21 0 36 10zM1159 146q-29 0 -48 -20t-19 -51q0 -32 19.5 -51.5t49.5 -19.5q33 0 55 19l-14 22
+q-18 -15 -39 -15q-34 0 -41 33h101v12q0 32 -18 51.5t-46 19.5zM1318 146q-23 0 -35 -20v16h-30v-135h30v76q0 35 29 35q10 0 18 -4l9 28q-9 4 -21 4zM1348 75q0 -31 19.5 -51t52.5 -20q29 0 48 16l-14 24q-18 -13 -35 -12q-18 0 -29.5 12t-11.5 31t11.5 31t29.5 12
+q19 0 35 -12l14 24q-20 16 -48 16q-33 0 -52.5 -20t-19.5 -51zM1593 7h30v68v67h-30v-16q-15 20 -42 20q-29 0 -48.5 -20t-19.5 -51t19.5 -51t48.5 -20q28 0 42 20v-17zM1726 146q-23 0 -35 -20v16h-29v-135h29v76q0 35 29 35q10 0 18 -4l9 28q-8 4 -21 4zM1866 7h29v68v122
+h-29v-71q-15 20 -43 20t-47.5 -20.5t-19.5 -50.5t19.5 -50.5t47.5 -20.5q29 0 43 20v-17zM1944 27l-2 -1h-3q-2 -1 -4 -3q-3 -1 -3 -4q-1 -2 -1 -6q0 -3 1 -5q0 -2 3 -4q2 -2 4 -3t5 -1q4 0 6 1q0 1 2 2l2 1q1 1 3 4q1 2 1 5q0 4 -1 6q-1 1 -3 4q0 1 -2 2l-2 1q-1 0 -3 0.5
+t-3 0.5zM2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h2048q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="_467" unicode="&#xf1f2;" horiz-adv-x="2304" 
+d="M313 759q0 -51 -36 -84q-29 -26 -89 -26h-17v220h17q61 0 89 -27q36 -31 36 -83zM2089 824q0 -52 -64 -52h-19v101h20q63 0 63 -49zM380 759q0 74 -50 120.5t-129 46.5h-95v-333h95q74 0 119 38q60 51 60 128zM410 593h65v333h-65v-333zM730 694q0 40 -20.5 62t-75.5 42
+q-29 10 -39.5 19t-10.5 23q0 16 13.5 26.5t34.5 10.5q29 0 53 -27l34 44q-41 37 -98 37q-44 0 -74 -27.5t-30 -67.5q0 -35 18 -55.5t64 -36.5q37 -13 45 -19q19 -12 19 -34q0 -20 -14 -33.5t-36 -13.5q-48 0 -71 44l-42 -40q44 -64 115 -64q51 0 83 30.5t32 79.5zM1008 604
+v77q-37 -37 -78 -37q-49 0 -80.5 32.5t-31.5 82.5q0 48 31.5 81.5t77.5 33.5q43 0 81 -38v77q-40 20 -80 20q-74 0 -125.5 -50.5t-51.5 -123.5t51 -123.5t125 -50.5q42 0 81 19zM2240 0v527q-65 -40 -144.5 -84t-237.5 -117t-329.5 -137.5t-417.5 -134.5t-504 -118h1569
+q26 0 45 19t19 45zM1389 757q0 75 -53 128t-128 53t-128 -53t-53 -128t53 -128t128 -53t128 53t53 128zM1541 584l144 342h-71l-90 -224l-89 224h-71l142 -342h35zM1714 593h184v56h-119v90h115v56h-115v74h119v57h-184v-333zM2105 593h80l-105 140q76 16 76 94q0 47 -31 73
+t-87 26h-97v-333h65v133h9zM2304 1274v-1268q0 -56 -38.5 -95t-93.5 -39h-2040q-55 0 -93.5 39t-38.5 95v1268q0 56 38.5 95t93.5 39h2040q55 0 93.5 -39t38.5 -95z" />
+    <glyph glyph-name="f1f3" unicode="&#xf1f3;" horiz-adv-x="2304" 
+d="M119 854h89l-45 108zM740 328l74 79l-70 79h-163v-49h142v-55h-142v-54h159zM898 406l99 -110v217zM1186 453q0 33 -40 33h-84v-69h83q41 0 41 36zM1475 457q0 29 -42 29h-82v-61h81q43 0 43 32zM1197 923q0 29 -42 29h-82v-60h81q43 0 43 31zM1656 854h89l-44 108z
+M699 1009v-271h-66v212l-94 -212h-57l-94 212v-212h-132l-25 60h-135l-25 -60h-70l116 271h96l110 -257v257h106l85 -184l77 184h108zM1255 453q0 -20 -5.5 -35t-14 -25t-22.5 -16.5t-26 -10t-31.5 -4.5t-31.5 -1t-32.5 0.5t-29.5 0.5v-91h-126l-80 90l-83 -90h-256v271h260
+l80 -89l82 89h207q109 0 109 -89zM964 794v-56h-217v271h217v-57h-152v-49h148v-55h-148v-54h152zM2304 235v-229q0 -55 -38.5 -94.5t-93.5 -39.5h-2040q-55 0 -93.5 39.5t-38.5 94.5v678h111l25 61h55l25 -61h218v46l19 -46h113l20 47v-47h541v99l10 1q10 0 10 -14v-86h279
+v23q23 -12 55 -18t52.5 -6.5t63 0.5t51.5 1l25 61h56l25 -61h227v58l34 -58h182v378h-180v-44l-25 44h-185v-44l-23 44h-249q-69 0 -109 -22v22h-172v-22q-24 22 -73 22h-628l-43 -97l-43 97h-198v-44l-22 44h-169l-78 -179v391q0 55 38.5 94.5t93.5 39.5h2040
+q55 0 93.5 -39.5t38.5 -94.5v-678h-120q-51 0 -81 -22v22h-177q-55 0 -78 -22v22h-316v-22q-31 22 -87 22h-209v-22q-23 22 -91 22h-234l-54 -58l-50 58h-349v-378h343l55 59l52 -59h211v89h21q59 0 90 13v-102h174v99h8q8 0 10 -2t2 -10v-87h529q57 0 88 24v-24h168
+q60 0 95 17zM1546 469q0 -23 -12 -43t-34 -29q25 -9 34 -26t9 -46v-54h-65v45q0 33 -12 43.5t-46 10.5h-69v-99h-65v271h154q48 0 77 -15t29 -58zM1269 936q0 -24 -12.5 -44t-33.5 -29q26 -9 34.5 -25.5t8.5 -46.5v-53h-65q0 9 0.5 26.5t0 25t-3 18.5t-8.5 16t-17.5 8.5
+t-29.5 3.5h-70v-98h-64v271l153 -1q49 0 78 -14.5t29 -57.5zM1798 327v-56h-216v271h216v-56h-151v-49h148v-55h-148v-54zM1372 1009v-271h-66v271h66zM2065 357q0 -86 -102 -86h-126v58h126q34 0 34 25q0 16 -17 21t-41.5 5t-49.5 3.5t-42 22.5t-17 55q0 39 26 60t66 21
+h130v-57h-119q-36 0 -36 -25q0 -16 17.5 -20.5t42 -4t49 -2.5t42 -21.5t17.5 -54.5zM2304 407v-101q-24 -35 -88 -35h-125v58h125q33 0 33 25q0 13 -12.5 19t-31 5.5t-40 2t-40 8t-31 24t-12.5 48.5q0 39 26.5 60t66.5 21h129v-57h-118q-36 0 -36 -25q0 -20 29 -22t68.5 -5
+t56.5 -26zM2139 1008v-270h-92l-122 203v-203h-132l-26 60h-134l-25 -60h-75q-129 0 -129 133q0 138 133 138h63v-59q-7 0 -28 1t-28.5 0.5t-23 -2t-21.5 -6.5t-14.5 -13.5t-11.5 -23t-3 -33.5q0 -38 13.5 -58t49.5 -20h29l92 213h97l109 -256v256h99l114 -188v188h66z" />
+    <glyph glyph-name="_469" unicode="&#xf1f4;" horiz-adv-x="2304" 
+d="M745 630q0 -37 -25.5 -61.5t-62.5 -24.5q-29 0 -46.5 16t-17.5 44q0 37 25 62.5t62 25.5q28 0 46.5 -16.5t18.5 -45.5zM1530 779q0 -42 -22 -57t-66 -15l-32 -1l17 107q2 11 13 11h18q22 0 35 -2t25 -12.5t12 -30.5zM1881 630q0 -36 -25.5 -61t-61.5 -25q-29 0 -47 16
+t-18 44q0 37 25 62.5t62 25.5q28 0 46.5 -16.5t18.5 -45.5zM513 801q0 59 -38.5 85.5t-100.5 26.5h-160q-19 0 -21 -19l-65 -408q-1 -6 3 -11t10 -5h76q20 0 22 19l18 110q1 8 7 13t15 6.5t17 1.5t19 -1t14 -1q86 0 135 48.5t49 134.5zM822 489l41 261q1 6 -3 11t-10 5h-76
+q-14 0 -17 -33q-27 40 -95 40q-72 0 -122.5 -54t-50.5 -127q0 -59 34.5 -94t92.5 -35q28 0 58 12t48 32q-4 -12 -4 -21q0 -16 13 -16h69q19 0 22 19zM1269 752q0 5 -4 9.5t-9 4.5h-77q-11 0 -18 -10l-106 -156l-44 150q-5 16 -22 16h-75q-5 0 -9 -4.5t-4 -9.5q0 -2 19.5 -59
+t42 -123t23.5 -70q-82 -112 -82 -120q0 -13 13 -13h77q11 0 18 10l255 368q2 2 2 7zM1649 801q0 59 -38.5 85.5t-100.5 26.5h-159q-20 0 -22 -19l-65 -408q-1 -6 3 -11t10 -5h82q12 0 16 13l18 116q1 8 7 13t15 6.5t17 1.5t19 -1t14 -1q86 0 135 48.5t49 134.5zM1958 489
+l41 261q1 6 -3 11t-10 5h-76q-14 0 -17 -33q-26 40 -95 40q-72 0 -122.5 -54t-50.5 -127q0 -59 34.5 -94t92.5 -35q29 0 59 12t47 32q0 -1 -2 -9t-2 -12q0 -16 13 -16h69q19 0 22 19zM2176 898v1q0 14 -13 14h-74q-11 0 -13 -11l-65 -416l-1 -2q0 -5 4 -9.5t10 -4.5h66
+q19 0 21 19zM392 764q-5 -35 -26 -46t-60 -11l-33 -1l17 107q2 11 13 11h19q40 0 58 -11.5t12 -48.5zM2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h2048q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="_470" unicode="&#xf1f5;" horiz-adv-x="2304" 
+d="M1597 633q0 -69 -21 -106q-19 -35 -52 -35q-23 0 -41 9v224q29 30 57 30q57 0 57 -122zM2035 669h-110q6 98 56 98q51 0 54 -98zM476 534q0 59 -33 91.5t-101 57.5q-36 13 -52 24t-16 25q0 26 38 26q58 0 124 -33l18 112q-67 32 -149 32q-77 0 -123 -38q-48 -39 -48 -109
+q0 -58 32.5 -90.5t99.5 -56.5q39 -14 54.5 -25.5t15.5 -27.5q0 -31 -48 -31q-29 0 -70 12.5t-72 30.5l-18 -113q72 -41 168 -41q81 0 129 37q51 41 51 117zM771 749l19 111h-96v135l-129 -21l-18 -114l-46 -8l-17 -103h62v-219q0 -84 44 -120q38 -30 111 -30q32 0 79 11v118
+q-32 -7 -44 -7q-42 0 -42 50v197h77zM1087 724v139q-15 3 -28 3q-32 0 -55.5 -16t-33.5 -46l-10 56h-131v-471h150v306q26 31 82 31q16 0 26 -2zM1124 389h150v471h-150v-471zM1746 638q0 122 -45 179q-40 52 -111 52q-64 0 -117 -56l-8 47h-132v-645l150 25v151
+q36 -11 68 -11q83 0 134 56q61 65 61 202zM1278 986q0 33 -23 56t-56 23t-56 -23t-23 -56t23 -56.5t56 -23.5t56 23.5t23 56.5zM2176 629q0 113 -48 176q-50 64 -144 64q-96 0 -151.5 -66t-55.5 -180q0 -128 63 -188q55 -55 161 -55q101 0 160 40l-16 103q-57 -31 -128 -31
+q-43 0 -63 19q-23 19 -28 66h248q2 14 2 52zM2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h2048q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="_471" unicode="&#xf1f6;" horiz-adv-x="2048" 
+d="M1558 684q61 -356 298 -556q0 -52 -38 -90t-90 -38h-448q0 -106 -75 -181t-181 -75t-180.5 74.5t-75.5 180.5zM1024 -176q16 0 16 16t-16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5zM2026 1424q8 -10 7.5 -23.5t-10.5 -22.5
+l-1872 -1622q-10 -8 -23.5 -7t-21.5 11l-84 96q-8 10 -7.5 23.5t10.5 21.5l186 161q-19 32 -19 66q50 42 91 88t85 119.5t74.5 158.5t50 206t19.5 260q0 152 117 282.5t307 158.5q-8 19 -8 39q0 40 28 68t68 28t68 -28t28 -68q0 -20 -8 -39q124 -18 219 -82.5t148 -157.5
+l418 363q10 8 23.5 7t21.5 -11z" />
+    <glyph glyph-name="_472" unicode="&#xf1f7;" horiz-adv-x="2048" 
+d="M1040 -160q0 16 -16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5q16 0 16 16zM503 315l877 760q-42 88 -132.5 146.5t-223.5 58.5q-93 0 -169.5 -31.5t-121.5 -80.5t-69 -103t-24 -105q0 -384 -137 -645zM1856 128
+q0 -52 -38 -90t-90 -38h-448q0 -106 -75 -181t-181 -75t-180.5 74.5t-75.5 180.5l149 129h757q-166 187 -227 459l111 97q61 -356 298 -556zM1942 1520l84 -96q8 -10 7.5 -23.5t-10.5 -22.5l-1872 -1622q-10 -8 -23.5 -7t-21.5 11l-84 96q-8 10 -7.5 23.5t10.5 21.5l186 161
+q-19 32 -19 66q50 42 91 88t85 119.5t74.5 158.5t50 206t19.5 260q0 152 117 282.5t307 158.5q-8 19 -8 39q0 40 28 68t68 28t68 -28t28 -68q0 -20 -8 -39q124 -18 219 -82.5t148 -157.5l418 363q10 8 23.5 7t21.5 -11z" />
+    <glyph glyph-name="_473" unicode="&#xf1f8;" horiz-adv-x="1408" 
+d="M512 160v704q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-704q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM768 160v704q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-704q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1024 160v704q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-704
+q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM480 1152h448l-48 117q-7 9 -17 11h-317q-10 -2 -17 -11zM1408 1120v-64q0 -14 -9 -23t-23 -9h-96v-948q0 -83 -47 -143.5t-113 -60.5h-832q-66 0 -113 58.5t-47 141.5v952h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h309l70 167
+q15 37 54 63t79 26h320q40 0 79 -26t54 -63l70 -167h309q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="_474" unicode="&#xf1f9;" 
+d="M1150 462v-109q0 -50 -36.5 -89t-94 -60.5t-118 -32.5t-117.5 -11q-205 0 -342.5 139t-137.5 346q0 203 136 339t339 136q34 0 75.5 -4.5t93 -18t92.5 -34t69 -56.5t28 -81v-109q0 -16 -16 -16h-118q-16 0 -16 16v70q0 43 -65.5 67.5t-137.5 24.5q-140 0 -228.5 -91.5
+t-88.5 -237.5q0 -151 91.5 -249.5t233.5 -98.5q68 0 138 24t70 66v70q0 7 4.5 11.5t10.5 4.5h119q6 0 11 -4.5t5 -11.5zM768 1280q-130 0 -248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5
+t-51 248.5t-136.5 204t-204 136.5t-248.5 51zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="_475" unicode="&#xf1fa;" 
+d="M972 761q0 108 -53.5 169t-147.5 61q-63 0 -124 -30.5t-110 -84.5t-79.5 -137t-30.5 -180q0 -112 53.5 -173t150.5 -61q96 0 176 66.5t122.5 166t42.5 203.5zM1536 640q0 -111 -37 -197t-98.5 -135t-131.5 -74.5t-145 -27.5q-6 0 -15.5 -0.5t-16.5 -0.5q-95 0 -142 53
+q-28 33 -33 83q-52 -66 -131.5 -110t-173.5 -44q-161 0 -249.5 95.5t-88.5 269.5q0 157 66 290t179 210.5t246 77.5q87 0 155 -35.5t106 -99.5l2 19l11 56q1 6 5.5 12t9.5 6h118q5 0 13 -11q5 -5 3 -16l-120 -614q-5 -24 -5 -48q0 -39 12.5 -52t44.5 -13q28 1 57 5.5t73 24
+t77 50t57 89.5t24 137q0 292 -174 466t-466 174q-130 0 -248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51q228 0 405 144q11 9 24 8t21 -12l41 -49q8 -12 7 -24q-2 -13 -12 -22q-102 -83 -227.5 -128t-258.5 -45q-156 0 -298 61
+t-245 164t-164 245t-61 298t61 298t164 245t245 164t298 61q344 0 556 -212t212 -556z" />
+    <glyph glyph-name="_476" unicode="&#xf1fb;" horiz-adv-x="1792" 
+d="M1698 1442q94 -94 94 -226.5t-94 -225.5l-225 -223l104 -104q10 -10 10 -23t-10 -23l-210 -210q-10 -10 -23 -10t-23 10l-105 105l-603 -603q-37 -37 -90 -37h-203l-256 -128l-64 64l128 256v203q0 53 37 90l603 603l-105 105q-10 10 -10 23t10 23l210 210q10 10 23 10
+t23 -10l104 -104l223 225q93 94 225.5 94t226.5 -94zM512 64l576 576l-192 192l-576 -576v-192h192z" />
+    <glyph glyph-name="f1fc" unicode="&#xf1fc;" horiz-adv-x="1792" 
+d="M1615 1536q70 0 122.5 -46.5t52.5 -116.5q0 -63 -45 -151q-332 -629 -465 -752q-97 -91 -218 -91q-126 0 -216.5 92.5t-90.5 219.5q0 128 92 212l638 579q59 54 130 54zM706 502q39 -76 106.5 -130t150.5 -76l1 -71q4 -213 -129.5 -347t-348.5 -134q-123 0 -218 46.5
+t-152.5 127.5t-86.5 183t-29 220q7 -5 41 -30t62 -44.5t59 -36.5t46 -17q41 0 55 37q25 66 57.5 112.5t69.5 76t88 47.5t103 25.5t125 10.5z" />
+    <glyph glyph-name="_478" unicode="&#xf1fd;" horiz-adv-x="1792" 
+d="M1792 128v-384h-1792v384q45 0 85 14t59 27.5t47 37.5q30 27 51.5 38t56.5 11q24 0 44 -7t31 -15t33 -27q29 -25 47 -38t58 -27t86 -14q45 0 85 14.5t58 27t48 37.5q21 19 32.5 27t31 15t43.5 7q35 0 56.5 -11t51.5 -38q28 -24 47 -37.5t59 -27.5t85 -14t85 14t59 27.5
+t47 37.5q30 27 51.5 38t56.5 11q34 0 55.5 -11t51.5 -38q28 -24 47 -37.5t59 -27.5t85 -14zM1792 448v-192q-24 0 -44 7t-31 15t-33 27q-29 25 -47 38t-58 27t-85 14q-46 0 -86 -14t-58 -27t-47 -38q-22 -19 -33 -27t-31 -15t-44 -7q-35 0 -56.5 11t-51.5 38q-29 25 -47 38
+t-58 27t-86 14q-45 0 -85 -14.5t-58 -27t-48 -37.5q-21 -19 -32.5 -27t-31 -15t-43.5 -7q-35 0 -56.5 11t-51.5 38q-28 24 -47 37.5t-59 27.5t-85 14q-46 0 -86 -14t-58 -27t-47 -38q-30 -27 -51.5 -38t-56.5 -11v192q0 80 56 136t136 56h64v448h256v-448h256v448h256v-448
+h256v448h256v-448h64q80 0 136 -56t56 -136zM512 1312q0 -77 -36 -118.5t-92 -41.5q-53 0 -90.5 37.5t-37.5 90.5q0 29 9.5 51t23.5 34t31 28t31 31.5t23.5 44.5t9.5 67q38 0 83 -74t45 -150zM1024 1312q0 -77 -36 -118.5t-92 -41.5q-53 0 -90.5 37.5t-37.5 90.5
+q0 29 9.5 51t23.5 34t31 28t31 31.5t23.5 44.5t9.5 67q38 0 83 -74t45 -150zM1536 1312q0 -77 -36 -118.5t-92 -41.5q-53 0 -90.5 37.5t-37.5 90.5q0 29 9.5 51t23.5 34t31 28t31 31.5t23.5 44.5t9.5 67q38 0 83 -74t45 -150z" />
+    <glyph glyph-name="_479" unicode="&#xf1fe;" horiz-adv-x="2048" 
+d="M2048 0v-128h-2048v1536h128v-1408h1920zM1664 1024l256 -896h-1664v576l448 576l576 -576z" />
+    <glyph glyph-name="_480" unicode="&#xf200;" horiz-adv-x="1792" 
+d="M768 646l546 -546q-106 -108 -247.5 -168t-298.5 -60q-209 0 -385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103v-762zM955 640h773q0 -157 -60 -298.5t-168 -247.5zM1664 768h-768v768q209 0 385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="_481" unicode="&#xf201;" horiz-adv-x="2048" 
+d="M2048 0v-128h-2048v1536h128v-1408h1920zM1920 1248v-435q0 -21 -19.5 -29.5t-35.5 7.5l-121 121l-633 -633q-10 -10 -23 -10t-23 10l-233 233l-416 -416l-192 192l585 585q10 10 23 10t23 -10l233 -233l464 464l-121 121q-16 16 -7.5 35.5t29.5 19.5h435q14 0 23 -9
+t9 -23z" />
+    <glyph glyph-name="_482" unicode="&#xf202;" horiz-adv-x="1792" 
+d="M1292 832q0 -6 10 -41q10 -29 25 -49.5t41 -34t44 -20t55 -16.5q325 -91 325 -332q0 -146 -105.5 -242.5t-254.5 -96.5q-59 0 -111.5 18.5t-91.5 45.5t-77 74.5t-63 87.5t-53.5 103.5t-43.5 103t-39.5 106.5t-35.5 95q-32 81 -61.5 133.5t-73.5 96.5t-104 64t-142 20
+q-96 0 -183 -55.5t-138 -144.5t-51 -185q0 -160 106.5 -279.5t263.5 -119.5q177 0 258 95q56 63 83 116l84 -152q-15 -34 -44 -70l1 -1q-131 -152 -388 -152q-147 0 -269.5 79t-190.5 207.5t-68 274.5q0 105 43.5 206t116 176.5t172 121.5t204.5 46q87 0 159 -19t123.5 -50
+t95 -80t72.5 -99t58.5 -117t50.5 -124.5t50 -130.5t55 -127q96 -200 233 -200q81 0 138.5 48.5t57.5 128.5q0 42 -19 72t-50.5 46t-72.5 31.5t-84.5 27t-87.5 34t-81 52t-65 82t-39 122.5q-3 16 -3 33q0 110 87.5 192t198.5 78q78 -3 120.5 -14.5t90.5 -53.5h-1
+q12 -11 23 -24.5t26 -36t19 -27.5l-129 -99q-26 49 -54 70v1q-23 21 -97 21q-49 0 -84 -33t-35 -83z" />
+    <glyph glyph-name="_483" unicode="&#xf203;" 
+d="M1432 484q0 173 -234 239q-35 10 -53 16.5t-38 25t-29 46.5q0 2 -2 8.5t-3 12t-1 7.5q0 36 24.5 59.5t60.5 23.5q54 0 71 -15h-1q20 -15 39 -51l93 71q-39 54 -49 64q-33 29 -67.5 39t-85.5 10q-80 0 -142 -57.5t-62 -137.5q0 -7 2 -23q16 -96 64.5 -140t148.5 -73
+q29 -8 49 -15.5t45 -21.5t38.5 -34.5t13.5 -46.5v-5q1 -58 -40.5 -93t-100.5 -35q-97 0 -167 144q-23 47 -51.5 121.5t-48 125.5t-54 110.5t-74 95.5t-103.5 60.5t-147 24.5q-101 0 -192 -56t-144 -148t-50 -192v-1q4 -108 50.5 -199t133.5 -147.5t196 -56.5q186 0 279 110
+q20 27 31 51l-60 109q-42 -80 -99 -116t-146 -36q-115 0 -191 87t-76 204q0 105 82 189t186 84q112 0 170 -53.5t104 -172.5q8 -21 25.5 -68.5t28.5 -76.5t31.5 -74.5t38.5 -74t45.5 -62.5t55.5 -53.5t66 -33t80 -13.5q107 0 183 69.5t76 174.5zM1536 1120v-960
+q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="_484" unicode="&#xf204;" horiz-adv-x="2048" 
+d="M1152 640q0 104 -40.5 198.5t-109.5 163.5t-163.5 109.5t-198.5 40.5t-198.5 -40.5t-163.5 -109.5t-109.5 -163.5t-40.5 -198.5t40.5 -198.5t109.5 -163.5t163.5 -109.5t198.5 -40.5t198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5zM1920 640q0 104 -40.5 198.5
+t-109.5 163.5t-163.5 109.5t-198.5 40.5h-386q119 -90 188.5 -224t69.5 -288t-69.5 -288t-188.5 -224h386q104 0 198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5zM2048 640q0 -130 -51 -248.5t-136.5 -204t-204 -136.5t-248.5 -51h-768q-130 0 -248.5 51t-204 136.5
+t-136.5 204t-51 248.5t51 248.5t136.5 204t204 136.5t248.5 51h768q130 0 248.5 -51t204 -136.5t136.5 -204t51 -248.5z" />
+    <glyph glyph-name="_485" unicode="&#xf205;" horiz-adv-x="2048" 
+d="M0 640q0 130 51 248.5t136.5 204t204 136.5t248.5 51h768q130 0 248.5 -51t204 -136.5t136.5 -204t51 -248.5t-51 -248.5t-136.5 -204t-204 -136.5t-248.5 -51h-768q-130 0 -248.5 51t-204 136.5t-136.5 204t-51 248.5zM1408 128q104 0 198.5 40.5t163.5 109.5
+t109.5 163.5t40.5 198.5t-40.5 198.5t-109.5 163.5t-163.5 109.5t-198.5 40.5t-198.5 -40.5t-163.5 -109.5t-109.5 -163.5t-40.5 -198.5t40.5 -198.5t109.5 -163.5t163.5 -109.5t198.5 -40.5z" />
+    <glyph glyph-name="_486" unicode="&#xf206;" horiz-adv-x="2304" 
+d="M762 384h-314q-40 0 -57.5 35t6.5 67l188 251q-65 31 -137 31q-132 0 -226 -94t-94 -226t94 -226t226 -94q115 0 203 72.5t111 183.5zM576 512h186q-18 85 -75 148zM1056 512l288 384h-480l-99 -132q105 -103 126 -252h165zM2176 448q0 132 -94 226t-226 94
+q-60 0 -121 -24l174 -260q15 -23 10 -49t-27 -40q-15 -11 -36 -11q-35 0 -53 29l-174 260q-93 -95 -93 -225q0 -132 94 -226t226 -94t226 94t94 226zM2304 448q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 97 39.5 183.5t109.5 149.5l-65 98l-353 -469
+q-18 -26 -51 -26h-197q-23 -164 -149 -274t-294 -110q-185 0 -316.5 131.5t-131.5 316.5t131.5 316.5t316.5 131.5q114 0 215 -55l137 183h-224q-26 0 -45 19t-19 45t19 45t45 19h384v-128h435l-85 128h-222q-26 0 -45 19t-19 45t19 45t45 19h256q33 0 53 -28l267 -400
+q91 44 192 44q185 0 316.5 -131.5t131.5 -316.5z" />
+    <glyph glyph-name="_487" unicode="&#xf207;" 
+d="M384 320q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1408 320q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1362 716l-72 384q-5 23 -22.5 37.5t-40.5 14.5
+h-918q-23 0 -40.5 -14.5t-22.5 -37.5l-72 -384q-5 -30 14 -53t49 -23h1062q30 0 49 23t14 53zM1136 1328q0 20 -14 34t-34 14h-640q-20 0 -34 -14t-14 -34t14 -34t34 -14h640q20 0 34 14t14 34zM1536 603v-603h-128v-128q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5
+t-37.5 90.5v128h-768v-128q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5v128h-128v603q0 112 25 223l103 454q9 78 97.5 137t230 89t312.5 30t312.5 -30t230 -89t97.5 -137l105 -454q23 -102 23 -223z" />
+    <glyph glyph-name="_488" unicode="&#xf208;" horiz-adv-x="2048" 
+d="M1463 704q0 -35 -25 -60.5t-61 -25.5h-702q-36 0 -61 25.5t-25 60.5t25 60.5t61 25.5h702q36 0 61 -25.5t25 -60.5zM1677 704q0 86 -23 170h-982q-36 0 -61 25t-25 60q0 36 25 61t61 25h908q-88 143 -235 227t-320 84q-177 0 -327.5 -87.5t-238 -237.5t-87.5 -327
+q0 -86 23 -170h982q36 0 61 -25t25 -60q0 -36 -25 -61t-61 -25h-908q88 -143 235.5 -227t320.5 -84q132 0 253 51.5t208 139t139 208t52 253.5zM2048 959q0 -35 -25 -60t-61 -25h-131q17 -85 17 -170q0 -167 -65.5 -319.5t-175.5 -263t-262.5 -176t-319.5 -65.5
+q-246 0 -448.5 133t-301.5 350h-189q-36 0 -61 25t-25 61q0 35 25 60t61 25h132q-17 85 -17 170q0 167 65.5 319.5t175.5 263t262.5 176t320.5 65.5q245 0 447.5 -133t301.5 -350h188q36 0 61 -25t25 -61z" />
+    <glyph glyph-name="_489" unicode="&#xf209;" horiz-adv-x="1280" 
+d="M953 1158l-114 -328l117 -21q165 451 165 518q0 56 -38 56q-57 0 -130 -225zM654 471l33 -88q37 42 71 67l-33 5.5t-38.5 7t-32.5 8.5zM362 1367q0 -98 159 -521q17 10 49 10q15 0 75 -5l-121 351q-75 220 -123 220q-19 0 -29 -17.5t-10 -37.5zM283 608q0 -36 51.5 -119
+t117.5 -153t100 -70q14 0 25.5 13t11.5 27q0 24 -32 102q-13 32 -32 72t-47.5 89t-61.5 81t-62 32q-20 0 -45.5 -27t-25.5 -47zM125 273q0 -41 25 -104q59 -145 183.5 -227t281.5 -82q227 0 382 170q152 169 152 427q0 43 -1 67t-11.5 62t-30.5 56q-56 49 -211.5 75.5
+t-270.5 26.5q-37 0 -49 -11q-12 -5 -12 -35q0 -34 21.5 -60t55.5 -40t77.5 -23.5t87.5 -11.5t85 -4t70 0h23q24 0 40 -19q15 -19 19 -55q-28 -28 -96 -54q-61 -22 -93 -46q-64 -46 -108.5 -114t-44.5 -137q0 -31 18.5 -88.5t18.5 -87.5l-3 -12q-4 -12 -4 -14
+q-137 10 -146 216q-8 -2 -41 -2q2 -7 2 -21q0 -53 -40.5 -89.5t-94.5 -36.5q-82 0 -166.5 78t-84.5 159q0 34 33 67q52 -64 60 -76q77 -104 133 -104q12 0 26.5 8.5t14.5 20.5q0 34 -87.5 145t-116.5 111q-43 0 -70 -44.5t-27 -90.5zM11 264q0 101 42.5 163t136.5 88
+q-28 74 -28 104q0 62 61 123t122 61q29 0 70 -15q-163 462 -163 567q0 80 41 130.5t119 50.5q131 0 325 -581q6 -17 8 -23q6 16 29 79.5t43.5 118.5t54 127.5t64.5 123t70.5 86.5t76.5 36q71 0 112 -49t41 -122q0 -108 -159 -550q61 -15 100.5 -46t58.5 -78t26 -93.5
+t7 -110.5q0 -150 -47 -280t-132 -225t-211 -150t-278 -55q-111 0 -223 42q-149 57 -258 191.5t-109 286.5z" />
+    <glyph glyph-name="_490" unicode="&#xf20a;" horiz-adv-x="2048" 
+d="M785 528h207q-14 -158 -98.5 -248.5t-214.5 -90.5q-162 0 -254.5 116t-92.5 316q0 194 93 311.5t233 117.5q148 0 232 -87t97 -247h-203q-5 64 -35.5 99t-81.5 35q-57 0 -88.5 -60.5t-31.5 -177.5q0 -48 5 -84t18 -69.5t40 -51.5t66 -18q95 0 109 139zM1497 528h206
+q-14 -158 -98 -248.5t-214 -90.5q-162 0 -254.5 116t-92.5 316q0 194 93 311.5t233 117.5q148 0 232 -87t97 -247h-204q-4 64 -35 99t-81 35q-57 0 -88.5 -60.5t-31.5 -177.5q0 -48 5 -84t18 -69.5t39.5 -51.5t65.5 -18q49 0 76.5 38t33.5 101zM1856 647q0 207 -15.5 307
+t-60.5 161q-6 8 -13.5 14t-21.5 15t-16 11q-86 63 -697 63q-625 0 -710 -63q-5 -4 -17.5 -11.5t-21 -14t-14.5 -14.5q-45 -60 -60 -159.5t-15 -308.5q0 -208 15 -307.5t60 -160.5q6 -8 15 -15t20.5 -14t17.5 -12q44 -33 239.5 -49t470.5 -16q610 0 697 65q5 4 17 11t20.5 14
+t13.5 16q46 60 61 159t15 309zM2048 1408v-1536h-2048v1536h2048z" />
+    <glyph glyph-name="_491" unicode="&#xf20b;" 
+d="M992 912v-496q0 -14 -9 -23t-23 -9h-160q-14 0 -23 9t-9 23v496q0 112 -80 192t-192 80h-272v-1152q0 -14 -9 -23t-23 -9h-160q-14 0 -23 9t-9 23v1344q0 14 9 23t23 9h464q135 0 249 -66.5t180.5 -180.5t66.5 -249zM1376 1376v-880q0 -135 -66.5 -249t-180.5 -180.5
+t-249 -66.5h-464q-14 0 -23 9t-9 23v960q0 14 9 23t23 9h160q14 0 23 -9t9 -23v-768h272q112 0 192 80t80 192v880q0 14 9 23t23 9h160q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="_492" unicode="&#xf20c;" 
+d="M1311 694v-114q0 -24 -13.5 -38t-37.5 -14h-202q-24 0 -38 14t-14 38v114q0 24 14 38t38 14h202q24 0 37.5 -14t13.5 -38zM821 464v250q0 53 -32.5 85.5t-85.5 32.5h-133q-68 0 -96 -52q-28 52 -96 52h-130q-53 0 -85.5 -32.5t-32.5 -85.5v-250q0 -22 21 -22h55
+q22 0 22 22v230q0 24 13.5 38t38.5 14h94q24 0 38 -14t14 -38v-230q0 -22 21 -22h54q22 0 22 22v230q0 24 14 38t38 14h97q24 0 37.5 -14t13.5 -38v-230q0 -22 22 -22h55q21 0 21 22zM1410 560v154q0 53 -33 85.5t-86 32.5h-264q-53 0 -86 -32.5t-33 -85.5v-410
+q0 -21 22 -21h55q21 0 21 21v180q31 -42 94 -42h191q53 0 86 32.5t33 85.5zM1536 1176v-1072q0 -96 -68 -164t-164 -68h-1072q-96 0 -164 68t-68 164v1072q0 96 68 164t164 68h1072q96 0 164 -68t68 -164z" />
+    <glyph glyph-name="_493" unicode="&#xf20d;" 
+d="M915 450h-294l147 551zM1001 128h311l-324 1024h-440l-324 -1024h311l383 314zM1536 1120v-960q0 -118 -85 -203t-203 -85h-960q-118 0 -203 85t-85 203v960q0 118 85 203t203 85h960q118 0 203 -85t85 -203z" />
+    <glyph glyph-name="_494" unicode="&#xf20e;" horiz-adv-x="2048" 
+d="M2048 641q0 -21 -13 -36.5t-33 -19.5l-205 -356q3 -9 3 -18q0 -20 -12.5 -35.5t-32.5 -19.5l-193 -337q3 -8 3 -16q0 -23 -16.5 -40t-40.5 -17q-25 0 -41 18h-400q-17 -20 -43 -20t-43 20h-399q-17 -20 -43 -20q-23 0 -40 16.5t-17 40.5q0 8 4 20l-193 335
+q-20 4 -32.5 19.5t-12.5 35.5q0 9 3 18l-206 356q-20 5 -32.5 20.5t-12.5 35.5q0 21 13.5 36.5t33.5 19.5l199 344q0 1 -0.5 3t-0.5 3q0 36 34 51l209 363q-4 10 -4 18q0 24 17 40.5t40 16.5q26 0 44 -21h396q16 21 43 21t43 -21h398q18 21 44 21q23 0 40 -16.5t17 -40.5
+q0 -6 -4 -18l207 -358q23 -1 39 -17.5t16 -38.5q0 -13 -7 -27l187 -324q19 -4 31.5 -19.5t12.5 -35.5zM1063 -158h389l-342 354h-143l-342 -354h360q18 16 39 16t39 -16zM112 654q1 -4 1 -13q0 -10 -2 -15l208 -360l15 -6l188 199v347l-187 194q-13 -8 -29 -10zM986 1438
+h-388l190 -200l554 200h-280q-16 -16 -38 -16t-38 16zM1689 226q1 6 5 11l-64 68l-17 -79h76zM1583 226l22 105l-252 266l-296 -307l63 -64h463zM1495 -142l16 28l65 310h-427l333 -343q8 4 13 5zM578 -158h5l342 354h-373v-335l4 -6q14 -5 22 -13zM552 226h402l64 66
+l-309 321l-157 -166v-221zM359 226h163v189l-168 -177q4 -8 5 -12zM358 1051q0 -1 0.5 -2t0.5 -2q0 -16 -8 -29l171 -177v269zM552 1121v-311l153 -157l297 314l-223 236zM556 1425l-4 -8v-264l205 74l-191 201q-6 -2 -10 -3zM1447 1438h-16l-621 -224l213 -225zM1023 946
+l-297 -315l311 -319l296 307zM688 634l-136 141v-284zM1038 270l-42 -44h85zM1374 618l238 -251l132 624l-3 5l-1 1zM1718 1018q-8 13 -8 29v2l-216 376q-5 1 -13 5l-437 -463l310 -327zM522 1142v223l-163 -282zM522 196h-163l163 -283v283zM1607 196l-48 -227l130 227h-82
+zM1729 266l207 361q-2 10 -2 14q0 1 3 16l-171 296l-129 -612l77 -82q5 3 15 7z" />
+    <glyph glyph-name="f210" unicode="&#xf210;" 
+d="M0 856q0 131 91.5 226.5t222.5 95.5h742l352 358v-1470q0 -132 -91.5 -227t-222.5 -95h-780q-131 0 -222.5 95t-91.5 227v790zM1232 102l-176 180v425q0 46 -32 79t-78 33h-484q-46 0 -78 -33t-32 -79v-492q0 -46 32.5 -79.5t77.5 -33.5h770z" />
+    <glyph glyph-name="_496" unicode="&#xf211;" 
+d="M934 1386q-317 -121 -556 -362.5t-358 -560.5q-20 89 -20 176q0 208 102.5 384.5t278.5 279t384 102.5q82 0 169 -19zM1203 1267q93 -65 164 -155q-389 -113 -674.5 -400.5t-396.5 -676.5q-93 72 -155 162q112 386 395 671t667 399zM470 -67q115 356 379.5 622t619.5 384
+q40 -92 54 -195q-292 -120 -516 -345t-343 -518q-103 14 -194 52zM1536 -125q-193 50 -367 115q-135 -84 -290 -107q109 205 274 370.5t369 275.5q-21 -152 -101 -284q65 -175 115 -370z" />
+    <glyph glyph-name="f212" unicode="&#xf212;" horiz-adv-x="2048" 
+d="M1893 1144l155 -1272q-131 0 -257 57q-200 91 -393 91q-226 0 -374 -148q-148 148 -374 148q-193 0 -393 -91q-128 -57 -252 -57h-5l155 1272q224 127 482 127q233 0 387 -106q154 106 387 106q258 0 482 -127zM1398 157q129 0 232 -28.5t260 -93.5l-124 1021
+q-171 78 -368 78q-224 0 -374 -141q-150 141 -374 141q-197 0 -368 -78l-124 -1021q105 43 165.5 65t148.5 39.5t178 17.5q202 0 374 -108q172 108 374 108zM1438 191l-55 907q-211 -4 -359 -155q-152 155 -374 155q-176 0 -336 -66l-114 -941q124 51 228.5 76t221.5 25
+q209 0 374 -102q172 107 374 102z" />
+    <glyph glyph-name="_498" unicode="&#xf213;" horiz-adv-x="2048" 
+d="M1500 165v733q0 21 -15 36t-35 15h-93q-20 0 -35 -15t-15 -36v-733q0 -20 15 -35t35 -15h93q20 0 35 15t15 35zM1216 165v531q0 20 -15 35t-35 15h-101q-20 0 -35 -15t-15 -35v-531q0 -20 15 -35t35 -15h101q20 0 35 15t15 35zM924 165v429q0 20 -15 35t-35 15h-101
+q-20 0 -35 -15t-15 -35v-429q0 -20 15 -35t35 -15h101q20 0 35 15t15 35zM632 165v362q0 20 -15 35t-35 15h-101q-20 0 -35 -15t-15 -35v-362q0 -20 15 -35t35 -15h101q20 0 35 15t15 35zM2048 311q0 -166 -118 -284t-284 -118h-1244q-166 0 -284 118t-118 284
+q0 116 63 214.5t168 148.5q-10 34 -10 73q0 113 80.5 193.5t193.5 80.5q102 0 180 -67q45 183 194 300t338 117q149 0 275 -73.5t199.5 -199.5t73.5 -275q0 -66 -14 -122q135 -33 221 -142.5t86 -247.5z" />
+    <glyph glyph-name="_499" unicode="&#xf214;" 
+d="M0 1536h1536v-1392l-776 -338l-760 338v1392zM1436 209v926h-1336v-926l661 -294zM1436 1235v201h-1336v-201h1336zM181 937v-115h-37v115h37zM181 789v-115h-37v115h37zM181 641v-115h-37v115h37zM181 493v-115h-37v115h37zM181 345v-115h-37v115h37zM207 202l15 34
+l105 -47l-15 -33zM343 142l15 34l105 -46l-15 -34zM478 82l15 34l105 -46l-15 -34zM614 23l15 33l104 -46l-15 -34zM797 10l105 46l15 -33l-105 -47zM932 70l105 46l15 -34l-105 -46zM1068 130l105 46l15 -34l-105 -46zM1203 189l105 47l15 -34l-105 -46zM259 1389v-36h-114
+v36h114zM421 1389v-36h-115v36h115zM583 1389v-36h-115v36h115zM744 1389v-36h-114v36h114zM906 1389v-36h-114v36h114zM1068 1389v-36h-115v36h115zM1230 1389v-36h-115v36h115zM1391 1389v-36h-114v36h114zM181 1049v-79h-37v115h115v-36h-78zM421 1085v-36h-115v36h115z
+M583 1085v-36h-115v36h115zM744 1085v-36h-114v36h114zM906 1085v-36h-114v36h114zM1068 1085v-36h-115v36h115zM1230 1085v-36h-115v36h115zM1355 970v79h-78v36h115v-115h-37zM1355 822v115h37v-115h-37zM1355 674v115h37v-115h-37zM1355 526v115h37v-115h-37zM1355 378
+v115h37v-115h-37zM1355 230v115h37v-115h-37zM760 265q-129 0 -221 91.5t-92 221.5q0 129 92 221t221 92q130 0 221.5 -92t91.5 -221q0 -130 -91.5 -221.5t-221.5 -91.5zM595 646q0 -36 19.5 -56.5t49.5 -25t64 -7t64 -2t49.5 -9t19.5 -30.5q0 -49 -112 -49q-97 0 -123 51
+h-3l-31 -63q67 -42 162 -42q29 0 56.5 5t55.5 16t45.5 33t17.5 53q0 46 -27.5 69.5t-67.5 27t-79.5 3t-67 5t-27.5 25.5q0 21 20.5 33t40.5 15t41 3q34 0 70.5 -11t51.5 -34h3l30 58q-3 1 -21 8.5t-22.5 9t-19.5 7t-22 7t-20 4.5t-24 4t-23 1q-29 0 -56.5 -5t-54 -16.5
+t-43 -34t-16.5 -53.5z" />
+    <glyph glyph-name="_500" unicode="&#xf215;" horiz-adv-x="2048" 
+d="M863 504q0 112 -79.5 191.5t-191.5 79.5t-191 -79.5t-79 -191.5t79 -191t191 -79t191.5 79t79.5 191zM1726 505q0 112 -79 191t-191 79t-191.5 -79t-79.5 -191q0 -113 79.5 -192t191.5 -79t191 79.5t79 191.5zM2048 1314v-1348q0 -44 -31.5 -75.5t-76.5 -31.5h-1832
+q-45 0 -76.5 31.5t-31.5 75.5v1348q0 44 31.5 75.5t76.5 31.5h431q44 0 76 -31.5t32 -75.5v-161h754v161q0 44 32 75.5t76 31.5h431q45 0 76.5 -31.5t31.5 -75.5z" />
+    <glyph glyph-name="_501" unicode="&#xf216;" horiz-adv-x="2048" 
+d="M1430 953zM1690 749q148 0 253 -98.5t105 -244.5q0 -157 -109 -261.5t-267 -104.5q-85 0 -162 27.5t-138 73.5t-118 106t-109 126t-103.5 132.5t-108.5 126.5t-117 106t-136 73.5t-159 27.5q-154 0 -251.5 -91.5t-97.5 -244.5q0 -157 104 -250t263 -93q100 0 208 37.5
+t193 98.5q5 4 21 18.5t30 24t22 9.5q14 0 24.5 -10.5t10.5 -24.5q0 -24 -60 -77q-101 -88 -234.5 -142t-260.5 -54q-133 0 -245.5 58t-180 165t-67.5 241q0 205 141.5 341t347.5 136q120 0 226.5 -43.5t185.5 -113t151.5 -153t139 -167.5t133.5 -153.5t149.5 -113
+t172.5 -43.5q102 0 168.5 61.5t66.5 162.5q0 95 -64.5 159t-159.5 64q-30 0 -81.5 -18.5t-68.5 -18.5q-20 0 -35.5 15t-15.5 35q0 18 8.5 57t8.5 59q0 159 -107.5 263t-266.5 104q-58 0 -111.5 -18.5t-84 -40.5t-55.5 -40.5t-33 -18.5q-15 0 -25.5 10.5t-10.5 25.5
+q0 19 25 46q59 67 147 103.5t182 36.5q191 0 318 -125.5t127 -315.5q0 -37 -4 -66q57 15 115 15z" />
+    <glyph glyph-name="_502" unicode="&#xf217;" horiz-adv-x="1664" 
+d="M1216 832q0 26 -19 45t-45 19h-128v128q0 26 -19 45t-45 19t-45 -19t-19 -45v-128h-128q-26 0 -45 -19t-19 -45t19 -45t45 -19h128v-128q0 -26 19 -45t45 -19t45 19t19 45v128h128q26 0 45 19t19 45zM640 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5
+t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1536 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1664 1088v-512q0 -24 -16 -42.5t-41 -21.5l-1044 -122q1 -7 4.5 -21.5t6 -26.5t2.5 -22q0 -16 -24 -64h920
+q26 0 45 -19t19 -45t-19 -45t-45 -19h-1024q-26 0 -45 19t-19 45q0 14 11 39.5t29.5 59.5t20.5 38l-177 823h-204q-26 0 -45 19t-19 45t19 45t45 19h256q16 0 28.5 -6.5t20 -15.5t13 -24.5t7.5 -26.5t5.5 -29.5t4.5 -25.5h1201q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="_503" unicode="&#xf218;" horiz-adv-x="1664" 
+d="M1280 832q0 26 -19 45t-45 19t-45 -19l-147 -146v293q0 26 -19 45t-45 19t-45 -19t-19 -45v-293l-147 146q-19 19 -45 19t-45 -19t-19 -45t19 -45l256 -256q19 -19 45 -19t45 19l256 256q19 19 19 45zM640 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5
+t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1536 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1664 1088v-512q0 -24 -16 -42.5t-41 -21.5l-1044 -122q1 -7 4.5 -21.5t6 -26.5t2.5 -22q0 -16 -24 -64h920
+q26 0 45 -19t19 -45t-19 -45t-45 -19h-1024q-26 0 -45 19t-19 45q0 14 11 39.5t29.5 59.5t20.5 38l-177 823h-204q-26 0 -45 19t-19 45t19 45t45 19h256q16 0 28.5 -6.5t20 -15.5t13 -24.5t7.5 -26.5t5.5 -29.5t4.5 -25.5h1201q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="_504" unicode="&#xf219;" horiz-adv-x="2048" 
+d="M212 768l623 -665l-300 665h-323zM1024 -4l349 772h-698zM538 896l204 384h-262l-288 -384h346zM1213 103l623 665h-323zM683 896h682l-204 384h-274zM1510 896h346l-288 384h-262zM1651 1382l384 -512q14 -18 13 -41.5t-17 -40.5l-960 -1024q-18 -20 -47 -20t-47 20
+l-960 1024q-16 17 -17 40.5t13 41.5l384 512q18 26 51 26h1152q33 0 51 -26z" />
+    <glyph glyph-name="_505" unicode="&#xf21a;" horiz-adv-x="2048" 
+d="M1811 -19q19 19 45 19t45 -19l128 -128l-90 -90l-83 83l-83 -83q-18 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83
+q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-128 128l90 90l83 -83l83 83q19 19 45 19t45 -19l83 -83l83 83q19 19 45 19t45 -19l83 -83l83 83q19 19 45 19t45 -19l83 -83l83 83q19 19 45 19t45 -19l83 -83l83 83q19 19 45 19t45 -19l83 -83l83 83
+q19 19 45 19t45 -19l83 -83zM237 19q-19 -19 -45 -19t-45 19l-128 128l90 90l83 -82l83 82q19 19 45 19t45 -19l83 -82l64 64v293l-210 314q-17 26 -7 56.5t40 40.5l177 58v299h128v128h256v128h256v-128h256v-128h128v-299l177 -58q30 -10 40 -40.5t-7 -56.5l-210 -314
+v-293l19 18q19 19 45 19t45 -19l83 -82l83 82q19 19 45 19t45 -19l128 -128l-90 -90l-83 83l-83 -83q-18 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83
+q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83zM640 1152v-128l384 128l384 -128v128h-128v128h-512v-128h-128z" />
+    <glyph glyph-name="_506" unicode="&#xf21b;" 
+d="M576 0l96 448l-96 128l-128 64zM832 0l128 640l-128 -64l-96 -128zM992 1010q-2 4 -4 6q-10 8 -96 8q-70 0 -167 -19q-7 -2 -21 -2t-21 2q-97 19 -167 19q-86 0 -96 -8q-2 -2 -4 -6q2 -18 4 -27q2 -3 7.5 -6.5t7.5 -10.5q2 -4 7.5 -20.5t7 -20.5t7.5 -17t8.5 -17t9 -14
+t12 -13.5t14 -9.5t17.5 -8t20.5 -4t24.5 -2q36 0 59 12.5t32.5 30t14.5 34.5t11.5 29.5t17.5 12.5h12q11 0 17.5 -12.5t11.5 -29.5t14.5 -34.5t32.5 -30t59 -12.5q13 0 24.5 2t20.5 4t17.5 8t14 9.5t12 13.5t9 14t8.5 17t7.5 17t7 20.5t7.5 20.5q2 7 7.5 10.5t7.5 6.5
+q2 9 4 27zM1408 131q0 -121 -73 -190t-194 -69h-874q-121 0 -194 69t-73 190q0 61 4.5 118t19 125.5t37.5 123.5t63.5 103.5t93.5 74.5l-90 220h214q-22 64 -22 128q0 12 2 32q-194 40 -194 96q0 57 210 99q17 62 51.5 134t70.5 114q32 37 76 37q30 0 84 -31t84 -31t84 31
+t84 31q44 0 76 -37q36 -42 70.5 -114t51.5 -134q210 -42 210 -99q0 -56 -194 -96q7 -81 -20 -160h214l-82 -225q63 -33 107.5 -96.5t65.5 -143.5t29 -151.5t8 -148.5z" />
+    <glyph glyph-name="_507" unicode="&#xf21c;" horiz-adv-x="2304" 
+d="M2301 500q12 -103 -22 -198.5t-99 -163.5t-158.5 -106t-196.5 -31q-161 11 -279.5 125t-134.5 274q-12 111 27.5 210.5t118.5 170.5l-71 107q-96 -80 -151 -194t-55 -244q0 -27 -18.5 -46.5t-45.5 -19.5h-256h-69q-23 -164 -149 -274t-294 -110q-185 0 -316.5 131.5
+t-131.5 316.5t131.5 316.5t316.5 131.5q76 0 152 -27l24 45q-123 110 -304 110h-64q-26 0 -45 19t-19 45t19 45t45 19h128q78 0 145 -13.5t116.5 -38.5t71.5 -39.5t51 -36.5h512h115l-85 128h-222q-30 0 -49 22.5t-14 52.5q4 23 23 38t43 15h253q33 0 53 -28l70 -105
+l114 114q19 19 46 19h101q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-179l115 -172q131 63 275 36q143 -26 244 -134.5t118 -253.5zM448 128q115 0 203 72.5t111 183.5h-314q-35 0 -55 31q-18 32 -1 63l147 277q-47 13 -91 13q-132 0 -226 -94t-94 -226t94 -226
+t226 -94zM1856 128q132 0 226 94t94 226t-94 226t-226 94q-60 0 -121 -24l174 -260q15 -23 10 -49t-27 -40q-15 -11 -36 -11q-35 0 -53 29l-174 260q-93 -95 -93 -225q0 -132 94 -226t226 -94z" />
+    <glyph glyph-name="_508" unicode="&#xf21d;" 
+d="M1408 0q0 -63 -61.5 -113.5t-164 -81t-225 -46t-253.5 -15.5t-253.5 15.5t-225 46t-164 81t-61.5 113.5q0 49 33 88.5t91 66.5t118 44.5t131 29.5q26 5 48 -10.5t26 -41.5q5 -26 -10.5 -48t-41.5 -26q-58 -10 -106 -23.5t-76.5 -25.5t-48.5 -23.5t-27.5 -19.5t-8.5 -12
+q3 -11 27 -26.5t73 -33t114 -32.5t160.5 -25t201.5 -10t201.5 10t160.5 25t114 33t73 33.5t27 27.5q-1 4 -8.5 11t-27.5 19t-48.5 23.5t-76.5 25t-106 23.5q-26 4 -41.5 26t-10.5 48q4 26 26 41.5t48 10.5q71 -12 131 -29.5t118 -44.5t91 -66.5t33 -88.5zM1024 896v-384
+q0 -26 -19 -45t-45 -19h-64v-384q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v384h-64q-26 0 -45 19t-19 45v384q0 53 37.5 90.5t90.5 37.5h384q53 0 90.5 -37.5t37.5 -90.5zM928 1280q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5
+t158.5 -65.5t65.5 -158.5z" />
+    <glyph glyph-name="_509" unicode="&#xf21e;" horiz-adv-x="1792" 
+d="M1280 512h305q-5 -6 -10 -10.5t-9 -7.5l-3 -4l-623 -600q-18 -18 -44 -18t-44 18l-624 602q-5 2 -21 20h369q22 0 39.5 13.5t22.5 34.5l70 281l190 -667q6 -20 23 -33t39 -13q21 0 38 13t23 33l146 485l56 -112q18 -35 57 -35zM1792 940q0 -145 -103 -300h-369l-111 221
+q-8 17 -25.5 27t-36.5 8q-45 -5 -56 -46l-129 -430l-196 686q-6 20 -23.5 33t-39.5 13t-39 -13.5t-22 -34.5l-116 -464h-423q-103 155 -103 300q0 220 127 344t351 124q62 0 126.5 -21.5t120 -58t95.5 -68.5t76 -68q36 36 76 68t95.5 68.5t120 58t126.5 21.5q224 0 351 -124
+t127 -344z" />
+    <glyph glyph-name="venus" unicode="&#xf221;" horiz-adv-x="1280" 
+d="M1152 960q0 -221 -147.5 -384.5t-364.5 -187.5v-260h224q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-224v-224q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v224h-224q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h224v260q-150 16 -271.5 103t-186 224t-52.5 292
+q11 134 80.5 249t182 188t245.5 88q170 19 319 -54t236 -212t87 -306zM128 960q0 -185 131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5z" />
+    <glyph glyph-name="_511" unicode="&#xf222;" 
+d="M1472 1408q26 0 45 -19t19 -45v-416q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v262l-382 -383q126 -156 126 -359q0 -117 -45.5 -223.5t-123 -184t-184 -123t-223.5 -45.5t-223.5 45.5t-184 123t-123 184t-45.5 223.5t45.5 223.5t123 184t184 123t223.5 45.5
+q203 0 359 -126l382 382h-261q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h416zM576 0q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" />
+    <glyph glyph-name="_512" unicode="&#xf223;" horiz-adv-x="1280" 
+d="M830 1220q145 -72 233.5 -210.5t88.5 -305.5q0 -221 -147.5 -384.5t-364.5 -187.5v-132h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96v-96q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v96h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96v132q-217 24 -364.5 187.5
+t-147.5 384.5q0 167 88.5 305.5t233.5 210.5q-165 96 -228 273q-6 16 3.5 29.5t26.5 13.5h69q21 0 29 -20q44 -106 140 -171t214 -65t214 65t140 171q8 20 37 20h61q17 0 26.5 -13.5t3.5 -29.5q-63 -177 -228 -273zM576 256q185 0 316.5 131.5t131.5 316.5t-131.5 316.5
+t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" />
+    <glyph glyph-name="_513" unicode="&#xf224;" 
+d="M1024 1504q0 14 9 23t23 9h288q26 0 45 -19t19 -45v-288q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v134l-254 -255q126 -158 126 -359q0 -221 -147.5 -384.5t-364.5 -187.5v-132h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96v-96q0 -14 -9 -23t-23 -9h-64
+q-14 0 -23 9t-9 23v96h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96v132q-149 16 -270.5 103t-186.5 223.5t-53 291.5q16 204 160 353.5t347 172.5q118 14 228 -19t198 -103l255 254h-134q-14 0 -23 9t-9 23v64zM576 256q185 0 316.5 131.5t131.5 316.5t-131.5 316.5
+t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" />
+    <glyph glyph-name="_514" unicode="&#xf225;" horiz-adv-x="1792" 
+d="M1280 1504q0 14 9 23t23 9h288q26 0 45 -19t19 -45v-288q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v134l-254 -255q126 -158 126 -359q0 -221 -147.5 -384.5t-364.5 -187.5v-132h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96v-96q0 -14 -9 -23t-23 -9h-64
+q-14 0 -23 9t-9 23v96h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96v132q-217 24 -364.5 187.5t-147.5 384.5q0 201 126 359l-52 53l-101 -111q-9 -10 -22 -10.5t-23 7.5l-48 44q-10 8 -10.5 21.5t8.5 23.5l105 115l-111 112v-134q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9
+t-9 23v288q0 26 19 45t45 19h288q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-133l106 -107l86 94q9 10 22 10.5t23 -7.5l48 -44q10 -8 10.5 -21.5t-8.5 -23.5l-90 -99l57 -56q158 126 359 126t359 -126l255 254h-134q-14 0 -23 9t-9 23v64zM832 256q185 0 316.5 131.5
+t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" />
+    <glyph glyph-name="_515" unicode="&#xf226;" horiz-adv-x="1792" 
+d="M1790 1007q12 -155 -52.5 -292t-186 -224t-271.5 -103v-260h224q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-224v-224q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v224h-512v-224q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v224h-224q-14 0 -23 9t-9 23v64q0 14 9 23
+t23 9h224v260q-150 16 -271.5 103t-186 224t-52.5 292q17 206 164.5 356.5t352.5 169.5q206 21 377 -94q171 115 377 94q205 -19 352.5 -169.5t164.5 -356.5zM896 647q128 131 128 313t-128 313q-128 -131 -128 -313t128 -313zM576 512q115 0 218 57q-154 165 -154 391
+q0 224 154 391q-103 57 -218 57q-185 0 -316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5zM1152 128v260q-137 15 -256 94q-119 -79 -256 -94v-260h512zM1216 512q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5q-115 0 -218 -57q154 -167 154 -391
+q0 -226 -154 -391q103 -57 218 -57z" />
+    <glyph glyph-name="_516" unicode="&#xf227;" horiz-adv-x="1920" 
+d="M1536 1120q0 14 9 23t23 9h288q26 0 45 -19t19 -45v-288q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v134l-254 -255q76 -95 107.5 -214t9.5 -247q-31 -182 -166 -312t-318 -156q-210 -29 -384.5 80t-241.5 300q-117 6 -221 57.5t-177.5 133t-113.5 192.5t-32 230
+q9 135 78 252t182 191.5t248 89.5q118 14 227.5 -19t198.5 -103l255 254h-134q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h288q26 0 45 -19t19 -45v-288q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v134l-254 -255q59 -74 93 -169q182 -9 328 -124l255 254h-134q-14 0 -23 9
+t-9 23v64zM1024 704q0 20 -4 58q-162 -25 -271 -150t-109 -292q0 -20 4 -58q162 25 271 150t109 292zM128 704q0 -168 111 -294t276 -149q-3 29 -3 59q0 210 135 369.5t338 196.5q-53 120 -163.5 193t-245.5 73q-185 0 -316.5 -131.5t-131.5 -316.5zM1088 -128
+q185 0 316.5 131.5t131.5 316.5q0 168 -111 294t-276 149q3 -28 3 -59q0 -210 -135 -369.5t-338 -196.5q53 -120 163.5 -193t245.5 -73z" />
+    <glyph glyph-name="_517" unicode="&#xf228;" horiz-adv-x="2048" 
+d="M1664 1504q0 14 9 23t23 9h288q26 0 45 -19t19 -45v-288q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v134l-254 -255q76 -95 107.5 -214t9.5 -247q-32 -180 -164.5 -310t-313.5 -157q-223 -34 -409 90q-117 -78 -256 -93v-132h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23
+t-23 -9h-96v-96q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v96h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96v132q-155 17 -279.5 109.5t-187 237.5t-39.5 307q25 187 159.5 322.5t320.5 164.5q224 34 410 -90q146 97 320 97q201 0 359 -126l255 254h-134q-14 0 -23 9
+t-9 23v64zM896 391q128 131 128 313t-128 313q-128 -131 -128 -313t128 -313zM128 704q0 -185 131.5 -316.5t316.5 -131.5q117 0 218 57q-154 167 -154 391t154 391q-101 57 -218 57q-185 0 -316.5 -131.5t-131.5 -316.5zM1216 256q185 0 316.5 131.5t131.5 316.5
+t-131.5 316.5t-316.5 131.5q-117 0 -218 -57q154 -167 154 -391t-154 -391q101 -57 218 -57z" />
+    <glyph glyph-name="_518" unicode="&#xf229;" 
+d="M1472 1408q26 0 45 -19t19 -45v-416q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v262l-213 -214l140 -140q9 -10 9 -23t-9 -22l-46 -46q-9 -9 -22 -9t-23 9l-140 141l-78 -79q126 -156 126 -359q0 -117 -45.5 -223.5t-123 -184t-184 -123t-223.5 -45.5t-223.5 45.5
+t-184 123t-123 184t-45.5 223.5t45.5 223.5t123 184t184 123t223.5 45.5q203 0 359 -126l78 78l-172 172q-9 10 -9 23t9 22l46 46q9 9 22 9t23 -9l172 -172l213 213h-261q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h416zM576 0q185 0 316.5 131.5t131.5 316.5t-131.5 316.5
+t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" />
+    <glyph glyph-name="_519" unicode="&#xf22a;" horiz-adv-x="1280" 
+d="M640 892q217 -24 364.5 -187.5t147.5 -384.5q0 -167 -87 -306t-236 -212t-319 -54q-133 15 -245.5 88t-182 188t-80.5 249q-12 155 52.5 292t186 224t271.5 103v132h-160q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h160v165l-92 -92q-10 -9 -23 -9t-22 9l-46 46q-9 9 -9 22
+t9 23l202 201q19 19 45 19t45 -19l202 -201q9 -10 9 -23t-9 -22l-46 -46q-9 -9 -22 -9t-23 9l-92 92v-165h160q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-160v-132zM576 -128q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5
+t131.5 -316.5t316.5 -131.5z" />
+    <glyph glyph-name="_520" unicode="&#xf22b;" horiz-adv-x="2048" 
+d="M1901 621q19 -19 19 -45t-19 -45l-294 -294q-9 -10 -22.5 -10t-22.5 10l-45 45q-10 9 -10 22.5t10 22.5l185 185h-294v-224q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v224h-132q-24 -217 -187.5 -364.5t-384.5 -147.5q-167 0 -306 87t-212 236t-54 319q15 133 88 245.5
+t188 182t249 80.5q155 12 292 -52.5t224 -186t103 -271.5h132v224q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-224h294l-185 185q-10 9 -10 22.5t10 22.5l45 45q9 10 22.5 10t22.5 -10zM576 128q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5
+t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" />
+    <glyph glyph-name="_521" unicode="&#xf22c;" horiz-adv-x="1280" 
+d="M1152 960q0 -221 -147.5 -384.5t-364.5 -187.5v-612q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v612q-217 24 -364.5 187.5t-147.5 384.5q0 117 45.5 223.5t123 184t184 123t223.5 45.5t223.5 -45.5t184 -123t123 -184t45.5 -223.5zM576 512q185 0 316.5 131.5
+t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" />
+    <glyph glyph-name="_522" unicode="&#xf22d;" horiz-adv-x="1280" 
+d="M1024 576q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5zM1152 576q0 -117 -45.5 -223.5t-123 -184t-184 -123t-223.5 -45.5t-223.5 45.5t-184 123t-123 184t-45.5 223.5t45.5 223.5t123 184t184 123
+t223.5 45.5t223.5 -45.5t184 -123t123 -184t45.5 -223.5z" />
+    <glyph glyph-name="_523" unicode="&#xf22e;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="_524" unicode="&#xf22f;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="_525" unicode="&#xf230;" 
+d="M1451 1408q35 0 60 -25t25 -60v-1366q0 -35 -25 -60t-60 -25h-391v595h199l30 232h-229v148q0 56 23.5 84t91.5 28l122 1v207q-63 9 -178 9q-136 0 -217.5 -80t-81.5 -226v-171h-200v-232h200v-595h-735q-35 0 -60 25t-25 60v1366q0 35 25 60t60 25h1366z" />
+    <glyph glyph-name="_526" unicode="&#xf231;" horiz-adv-x="1280" 
+d="M0 939q0 108 37.5 203.5t103.5 166.5t152 123t185 78t202 26q158 0 294 -66.5t221 -193.5t85 -287q0 -96 -19 -188t-60 -177t-100 -149.5t-145 -103t-189 -38.5q-68 0 -135 32t-96 88q-10 -39 -28 -112.5t-23.5 -95t-20.5 -71t-26 -71t-32 -62.5t-46 -77.5t-62 -86.5
+l-14 -5l-9 10q-15 157 -15 188q0 92 21.5 206.5t66.5 287.5t52 203q-32 65 -32 169q0 83 52 156t132 73q61 0 95 -40.5t34 -102.5q0 -66 -44 -191t-44 -187q0 -63 45 -104.5t109 -41.5q55 0 102 25t78.5 68t56 95t38 110.5t20 111t6.5 99.5q0 173 -109.5 269.5t-285.5 96.5
+q-200 0 -334 -129.5t-134 -328.5q0 -44 12.5 -85t27 -65t27 -45.5t12.5 -30.5q0 -28 -15 -73t-37 -45q-2 0 -17 3q-51 15 -90.5 56t-61 94.5t-32.5 108t-11 106.5z" />
+    <glyph glyph-name="_527" unicode="&#xf232;" 
+d="M985 562q13 0 97.5 -44t89.5 -53q2 -5 2 -15q0 -33 -17 -76q-16 -39 -71 -65.5t-102 -26.5q-57 0 -190 62q-98 45 -170 118t-148 185q-72 107 -71 194v8q3 91 74 158q24 22 52 22q6 0 18 -1.5t19 -1.5q19 0 26.5 -6.5t15.5 -27.5q8 -20 33 -88t25 -75q0 -21 -34.5 -57.5
+t-34.5 -46.5q0 -7 5 -15q34 -73 102 -137q56 -53 151 -101q12 -7 22 -7q15 0 54 48.5t52 48.5zM782 32q127 0 243.5 50t200.5 134t134 200.5t50 243.5t-50 243.5t-134 200.5t-200.5 134t-243.5 50t-243.5 -50t-200.5 -134t-134 -200.5t-50 -243.5q0 -203 120 -368l-79 -233
+l242 77q158 -104 345 -104zM782 1414q153 0 292.5 -60t240.5 -161t161 -240.5t60 -292.5t-60 -292.5t-161 -240.5t-240.5 -161t-292.5 -60q-195 0 -365 94l-417 -134l136 405q-108 178 -108 389q0 153 60 292.5t161 240.5t240.5 161t292.5 60z" />
+    <glyph glyph-name="_528" unicode="&#xf233;" horiz-adv-x="1792" 
+d="M128 128h1024v128h-1024v-128zM128 640h1024v128h-1024v-128zM1696 192q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM128 1152h1024v128h-1024v-128zM1696 704q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1696 1216
+q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1792 384v-384h-1792v384h1792zM1792 896v-384h-1792v384h1792zM1792 1408v-384h-1792v384h1792z" />
+    <glyph glyph-name="_529" unicode="&#xf234;" horiz-adv-x="2048" 
+d="M704 640q-159 0 -271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5t-112.5 -271.5t-271.5 -112.5zM1664 512h352q13 0 22.5 -9.5t9.5 -22.5v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-352v-352q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5
+t-9.5 22.5v352h-352q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h352v352q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5v-352zM928 288q0 -52 38 -90t90 -38h256v-238q-68 -50 -171 -50h-874q-121 0 -194 69t-73 190q0 53 3.5 103.5t14 109t26.5 108.5
+t43 97.5t62 81t85.5 53.5t111.5 20q19 0 39 -17q79 -61 154.5 -91.5t164.5 -30.5t164.5 30.5t154.5 91.5q20 17 39 17q132 0 217 -96h-223q-52 0 -90 -38t-38 -90v-192z" />
+    <glyph glyph-name="_530" unicode="&#xf235;" horiz-adv-x="2048" 
+d="M704 640q-159 0 -271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5t-112.5 -271.5t-271.5 -112.5zM1781 320l249 -249q9 -9 9 -23q0 -13 -9 -22l-136 -136q-9 -9 -22 -9q-14 0 -23 9l-249 249l-249 -249q-9 -9 -23 -9q-13 0 -22 9l-136 136
+q-9 9 -9 22q0 14 9 23l249 249l-249 249q-9 9 -9 23q0 13 9 22l136 136q9 9 22 9q14 0 23 -9l249 -249l249 249q9 9 23 9q13 0 22 -9l136 -136q9 -9 9 -22q0 -14 -9 -23zM1283 320l-181 -181q-37 -37 -37 -91q0 -53 37 -90l83 -83q-21 -3 -44 -3h-874q-121 0 -194 69
+t-73 190q0 53 3.5 103.5t14 109t26.5 108.5t43 97.5t62 81t85.5 53.5t111.5 20q19 0 39 -17q154 -122 319 -122t319 122q20 17 39 17q28 0 57 -6q-28 -27 -41 -50t-13 -56q0 -54 37 -91z" />
+    <glyph glyph-name="_531" unicode="&#xf236;" horiz-adv-x="2048" 
+d="M256 512h1728q26 0 45 -19t19 -45v-448h-256v256h-1536v-256h-256v1216q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-704zM832 832q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM2048 576v64q0 159 -112.5 271.5t-271.5 112.5h-704
+q-26 0 -45 -19t-19 -45v-384h1152z" />
+    <glyph glyph-name="_532" unicode="&#xf237;" 
+d="M1536 1536l-192 -448h192v-192h-274l-55 -128h329v-192h-411l-357 -832l-357 832h-411v192h329l-55 128h-274v192h192l-192 448h256l323 -768h378l323 768h256zM768 320l108 256h-216z" />
+    <glyph glyph-name="_533" unicode="&#xf238;" 
+d="M1088 1536q185 0 316.5 -93.5t131.5 -226.5v-896q0 -130 -125.5 -222t-305.5 -97l213 -202q16 -15 8 -35t-30 -20h-1056q-22 0 -30 20t8 35l213 202q-180 5 -305.5 97t-125.5 222v896q0 133 131.5 226.5t316.5 93.5h640zM768 192q80 0 136 56t56 136t-56 136t-136 56
+t-136 -56t-56 -136t56 -136t136 -56zM1344 768v512h-1152v-512h1152z" />
+    <glyph glyph-name="_534" unicode="&#xf239;" 
+d="M1088 1536q185 0 316.5 -93.5t131.5 -226.5v-896q0 -130 -125.5 -222t-305.5 -97l213 -202q16 -15 8 -35t-30 -20h-1056q-22 0 -30 20t8 35l213 202q-180 5 -305.5 97t-125.5 222v896q0 133 131.5 226.5t316.5 93.5h640zM288 224q66 0 113 47t47 113t-47 113t-113 47
+t-113 -47t-47 -113t47 -113t113 -47zM704 768v512h-544v-512h544zM1248 224q66 0 113 47t47 113t-47 113t-113 47t-113 -47t-47 -113t47 -113t113 -47zM1408 768v512h-576v-512h576z" />
+    <glyph glyph-name="_535" unicode="&#xf23a;" horiz-adv-x="1792" 
+d="M597 1115v-1173q0 -25 -12.5 -42.5t-36.5 -17.5q-17 0 -33 8l-465 233q-21 10 -35.5 33.5t-14.5 46.5v1140q0 20 10 34t29 14q14 0 44 -15l511 -256q3 -3 3 -5zM661 1014l534 -866l-534 266v600zM1792 996v-1054q0 -25 -14 -40.5t-38 -15.5t-47 13l-441 220zM1789 1116
+q0 -3 -256.5 -419.5t-300.5 -487.5l-390 634l324 527q17 28 52 28q14 0 26 -6l541 -270q4 -2 4 -6z" />
+    <glyph glyph-name="_536" unicode="&#xf23b;" 
+d="M809 532l266 499h-112l-157 -312q-24 -48 -44 -92l-42 92l-155 312h-120l263 -493v-324h101v318zM1536 1408v-1536h-1536v1536h1536z" />
+    <glyph glyph-name="_537" unicode="&#xf23c;" horiz-adv-x="2296" 
+d="M478 -139q-8 -16 -27 -34.5t-37 -25.5q-25 -9 -51.5 3.5t-28.5 31.5q-1 22 40 55t68 38q23 4 34 -21.5t2 -46.5zM1819 -139q7 -16 26 -34.5t38 -25.5q25 -9 51.5 3.5t27.5 31.5q2 22 -39.5 55t-68.5 38q-22 4 -33 -21.5t-2 -46.5zM1867 -30q13 -27 56.5 -59.5t77.5 -41.5
+q45 -13 82 4.5t37 50.5q0 46 -67.5 100.5t-115.5 59.5q-40 5 -63.5 -37.5t-6.5 -76.5zM428 -30q-13 -27 -56 -59.5t-77 -41.5q-45 -13 -82 4.5t-37 50.5q0 46 67.5 100.5t115.5 59.5q40 5 63 -37.5t6 -76.5zM1158 1094h1q-41 0 -76 -15q27 -8 44 -30.5t17 -49.5
+q0 -35 -27 -60t-65 -25q-52 0 -80 43q-5 -23 -5 -42q0 -74 56 -126.5t135 -52.5q80 0 136 52.5t56 126.5t-56 126.5t-136 52.5zM1462 1312q-99 109 -220.5 131.5t-245.5 -44.5q27 60 82.5 96.5t118 39.5t121.5 -17t99.5 -74.5t44.5 -131.5zM2212 73q8 -11 -11 -42
+q7 -23 7 -40q1 -56 -44.5 -112.5t-109.5 -91.5t-118 -37q-48 -2 -92 21.5t-66 65.5q-687 -25 -1259 0q-23 -41 -66.5 -65t-92.5 -22q-86 3 -179.5 80.5t-92.5 160.5q2 22 7 40q-19 31 -11 42q6 10 31 1q14 22 41 51q-7 29 2 38q11 10 39 -4q29 20 59 34q0 29 13 37
+q23 12 51 -16q35 5 61 -2q18 -4 38 -19v73q-11 0 -18 2q-53 10 -97 44.5t-55 87.5q-9 38 0 81q15 62 93 95q2 17 19 35.5t36 23.5t33 -7.5t19 -30.5h13q46 -5 60 -23q3 -3 5 -7q10 1 30.5 3.5t30.5 3.5q-15 11 -30 17q-23 40 -91 43q0 6 1 10q-62 2 -118.5 18.5t-84.5 47.5
+q-32 36 -42.5 92t-2.5 112q16 126 90 179q23 16 52 4.5t32 -40.5q0 -1 1.5 -14t2.5 -21t3 -20t5.5 -19t8.5 -10q27 -14 76 -12q48 46 98 74q-40 4 -162 -14l47 46q61 58 163 111q145 73 282 86q-20 8 -41 15.5t-47 14t-42.5 10.5t-47.5 11t-43 10q595 126 904 -139
+q98 -84 158 -222q85 -10 121 9h1q5 3 8.5 10t5.5 19t3 19.5t3 21.5l1 14q3 28 32 40t52 -5q73 -52 91 -178q7 -57 -3.5 -113t-42.5 -91q-28 -32 -83.5 -48.5t-115.5 -18.5v-10q-71 -2 -95 -43q-14 -5 -31 -17q11 -1 32 -3.5t30 -3.5q1 5 5 8q16 18 60 23h13q5 18 19 30t33 8
+t36 -23t19 -36q79 -32 93 -95q9 -40 1 -81q-12 -53 -56 -88t-97 -44q-10 -2 -17 -2q0 -49 -1 -73q20 15 38 19q26 7 61 2q28 28 51 16q14 -9 14 -37q33 -16 59 -34q27 13 38 4q10 -10 2 -38q28 -30 41 -51q23 8 31 -1zM1937 1025q0 -29 -9 -54q82 -32 112 -132
+q4 37 -9.5 98.5t-41.5 90.5q-20 19 -36 17t-16 -20zM1859 925q35 -42 47.5 -108.5t-0.5 -124.5q67 13 97 45q13 14 18 28q-3 64 -31 114.5t-79 66.5q-15 -15 -52 -21zM1822 921q-30 0 -44 1q42 -115 53 -239q21 0 43 3q16 68 1 135t-53 100zM258 839q30 100 112 132
+q-9 25 -9 54q0 18 -16.5 20t-35.5 -17q-28 -29 -41.5 -90.5t-9.5 -98.5zM294 737q29 -31 97 -45q-13 58 -0.5 124.5t47.5 108.5v0q-37 6 -52 21q-51 -16 -78.5 -66t-31.5 -115q9 -17 18 -28zM471 683q14 124 73 235q-19 -4 -55 -18l-45 -19v1q-46 -89 -20 -196q25 -3 47 -3z
+M1434 644q8 -38 16.5 -108.5t11.5 -89.5q3 -18 9.5 -21.5t23.5 4.5q40 20 62 85.5t23 125.5q-24 2 -146 4zM1152 1285q-116 0 -199 -82.5t-83 -198.5q0 -117 83 -199.5t199 -82.5t199 82.5t83 199.5q0 116 -83 198.5t-199 82.5zM1380 646q-105 2 -211 0v1q-1 -27 2.5 -86
+t13.5 -66q29 -14 93.5 -14.5t95.5 10.5q9 3 11 39t-0.5 69.5t-4.5 46.5zM1112 447q8 4 9.5 48t-0.5 88t-4 63v1q-212 -3 -214 -3q-4 -20 -7 -62t0 -83t14 -46q34 -15 101 -16t101 10zM718 636q-16 -59 4.5 -118.5t77.5 -84.5q15 -8 24 -5t12 21q3 16 8 90t10 103
+q-69 -2 -136 -6zM591 510q3 -23 -34 -36q132 -141 271.5 -240t305.5 -154q172 49 310.5 146t293.5 250q-33 13 -30 34q0 2 0.5 3.5t1.5 3t1 2.5v1v-1q-17 2 -50 5.5t-48 4.5q-26 -90 -82 -132q-51 -38 -82 1q-5 6 -9 14q-7 13 -17 62q-2 -5 -5 -9t-7.5 -7t-8 -5.5t-9.5 -4
+l-10 -2.5t-12 -2l-12 -1.5t-13.5 -1t-13.5 -0.5q-106 -9 -163 11q-4 -17 -10 -26.5t-21 -15t-23 -7t-36 -3.5q-6 -1 -9 -1q-179 -17 -203 40q-2 -63 -56 -54q-47 8 -91 54q-12 13 -20 26q-17 29 -26 65q-58 -6 -87 -10q1 -2 4 -10zM507 -118q3 14 3 30q-17 71 -51 130
+t-73 70q-41 12 -101.5 -14.5t-104.5 -80t-39 -107.5q35 -53 100 -93t119 -42q51 -2 94 28t53 79zM510 53q23 -63 27 -119q195 113 392 174q-98 52 -180.5 120t-179.5 165q-6 -4 -29 -13q0 -1 -1 -4t-1 -5q31 -18 22 -37q-12 -23 -56 -34q-10 -13 -29 -24h-1q-2 -83 1 -150
+q19 -34 35 -73zM579 -113q532 -21 1145 0q-254 147 -428 196q-76 -35 -156 -57q-8 -3 -16 0q-65 21 -129 49q-208 -60 -416 -188h-1v-1q1 0 1 1zM1763 -67q4 54 28 120q14 38 33 71l-1 -1q3 77 3 153q-15 8 -30 25q-42 9 -56 33q-9 20 22 38q-2 4 -2 9q-16 4 -28 12
+q-204 -190 -383 -284q198 -59 414 -176zM2155 -90q5 54 -39 107.5t-104 80t-102 14.5q-38 -11 -72.5 -70.5t-51.5 -129.5q0 -16 3 -30q10 -49 53 -79t94 -28q54 2 119 42t100 93z" />
+    <glyph glyph-name="_538" unicode="&#xf23d;" horiz-adv-x="2304" 
+d="M1524 -25q0 -68 -48 -116t-116 -48t-116.5 48t-48.5 116t48.5 116.5t116.5 48.5t116 -48.5t48 -116.5zM775 -25q0 -68 -48.5 -116t-116.5 -48t-116 48t-48 116t48 116.5t116 48.5t116.5 -48.5t48.5 -116.5zM0 1469q57 -60 110.5 -104.5t121 -82t136 -63t166 -45.5
+t200 -31.5t250 -18.5t304 -9.5t372.5 -2.5q139 0 244.5 -5t181 -16.5t124 -27.5t71 -39.5t24 -51.5t-19.5 -64t-56.5 -76.5t-89.5 -91t-116 -104.5t-139 -119q-185 -157 -286 -247q29 51 76.5 109t94 105.5t94.5 98.5t83 91.5t54 80.5t13 70t-45.5 55.5t-116.5 41t-204 23.5
+t-304 5q-168 -2 -314 6t-256 23t-204.5 41t-159.5 51.5t-122.5 62.5t-91.5 66.5t-68 71.5t-50.5 69.5t-40 68t-36.5 59.5z" />
+    <glyph glyph-name="_539" unicode="&#xf23e;" horiz-adv-x="1792" 
+d="M896 1472q-169 0 -323 -66t-265.5 -177.5t-177.5 -265.5t-66 -323t66 -323t177.5 -265.5t265.5 -177.5t323 -66t323 66t265.5 177.5t177.5 265.5t66 323t-66 323t-177.5 265.5t-265.5 177.5t-323 66zM896 1536q182 0 348 -71t286 -191t191 -286t71 -348t-71 -348
+t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71zM496 704q16 0 16 -16v-480q0 -16 -16 -16h-32q-16 0 -16 16v480q0 16 16 16h32zM896 640q53 0 90.5 -37.5t37.5 -90.5q0 -35 -17.5 -64t-46.5 -46v-114q0 -14 -9 -23
+t-23 -9h-64q-14 0 -23 9t-9 23v114q-29 17 -46.5 46t-17.5 64q0 53 37.5 90.5t90.5 37.5zM896 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM544 928v-96
+q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v96q0 93 65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5v-96q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v96q0 146 -103 249t-249 103t-249 -103t-103 -249zM1408 192v512q0 26 -19 45t-45 19h-896q-26 0 -45 -19t-19 -45v-512
+q0 -26 19 -45t45 -19h896q26 0 45 19t19 45z" />
+    <glyph glyph-name="_540" unicode="&#xf240;" horiz-adv-x="2304" 
+d="M1920 1024v-768h-1664v768h1664zM2048 448h128v384h-128v288q0 14 -9 23t-23 9h-1856q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h1856q14 0 23 9t9 23v288zM2304 832v-384q0 -53 -37.5 -90.5t-90.5 -37.5v-160q0 -66 -47 -113t-113 -47h-1856q-66 0 -113 47t-47 113
+v960q0 66 47 113t113 47h1856q66 0 113 -47t47 -113v-160q53 0 90.5 -37.5t37.5 -90.5z" />
+    <glyph glyph-name="_541" unicode="&#xf241;" horiz-adv-x="2304" 
+d="M256 256v768h1280v-768h-1280zM2176 960q53 0 90.5 -37.5t37.5 -90.5v-384q0 -53 -37.5 -90.5t-90.5 -37.5v-160q0 -66 -47 -113t-113 -47h-1856q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h1856q66 0 113 -47t47 -113v-160zM2176 448v384h-128v288q0 14 -9 23t-23 9
+h-1856q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h1856q14 0 23 9t9 23v288h128z" />
+    <glyph glyph-name="_542" unicode="&#xf242;" horiz-adv-x="2304" 
+d="M256 256v768h896v-768h-896zM2176 960q53 0 90.5 -37.5t37.5 -90.5v-384q0 -53 -37.5 -90.5t-90.5 -37.5v-160q0 -66 -47 -113t-113 -47h-1856q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h1856q66 0 113 -47t47 -113v-160zM2176 448v384h-128v288q0 14 -9 23t-23 9
+h-1856q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h1856q14 0 23 9t9 23v288h128z" />
+    <glyph glyph-name="_543" unicode="&#xf243;" horiz-adv-x="2304" 
+d="M256 256v768h512v-768h-512zM2176 960q53 0 90.5 -37.5t37.5 -90.5v-384q0 -53 -37.5 -90.5t-90.5 -37.5v-160q0 -66 -47 -113t-113 -47h-1856q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h1856q66 0 113 -47t47 -113v-160zM2176 448v384h-128v288q0 14 -9 23t-23 9
+h-1856q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h1856q14 0 23 9t9 23v288h128z" />
+    <glyph glyph-name="_544" unicode="&#xf244;" horiz-adv-x="2304" 
+d="M2176 960q53 0 90.5 -37.5t37.5 -90.5v-384q0 -53 -37.5 -90.5t-90.5 -37.5v-160q0 -66 -47 -113t-113 -47h-1856q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h1856q66 0 113 -47t47 -113v-160zM2176 448v384h-128v288q0 14 -9 23t-23 9h-1856q-14 0 -23 -9t-9 -23
+v-960q0 -14 9 -23t23 -9h1856q14 0 23 9t9 23v288h128z" />
+    <glyph glyph-name="_545" unicode="&#xf245;" horiz-adv-x="1280" 
+d="M1133 493q31 -30 14 -69q-17 -40 -59 -40h-382l201 -476q10 -25 0 -49t-34 -35l-177 -75q-25 -10 -49 0t-35 34l-191 452l-312 -312q-19 -19 -45 -19q-12 0 -24 5q-40 17 -40 59v1504q0 42 40 59q12 5 24 5q27 0 45 -19z" />
+    <glyph glyph-name="_546" unicode="&#xf246;" horiz-adv-x="1024" 
+d="M832 1408q-320 0 -320 -224v-416h128v-128h-128v-544q0 -224 320 -224h64v-128h-64q-272 0 -384 146q-112 -146 -384 -146h-64v128h64q320 0 320 224v544h-128v128h128v416q0 224 -320 224h-64v128h64q272 0 384 -146q112 146 384 146h64v-128h-64z" />
+    <glyph glyph-name="_547" unicode="&#xf247;" horiz-adv-x="2048" 
+d="M2048 1152h-128v-1024h128v-384h-384v128h-1280v-128h-384v384h128v1024h-128v384h384v-128h1280v128h384v-384zM1792 1408v-128h128v128h-128zM128 1408v-128h128v128h-128zM256 -128v128h-128v-128h128zM1664 0v128h128v1024h-128v128h-1280v-128h-128v-1024h128v-128
+h1280zM1920 -128v128h-128v-128h128zM1280 896h384v-768h-896v256h-384v768h896v-256zM512 512h640v512h-640v-512zM1536 256v512h-256v-384h-384v-128h640z" />
+    <glyph glyph-name="_548" unicode="&#xf248;" horiz-adv-x="2304" 
+d="M2304 768h-128v-640h128v-384h-384v128h-896v-128h-384v384h128v128h-384v-128h-384v384h128v640h-128v384h384v-128h896v128h384v-384h-128v-128h384v128h384v-384zM2048 1024v-128h128v128h-128zM1408 1408v-128h128v128h-128zM128 1408v-128h128v128h-128zM256 256
+v128h-128v-128h128zM1536 384h-128v-128h128v128zM384 384h896v128h128v640h-128v128h-896v-128h-128v-640h128v-128zM896 -128v128h-128v-128h128zM2176 -128v128h-128v-128h128zM2048 128v640h-128v128h-384v-384h128v-384h-384v128h-384v-128h128v-128h896v128h128z" />
+    <glyph glyph-name="_549" unicode="&#xf249;" 
+d="M1024 288v-416h-928q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h1344q40 0 68 -28t28 -68v-928h-416q-40 0 -68 -28t-28 -68zM1152 256h381q-15 -82 -65 -132l-184 -184q-50 -50 -132 -65v381z" />
+    <glyph glyph-name="_550" unicode="&#xf24a;" 
+d="M1400 256h-248v-248q29 10 41 22l185 185q12 12 22 41zM1120 384h288v896h-1280v-1280h896v288q0 40 28 68t68 28zM1536 1312v-1024q0 -40 -20 -88t-48 -76l-184 -184q-28 -28 -76 -48t-88 -20h-1024q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h1344q40 0 68 -28t28 -68
+z" />
+    <glyph glyph-name="_551" unicode="&#xf24b;" horiz-adv-x="2304" 
+d="M1951 538q0 -26 -15.5 -44.5t-38.5 -23.5q-8 -2 -18 -2h-153v140h153q10 0 18 -2q23 -5 38.5 -23.5t15.5 -44.5zM1933 751q0 -25 -15 -42t-38 -21q-3 -1 -15 -1h-139v129h139q3 0 8.5 -0.5t6.5 -0.5q23 -4 38 -21.5t15 -42.5zM728 587v308h-228v-308q0 -58 -38 -94.5
+t-105 -36.5q-108 0 -229 59v-112q53 -15 121 -23t109 -9l42 -1q328 0 328 217zM1442 403v113q-99 -52 -200 -59q-108 -8 -169 41t-61 142t61 142t169 41q101 -7 200 -58v112q-48 12 -100 19.5t-80 9.5l-28 2q-127 6 -218.5 -14t-140.5 -60t-71 -88t-22 -106t22 -106t71 -88
+t140.5 -60t218.5 -14q101 4 208 31zM2176 518q0 54 -43 88.5t-109 39.5v3q57 8 89 41.5t32 79.5q0 55 -41 88t-107 36q-3 0 -12 0.5t-14 0.5h-455v-510h491q74 0 121.5 36.5t47.5 96.5zM2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90
+t90 38h2048q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="_552" unicode="&#xf24c;" horiz-adv-x="2304" 
+d="M858 295v693q-106 -41 -172 -135.5t-66 -211.5t66 -211.5t172 -134.5zM1362 641q0 117 -66 211.5t-172 135.5v-694q106 41 172 135.5t66 211.5zM1577 641q0 -159 -78.5 -294t-213.5 -213.5t-294 -78.5q-119 0 -227.5 46.5t-187 125t-125 187t-46.5 227.5q0 159 78.5 294
+t213.5 213.5t294 78.5t294 -78.5t213.5 -213.5t78.5 -294zM1960 634q0 139 -55.5 261.5t-147.5 205.5t-213.5 131t-252.5 48h-301q-176 0 -323.5 -81t-235 -230t-87.5 -335q0 -171 87 -317.5t236 -231.5t323 -85h301q129 0 251.5 50.5t214.5 135t147.5 202.5t55.5 246z
+M2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h2048q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="_553" unicode="&#xf24d;" horiz-adv-x="1792" 
+d="M1664 -96v1088q0 13 -9.5 22.5t-22.5 9.5h-1088q-13 0 -22.5 -9.5t-9.5 -22.5v-1088q0 -13 9.5 -22.5t22.5 -9.5h1088q13 0 22.5 9.5t9.5 22.5zM1792 992v-1088q0 -66 -47 -113t-113 -47h-1088q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1088q66 0 113 -47t47 -113
+zM1408 1376v-160h-128v160q0 13 -9.5 22.5t-22.5 9.5h-1088q-13 0 -22.5 -9.5t-9.5 -22.5v-1088q0 -13 9.5 -22.5t22.5 -9.5h160v-128h-160q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1088q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="_554" unicode="&#xf24e;" horiz-adv-x="2304" 
+d="M1728 1088l-384 -704h768zM448 1088l-384 -704h768zM1269 1280q-14 -40 -45.5 -71.5t-71.5 -45.5v-1291h608q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1344q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h608v1291q-40 14 -71.5 45.5t-45.5 71.5h-491q-14 0 -23 9t-9 23v64
+q0 14 9 23t23 9h491q21 57 70 92.5t111 35.5t111 -35.5t70 -92.5h491q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-491zM1088 1264q33 0 56.5 23.5t23.5 56.5t-23.5 56.5t-56.5 23.5t-56.5 -23.5t-23.5 -56.5t23.5 -56.5t56.5 -23.5zM2176 384q0 -73 -46.5 -131t-117.5 -91
+t-144.5 -49.5t-139.5 -16.5t-139.5 16.5t-144.5 49.5t-117.5 91t-46.5 131q0 11 35 81t92 174.5t107 195.5t102 184t56 100q18 33 56 33t56 -33q4 -7 56 -100t102 -184t107 -195.5t92 -174.5t35 -81zM896 384q0 -73 -46.5 -131t-117.5 -91t-144.5 -49.5t-139.5 -16.5
+t-139.5 16.5t-144.5 49.5t-117.5 91t-46.5 131q0 11 35 81t92 174.5t107 195.5t102 184t56 100q18 33 56 33t56 -33q4 -7 56 -100t102 -184t107 -195.5t92 -174.5t35 -81z" />
+    <glyph glyph-name="_555" unicode="&#xf250;" 
+d="M1408 1408q0 -261 -106.5 -461.5t-266.5 -306.5q160 -106 266.5 -306.5t106.5 -461.5h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1472q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96q0 261 106.5 461.5t266.5 306.5q-160 106 -266.5 306.5t-106.5 461.5h-96q-14 0 -23 9
+t-9 23v64q0 14 9 23t23 9h1472q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96zM874 700q77 29 149 92.5t129.5 152.5t92.5 210t35 253h-1024q0 -132 35 -253t92.5 -210t129.5 -152.5t149 -92.5q19 -7 30.5 -23.5t11.5 -36.5t-11.5 -36.5t-30.5 -23.5q-77 -29 -149 -92.5
+t-129.5 -152.5t-92.5 -210t-35 -253h1024q0 132 -35 253t-92.5 210t-129.5 152.5t-149 92.5q-19 7 -30.5 23.5t-11.5 36.5t11.5 36.5t30.5 23.5z" />
+    <glyph glyph-name="_556" unicode="&#xf251;" 
+d="M1408 1408q0 -261 -106.5 -461.5t-266.5 -306.5q160 -106 266.5 -306.5t106.5 -461.5h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1472q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96q0 261 106.5 461.5t266.5 306.5q-160 106 -266.5 306.5t-106.5 461.5h-96q-14 0 -23 9
+t-9 23v64q0 14 9 23t23 9h1472q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96zM1280 1408h-1024q0 -66 9 -128h1006q9 61 9 128zM1280 -128q0 130 -34 249.5t-90.5 208t-126.5 152t-146 94.5h-230q-76 -31 -146 -94.5t-126.5 -152t-90.5 -208t-34 -249.5h1024z" />
+    <glyph glyph-name="_557" unicode="&#xf252;" 
+d="M1408 1408q0 -261 -106.5 -461.5t-266.5 -306.5q160 -106 266.5 -306.5t106.5 -461.5h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1472q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96q0 261 106.5 461.5t266.5 306.5q-160 106 -266.5 306.5t-106.5 461.5h-96q-14 0 -23 9
+t-9 23v64q0 14 9 23t23 9h1472q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96zM1280 1408h-1024q0 -206 85 -384h854q85 178 85 384zM1223 192q-54 141 -145.5 241.5t-194.5 142.5h-230q-103 -42 -194.5 -142.5t-145.5 -241.5h910z" />
+    <glyph glyph-name="_558" unicode="&#xf253;" 
+d="M1408 1408q0 -261 -106.5 -461.5t-266.5 -306.5q160 -106 266.5 -306.5t106.5 -461.5h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1472q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96q0 261 106.5 461.5t266.5 306.5q-160 106 -266.5 306.5t-106.5 461.5h-96q-14 0 -23 9
+t-9 23v64q0 14 9 23t23 9h1472q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96zM874 700q77 29 149 92.5t129.5 152.5t92.5 210t35 253h-1024q0 -132 35 -253t92.5 -210t129.5 -152.5t149 -92.5q19 -7 30.5 -23.5t11.5 -36.5t-11.5 -36.5t-30.5 -23.5q-137 -51 -244 -196
+h700q-107 145 -244 196q-19 7 -30.5 23.5t-11.5 36.5t11.5 36.5t30.5 23.5z" />
+    <glyph glyph-name="_559" unicode="&#xf254;" 
+d="M1504 -64q14 0 23 -9t9 -23v-128q0 -14 -9 -23t-23 -9h-1472q-14 0 -23 9t-9 23v128q0 14 9 23t23 9h1472zM130 0q3 55 16 107t30 95t46 87t53.5 76t64.5 69.5t66 60t70.5 55t66.5 47.5t65 43q-43 28 -65 43t-66.5 47.5t-70.5 55t-66 60t-64.5 69.5t-53.5 76t-46 87
+t-30 95t-16 107h1276q-3 -55 -16 -107t-30 -95t-46 -87t-53.5 -76t-64.5 -69.5t-66 -60t-70.5 -55t-66.5 -47.5t-65 -43q43 -28 65 -43t66.5 -47.5t70.5 -55t66 -60t64.5 -69.5t53.5 -76t46 -87t30 -95t16 -107h-1276zM1504 1536q14 0 23 -9t9 -23v-128q0 -14 -9 -23t-23 -9
+h-1472q-14 0 -23 9t-9 23v128q0 14 9 23t23 9h1472z" />
+    <glyph glyph-name="_560" unicode="&#xf255;" 
+d="M768 1152q-53 0 -90.5 -37.5t-37.5 -90.5v-128h-32v93q0 48 -32 81.5t-80 33.5q-46 0 -79 -33t-33 -79v-429l-32 30v172q0 48 -32 81.5t-80 33.5q-46 0 -79 -33t-33 -79v-224q0 -47 35 -82l310 -296q39 -39 39 -102q0 -26 19 -45t45 -19h640q26 0 45 19t19 45v25
+q0 41 10 77l108 436q10 36 10 77v246q0 48 -32 81.5t-80 33.5q-46 0 -79 -33t-33 -79v-32h-32v125q0 40 -25 72.5t-64 40.5q-14 2 -23 2q-46 0 -79 -33t-33 -79v-128h-32v122q0 51 -32.5 89.5t-82.5 43.5q-5 1 -13 1zM768 1280q84 0 149 -50q57 34 123 34q59 0 111 -27
+t86 -76q27 7 59 7q100 0 170 -71.5t70 -171.5v-246q0 -51 -13 -108l-109 -436q-6 -24 -6 -71q0 -80 -56 -136t-136 -56h-640q-84 0 -138 58.5t-54 142.5l-308 296q-76 73 -76 175v224q0 99 70.5 169.5t169.5 70.5q11 0 16 -1q6 95 75.5 160t164.5 65q52 0 98 -21
+q72 69 174 69z" />
+    <glyph glyph-name="_561" unicode="&#xf256;" horiz-adv-x="1792" 
+d="M880 1408q-46 0 -79 -33t-33 -79v-656h-32v528q0 46 -33 79t-79 33t-79 -33t-33 -79v-528v-256l-154 205q-38 51 -102 51q-53 0 -90.5 -37.5t-37.5 -90.5q0 -43 26 -77l384 -512q38 -51 102 -51h688q34 0 61 22t34 56l76 405q5 32 5 59v498q0 46 -33 79t-79 33t-79 -33
+t-33 -79v-272h-32v528q0 46 -33 79t-79 33t-79 -33t-33 -79v-528h-32v656q0 46 -33 79t-79 33zM880 1536q68 0 125.5 -35.5t88.5 -96.5q19 4 42 4q99 0 169.5 -70.5t70.5 -169.5v-17q105 6 180.5 -64t75.5 -175v-498q0 -40 -8 -83l-76 -404q-14 -79 -76.5 -131t-143.5 -52
+h-688q-60 0 -114.5 27.5t-90.5 74.5l-384 512q-51 68 -51 154q0 106 75 181t181 75q78 0 128 -34v434q0 99 70.5 169.5t169.5 70.5q23 0 42 -4q31 61 88.5 96.5t125.5 35.5z" />
+    <glyph glyph-name="_562" unicode="&#xf257;" horiz-adv-x="1792" 
+d="M1073 -128h-177q-163 0 -226 141q-23 49 -23 102v5q-62 30 -98.5 88.5t-36.5 127.5q0 38 5 48h-261q-106 0 -181 75t-75 181t75 181t181 75h113l-44 17q-74 28 -119.5 93.5t-45.5 145.5q0 106 75 181t181 75q46 0 91 -17l628 -239h401q106 0 181 -75t75 -181v-668
+q0 -88 -54 -157.5t-140 -90.5l-339 -85q-92 -23 -186 -23zM1024 583l-155 -71l-163 -74q-30 -14 -48 -41.5t-18 -60.5q0 -46 33 -79t79 -33q26 0 46 10l338 154q-49 10 -80.5 50t-31.5 90v55zM1344 272q0 46 -33 79t-79 33q-26 0 -46 -10l-290 -132q-28 -13 -37 -17
+t-30.5 -17t-29.5 -23.5t-16 -29t-8 -40.5q0 -50 31.5 -82t81.5 -32q20 0 38 9l352 160q30 14 48 41.5t18 60.5zM1112 1024l-650 248q-24 8 -46 8q-53 0 -90.5 -37.5t-37.5 -90.5q0 -40 22.5 -73t59.5 -47l526 -200v-64h-640q-53 0 -90.5 -37.5t-37.5 -90.5t37.5 -90.5
+t90.5 -37.5h535l233 106v198q0 63 46 106l111 102h-69zM1073 0q82 0 155 19l339 85q43 11 70 45.5t27 78.5v668q0 53 -37.5 90.5t-90.5 37.5h-308l-136 -126q-36 -33 -36 -82v-296q0 -46 33 -77t79 -31t79 35t33 81v208h32v-208q0 -70 -57 -114q52 -8 86.5 -48.5t34.5 -93.5
+q0 -42 -23 -78t-61 -53l-310 -141h91z" />
+    <glyph glyph-name="_563" unicode="&#xf258;" horiz-adv-x="2048" 
+d="M1151 1536q61 0 116 -28t91 -77l572 -781q118 -159 118 -359v-355q0 -80 -56 -136t-136 -56h-384q-80 0 -136 56t-56 136v177l-286 143h-546q-80 0 -136 56t-56 136v32q0 119 84.5 203.5t203.5 84.5h420l42 128h-686q-100 0 -173.5 67.5t-81.5 166.5q-65 79 -65 182v32
+q0 80 56 136t136 56h959zM1920 -64v355q0 157 -93 284l-573 781q-39 52 -103 52h-959q-26 0 -45 -19t-19 -45q0 -32 1.5 -49.5t9.5 -40.5t25 -43q10 31 35.5 50t56.5 19h832v-32h-832q-26 0 -45 -19t-19 -45q0 -44 3 -58q8 -44 44 -73t81 -29h640h91q40 0 68 -28t28 -68
+q0 -15 -5 -30l-64 -192q-10 -29 -35 -47.5t-56 -18.5h-443q-66 0 -113 -47t-47 -113v-32q0 -26 19 -45t45 -19h561q16 0 29 -7l317 -158q24 -13 38.5 -36t14.5 -50v-197q0 -26 19 -45t45 -19h384q26 0 45 19t19 45z" />
+    <glyph glyph-name="_564" unicode="&#xf259;" horiz-adv-x="2048" 
+d="M459 -256q-77 0 -137.5 47.5t-79.5 122.5l-101 401q-13 57 -13 108q0 45 -5 67l-116 477q-7 27 -7 57q0 93 62 161t155 78q17 85 82.5 139t152.5 54q83 0 148 -51.5t85 -132.5l83 -348l103 428q20 81 85 132.5t148 51.5q89 0 155.5 -57.5t80.5 -144.5q92 -10 152 -79
+t60 -162q0 -24 -7 -59l-123 -512q10 7 37.5 28.5t38.5 29.5t35 23t41 20.5t41.5 11t49.5 5.5q105 0 180 -74t75 -179q0 -62 -28.5 -118t-78.5 -94l-507 -380q-68 -51 -153 -51h-694zM1104 1408q-38 0 -68.5 -24t-39.5 -62l-164 -682h-127l-145 602q-9 38 -39.5 62t-68.5 24
+q-48 0 -80 -33t-32 -80q0 -15 3 -28l132 -547h-26l-99 408q-9 37 -40 62.5t-69 25.5q-47 0 -80 -33t-33 -79q0 -14 3 -26l116 -478q7 -28 9 -86t10 -88l100 -401q8 -32 34 -52.5t59 -20.5h694q42 0 76 26l507 379q56 43 56 110q0 52 -37.5 88.5t-89.5 36.5q-43 0 -77 -26
+l-307 -230v227q0 4 32 138t68 282t39 161q4 18 4 29q0 47 -32 81t-79 34q-39 0 -69.5 -24t-39.5 -62l-116 -482h-26l150 624q3 14 3 28q0 48 -31.5 82t-79.5 34z" />
+    <glyph glyph-name="_565" unicode="&#xf25a;" horiz-adv-x="1792" 
+d="M640 1408q-53 0 -90.5 -37.5t-37.5 -90.5v-512v-384l-151 202q-41 54 -107 54q-52 0 -89 -38t-37 -90q0 -43 26 -77l384 -512q38 -51 102 -51h718q22 0 39.5 13.5t22.5 34.5l92 368q24 96 24 194v217q0 41 -28 71t-68 30t-68 -28t-28 -68h-32v61q0 48 -32 81.5t-80 33.5
+q-46 0 -79 -33t-33 -79v-64h-32v90q0 55 -37 94.5t-91 39.5q-53 0 -90.5 -37.5t-37.5 -90.5v-96h-32v570q0 55 -37 94.5t-91 39.5zM640 1536q107 0 181.5 -77.5t74.5 -184.5v-220q22 2 32 2q99 0 173 -69q47 21 99 21q113 0 184 -87q27 7 56 7q94 0 159 -67.5t65 -161.5
+v-217q0 -116 -28 -225l-92 -368q-16 -64 -68 -104.5t-118 -40.5h-718q-60 0 -114.5 27.5t-90.5 74.5l-384 512q-51 68 -51 154q0 105 74.5 180.5t179.5 75.5q71 0 130 -35v547q0 106 75 181t181 75zM768 128v384h-32v-384h32zM1024 128v384h-32v-384h32zM1280 128v384h-32
+v-384h32z" />
+    <glyph glyph-name="_566" unicode="&#xf25b;" 
+d="M1288 889q60 0 107 -23q141 -63 141 -226v-177q0 -94 -23 -186l-85 -339q-21 -86 -90.5 -140t-157.5 -54h-668q-106 0 -181 75t-75 181v401l-239 628q-17 45 -17 91q0 106 75 181t181 75q80 0 145.5 -45.5t93.5 -119.5l17 -44v113q0 106 75 181t181 75t181 -75t75 -181
+v-261q27 5 48 5q69 0 127.5 -36.5t88.5 -98.5zM1072 896q-33 0 -60.5 -18t-41.5 -48l-74 -163l-71 -155h55q50 0 90 -31.5t50 -80.5l154 338q10 20 10 46q0 46 -33 79t-79 33zM1293 761q-22 0 -40.5 -8t-29 -16t-23.5 -29.5t-17 -30.5t-17 -37l-132 -290q-10 -20 -10 -46
+q0 -46 33 -79t79 -33q33 0 60.5 18t41.5 48l160 352q9 18 9 38q0 50 -32 81.5t-82 31.5zM128 1120q0 -22 8 -46l248 -650v-69l102 111q43 46 106 46h198l106 233v535q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5v-640h-64l-200 526q-14 37 -47 59.5t-73 22.5
+q-53 0 -90.5 -37.5t-37.5 -90.5zM1180 -128q44 0 78.5 27t45.5 70l85 339q19 73 19 155v91l-141 -310q-17 -38 -53 -61t-78 -23q-53 0 -93.5 34.5t-48.5 86.5q-44 -57 -114 -57h-208v32h208q46 0 81 33t35 79t-31 79t-77 33h-296q-49 0 -82 -36l-126 -136v-308
+q0 -53 37.5 -90.5t90.5 -37.5h668z" />
+    <glyph glyph-name="_567" unicode="&#xf25c;" horiz-adv-x="1973" 
+d="M857 992v-117q0 -13 -9.5 -22t-22.5 -9h-298v-812q0 -13 -9 -22.5t-22 -9.5h-135q-13 0 -22.5 9t-9.5 23v812h-297q-13 0 -22.5 9t-9.5 22v117q0 14 9 23t23 9h793q13 0 22.5 -9.5t9.5 -22.5zM1895 995l77 -961q1 -13 -8 -24q-10 -10 -23 -10h-134q-12 0 -21 8.5
+t-10 20.5l-46 588l-189 -425q-8 -19 -29 -19h-120q-20 0 -29 19l-188 427l-45 -590q-1 -12 -10 -20.5t-21 -8.5h-135q-13 0 -23 10q-9 10 -9 24l78 961q1 12 10 20.5t21 8.5h142q20 0 29 -19l220 -520q10 -24 20 -51q3 7 9.5 24.5t10.5 26.5l221 520q9 19 29 19h141
+q13 0 22 -8.5t10 -20.5z" />
+    <glyph glyph-name="_568" unicode="&#xf25d;" horiz-adv-x="1792" 
+d="M1042 833q0 88 -60 121q-33 18 -117 18h-123v-281h162q66 0 102 37t36 105zM1094 548l205 -373q8 -17 -1 -31q-8 -16 -27 -16h-152q-20 0 -28 17l-194 365h-155v-350q0 -14 -9 -23t-23 -9h-134q-14 0 -23 9t-9 23v960q0 14 9 23t23 9h294q128 0 190 -24q85 -31 134 -109
+t49 -180q0 -92 -42.5 -165.5t-115.5 -109.5q6 -10 9 -16zM896 1376q-150 0 -286 -58.5t-234.5 -157t-157 -234.5t-58.5 -286t58.5 -286t157 -234.5t234.5 -157t286 -58.5t286 58.5t234.5 157t157 234.5t58.5 286t-58.5 286t-157 234.5t-234.5 157t-286 58.5zM1792 640
+q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" />
+    <glyph glyph-name="_569" unicode="&#xf25e;" horiz-adv-x="1792" 
+d="M605 303q153 0 257 104q14 18 3 36l-45 82q-6 13 -24 17q-16 2 -27 -11l-4 -3q-4 -4 -11.5 -10t-17.5 -13.5t-23.5 -14.5t-28.5 -13t-33.5 -9.5t-37.5 -3.5q-76 0 -125 50t-49 127q0 76 48 125.5t122 49.5q37 0 71.5 -14t50.5 -28l16 -14q11 -11 26 -10q16 2 24 14l53 78
+q13 20 -2 39q-3 4 -11 12t-30 23.5t-48.5 28t-67.5 22.5t-86 10q-148 0 -246 -96.5t-98 -240.5q0 -146 97 -241.5t247 -95.5zM1235 303q153 0 257 104q14 18 4 36l-45 82q-8 14 -25 17q-16 2 -27 -11l-4 -3q-4 -4 -11.5 -10t-17.5 -13.5t-23.5 -14.5t-28.5 -13t-33.5 -9.5
+t-37.5 -3.5q-76 0 -125 50t-49 127q0 76 48 125.5t122 49.5q37 0 71.5 -14t50.5 -28l16 -14q11 -11 26 -10q16 2 24 14l53 78q13 20 -2 39q-3 4 -11 12t-30 23.5t-48.5 28t-67.5 22.5t-86 10q-147 0 -245.5 -96.5t-98.5 -240.5q0 -146 97 -241.5t247 -95.5zM896 1376
+q-150 0 -286 -58.5t-234.5 -157t-157 -234.5t-58.5 -286t58.5 -286t157 -234.5t234.5 -157t286 -58.5t286 58.5t234.5 157t157 234.5t58.5 286t-58.5 286t-157 234.5t-234.5 157t-286 58.5zM896 1536q182 0 348 -71t286 -191t191 -286t71 -348t-71 -348t-191 -286t-286 -191
+t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71z" />
+    <glyph glyph-name="f260" unicode="&#xf260;" horiz-adv-x="2048" 
+d="M736 736l384 -384l-384 -384l-672 672l672 672l168 -168l-96 -96l-72 72l-480 -480l480 -480l193 193l-289 287zM1312 1312l672 -672l-672 -672l-168 168l96 96l72 -72l480 480l-480 480l-193 -193l289 -287l-96 -96l-384 384z" />
+    <glyph glyph-name="f261" unicode="&#xf261;" horiz-adv-x="1792" 
+d="M717 182l271 271l-279 279l-88 -88l192 -191l-96 -96l-279 279l279 279l40 -40l87 87l-127 128l-454 -454zM1075 190l454 454l-454 454l-271 -271l279 -279l88 88l-192 191l96 96l279 -279l-279 -279l-40 40l-87 -88zM1792 640q0 -182 -71 -348t-191 -286t-286 -191
+t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" />
+    <glyph glyph-name="_572" unicode="&#xf262;" horiz-adv-x="2304" 
+d="M651 539q0 -39 -27.5 -66.5t-65.5 -27.5q-39 0 -66.5 27.5t-27.5 66.5q0 38 27.5 65.5t66.5 27.5q38 0 65.5 -27.5t27.5 -65.5zM1805 540q0 -39 -27.5 -66.5t-66.5 -27.5t-66.5 27.5t-27.5 66.5t27.5 66t66.5 27t66.5 -27t27.5 -66zM765 539q0 79 -56.5 136t-136.5 57
+t-136.5 -56.5t-56.5 -136.5t56.5 -136.5t136.5 -56.5t136.5 56.5t56.5 136.5zM1918 540q0 80 -56.5 136.5t-136.5 56.5q-79 0 -136 -56.5t-57 -136.5t56.5 -136.5t136.5 -56.5t136.5 56.5t56.5 136.5zM850 539q0 -116 -81.5 -197.5t-196.5 -81.5q-116 0 -197.5 82t-81.5 197
+t82 196.5t197 81.5t196.5 -81.5t81.5 -196.5zM2004 540q0 -115 -81.5 -196.5t-197.5 -81.5q-115 0 -196.5 81.5t-81.5 196.5t81.5 196.5t196.5 81.5q116 0 197.5 -81.5t81.5 -196.5zM1040 537q0 191 -135.5 326.5t-326.5 135.5q-125 0 -231 -62t-168 -168.5t-62 -231.5
+t62 -231.5t168 -168.5t231 -62q191 0 326.5 135.5t135.5 326.5zM1708 1110q-254 111 -556 111q-319 0 -573 -110q117 0 223 -45.5t182.5 -122.5t122 -183t45.5 -223q0 115 43.5 219.5t118 180.5t177.5 123t217 50zM2187 537q0 191 -135 326.5t-326 135.5t-326.5 -135.5
+t-135.5 -326.5t135.5 -326.5t326.5 -135.5t326 135.5t135 326.5zM1921 1103h383q-44 -51 -75 -114.5t-40 -114.5q110 -151 110 -337q0 -156 -77 -288t-209 -208.5t-287 -76.5q-133 0 -249 56t-196 155q-47 -56 -129 -179q-11 22 -53.5 82.5t-74.5 97.5
+q-80 -99 -196.5 -155.5t-249.5 -56.5q-155 0 -287 76.5t-209 208.5t-77 288q0 186 110 337q-9 51 -40 114.5t-75 114.5h365q149 100 355 156.5t432 56.5q224 0 421 -56t348 -157z" />
+    <glyph glyph-name="f263" unicode="&#xf263;" horiz-adv-x="1280" 
+d="M640 629q-188 0 -321 133t-133 320q0 188 133 321t321 133t321 -133t133 -321q0 -187 -133 -320t-321 -133zM640 1306q-92 0 -157.5 -65.5t-65.5 -158.5q0 -92 65.5 -157.5t157.5 -65.5t157.5 65.5t65.5 157.5q0 93 -65.5 158.5t-157.5 65.5zM1163 574q13 -27 15 -49.5
+t-4.5 -40.5t-26.5 -38.5t-42.5 -37t-61.5 -41.5q-115 -73 -315 -94l73 -72l267 -267q30 -31 30 -74t-30 -73l-12 -13q-31 -30 -74 -30t-74 30q-67 68 -267 268l-267 -268q-31 -30 -74 -30t-73 30l-12 13q-31 30 -31 73t31 74l267 267l72 72q-203 21 -317 94
+q-39 25 -61.5 41.5t-42.5 37t-26.5 38.5t-4.5 40.5t15 49.5q10 20 28 35t42 22t56 -2t65 -35q5 -4 15 -11t43 -24.5t69 -30.5t92 -24t113 -11q91 0 174 25.5t120 50.5l38 25q33 26 65 35t56 2t42 -22t28 -35z" />
+    <glyph glyph-name="_574" unicode="&#xf264;" 
+d="M927 956q0 -66 -46.5 -112.5t-112.5 -46.5t-112.5 46.5t-46.5 112.5t46.5 112.5t112.5 46.5t112.5 -46.5t46.5 -112.5zM1141 593q-10 20 -28 32t-47.5 9.5t-60.5 -27.5q-10 -8 -29 -20t-81 -32t-127 -20t-124 18t-86 36l-27 18q-31 25 -60.5 27.5t-47.5 -9.5t-28 -32
+q-22 -45 -2 -74.5t87 -73.5q83 -53 226 -67l-51 -52q-142 -142 -191 -190q-22 -22 -22 -52.5t22 -52.5l9 -9q22 -22 52.5 -22t52.5 22l191 191q114 -115 191 -191q22 -22 52.5 -22t52.5 22l9 9q22 22 22 52.5t-22 52.5l-191 190l-52 52q141 14 225 67q67 44 87 73.5t-2 74.5
+zM1092 956q0 134 -95 229t-229 95t-229 -95t-95 -229t95 -229t229 -95t229 95t95 229zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="_575" unicode="&#xf265;" horiz-adv-x="1720" 
+d="M1565 1408q65 0 110 -45.5t45 -110.5v-519q0 -176 -68 -336t-182.5 -275t-274 -182.5t-334.5 -67.5q-176 0 -335.5 67.5t-274.5 182.5t-183 275t-68 336v519q0 64 46 110t110 46h1409zM861 344q47 0 82 33l404 388q37 35 37 85q0 49 -34.5 83.5t-83.5 34.5q-47 0 -82 -33
+l-323 -310l-323 310q-35 33 -81 33q-49 0 -83.5 -34.5t-34.5 -83.5q0 -51 36 -85l405 -388q33 -33 81 -33z" />
+    <glyph glyph-name="_576" unicode="&#xf266;" horiz-adv-x="2304" 
+d="M1494 -103l-295 695q-25 -49 -158.5 -305.5t-198.5 -389.5q-1 -1 -27.5 -0.5t-26.5 1.5q-82 193 -255.5 587t-259.5 596q-21 50 -66.5 107.5t-103.5 100.5t-102 43q0 5 -0.5 24t-0.5 27h583v-50q-39 -2 -79.5 -16t-66.5 -43t-10 -64q26 -59 216.5 -499t235.5 -540
+q31 61 140 266.5t131 247.5q-19 39 -126 281t-136 295q-38 69 -201 71v50l513 -1v-47q-60 -2 -93.5 -25t-12.5 -69q33 -70 87 -189.5t86 -187.5q110 214 173 363q24 55 -10 79.5t-129 26.5q1 7 1 25v24q64 0 170.5 0.5t180 1t92.5 0.5v-49q-62 -2 -119 -33t-90 -81
+l-213 -442q13 -33 127.5 -290t121.5 -274l441 1017q-14 38 -49.5 62.5t-65 31.5t-55.5 8v50l460 -4l1 -2l-1 -44q-139 -4 -201 -145q-526 -1216 -559 -1291h-49z" />
+    <glyph glyph-name="_577" unicode="&#xf267;" horiz-adv-x="1792" 
+d="M949 643q0 -26 -16.5 -45t-41.5 -19q-26 0 -45 16.5t-19 41.5q0 26 17 45t42 19t44 -16.5t19 -41.5zM964 585l350 581q-9 -8 -67.5 -62.5t-125.5 -116.5t-136.5 -127t-117 -110.5t-50.5 -51.5l-349 -580q7 7 67 62t126 116.5t136 127t117 111t50 50.5zM1611 640
+q0 -201 -104 -371q-3 2 -17 11t-26.5 16.5t-16.5 7.5q-13 0 -13 -13q0 -10 59 -44q-74 -112 -184.5 -190.5t-241.5 -110.5l-16 67q-1 10 -15 10q-5 0 -8 -5.5t-2 -9.5l16 -68q-72 -15 -146 -15q-199 0 -372 105q1 2 13 20.5t21.5 33.5t9.5 19q0 13 -13 13q-6 0 -17 -14.5
+t-22.5 -34.5t-13.5 -23q-113 75 -192 187.5t-110 244.5l69 15q10 3 10 15q0 5 -5.5 8t-10.5 2l-68 -15q-14 72 -14 139q0 206 109 379q2 -1 18.5 -12t30 -19t17.5 -8q13 0 13 12q0 6 -12.5 15.5t-32.5 21.5l-20 12q77 112 189 189t244 107l15 -67q2 -10 15 -10q5 0 8 5.5
+t2 10.5l-15 66q71 13 134 13q204 0 379 -109q-39 -56 -39 -65q0 -13 12 -13q11 0 48 64q111 -75 187.5 -186t107.5 -241l-56 -12q-10 -2 -10 -16q0 -5 5.5 -8t9.5 -2l57 13q14 -72 14 -140zM1696 640q0 163 -63.5 311t-170.5 255t-255 170.5t-311 63.5t-311 -63.5
+t-255 -170.5t-170.5 -255t-63.5 -311t63.5 -311t170.5 -255t255 -170.5t311 -63.5t311 63.5t255 170.5t170.5 255t63.5 311zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191
+t191 -286t71 -348z" />
+    <glyph glyph-name="_578" unicode="&#xf268;" horiz-adv-x="1792" 
+d="M893 1536q240 2 451 -120q232 -134 352 -372l-742 39q-160 9 -294 -74.5t-185 -229.5l-276 424q128 159 311 245.5t383 87.5zM146 1131l337 -663q72 -143 211 -217t293 -45l-230 -451q-212 33 -385 157.5t-272.5 316t-99.5 411.5q0 267 146 491zM1732 962
+q58 -150 59.5 -310.5t-48.5 -306t-153 -272t-246 -209.5q-230 -133 -498 -119l405 623q88 131 82.5 290.5t-106.5 277.5zM896 942q125 0 213.5 -88.5t88.5 -213.5t-88.5 -213.5t-213.5 -88.5t-213.5 88.5t-88.5 213.5t88.5 213.5t213.5 88.5z" />
+    <glyph glyph-name="_579" unicode="&#xf269;" horiz-adv-x="1792" 
+d="M903 -256q-283 0 -504.5 150.5t-329.5 398.5q-58 131 -67 301t26 332.5t111 312t179 242.5l-11 -281q11 14 68 15.5t70 -15.5q42 81 160.5 138t234.5 59q-54 -45 -119.5 -148.5t-58.5 -163.5q25 -8 62.5 -13.5t63 -7.5t68 -4t50.5 -3q15 -5 9.5 -45.5t-30.5 -75.5
+q-5 -7 -16.5 -18.5t-56.5 -35.5t-101 -34l15 -189l-139 67q-18 -43 -7.5 -81.5t36 -66.5t65.5 -41.5t81 -6.5q51 9 98 34.5t83.5 45t73.5 17.5q61 -4 89.5 -33t19.5 -65q-1 -2 -2.5 -5.5t-8.5 -12.5t-18 -15.5t-31.5 -10.5t-46.5 -1q-60 -95 -144.5 -135.5t-209.5 -29.5
+q74 -61 162.5 -82.5t168.5 -6t154.5 52t128 87.5t80.5 104q43 91 39 192.5t-37.5 188.5t-78.5 125q87 -38 137 -79.5t77 -112.5q15 170 -57.5 343t-209.5 284q265 -77 412 -279.5t151 -517.5q2 -127 -40.5 -255t-123.5 -238t-189 -196t-247.5 -135.5t-288.5 -49.5z" />
+    <glyph glyph-name="_580" unicode="&#xf26a;" horiz-adv-x="1792" 
+d="M1493 1308q-165 110 -359 110q-155 0 -293 -73t-240 -200q-75 -93 -119.5 -218t-48.5 -266v-42q4 -141 48.5 -266t119.5 -218q102 -127 240 -200t293 -73q194 0 359 110q-121 -108 -274.5 -168t-322.5 -60q-29 0 -43 1q-175 8 -333 82t-272 193t-181 281t-67 339
+q0 182 71 348t191 286t286 191t348 71h3q168 -1 320.5 -60.5t273.5 -167.5zM1792 640q0 -192 -77 -362.5t-213 -296.5q-104 -63 -222 -63q-137 0 -255 84q154 56 253.5 233t99.5 405q0 227 -99 404t-253 234q119 83 254 83q119 0 226 -65q135 -125 210.5 -295t75.5 -361z
+" />
+    <glyph glyph-name="_581" unicode="&#xf26b;" horiz-adv-x="1792" 
+d="M1792 599q0 -56 -7 -104h-1151q0 -146 109.5 -244.5t257.5 -98.5q99 0 185.5 46.5t136.5 130.5h423q-56 -159 -170.5 -281t-267.5 -188.5t-321 -66.5q-187 0 -356 83q-228 -116 -394 -116q-237 0 -237 263q0 115 45 275q17 60 109 229q199 360 475 606
+q-184 -79 -427 -354q63 274 283.5 449.5t501.5 175.5q30 0 45 -1q255 117 433 117q64 0 116 -13t94.5 -40.5t66.5 -76.5t24 -115q0 -116 -75 -286q101 -182 101 -390zM1722 1239q0 83 -53 132t-137 49q-108 0 -254 -70q121 -47 222.5 -131.5t170.5 -195.5q51 135 51 216z
+M128 2q0 -86 48.5 -132.5t134.5 -46.5q115 0 266 83q-122 72 -213.5 183t-137.5 245q-98 -205 -98 -332zM632 715h728q-5 142 -113 237t-251 95q-144 0 -251.5 -95t-112.5 -237z" />
+    <glyph glyph-name="_582" unicode="&#xf26c;" horiz-adv-x="2048" 
+d="M1792 288v960q0 13 -9.5 22.5t-22.5 9.5h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5zM1920 1248v-960q0 -66 -47 -113t-113 -47h-736v-128h352q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23
+v64q0 14 9 23t23 9h352v128h-736q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="_583" unicode="&#xf26d;" horiz-adv-x="1792" 
+d="M138 1408h197q-70 -64 -126 -149q-36 -56 -59 -115t-30 -125.5t-8.5 -120t10.5 -132t21 -126t28 -136.5q4 -19 6 -28q51 -238 81 -329q57 -171 152 -275h-272q-48 0 -82 34t-34 82v1304q0 48 34 82t82 34zM1346 1408h308q48 0 82 -34t34 -82v-1304q0 -48 -34 -82t-82 -34
+h-178q212 210 196 565l-469 -101q-2 -45 -12 -82t-31 -72t-59.5 -59.5t-93.5 -36.5q-123 -26 -199 40q-32 27 -53 61t-51.5 129t-64.5 258q-35 163 -45.5 263t-5.5 139t23 77q20 41 62.5 73t102.5 45q45 12 83.5 6.5t67 -17t54 -35t43 -48t34.5 -56.5l468 100
+q-68 175 -180 287z" />
+    <glyph glyph-name="_584" unicode="&#xf26e;" 
+d="M1401 -11l-6 -6q-113 -113 -259 -175q-154 -64 -317 -64q-165 0 -317 64q-148 63 -259 175q-113 112 -175 258q-42 103 -54 189q-4 28 48 36q51 8 56 -20q1 -1 1 -4q18 -90 46 -159q50 -124 152 -226q98 -98 226 -152q132 -56 276 -56q143 0 276 56q128 55 225 152l6 6
+q10 10 25 6q12 -3 33 -22q36 -37 17 -58zM929 604l-66 -66l63 -63q21 -21 -7 -49q-17 -17 -32 -17q-10 0 -19 10l-62 61l-66 -66q-5 -5 -15 -5q-15 0 -31 16l-2 2q-18 15 -18 29q0 7 8 17l66 65l-66 66q-16 16 14 45q18 18 31 18q6 0 13 -5l65 -66l65 65q18 17 48 -13
+q27 -27 11 -44zM1400 547q0 -118 -46 -228q-45 -105 -126 -186q-80 -80 -187 -126t-228 -46t-228 46t-187 126q-82 82 -125 186q-15 33 -15 40h-1q-9 27 43 44q50 16 60 -12q37 -99 97 -167h1v339v2q3 136 102 232q105 103 253 103q147 0 251 -103t104 -249
+q0 -147 -104.5 -251t-250.5 -104q-58 0 -112 16q-28 11 -13 61q16 51 44 43l14 -3q14 -3 33 -6t30 -3q104 0 176 71.5t72 174.5q0 101 -72 171q-71 71 -175 71q-107 0 -178 -80q-64 -72 -64 -160v-413q110 -67 242 -67q96 0 185 36.5t156 103.5t103.5 155t36.5 183
+q0 198 -141 339q-140 140 -339 140q-200 0 -340 -140q-53 -53 -77 -87l-2 -2q-8 -11 -13 -15.5t-21.5 -9.5t-38.5 3q-21 5 -36.5 16.5t-15.5 26.5v680q0 15 10.5 26.5t27.5 11.5h877q30 0 30 -55t-30 -55h-811v-483h1q40 42 102 84t108 61q109 46 231 46q121 0 228 -46
+t187 -126q81 -81 126 -186q46 -112 46 -229zM1369 1128q9 -8 9 -18t-5.5 -18t-16.5 -21q-26 -26 -39 -26q-9 0 -16 7q-106 91 -207 133q-128 56 -276 56q-133 0 -262 -49q-27 -10 -45 37q-9 25 -8 38q3 16 16 20q130 57 299 57q164 0 316 -64q137 -58 235 -152z" />
+    <glyph glyph-name="_585" unicode="&#xf270;" horiz-adv-x="1792" 
+d="M1551 60q15 6 26 3t11 -17.5t-15 -33.5q-13 -16 -44 -43.5t-95.5 -68t-141 -74t-188 -58t-229.5 -24.5q-119 0 -238 31t-209 76.5t-172.5 104t-132.5 105t-84 87.5q-8 9 -10 16.5t1 12t8 7t11.5 2t11.5 -4.5q192 -117 300 -166q389 -176 799 -90q190 40 391 135z
+M1758 175q11 -16 2.5 -69.5t-28.5 -102.5q-34 -83 -85 -124q-17 -14 -26 -9t0 24q21 45 44.5 121.5t6.5 98.5q-5 7 -15.5 11.5t-27 6t-29.5 2.5t-35 0t-31.5 -2t-31 -3t-22.5 -2q-6 -1 -13 -1.5t-11 -1t-8.5 -1t-7 -0.5h-5.5h-4.5t-3 0.5t-2 1.5l-1.5 3q-6 16 47 40t103 30
+q46 7 108 1t76 -24zM1364 618q0 -31 13.5 -64t32 -58t37.5 -46t33 -32l13 -11l-227 -224q-40 37 -79 75.5t-58 58.5l-19 20q-11 11 -25 33q-38 -59 -97.5 -102.5t-127.5 -63.5t-140 -23t-137.5 21t-117.5 65.5t-83 113t-31 162.5q0 84 28 154t72 116.5t106.5 83t122.5 57
+t130 34.5t119.5 18.5t99.5 6.5v127q0 65 -21 97q-34 53 -121 53q-6 0 -16.5 -1t-40.5 -12t-56 -29.5t-56 -59.5t-48 -96l-294 27q0 60 22 119t67 113t108 95t151.5 65.5t190.5 24.5q100 0 181 -25t129.5 -61.5t81 -83t45 -86t12.5 -73.5v-589zM692 597q0 -86 70 -133
+q66 -44 139 -22q84 25 114 123q14 45 14 101v162q-59 -2 -111 -12t-106.5 -33.5t-87 -71t-32.5 -114.5z" />
+    <glyph glyph-name="_586" unicode="&#xf271;" horiz-adv-x="1792" 
+d="M1536 1280q52 0 90 -38t38 -90v-1280q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h128zM1152 1376v-288q0 -14 9 -23t23 -9
+h64q14 0 23 9t9 23v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM384 1376v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM1536 -128v1024h-1408v-1024h1408zM896 448h224q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-224
+v-224q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v224h-224q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h224v224q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-224z" />
+    <glyph glyph-name="_587" unicode="&#xf272;" horiz-adv-x="1792" 
+d="M1152 416v-64q0 -14 -9 -23t-23 -9h-576q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h576q14 0 23 -9t9 -23zM128 -128h1408v1024h-1408v-1024zM512 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1280 1088v288q0 14 -9 23
+t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1664 1152v-1280q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47
+t47 -113v-96h128q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="_588" unicode="&#xf273;" horiz-adv-x="1792" 
+d="M1111 151l-46 -46q-9 -9 -22 -9t-23 9l-188 189l-188 -189q-10 -9 -23 -9t-22 9l-46 46q-9 9 -9 22t9 23l189 188l-189 188q-9 10 -9 23t9 22l46 46q9 9 22 9t23 -9l188 -188l188 188q10 9 23 9t22 -9l46 -46q9 -9 9 -22t-9 -23l-188 -188l188 -188q9 -10 9 -23t-9 -22z
+M128 -128h1408v1024h-1408v-1024zM512 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1280 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1664 1152v-1280
+q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="_589" unicode="&#xf274;" horiz-adv-x="1792" 
+d="M1303 572l-512 -512q-10 -9 -23 -9t-23 9l-288 288q-9 10 -9 23t9 22l46 46q9 9 22 9t23 -9l220 -220l444 444q10 9 23 9t22 -9l46 -46q9 -9 9 -22t-9 -23zM128 -128h1408v1024h-1408v-1024zM512 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23
+t23 -9h64q14 0 23 9t9 23zM1280 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1664 1152v-1280q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47
+t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="_590" unicode="&#xf275;" horiz-adv-x="1792" 
+d="M448 1536q26 0 45 -19t19 -45v-891l536 429q17 14 40 14q26 0 45 -19t19 -45v-379l536 429q17 14 40 14q26 0 45 -19t19 -45v-1152q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v1664q0 26 19 45t45 19h384z" />
+    <glyph glyph-name="_591" unicode="&#xf276;" horiz-adv-x="1024" 
+d="M512 448q66 0 128 15v-655q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v655q62 -15 128 -15zM512 1536q212 0 362 -150t150 -362t-150 -362t-362 -150t-362 150t-150 362t150 362t362 150zM512 1312q14 0 23 9t9 23t-9 23t-23 9q-146 0 -249 -103t-103 -249
+q0 -14 9 -23t23 -9t23 9t9 23q0 119 84.5 203.5t203.5 84.5z" />
+    <glyph glyph-name="_592" unicode="&#xf277;" horiz-adv-x="1792" 
+d="M1745 1239q10 -10 10 -23t-10 -23l-141 -141q-28 -28 -68 -28h-1344q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h576v64q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-64h512q40 0 68 -28zM768 320h256v-512q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v512zM1600 768
+q26 0 45 -19t19 -45v-256q0 -26 -19 -45t-45 -19h-1344q-40 0 -68 28l-141 141q-10 10 -10 23t10 23l141 141q28 28 68 28h512v192h256v-192h576z" />
+    <glyph glyph-name="_593" unicode="&#xf278;" horiz-adv-x="2048" 
+d="M2020 1525q28 -20 28 -53v-1408q0 -20 -11 -36t-29 -23l-640 -256q-24 -11 -48 0l-616 246l-616 -246q-10 -5 -24 -5q-19 0 -36 11q-28 20 -28 53v1408q0 20 11 36t29 23l640 256q24 11 48 0l616 -246l616 246q32 13 60 -6zM736 1390v-1270l576 -230v1270zM128 1173
+v-1270l544 217v1270zM1920 107v1270l-544 -217v-1270z" />
+    <glyph glyph-name="_594" unicode="&#xf279;" horiz-adv-x="1792" 
+d="M512 1536q13 0 22.5 -9.5t9.5 -22.5v-1472q0 -20 -17 -28l-480 -256q-7 -4 -15 -4q-13 0 -22.5 9.5t-9.5 22.5v1472q0 20 17 28l480 256q7 4 15 4zM1760 1536q13 0 22.5 -9.5t9.5 -22.5v-1472q0 -20 -17 -28l-480 -256q-7 -4 -15 -4q-13 0 -22.5 9.5t-9.5 22.5v1472
+q0 20 17 28l480 256q7 4 15 4zM640 1536q8 0 14 -3l512 -256q18 -10 18 -29v-1472q0 -13 -9.5 -22.5t-22.5 -9.5q-8 0 -14 3l-512 256q-18 10 -18 29v1472q0 13 9.5 22.5t22.5 9.5z" />
+    <glyph glyph-name="_595" unicode="&#xf27a;" horiz-adv-x="1792" 
+d="M640 640q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1024 640q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1408 640q0 53 -37.5 90.5t-90.5 37.5
+t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1792 640q0 -174 -120 -321.5t-326 -233t-450 -85.5q-110 0 -211 18q-173 -173 -435 -229q-52 -10 -86 -13q-12 -1 -22 6t-13 18q-4 15 20 37q5 5 23.5 21.5t25.5 23.5t23.5 25.5t24 31.5t20.5 37
+t20 48t14.5 57.5t12.5 72.5q-146 90 -229.5 216.5t-83.5 269.5q0 174 120 321.5t326 233t450 85.5t450 -85.5t326 -233t120 -321.5z" />
+    <glyph glyph-name="_596" unicode="&#xf27b;" horiz-adv-x="1792" 
+d="M640 640q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1024 640q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 -53 -37.5 -90.5t-90.5 -37.5
+t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM896 1152q-204 0 -381.5 -69.5t-282 -187.5t-104.5 -255q0 -112 71.5 -213.5t201.5 -175.5l87 -50l-27 -96q-24 -91 -70 -172q152 63 275 171l43 38l57 -6q69 -8 130 -8q204 0 381.5 69.5t282 187.5
+t104.5 255t-104.5 255t-282 187.5t-381.5 69.5zM1792 640q0 -174 -120 -321.5t-326 -233t-450 -85.5q-70 0 -145 8q-198 -175 -460 -242q-49 -14 -114 -22h-5q-15 0 -27 10.5t-16 27.5v1q-3 4 -0.5 12t2 10t4.5 9.5l6 9t7 8.5t8 9q7 8 31 34.5t34.5 38t31 39.5t32.5 51
+t27 59t26 76q-157 89 -247.5 220t-90.5 281q0 130 71 248.5t191 204.5t286 136.5t348 50.5t348 -50.5t286 -136.5t191 -204.5t71 -248.5z" />
+    <glyph glyph-name="_597" unicode="&#xf27c;" horiz-adv-x="1024" 
+d="M512 345l512 295v-591l-512 -296v592zM0 640v-591l512 296zM512 1527v-591l-512 -296v591zM512 936l512 295v-591z" />
+    <glyph glyph-name="_598" unicode="&#xf27d;" horiz-adv-x="1792" 
+d="M1709 1018q-10 -236 -332 -651q-333 -431 -562 -431q-142 0 -240 263q-44 160 -132 482q-72 262 -157 262q-18 0 -127 -76l-77 98q24 21 108 96.5t130 115.5q156 138 241 146q95 9 153 -55.5t81 -203.5q44 -287 66 -373q55 -249 120 -249q51 0 154 161q101 161 109 246
+q13 139 -109 139q-57 0 -121 -26q120 393 459 382q251 -8 236 -326z" />
+    <glyph glyph-name="f27e" unicode="&#xf27e;" 
+d="M0 1408h1536v-1536h-1536v1536zM1085 293l-221 631l221 297h-634l221 -297l-221 -631l317 -304z" />
+    <glyph glyph-name="uniF280" unicode="&#xf280;" 
+d="M0 1408h1536v-1536h-1536v1536zM908 1088l-12 -33l75 -83l-31 -114l25 -25l107 57l107 -57l25 25l-31 114l75 83l-12 33h-95l-53 96h-32l-53 -96h-95zM641 925q32 0 44.5 -16t11.5 -63l174 21q0 55 -17.5 92.5t-50.5 56t-69 25.5t-85 7q-133 0 -199 -57.5t-66 -182.5v-72
+h-96v-128h76q20 0 20 -8v-382q0 -14 -5 -20t-18 -7l-73 -7v-88h448v86l-149 14q-6 1 -8.5 1.5t-3.5 2.5t-0.5 4t1 7t0.5 10v387h191l38 128h-231q-6 0 -2 6t4 9v80q0 27 1.5 40.5t7.5 28t19.5 20t36.5 5.5zM1248 96v86l-54 9q-7 1 -9.5 2.5t-2.5 3t1 7.5t1 12v520h-275
+l-23 -101l83 -22q23 -7 23 -27v-370q0 -14 -6 -18.5t-20 -6.5l-70 -9v-86h352z" />
+    <glyph glyph-name="uniF281" unicode="&#xf281;" horiz-adv-x="1792" 
+d="M1792 690q0 -58 -29.5 -105.5t-79.5 -72.5q12 -46 12 -96q0 -155 -106.5 -287t-290.5 -208.5t-400 -76.5t-399.5 76.5t-290 208.5t-106.5 287q0 47 11 94q-51 25 -82 73.5t-31 106.5q0 82 58 140.5t141 58.5q85 0 145 -63q218 152 515 162l116 521q3 13 15 21t26 5
+l369 -81q18 37 54 59.5t79 22.5q62 0 106 -43.5t44 -105.5t-44 -106t-106 -44t-105.5 43.5t-43.5 105.5l-334 74l-104 -472q300 -9 519 -160q58 61 143 61q83 0 141 -58.5t58 -140.5zM418 491q0 -62 43.5 -106t105.5 -44t106 44t44 106t-44 105.5t-106 43.5q-61 0 -105 -44
+t-44 -105zM1228 136q11 11 11 26t-11 26q-10 10 -25 10t-26 -10q-41 -42 -121 -62t-160 -20t-160 20t-121 62q-11 10 -26 10t-25 -10q-11 -10 -11 -25.5t11 -26.5q43 -43 118.5 -68t122.5 -29.5t91 -4.5t91 4.5t122.5 29.5t118.5 68zM1225 341q62 0 105.5 44t43.5 106
+q0 61 -44 105t-105 44q-62 0 -106 -43.5t-44 -105.5t44 -106t106 -44z" />
+    <glyph glyph-name="_602" unicode="&#xf282;" horiz-adv-x="1792" 
+d="M69 741h1q16 126 58.5 241.5t115 217t167.5 176t223.5 117.5t276.5 43q231 0 414 -105.5t294 -303.5q104 -187 104 -442v-188h-1125q1 -111 53.5 -192.5t136.5 -122.5t189.5 -57t213 -3t208 46.5t173.5 84.5v-377q-92 -55 -229.5 -92t-312.5 -38t-316 53
+q-189 73 -311.5 249t-124.5 372q-3 242 111 412t325 268q-48 -60 -78 -125.5t-46 -159.5h635q8 77 -8 140t-47 101.5t-70.5 66.5t-80.5 41t-75 20.5t-56 8.5l-22 1q-135 -5 -259.5 -44.5t-223.5 -104.5t-176 -140.5t-138 -163.5z" />
+    <glyph glyph-name="_603" unicode="&#xf283;" horiz-adv-x="2304" 
+d="M0 32v608h2304v-608q0 -66 -47 -113t-113 -47h-1984q-66 0 -113 47t-47 113zM640 256v-128h384v128h-384zM256 256v-128h256v128h-256zM2144 1408q66 0 113 -47t47 -113v-224h-2304v224q0 66 47 113t113 47h1984z" />
+    <glyph glyph-name="_604" unicode="&#xf284;" horiz-adv-x="1792" 
+d="M1584 246l-218 111q-74 -120 -196.5 -189t-263.5 -69q-147 0 -271 72t-196 196t-72 270q0 110 42.5 209.5t115 172t172 115t209.5 42.5q131 0 247.5 -60.5t192.5 -168.5l215 125q-110 169 -286.5 265t-378.5 96q-161 0 -308 -63t-253 -169t-169 -253t-63 -308t63 -308
+t169 -253t253 -169t308 -63q213 0 397.5 107t290.5 292zM1030 643l693 -352q-116 -253 -334.5 -400t-492.5 -147q-182 0 -348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71q260 0 470.5 -133.5t335.5 -366.5zM1543 640h-39v-160h-96v352h136q32 0 54.5 -20
+t28.5 -48t1 -56t-27.5 -48t-57.5 -20z" />
+    <glyph glyph-name="uniF285" unicode="&#xf285;" horiz-adv-x="1792" 
+d="M1427 827l-614 386l92 151h855zM405 562l-184 116v858l1183 -743zM1424 697l147 -95v-858l-532 335zM1387 718l-500 -802h-855l356 571z" />
+    <glyph glyph-name="uniF286" unicode="&#xf286;" horiz-adv-x="1792" 
+d="M640 528v224q0 16 -16 16h-96q-16 0 -16 -16v-224q0 -16 16 -16h96q16 0 16 16zM1152 528v224q0 16 -16 16h-96q-16 0 -16 -16v-224q0 -16 16 -16h96q16 0 16 16zM1664 496v-752h-640v320q0 80 -56 136t-136 56t-136 -56t-56 -136v-320h-640v752q0 16 16 16h96
+q16 0 16 -16v-112h128v624q0 16 16 16h96q16 0 16 -16v-112h128v112q0 16 16 16h96q16 0 16 -16v-112h128v112q0 6 2.5 9.5t8.5 5t9.5 2t11.5 0t9 -0.5v391q-32 15 -32 50q0 23 16.5 39t38.5 16t38.5 -16t16.5 -39q0 -35 -32 -50v-17q45 10 83 10q21 0 59.5 -7.5t54.5 -7.5
+q17 0 47 7.5t37 7.5q16 0 16 -16v-210q0 -15 -35 -21.5t-62 -6.5q-18 0 -54.5 7.5t-55.5 7.5q-40 0 -90 -12v-133q1 0 9 0.5t11.5 0t9.5 -2t8.5 -5t2.5 -9.5v-112h128v112q0 16 16 16h96q16 0 16 -16v-112h128v112q0 16 16 16h96q16 0 16 -16v-624h128v112q0 16 16 16h96
+q16 0 16 -16z" />
+    <glyph glyph-name="_607" unicode="&#xf287;" horiz-adv-x="2304" 
+d="M2288 731q16 -8 16 -27t-16 -27l-320 -192q-8 -5 -16 -5q-9 0 -16 4q-16 10 -16 28v128h-858q37 -58 83 -165q16 -37 24.5 -55t24 -49t27 -47t27 -34t31.5 -26t33 -8h96v96q0 14 9 23t23 9h320q14 0 23 -9t9 -23v-320q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23v96h-96
+q-32 0 -61 10t-51 23.5t-45 40.5t-37 46t-33.5 57t-28.5 57.5t-28 60.5q-23 53 -37 81.5t-36 65t-44.5 53.5t-46.5 17h-360q-22 -84 -91 -138t-157 -54q-106 0 -181 75t-75 181t75 181t181 75q88 0 157 -54t91 -138h104q24 0 46.5 17t44.5 53.5t36 65t37 81.5q19 41 28 60.5
+t28.5 57.5t33.5 57t37 46t45 40.5t51 23.5t61 10h107q21 57 70 92.5t111 35.5q80 0 136 -56t56 -136t-56 -136t-136 -56q-62 0 -111 35.5t-70 92.5h-107q-17 0 -33 -8t-31.5 -26t-27 -34t-27 -47t-24 -49t-24.5 -55q-46 -107 -83 -165h1114v128q0 18 16 28t32 -1z" />
+    <glyph glyph-name="_608" unicode="&#xf288;" horiz-adv-x="1792" 
+d="M1150 774q0 -56 -39.5 -95t-95.5 -39h-253v269h253q56 0 95.5 -39.5t39.5 -95.5zM1329 774q0 130 -91.5 222t-222.5 92h-433v-896h180v269h253q130 0 222 91.5t92 221.5zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348
+t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" />
+    <glyph glyph-name="_609" unicode="&#xf289;" horiz-adv-x="2304" 
+d="M1645 438q0 59 -34 106.5t-87 68.5q-7 -45 -23 -92q-7 -24 -27.5 -38t-44.5 -14q-12 0 -24 3q-31 10 -45 38.5t-4 58.5q23 71 23 143q0 123 -61 227.5t-166 165.5t-228 61q-134 0 -247 -73t-167 -194q108 -28 188 -106q22 -23 22 -55t-22 -54t-54 -22t-55 22
+q-75 75 -180 75q-106 0 -181 -74.5t-75 -180.5t75 -180.5t181 -74.5h1046q79 0 134.5 55.5t55.5 133.5zM1798 438q0 -142 -100.5 -242t-242.5 -100h-1046q-169 0 -289 119.5t-120 288.5q0 153 100 267t249 136q62 184 221 298t354 114q235 0 408.5 -158.5t196.5 -389.5
+q116 -25 192.5 -118.5t76.5 -214.5zM2048 438q0 -175 -97 -319q-23 -33 -64 -33q-24 0 -43 13q-26 17 -32 48.5t12 57.5q71 104 71 233t-71 233q-18 26 -12 57t32 49t57.5 11.5t49.5 -32.5q97 -142 97 -318zM2304 438q0 -244 -134 -443q-23 -34 -64 -34q-23 0 -42 13
+q-26 18 -32.5 49t11.5 57q108 164 108 358q0 195 -108 357q-18 26 -11.5 57.5t32.5 48.5q26 18 57 12t49 -33q134 -198 134 -442z" />
+    <glyph glyph-name="_610" unicode="&#xf28a;" 
+d="M1500 -13q0 -89 -63 -152.5t-153 -63.5t-153.5 63.5t-63.5 152.5q0 90 63.5 153.5t153.5 63.5t153 -63.5t63 -153.5zM1267 268q-115 -15 -192.5 -102.5t-77.5 -205.5q0 -74 33 -138q-146 -78 -379 -78q-109 0 -201 21t-153.5 54.5t-110.5 76.5t-76 85t-44.5 83
+t-23.5 66.5t-6 39.5q0 19 4.5 42.5t18.5 56t36.5 58t64 43.5t94.5 18t94 -17.5t63 -41t35.5 -53t17.5 -49t4 -33.5q0 -34 -23 -81q28 -27 82 -42t93 -17l40 -1q115 0 190 51t75 133q0 26 -9 48.5t-31.5 44.5t-49.5 41t-74 44t-93.5 47.5t-119.5 56.5q-28 13 -43 20
+q-116 55 -187 100t-122.5 102t-72 125.5t-20.5 162.5q0 78 20.5 150t66 137.5t112.5 114t166.5 77t221.5 28.5q120 0 220 -26t164.5 -67t109.5 -94t64 -105.5t19 -103.5q0 -46 -15 -82.5t-36.5 -58t-48.5 -36t-49 -19.5t-39 -5h-8h-32t-39 5t-44 14t-41 28t-37 46t-24 70.5
+t-10 97.5q-15 16 -59 25.5t-81 10.5l-37 1q-68 0 -117.5 -31t-70.5 -70t-21 -76q0 -24 5 -43t24 -46t53 -51t97 -53.5t150 -58.5q76 -25 138.5 -53.5t109 -55.5t83 -59t60.5 -59.5t41 -62.5t26.5 -62t14.5 -63.5t6 -62t1 -62.5z" />
+    <glyph glyph-name="_611" unicode="&#xf28b;" 
+d="M704 352v576q0 14 -9 23t-23 9h-256q-14 0 -23 -9t-9 -23v-576q0 -14 9 -23t23 -9h256q14 0 23 9t9 23zM1152 352v576q0 14 -9 23t-23 9h-256q-14 0 -23 -9t-9 -23v-576q0 -14 9 -23t23 -9h256q14 0 23 9t9 23zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103
+t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="_612" unicode="&#xf28c;" 
+d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM768 96q148 0 273 73t198 198t73 273t-73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273
+t73 -273t198 -198t273 -73zM864 320q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-576q0 -14 -9 -23t-23 -9h-192zM480 320q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-576q0 -14 -9 -23t-23 -9h-192z" />
+    <glyph glyph-name="_613" unicode="&#xf28d;" 
+d="M1088 352v576q0 14 -9 23t-23 9h-576q-14 0 -23 -9t-9 -23v-576q0 -14 9 -23t23 -9h576q14 0 23 9t9 23zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5
+t103 -385.5z" />
+    <glyph glyph-name="_614" unicode="&#xf28e;" 
+d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM768 96q148 0 273 73t198 198t73 273t-73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273
+t73 -273t198 -198t273 -73zM480 320q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h576q14 0 23 -9t9 -23v-576q0 -14 -9 -23t-23 -9h-576z" />
+    <glyph glyph-name="_615" unicode="&#xf290;" horiz-adv-x="1792" 
+d="M1757 128l35 -313q3 -28 -16 -50q-19 -21 -48 -21h-1664q-29 0 -48 21q-19 22 -16 50l35 313h1722zM1664 967l86 -775h-1708l86 775q3 24 21 40.5t43 16.5h256v-128q0 -53 37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5v128h384v-128q0 -53 37.5 -90.5t90.5 -37.5
+t90.5 37.5t37.5 90.5v128h256q25 0 43 -16.5t21 -40.5zM1280 1152v-256q0 -26 -19 -45t-45 -19t-45 19t-19 45v256q0 106 -75 181t-181 75t-181 -75t-75 -181v-256q0 -26 -19 -45t-45 -19t-45 19t-19 45v256q0 159 112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5z" />
+    <glyph glyph-name="_616" unicode="&#xf291;" horiz-adv-x="2048" 
+d="M1920 768q53 0 90.5 -37.5t37.5 -90.5t-37.5 -90.5t-90.5 -37.5h-15l-115 -662q-8 -46 -44 -76t-82 -30h-1280q-46 0 -82 30t-44 76l-115 662h-15q-53 0 -90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5h1792zM485 -32q26 2 43.5 22.5t15.5 46.5l-32 416q-2 26 -22.5 43.5
+t-46.5 15.5t-43.5 -22.5t-15.5 -46.5l32 -416q2 -25 20.5 -42t43.5 -17h5zM896 32v416q0 26 -19 45t-45 19t-45 -19t-19 -45v-416q0 -26 19 -45t45 -19t45 19t19 45zM1280 32v416q0 26 -19 45t-45 19t-45 -19t-19 -45v-416q0 -26 19 -45t45 -19t45 19t19 45zM1632 27l32 416
+q2 26 -15.5 46.5t-43.5 22.5t-46.5 -15.5t-22.5 -43.5l-32 -416q-2 -26 15.5 -46.5t43.5 -22.5h5q25 0 43.5 17t20.5 42zM476 1244l-93 -412h-132l101 441q19 88 89 143.5t160 55.5h167q0 26 19 45t45 19h384q26 0 45 -19t19 -45h167q90 0 160 -55.5t89 -143.5l101 -441
+h-132l-93 412q-11 44 -45.5 72t-79.5 28h-167q0 -26 -19 -45t-45 -19h-384q-26 0 -45 19t-19 45h-167q-45 0 -79.5 -28t-45.5 -72z" />
+    <glyph glyph-name="_617" unicode="&#xf292;" horiz-adv-x="1792" 
+d="M991 512l64 256h-254l-64 -256h254zM1759 1016l-56 -224q-7 -24 -31 -24h-327l-64 -256h311q15 0 25 -12q10 -14 6 -28l-56 -224q-5 -24 -31 -24h-327l-81 -328q-7 -24 -31 -24h-224q-16 0 -26 12q-9 12 -6 28l78 312h-254l-81 -328q-7 -24 -31 -24h-225q-15 0 -25 12
+q-9 12 -6 28l78 312h-311q-15 0 -25 12q-9 12 -6 28l56 224q7 24 31 24h327l64 256h-311q-15 0 -25 12q-10 14 -6 28l56 224q5 24 31 24h327l81 328q7 24 32 24h224q15 0 25 -12q9 -12 6 -28l-78 -312h254l81 328q7 24 32 24h224q15 0 25 -12q9 -12 6 -28l-78 -312h311
+q15 0 25 -12q9 -12 6 -28z" />
+    <glyph glyph-name="_618" unicode="&#xf293;" 
+d="M841 483l148 -148l-149 -149zM840 1094l149 -149l-148 -148zM710 -130l464 464l-306 306l306 306l-464 464v-611l-255 255l-93 -93l320 -321l-320 -321l93 -93l255 255v-611zM1429 640q0 -209 -32 -365.5t-87.5 -257t-140.5 -162.5t-181.5 -86.5t-219.5 -24.5
+t-219.5 24.5t-181.5 86.5t-140.5 162.5t-87.5 257t-32 365.5t32 365.5t87.5 257t140.5 162.5t181.5 86.5t219.5 24.5t219.5 -24.5t181.5 -86.5t140.5 -162.5t87.5 -257t32 -365.5z" />
+    <glyph glyph-name="_619" unicode="&#xf294;" horiz-adv-x="1024" 
+d="M596 113l173 172l-173 172v-344zM596 823l173 172l-173 172v-344zM628 640l356 -356l-539 -540v711l-297 -296l-108 108l372 373l-372 373l108 108l297 -296v711l539 -540z" />
+    <glyph glyph-name="_620" unicode="&#xf295;" 
+d="M1280 256q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM512 1024q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM1536 256q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5
+t112.5 -271.5zM1440 1344q0 -20 -13 -38l-1056 -1408q-19 -26 -51 -26h-160q-26 0 -45 19t-19 45q0 20 13 38l1056 1408q19 26 51 26h160q26 0 45 -19t19 -45zM768 1024q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5
+t271.5 -112.5t112.5 -271.5z" />
+    <glyph glyph-name="_621" unicode="&#xf296;" horiz-adv-x="1792" 
+d="M104 830l792 -1015l-868 630q-18 13 -25 34.5t0 42.5l101 308v0zM566 830h660l-330 -1015v0zM368 1442l198 -612h-462l198 612q8 23 33 23t33 -23zM1688 830l101 -308q7 -21 0 -42.5t-25 -34.5l-868 -630l792 1015v0zM1688 830h-462l198 612q8 23 33 23t33 -23z" />
+    <glyph glyph-name="_622" unicode="&#xf297;" horiz-adv-x="1792" 
+d="M384 704h160v224h-160v-224zM1221 372v92q-104 -36 -243 -38q-135 -1 -259.5 46.5t-220.5 122.5l1 -96q88 -80 212 -128.5t272 -47.5q129 0 238 49zM640 704h640v224h-640v-224zM1792 736q0 -187 -99 -352q89 -102 89 -229q0 -157 -129.5 -268t-313.5 -111
+q-122 0 -225 52.5t-161 140.5q-19 -1 -57 -1t-57 1q-58 -88 -161 -140.5t-225 -52.5q-184 0 -313.5 111t-129.5 268q0 127 89 229q-99 165 -99 352q0 209 120 385.5t326.5 279.5t449.5 103t449.5 -103t326.5 -279.5t120 -385.5z" />
+    <glyph glyph-name="_623" unicode="&#xf298;" 
+d="M515 625v-128h-252v128h252zM515 880v-127h-252v127h252zM1273 369v-128h-341v128h341zM1273 625v-128h-672v128h672zM1273 880v-127h-672v127h672zM1408 20v1240q0 8 -6 14t-14 6h-32l-378 -256l-210 171l-210 -171l-378 256h-32q-8 0 -14 -6t-6 -14v-1240q0 -8 6 -14
+t14 -6h1240q8 0 14 6t6 14zM553 1130l185 150h-406zM983 1130l221 150h-406zM1536 1260v-1240q0 -62 -43 -105t-105 -43h-1240q-62 0 -105 43t-43 105v1240q0 62 43 105t105 43h1240q62 0 105 -43t43 -105z" />
+    <glyph glyph-name="_624" unicode="&#xf299;" horiz-adv-x="1792" 
+d="M896 720q-104 196 -160 278q-139 202 -347 318q-34 19 -70 36q-89 40 -94 32t34 -38l39 -31q62 -43 112.5 -93.5t94.5 -116.5t70.5 -113t70.5 -131q9 -17 13 -25q44 -84 84 -153t98 -154t115.5 -150t131 -123.5t148.5 -90.5q153 -66 154 -60q1 3 -49 37q-53 36 -81 57
+q-77 58 -179 211t-185 310zM549 177q-76 60 -132.5 125t-98 143.5t-71 154.5t-58.5 186t-52 209t-60.5 252t-76.5 289q273 0 497.5 -36t379 -92t271 -144.5t185.5 -172.5t110 -198.5t56 -199.5t12.5 -198.5t-9.5 -173t-20 -143.5t-13 -107l323 -327h-104l-281 285
+q-22 -2 -91.5 -14t-121.5 -19t-138 -6t-160.5 17t-167.5 59t-179 111z" />
+    <glyph glyph-name="_625" unicode="&#xf29a;" horiz-adv-x="1792" 
+d="M1374 879q-6 26 -28.5 39.5t-48.5 7.5q-261 -62 -401 -62t-401 62q-26 6 -48.5 -7.5t-28.5 -39.5t7.5 -48.5t39.5 -28.5q194 -46 303 -58q-2 -158 -15.5 -269t-26.5 -155.5t-41 -115.5l-9 -21q-10 -25 1 -49t36 -34q9 -4 23 -4q44 0 60 41l8 20q54 139 71 259h42
+q17 -120 71 -259l8 -20q16 -41 60 -41q14 0 23 4q25 10 36 34t1 49l-9 21q-28 71 -41 115.5t-26.5 155.5t-15.5 269q109 12 303 58q26 6 39.5 28.5t7.5 48.5zM1024 1024q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5z
+M1600 640q0 -143 -55.5 -273.5t-150 -225t-225 -150t-273.5 -55.5t-273.5 55.5t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5zM896 1408q-156 0 -298 -61t-245 -164t-164 -245t-61 -298t61 -298
+t164 -245t245 -164t298 -61t298 61t245 164t164 245t61 298t-61 298t-164 245t-245 164t-298 61zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" />
+    <glyph glyph-name="_626" unicode="&#xf29b;" 
+d="M1438 723q34 -35 29 -82l-44 -551q-4 -42 -34.5 -70t-71.5 -28q-6 0 -9 1q-44 3 -72.5 36.5t-25.5 77.5l35 429l-143 -8q55 -113 55 -240q0 -216 -148 -372l-137 137q91 101 91 235q0 145 -102.5 248t-247.5 103q-134 0 -236 -92l-137 138q120 114 284 141l264 300
+l-149 87l-181 -161q-33 -30 -77 -27.5t-73 35.5t-26.5 77t34.5 73l239 213q26 23 60 26.5t64 -14.5l488 -283q36 -21 48 -68q17 -67 -26 -117l-205 -232l371 20q49 3 83 -32zM1240 1180q-74 0 -126 52t-52 126t52 126t126 52t126.5 -52t52.5 -126t-52.5 -126t-126.5 -52z
+M613 -62q106 0 196 61l139 -139q-146 -116 -335 -116q-148 0 -273.5 73t-198.5 198t-73 273q0 188 116 336l139 -139q-60 -88 -60 -197q0 -145 102.5 -247.5t247.5 -102.5z" />
+    <glyph glyph-name="_627" unicode="&#xf29c;" 
+d="M880 336v-160q0 -14 -9 -23t-23 -9h-160q-14 0 -23 9t-9 23v160q0 14 9 23t23 9h160q14 0 23 -9t9 -23zM1136 832q0 -50 -15 -90t-45.5 -69t-52 -44t-59.5 -36q-32 -18 -46.5 -28t-26 -24t-11.5 -29v-32q0 -14 -9 -23t-23 -9h-160q-14 0 -23 9t-9 23v68q0 35 10.5 64.5
+t24 47.5t39 35.5t41 25.5t44.5 21q53 25 75 43t22 49q0 42 -43.5 71.5t-95.5 29.5q-56 0 -95 -27q-29 -20 -80 -83q-9 -12 -25 -12q-11 0 -19 6l-108 82q-10 7 -12 20t5 23q122 192 349 192q129 0 238.5 -89.5t109.5 -214.5zM768 1280q-130 0 -248.5 -51t-204 -136.5
+t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5t-51 248.5t-136.5 204t-204 136.5t-248.5 51zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5
+t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="_628" unicode="&#xf29d;" horiz-adv-x="1408" 
+d="M366 1225q-64 0 -110 45.5t-46 110.5q0 64 46 109.5t110 45.5t109.5 -45.5t45.5 -109.5q0 -65 -45.5 -110.5t-109.5 -45.5zM917 583q0 -50 -30 -67.5t-63.5 -6.5t-47.5 34l-367 438q-7 12 -14 15.5t-11 1.5l-3 -3q-7 -8 4 -21l122 -139l1 -354l-161 -457
+q-67 -192 -92 -234q-15 -26 -28 -32q-50 -26 -103 -1q-29 13 -41.5 43t-9.5 57q2 17 197 618l5 416l-85 -164l35 -222q4 -24 -1 -42t-14 -27.5t-19 -16t-17 -7.5l-7 -2q-19 -3 -34.5 3t-24 16t-14 22t-7.5 19.5t-2 9.5l-46 299l211 381q23 34 113 34q75 0 107 -40l424 -521
+q7 -5 14 -17l3 -3l-1 -1q7 -13 7 -29zM514 433q43 -113 88.5 -225t69.5 -168l24 -55q36 -93 42 -125q11 -70 -36 -97q-35 -22 -66 -16t-51 22t-29 35h-1q-6 16 -8 25l-124 351zM1338 -159q31 -49 31 -57q0 -5 -3 -7q-9 -5 -14.5 0.5t-15.5 26t-16 30.5q-114 172 -423 661
+q3 -1 7 1t7 4l3 2q11 9 11 17z" />
+    <glyph glyph-name="_629" unicode="&#xf29e;" horiz-adv-x="2304" 
+d="M504 542h171l-1 265zM1530 641q0 87 -50.5 140t-146.5 53h-54v-388h52q91 0 145 57t54 138zM956 1018l1 -756q0 -14 -9.5 -24t-23.5 -10h-216q-14 0 -23.5 10t-9.5 24v62h-291l-55 -81q-10 -15 -28 -15h-267q-21 0 -30.5 18t3.5 35l556 757q9 14 27 14h332q14 0 24 -10
+t10 -24zM1783 641q0 -193 -125.5 -303t-324.5 -110h-270q-14 0 -24 10t-10 24v756q0 14 10 24t24 10h268q200 0 326 -109t126 -302zM1939 640q0 -11 -0.5 -29t-8 -71.5t-21.5 -102t-44.5 -108t-73.5 -102.5h-51q38 45 66.5 104.5t41.5 112t21 98t9 72.5l1 27q0 8 -0.5 22.5
+t-7.5 60t-20 91.5t-41 111.5t-66 124.5h43q41 -47 72 -107t45.5 -111.5t23 -96t10.5 -70.5zM2123 640q0 -11 -0.5 -29t-8 -71.5t-21.5 -102t-45 -108t-74 -102.5h-51q38 45 66.5 104.5t41.5 112t21 98t9 72.5l1 27q0 8 -0.5 22.5t-7.5 60t-19.5 91.5t-40.5 111.5t-66 124.5
+h43q41 -47 72 -107t45.5 -111.5t23 -96t10.5 -70.5zM2304 640q0 -11 -0.5 -29t-8 -71.5t-21.5 -102t-44.5 -108t-73.5 -102.5h-51q38 45 66 104.5t41 112t21 98t9 72.5l1 27q0 8 -0.5 22.5t-7.5 60t-19.5 91.5t-40.5 111.5t-66 124.5h43q41 -47 72 -107t45.5 -111.5t23 -96
+t9.5 -70.5z" />
+    <glyph glyph-name="uniF2A0" unicode="&#xf2a0;" horiz-adv-x="1408" 
+d="M617 -153q0 11 -13 58t-31 107t-20 69q-1 4 -5 26.5t-8.5 36t-13.5 21.5q-15 14 -51 14q-23 0 -70 -5.5t-71 -5.5q-34 0 -47 11q-6 5 -11 15.5t-7.5 20t-6.5 24t-5 18.5q-37 128 -37 255t37 255q1 4 5 18.5t6.5 24t7.5 20t11 15.5q13 11 47 11q24 0 71 -5.5t70 -5.5
+q36 0 51 14q9 8 13.5 21.5t8.5 36t5 26.5q2 9 20 69t31 107t13 58q0 22 -43.5 52.5t-75.5 42.5q-20 8 -45 8q-34 0 -98 -18q-57 -17 -96.5 -40.5t-71 -66t-46 -70t-45.5 -94.5q-6 -12 -9 -19q-49 -107 -68 -216t-19 -244t19 -244t68 -216q56 -122 83 -161q63 -91 179 -127
+l6 -2q64 -18 98 -18q25 0 45 8q32 12 75.5 42.5t43.5 52.5zM776 760q-26 0 -45 19t-19 45.5t19 45.5q37 37 37 90q0 52 -37 91q-19 19 -19 45t19 45t45 19t45 -19q75 -75 75 -181t-75 -181q-21 -19 -45 -19zM957 579q-27 0 -45 19q-19 19 -19 45t19 45q112 114 112 272
+t-112 272q-19 19 -19 45t19 45t45 19t45 -19q150 -150 150 -362t-150 -362q-18 -19 -45 -19zM1138 398q-27 0 -45 19q-19 19 -19 45t19 45q90 91 138.5 208t48.5 245t-48.5 245t-138.5 208q-19 19 -19 45t19 45t45 19t45 -19q109 -109 167 -249t58 -294t-58 -294t-167 -249
+q-18 -19 -45 -19z" />
+    <glyph glyph-name="uniF2A1" unicode="&#xf2a1;" horiz-adv-x="2176" 
+d="M192 352q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM704 352q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM704 864q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM1472 352
+q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM1984 352q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM1472 864q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM1984 864
+q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM1984 1376q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM384 192q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM896 192q0 -80 -56 -136
+t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM384 704q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM896 704q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM384 1216q0 -80 -56 -136t-136 -56
+t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1664 192q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM896 1216q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM2176 192q0 -80 -56 -136t-136 -56t-136 56
+t-56 136t56 136t136 56t136 -56t56 -136zM1664 704q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM2176 704q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1664 1216q0 -80 -56 -136t-136 -56t-136 56t-56 136
+t56 136t136 56t136 -56t56 -136zM2176 1216q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136z" />
+    <glyph glyph-name="uniF2A2" unicode="&#xf2a2;" horiz-adv-x="1792" 
+d="M128 -192q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45t45 19t45 -19t19 -45zM320 0q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45t45 19t45 -19t19 -45zM365 365l256 -256l-90 -90l-256 256zM704 384q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45t45 19t45 -19t19 -45z
+M1411 704q0 -59 -11.5 -108.5t-37.5 -93.5t-44 -67.5t-53 -64.5q-31 -35 -45.5 -54t-33.5 -50t-26.5 -64t-7.5 -74q0 -159 -112.5 -271.5t-271.5 -112.5q-26 0 -45 19t-19 45t19 45t45 19q106 0 181 75t75 181q0 57 11.5 105.5t37 91t43.5 66.5t52 63q40 46 59.5 72
+t37.5 74.5t18 103.5q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5q0 -26 -19 -45t-45 -19t-45 19t-19 45q0 117 45.5 223.5t123 184t184 123t223.5 45.5t223.5 -45.5t184 -123t123 -184t45.5 -223.5zM896 576q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45
+t45 19t45 -19t19 -45zM1184 704q0 -26 -19 -45t-45 -19t-45 19t-19 45q0 93 -65.5 158.5t-158.5 65.5q-92 0 -158 -65.5t-66 -158.5q0 -26 -19 -45t-45 -19t-45 19t-19 45q0 146 103 249t249 103t249 -103t103 -249zM1578 993q10 -25 -1 -49t-36 -34q-9 -4 -23 -4
+q-19 0 -35.5 11t-23.5 30q-68 178 -224 295q-21 16 -25 42t12 47q17 21 43 25t47 -12q183 -137 266 -351zM1788 1074q9 -25 -1.5 -49t-35.5 -34q-11 -4 -23 -4q-44 0 -60 41q-92 238 -297 393q-22 16 -25.5 42t12.5 47q16 22 42 25.5t47 -12.5q235 -175 341 -449z" />
+    <glyph glyph-name="uniF2A3" unicode="&#xf2a3;" horiz-adv-x="2304" 
+d="M1032 576q-59 2 -84 55q-17 34 -48 53.5t-68 19.5q-53 0 -90.5 -37.5t-37.5 -90.5q0 -56 36 -89l10 -8q34 -31 82 -31q37 0 68 19.5t48 53.5q25 53 84 55zM1600 704q0 56 -36 89l-10 8q-34 31 -82 31q-37 0 -68 -19.5t-48 -53.5q-25 -53 -84 -55q59 -2 84 -55
+q17 -34 48 -53.5t68 -19.5q53 0 90.5 37.5t37.5 90.5zM1174 925q-17 -35 -55 -48t-73 4q-62 31 -134 31q-51 0 -99 -17q3 0 9.5 0.5t9.5 0.5q92 0 170.5 -50t118.5 -133q17 -36 3.5 -73.5t-49.5 -54.5q-18 -9 -39 -9q21 0 39 -9q36 -17 49.5 -54.5t-3.5 -73.5
+q-40 -83 -118.5 -133t-170.5 -50h-6q-16 2 -44 4l-290 27l-239 -120q-14 -7 -29 -7q-40 0 -57 35l-160 320q-11 23 -4 47.5t29 37.5l209 119l148 267q17 155 91.5 291.5t195.5 236.5q31 25 70.5 21.5t64.5 -34.5t21.5 -70t-34.5 -65q-70 -59 -117 -128q123 84 267 101
+q40 5 71.5 -19t35.5 -64q5 -40 -19 -71.5t-64 -35.5q-84 -10 -159 -55q46 10 99 10q115 0 218 -50q36 -18 49 -55.5t-5 -73.5zM2137 1085l160 -320q11 -23 4 -47.5t-29 -37.5l-209 -119l-148 -267q-17 -155 -91.5 -291.5t-195.5 -236.5q-26 -22 -61 -22q-45 0 -74 35
+q-25 31 -21.5 70t34.5 65q70 59 117 128q-123 -84 -267 -101q-4 -1 -12 -1q-36 0 -63.5 24t-31.5 60q-5 40 19 71.5t64 35.5q84 10 159 55q-46 -10 -99 -10q-115 0 -218 50q-36 18 -49 55.5t5 73.5q17 35 55 48t73 -4q62 -31 134 -31q51 0 99 17q-3 0 -9.5 -0.5t-9.5 -0.5
+q-92 0 -170.5 50t-118.5 133q-17 36 -3.5 73.5t49.5 54.5q18 9 39 9q-21 0 -39 9q-36 17 -49.5 54.5t3.5 73.5q40 83 118.5 133t170.5 50h6h1q14 -2 42 -4l291 -27l239 120q14 7 29 7q40 0 57 -35z" />
+    <glyph glyph-name="uniF2A4" unicode="&#xf2a4;" horiz-adv-x="1792" 
+d="M1056 704q0 -26 19 -45t45 -19t45 19t19 45q0 146 -103 249t-249 103t-249 -103t-103 -249q0 -26 19 -45t45 -19t45 19t19 45q0 93 66 158.5t158 65.5t158 -65.5t66 -158.5zM835 1280q-117 0 -223.5 -45.5t-184 -123t-123 -184t-45.5 -223.5q0 -26 19 -45t45 -19t45 19
+t19 45q0 185 131.5 316.5t316.5 131.5t316.5 -131.5t131.5 -316.5q0 -55 -18 -103.5t-37.5 -74.5t-59.5 -72q-34 -39 -52 -63t-43.5 -66.5t-37 -91t-11.5 -105.5q0 -106 -75 -181t-181 -75q-26 0 -45 -19t-19 -45t19 -45t45 -19q159 0 271.5 112.5t112.5 271.5q0 41 7.5 74
+t26.5 64t33.5 50t45.5 54q35 41 53 64.5t44 67.5t37.5 93.5t11.5 108.5q0 117 -45.5 223.5t-123 184t-184 123t-223.5 45.5zM591 561l226 -226l-579 -579q-12 -12 -29 -12t-29 12l-168 168q-12 12 -12 29t12 29zM1612 1524l168 -168q12 -12 12 -29t-12 -30l-233 -233
+l-26 -25l-71 -71q-66 153 -195 258l91 91l207 207q13 12 30 12t29 -12z" />
+    <glyph glyph-name="uniF2A5" unicode="&#xf2a5;" 
+d="M866 1021q0 -27 -13 -94q-11 -50 -31.5 -150t-30.5 -150q-2 -11 -4.5 -12.5t-13.5 -2.5q-20 -2 -31 -2q-58 0 -84 49.5t-26 113.5q0 88 35 174t103 124q28 14 51 14q28 0 36.5 -16.5t8.5 -47.5zM1352 597q0 14 -39 75.5t-52 66.5q-21 8 -34 8q-91 0 -226 -77l-2 2
+q3 22 27.5 135t24.5 178q0 233 -242 233q-24 0 -68 -6q-94 -17 -168.5 -89.5t-111.5 -166.5t-37 -189q0 -146 80.5 -225t227.5 -79q25 0 25 -3t-1 -5q-4 -34 -26 -117q-14 -52 -51.5 -101t-82.5 -49q-42 0 -42 47q0 24 10.5 47.5t25 39.5t29.5 28.5t26 20t11 8.5q0 3 -7 10
+q-24 22 -58.5 36.5t-65.5 14.5q-35 0 -63.5 -34t-41 -75t-12.5 -75q0 -88 51.5 -142t138.5 -54q82 0 155 53t117.5 126t65.5 153q6 22 15.5 66.5t14.5 66.5q3 12 14 18q118 60 227 60q48 0 127 -18q1 -1 4 -1q5 0 9.5 4.5t4.5 8.5zM1536 1120v-960q0 -119 -84.5 -203.5
+t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="uniF2A6" unicode="&#xf2a6;" horiz-adv-x="1535" 
+d="M744 1231q0 24 -2 38.5t-8.5 30t-21 23t-37.5 7.5q-39 0 -78 -23q-105 -58 -159 -190.5t-54 -269.5q0 -44 8.5 -85.5t26.5 -80.5t52.5 -62.5t81.5 -23.5q4 0 18 -0.5t20 0t16 3t15 8.5t7 16q16 77 48 231.5t48 231.5q19 91 19 146zM1498 575q0 -7 -7.5 -13.5t-15.5 -6.5
+l-6 1q-22 3 -62 11t-72 12.5t-63 4.5q-167 0 -351 -93q-15 -8 -21 -27q-10 -36 -24.5 -105.5t-22.5 -100.5q-23 -91 -70 -179.5t-112.5 -164.5t-154.5 -123t-185 -47q-135 0 -214.5 83.5t-79.5 219.5q0 53 19.5 117t63 116.5t97.5 52.5q38 0 120 -33.5t83 -61.5
+q0 -1 -16.5 -12.5t-39.5 -31t-46 -44.5t-39 -61t-16 -74q0 -33 16.5 -53t48.5 -20q45 0 85 31.5t66.5 78t48 105.5t32.5 107t16 90v9q0 2 -3.5 3.5t-8.5 1.5h-10t-10 -0.5t-6 -0.5q-227 0 -352 122.5t-125 348.5q0 108 34.5 221t96 210t156 167.5t204.5 89.5q52 9 106 9
+q374 0 374 -360q0 -98 -38 -273t-43 -211l3 -3q101 57 182.5 88t167.5 31q22 0 53 -13q19 -7 80 -102.5t61 -116.5z" />
+    <glyph glyph-name="uniF2A7" unicode="&#xf2a7;" horiz-adv-x="1664" 
+d="M831 863q32 0 59 -18l222 -148q61 -40 110 -97l146 -170q40 -46 29 -106l-72 -413q-6 -32 -29.5 -53.5t-55.5 -25.5l-527 -56l-352 -32h-9q-39 0 -67.5 28t-28.5 68q0 37 27 64t65 32l260 32h-448q-41 0 -69.5 30t-26.5 71q2 39 32 65t69 26l442 1l-521 64q-41 5 -66 37
+t-19 73q6 35 34.5 57.5t65.5 22.5h10l481 -60l-351 94q-38 10 -62 41.5t-18 68.5q6 36 33 58.5t62 22.5q6 0 20 -2l448 -96l217 -37q1 0 3 -0.5t3 -0.5q23 0 30.5 23t-12.5 36l-186 125q-35 23 -42 63.5t18 73.5q27 38 76 38zM761 661l186 -125l-218 37l-5 2l-36 38
+l-238 262q-1 1 -2.5 3.5t-2.5 3.5q-24 31 -18.5 70t37.5 64q31 23 68 17.5t64 -33.5l142 -147q-2 -1 -5 -3.5t-4 -4.5q-32 -45 -23 -99t55 -85zM1648 1115l15 -266q4 -73 -11 -147l-48 -219q-12 -59 -67 -87l-106 -54q2 62 -39 109l-146 170q-53 61 -117 103l-222 148
+q-34 23 -76 23q-51 0 -88 -37l-235 312q-25 33 -18 73.5t41 63.5q33 22 71.5 14t62.5 -40l266 -352l-262 455q-21 35 -10.5 75t47.5 59q35 18 72.5 6t57.5 -46l241 -420l-136 337q-15 35 -4.5 74t44.5 56q37 19 76 6t56 -51l193 -415l101 -196q8 -15 23 -17.5t27 7.5t11 26
+l-12 224q-2 41 26 71t69 31q39 0 67 -28.5t30 -67.5z" />
+    <glyph glyph-name="uniF2A8" unicode="&#xf2a8;" horiz-adv-x="1792" 
+d="M335 180q-2 0 -6 2q-86 57 -168.5 145t-139.5 180q-21 30 -21 69q0 9 2 19t4 18t7 18t8.5 16t10.5 17t10 15t12 15.5t11 14.5q184 251 452 365q-110 198 -110 211q0 19 17 29q116 64 128 64q18 0 28 -16l124 -229q92 19 192 19q266 0 497.5 -137.5t378.5 -369.5
+q20 -31 20 -69t-20 -69q-91 -142 -218.5 -253.5t-278.5 -175.5q110 -198 110 -211q0 -20 -17 -29q-116 -64 -127 -64q-19 0 -29 16l-124 229l-64 119l-444 820l7 7q-58 -24 -99 -47q3 -5 127 -234t243 -449t119 -223q0 -7 -9 -9q-13 -3 -72 -3q-57 0 -60 7l-456 841
+q-39 -28 -82 -68q24 -43 214 -393.5t190 -354.5q0 -10 -11 -10q-14 0 -82.5 22t-72.5 28l-106 197l-224 413q-44 -53 -78 -106q2 -3 18 -25t23 -34l176 -327q0 -10 -10 -10zM1165 282l49 -91q273 111 450 385q-180 277 -459 389q67 -64 103 -148.5t36 -176.5
+q0 -106 -47 -200.5t-132 -157.5zM848 896q0 -20 14 -34t34 -14q86 0 147 -61t61 -147q0 -20 14 -34t34 -14t34 14t14 34q0 126 -89 215t-215 89q-20 0 -34 -14t-14 -34zM1214 961l-9 4l7 -7z" />
+    <glyph glyph-name="uniF2A9" unicode="&#xf2a9;" horiz-adv-x="1280" 
+d="M1050 430q0 -215 -147 -374q-148 -161 -378 -161q-232 0 -378 161q-147 159 -147 374q0 147 68 270.5t189 196.5t268 73q96 0 182 -31q-32 -62 -39 -126q-66 28 -143 28q-167 0 -280.5 -123t-113.5 -291q0 -170 112.5 -288.5t281.5 -118.5t281 118.5t112 288.5
+q0 89 -32 166q66 13 123 49q41 -98 41 -212zM846 619q0 -192 -79.5 -345t-238.5 -253l-14 -1q-29 0 -62 5q83 32 146.5 102.5t99.5 154.5t58.5 189t30 192.5t7.5 178.5q0 69 -3 103q55 -160 55 -326zM791 947v-2q-73 214 -206 440q88 -59 142.5 -186.5t63.5 -251.5z
+M1035 744q-83 0 -160 75q218 120 290 247q19 37 21 56q-42 -94 -139.5 -166.5t-204.5 -97.5q-35 54 -35 113q0 37 17 79t43 68q46 44 157 74q59 16 106 58.5t74 100.5q74 -105 74 -253q0 -109 -24 -170q-32 -77 -88.5 -130.5t-130.5 -53.5z" />
+    <glyph glyph-name="uniF2AA" unicode="&#xf2aa;" 
+d="M1050 495q0 78 -28 147q-41 -25 -85 -34q22 -50 22 -114q0 -117 -77 -198.5t-193 -81.5t-193.5 81.5t-77.5 198.5q0 115 78 199.5t193 84.5q53 0 98 -19q4 43 27 87q-60 21 -125 21q-154 0 -257.5 -108.5t-103.5 -263.5t103.5 -261t257.5 -106t257.5 106.5t103.5 260.5z
+M872 850q2 -24 2 -71q0 -63 -5 -123t-20.5 -132.5t-40.5 -130t-68.5 -106t-100.5 -70.5q21 -3 42 -3h10q219 139 219 411q0 116 -38 225zM872 850q-4 80 -44 171.5t-98 130.5q92 -156 142 -302zM1207 955q0 102 -51 174q-41 -86 -124 -109q-69 -19 -109 -53.5t-40 -99.5
+q0 -40 24 -77q74 17 140.5 67t95.5 115q-4 -52 -74.5 -111.5t-138.5 -97.5q52 -52 110 -52q51 0 90 37t60 90q17 42 17 117zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5
+t84.5 -203.5z" />
+    <glyph glyph-name="uniF2AB" unicode="&#xf2ab;" 
+d="M1279 388q0 22 -22 27q-67 15 -118 59t-80 108q-7 19 -7 25q0 15 19.5 26t43 17t43 20.5t19.5 36.5q0 19 -18.5 31.5t-38.5 12.5q-12 0 -32 -8t-31 -8q-4 0 -12 2q5 95 5 114q0 79 -17 114q-36 78 -103 121.5t-152 43.5q-199 0 -275 -165q-17 -35 -17 -114q0 -19 5 -114
+q-4 -2 -14 -2q-12 0 -32 7.5t-30 7.5q-21 0 -38.5 -12t-17.5 -32q0 -21 19.5 -35.5t43 -20.5t43 -17t19.5 -26q0 -6 -7 -25q-64 -138 -198 -167q-22 -5 -22 -27q0 -46 137 -68q2 -5 6 -26t11.5 -30.5t23.5 -9.5q12 0 37.5 4.5t39.5 4.5q35 0 67 -15t54 -32.5t57.5 -32.5
+t76.5 -15q43 0 79 15t57.5 32.5t53.5 32.5t67 15q14 0 39.5 -4t38.5 -4q16 0 23 10t11 30t6 25q137 22 137 68zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5
+t103 -385.5z" />
+    <glyph glyph-name="uniF2AC" unicode="&#xf2ac;" horiz-adv-x="1664" 
+d="M848 1408q134 1 240.5 -68.5t163.5 -192.5q27 -58 27 -179q0 -47 -9 -191q14 -7 28 -7q18 0 51 13.5t51 13.5q29 0 56 -18t27 -46q0 -32 -31.5 -54t-69 -31.5t-69 -29t-31.5 -47.5q0 -15 12 -43q37 -82 102.5 -150t144.5 -101q28 -12 80 -23q28 -6 28 -35
+q0 -70 -219 -103q-7 -11 -11 -39t-14 -46.5t-33 -18.5q-20 0 -62 6.5t-64 6.5q-37 0 -62 -5q-32 -5 -63 -22.5t-58 -38t-58 -40.5t-76 -33.5t-99 -13.5q-52 0 -96.5 13.5t-75 33.5t-57.5 40.5t-58 38t-62 22.5q-26 5 -63 5q-24 0 -65.5 -7.5t-58.5 -7.5q-25 0 -35 18.5
+t-14 47.5t-11 40q-219 33 -219 103q0 29 28 35q52 11 80 23q78 32 144.5 101t102.5 150q12 28 12 43q0 28 -31.5 47.5t-69.5 29.5t-69.5 31.5t-31.5 52.5q0 27 26 45.5t55 18.5q15 0 48 -13t53 -13q18 0 32 7q-9 142 -9 190q0 122 27 180q64 137 172 198t264 63z" />
+    <glyph glyph-name="uniF2AD" unicode="&#xf2ad;" 
+d="M1280 388q0 22 -22 27q-67 14 -118 58t-80 109q-7 14 -7 25q0 15 19.5 26t42.5 17t42.5 20.5t19.5 36.5q0 19 -18.5 31.5t-38.5 12.5q-11 0 -31 -8t-32 -8q-4 0 -12 2q5 63 5 115q0 78 -17 114q-36 78 -102.5 121.5t-152.5 43.5q-198 0 -275 -165q-18 -38 -18 -115
+q0 -38 6 -114q-10 -2 -15 -2q-11 0 -31.5 8t-30.5 8q-20 0 -37.5 -12.5t-17.5 -32.5q0 -21 19.5 -35.5t42.5 -20.5t42.5 -17t19.5 -26q0 -11 -7 -25q-64 -138 -198 -167q-22 -5 -22 -27q0 -47 138 -69q2 -5 6 -26t11 -30.5t23 -9.5q13 0 38.5 5t38.5 5q35 0 67.5 -15
+t54.5 -32.5t57.5 -32.5t76.5 -15q43 0 79 15t57.5 32.5t54 32.5t67.5 15q13 0 39 -4.5t39 -4.5q15 0 22.5 9.5t11.5 31t5 24.5q138 22 138 69zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960
+q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="uniF2AE" unicode="&#xf2ae;" horiz-adv-x="2304" 
+d="M2304 1536q-69 -46 -125 -92t-89 -81t-59.5 -71.5t-37.5 -57.5t-22 -44.5t-14 -29.5q-10 -18 -35.5 -136.5t-48.5 -164.5q-15 -29 -50 -60.5t-67.5 -50.5t-72.5 -41t-48 -28q-47 -31 -151 -231q-341 14 -630 -158q-92 -53 -303 -179q47 16 86 31t55 22l15 7
+q71 27 163 64.5t133.5 53.5t108 34.5t142.5 31.5q186 31 465 -7q1 0 10 -3q11 -6 14 -17t-3 -22l-194 -345q-15 -29 -47 -22q-128 24 -354 24q-146 0 -402 -44.5t-392 -46.5q-82 -1 -149 13t-107 37t-61 40t-33 34l-1 1v2q0 6 6 6q138 0 371 55q192 366 374.5 524t383.5 158
+q5 0 14.5 -0.5t38 -5t55 -12t61.5 -24.5t63 -39.5t54 -59t40 -82.5l102 177q2 4 21 42.5t44.5 86.5t61 109.5t84 133.5t100.5 137q66 82 128 141.5t121.5 96.5t92.5 53.5t88 39.5z" />
+    <glyph glyph-name="uniF2B0" unicode="&#xf2b0;" 
+d="M1322 640q0 -45 -5 -76l-236 14l224 -78q-19 -73 -58 -141l-214 103l177 -158q-44 -61 -107 -108l-157 178l103 -215q-61 -37 -140 -59l-79 228l14 -240q-38 -6 -76 -6t-76 6l14 238l-78 -226q-74 19 -140 59l103 215l-157 -178q-59 43 -108 108l178 158l-214 -104
+q-39 69 -58 141l224 79l-237 -14q-5 42 -5 76q0 35 5 77l238 -14l-225 79q19 73 58 140l214 -104l-177 159q46 61 107 108l158 -178l-103 215q67 39 140 58l77 -224l-13 236q36 6 75 6q38 0 76 -6l-14 -237l78 225q74 -19 140 -59l-103 -214l158 178q61 -47 107 -108
+l-177 -159l213 104q37 -62 58 -141l-224 -78l237 14q5 -31 5 -77zM1352 640q0 160 -78.5 295.5t-213 214t-292.5 78.5q-119 0 -227 -46.5t-186.5 -125t-124.5 -187.5t-46 -229q0 -119 46 -228t124.5 -187.5t186.5 -125t227 -46.5q158 0 292.5 78.5t213 214t78.5 294.5z
+M1425 1023v-766l-657 -383l-657 383v766l657 383zM768 -183l708 412v823l-708 411l-708 -411v-823zM1536 1088v-896l-768 -448l-768 448v896l768 448z" />
+    <glyph glyph-name="uniF2B1" unicode="&#xf2b1;" horiz-adv-x="1664" 
+d="M339 1318h691l-26 -72h-665q-110 0 -188.5 -79t-78.5 -189v-771q0 -95 60.5 -169.5t153.5 -93.5q23 -5 98 -5v-72h-45q-140 0 -239.5 100t-99.5 240v771q0 140 99.5 240t239.5 100zM1190 1536h247l-482 -1294q-23 -61 -40.5 -103.5t-45 -98t-54 -93.5t-64.5 -78.5
+t-79.5 -65t-95.5 -41t-116 -18.5v195q163 26 220 182q20 52 20 105q0 54 -20 106l-285 733h228l187 -585zM1664 978v-1111h-795q37 55 45 73h678v1038q0 85 -49.5 155t-129.5 99l25 67q101 -34 163.5 -123.5t62.5 -197.5z" />
+    <glyph glyph-name="uniF2B2" unicode="&#xf2b2;" horiz-adv-x="1792" 
+d="M852 1227q0 -29 -17 -52.5t-45 -23.5t-45 23.5t-17 52.5t17 52.5t45 23.5t45 -23.5t17 -52.5zM688 -149v114q0 30 -20.5 51.5t-50.5 21.5t-50 -21.5t-20 -51.5v-114q0 -30 20.5 -52t49.5 -22q30 0 50.5 22t20.5 52zM860 -149v114q0 30 -20 51.5t-50 21.5t-50.5 -21.5
+t-20.5 -51.5v-114q0 -30 20.5 -52t50.5 -22q29 0 49.5 22t20.5 52zM1034 -149v114q0 30 -20.5 51.5t-50.5 21.5t-50.5 -21.5t-20.5 -51.5v-114q0 -30 20.5 -52t50.5 -22t50.5 22t20.5 52zM1208 -149v114q0 30 -20.5 51.5t-50.5 21.5t-50.5 -21.5t-20.5 -51.5v-114
+q0 -30 20.5 -52t50.5 -22t50.5 22t20.5 52zM1476 535q-84 -160 -232 -259.5t-323 -99.5q-123 0 -229.5 51.5t-178.5 137t-113 197.5t-41 232q0 88 21 174q-104 -175 -104 -390q0 -162 65 -312t185 -251q30 57 91 57q56 0 86 -50q32 50 87 50q56 0 86 -50q32 50 87 50t87 -50
+q30 50 86 50q28 0 52.5 -15.5t37.5 -40.5q112 94 177 231.5t73 287.5zM1326 564q0 75 -72 75q-17 0 -47 -6q-95 -19 -149 -19q-226 0 -226 243q0 86 30 204q-83 -127 -83 -275q0 -150 89 -260.5t235 -110.5q111 0 210 70q13 48 13 79zM884 1223q0 50 -32 89.5t-81 39.5
+t-81 -39.5t-32 -89.5q0 -51 31.5 -90.5t81.5 -39.5t81.5 39.5t31.5 90.5zM1513 884q0 96 -37.5 179t-113 137t-173.5 54q-77 0 -149 -35t-127 -94q-48 -159 -48 -268q0 -104 45.5 -157t147.5 -53q53 0 142 19q36 6 53 6q51 0 77.5 -28t26.5 -80q0 -26 -4 -46
+q75 68 117.5 165.5t42.5 200.5zM1792 667q0 -111 -33.5 -249.5t-93.5 -204.5q-58 -64 -195 -142.5t-228 -104.5l-4 -1v-114q0 -43 -29.5 -75t-72.5 -32q-56 0 -86 50q-32 -50 -87 -50t-87 50q-30 -50 -86 -50q-55 0 -87 50q-30 -50 -86 -50q-47 0 -75 33.5t-28 81.5
+q-90 -68 -198 -68q-118 0 -211 80q54 1 106 20q-113 31 -182 127q32 -7 71 -7q89 0 164 46q-192 192 -240 306q-24 56 -24 160q0 57 9 125.5t31.5 146.5t55 141t86.5 105t120 42q59 0 81 -52q19 29 42 54q2 3 12 13t13 16q10 15 23 38t25 42t28 39q87 111 211.5 177
+t260.5 66q35 0 62 -4q59 64 146 64q83 0 140 -57q5 -5 5 -12q0 -5 -6 -13.5t-12.5 -16t-16 -17l-10.5 -10.5q17 -6 36 -18t19 -24q0 -6 -16 -25q157 -138 197 -378q25 30 60 30q45 0 100 -49q90 -80 90 -279z" />
+    <glyph glyph-name="uniF2B3" unicode="&#xf2b3;" 
+d="M917 631q0 33 -6 64h-362v-132h217q-12 -76 -74.5 -120.5t-142.5 -44.5q-99 0 -169 71.5t-70 170.5t70 170.5t169 71.5q93 0 153 -59l104 101q-108 100 -257 100q-160 0 -272 -112.5t-112 -271.5t112 -271.5t272 -112.5q165 0 266.5 105t101.5 270zM1262 585h109v110
+h-109v110h-110v-110h-110v-110h110v-110h110v110zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="uniF2B4" unicode="&#xf2b4;" 
+d="M1536 1024v-839q0 -48 -49 -62q-174 -52 -338 -52q-73 0 -215.5 29.5t-227.5 29.5q-164 0 -370 -48v-338h-160v1368q-63 25 -101 81t-38 124q0 91 64 155t155 64t155 -64t64 -155q0 -68 -38 -124t-101 -81v-68q190 44 343 44q99 0 198 -15q14 -2 111.5 -22.5t149.5 -20.5
+q77 0 165 18q11 2 80 21t89 19q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="uniF2B5" unicode="&#xf2b5;" horiz-adv-x="2304" 
+d="M192 384q40 0 56 32t0 64t-56 32t-56 -32t0 -64t56 -32zM1665 442q-10 13 -38.5 50t-41.5 54t-38 49t-42.5 53t-40.5 47t-45 49l-125 -140q-83 -94 -208.5 -92t-205.5 98q-57 69 -56.5 158t58.5 157l177 206q-22 11 -51 16.5t-47.5 6t-56.5 -0.5t-49 -1q-92 0 -158 -66
+l-158 -158h-155v-544q5 0 21 0.5t22 0t19.5 -2t20.5 -4.5t17.5 -8.5t18.5 -13.5l297 -292q115 -111 227 -111q78 0 125 47q57 -20 112.5 8t72.5 85q74 -6 127 44q20 18 36 45.5t14 50.5q10 -10 43 -10q43 0 77 21t49.5 53t12 71.5t-30.5 73.5zM1824 384h96v512h-93l-157 180
+q-66 76 -169 76h-167q-89 0 -146 -67l-209 -243q-28 -33 -28 -75t27 -75q43 -51 110 -52t111 49l193 218q25 23 53.5 21.5t47 -27t8.5 -56.5q16 -19 56 -63t60 -68q29 -36 82.5 -105.5t64.5 -84.5q52 -66 60 -140zM2112 384q40 0 56 32t0 64t-56 32t-56 -32t0 -64t56 -32z
+M2304 960v-640q0 -26 -19 -45t-45 -19h-434q-27 -65 -82 -106.5t-125 -51.5q-33 -48 -80.5 -81.5t-102.5 -45.5q-42 -53 -104.5 -81.5t-128.5 -24.5q-60 -34 -126 -39.5t-127.5 14t-117 53.5t-103.5 81l-287 282h-358q-26 0 -45 19t-19 45v672q0 26 19 45t45 19h421
+q14 14 47 48t47.5 48t44 40t50.5 37.5t51 25.5t62 19.5t68 5.5h117q99 0 181 -56q82 56 181 56h167q35 0 67 -6t56.5 -14.5t51.5 -26.5t44.5 -31t43 -39.5t39 -42t41 -48t41.5 -48.5h355q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="uniF2B6" unicode="&#xf2b6;" horiz-adv-x="1792" 
+d="M1792 882v-978q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v978q0 15 11 24q8 7 39 34.5t41.5 36t45.5 37.5t70 55.5t96 73t143.5 107t192.5 140.5q5 4 52.5 40t71.5 52.5t64 35t69 18.5t69 -18.5t65 -35.5t71 -52t52 -40q110 -80 192.5 -140.5t143.5 -107
+t96 -73t70 -55.5t45.5 -37.5t41.5 -36t39 -34.5q11 -9 11 -24zM1228 297q263 191 345 252q11 8 12.5 20.5t-6.5 23.5l-38 52q-8 11 -21 12.5t-24 -6.5q-231 -169 -343 -250q-5 -3 -52 -39t-71.5 -52.5t-64.5 -35t-69 -18.5t-69 18.5t-64.5 35t-71.5 52.5t-52 39
+q-186 134 -343 250q-11 8 -24 6.5t-21 -12.5l-38 -52q-8 -11 -6.5 -23.5t12.5 -20.5q82 -61 345 -252q10 -8 50 -38t65 -47t64 -39.5t77.5 -33.5t75.5 -11t75.5 11t79 34.5t64.5 39.5t65 47.5t48 36.5z" />
+    <glyph glyph-name="uniF2B7" unicode="&#xf2b7;" horiz-adv-x="1792" 
+d="M1474 623l39 -51q8 -11 6.5 -23.5t-11.5 -20.5q-43 -34 -126.5 -98.5t-146.5 -113t-67 -51.5q-39 -32 -60 -48t-60.5 -41t-76.5 -36.5t-74 -11.5h-1h-1q-37 0 -74 11.5t-76 36.5t-61 41.5t-60 47.5q-5 4 -65 50.5t-143.5 111t-122.5 94.5q-11 8 -12.5 20.5t6.5 23.5
+l37 52q8 11 21.5 13t24.5 -7q94 -73 306 -236q5 -4 43.5 -35t60.5 -46.5t56.5 -32.5t58.5 -17h1h1q24 0 58.5 17t56.5 32.5t60.5 46.5t43.5 35q258 198 313 242q11 8 24 6.5t21 -12.5zM1664 -96v928q-90 83 -159 139q-91 74 -389 304q-3 2 -43 35t-61 48t-56 32.5t-59 17.5
+h-1h-1q-24 0 -59 -17.5t-56 -32.5t-61 -48t-43 -35q-215 -166 -315.5 -245.5t-129.5 -104t-82 -74.5q-14 -12 -21 -19v-928q0 -13 9.5 -22.5t22.5 -9.5h1472q13 0 22.5 9.5t9.5 22.5zM1792 832v-928q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v928q0 56 41 94
+q123 114 350 290.5t233 181.5q36 30 59 47.5t61.5 42t76 36.5t74.5 12h1h1q37 0 74.5 -12t76 -36.5t61.5 -42t59 -47.5q43 -36 156 -122t226 -177t201 -173q41 -38 41 -94z" />
+    <glyph glyph-name="uniF2B8" unicode="&#xf2b8;" 
+d="M330 1l202 -214l-34 236l-216 213zM556 -225l274 218l-11 245l-300 -215zM245 413l227 -213l-48 327l-245 204zM495 189l317 214l-14 324l-352 -200zM843 178l95 -80l-2 239l-103 79q0 -1 1 -8.5t0 -12t-5 -7.5l-78 -52l85 -70q7 -6 7 -88zM138 930l256 -200l-68 465
+l-279 173zM1173 267l15 234l-230 -164l2 -240zM417 722l373 194l-19 441l-423 -163zM1270 357l20 233l-226 142l-2 -105l144 -95q6 -4 4 -9l-7 -119zM1461 496l30 222l-179 -128l-20 -228zM1273 329l-71 49l-8 -117q0 -5 -4 -8l-234 -187q-7 -5 -14 0l-98 83l7 -161
+q0 -5 -4 -8l-293 -234q-4 -2 -6 -2q-8 2 -8 3l-228 242q-4 4 -59 277q-2 7 5 11l61 37q-94 86 -95 92l-72 351q-2 7 6 12l94 45q-133 100 -135 108l-96 466q-2 10 7 13l433 135q5 0 8 -1l317 -153q6 -4 6 -9l20 -463q0 -7 -6 -10l-118 -61l126 -85q5 -2 5 -8l5 -123l121 74
+q5 4 11 0l84 -56l3 110q0 6 5 9l206 126q6 3 11 0l245 -135q4 -4 5 -7t-6.5 -60t-17.5 -124.5t-10 -70.5q0 -5 -4 -7l-191 -153q-6 -5 -13 0z" />
+    <glyph glyph-name="uniF2B9" unicode="&#xf2b9;" horiz-adv-x="1664" 
+d="M1201 298q0 57 -5.5 107t-21 100.5t-39.5 86t-64 58t-91 22.5q-6 -4 -33.5 -20.5t-42.5 -24.5t-40.5 -20t-49 -17t-46.5 -5t-46.5 5t-49 17t-40.5 20t-42.5 24.5t-33.5 20.5q-51 0 -91 -22.5t-64 -58t-39.5 -86t-21 -100.5t-5.5 -107q0 -73 42 -121.5t103 -48.5h576
+q61 0 103 48.5t42 121.5zM1028 892q0 108 -76.5 184t-183.5 76t-183.5 -76t-76.5 -184q0 -107 76.5 -183t183.5 -76t183.5 76t76.5 183zM1664 352v-192q0 -14 -9 -23t-23 -9h-96v-224q0 -66 -47 -113t-113 -47h-1216q-66 0 -113 47t-47 113v1472q0 66 47 113t113 47h1216
+q66 0 113 -47t47 -113v-224h96q14 0 23 -9t9 -23v-192q0 -14 -9 -23t-23 -9h-96v-128h96q14 0 23 -9t9 -23v-192q0 -14 -9 -23t-23 -9h-96v-128h96q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="uniF2BA" unicode="&#xf2ba;" horiz-adv-x="1664" 
+d="M1028 892q0 -107 -76.5 -183t-183.5 -76t-183.5 76t-76.5 183q0 108 76.5 184t183.5 76t183.5 -76t76.5 -184zM980 672q46 0 82.5 -17t60 -47.5t39.5 -67t24 -81t11.5 -82.5t3.5 -79q0 -67 -39.5 -118.5t-105.5 -51.5h-576q-66 0 -105.5 51.5t-39.5 118.5q0 48 4.5 93.5
+t18.5 98.5t36.5 91.5t63 64.5t93.5 26h5q7 -4 32 -19.5t35.5 -21t33 -17t37 -16t35 -9t39.5 -4.5t39.5 4.5t35 9t37 16t33 17t35.5 21t32 19.5zM1664 928q0 -13 -9.5 -22.5t-22.5 -9.5h-96v-128h96q13 0 22.5 -9.5t9.5 -22.5v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-96v-128h96
+q13 0 22.5 -9.5t9.5 -22.5v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-96v-224q0 -66 -47 -113t-113 -47h-1216q-66 0 -113 47t-47 113v1472q0 66 47 113t113 47h1216q66 0 113 -47t47 -113v-224h96q13 0 22.5 -9.5t9.5 -22.5v-192zM1408 -96v1472q0 13 -9.5 22.5t-22.5 9.5h-1216
+q-13 0 -22.5 -9.5t-9.5 -22.5v-1472q0 -13 9.5 -22.5t22.5 -9.5h1216q13 0 22.5 9.5t9.5 22.5z" />
+    <glyph glyph-name="uniF2BB" unicode="&#xf2bb;" horiz-adv-x="2048" 
+d="M1024 405q0 64 -9 117.5t-29.5 103t-60.5 78t-97 28.5q-6 -4 -30 -18t-37.5 -21.5t-35.5 -17.5t-43 -14.5t-42 -4.5t-42 4.5t-43 14.5t-35.5 17.5t-37.5 21.5t-30 18q-57 0 -97 -28.5t-60.5 -78t-29.5 -103t-9 -117.5t37 -106.5t91 -42.5h512q54 0 91 42.5t37 106.5z
+M867 925q0 94 -66.5 160.5t-160.5 66.5t-160.5 -66.5t-66.5 -160.5t66.5 -160.5t160.5 -66.5t160.5 66.5t66.5 160.5zM1792 416v64q0 14 -9 23t-23 9h-576q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h576q14 0 23 9t9 23zM1792 676v56q0 15 -10.5 25.5t-25.5 10.5h-568
+q-15 0 -25.5 -10.5t-10.5 -25.5v-56q0 -15 10.5 -25.5t25.5 -10.5h568q15 0 25.5 10.5t10.5 25.5zM1792 928v64q0 14 -9 23t-23 9h-576q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h576q14 0 23 9t9 23zM2048 1248v-1216q0 -66 -47 -113t-113 -47h-352v96q0 14 -9 23t-23 9
+h-64q-14 0 -23 -9t-9 -23v-96h-768v96q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-96h-352q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1728q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="uniF2BC" unicode="&#xf2bc;" horiz-adv-x="2048" 
+d="M1024 405q0 -64 -37 -106.5t-91 -42.5h-512q-54 0 -91 42.5t-37 106.5t9 117.5t29.5 103t60.5 78t97 28.5q6 -4 30 -18t37.5 -21.5t35.5 -17.5t43 -14.5t42 -4.5t42 4.5t43 14.5t35.5 17.5t37.5 21.5t30 18q57 0 97 -28.5t60.5 -78t29.5 -103t9 -117.5zM867 925
+q0 -94 -66.5 -160.5t-160.5 -66.5t-160.5 66.5t-66.5 160.5t66.5 160.5t160.5 66.5t160.5 -66.5t66.5 -160.5zM1792 480v-64q0 -14 -9 -23t-23 -9h-576q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h576q14 0 23 -9t9 -23zM1792 732v-56q0 -15 -10.5 -25.5t-25.5 -10.5h-568
+q-15 0 -25.5 10.5t-10.5 25.5v56q0 15 10.5 25.5t25.5 10.5h568q15 0 25.5 -10.5t10.5 -25.5zM1792 992v-64q0 -14 -9 -23t-23 -9h-576q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h576q14 0 23 -9t9 -23zM1920 32v1216q0 13 -9.5 22.5t-22.5 9.5h-1728q-13 0 -22.5 -9.5
+t-9.5 -22.5v-1216q0 -13 9.5 -22.5t22.5 -9.5h352v96q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-96h768v96q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-96h352q13 0 22.5 9.5t9.5 22.5zM2048 1248v-1216q0 -66 -47 -113t-113 -47h-1728q-66 0 -113 47t-47 113v1216q0 66 47 113
+t113 47h1728q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="uniF2BD" unicode="&#xf2bd;" horiz-adv-x="1792" 
+d="M1523 197q-22 155 -87.5 257.5t-184.5 118.5q-67 -74 -159.5 -115.5t-195.5 -41.5t-195.5 41.5t-159.5 115.5q-119 -16 -184.5 -118.5t-87.5 -257.5q106 -150 271 -237.5t356 -87.5t356 87.5t271 237.5zM1280 896q0 159 -112.5 271.5t-271.5 112.5t-271.5 -112.5
+t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5zM1792 640q0 -182 -71 -347.5t-190.5 -286t-285.5 -191.5t-349 -71q-182 0 -348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" />
+    <glyph glyph-name="uniF2BE" unicode="&#xf2be;" horiz-adv-x="1792" 
+d="M896 1536q182 0 348 -71t286 -191t191 -286t71 -348q0 -181 -70.5 -347t-190.5 -286t-286 -191.5t-349 -71.5t-349 71t-285.5 191.5t-190.5 286t-71 347.5t71 348t191 286t286 191t348 71zM1515 185q149 205 149 455q0 156 -61 298t-164 245t-245 164t-298 61t-298 -61
+t-245 -164t-164 -245t-61 -298q0 -250 149 -455q66 327 306 327q131 -128 313 -128t313 128q240 0 306 -327zM1280 832q0 159 -112.5 271.5t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5z" />
+    <glyph glyph-name="uniF2C0" unicode="&#xf2c0;" 
+d="M1201 752q47 -14 89.5 -38t89 -73t79.5 -115.5t55 -172t22 -236.5q0 -154 -100 -263.5t-241 -109.5h-854q-141 0 -241 109.5t-100 263.5q0 131 22 236.5t55 172t79.5 115.5t89 73t89.5 38q-79 125 -79 272q0 104 40.5 198.5t109.5 163.5t163.5 109.5t198.5 40.5
+t198.5 -40.5t163.5 -109.5t109.5 -163.5t40.5 -198.5q0 -147 -79 -272zM768 1408q-159 0 -271.5 -112.5t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5t-112.5 271.5t-271.5 112.5zM1195 -128q88 0 150.5 71.5t62.5 173.5q0 239 -78.5 377t-225.5 145
+q-145 -127 -336 -127t-336 127q-147 -7 -225.5 -145t-78.5 -377q0 -102 62.5 -173.5t150.5 -71.5h854z" />
+    <glyph glyph-name="uniF2C1" unicode="&#xf2c1;" horiz-adv-x="1280" 
+d="M1024 278q0 -64 -37 -107t-91 -43h-512q-54 0 -91 43t-37 107t9 118t29.5 104t61 78.5t96.5 28.5q80 -75 188 -75t188 75q56 0 96.5 -28.5t61 -78.5t29.5 -104t9 -118zM870 797q0 -94 -67.5 -160.5t-162.5 -66.5t-162.5 66.5t-67.5 160.5t67.5 160.5t162.5 66.5
+t162.5 -66.5t67.5 -160.5zM1152 -96v1376h-1024v-1376q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5zM1280 1376v-1472q0 -66 -47 -113t-113 -47h-960q-66 0 -113 47t-47 113v1472q0 66 47 113t113 47h352v-96q0 -14 9 -23t23 -9h192q14 0 23 9t9 23v96h352
+q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="uniF2C2" unicode="&#xf2c2;" horiz-adv-x="2048" 
+d="M896 324q0 54 -7.5 100.5t-24.5 90t-51 68.5t-81 25q-64 -64 -156 -64t-156 64q-47 0 -81 -25t-51 -68.5t-24.5 -90t-7.5 -100.5q0 -55 31.5 -93.5t75.5 -38.5h426q44 0 75.5 38.5t31.5 93.5zM768 768q0 80 -56 136t-136 56t-136 -56t-56 -136t56 -136t136 -56t136 56
+t56 136zM1792 288v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704q14 0 23 9t9 23zM1408 544v64q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1792 544v64q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23
+v-64q0 -14 9 -23t23 -9h192q14 0 23 9t9 23zM1792 800v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704q14 0 23 9t9 23zM128 1152h1792v96q0 14 -9 23t-23 9h-1728q-14 0 -23 -9t-9 -23v-96zM2048 1248v-1216q0 -66 -47 -113t-113 -47h-1728
+q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1728q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="uniF2C3" unicode="&#xf2c3;" horiz-adv-x="2048" 
+d="M896 324q0 -55 -31.5 -93.5t-75.5 -38.5h-426q-44 0 -75.5 38.5t-31.5 93.5q0 54 7.5 100.5t24.5 90t51 68.5t81 25q64 -64 156 -64t156 64q47 0 81 -25t51 -68.5t24.5 -90t7.5 -100.5zM768 768q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136z
+M1792 352v-64q0 -14 -9 -23t-23 -9h-704q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h704q14 0 23 -9t9 -23zM1408 608v-64q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h320q14 0 23 -9t9 -23zM1792 608v-64q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v64
+q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1792 864v-64q0 -14 -9 -23t-23 -9h-704q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h704q14 0 23 -9t9 -23zM1920 32v1120h-1792v-1120q0 -13 9.5 -22.5t22.5 -9.5h1728q13 0 22.5 9.5t9.5 22.5zM2048 1248v-1216q0 -66 -47 -113t-113 -47
+h-1728q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1728q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="uniF2C4" unicode="&#xf2c4;" horiz-adv-x="1792" 
+d="M1255 749q0 318 -105 474.5t-330 156.5q-222 0 -326 -157t-104 -474q0 -316 104 -471.5t326 -155.5q74 0 131 17q-22 43 -39 73t-44 65t-53.5 56.5t-63 36t-77.5 14.5q-46 0 -79 -16l-49 97q105 91 276 91q132 0 215.5 -54t150.5 -155q67 149 67 402zM1645 117h117
+q3 -27 -2 -67t-26.5 -95t-58 -100.5t-107 -78t-162.5 -32.5q-71 0 -130.5 19t-105.5 56t-79 78t-66 96q-97 -27 -205 -27q-150 0 -292.5 58t-253 158.5t-178 249t-67.5 317.5q0 170 67.5 319.5t178.5 250.5t253.5 159t291.5 58q121 0 238.5 -36t217 -106t176 -164.5
+t119.5 -219t43 -261.5q0 -190 -80.5 -347.5t-218.5 -264.5q47 -70 93.5 -106.5t104.5 -36.5q61 0 94 37.5t38 85.5z" />
+    <glyph glyph-name="uniF2C5" unicode="&#xf2c5;" horiz-adv-x="2304" 
+d="M453 -101q0 -21 -16 -37.5t-37 -16.5q-1 0 -13 3q-63 15 -162 140q-225 284 -225 676q0 341 213 614q39 51 95 103.5t94 52.5q19 0 35 -13.5t16 -32.5q0 -27 -63 -90q-98 -102 -147 -184q-119 -199 -119 -449q0 -281 123 -491q50 -85 136 -173q2 -3 14.5 -16t19.5 -21
+t17 -20.5t14.5 -23.5t4.5 -21zM1796 33q0 -29 -17.5 -48.5t-46.5 -19.5h-1081q-26 0 -45 19t-19 45q0 29 17.5 48.5t46.5 19.5h1081q26 0 45 -19t19 -45zM1581 644q0 -134 -67 -233q-25 -38 -69.5 -78.5t-83.5 -60.5q-16 -10 -27 -10q-7 0 -15 6t-8 12q0 9 19 30t42 46
+t42 67.5t19 88.5q0 76 -35 130q-29 42 -46 42q-3 0 -3 -5q0 -12 7.5 -35.5t7.5 -36.5q0 -22 -21.5 -35t-44.5 -13q-66 0 -66 76q0 15 1.5 44t1.5 44q0 25 -10 46q-13 25 -42 53.5t-51 28.5q-5 0 -7 -0.5t-3.5 -2.5t-1.5 -6q0 -2 16 -26t16 -54q0 -37 -19 -68t-46 -54
+t-53.5 -46t-45.5 -54t-19 -68q0 -98 42 -160q29 -43 79 -63q16 -5 17 -10q1 -2 1 -5q0 -16 -18 -16q-6 0 -33 11q-119 43 -195 139.5t-76 218.5q0 55 24.5 115.5t60 115t70.5 108.5t59.5 113.5t24.5 111.5q0 53 -25 94q-29 48 -56 64q-19 9 -19 21q0 20 41 20q50 0 110 -29
+q41 -19 71 -44.5t49.5 -51t33.5 -62.5t22 -69t16 -80q0 -1 3 -17.5t4.5 -25t5.5 -25t9 -27t11 -21.5t14.5 -16.5t18.5 -5.5q23 0 37 14t14 37q0 25 -20 67t-20 52t10 10q27 0 93 -70q72 -76 102.5 -156t30.5 -186zM2304 615q0 -274 -138 -503q-19 -32 -48 -72t-68 -86.5
+t-81 -77t-74 -30.5q-16 0 -31 15.5t-15 31.5q0 15 29 50.5t68.5 77t48.5 52.5q183 230 183 531q0 131 -20.5 235t-72.5 211q-58 119 -163 228q-2 3 -13 13.5t-16.5 16.5t-15 17.5t-15 20t-9.5 18.5t-4 19q0 19 16 35.5t35 16.5q70 0 196 -169q98 -131 146 -273t60 -314
+q2 -42 2 -64z" />
+    <glyph glyph-name="uniF2C6" unicode="&#xf2c6;" horiz-adv-x="1792" 
+d="M1189 229l147 693q9 44 -10.5 63t-51.5 7l-864 -333q-29 -11 -39.5 -25t-2.5 -26.5t32 -19.5l221 -69l513 323q21 14 32 6q7 -5 -4 -15l-415 -375v0v0l-16 -228q23 0 45 22l108 104l224 -165q64 -36 81 38zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71
+t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" />
+    <glyph glyph-name="uniF2C7" unicode="&#xf2c7;" horiz-adv-x="1024" 
+d="M640 192q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 60 35 110t93 71v907h128v-907q58 -21 93 -71t35 -110zM768 192q0 77 -34 144t-94 112v768q0 80 -56 136t-136 56t-136 -56t-56 -136v-768q-60 -45 -94 -112t-34 -144q0 -133 93.5 -226.5t226.5 -93.5t226.5 93.5
+t93.5 226.5zM896 192q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 182 128 313v711q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5v-711q128 -131 128 -313zM1024 768v-128h-192v128h192zM1024 1024v-128h-192v128h192zM1024 1280v-128h-192
+v128h192z" />
+    <glyph glyph-name="uniF2C8" unicode="&#xf2c8;" horiz-adv-x="1024" 
+d="M640 192q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 60 35 110t93 71v651h128v-651q58 -21 93 -71t35 -110zM768 192q0 77 -34 144t-94 112v768q0 80 -56 136t-136 56t-136 -56t-56 -136v-768q-60 -45 -94 -112t-34 -144q0 -133 93.5 -226.5t226.5 -93.5t226.5 93.5
+t93.5 226.5zM896 192q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 182 128 313v711q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5v-711q128 -131 128 -313zM1024 768v-128h-192v128h192zM1024 1024v-128h-192v128h192zM1024 1280v-128h-192
+v128h192z" />
+    <glyph glyph-name="uniF2C9" unicode="&#xf2c9;" horiz-adv-x="1024" 
+d="M640 192q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 60 35 110t93 71v395h128v-395q58 -21 93 -71t35 -110zM768 192q0 77 -34 144t-94 112v768q0 80 -56 136t-136 56t-136 -56t-56 -136v-768q-60 -45 -94 -112t-34 -144q0 -133 93.5 -226.5t226.5 -93.5t226.5 93.5
+t93.5 226.5zM896 192q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 182 128 313v711q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5v-711q128 -131 128 -313zM1024 768v-128h-192v128h192zM1024 1024v-128h-192v128h192zM1024 1280v-128h-192
+v128h192z" />
+    <glyph glyph-name="uniF2CA" unicode="&#xf2ca;" horiz-adv-x="1024" 
+d="M640 192q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 60 35 110t93 71v139h128v-139q58 -21 93 -71t35 -110zM768 192q0 77 -34 144t-94 112v768q0 80 -56 136t-136 56t-136 -56t-56 -136v-768q-60 -45 -94 -112t-34 -144q0 -133 93.5 -226.5t226.5 -93.5t226.5 93.5
+t93.5 226.5zM896 192q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 182 128 313v711q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5v-711q128 -131 128 -313zM1024 768v-128h-192v128h192zM1024 1024v-128h-192v128h192zM1024 1280v-128h-192
+v128h192z" />
+    <glyph glyph-name="uniF2CB" unicode="&#xf2cb;" horiz-adv-x="1024" 
+d="M640 192q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 79 56 135.5t136 56.5t136 -56.5t56 -135.5zM768 192q0 77 -34 144t-94 112v768q0 80 -56 136t-136 56t-136 -56t-56 -136v-768q-60 -45 -94 -112t-34 -144q0 -133 93.5 -226.5t226.5 -93.5t226.5 93.5t93.5 226.5z
+M896 192q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 182 128 313v711q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5v-711q128 -131 128 -313zM1024 768v-128h-192v128h192zM1024 1024v-128h-192v128h192zM1024 1280v-128h-192v128h192z" />
+    <glyph glyph-name="uniF2CC" unicode="&#xf2cc;" horiz-adv-x="1920" 
+d="M1433 1287q10 -10 10 -23t-10 -23l-626 -626q-10 -10 -23 -10t-23 10l-82 82q-10 10 -10 23t10 23l44 44q-72 91 -81.5 207t46.5 215q-74 71 -176 71q-106 0 -181 -75t-75 -181v-1280h-256v1280q0 104 40.5 198.5t109.5 163.5t163.5 109.5t198.5 40.5q106 0 201 -41
+t166 -115q94 39 197 24.5t185 -79.5l44 44q10 10 23 10t23 -10zM1344 1024q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1600 896q-26 0 -45 19t-19 45t19 45t45 19t45 -19t19 -45t-19 -45t-45 -19zM1856 1024q26 0 45 -19t19 -45t-19 -45t-45 -19
+t-45 19t-19 45t19 45t45 19zM1216 896q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1408 832q0 26 19 45t45 19t45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45zM1728 896q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1088 768
+q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1344 640q-26 0 -45 19t-19 45t19 45t45 19t45 -19t19 -45t-19 -45t-45 -19zM1600 768q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1216 512q-26 0 -45 19t-19 45t19 45t45 19t45 -19
+t19 -45t-19 -45t-45 -19zM1472 640q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1088 512q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1344 512q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1216 384
+q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1088 256q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19z" />
+    <glyph glyph-name="uniF2CD" unicode="&#xf2cd;" horiz-adv-x="1792" 
+d="M1664 448v-192q0 -169 -128 -286v-194q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v118q-63 -22 -128 -22h-768q-65 0 -128 22v-110q0 -17 -9.5 -28.5t-22.5 -11.5h-64q-13 0 -22.5 11.5t-9.5 28.5v186q-128 117 -128 286v192h1536zM704 864q0 -14 -9 -23t-23 -9t-23 9
+t-9 23t9 23t23 9t23 -9t9 -23zM768 928q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM704 992q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM832 992q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM768 1056q0 -14 -9 -23t-23 -9t-23 9
+t-9 23t9 23t23 9t23 -9t9 -23zM704 1120q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM1792 608v-64q0 -14 -9 -23t-23 -9h-1728q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96v640q0 106 75 181t181 75q108 0 184 -78q46 19 98 12t93 -39l22 22q11 11 22 0l42 -42
+q11 -11 0 -22l-314 -314q-11 -11 -22 0l-42 42q-11 11 0 22l22 22q-36 46 -40.5 104t23.5 108q-37 35 -88 35q-53 0 -90.5 -37.5t-37.5 -90.5v-640h1504q14 0 23 -9t9 -23zM896 1056q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM832 1120q0 -14 -9 -23t-23 -9
+t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM768 1184q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM960 1120q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM896 1184q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM832 1248q0 -14 -9 -23
+t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM1024 1184q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM960 1248q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM1088 1248q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23z" />
+    <glyph glyph-name="uniF2CE" unicode="&#xf2ce;" 
+d="M994 344q0 -86 -17 -197q-31 -215 -55 -313q-22 -90 -152 -90t-152 90q-24 98 -55 313q-17 110 -17 197q0 168 224 168t224 -168zM1536 768q0 -240 -134 -434t-350 -280q-8 -3 -15 3t-6 15q7 48 10 66q4 32 6 47q1 9 9 12q159 81 255.5 234t96.5 337q0 180 -91 330.5
+t-247 234.5t-337 74q-124 -7 -237 -61t-193.5 -140.5t-128 -202t-46.5 -240.5q1 -184 99 -336.5t257 -231.5q7 -3 9 -12q3 -21 6 -45q1 -9 5 -32.5t6 -35.5q1 -9 -6.5 -15t-15.5 -2q-148 58 -261 169.5t-173.5 264t-52.5 319.5q7 143 66 273.5t154.5 227t225 157.5t272.5 70
+q164 10 315.5 -46.5t261 -160.5t175 -250.5t65.5 -308.5zM994 800q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5zM1282 768q0 -122 -53.5 -228.5t-146.5 -177.5q-8 -6 -16 -2t-10 14q-6 52 -29 92q-7 10 3 20
+q58 54 91 127t33 155q0 111 -58.5 204t-157.5 141.5t-212 36.5q-133 -15 -229 -113t-109 -231q-10 -92 23.5 -176t98.5 -144q10 -10 3 -20q-24 -41 -29 -93q-2 -9 -10 -13t-16 2q-95 74 -148.5 183t-51.5 234q3 131 69 244t177 181.5t241 74.5q144 7 268 -60t196.5 -187.5
+t72.5 -263.5z" />
+    <glyph glyph-name="uniF2D0" unicode="&#xf2d0;" horiz-adv-x="1792" 
+d="M256 128h1280v768h-1280v-768zM1792 1248v-1216q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1472q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="uniF2D1" unicode="&#xf2d1;" horiz-adv-x="1792" 
+d="M1792 224v-192q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v192q0 66 47 113t113 47h1472q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="uniF2D2" unicode="&#xf2d2;" horiz-adv-x="2048" 
+d="M256 0h768v512h-768v-512zM1280 512h512v768h-768v-256h96q66 0 113 -47t47 -113v-352zM2048 1376v-960q0 -66 -47 -113t-113 -47h-608v-352q0 -66 -47 -113t-113 -47h-960q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h608v352q0 66 47 113t113 47h960q66 0 113 -47
+t47 -113z" />
+    <glyph glyph-name="uniF2D3" unicode="&#xf2d3;" horiz-adv-x="1792" 
+d="M1175 215l146 146q10 10 10 23t-10 23l-233 233l233 233q10 10 10 23t-10 23l-146 146q-10 10 -23 10t-23 -10l-233 -233l-233 233q-10 10 -23 10t-23 -10l-146 -146q-10 -10 -10 -23t10 -23l233 -233l-233 -233q-10 -10 -10 -23t10 -23l146 -146q10 -10 23 -10t23 10
+l233 233l233 -233q10 -10 23 -10t23 10zM1792 1248v-1216q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1472q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="uniF2D4" unicode="&#xf2d4;" horiz-adv-x="1792" 
+d="M1257 425l-146 -146q-10 -10 -23 -10t-23 10l-169 169l-169 -169q-10 -10 -23 -10t-23 10l-146 146q-10 10 -10 23t10 23l169 169l-169 169q-10 10 -10 23t10 23l146 146q10 10 23 10t23 -10l169 -169l169 169q10 10 23 10t23 -10l146 -146q10 -10 10 -23t-10 -23
+l-169 -169l169 -169q10 -10 10 -23t-10 -23zM256 128h1280v1024h-1280v-1024zM1792 1248v-1216q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1472q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="uniF2D5" unicode="&#xf2d5;" horiz-adv-x="1792" 
+d="M1070 358l306 564h-654l-306 -564h654zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" />
+    <glyph glyph-name="uniF2D6" unicode="&#xf2d6;" horiz-adv-x="1794" 
+d="M1291 1060q-15 17 -35 8.5t-26 -28.5t5 -38q14 -17 40 -14.5t34 20.5t-18 52zM895 814q-8 -8 -19.5 -8t-18.5 8q-8 8 -8 19t8 18q7 8 18.5 8t19.5 -8q7 -7 7 -18t-7 -19zM1060 740l-35 -35q-12 -13 -29.5 -13t-30.5 13l-38 38q-12 13 -12 30t12 30l35 35q12 12 29.5 12
+t30.5 -12l38 -39q12 -12 12 -29.5t-12 -29.5zM951 870q-7 -8 -18.5 -8t-19.5 8q-7 8 -7 19t7 19q8 8 19 8t19 -8t8 -19t-8 -19zM1354 968q-34 -64 -107.5 -85.5t-127.5 16.5q-38 28 -61 66.5t-21 87.5t39 92t75.5 53t70.5 -5t70 -51q2 -2 13 -12.5t14.5 -13.5t13 -13.5
+t12.5 -15.5t10 -15.5t8.5 -18t4 -18.5t1 -21t-5 -22t-9.5 -24zM1555 486q3 20 -8.5 34.5t-27.5 21.5t-33 17t-23 20q-40 71 -84 98.5t-113 11.5q19 13 40 18.5t33 4.5l12 -1q2 45 -34 90q6 20 6.5 40.5t-2.5 30.5l-3 10q43 24 71 65t34 91q10 84 -43 150.5t-137 76.5
+q-60 7 -114 -18.5t-82 -74.5q-30 -51 -33.5 -101t14.5 -87t43.5 -64t56.5 -42q-45 4 -88 36t-57 88q-28 108 32 222q-16 21 -29 32q-50 0 -89 -19q19 24 42 37t36 14l13 1q0 50 -13 78q-10 21 -32.5 28.5t-47 -3.5t-37.5 -40q2 4 4 7q-7 -28 -6.5 -75.5t19 -117t48.5 -122.5
+q-25 -14 -47 -36q-35 -16 -85.5 -70.5t-84.5 -101.5l-33 -46q-90 -34 -181 -125.5t-75 -162.5q1 -16 11 -27q-15 -12 -30 -30q-21 -25 -21 -54t21.5 -40t63.5 6q41 19 77 49.5t55 60.5q-2 2 -6.5 5t-20.5 7.5t-33 3.5q23 5 51 12.5t40 10t27.5 6t26 4t23.5 0.5q14 -7 22 34
+q7 37 7 90q0 102 -40 150q106 -103 101 -219q-1 -29 -15 -50t-27 -27l-13 -6q-4 -7 -19 -32t-26 -45.5t-26.5 -52t-25 -61t-17 -63t-6.5 -66.5t10 -63q-35 54 -37 80q-22 -24 -34.5 -39t-33.5 -42t-30.5 -46t-16.5 -41t-0.5 -38t25.5 -27q45 -25 144 64t190.5 221.5
+t122.5 228.5q86 52 145 115.5t86 119.5q47 -93 154 -178q104 -83 167 -80q39 2 46 43zM1794 640q0 -182 -71 -348t-191 -286t-286.5 -191t-348.5 -71t-348.5 71t-286.5 191t-191 286t-71 348t71 348t191 286t286.5 191t348.5 71t348.5 -71t286.5 -191t191 -286t71 -348z" />
+    <glyph glyph-name="uniF2D7" unicode="&#xf2d7;" 
+d="M518 1353v-655q103 -1 191.5 1.5t125.5 5.5l37 3q68 2 90.5 24.5t39.5 94.5l33 142h103l-14 -322l7 -319h-103l-29 127q-15 68 -45 93t-84 26q-87 8 -352 8v-556q0 -78 43.5 -115.5t133.5 -37.5h357q35 0 59.5 2t55 7.5t54 18t48.5 32t46 50.5t39 73l93 216h89
+q-6 -37 -31.5 -252t-30.5 -276q-146 5 -263.5 8t-162.5 4h-44h-628l-376 -12v102l127 25q67 13 91.5 37t25.5 79l8 643q3 402 -8 645q-2 61 -25.5 84t-91.5 36l-127 24v102l376 -12h702q139 0 374 27q-6 -68 -14 -194.5t-12 -219.5l-5 -92h-93l-32 124q-31 121 -74 179.5
+t-113 58.5h-548q-28 0 -35.5 -8.5t-7.5 -30.5z" />
+    <glyph glyph-name="uniF2D8" unicode="&#xf2d8;" 
+d="M922 739v-182q0 -4 0.5 -15t0 -15l-1.5 -12t-3.5 -11.5t-6.5 -7.5t-11 -5.5t-16 -1.5v309q9 0 16 -1t11 -5t6.5 -5.5t3.5 -9.5t1 -10.5v-13.5v-14zM1238 643v-121q0 -1 0.5 -12.5t0 -15.5t-2.5 -11.5t-7.5 -10.5t-13.5 -3q-9 0 -14 9q-4 10 -4 165v7v8.5v9t1.5 8.5l3.5 7
+t5 5.5t8 1.5q6 0 10 -1.5t6.5 -4.5t4 -6t2 -8.5t0.5 -8v-9.5v-9zM180 407h122v472h-122v-472zM614 407h106v472h-159l-28 -221q-20 148 -32 221h-158v-472h107v312l45 -312h76l43 319v-319zM1039 712q0 67 -5 90q-3 16 -11 28.5t-17 20.5t-25 14t-26.5 8.5t-31 4t-29 1.5
+h-29.5h-12h-91v-472h56q169 -1 197 24.5t25 180.5q-1 62 -1 100zM1356 515v133q0 29 -2 45t-9.5 33.5t-24.5 25t-46 7.5q-46 0 -77 -34v154h-117v-472h110l7 30q30 -36 77 -36q50 0 66 30.5t16 83.5zM1536 1248v-1216q0 -66 -47 -113t-113 -47h-1216q-66 0 -113 47t-47 113
+v1216q0 66 47 113t113 47h1216q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="uniF2D9" unicode="&#xf2d9;" horiz-adv-x="2176" 
+d="M1143 -197q-6 1 -11 4q-13 8 -36 23t-86 65t-116.5 104.5t-112 140t-89.5 172.5q-17 3 -175 37q66 -213 235 -362t391 -184zM502 409l168 -28q-25 76 -41 167.5t-19 145.5l-4 53q-84 -82 -121 -224q5 -65 17 -114zM612 1018q-43 -64 -77 -148q44 46 74 68zM2049 584
+q0 161 -62 307t-167.5 252t-250.5 168.5t-304 62.5q-147 0 -281 -52.5t-240 -148.5q-30 -58 -45 -160q60 51 143 83.5t158.5 43t143 13.5t108.5 -1l40 -3q33 -1 53 -15.5t24.5 -33t6.5 -37t-1 -28.5q-126 11 -227.5 0.5t-183 -43.5t-142.5 -71.5t-131 -98.5
+q4 -36 11.5 -92.5t35.5 -178t62 -179.5q123 -6 247.5 14.5t214.5 53.5t162.5 67t109.5 59l37 24q22 16 39.5 20.5t30.5 -5t17 -34.5q14 -97 -39 -121q-208 -97 -467 -134q-135 -20 -317 -16q41 -96 110 -176.5t137 -127t130.5 -79t101.5 -43.5l39 -12q143 -23 263 15
+q195 99 314 289t119 418zM2123 621q-14 -135 -40 -212q-70 -208 -181.5 -346.5t-318.5 -253.5q-48 -33 -82 -44q-72 -26 -163 -16q-36 -3 -73 -3q-283 0 -504.5 173t-295.5 442q-1 0 -4 0.5t-5 0.5q-6 -50 2.5 -112.5t26 -115t36 -98t31.5 -71.5l14 -26q8 -12 54 -82
+q-71 38 -124.5 106.5t-78.5 140t-39.5 137t-17.5 107.5l-2 42q-5 2 -33.5 12.5t-48.5 18t-53 20.5t-57.5 25t-50 25.5t-42.5 27t-25 25.5q19 -10 50.5 -25.5t113 -45.5t145.5 -38l2 32q11 149 94 290q41 202 176 365q28 115 81 214q15 28 32 45t49 32q158 74 303.5 104
+t302 11t306.5 -97q220 -115 333 -336t87 -474z" />
+    <glyph glyph-name="uniF2DA" unicode="&#xf2da;" horiz-adv-x="1792" 
+d="M1341 752q29 44 -6.5 129.5t-121.5 142.5q-58 39 -125.5 53.5t-118 4.5t-68.5 -37q-12 -23 -4.5 -28t42.5 -10q23 -3 38.5 -5t44.5 -9.5t56 -17.5q36 -13 67.5 -31.5t53 -37t40 -38.5t30.5 -38t22 -34.5t16.5 -28.5t12 -18.5t10.5 -6t11 9.5zM1704 178
+q-52 -127 -148.5 -220t-214.5 -141.5t-253 -60.5t-266 13.5t-251 91t-210 161.5t-141.5 235.5t-46.5 303.5q1 41 8.5 84.5t12.5 64t24 80.5t23 73q-51 -208 1 -397t173 -318t291 -206t346 -83t349 74.5t289 244.5q20 27 18 14q0 -4 -4 -14zM1465 627q0 -104 -40.5 -199
+t-108.5 -164t-162 -109.5t-198 -40.5t-198 40.5t-162 109.5t-108.5 164t-40.5 199t40.5 199t108.5 164t162 109.5t198 40.5t198 -40.5t162 -109.5t108.5 -164t40.5 -199zM1752 915q-65 147 -180.5 251t-253 153.5t-292 53.5t-301 -36.5t-275.5 -129t-220 -211.5t-131 -297
+t-10 -373q-49 161 -51.5 311.5t35.5 272.5t109 227t165.5 180.5t207 126t232 71t242.5 9t236 -54t216 -124.5t178 -197q33 -50 62 -121t31 -112zM1690 573q12 244 -136.5 416t-396.5 240q-8 0 -10 5t24 8q125 -4 230 -50t173 -120t116 -168.5t58.5 -199t-1 -208
+t-61.5 -197.5t-122.5 -167t-185 -117.5t-248.5 -46.5q108 30 201.5 80t174 123t129.5 176.5t55 225.5z" />
+    <glyph glyph-name="uniF2DB" unicode="&#xf2db;" 
+d="M192 256v-128h-112q-16 0 -16 16v16h-48q-16 0 -16 16v32q0 16 16 16h48v16q0 16 16 16h112zM192 512v-128h-112q-16 0 -16 16v16h-48q-16 0 -16 16v32q0 16 16 16h48v16q0 16 16 16h112zM192 768v-128h-112q-16 0 -16 16v16h-48q-16 0 -16 16v32q0 16 16 16h48v16
+q0 16 16 16h112zM192 1024v-128h-112q-16 0 -16 16v16h-48q-16 0 -16 16v32q0 16 16 16h48v16q0 16 16 16h112zM192 1280v-128h-112q-16 0 -16 16v16h-48q-16 0 -16 16v32q0 16 16 16h48v16q0 16 16 16h112zM1280 1440v-1472q0 -40 -28 -68t-68 -28h-832q-40 0 -68 28
+t-28 68v1472q0 40 28 68t68 28h832q40 0 68 -28t28 -68zM1536 208v-32q0 -16 -16 -16h-48v-16q0 -16 -16 -16h-112v128h112q16 0 16 -16v-16h48q16 0 16 -16zM1536 464v-32q0 -16 -16 -16h-48v-16q0 -16 -16 -16h-112v128h112q16 0 16 -16v-16h48q16 0 16 -16zM1536 720v-32
+q0 -16 -16 -16h-48v-16q0 -16 -16 -16h-112v128h112q16 0 16 -16v-16h48q16 0 16 -16zM1536 976v-32q0 -16 -16 -16h-48v-16q0 -16 -16 -16h-112v128h112q16 0 16 -16v-16h48q16 0 16 -16zM1536 1232v-32q0 -16 -16 -16h-48v-16q0 -16 -16 -16h-112v128h112q16 0 16 -16v-16
+h48q16 0 16 -16z" />
+    <glyph glyph-name="uniF2DC" unicode="&#xf2dc;" horiz-adv-x="1664" 
+d="M1566 419l-167 -33l186 -107q23 -13 29.5 -38.5t-6.5 -48.5q-14 -23 -39 -29.5t-48 6.5l-186 106l55 -160q13 -38 -12 -63.5t-60.5 -20.5t-48.5 42l-102 300l-271 156v-313l208 -238q16 -18 17 -39t-11 -36.5t-28.5 -25t-37 -5.5t-36.5 22l-112 128v-214q0 -26 -19 -45
+t-45 -19t-45 19t-19 45v214l-112 -128q-16 -18 -36.5 -22t-37 5.5t-28.5 25t-11 36.5t17 39l208 238v313l-271 -156l-102 -300q-13 -37 -48.5 -42t-60.5 20.5t-12 63.5l55 160l-186 -106q-23 -13 -48 -6.5t-39 29.5q-13 23 -6.5 48.5t29.5 38.5l186 107l-167 33
+q-29 6 -42 29t-8.5 46.5t25.5 40t50 10.5l310 -62l271 157l-271 157l-310 -62q-4 -1 -13 -1q-27 0 -44 18t-19 40t11 43t40 26l167 33l-186 107q-23 13 -29.5 38.5t6.5 48.5t39 30t48 -7l186 -106l-55 160q-13 38 12 63.5t60.5 20.5t48.5 -42l102 -300l271 -156v313
+l-208 238q-16 18 -17 39t11 36.5t28.5 25t37 5.5t36.5 -22l112 -128v214q0 26 19 45t45 19t45 -19t19 -45v-214l112 128q16 18 36.5 22t37 -5.5t28.5 -25t11 -36.5t-17 -39l-208 -238v-313l271 156l102 300q13 37 48.5 42t60.5 -20.5t12 -63.5l-55 -160l186 106
+q23 13 48 6.5t39 -29.5q13 -23 6.5 -48.5t-29.5 -38.5l-186 -107l167 -33q27 -5 40 -26t11 -43t-19 -40t-44 -18q-9 0 -13 1l-310 62l-271 -157l271 -157l310 62q29 6 50 -10.5t25.5 -40t-8.5 -46.5t-42 -29z" />
+    <glyph glyph-name="uniF2DD" unicode="&#xf2dd;" horiz-adv-x="1792" 
+d="M1473 607q7 118 -33 226.5t-113 189t-177 131t-221 57.5q-116 7 -225.5 -32t-192 -110.5t-135 -175t-59.5 -220.5q-7 -118 33 -226.5t113 -189t177.5 -131t221.5 -57.5q155 -9 293 59t224 195.5t94 283.5zM1792 1536l-349 -348q120 -117 180.5 -272t50.5 -321
+q-11 -183 -102 -339t-241 -255.5t-332 -124.5l-999 -132l347 347q-120 116 -180.5 271.5t-50.5 321.5q11 184 102 340t241.5 255.5t332.5 124.5q167 22 500 66t500 66z" />
+    <glyph glyph-name="uniF2DE" unicode="&#xf2de;" horiz-adv-x="1792" 
+d="M948 508l163 -329h-51l-175 350l-171 -350h-49l179 374l-78 33l21 49l240 -102l-21 -50zM563 1100l304 -130l-130 -304l-304 130zM907 915l240 -103l-103 -239l-239 102zM1188 765l191 -81l-82 -190l-190 81zM1680 640q0 159 -62 304t-167.5 250.5t-250.5 167.5t-304 62
+t-304 -62t-250.5 -167.5t-167.5 -250.5t-62 -304t62 -304t167.5 -250.5t250.5 -167.5t304 -62t304 62t250.5 167.5t167.5 250.5t62 304zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71
+t286 -191t191 -286t71 -348z" />
+    <glyph glyph-name="uniF2E0" unicode="&#xf2e0;" horiz-adv-x="1920" 
+d="M1334 302q-4 24 -27.5 34t-49.5 10.5t-48.5 12.5t-25.5 38q-5 47 33 139.5t75 181t32 127.5q-14 101 -117 103q-45 1 -75 -16l-3 -2l-5 -2.5t-4.5 -2t-5 -2t-5 -0.5t-6 1.5t-6 3.5t-6.5 5q-3 2 -9 8.5t-9 9t-8.5 7.5t-9.5 7.5t-9.5 5.5t-11 4.5t-11.5 2.5q-30 5 -48 -3
+t-45 -31q-1 -1 -9 -8.5t-12.5 -11t-15 -10t-16.5 -5.5t-17 3q-54 27 -84 40q-41 18 -94 -5t-76 -65q-16 -28 -41 -98.5t-43.5 -132.5t-40 -134t-21.5 -73q-22 -69 18.5 -119t110.5 -46q30 2 50.5 15t38.5 46q7 13 79 199.5t77 194.5q6 11 21.5 18t29.5 0q27 -15 21 -53
+q-2 -18 -51 -139.5t-50 -132.5q-6 -38 19.5 -56.5t60.5 -7t55 49.5q4 8 45.5 92t81.5 163.5t46 88.5q20 29 41 28q29 0 25 -38q-2 -16 -65.5 -147.5t-70.5 -159.5q-12 -53 13 -103t74 -74q17 -9 51 -15.5t71.5 -8t62.5 14t20 48.5zM383 86q3 -15 -5 -27.5t-23 -15.5
+q-14 -3 -26.5 5t-15.5 23q-3 14 5 27t22 16t27 -5t16 -23zM953 -177q12 -17 8.5 -37.5t-20.5 -32.5t-37.5 -8t-32.5 21q-11 17 -7.5 37.5t20.5 32.5t37.5 8t31.5 -21zM177 635q-18 -27 -49.5 -33t-57.5 13q-26 18 -32 50t12 58q18 27 49.5 33t57.5 -12q26 -19 32 -50.5
+t-12 -58.5zM1467 -42q19 -28 13 -61.5t-34 -52.5t-60.5 -13t-51.5 34t-13 61t33 53q28 19 60.5 13t52.5 -34zM1579 562q69 -113 42.5 -244.5t-134.5 -207.5q-90 -63 -199 -60q-20 -80 -84.5 -127t-143.5 -44.5t-140 57.5q-12 -9 -13 -10q-103 -71 -225 -48.5t-193 126.5
+q-50 73 -53 164q-83 14 -142.5 70.5t-80.5 128t-2 152t81 138.5q-36 60 -38 128t24.5 125t79.5 98.5t121 50.5q32 85 99 148t146.5 91.5t168 17t159.5 -66.5q72 21 140 17.5t128.5 -36t104.5 -80t67.5 -115t17.5 -140.5q52 -16 87 -57t45.5 -89t-5.5 -99.5t-58 -87.5z
+M455 1222q14 -20 9.5 -44.5t-24.5 -38.5q-19 -14 -43.5 -9.5t-37.5 24.5q-14 20 -9.5 44.5t24.5 38.5q19 14 43.5 9.5t37.5 -24.5zM614 1503q4 -16 -5 -30.5t-26 -18.5t-31 5.5t-18 26.5q-3 17 6.5 31t25.5 18q17 4 31 -5.5t17 -26.5zM1800 555q4 -20 -6.5 -37t-30.5 -21
+q-19 -4 -36 6.5t-21 30.5t6.5 37t30.5 22q20 4 36.5 -7.5t20.5 -30.5zM1136 1448q16 -27 8.5 -58.5t-35.5 -47.5q-27 -16 -57.5 -8.5t-46.5 34.5q-16 28 -8.5 59t34.5 48t58 9t47 -36zM1882 792q4 -15 -4 -27.5t-23 -16.5q-15 -3 -27.5 5.5t-15.5 22.5q-3 15 5 28t23 16
+q14 3 26.5 -5t15.5 -23zM1691 1033q15 -22 10.5 -49t-26.5 -43q-22 -15 -49 -10t-42 27t-10 49t27 43t48.5 11t41.5 -28z" />
+    <glyph glyph-name="uniF2E1" unicode="&#xf2e1;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2E2" unicode="&#xf2e2;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2E3" unicode="&#xf2e3;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2E4" unicode="&#xf2e4;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2E5" unicode="&#xf2e5;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2E6" unicode="&#xf2e6;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2E7" unicode="&#xf2e7;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="_698" unicode="&#xf2e8;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2E9" unicode="&#xf2e9;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2EA" unicode="&#xf2ea;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2EB" unicode="&#xf2eb;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2EC" unicode="&#xf2ec;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2ED" unicode="&#xf2ed;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2EE" unicode="&#xf2ee;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="lessequal" unicode="&#xf500;" horiz-adv-x="1792" 
+ />
+  </font>
+</defs></svg>
diff --git a/docs/lib/font-awesome/fonts/fontawesome-webfont.ttf b/docs/lib/font-awesome/fonts/fontawesome-webfont.ttf
new file mode 100644
index 0000000..35acda2
Binary files /dev/null and b/docs/lib/font-awesome/fonts/fontawesome-webfont.ttf differ
diff --git a/docs/lib/font-awesome/fonts/fontawesome-webfont.woff b/docs/lib/font-awesome/fonts/fontawesome-webfont.woff
new file mode 100644
index 0000000..400014a
Binary files /dev/null and b/docs/lib/font-awesome/fonts/fontawesome-webfont.woff differ
diff --git a/docs/lib/font-awesome/fonts/fontawesome-webfont.woff2 b/docs/lib/font-awesome/fonts/fontawesome-webfont.woff2
new file mode 100644
index 0000000..4d13fc6
Binary files /dev/null and b/docs/lib/font-awesome/fonts/fontawesome-webfont.woff2 differ
diff --git a/docs/lib/ionicons/css/ionicons.css b/docs/lib/ionicons/css/ionicons.css
new file mode 100644
index 0000000..885aa6b
--- /dev/null
+++ b/docs/lib/ionicons/css/ionicons.css
@@ -0,0 +1,1480 @@
+@charset "UTF-8";
+/*!
+  Ionicons, v2.0.0
+  Created by Ben Sperry for the Ionic Framework, http://ionicons.com/
+  https://twitter.com/benjsperry  https://twitter.com/ionicframework
+  MIT License: https://github.com/driftyco/ionicons
+
+  Android-style icons originally built by Google’s
+  Material Design Icons: https://github.com/google/material-design-icons
+  used under CC BY http://creativecommons.org/licenses/by/4.0/
+  Modified icons to fit ionicon’s grid from original.
+*/
+@font-face { font-family: "Ionicons"; src: url("../fonts/ionicons.eot?v=2.0.0"); src: url("../fonts/ionicons.eot?v=2.0.0#iefix") format("embedded-opentype"), url("../fonts/ionicons.ttf?v=2.0.0") format("truetype"), url("../fonts/ionicons.woff?v=2.0.0") format("woff"), url("../fonts/ionicons.svg?v=2.0.0#Ionicons") format("svg"); font-weight: normal; font-style: normal; }
+.ion, .ionicons, .ion-alert:before, .ion-alert-circled:before, .ion-android-add:before, .ion-android-add-circle:before, .ion-android-alarm-clock:before, .ion-android-alert:before, .ion-android-apps:before, .ion-android-archive:before, .ion-android-arrow-back:before, .ion-android-arrow-down:before, .ion-android-arrow-dropdown:before, .ion-android-arrow-dropdown-circle:before, .ion-android-arrow-dropleft:before, .ion-android-arrow-dropleft-circle:before, .ion-android-arrow-dropright:before, .ion-android-arrow-dropright-circle:before, .ion-android-arrow-dropup:before, .ion-android-arrow-dropup-circle:before, .ion-android-arrow-forward:before, .ion-android-arrow-up:before, .ion-android-attach:before, .ion-android-bar:before, .ion-android-bicycle:before, .ion-android-boat:before, .ion-android-bookmark:before, .ion-android-bulb:before, .ion-android-bus:before, .ion-android-calendar:before, .ion-android-call:before, .ion-android-camera:before, .ion-android-cancel:before, .ion-android-car:before, .ion-android-cart:before, .ion-android-chat:before, .ion-android-checkbox:before, .ion-android-checkbox-blank:before, .ion-android-checkbox-outline:before, .ion-android-checkbox-outline-blank:before, .ion-android-checkmark-circle:before, .ion-android-clipboard:before, .ion-android-close:before, .ion-android-cloud:before, .ion-android-cloud-circle:before, .ion-android-cloud-done:before, .ion-android-cloud-outline:before, .ion-android-color-palette:before, .ion-android-compass:before, .ion-android-contact:before, .ion-android-contacts:before, .ion-android-contract:before, .ion-android-create:before, .ion-android-delete:before, .ion-android-desktop:before, .ion-android-document:before, .ion-android-done:before, .ion-android-done-all:before, .ion-android-download:before, .ion-android-drafts:before, .ion-android-exit:before, .ion-android-expand:before, .ion-android-favorite:before, .ion-android-favorite-outline:before, .ion-android-film:before, .ion-android-folder:before, .ion-android-folder-open:before, .ion-android-funnel:before, .ion-android-globe:before, .ion-android-hand:before, .ion-android-hangout:before, .ion-android-happy:before, .ion-android-home:before, .ion-android-image:before, .ion-android-laptop:before, .ion-android-list:before, .ion-android-locate:before, .ion-android-lock:before, .ion-android-mail:before, .ion-android-map:before, .ion-android-menu:before, .ion-android-microphone:before, .ion-android-microphone-off:before, .ion-android-more-horizontal:before, .ion-android-more-vertical:before, .ion-android-navigate:before, .ion-android-notifications:before, .ion-android-notifications-none:before, .ion-android-notifications-off:before, .ion-android-open:before, .ion-android-options:before, .ion-android-people:before, .ion-android-person:before, .ion-android-person-add:before, .ion-android-phone-landscape:before, .ion-android-phone-portrait:before, .ion-android-pin:before, .ion-android-plane:before, .ion-android-playstore:before, .ion-android-print:before, .ion-android-radio-button-off:before, .ion-android-radio-button-on:before, .ion-android-refresh:before, .ion-android-remove:before, .ion-android-remove-circle:before, .ion-android-restaurant:before, .ion-android-sad:before, .ion-android-search:before, .ion-android-send:before, .ion-android-settings:before, .ion-android-share:before, .ion-android-share-alt:before, .ion-android-star:before, .ion-android-star-half:before, .ion-android-star-outline:before, .ion-android-stopwatch:before, .ion-android-subway:before, .ion-android-sunny:before, .ion-android-sync:before, .ion-android-textsms:before, .ion-android-time:before, .ion-android-train:before, .ion-android-unlock:before, .ion-android-upload:before, .ion-android-volume-down:before, .ion-android-volume-mute:before, .ion-android-volume-off:before, .ion-android-volume-up:before, .ion-android-walk:before, .ion-android-warning:before, .ion-android-watch:before, .ion-android-wifi:before, .ion-aperture:before, .ion-archive:before, .ion-arrow-down-a:before, .ion-arrow-down-b:before, .ion-arrow-down-c:before, .ion-arrow-expand:before, .ion-arrow-graph-down-left:before, .ion-arrow-graph-down-right:before, .ion-arrow-graph-up-left:before, .ion-arrow-graph-up-right:before, .ion-arrow-left-a:before, .ion-arrow-left-b:before, .ion-arrow-left-c:before, .ion-arrow-move:before, .ion-arrow-resize:before, .ion-arrow-return-left:before, .ion-arrow-return-right:before, .ion-arrow-right-a:before, .ion-arrow-right-b:before, .ion-arrow-right-c:before, .ion-arrow-shrink:before, .ion-arrow-swap:before, .ion-arrow-up-a:before, .ion-arrow-up-b:before, .ion-arrow-up-c:before, .ion-asterisk:before, .ion-at:before, .ion-backspace:before, .ion-backspace-outline:before, .ion-bag:before, .ion-battery-charging:before, .ion-battery-empty:before, .ion-battery-full:before, .ion-battery-half:before, .ion-battery-low:before, .ion-beaker:before, .ion-beer:before, .ion-bluetooth:before, .ion-bonfire:before, .ion-bookmark:before, .ion-bowtie:before, .ion-briefcase:before, .ion-bug:before, .ion-calculator:before, .ion-calendar:before, .ion-camera:before, .ion-card:before, .ion-cash:before, .ion-chatbox:before, .ion-chatbox-working:before, .ion-chatboxes:before, .ion-chatbubble:before, .ion-chatbubble-working:before, .ion-chatbubbles:before, .ion-checkmark:before, .ion-checkmark-circled:before, .ion-checkmark-round:before, .ion-chevron-down:before, .ion-chevron-left:before, .ion-chevron-right:before, .ion-chevron-up:before, .ion-clipboard:before, .ion-clock:before, .ion-close:before, .ion-close-circled:before, .ion-close-round:before, .ion-closed-captioning:before, .ion-cloud:before, .ion-code:before, .ion-code-download:before, .ion-code-working:before, .ion-coffee:before, .ion-compass:before, .ion-compose:before, .ion-connection-bars:before, .ion-contrast:before, .ion-crop:before, .ion-cube:before, .ion-disc:before, .ion-document:before, .ion-document-text:before, .ion-drag:before, .ion-earth:before, .ion-easel:before, .ion-edit:before, .ion-egg:before, .ion-eject:before, .ion-email:before, .ion-email-unread:before, .ion-erlenmeyer-flask:before, .ion-erlenmeyer-flask-bubbles:before, .ion-eye:before, .ion-eye-disabled:before, .ion-female:before, .ion-filing:before, .ion-film-marker:before, .ion-fireball:before, .ion-flag:before, .ion-flame:before, .ion-flash:before, .ion-flash-off:before, .ion-folder:before, .ion-fork:before, .ion-fork-repo:before, .ion-forward:before, .ion-funnel:before, .ion-gear-a:before, .ion-gear-b:before, .ion-grid:before, .ion-hammer:before, .ion-happy:before, .ion-happy-outline:before, .ion-headphone:before, .ion-heart:before, .ion-heart-broken:before, .ion-help:before, .ion-help-buoy:before, .ion-help-circled:before, .ion-home:before, .ion-icecream:before, .ion-image:before, .ion-images:before, .ion-information:before, .ion-information-circled:before, .ion-ionic:before, .ion-ios-alarm:before, .ion-ios-alarm-outline:before, .ion-ios-albums:before, .ion-ios-albums-outline:before, .ion-ios-americanfootball:before, .ion-ios-americanfootball-outline:before, .ion-ios-analytics:before, .ion-ios-analytics-outline:before, .ion-ios-arrow-back:before, .ion-ios-arrow-down:before, .ion-ios-arrow-forward:before, .ion-ios-arrow-left:before, .ion-ios-arrow-right:before, .ion-ios-arrow-thin-down:before, .ion-ios-arrow-thin-left:before, .ion-ios-arrow-thin-right:before, .ion-ios-arrow-thin-up:before, .ion-ios-arrow-up:before, .ion-ios-at:before, .ion-ios-at-outline:before, .ion-ios-barcode:before, .ion-ios-barcode-outline:before, .ion-ios-baseball:before, .ion-ios-baseball-outline:before, .ion-ios-basketball:before, .ion-ios-basketball-outline:before, .ion-ios-bell:before, .ion-ios-bell-outline:before, .ion-ios-body:before, .ion-ios-body-outline:before, .ion-ios-bolt:before, .ion-ios-bolt-outline:before, .ion-ios-book:before, .ion-ios-book-outline:before, .ion-ios-bookmarks:before, .ion-ios-bookmarks-outline:before, .ion-ios-box:before, .ion-ios-box-outline:before, .ion-ios-briefcase:before, .ion-ios-briefcase-outline:before, .ion-ios-browsers:before, .ion-ios-browsers-outline:before, .ion-ios-calculator:before, .ion-ios-calculator-outline:before, .ion-ios-calendar:before, .ion-ios-calendar-outline:before, .ion-ios-camera:before, .ion-ios-camera-outline:before, .ion-ios-cart:before, .ion-ios-cart-outline:before, .ion-ios-chatboxes:before, .ion-ios-chatboxes-outline:before, .ion-ios-chatbubble:before, .ion-ios-chatbubble-outline:before, .ion-ios-checkmark:before, .ion-ios-checkmark-empty:before, .ion-ios-checkmark-outline:before, .ion-ios-circle-filled:before, .ion-ios-circle-outline:before, .ion-ios-clock:before, .ion-ios-clock-outline:before, .ion-ios-close:before, .ion-ios-close-empty:before, .ion-ios-close-outline:before, .ion-ios-cloud:before, .ion-ios-cloud-download:before, .ion-ios-cloud-download-outline:before, .ion-ios-cloud-outline:before, .ion-ios-cloud-upload:before, .ion-ios-cloud-upload-outline:before, .ion-ios-cloudy:before, .ion-ios-cloudy-night:before, .ion-ios-cloudy-night-outline:before, .ion-ios-cloudy-outline:before, .ion-ios-cog:before, .ion-ios-cog-outline:before, .ion-ios-color-filter:before, .ion-ios-color-filter-outline:before, .ion-ios-color-wand:before, .ion-ios-color-wand-outline:before, .ion-ios-compose:before, .ion-ios-compose-outline:before, .ion-ios-contact:before, .ion-ios-contact-outline:before, .ion-ios-copy:before, .ion-ios-copy-outline:before, .ion-ios-crop:before, .ion-ios-crop-strong:before, .ion-ios-download:before, .ion-ios-download-outline:before, .ion-ios-drag:before, .ion-ios-email:before, .ion-ios-email-outline:before, .ion-ios-eye:before, .ion-ios-eye-outline:before, .ion-ios-fastforward:before, .ion-ios-fastforward-outline:before, .ion-ios-filing:before, .ion-ios-filing-outline:before, .ion-ios-film:before, .ion-ios-film-outline:before, .ion-ios-flag:before, .ion-ios-flag-outline:before, .ion-ios-flame:before, .ion-ios-flame-outline:before, .ion-ios-flask:before, .ion-ios-flask-outline:before, .ion-ios-flower:before, .ion-ios-flower-outline:before, .ion-ios-folder:before, .ion-ios-folder-outline:before, .ion-ios-football:before, .ion-ios-football-outline:before, .ion-ios-game-controller-a:before, .ion-ios-game-controller-a-outline:before, .ion-ios-game-controller-b:before, .ion-ios-game-controller-b-outline:before, .ion-ios-gear:before, .ion-ios-gear-outline:before, .ion-ios-glasses:before, .ion-ios-glasses-outline:before, .ion-ios-grid-view:before, .ion-ios-grid-view-outline:before, .ion-ios-heart:before, .ion-ios-heart-outline:before, .ion-ios-help:before, .ion-ios-help-empty:before, .ion-ios-help-outline:before, .ion-ios-home:before, .ion-ios-home-outline:before, .ion-ios-infinite:before, .ion-ios-infinite-outline:before, .ion-ios-information:before, .ion-ios-information-empty:before, .ion-ios-information-outline:before, .ion-ios-ionic-outline:before, .ion-ios-keypad:before, .ion-ios-keypad-outline:before, .ion-ios-lightbulb:before, .ion-ios-lightbulb-outline:before, .ion-ios-list:before, .ion-ios-list-outline:before, .ion-ios-location:before, .ion-ios-location-outline:before, .ion-ios-locked:before, .ion-ios-locked-outline:before, .ion-ios-loop:before, .ion-ios-loop-strong:before, .ion-ios-medical:before, .ion-ios-medical-outline:before, .ion-ios-medkit:before, .ion-ios-medkit-outline:before, .ion-ios-mic:before, .ion-ios-mic-off:before, .ion-ios-mic-outline:before, .ion-ios-minus:before, .ion-ios-minus-empty:before, .ion-ios-minus-outline:before, .ion-ios-monitor:before, .ion-ios-monitor-outline:before, .ion-ios-moon:before, .ion-ios-moon-outline:before, .ion-ios-more:before, .ion-ios-more-outline:before, .ion-ios-musical-note:before, .ion-ios-musical-notes:before, .ion-ios-navigate:before, .ion-ios-navigate-outline:before, .ion-ios-nutrition:before, .ion-ios-nutrition-outline:before, .ion-ios-paper:before, .ion-ios-paper-outline:before, .ion-ios-paperplane:before, .ion-ios-paperplane-outline:before, .ion-ios-partlysunny:before, .ion-ios-partlysunny-outline:before, .ion-ios-pause:before, .ion-ios-pause-outline:before, .ion-ios-paw:before, .ion-ios-paw-outline:before, .ion-ios-people:before, .ion-ios-people-outline:before, .ion-ios-person:before, .ion-ios-person-outline:before, .ion-ios-personadd:before, .ion-ios-personadd-outline:before, .ion-ios-photos:before, .ion-ios-photos-outline:before, .ion-ios-pie:before, .ion-ios-pie-outline:before, .ion-ios-pint:before, .ion-ios-pint-outline:before, .ion-ios-play:before, .ion-ios-play-outline:before, .ion-ios-plus:before, .ion-ios-plus-empty:before, .ion-ios-plus-outline:before, .ion-ios-pricetag:before, .ion-ios-pricetag-outline:before, .ion-ios-pricetags:before, .ion-ios-pricetags-outline:before, .ion-ios-printer:before, .ion-ios-printer-outline:before, .ion-ios-pulse:before, .ion-ios-pulse-strong:before, .ion-ios-rainy:before, .ion-ios-rainy-outline:before, .ion-ios-recording:before, .ion-ios-recording-outline:before, .ion-ios-redo:before, .ion-ios-redo-outline:before, .ion-ios-refresh:before, .ion-ios-refresh-empty:before, .ion-ios-refresh-outline:before, .ion-ios-reload:before, .ion-ios-reverse-camera:before, .ion-ios-reverse-camera-outline:before, .ion-ios-rewind:before, .ion-ios-rewind-outline:before, .ion-ios-rose:before, .ion-ios-rose-outline:before, .ion-ios-search:before, .ion-ios-search-strong:before, .ion-ios-settings:before, .ion-ios-settings-strong:before, .ion-ios-shuffle:before, .ion-ios-shuffle-strong:before, .ion-ios-skipbackward:before, .ion-ios-skipbackward-outline:before, .ion-ios-skipforward:before, .ion-ios-skipforward-outline:before, .ion-ios-snowy:before, .ion-ios-speedometer:before, .ion-ios-speedometer-outline:before, .ion-ios-star:before, .ion-ios-star-half:before, .ion-ios-star-outline:before, .ion-ios-stopwatch:before, .ion-ios-stopwatch-outline:before, .ion-ios-sunny:before, .ion-ios-sunny-outline:before, .ion-ios-telephone:before, .ion-ios-telephone-outline:before, .ion-ios-tennisball:before, .ion-ios-tennisball-outline:before, .ion-ios-thunderstorm:before, .ion-ios-thunderstorm-outline:before, .ion-ios-time:before, .ion-ios-time-outline:before, .ion-ios-timer:before, .ion-ios-timer-outline:before, .ion-ios-toggle:before, .ion-ios-toggle-outline:before, .ion-ios-trash:before, .ion-ios-trash-outline:before, .ion-ios-undo:before, .ion-ios-undo-outline:before, .ion-ios-unlocked:before, .ion-ios-unlocked-outline:before, .ion-ios-upload:before, .ion-ios-upload-outline:before, .ion-ios-videocam:before, .ion-ios-videocam-outline:before, .ion-ios-volume-high:before, .ion-ios-volume-low:before, .ion-ios-wineglass:before, .ion-ios-wineglass-outline:before, .ion-ios-world:before, .ion-ios-world-outline:before, .ion-ipad:before, .ion-iphone:before, .ion-ipod:before, .ion-jet:before, .ion-key:before, .ion-knife:before, .ion-laptop:before, .ion-leaf:before, .ion-levels:before, .ion-lightbulb:before, .ion-link:before, .ion-load-a:before, .ion-load-b:before, .ion-load-c:before, .ion-load-d:before, .ion-location:before, .ion-lock-combination:before, .ion-locked:before, .ion-log-in:before, .ion-log-out:before, .ion-loop:before, .ion-magnet:before, .ion-male:before, .ion-man:before, .ion-map:before, .ion-medkit:before, .ion-merge:before, .ion-mic-a:before, .ion-mic-b:before, .ion-mic-c:before, .ion-minus:before, .ion-minus-circled:before, .ion-minus-round:before, .ion-model-s:before, .ion-monitor:before, .ion-more:before, .ion-mouse:before, .ion-music-note:before, .ion-navicon:before, .ion-navicon-round:before, .ion-navigate:before, .ion-network:before, .ion-no-smoking:before, .ion-nuclear:before, .ion-outlet:before, .ion-paintbrush:before, .ion-paintbucket:before, .ion-paper-airplane:before, .ion-paperclip:before, .ion-pause:before, .ion-person:before, .ion-person-add:before, .ion-person-stalker:before, .ion-pie-graph:before, .ion-pin:before, .ion-pinpoint:before, .ion-pizza:before, .ion-plane:before, .ion-planet:before, .ion-play:before, .ion-playstation:before, .ion-plus:before, .ion-plus-circled:before, .ion-plus-round:before, .ion-podium:before, .ion-pound:before, .ion-power:before, .ion-pricetag:before, .ion-pricetags:before, .ion-printer:before, .ion-pull-request:before, .ion-qr-scanner:before, .ion-quote:before, .ion-radio-waves:before, .ion-record:before, .ion-refresh:before, .ion-reply:before, .ion-reply-all:before, .ion-ribbon-a:before, .ion-ribbon-b:before, .ion-sad:before, .ion-sad-outline:before, .ion-scissors:before, .ion-search:before, .ion-settings:before, .ion-share:before, .ion-shuffle:before, .ion-skip-backward:before, .ion-skip-forward:before, .ion-social-android:before, .ion-social-android-outline:before, .ion-social-angular:before, .ion-social-angular-outline:before, .ion-social-apple:before, .ion-social-apple-outline:before, .ion-social-bitcoin:before, .ion-social-bitcoin-outline:before, .ion-social-buffer:before, .ion-social-buffer-outline:before, .ion-social-chrome:before, .ion-social-chrome-outline:before, .ion-social-codepen:before, .ion-social-codepen-outline:before, .ion-social-css3:before, .ion-social-css3-outline:before, .ion-social-designernews:before, .ion-social-designernews-outline:before, .ion-social-dribbble:before, .ion-social-dribbble-outline:before, .ion-social-dropbox:before, .ion-social-dropbox-outline:before, .ion-social-euro:before, .ion-social-euro-outline:before, .ion-social-facebook:before, .ion-social-facebook-outline:before, .ion-social-foursquare:before, .ion-social-foursquare-outline:before, .ion-social-freebsd-devil:before, .ion-social-github:before, .ion-social-github-outline:before, .ion-social-google:before, .ion-social-google-outline:before, .ion-social-googleplus:before, .ion-social-googleplus-outline:before, .ion-social-hackernews:before, .ion-social-hackernews-outline:before, .ion-social-html5:before, .ion-social-html5-outline:before, .ion-social-instagram:before, .ion-social-instagram-outline:before, .ion-social-javascript:before, .ion-social-javascript-outline:before, .ion-social-linkedin:before, .ion-social-linkedin-outline:before, .ion-social-markdown:before, .ion-social-nodejs:before, .ion-social-octocat:before, .ion-social-pinterest:before, .ion-social-pinterest-outline:before, .ion-social-python:before, .ion-social-reddit:before, .ion-social-reddit-outline:before, .ion-social-rss:before, .ion-social-rss-outline:before, .ion-social-sass:before, .ion-social-skype:before, .ion-social-skype-outline:before, .ion-social-snapchat:before, .ion-social-snapchat-outline:before, .ion-social-tumblr:before, .ion-social-tumblr-outline:before, .ion-social-tux:before, .ion-social-twitch:before, .ion-social-twitch-outline:before, .ion-social-twitter:before, .ion-social-twitter-outline:before, .ion-social-usd:before, .ion-social-usd-outline:before, .ion-social-vimeo:before, .ion-social-vimeo-outline:before, .ion-social-whatsapp:before, .ion-social-whatsapp-outline:before, .ion-social-windows:before, .ion-social-windows-outline:before, .ion-social-wordpress:before, .ion-social-wordpress-outline:before, .ion-social-yahoo:before, .ion-social-yahoo-outline:before, .ion-social-yen:before, .ion-social-yen-outline:before, .ion-social-youtube:before, .ion-social-youtube-outline:before, .ion-soup-can:before, .ion-soup-can-outline:before, .ion-speakerphone:before, .ion-speedometer:before, .ion-spoon:before, .ion-star:before, .ion-stats-bars:before, .ion-steam:before, .ion-stop:before, .ion-thermometer:before, .ion-thumbsdown:before, .ion-thumbsup:before, .ion-toggle:before, .ion-toggle-filled:before, .ion-transgender:before, .ion-trash-a:before, .ion-trash-b:before, .ion-trophy:before, .ion-tshirt:before, .ion-tshirt-outline:before, .ion-umbrella:before, .ion-university:before, .ion-unlocked:before, .ion-upload:before, .ion-usb:before, .ion-videocamera:before, .ion-volume-high:before, .ion-volume-low:before, .ion-volume-medium:before, .ion-volume-mute:before, .ion-wand:before, .ion-waterdrop:before, .ion-wifi:before, .ion-wineglass:before, .ion-woman:before, .ion-wrench:before, .ion-xbox:before { display: inline-block; font-family: "Ionicons"; speak: none; font-style: normal; font-weight: normal; font-variant: normal; text-transform: none; text-rendering: auto; line-height: 1; -webkit-font-smoothing: antialiased; -moz-osx-font-smoothing: grayscale; }
+
+.ion-alert:before { content: "\f101"; }
+
+.ion-alert-circled:before { content: "\f100"; }
+
+.ion-android-add:before { content: "\f2c7"; }
+
+.ion-android-add-circle:before { content: "\f359"; }
+
+.ion-android-alarm-clock:before { content: "\f35a"; }
+
+.ion-android-alert:before { content: "\f35b"; }
+
+.ion-android-apps:before { content: "\f35c"; }
+
+.ion-android-archive:before { content: "\f2c9"; }
+
+.ion-android-arrow-back:before { content: "\f2ca"; }
+
+.ion-android-arrow-down:before { content: "\f35d"; }
+
+.ion-android-arrow-dropdown:before { content: "\f35f"; }
+
+.ion-android-arrow-dropdown-circle:before { content: "\f35e"; }
+
+.ion-android-arrow-dropleft:before { content: "\f361"; }
+
+.ion-android-arrow-dropleft-circle:before { content: "\f360"; }
+
+.ion-android-arrow-dropright:before { content: "\f363"; }
+
+.ion-android-arrow-dropright-circle:before { content: "\f362"; }
+
+.ion-android-arrow-dropup:before { content: "\f365"; }
+
+.ion-android-arrow-dropup-circle:before { content: "\f364"; }
+
+.ion-android-arrow-forward:before { content: "\f30f"; }
+
+.ion-android-arrow-up:before { content: "\f366"; }
+
+.ion-android-attach:before { content: "\f367"; }
+
+.ion-android-bar:before { content: "\f368"; }
+
+.ion-android-bicycle:before { content: "\f369"; }
+
+.ion-android-boat:before { content: "\f36a"; }
+
+.ion-android-bookmark:before { content: "\f36b"; }
+
+.ion-android-bulb:before { content: "\f36c"; }
+
+.ion-android-bus:before { content: "\f36d"; }
+
+.ion-android-calendar:before { content: "\f2d1"; }
+
+.ion-android-call:before { content: "\f2d2"; }
+
+.ion-android-camera:before { content: "\f2d3"; }
+
+.ion-android-cancel:before { content: "\f36e"; }
+
+.ion-android-car:before { content: "\f36f"; }
+
+.ion-android-cart:before { content: "\f370"; }
+
+.ion-android-chat:before { content: "\f2d4"; }
+
+.ion-android-checkbox:before { content: "\f374"; }
+
+.ion-android-checkbox-blank:before { content: "\f371"; }
+
+.ion-android-checkbox-outline:before { content: "\f373"; }
+
+.ion-android-checkbox-outline-blank:before { content: "\f372"; }
+
+.ion-android-checkmark-circle:before { content: "\f375"; }
+
+.ion-android-clipboard:before { content: "\f376"; }
+
+.ion-android-close:before { content: "\f2d7"; }
+
+.ion-android-cloud:before { content: "\f37a"; }
+
+.ion-android-cloud-circle:before { content: "\f377"; }
+
+.ion-android-cloud-done:before { content: "\f378"; }
+
+.ion-android-cloud-outline:before { content: "\f379"; }
+
+.ion-android-color-palette:before { content: "\f37b"; }
+
+.ion-android-compass:before { content: "\f37c"; }
+
+.ion-android-contact:before { content: "\f2d8"; }
+
+.ion-android-contacts:before { content: "\f2d9"; }
+
+.ion-android-contract:before { content: "\f37d"; }
+
+.ion-android-create:before { content: "\f37e"; }
+
+.ion-android-delete:before { content: "\f37f"; }
+
+.ion-android-desktop:before { content: "\f380"; }
+
+.ion-android-document:before { content: "\f381"; }
+
+.ion-android-done:before { content: "\f383"; }
+
+.ion-android-done-all:before { content: "\f382"; }
+
+.ion-android-download:before { content: "\f2dd"; }
+
+.ion-android-drafts:before { content: "\f384"; }
+
+.ion-android-exit:before { content: "\f385"; }
+
+.ion-android-expand:before { content: "\f386"; }
+
+.ion-android-favorite:before { content: "\f388"; }
+
+.ion-android-favorite-outline:before { content: "\f387"; }
+
+.ion-android-film:before { content: "\f389"; }
+
+.ion-android-folder:before { content: "\f2e0"; }
+
+.ion-android-folder-open:before { content: "\f38a"; }
+
+.ion-android-funnel:before { content: "\f38b"; }
+
+.ion-android-globe:before { content: "\f38c"; }
+
+.ion-android-hand:before { content: "\f2e3"; }
+
+.ion-android-hangout:before { content: "\f38d"; }
+
+.ion-android-happy:before { content: "\f38e"; }
+
+.ion-android-home:before { content: "\f38f"; }
+
+.ion-android-image:before { content: "\f2e4"; }
+
+.ion-android-laptop:before { content: "\f390"; }
+
+.ion-android-list:before { content: "\f391"; }
+
+.ion-android-locate:before { content: "\f2e9"; }
+
+.ion-android-lock:before { content: "\f392"; }
+
+.ion-android-mail:before { content: "\f2eb"; }
+
+.ion-android-map:before { content: "\f393"; }
+
+.ion-android-menu:before { content: "\f394"; }
+
+.ion-android-microphone:before { content: "\f2ec"; }
+
+.ion-android-microphone-off:before { content: "\f395"; }
+
+.ion-android-more-horizontal:before { content: "\f396"; }
+
+.ion-android-more-vertical:before { content: "\f397"; }
+
+.ion-android-navigate:before { content: "\f398"; }
+
+.ion-android-notifications:before { content: "\f39b"; }
+
+.ion-android-notifications-none:before { content: "\f399"; }
+
+.ion-android-notifications-off:before { content: "\f39a"; }
+
+.ion-android-open:before { content: "\f39c"; }
+
+.ion-android-options:before { content: "\f39d"; }
+
+.ion-android-people:before { content: "\f39e"; }
+
+.ion-android-person:before { content: "\f3a0"; }
+
+.ion-android-person-add:before { content: "\f39f"; }
+
+.ion-android-phone-landscape:before { content: "\f3a1"; }
+
+.ion-android-phone-portrait:before { content: "\f3a2"; }
+
+.ion-android-pin:before { content: "\f3a3"; }
+
+.ion-android-plane:before { content: "\f3a4"; }
+
+.ion-android-playstore:before { content: "\f2f0"; }
+
+.ion-android-print:before { content: "\f3a5"; }
+
+.ion-android-radio-button-off:before { content: "\f3a6"; }
+
+.ion-android-radio-button-on:before { content: "\f3a7"; }
+
+.ion-android-refresh:before { content: "\f3a8"; }
+
+.ion-android-remove:before { content: "\f2f4"; }
+
+.ion-android-remove-circle:before { content: "\f3a9"; }
+
+.ion-android-restaurant:before { content: "\f3aa"; }
+
+.ion-android-sad:before { content: "\f3ab"; }
+
+.ion-android-search:before { content: "\f2f5"; }
+
+.ion-android-send:before { content: "\f2f6"; }
+
+.ion-android-settings:before { content: "\f2f7"; }
+
+.ion-android-share:before { content: "\f2f8"; }
+
+.ion-android-share-alt:before { content: "\f3ac"; }
+
+.ion-android-star:before { content: "\f2fc"; }
+
+.ion-android-star-half:before { content: "\f3ad"; }
+
+.ion-android-star-outline:before { content: "\f3ae"; }
+
+.ion-android-stopwatch:before { content: "\f2fd"; }
+
+.ion-android-subway:before { content: "\f3af"; }
+
+.ion-android-sunny:before { content: "\f3b0"; }
+
+.ion-android-sync:before { content: "\f3b1"; }
+
+.ion-android-textsms:before { content: "\f3b2"; }
+
+.ion-android-time:before { content: "\f3b3"; }
+
+.ion-android-train:before { content: "\f3b4"; }
+
+.ion-android-unlock:before { content: "\f3b5"; }
+
+.ion-android-upload:before { content: "\f3b6"; }
+
+.ion-android-volume-down:before { content: "\f3b7"; }
+
+.ion-android-volume-mute:before { content: "\f3b8"; }
+
+.ion-android-volume-off:before { content: "\f3b9"; }
+
+.ion-android-volume-up:before { content: "\f3ba"; }
+
+.ion-android-walk:before { content: "\f3bb"; }
+
+.ion-android-warning:before { content: "\f3bc"; }
+
+.ion-android-watch:before { content: "\f3bd"; }
+
+.ion-android-wifi:before { content: "\f305"; }
+
+.ion-aperture:before { content: "\f313"; }
+
+.ion-archive:before { content: "\f102"; }
+
+.ion-arrow-down-a:before { content: "\f103"; }
+
+.ion-arrow-down-b:before { content: "\f104"; }
+
+.ion-arrow-down-c:before { content: "\f105"; }
+
+.ion-arrow-expand:before { content: "\f25e"; }
+
+.ion-arrow-graph-down-left:before { content: "\f25f"; }
+
+.ion-arrow-graph-down-right:before { content: "\f260"; }
+
+.ion-arrow-graph-up-left:before { content: "\f261"; }
+
+.ion-arrow-graph-up-right:before { content: "\f262"; }
+
+.ion-arrow-left-a:before { content: "\f106"; }
+
+.ion-arrow-left-b:before { content: "\f107"; }
+
+.ion-arrow-left-c:before { content: "\f108"; }
+
+.ion-arrow-move:before { content: "\f263"; }
+
+.ion-arrow-resize:before { content: "\f264"; }
+
+.ion-arrow-return-left:before { content: "\f265"; }
+
+.ion-arrow-return-right:before { content: "\f266"; }
+
+.ion-arrow-right-a:before { content: "\f109"; }
+
+.ion-arrow-right-b:before { content: "\f10a"; }
+
+.ion-arrow-right-c:before { content: "\f10b"; }
+
+.ion-arrow-shrink:before { content: "\f267"; }
+
+.ion-arrow-swap:before { content: "\f268"; }
+
+.ion-arrow-up-a:before { content: "\f10c"; }
+
+.ion-arrow-up-b:before { content: "\f10d"; }
+
+.ion-arrow-up-c:before { content: "\f10e"; }
+
+.ion-asterisk:before { content: "\f314"; }
+
+.ion-at:before { content: "\f10f"; }
+
+.ion-backspace:before { content: "\f3bf"; }
+
+.ion-backspace-outline:before { content: "\f3be"; }
+
+.ion-bag:before { content: "\f110"; }
+
+.ion-battery-charging:before { content: "\f111"; }
+
+.ion-battery-empty:before { content: "\f112"; }
+
+.ion-battery-full:before { content: "\f113"; }
+
+.ion-battery-half:before { content: "\f114"; }
+
+.ion-battery-low:before { content: "\f115"; }
+
+.ion-beaker:before { content: "\f269"; }
+
+.ion-beer:before { content: "\f26a"; }
+
+.ion-bluetooth:before { content: "\f116"; }
+
+.ion-bonfire:before { content: "\f315"; }
+
+.ion-bookmark:before { content: "\f26b"; }
+
+.ion-bowtie:before { content: "\f3c0"; }
+
+.ion-briefcase:before { content: "\f26c"; }
+
+.ion-bug:before { content: "\f2be"; }
+
+.ion-calculator:before { content: "\f26d"; }
+
+.ion-calendar:before { content: "\f117"; }
+
+.ion-camera:before { content: "\f118"; }
+
+.ion-card:before { content: "\f119"; }
+
+.ion-cash:before { content: "\f316"; }
+
+.ion-chatbox:before { content: "\f11b"; }
+
+.ion-chatbox-working:before { content: "\f11a"; }
+
+.ion-chatboxes:before { content: "\f11c"; }
+
+.ion-chatbubble:before { content: "\f11e"; }
+
+.ion-chatbubble-working:before { content: "\f11d"; }
+
+.ion-chatbubbles:before { content: "\f11f"; }
+
+.ion-checkmark:before { content: "\f122"; }
+
+.ion-checkmark-circled:before { content: "\f120"; }
+
+.ion-checkmark-round:before { content: "\f121"; }
+
+.ion-chevron-down:before { content: "\f123"; }
+
+.ion-chevron-left:before { content: "\f124"; }
+
+.ion-chevron-right:before { content: "\f125"; }
+
+.ion-chevron-up:before { content: "\f126"; }
+
+.ion-clipboard:before { content: "\f127"; }
+
+.ion-clock:before { content: "\f26e"; }
+
+.ion-close:before { content: "\f12a"; }
+
+.ion-close-circled:before { content: "\f128"; }
+
+.ion-close-round:before { content: "\f129"; }
+
+.ion-closed-captioning:before { content: "\f317"; }
+
+.ion-cloud:before { content: "\f12b"; }
+
+.ion-code:before { content: "\f271"; }
+
+.ion-code-download:before { content: "\f26f"; }
+
+.ion-code-working:before { content: "\f270"; }
+
+.ion-coffee:before { content: "\f272"; }
+
+.ion-compass:before { content: "\f273"; }
+
+.ion-compose:before { content: "\f12c"; }
+
+.ion-connection-bars:before { content: "\f274"; }
+
+.ion-contrast:before { content: "\f275"; }
+
+.ion-crop:before { content: "\f3c1"; }
+
+.ion-cube:before { content: "\f318"; }
+
+.ion-disc:before { content: "\f12d"; }
+
+.ion-document:before { content: "\f12f"; }
+
+.ion-document-text:before { content: "\f12e"; }
+
+.ion-drag:before { content: "\f130"; }
+
+.ion-earth:before { content: "\f276"; }
+
+.ion-easel:before { content: "\f3c2"; }
+
+.ion-edit:before { content: "\f2bf"; }
+
+.ion-egg:before { content: "\f277"; }
+
+.ion-eject:before { content: "\f131"; }
+
+.ion-email:before { content: "\f132"; }
+
+.ion-email-unread:before { content: "\f3c3"; }
+
+.ion-erlenmeyer-flask:before { content: "\f3c5"; }
+
+.ion-erlenmeyer-flask-bubbles:before { content: "\f3c4"; }
+
+.ion-eye:before { content: "\f133"; }
+
+.ion-eye-disabled:before { content: "\f306"; }
+
+.ion-female:before { content: "\f278"; }
+
+.ion-filing:before { content: "\f134"; }
+
+.ion-film-marker:before { content: "\f135"; }
+
+.ion-fireball:before { content: "\f319"; }
+
+.ion-flag:before { content: "\f279"; }
+
+.ion-flame:before { content: "\f31a"; }
+
+.ion-flash:before { content: "\f137"; }
+
+.ion-flash-off:before { content: "\f136"; }
+
+.ion-folder:before { content: "\f139"; }
+
+.ion-fork:before { content: "\f27a"; }
+
+.ion-fork-repo:before { content: "\f2c0"; }
+
+.ion-forward:before { content: "\f13a"; }
+
+.ion-funnel:before { content: "\f31b"; }
+
+.ion-gear-a:before { content: "\f13d"; }
+
+.ion-gear-b:before { content: "\f13e"; }
+
+.ion-grid:before { content: "\f13f"; }
+
+.ion-hammer:before { content: "\f27b"; }
+
+.ion-happy:before { content: "\f31c"; }
+
+.ion-happy-outline:before { content: "\f3c6"; }
+
+.ion-headphone:before { content: "\f140"; }
+
+.ion-heart:before { content: "\f141"; }
+
+.ion-heart-broken:before { content: "\f31d"; }
+
+.ion-help:before { content: "\f143"; }
+
+.ion-help-buoy:before { content: "\f27c"; }
+
+.ion-help-circled:before { content: "\f142"; }
+
+.ion-home:before { content: "\f144"; }
+
+.ion-icecream:before { content: "\f27d"; }
+
+.ion-image:before { content: "\f147"; }
+
+.ion-images:before { content: "\f148"; }
+
+.ion-information:before { content: "\f14a"; }
+
+.ion-information-circled:before { content: "\f149"; }
+
+.ion-ionic:before { content: "\f14b"; }
+
+.ion-ios-alarm:before { content: "\f3c8"; }
+
+.ion-ios-alarm-outline:before { content: "\f3c7"; }
+
+.ion-ios-albums:before { content: "\f3ca"; }
+
+.ion-ios-albums-outline:before { content: "\f3c9"; }
+
+.ion-ios-americanfootball:before { content: "\f3cc"; }
+
+.ion-ios-americanfootball-outline:before { content: "\f3cb"; }
+
+.ion-ios-analytics:before { content: "\f3ce"; }
+
+.ion-ios-analytics-outline:before { content: "\f3cd"; }
+
+.ion-ios-arrow-back:before { content: "\f3cf"; }
+
+.ion-ios-arrow-down:before { content: "\f3d0"; }
+
+.ion-ios-arrow-forward:before { content: "\f3d1"; }
+
+.ion-ios-arrow-left:before { content: "\f3d2"; }
+
+.ion-ios-arrow-right:before { content: "\f3d3"; }
+
+.ion-ios-arrow-thin-down:before { content: "\f3d4"; }
+
+.ion-ios-arrow-thin-left:before { content: "\f3d5"; }
+
+.ion-ios-arrow-thin-right:before { content: "\f3d6"; }
+
+.ion-ios-arrow-thin-up:before { content: "\f3d7"; }
+
+.ion-ios-arrow-up:before { content: "\f3d8"; }
+
+.ion-ios-at:before { content: "\f3da"; }
+
+.ion-ios-at-outline:before { content: "\f3d9"; }
+
+.ion-ios-barcode:before { content: "\f3dc"; }
+
+.ion-ios-barcode-outline:before { content: "\f3db"; }
+
+.ion-ios-baseball:before { content: "\f3de"; }
+
+.ion-ios-baseball-outline:before { content: "\f3dd"; }
+
+.ion-ios-basketball:before { content: "\f3e0"; }
+
+.ion-ios-basketball-outline:before { content: "\f3df"; }
+
+.ion-ios-bell:before { content: "\f3e2"; }
+
+.ion-ios-bell-outline:before { content: "\f3e1"; }
+
+.ion-ios-body:before { content: "\f3e4"; }
+
+.ion-ios-body-outline:before { content: "\f3e3"; }
+
+.ion-ios-bolt:before { content: "\f3e6"; }
+
+.ion-ios-bolt-outline:before { content: "\f3e5"; }
+
+.ion-ios-book:before { content: "\f3e8"; }
+
+.ion-ios-book-outline:before { content: "\f3e7"; }
+
+.ion-ios-bookmarks:before { content: "\f3ea"; }
+
+.ion-ios-bookmarks-outline:before { content: "\f3e9"; }
+
+.ion-ios-box:before { content: "\f3ec"; }
+
+.ion-ios-box-outline:before { content: "\f3eb"; }
+
+.ion-ios-briefcase:before { content: "\f3ee"; }
+
+.ion-ios-briefcase-outline:before { content: "\f3ed"; }
+
+.ion-ios-browsers:before { content: "\f3f0"; }
+
+.ion-ios-browsers-outline:before { content: "\f3ef"; }
+
+.ion-ios-calculator:before { content: "\f3f2"; }
+
+.ion-ios-calculator-outline:before { content: "\f3f1"; }
+
+.ion-ios-calendar:before { content: "\f3f4"; }
+
+.ion-ios-calendar-outline:before { content: "\f3f3"; }
+
+.ion-ios-camera:before { content: "\f3f6"; }
+
+.ion-ios-camera-outline:before { content: "\f3f5"; }
+
+.ion-ios-cart:before { content: "\f3f8"; }
+
+.ion-ios-cart-outline:before { content: "\f3f7"; }
+
+.ion-ios-chatboxes:before { content: "\f3fa"; }
+
+.ion-ios-chatboxes-outline:before { content: "\f3f9"; }
+
+.ion-ios-chatbubble:before { content: "\f3fc"; }
+
+.ion-ios-chatbubble-outline:before { content: "\f3fb"; }
+
+.ion-ios-checkmark:before { content: "\f3ff"; }
+
+.ion-ios-checkmark-empty:before { content: "\f3fd"; }
+
+.ion-ios-checkmark-outline:before { content: "\f3fe"; }
+
+.ion-ios-circle-filled:before { content: "\f400"; }
+
+.ion-ios-circle-outline:before { content: "\f401"; }
+
+.ion-ios-clock:before { content: "\f403"; }
+
+.ion-ios-clock-outline:before { content: "\f402"; }
+
+.ion-ios-close:before { content: "\f406"; }
+
+.ion-ios-close-empty:before { content: "\f404"; }
+
+.ion-ios-close-outline:before { content: "\f405"; }
+
+.ion-ios-cloud:before { content: "\f40c"; }
+
+.ion-ios-cloud-download:before { content: "\f408"; }
+
+.ion-ios-cloud-download-outline:before { content: "\f407"; }
+
+.ion-ios-cloud-outline:before { content: "\f409"; }
+
+.ion-ios-cloud-upload:before { content: "\f40b"; }
+
+.ion-ios-cloud-upload-outline:before { content: "\f40a"; }
+
+.ion-ios-cloudy:before { content: "\f410"; }
+
+.ion-ios-cloudy-night:before { content: "\f40e"; }
+
+.ion-ios-cloudy-night-outline:before { content: "\f40d"; }
+
+.ion-ios-cloudy-outline:before { content: "\f40f"; }
+
+.ion-ios-cog:before { content: "\f412"; }
+
+.ion-ios-cog-outline:before { content: "\f411"; }
+
+.ion-ios-color-filter:before { content: "\f414"; }
+
+.ion-ios-color-filter-outline:before { content: "\f413"; }
+
+.ion-ios-color-wand:before { content: "\f416"; }
+
+.ion-ios-color-wand-outline:before { content: "\f415"; }
+
+.ion-ios-compose:before { content: "\f418"; }
+
+.ion-ios-compose-outline:before { content: "\f417"; }
+
+.ion-ios-contact:before { content: "\f41a"; }
+
+.ion-ios-contact-outline:before { content: "\f419"; }
+
+.ion-ios-copy:before { content: "\f41c"; }
+
+.ion-ios-copy-outline:before { content: "\f41b"; }
+
+.ion-ios-crop:before { content: "\f41e"; }
+
+.ion-ios-crop-strong:before { content: "\f41d"; }
+
+.ion-ios-download:before { content: "\f420"; }
+
+.ion-ios-download-outline:before { content: "\f41f"; }
+
+.ion-ios-drag:before { content: "\f421"; }
+
+.ion-ios-email:before { content: "\f423"; }
+
+.ion-ios-email-outline:before { content: "\f422"; }
+
+.ion-ios-eye:before { content: "\f425"; }
+
+.ion-ios-eye-outline:before { content: "\f424"; }
+
+.ion-ios-fastforward:before { content: "\f427"; }
+
+.ion-ios-fastforward-outline:before { content: "\f426"; }
+
+.ion-ios-filing:before { content: "\f429"; }
+
+.ion-ios-filing-outline:before { content: "\f428"; }
+
+.ion-ios-film:before { content: "\f42b"; }
+
+.ion-ios-film-outline:before { content: "\f42a"; }
+
+.ion-ios-flag:before { content: "\f42d"; }
+
+.ion-ios-flag-outline:before { content: "\f42c"; }
+
+.ion-ios-flame:before { content: "\f42f"; }
+
+.ion-ios-flame-outline:before { content: "\f42e"; }
+
+.ion-ios-flask:before { content: "\f431"; }
+
+.ion-ios-flask-outline:before { content: "\f430"; }
+
+.ion-ios-flower:before { content: "\f433"; }
+
+.ion-ios-flower-outline:before { content: "\f432"; }
+
+.ion-ios-folder:before { content: "\f435"; }
+
+.ion-ios-folder-outline:before { content: "\f434"; }
+
+.ion-ios-football:before { content: "\f437"; }
+
+.ion-ios-football-outline:before { content: "\f436"; }
+
+.ion-ios-game-controller-a:before { content: "\f439"; }
+
+.ion-ios-game-controller-a-outline:before { content: "\f438"; }
+
+.ion-ios-game-controller-b:before { content: "\f43b"; }
+
+.ion-ios-game-controller-b-outline:before { content: "\f43a"; }
+
+.ion-ios-gear:before { content: "\f43d"; }
+
+.ion-ios-gear-outline:before { content: "\f43c"; }
+
+.ion-ios-glasses:before { content: "\f43f"; }
+
+.ion-ios-glasses-outline:before { content: "\f43e"; }
+
+.ion-ios-grid-view:before { content: "\f441"; }
+
+.ion-ios-grid-view-outline:before { content: "\f440"; }
+
+.ion-ios-heart:before { content: "\f443"; }
+
+.ion-ios-heart-outline:before { content: "\f442"; }
+
+.ion-ios-help:before { content: "\f446"; }
+
+.ion-ios-help-empty:before { content: "\f444"; }
+
+.ion-ios-help-outline:before { content: "\f445"; }
+
+.ion-ios-home:before { content: "\f448"; }
+
+.ion-ios-home-outline:before { content: "\f447"; }
+
+.ion-ios-infinite:before { content: "\f44a"; }
+
+.ion-ios-infinite-outline:before { content: "\f449"; }
+
+.ion-ios-information:before { content: "\f44d"; }
+
+.ion-ios-information-empty:before { content: "\f44b"; }
+
+.ion-ios-information-outline:before { content: "\f44c"; }
+
+.ion-ios-ionic-outline:before { content: "\f44e"; }
+
+.ion-ios-keypad:before { content: "\f450"; }
+
+.ion-ios-keypad-outline:before { content: "\f44f"; }
+
+.ion-ios-lightbulb:before { content: "\f452"; }
+
+.ion-ios-lightbulb-outline:before { content: "\f451"; }
+
+.ion-ios-list:before { content: "\f454"; }
+
+.ion-ios-list-outline:before { content: "\f453"; }
+
+.ion-ios-location:before { content: "\f456"; }
+
+.ion-ios-location-outline:before { content: "\f455"; }
+
+.ion-ios-locked:before { content: "\f458"; }
+
+.ion-ios-locked-outline:before { content: "\f457"; }
+
+.ion-ios-loop:before { content: "\f45a"; }
+
+.ion-ios-loop-strong:before { content: "\f459"; }
+
+.ion-ios-medical:before { content: "\f45c"; }
+
+.ion-ios-medical-outline:before { content: "\f45b"; }
+
+.ion-ios-medkit:before { content: "\f45e"; }
+
+.ion-ios-medkit-outline:before { content: "\f45d"; }
+
+.ion-ios-mic:before { content: "\f461"; }
+
+.ion-ios-mic-off:before { content: "\f45f"; }
+
+.ion-ios-mic-outline:before { content: "\f460"; }
+
+.ion-ios-minus:before { content: "\f464"; }
+
+.ion-ios-minus-empty:before { content: "\f462"; }
+
+.ion-ios-minus-outline:before { content: "\f463"; }
+
+.ion-ios-monitor:before { content: "\f466"; }
+
+.ion-ios-monitor-outline:before { content: "\f465"; }
+
+.ion-ios-moon:before { content: "\f468"; }
+
+.ion-ios-moon-outline:before { content: "\f467"; }
+
+.ion-ios-more:before { content: "\f46a"; }
+
+.ion-ios-more-outline:before { content: "\f469"; }
+
+.ion-ios-musical-note:before { content: "\f46b"; }
+
+.ion-ios-musical-notes:before { content: "\f46c"; }
+
+.ion-ios-navigate:before { content: "\f46e"; }
+
+.ion-ios-navigate-outline:before { content: "\f46d"; }
+
+.ion-ios-nutrition:before { content: "\f470"; }
+
+.ion-ios-nutrition-outline:before { content: "\f46f"; }
+
+.ion-ios-paper:before { content: "\f472"; }
+
+.ion-ios-paper-outline:before { content: "\f471"; }
+
+.ion-ios-paperplane:before { content: "\f474"; }
+
+.ion-ios-paperplane-outline:before { content: "\f473"; }
+
+.ion-ios-partlysunny:before { content: "\f476"; }
+
+.ion-ios-partlysunny-outline:before { content: "\f475"; }
+
+.ion-ios-pause:before { content: "\f478"; }
+
+.ion-ios-pause-outline:before { content: "\f477"; }
+
+.ion-ios-paw:before { content: "\f47a"; }
+
+.ion-ios-paw-outline:before { content: "\f479"; }
+
+.ion-ios-people:before { content: "\f47c"; }
+
+.ion-ios-people-outline:before { content: "\f47b"; }
+
+.ion-ios-person:before { content: "\f47e"; }
+
+.ion-ios-person-outline:before { content: "\f47d"; }
+
+.ion-ios-personadd:before { content: "\f480"; }
+
+.ion-ios-personadd-outline:before { content: "\f47f"; }
+
+.ion-ios-photos:before { content: "\f482"; }
+
+.ion-ios-photos-outline:before { content: "\f481"; }
+
+.ion-ios-pie:before { content: "\f484"; }
+
+.ion-ios-pie-outline:before { content: "\f483"; }
+
+.ion-ios-pint:before { content: "\f486"; }
+
+.ion-ios-pint-outline:before { content: "\f485"; }
+
+.ion-ios-play:before { content: "\f488"; }
+
+.ion-ios-play-outline:before { content: "\f487"; }
+
+.ion-ios-plus:before { content: "\f48b"; }
+
+.ion-ios-plus-empty:before { content: "\f489"; }
+
+.ion-ios-plus-outline:before { content: "\f48a"; }
+
+.ion-ios-pricetag:before { content: "\f48d"; }
+
+.ion-ios-pricetag-outline:before { content: "\f48c"; }
+
+.ion-ios-pricetags:before { content: "\f48f"; }
+
+.ion-ios-pricetags-outline:before { content: "\f48e"; }
+
+.ion-ios-printer:before { content: "\f491"; }
+
+.ion-ios-printer-outline:before { content: "\f490"; }
+
+.ion-ios-pulse:before { content: "\f493"; }
+
+.ion-ios-pulse-strong:before { content: "\f492"; }
+
+.ion-ios-rainy:before { content: "\f495"; }
+
+.ion-ios-rainy-outline:before { content: "\f494"; }
+
+.ion-ios-recording:before { content: "\f497"; }
+
+.ion-ios-recording-outline:before { content: "\f496"; }
+
+.ion-ios-redo:before { content: "\f499"; }
+
+.ion-ios-redo-outline:before { content: "\f498"; }
+
+.ion-ios-refresh:before { content: "\f49c"; }
+
+.ion-ios-refresh-empty:before { content: "\f49a"; }
+
+.ion-ios-refresh-outline:before { content: "\f49b"; }
+
+.ion-ios-reload:before { content: "\f49d"; }
+
+.ion-ios-reverse-camera:before { content: "\f49f"; }
+
+.ion-ios-reverse-camera-outline:before { content: "\f49e"; }
+
+.ion-ios-rewind:before { content: "\f4a1"; }
+
+.ion-ios-rewind-outline:before { content: "\f4a0"; }
+
+.ion-ios-rose:before { content: "\f4a3"; }
+
+.ion-ios-rose-outline:before { content: "\f4a2"; }
+
+.ion-ios-search:before { content: "\f4a5"; }
+
+.ion-ios-search-strong:before { content: "\f4a4"; }
+
+.ion-ios-settings:before { content: "\f4a7"; }
+
+.ion-ios-settings-strong:before { content: "\f4a6"; }
+
+.ion-ios-shuffle:before { content: "\f4a9"; }
+
+.ion-ios-shuffle-strong:before { content: "\f4a8"; }
+
+.ion-ios-skipbackward:before { content: "\f4ab"; }
+
+.ion-ios-skipbackward-outline:before { content: "\f4aa"; }
+
+.ion-ios-skipforward:before { content: "\f4ad"; }
+
+.ion-ios-skipforward-outline:before { content: "\f4ac"; }
+
+.ion-ios-snowy:before { content: "\f4ae"; }
+
+.ion-ios-speedometer:before { content: "\f4b0"; }
+
+.ion-ios-speedometer-outline:before { content: "\f4af"; }
+
+.ion-ios-star:before { content: "\f4b3"; }
+
+.ion-ios-star-half:before { content: "\f4b1"; }
+
+.ion-ios-star-outline:before { content: "\f4b2"; }
+
+.ion-ios-stopwatch:before { content: "\f4b5"; }
+
+.ion-ios-stopwatch-outline:before { content: "\f4b4"; }
+
+.ion-ios-sunny:before { content: "\f4b7"; }
+
+.ion-ios-sunny-outline:before { content: "\f4b6"; }
+
+.ion-ios-telephone:before { content: "\f4b9"; }
+
+.ion-ios-telephone-outline:before { content: "\f4b8"; }
+
+.ion-ios-tennisball:before { content: "\f4bb"; }
+
+.ion-ios-tennisball-outline:before { content: "\f4ba"; }
+
+.ion-ios-thunderstorm:before { content: "\f4bd"; }
+
+.ion-ios-thunderstorm-outline:before { content: "\f4bc"; }
+
+.ion-ios-time:before { content: "\f4bf"; }
+
+.ion-ios-time-outline:before { content: "\f4be"; }
+
+.ion-ios-timer:before { content: "\f4c1"; }
+
+.ion-ios-timer-outline:before { content: "\f4c0"; }
+
+.ion-ios-toggle:before { content: "\f4c3"; }
+
+.ion-ios-toggle-outline:before { content: "\f4c2"; }
+
+.ion-ios-trash:before { content: "\f4c5"; }
+
+.ion-ios-trash-outline:before { content: "\f4c4"; }
+
+.ion-ios-undo:before { content: "\f4c7"; }
+
+.ion-ios-undo-outline:before { content: "\f4c6"; }
+
+.ion-ios-unlocked:before { content: "\f4c9"; }
+
+.ion-ios-unlocked-outline:before { content: "\f4c8"; }
+
+.ion-ios-upload:before { content: "\f4cb"; }
+
+.ion-ios-upload-outline:before { content: "\f4ca"; }
+
+.ion-ios-videocam:before { content: "\f4cd"; }
+
+.ion-ios-videocam-outline:before { content: "\f4cc"; }
+
+.ion-ios-volume-high:before { content: "\f4ce"; }
+
+.ion-ios-volume-low:before { content: "\f4cf"; }
+
+.ion-ios-wineglass:before { content: "\f4d1"; }
+
+.ion-ios-wineglass-outline:before { content: "\f4d0"; }
+
+.ion-ios-world:before { content: "\f4d3"; }
+
+.ion-ios-world-outline:before { content: "\f4d2"; }
+
+.ion-ipad:before { content: "\f1f9"; }
+
+.ion-iphone:before { content: "\f1fa"; }
+
+.ion-ipod:before { content: "\f1fb"; }
+
+.ion-jet:before { content: "\f295"; }
+
+.ion-key:before { content: "\f296"; }
+
+.ion-knife:before { content: "\f297"; }
+
+.ion-laptop:before { content: "\f1fc"; }
+
+.ion-leaf:before { content: "\f1fd"; }
+
+.ion-levels:before { content: "\f298"; }
+
+.ion-lightbulb:before { content: "\f299"; }
+
+.ion-link:before { content: "\f1fe"; }
+
+.ion-load-a:before { content: "\f29a"; }
+
+.ion-load-b:before { content: "\f29b"; }
+
+.ion-load-c:before { content: "\f29c"; }
+
+.ion-load-d:before { content: "\f29d"; }
+
+.ion-location:before { content: "\f1ff"; }
+
+.ion-lock-combination:before { content: "\f4d4"; }
+
+.ion-locked:before { content: "\f200"; }
+
+.ion-log-in:before { content: "\f29e"; }
+
+.ion-log-out:before { content: "\f29f"; }
+
+.ion-loop:before { content: "\f201"; }
+
+.ion-magnet:before { content: "\f2a0"; }
+
+.ion-male:before { content: "\f2a1"; }
+
+.ion-man:before { content: "\f202"; }
+
+.ion-map:before { content: "\f203"; }
+
+.ion-medkit:before { content: "\f2a2"; }
+
+.ion-merge:before { content: "\f33f"; }
+
+.ion-mic-a:before { content: "\f204"; }
+
+.ion-mic-b:before { content: "\f205"; }
+
+.ion-mic-c:before { content: "\f206"; }
+
+.ion-minus:before { content: "\f209"; }
+
+.ion-minus-circled:before { content: "\f207"; }
+
+.ion-minus-round:before { content: "\f208"; }
+
+.ion-model-s:before { content: "\f2c1"; }
+
+.ion-monitor:before { content: "\f20a"; }
+
+.ion-more:before { content: "\f20b"; }
+
+.ion-mouse:before { content: "\f340"; }
+
+.ion-music-note:before { content: "\f20c"; }
+
+.ion-navicon:before { content: "\f20e"; }
+
+.ion-navicon-round:before { content: "\f20d"; }
+
+.ion-navigate:before { content: "\f2a3"; }
+
+.ion-network:before { content: "\f341"; }
+
+.ion-no-smoking:before { content: "\f2c2"; }
+
+.ion-nuclear:before { content: "\f2a4"; }
+
+.ion-outlet:before { content: "\f342"; }
+
+.ion-paintbrush:before { content: "\f4d5"; }
+
+.ion-paintbucket:before { content: "\f4d6"; }
+
+.ion-paper-airplane:before { content: "\f2c3"; }
+
+.ion-paperclip:before { content: "\f20f"; }
+
+.ion-pause:before { content: "\f210"; }
+
+.ion-person:before { content: "\f213"; }
+
+.ion-person-add:before { content: "\f211"; }
+
+.ion-person-stalker:before { content: "\f212"; }
+
+.ion-pie-graph:before { content: "\f2a5"; }
+
+.ion-pin:before { content: "\f2a6"; }
+
+.ion-pinpoint:before { content: "\f2a7"; }
+
+.ion-pizza:before { content: "\f2a8"; }
+
+.ion-plane:before { content: "\f214"; }
+
+.ion-planet:before { content: "\f343"; }
+
+.ion-play:before { content: "\f215"; }
+
+.ion-playstation:before { content: "\f30a"; }
+
+.ion-plus:before { content: "\f218"; }
+
+.ion-plus-circled:before { content: "\f216"; }
+
+.ion-plus-round:before { content: "\f217"; }
+
+.ion-podium:before { content: "\f344"; }
+
+.ion-pound:before { content: "\f219"; }
+
+.ion-power:before { content: "\f2a9"; }
+
+.ion-pricetag:before { content: "\f2aa"; }
+
+.ion-pricetags:before { content: "\f2ab"; }
+
+.ion-printer:before { content: "\f21a"; }
+
+.ion-pull-request:before { content: "\f345"; }
+
+.ion-qr-scanner:before { content: "\f346"; }
+
+.ion-quote:before { content: "\f347"; }
+
+.ion-radio-waves:before { content: "\f2ac"; }
+
+.ion-record:before { content: "\f21b"; }
+
+.ion-refresh:before { content: "\f21c"; }
+
+.ion-reply:before { content: "\f21e"; }
+
+.ion-reply-all:before { content: "\f21d"; }
+
+.ion-ribbon-a:before { content: "\f348"; }
+
+.ion-ribbon-b:before { content: "\f349"; }
+
+.ion-sad:before { content: "\f34a"; }
+
+.ion-sad-outline:before { content: "\f4d7"; }
+
+.ion-scissors:before { content: "\f34b"; }
+
+.ion-search:before { content: "\f21f"; }
+
+.ion-settings:before { content: "\f2ad"; }
+
+.ion-share:before { content: "\f220"; }
+
+.ion-shuffle:before { content: "\f221"; }
+
+.ion-skip-backward:before { content: "\f222"; }
+
+.ion-skip-forward:before { content: "\f223"; }
+
+.ion-social-android:before { content: "\f225"; }
+
+.ion-social-android-outline:before { content: "\f224"; }
+
+.ion-social-angular:before { content: "\f4d9"; }
+
+.ion-social-angular-outline:before { content: "\f4d8"; }
+
+.ion-social-apple:before { content: "\f227"; }
+
+.ion-social-apple-outline:before { content: "\f226"; }
+
+.ion-social-bitcoin:before { content: "\f2af"; }
+
+.ion-social-bitcoin-outline:before { content: "\f2ae"; }
+
+.ion-social-buffer:before { content: "\f229"; }
+
+.ion-social-buffer-outline:before { content: "\f228"; }
+
+.ion-social-chrome:before { content: "\f4db"; }
+
+.ion-social-chrome-outline:before { content: "\f4da"; }
+
+.ion-social-codepen:before { content: "\f4dd"; }
+
+.ion-social-codepen-outline:before { content: "\f4dc"; }
+
+.ion-social-css3:before { content: "\f4df"; }
+
+.ion-social-css3-outline:before { content: "\f4de"; }
+
+.ion-social-designernews:before { content: "\f22b"; }
+
+.ion-social-designernews-outline:before { content: "\f22a"; }
+
+.ion-social-dribbble:before { content: "\f22d"; }
+
+.ion-social-dribbble-outline:before { content: "\f22c"; }
+
+.ion-social-dropbox:before { content: "\f22f"; }
+
+.ion-social-dropbox-outline:before { content: "\f22e"; }
+
+.ion-social-euro:before { content: "\f4e1"; }
+
+.ion-social-euro-outline:before { content: "\f4e0"; }
+
+.ion-social-facebook:before { content: "\f231"; }
+
+.ion-social-facebook-outline:before { content: "\f230"; }
+
+.ion-social-foursquare:before { content: "\f34d"; }
+
+.ion-social-foursquare-outline:before { content: "\f34c"; }
+
+.ion-social-freebsd-devil:before { content: "\f2c4"; }
+
+.ion-social-github:before { content: "\f233"; }
+
+.ion-social-github-outline:before { content: "\f232"; }
+
+.ion-social-google:before { content: "\f34f"; }
+
+.ion-social-google-outline:before { content: "\f34e"; }
+
+.ion-social-googleplus:before { content: "\f235"; }
+
+.ion-social-googleplus-outline:before { content: "\f234"; }
+
+.ion-social-hackernews:before { content: "\f237"; }
+
+.ion-social-hackernews-outline:before { content: "\f236"; }
+
+.ion-social-html5:before { content: "\f4e3"; }
+
+.ion-social-html5-outline:before { content: "\f4e2"; }
+
+.ion-social-instagram:before { content: "\f351"; }
+
+.ion-social-instagram-outline:before { content: "\f350"; }
+
+.ion-social-javascript:before { content: "\f4e5"; }
+
+.ion-social-javascript-outline:before { content: "\f4e4"; }
+
+.ion-social-linkedin:before { content: "\f239"; }
+
+.ion-social-linkedin-outline:before { content: "\f238"; }
+
+.ion-social-markdown:before { content: "\f4e6"; }
+
+.ion-social-nodejs:before { content: "\f4e7"; }
+
+.ion-social-octocat:before { content: "\f4e8"; }
+
+.ion-social-pinterest:before { content: "\f2b1"; }
+
+.ion-social-pinterest-outline:before { content: "\f2b0"; }
+
+.ion-social-python:before { content: "\f4e9"; }
+
+.ion-social-reddit:before { content: "\f23b"; }
+
+.ion-social-reddit-outline:before { content: "\f23a"; }
+
+.ion-social-rss:before { content: "\f23d"; }
+
+.ion-social-rss-outline:before { content: "\f23c"; }
+
+.ion-social-sass:before { content: "\f4ea"; }
+
+.ion-social-skype:before { content: "\f23f"; }
+
+.ion-social-skype-outline:before { content: "\f23e"; }
+
+.ion-social-snapchat:before { content: "\f4ec"; }
+
+.ion-social-snapchat-outline:before { content: "\f4eb"; }
+
+.ion-social-tumblr:before { content: "\f241"; }
+
+.ion-social-tumblr-outline:before { content: "\f240"; }
+
+.ion-social-tux:before { content: "\f2c5"; }
+
+.ion-social-twitch:before { content: "\f4ee"; }
+
+.ion-social-twitch-outline:before { content: "\f4ed"; }
+
+.ion-social-twitter:before { content: "\f243"; }
+
+.ion-social-twitter-outline:before { content: "\f242"; }
+
+.ion-social-usd:before { content: "\f353"; }
+
+.ion-social-usd-outline:before { content: "\f352"; }
+
+.ion-social-vimeo:before { content: "\f245"; }
+
+.ion-social-vimeo-outline:before { content: "\f244"; }
+
+.ion-social-whatsapp:before { content: "\f4f0"; }
+
+.ion-social-whatsapp-outline:before { content: "\f4ef"; }
+
+.ion-social-windows:before { content: "\f247"; }
+
+.ion-social-windows-outline:before { content: "\f246"; }
+
+.ion-social-wordpress:before { content: "\f249"; }
+
+.ion-social-wordpress-outline:before { content: "\f248"; }
+
+.ion-social-yahoo:before { content: "\f24b"; }
+
+.ion-social-yahoo-outline:before { content: "\f24a"; }
+
+.ion-social-yen:before { content: "\f4f2"; }
+
+.ion-social-yen-outline:before { content: "\f4f1"; }
+
+.ion-social-youtube:before { content: "\f24d"; }
+
+.ion-social-youtube-outline:before { content: "\f24c"; }
+
+.ion-soup-can:before { content: "\f4f4"; }
+
+.ion-soup-can-outline:before { content: "\f4f3"; }
+
+.ion-speakerphone:before { content: "\f2b2"; }
+
+.ion-speedometer:before { content: "\f2b3"; }
+
+.ion-spoon:before { content: "\f2b4"; }
+
+.ion-star:before { content: "\f24e"; }
+
+.ion-stats-bars:before { content: "\f2b5"; }
+
+.ion-steam:before { content: "\f30b"; }
+
+.ion-stop:before { content: "\f24f"; }
+
+.ion-thermometer:before { content: "\f2b6"; }
+
+.ion-thumbsdown:before { content: "\f250"; }
+
+.ion-thumbsup:before { content: "\f251"; }
+
+.ion-toggle:before { content: "\f355"; }
+
+.ion-toggle-filled:before { content: "\f354"; }
+
+.ion-transgender:before { content: "\f4f5"; }
+
+.ion-trash-a:before { content: "\f252"; }
+
+.ion-trash-b:before { content: "\f253"; }
+
+.ion-trophy:before { content: "\f356"; }
+
+.ion-tshirt:before { content: "\f4f7"; }
+
+.ion-tshirt-outline:before { content: "\f4f6"; }
+
+.ion-umbrella:before { content: "\f2b7"; }
+
+.ion-university:before { content: "\f357"; }
+
+.ion-unlocked:before { content: "\f254"; }
+
+.ion-upload:before { content: "\f255"; }
+
+.ion-usb:before { content: "\f2b8"; }
+
+.ion-videocamera:before { content: "\f256"; }
+
+.ion-volume-high:before { content: "\f257"; }
+
+.ion-volume-low:before { content: "\f258"; }
+
+.ion-volume-medium:before { content: "\f259"; }
+
+.ion-volume-mute:before { content: "\f25a"; }
+
+.ion-wand:before { content: "\f358"; }
+
+.ion-waterdrop:before { content: "\f25b"; }
+
+.ion-wifi:before { content: "\f25c"; }
+
+.ion-wineglass:before { content: "\f2b9"; }
+
+.ion-woman:before { content: "\f25d"; }
+
+.ion-wrench:before { content: "\f2ba"; }
+
+.ion-xbox:before { content: "\f30c"; }
diff --git a/docs/lib/ionicons/css/ionicons.min.css b/docs/lib/ionicons/css/ionicons.min.css
new file mode 100644
index 0000000..baba9e9
--- /dev/null
+++ b/docs/lib/ionicons/css/ionicons.min.css
@@ -0,0 +1,11 @@
+@charset "UTF-8";/*!
+  Ionicons, v2.0.0
+  Created by Ben Sperry for the Ionic Framework, http://ionicons.com/
+  https://twitter.com/benjsperry  https://twitter.com/ionicframework
+  MIT License: https://github.com/driftyco/ionicons
+
+  Android-style icons originally built by Google’s
+  Material Design Icons: https://github.com/google/material-design-icons
+  used under CC BY http://creativecommons.org/licenses/by/4.0/
+  Modified icons to fit ionicon’s grid from original.
+*/@font-face{font-family:"Ionicons";src:url("../fonts/ionicons.eot?v=2.0.0");src:url("../fonts/ionicons.eot?v=2.0.0#iefix") format("embedded-opentype"),url("../fonts/ionicons.ttf?v=2.0.0") format("truetype"),url("../fonts/ionicons.woff?v=2.0.0") format("woff"),url("../fonts/ionicons.svg?v=2.0.0#Ionicons") format("svg");font-weight:normal;font-style:normal}.ion,.ionicons,.ion-alert:before,.ion-alert-circled:before,.ion-android-add:before,.ion-android-add-circle:before,.ion-android-alarm-clock:before,.ion-android-alert:before,.ion-android-apps:before,.ion-android-archive:before,.ion-android-arrow-back:before,.ion-android-arrow-down:before,.ion-android-arrow-dropdown:before,.ion-android-arrow-dropdown-circle:before,.ion-android-arrow-dropleft:before,.ion-android-arrow-dropleft-circle:before,.ion-android-arrow-dropright:before,.ion-android-arrow-dropright-circle:before,.ion-android-arrow-dropup:before,.ion-android-arrow-dropup-circle:before,.ion-android-arrow-forward:before,.ion-android-arrow-up:before,.ion-android-attach:before,.ion-android-bar:before,.ion-android-bicycle:before,.ion-android-boat:before,.ion-android-bookmark:before,.ion-android-bulb:before,.ion-android-bus:before,.ion-android-calendar:before,.ion-android-call:before,.ion-android-camera:before,.ion-android-cancel:before,.ion-android-car:before,.ion-android-cart:before,.ion-android-chat:before,.ion-android-checkbox:before,.ion-android-checkbox-blank:before,.ion-android-checkbox-outline:before,.ion-android-checkbox-outline-blank:before,.ion-android-checkmark-circle:before,.ion-android-clipboard:before,.ion-android-close:before,.ion-android-cloud:before,.ion-android-cloud-circle:before,.ion-android-cloud-done:before,.ion-android-cloud-outline:before,.ion-android-color-palette:before,.ion-android-compass:before,.ion-android-contact:before,.ion-android-contacts:before,.ion-android-contract:before,.ion-android-create:before,.ion-android-delete:before,.ion-android-desktop:before,.ion-android-document:before,.ion-android-done:before,.ion-android-done-all:before,.ion-android-download:before,.ion-android-drafts:before,.ion-android-exit:before,.ion-android-expand:before,.ion-android-favorite:before,.ion-android-favorite-outline:before,.ion-android-film:before,.ion-android-folder:before,.ion-android-folder-open:before,.ion-android-funnel:before,.ion-android-globe:before,.ion-android-hand:before,.ion-android-hangout:before,.ion-android-happy:before,.ion-android-home:before,.ion-android-image:before,.ion-android-laptop:before,.ion-android-list:before,.ion-android-locate:before,.ion-android-lock:before,.ion-android-mail:before,.ion-android-map:before,.ion-android-menu:before,.ion-android-microphone:before,.ion-android-microphone-off:before,.ion-android-more-horizontal:before,.ion-android-more-vertical:before,.ion-android-navigate:before,.ion-android-notifications:before,.ion-android-notifications-none:before,.ion-android-notifications-off:before,.ion-android-open:before,.ion-android-options:before,.ion-android-people:before,.ion-android-person:before,.ion-android-person-add:before,.ion-android-phone-landscape:before,.ion-android-phone-portrait:before,.ion-android-pin:before,.ion-android-plane:before,.ion-android-playstore:before,.ion-android-print:before,.ion-android-radio-button-off:before,.ion-android-radio-button-on:before,.ion-android-refresh:before,.ion-android-remove:before,.ion-android-remove-circle:before,.ion-android-restaurant:before,.ion-android-sad:before,.ion-android-search:before,.ion-android-send:before,.ion-android-settings:before,.ion-android-share:before,.ion-android-share-alt:before,.ion-android-star:before,.ion-android-star-half:before,.ion-android-star-outline:before,.ion-android-stopwatch:before,.ion-android-subway:before,.ion-android-sunny:before,.ion-android-sync:before,.ion-android-textsms:before,.ion-android-time:before,.ion-android-train:before,.ion-android-unlock:before,.ion-android-upload:before,.ion-android-volume-down:before,.ion-android-volume-mute:before,.ion-android-volume-off:before,.ion-android-volume-up:before,.ion-android-walk:before,.ion-android-warning:before,.ion-android-watch:before,.ion-android-wifi:before,.ion-aperture:before,.ion-archive:before,.ion-arrow-down-a:before,.ion-arrow-down-b:before,.ion-arrow-down-c:before,.ion-arrow-expand:before,.ion-arrow-graph-down-left:before,.ion-arrow-graph-down-right:before,.ion-arrow-graph-up-left:before,.ion-arrow-graph-up-right:before,.ion-arrow-left-a:before,.ion-arrow-left-b:before,.ion-arrow-left-c:before,.ion-arrow-move:before,.ion-arrow-resize:before,.ion-arrow-return-left:before,.ion-arrow-return-right:before,.ion-arrow-right-a:before,.ion-arrow-right-b:before,.ion-arrow-right-c:before,.ion-arrow-shrink:before,.ion-arrow-swap:before,.ion-arrow-up-a:before,.ion-arrow-up-b:before,.ion-arrow-up-c:before,.ion-asterisk:before,.ion-at:before,.ion-backspace:before,.ion-backspace-outline:before,.ion-bag:before,.ion-battery-charging:before,.ion-battery-empty:before,.ion-battery-full:before,.ion-battery-half:before,.ion-battery-low:before,.ion-beaker:before,.ion-beer:before,.ion-bluetooth:before,.ion-bonfire:before,.ion-bookmark:before,.ion-bowtie:before,.ion-briefcase:before,.ion-bug:before,.ion-calculator:before,.ion-calendar:before,.ion-camera:before,.ion-card:before,.ion-cash:before,.ion-chatbox:before,.ion-chatbox-working:before,.ion-chatboxes:before,.ion-chatbubble:before,.ion-chatbubble-working:before,.ion-chatbubbles:before,.ion-checkmark:before,.ion-checkmark-circled:before,.ion-checkmark-round:before,.ion-chevron-down:before,.ion-chevron-left:before,.ion-chevron-right:before,.ion-chevron-up:before,.ion-clipboard:before,.ion-clock:before,.ion-close:before,.ion-close-circled:before,.ion-close-round:before,.ion-closed-captioning:before,.ion-cloud:before,.ion-code:before,.ion-code-download:before,.ion-code-working:before,.ion-coffee:before,.ion-compass:before,.ion-compose:before,.ion-connection-bars:before,.ion-contrast:before,.ion-crop:before,.ion-cube:before,.ion-disc:before,.ion-document:before,.ion-document-text:before,.ion-drag:before,.ion-earth:before,.ion-easel:before,.ion-edit:before,.ion-egg:before,.ion-eject:before,.ion-email:before,.ion-email-unread:before,.ion-erlenmeyer-flask:before,.ion-erlenmeyer-flask-bubbles:before,.ion-eye:before,.ion-eye-disabled:before,.ion-female:before,.ion-filing:before,.ion-film-marker:before,.ion-fireball:before,.ion-flag:before,.ion-flame:before,.ion-flash:before,.ion-flash-off:before,.ion-folder:before,.ion-fork:before,.ion-fork-repo:before,.ion-forward:before,.ion-funnel:before,.ion-gear-a:before,.ion-gear-b:before,.ion-grid:before,.ion-hammer:before,.ion-happy:before,.ion-happy-outline:before,.ion-headphone:before,.ion-heart:before,.ion-heart-broken:before,.ion-help:before,.ion-help-buoy:before,.ion-help-circled:before,.ion-home:before,.ion-icecream:before,.ion-image:before,.ion-images:before,.ion-information:before,.ion-information-circled:before,.ion-ionic:before,.ion-ios-alarm:before,.ion-ios-alarm-outline:before,.ion-ios-albums:before,.ion-ios-albums-outline:before,.ion-ios-americanfootball:before,.ion-ios-americanfootball-outline:before,.ion-ios-analytics:before,.ion-ios-analytics-outline:before,.ion-ios-arrow-back:before,.ion-ios-arrow-down:before,.ion-ios-arrow-forward:before,.ion-ios-arrow-left:before,.ion-ios-arrow-right:before,.ion-ios-arrow-thin-down:before,.ion-ios-arrow-thin-left:before,.ion-ios-arrow-thin-right:before,.ion-ios-arrow-thin-up:before,.ion-ios-arrow-up:before,.ion-ios-at:before,.ion-ios-at-outline:before,.ion-ios-barcode:before,.ion-ios-barcode-outline:before,.ion-ios-baseball:before,.ion-ios-baseball-outline:before,.ion-ios-basketball:before,.ion-ios-basketball-outline:before,.ion-ios-bell:before,.ion-ios-bell-outline:before,.ion-ios-body:before,.ion-ios-body-outline:before,.ion-ios-bolt:before,.ion-ios-bolt-outline:before,.ion-ios-book:before,.ion-ios-book-outline:before,.ion-ios-bookmarks:before,.ion-ios-bookmarks-outline:before,.ion-ios-box:before,.ion-ios-box-outline:before,.ion-ios-briefcase:before,.ion-ios-briefcase-outline:before,.ion-ios-browsers:before,.ion-ios-browsers-outline:before,.ion-ios-calculator:before,.ion-ios-calculator-outline:before,.ion-ios-calendar:before,.ion-ios-calendar-outline:before,.ion-ios-camera:before,.ion-ios-camera-outline:before,.ion-ios-cart:before,.ion-ios-cart-outline:before,.ion-ios-chatboxes:before,.ion-ios-chatboxes-outline:before,.ion-ios-chatbubble:before,.ion-ios-chatbubble-outline:before,.ion-ios-checkmark:before,.ion-ios-checkmark-empty:before,.ion-ios-checkmark-outline:before,.ion-ios-circle-filled:before,.ion-ios-circle-outline:before,.ion-ios-clock:before,.ion-ios-clock-outline:before,.ion-ios-close:before,.ion-ios-close-empty:before,.ion-ios-close-outline:before,.ion-ios-cloud:before,.ion-ios-cloud-download:before,.ion-ios-cloud-download-outline:before,.ion-ios-cloud-outline:before,.ion-ios-cloud-upload:before,.ion-ios-cloud-upload-outline:before,.ion-ios-cloudy:before,.ion-ios-cloudy-night:before,.ion-ios-cloudy-night-outline:before,.ion-ios-cloudy-outline:before,.ion-ios-cog:before,.ion-ios-cog-outline:before,.ion-ios-color-filter:before,.ion-ios-color-filter-outline:before,.ion-ios-color-wand:before,.ion-ios-color-wand-outline:before,.ion-ios-compose:before,.ion-ios-compose-outline:before,.ion-ios-contact:before,.ion-ios-contact-outline:before,.ion-ios-copy:before,.ion-ios-copy-outline:before,.ion-ios-crop:before,.ion-ios-crop-strong:before,.ion-ios-download:before,.ion-ios-download-outline:before,.ion-ios-drag:before,.ion-ios-email:before,.ion-ios-email-outline:before,.ion-ios-eye:before,.ion-ios-eye-outline:before,.ion-ios-fastforward:before,.ion-ios-fastforward-outline:before,.ion-ios-filing:before,.ion-ios-filing-outline:before,.ion-ios-film:before,.ion-ios-film-outline:before,.ion-ios-flag:before,.ion-ios-flag-outline:before,.ion-ios-flame:before,.ion-ios-flame-outline:before,.ion-ios-flask:before,.ion-ios-flask-outline:before,.ion-ios-flower:before,.ion-ios-flower-outline:before,.ion-ios-folder:before,.ion-ios-folder-outline:before,.ion-ios-football:before,.ion-ios-football-outline:before,.ion-ios-game-controller-a:before,.ion-ios-game-controller-a-outline:before,.ion-ios-game-controller-b:before,.ion-ios-game-controller-b-outline:before,.ion-ios-gear:before,.ion-ios-gear-outline:before,.ion-ios-glasses:before,.ion-ios-glasses-outline:before,.ion-ios-grid-view:before,.ion-ios-grid-view-outline:before,.ion-ios-heart:before,.ion-ios-heart-outline:before,.ion-ios-help:before,.ion-ios-help-empty:before,.ion-ios-help-outline:before,.ion-ios-home:before,.ion-ios-home-outline:before,.ion-ios-infinite:before,.ion-ios-infinite-outline:before,.ion-ios-information:before,.ion-ios-information-empty:before,.ion-ios-information-outline:before,.ion-ios-ionic-outline:before,.ion-ios-keypad:before,.ion-ios-keypad-outline:before,.ion-ios-lightbulb:before,.ion-ios-lightbulb-outline:before,.ion-ios-list:before,.ion-ios-list-outline:before,.ion-ios-location:before,.ion-ios-location-outline:before,.ion-ios-locked:before,.ion-ios-locked-outline:before,.ion-ios-loop:before,.ion-ios-loop-strong:before,.ion-ios-medical:before,.ion-ios-medical-outline:before,.ion-ios-medkit:before,.ion-ios-medkit-outline:before,.ion-ios-mic:before,.ion-ios-mic-off:before,.ion-ios-mic-outline:before,.ion-ios-minus:before,.ion-ios-minus-empty:before,.ion-ios-minus-outline:before,.ion-ios-monitor:before,.ion-ios-monitor-outline:before,.ion-ios-moon:before,.ion-ios-moon-outline:before,.ion-ios-more:before,.ion-ios-more-outline:before,.ion-ios-musical-note:before,.ion-ios-musical-notes:before,.ion-ios-navigate:before,.ion-ios-navigate-outline:before,.ion-ios-nutrition:before,.ion-ios-nutrition-outline:before,.ion-ios-paper:before,.ion-ios-paper-outline:before,.ion-ios-paperplane:before,.ion-ios-paperplane-outline:before,.ion-ios-partlysunny:before,.ion-ios-partlysunny-outline:before,.ion-ios-pause:before,.ion-ios-pause-outline:before,.ion-ios-paw:before,.ion-ios-paw-outline:before,.ion-ios-people:before,.ion-ios-people-outline:before,.ion-ios-person:before,.ion-ios-person-outline:before,.ion-ios-personadd:before,.ion-ios-personadd-outline:before,.ion-ios-photos:before,.ion-ios-photos-outline:before,.ion-ios-pie:before,.ion-ios-pie-outline:before,.ion-ios-pint:before,.ion-ios-pint-outline:before,.ion-ios-play:before,.ion-ios-play-outline:before,.ion-ios-plus:before,.ion-ios-plus-empty:before,.ion-ios-plus-outline:before,.ion-ios-pricetag:before,.ion-ios-pricetag-outline:before,.ion-ios-pricetags:before,.ion-ios-pricetags-outline:before,.ion-ios-printer:before,.ion-ios-printer-outline:before,.ion-ios-pulse:before,.ion-ios-pulse-strong:before,.ion-ios-rainy:before,.ion-ios-rainy-outline:before,.ion-ios-recording:before,.ion-ios-recording-outline:before,.ion-ios-redo:before,.ion-ios-redo-outline:before,.ion-ios-refresh:before,.ion-ios-refresh-empty:before,.ion-ios-refresh-outline:before,.ion-ios-reload:before,.ion-ios-reverse-camera:before,.ion-ios-reverse-camera-outline:before,.ion-ios-rewind:before,.ion-ios-rewind-outline:before,.ion-ios-rose:before,.ion-ios-rose-outline:before,.ion-ios-search:before,.ion-ios-search-strong:before,.ion-ios-settings:before,.ion-ios-settings-strong:before,.ion-ios-shuffle:before,.ion-ios-shuffle-strong:before,.ion-ios-skipbackward:before,.ion-ios-skipbackward-outline:before,.ion-ios-skipforward:before,.ion-ios-skipforward-outline:before,.ion-ios-snowy:before,.ion-ios-speedometer:before,.ion-ios-speedometer-outline:before,.ion-ios-star:before,.ion-ios-star-half:before,.ion-ios-star-outline:before,.ion-ios-stopwatch:before,.ion-ios-stopwatch-outline:before,.ion-ios-sunny:before,.ion-ios-sunny-outline:before,.ion-ios-telephone:before,.ion-ios-telephone-outline:before,.ion-ios-tennisball:before,.ion-ios-tennisball-outline:before,.ion-ios-thunderstorm:before,.ion-ios-thunderstorm-outline:before,.ion-ios-time:before,.ion-ios-time-outline:before,.ion-ios-timer:before,.ion-ios-timer-outline:before,.ion-ios-toggle:before,.ion-ios-toggle-outline:before,.ion-ios-trash:before,.ion-ios-trash-outline:before,.ion-ios-undo:before,.ion-ios-undo-outline:before,.ion-ios-unlocked:before,.ion-ios-unlocked-outline:before,.ion-ios-upload:before,.ion-ios-upload-outline:before,.ion-ios-videocam:before,.ion-ios-videocam-outline:before,.ion-ios-volume-high:before,.ion-ios-volume-low:before,.ion-ios-wineglass:before,.ion-ios-wineglass-outline:before,.ion-ios-world:before,.ion-ios-world-outline:before,.ion-ipad:before,.ion-iphone:before,.ion-ipod:before,.ion-jet:before,.ion-key:before,.ion-knife:before,.ion-laptop:before,.ion-leaf:before,.ion-levels:before,.ion-lightbulb:before,.ion-link:before,.ion-load-a:before,.ion-load-b:before,.ion-load-c:before,.ion-load-d:before,.ion-location:before,.ion-lock-combination:before,.ion-locked:before,.ion-log-in:before,.ion-log-out:before,.ion-loop:before,.ion-magnet:before,.ion-male:before,.ion-man:before,.ion-map:before,.ion-medkit:before,.ion-merge:before,.ion-mic-a:before,.ion-mic-b:before,.ion-mic-c:before,.ion-minus:before,.ion-minus-circled:before,.ion-minus-round:before,.ion-model-s:before,.ion-monitor:before,.ion-more:before,.ion-mouse:before,.ion-music-note:before,.ion-navicon:before,.ion-navicon-round:before,.ion-navigate:before,.ion-network:before,.ion-no-smoking:before,.ion-nuclear:before,.ion-outlet:before,.ion-paintbrush:before,.ion-paintbucket:before,.ion-paper-airplane:before,.ion-paperclip:before,.ion-pause:before,.ion-person:before,.ion-person-add:before,.ion-person-stalker:before,.ion-pie-graph:before,.ion-pin:before,.ion-pinpoint:before,.ion-pizza:before,.ion-plane:before,.ion-planet:before,.ion-play:before,.ion-playstation:before,.ion-plus:before,.ion-plus-circled:before,.ion-plus-round:before,.ion-podium:before,.ion-pound:before,.ion-power:before,.ion-pricetag:before,.ion-pricetags:before,.ion-printer:before,.ion-pull-request:before,.ion-qr-scanner:before,.ion-quote:before,.ion-radio-waves:before,.ion-record:before,.ion-refresh:before,.ion-reply:before,.ion-reply-all:before,.ion-ribbon-a:before,.ion-ribbon-b:before,.ion-sad:before,.ion-sad-outline:before,.ion-scissors:before,.ion-search:before,.ion-settings:before,.ion-share:before,.ion-shuffle:before,.ion-skip-backward:before,.ion-skip-forward:before,.ion-social-android:before,.ion-social-android-outline:before,.ion-social-angular:before,.ion-social-angular-outline:before,.ion-social-apple:before,.ion-social-apple-outline:before,.ion-social-bitcoin:before,.ion-social-bitcoin-outline:before,.ion-social-buffer:before,.ion-social-buffer-outline:before,.ion-social-chrome:before,.ion-social-chrome-outline:before,.ion-social-codepen:before,.ion-social-codepen-outline:before,.ion-social-css3:before,.ion-social-css3-outline:before,.ion-social-designernews:before,.ion-social-designernews-outline:before,.ion-social-dribbble:before,.ion-social-dribbble-outline:before,.ion-social-dropbox:before,.ion-social-dropbox-outline:before,.ion-social-euro:before,.ion-social-euro-outline:before,.ion-social-facebook:before,.ion-social-facebook-outline:before,.ion-social-foursquare:before,.ion-social-foursquare-outline:before,.ion-social-freebsd-devil:before,.ion-social-github:before,.ion-social-github-outline:before,.ion-social-google:before,.ion-social-google-outline:before,.ion-social-googleplus:before,.ion-social-googleplus-outline:before,.ion-social-hackernews:before,.ion-social-hackernews-outline:before,.ion-social-html5:before,.ion-social-html5-outline:before,.ion-social-instagram:before,.ion-social-instagram-outline:before,.ion-social-javascript:before,.ion-social-javascript-outline:before,.ion-social-linkedin:before,.ion-social-linkedin-outline:before,.ion-social-markdown:before,.ion-social-nodejs:before,.ion-social-octocat:before,.ion-social-pinterest:before,.ion-social-pinterest-outline:before,.ion-social-python:before,.ion-social-reddit:before,.ion-social-reddit-outline:before,.ion-social-rss:before,.ion-social-rss-outline:before,.ion-social-sass:before,.ion-social-skype:before,.ion-social-skype-outline:before,.ion-social-snapchat:before,.ion-social-snapchat-outline:before,.ion-social-tumblr:before,.ion-social-tumblr-outline:before,.ion-social-tux:before,.ion-social-twitch:before,.ion-social-twitch-outline:before,.ion-social-twitter:before,.ion-social-twitter-outline:before,.ion-social-usd:before,.ion-social-usd-outline:before,.ion-social-vimeo:before,.ion-social-vimeo-outline:before,.ion-social-whatsapp:before,.ion-social-whatsapp-outline:before,.ion-social-windows:before,.ion-social-windows-outline:before,.ion-social-wordpress:before,.ion-social-wordpress-outline:before,.ion-social-yahoo:before,.ion-social-yahoo-outline:before,.ion-social-yen:before,.ion-social-yen-outline:before,.ion-social-youtube:before,.ion-social-youtube-outline:before,.ion-soup-can:before,.ion-soup-can-outline:before,.ion-speakerphone:before,.ion-speedometer:before,.ion-spoon:before,.ion-star:before,.ion-stats-bars:before,.ion-steam:before,.ion-stop:before,.ion-thermometer:before,.ion-thumbsdown:before,.ion-thumbsup:before,.ion-toggle:before,.ion-toggle-filled:before,.ion-transgender:before,.ion-trash-a:before,.ion-trash-b:before,.ion-trophy:before,.ion-tshirt:before,.ion-tshirt-outline:before,.ion-umbrella:before,.ion-university:before,.ion-unlocked:before,.ion-upload:before,.ion-usb:before,.ion-videocamera:before,.ion-volume-high:before,.ion-volume-low:before,.ion-volume-medium:before,.ion-volume-mute:before,.ion-wand:before,.ion-waterdrop:before,.ion-wifi:before,.ion-wineglass:before,.ion-woman:before,.ion-wrench:before,.ion-xbox:before{display:inline-block;font-family:"Ionicons";speak:none;font-style:normal;font-weight:normal;font-variant:normal;text-transform:none;text-rendering:auto;line-height:1;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}.ion-alert:before{content:"\f101"}.ion-alert-circled:before{content:"\f100"}.ion-android-add:before{content:"\f2c7"}.ion-android-add-circle:before{content:"\f359"}.ion-android-alarm-clock:before{content:"\f35a"}.ion-android-alert:before{content:"\f35b"}.ion-android-apps:before{content:"\f35c"}.ion-android-archive:before{content:"\f2c9"}.ion-android-arrow-back:before{content:"\f2ca"}.ion-android-arrow-down:before{content:"\f35d"}.ion-android-arrow-dropdown:before{content:"\f35f"}.ion-android-arrow-dropdown-circle:before{content:"\f35e"}.ion-android-arrow-dropleft:before{content:"\f361"}.ion-android-arrow-dropleft-circle:before{content:"\f360"}.ion-android-arrow-dropright:before{content:"\f363"}.ion-android-arrow-dropright-circle:before{content:"\f362"}.ion-android-arrow-dropup:before{content:"\f365"}.ion-android-arrow-dropup-circle:before{content:"\f364"}.ion-android-arrow-forward:before{content:"\f30f"}.ion-android-arrow-up:before{content:"\f366"}.ion-android-attach:before{content:"\f367"}.ion-android-bar:before{content:"\f368"}.ion-android-bicycle:before{content:"\f369"}.ion-android-boat:before{content:"\f36a"}.ion-android-bookmark:before{content:"\f36b"}.ion-android-bulb:before{content:"\f36c"}.ion-android-bus:before{content:"\f36d"}.ion-android-calendar:before{content:"\f2d1"}.ion-android-call:before{content:"\f2d2"}.ion-android-camera:before{content:"\f2d3"}.ion-android-cancel:before{content:"\f36e"}.ion-android-car:before{content:"\f36f"}.ion-android-cart:before{content:"\f370"}.ion-android-chat:before{content:"\f2d4"}.ion-android-checkbox:before{content:"\f374"}.ion-android-checkbox-blank:before{content:"\f371"}.ion-android-checkbox-outline:before{content:"\f373"}.ion-android-checkbox-outline-blank:before{content:"\f372"}.ion-android-checkmark-circle:before{content:"\f375"}.ion-android-clipboard:before{content:"\f376"}.ion-android-close:before{content:"\f2d7"}.ion-android-cloud:before{content:"\f37a"}.ion-android-cloud-circle:before{content:"\f377"}.ion-android-cloud-done:before{content:"\f378"}.ion-android-cloud-outline:before{content:"\f379"}.ion-android-color-palette:before{content:"\f37b"}.ion-android-compass:before{content:"\f37c"}.ion-android-contact:before{content:"\f2d8"}.ion-android-contacts:before{content:"\f2d9"}.ion-android-contract:before{content:"\f37d"}.ion-android-create:before{content:"\f37e"}.ion-android-delete:before{content:"\f37f"}.ion-android-desktop:before{content:"\f380"}.ion-android-document:before{content:"\f381"}.ion-android-done:before{content:"\f383"}.ion-android-done-all:before{content:"\f382"}.ion-android-download:before{content:"\f2dd"}.ion-android-drafts:before{content:"\f384"}.ion-android-exit:before{content:"\f385"}.ion-android-expand:before{content:"\f386"}.ion-android-favorite:before{content:"\f388"}.ion-android-favorite-outline:before{content:"\f387"}.ion-android-film:before{content:"\f389"}.ion-android-folder:before{content:"\f2e0"}.ion-android-folder-open:before{content:"\f38a"}.ion-android-funnel:before{content:"\f38b"}.ion-android-globe:before{content:"\f38c"}.ion-android-hand:before{content:"\f2e3"}.ion-android-hangout:before{content:"\f38d"}.ion-android-happy:before{content:"\f38e"}.ion-android-home:before{content:"\f38f"}.ion-android-image:before{content:"\f2e4"}.ion-android-laptop:before{content:"\f390"}.ion-android-list:before{content:"\f391"}.ion-android-locate:before{content:"\f2e9"}.ion-android-lock:before{content:"\f392"}.ion-android-mail:before{content:"\f2eb"}.ion-android-map:before{content:"\f393"}.ion-android-menu:before{content:"\f394"}.ion-android-microphone:before{content:"\f2ec"}.ion-android-microphone-off:before{content:"\f395"}.ion-android-more-horizontal:before{content:"\f396"}.ion-android-more-vertical:before{content:"\f397"}.ion-android-navigate:before{content:"\f398"}.ion-android-notifications:before{content:"\f39b"}.ion-android-notifications-none:before{content:"\f399"}.ion-android-notifications-off:before{content:"\f39a"}.ion-android-open:before{content:"\f39c"}.ion-android-options:before{content:"\f39d"}.ion-android-people:before{content:"\f39e"}.ion-android-person:before{content:"\f3a0"}.ion-android-person-add:before{content:"\f39f"}.ion-android-phone-landscape:before{content:"\f3a1"}.ion-android-phone-portrait:before{content:"\f3a2"}.ion-android-pin:before{content:"\f3a3"}.ion-android-plane:before{content:"\f3a4"}.ion-android-playstore:before{content:"\f2f0"}.ion-android-print:before{content:"\f3a5"}.ion-android-radio-button-off:before{content:"\f3a6"}.ion-android-radio-button-on:before{content:"\f3a7"}.ion-android-refresh:before{content:"\f3a8"}.ion-android-remove:before{content:"\f2f4"}.ion-android-remove-circle:before{content:"\f3a9"}.ion-android-restaurant:before{content:"\f3aa"}.ion-android-sad:before{content:"\f3ab"}.ion-android-search:before{content:"\f2f5"}.ion-android-send:before{content:"\f2f6"}.ion-android-settings:before{content:"\f2f7"}.ion-android-share:before{content:"\f2f8"}.ion-android-share-alt:before{content:"\f3ac"}.ion-android-star:before{content:"\f2fc"}.ion-android-star-half:before{content:"\f3ad"}.ion-android-star-outline:before{content:"\f3ae"}.ion-android-stopwatch:before{content:"\f2fd"}.ion-android-subway:before{content:"\f3af"}.ion-android-sunny:before{content:"\f3b0"}.ion-android-sync:before{content:"\f3b1"}.ion-android-textsms:before{content:"\f3b2"}.ion-android-time:before{content:"\f3b3"}.ion-android-train:before{content:"\f3b4"}.ion-android-unlock:before{content:"\f3b5"}.ion-android-upload:before{content:"\f3b6"}.ion-android-volume-down:before{content:"\f3b7"}.ion-android-volume-mute:before{content:"\f3b8"}.ion-android-volume-off:before{content:"\f3b9"}.ion-android-volume-up:before{content:"\f3ba"}.ion-android-walk:before{content:"\f3bb"}.ion-android-warning:before{content:"\f3bc"}.ion-android-watch:before{content:"\f3bd"}.ion-android-wifi:before{content:"\f305"}.ion-aperture:before{content:"\f313"}.ion-archive:before{content:"\f102"}.ion-arrow-down-a:before{content:"\f103"}.ion-arrow-down-b:before{content:"\f104"}.ion-arrow-down-c:before{content:"\f105"}.ion-arrow-expand:before{content:"\f25e"}.ion-arrow-graph-down-left:before{content:"\f25f"}.ion-arrow-graph-down-right:before{content:"\f260"}.ion-arrow-graph-up-left:before{content:"\f261"}.ion-arrow-graph-up-right:before{content:"\f262"}.ion-arrow-left-a:before{content:"\f106"}.ion-arrow-left-b:before{content:"\f107"}.ion-arrow-left-c:before{content:"\f108"}.ion-arrow-move:before{content:"\f263"}.ion-arrow-resize:before{content:"\f264"}.ion-arrow-return-left:before{content:"\f265"}.ion-arrow-return-right:before{content:"\f266"}.ion-arrow-right-a:before{content:"\f109"}.ion-arrow-right-b:before{content:"\f10a"}.ion-arrow-right-c:before{content:"\f10b"}.ion-arrow-shrink:before{content:"\f267"}.ion-arrow-swap:before{content:"\f268"}.ion-arrow-up-a:before{content:"\f10c"}.ion-arrow-up-b:before{content:"\f10d"}.ion-arrow-up-c:before{content:"\f10e"}.ion-asterisk:before{content:"\f314"}.ion-at:before{content:"\f10f"}.ion-backspace:before{content:"\f3bf"}.ion-backspace-outline:before{content:"\f3be"}.ion-bag:before{content:"\f110"}.ion-battery-charging:before{content:"\f111"}.ion-battery-empty:before{content:"\f112"}.ion-battery-full:before{content:"\f113"}.ion-battery-half:before{content:"\f114"}.ion-battery-low:before{content:"\f115"}.ion-beaker:before{content:"\f269"}.ion-beer:before{content:"\f26a"}.ion-bluetooth:before{content:"\f116"}.ion-bonfire:before{content:"\f315"}.ion-bookmark:before{content:"\f26b"}.ion-bowtie:before{content:"\f3c0"}.ion-briefcase:before{content:"\f26c"}.ion-bug:before{content:"\f2be"}.ion-calculator:before{content:"\f26d"}.ion-calendar:before{content:"\f117"}.ion-camera:before{content:"\f118"}.ion-card:before{content:"\f119"}.ion-cash:before{content:"\f316"}.ion-chatbox:before{content:"\f11b"}.ion-chatbox-working:before{content:"\f11a"}.ion-chatboxes:before{content:"\f11c"}.ion-chatbubble:before{content:"\f11e"}.ion-chatbubble-working:before{content:"\f11d"}.ion-chatbubbles:before{content:"\f11f"}.ion-checkmark:before{content:"\f122"}.ion-checkmark-circled:before{content:"\f120"}.ion-checkmark-round:before{content:"\f121"}.ion-chevron-down:before{content:"\f123"}.ion-chevron-left:before{content:"\f124"}.ion-chevron-right:before{content:"\f125"}.ion-chevron-up:before{content:"\f126"}.ion-clipboard:before{content:"\f127"}.ion-clock:before{content:"\f26e"}.ion-close:before{content:"\f12a"}.ion-close-circled:before{content:"\f128"}.ion-close-round:before{content:"\f129"}.ion-closed-captioning:before{content:"\f317"}.ion-cloud:before{content:"\f12b"}.ion-code:before{content:"\f271"}.ion-code-download:before{content:"\f26f"}.ion-code-working:before{content:"\f270"}.ion-coffee:before{content:"\f272"}.ion-compass:before{content:"\f273"}.ion-compose:before{content:"\f12c"}.ion-connection-bars:before{content:"\f274"}.ion-contrast:before{content:"\f275"}.ion-crop:before{content:"\f3c1"}.ion-cube:before{content:"\f318"}.ion-disc:before{content:"\f12d"}.ion-document:before{content:"\f12f"}.ion-document-text:before{content:"\f12e"}.ion-drag:before{content:"\f130"}.ion-earth:before{content:"\f276"}.ion-easel:before{content:"\f3c2"}.ion-edit:before{content:"\f2bf"}.ion-egg:before{content:"\f277"}.ion-eject:before{content:"\f131"}.ion-email:before{content:"\f132"}.ion-email-unread:before{content:"\f3c3"}.ion-erlenmeyer-flask:before{content:"\f3c5"}.ion-erlenmeyer-flask-bubbles:before{content:"\f3c4"}.ion-eye:before{content:"\f133"}.ion-eye-disabled:before{content:"\f306"}.ion-female:before{content:"\f278"}.ion-filing:before{content:"\f134"}.ion-film-marker:before{content:"\f135"}.ion-fireball:before{content:"\f319"}.ion-flag:before{content:"\f279"}.ion-flame:before{content:"\f31a"}.ion-flash:before{content:"\f137"}.ion-flash-off:before{content:"\f136"}.ion-folder:before{content:"\f139"}.ion-fork:before{content:"\f27a"}.ion-fork-repo:before{content:"\f2c0"}.ion-forward:before{content:"\f13a"}.ion-funnel:before{content:"\f31b"}.ion-gear-a:before{content:"\f13d"}.ion-gear-b:before{content:"\f13e"}.ion-grid:before{content:"\f13f"}.ion-hammer:before{content:"\f27b"}.ion-happy:before{content:"\f31c"}.ion-happy-outline:before{content:"\f3c6"}.ion-headphone:before{content:"\f140"}.ion-heart:before{content:"\f141"}.ion-heart-broken:before{content:"\f31d"}.ion-help:before{content:"\f143"}.ion-help-buoy:before{content:"\f27c"}.ion-help-circled:before{content:"\f142"}.ion-home:before{content:"\f144"}.ion-icecream:before{content:"\f27d"}.ion-image:before{content:"\f147"}.ion-images:before{content:"\f148"}.ion-information:before{content:"\f14a"}.ion-information-circled:before{content:"\f149"}.ion-ionic:before{content:"\f14b"}.ion-ios-alarm:before{content:"\f3c8"}.ion-ios-alarm-outline:before{content:"\f3c7"}.ion-ios-albums:before{content:"\f3ca"}.ion-ios-albums-outline:before{content:"\f3c9"}.ion-ios-americanfootball:before{content:"\f3cc"}.ion-ios-americanfootball-outline:before{content:"\f3cb"}.ion-ios-analytics:before{content:"\f3ce"}.ion-ios-analytics-outline:before{content:"\f3cd"}.ion-ios-arrow-back:before{content:"\f3cf"}.ion-ios-arrow-down:before{content:"\f3d0"}.ion-ios-arrow-forward:before{content:"\f3d1"}.ion-ios-arrow-left:before{content:"\f3d2"}.ion-ios-arrow-right:before{content:"\f3d3"}.ion-ios-arrow-thin-down:before{content:"\f3d4"}.ion-ios-arrow-thin-left:before{content:"\f3d5"}.ion-ios-arrow-thin-right:before{content:"\f3d6"}.ion-ios-arrow-thin-up:before{content:"\f3d7"}.ion-ios-arrow-up:before{content:"\f3d8"}.ion-ios-at:before{content:"\f3da"}.ion-ios-at-outline:before{content:"\f3d9"}.ion-ios-barcode:before{content:"\f3dc"}.ion-ios-barcode-outline:before{content:"\f3db"}.ion-ios-baseball:before{content:"\f3de"}.ion-ios-baseball-outline:before{content:"\f3dd"}.ion-ios-basketball:before{content:"\f3e0"}.ion-ios-basketball-outline:before{content:"\f3df"}.ion-ios-bell:before{content:"\f3e2"}.ion-ios-bell-outline:before{content:"\f3e1"}.ion-ios-body:before{content:"\f3e4"}.ion-ios-body-outline:before{content:"\f3e3"}.ion-ios-bolt:before{content:"\f3e6"}.ion-ios-bolt-outline:before{content:"\f3e5"}.ion-ios-book:before{content:"\f3e8"}.ion-ios-book-outline:before{content:"\f3e7"}.ion-ios-bookmarks:before{content:"\f3ea"}.ion-ios-bookmarks-outline:before{content:"\f3e9"}.ion-ios-box:before{content:"\f3ec"}.ion-ios-box-outline:before{content:"\f3eb"}.ion-ios-briefcase:before{content:"\f3ee"}.ion-ios-briefcase-outline:before{content:"\f3ed"}.ion-ios-browsers:before{content:"\f3f0"}.ion-ios-browsers-outline:before{content:"\f3ef"}.ion-ios-calculator:before{content:"\f3f2"}.ion-ios-calculator-outline:before{content:"\f3f1"}.ion-ios-calendar:before{content:"\f3f4"}.ion-ios-calendar-outline:before{content:"\f3f3"}.ion-ios-camera:before{content:"\f3f6"}.ion-ios-camera-outline:before{content:"\f3f5"}.ion-ios-cart:before{content:"\f3f8"}.ion-ios-cart-outline:before{content:"\f3f7"}.ion-ios-chatboxes:before{content:"\f3fa"}.ion-ios-chatboxes-outline:before{content:"\f3f9"}.ion-ios-chatbubble:before{content:"\f3fc"}.ion-ios-chatbubble-outline:before{content:"\f3fb"}.ion-ios-checkmark:before{content:"\f3ff"}.ion-ios-checkmark-empty:before{content:"\f3fd"}.ion-ios-checkmark-outline:before{content:"\f3fe"}.ion-ios-circle-filled:before{content:"\f400"}.ion-ios-circle-outline:before{content:"\f401"}.ion-ios-clock:before{content:"\f403"}.ion-ios-clock-outline:before{content:"\f402"}.ion-ios-close:before{content:"\f406"}.ion-ios-close-empty:before{content:"\f404"}.ion-ios-close-outline:before{content:"\f405"}.ion-ios-cloud:before{content:"\f40c"}.ion-ios-cloud-download:before{content:"\f408"}.ion-ios-cloud-download-outline:before{content:"\f407"}.ion-ios-cloud-outline:before{content:"\f409"}.ion-ios-cloud-upload:before{content:"\f40b"}.ion-ios-cloud-upload-outline:before{content:"\f40a"}.ion-ios-cloudy:before{content:"\f410"}.ion-ios-cloudy-night:before{content:"\f40e"}.ion-ios-cloudy-night-outline:before{content:"\f40d"}.ion-ios-cloudy-outline:before{content:"\f40f"}.ion-ios-cog:before{content:"\f412"}.ion-ios-cog-outline:before{content:"\f411"}.ion-ios-color-filter:before{content:"\f414"}.ion-ios-color-filter-outline:before{content:"\f413"}.ion-ios-color-wand:before{content:"\f416"}.ion-ios-color-wand-outline:before{content:"\f415"}.ion-ios-compose:before{content:"\f418"}.ion-ios-compose-outline:before{content:"\f417"}.ion-ios-contact:before{content:"\f41a"}.ion-ios-contact-outline:before{content:"\f419"}.ion-ios-copy:before{content:"\f41c"}.ion-ios-copy-outline:before{content:"\f41b"}.ion-ios-crop:before{content:"\f41e"}.ion-ios-crop-strong:before{content:"\f41d"}.ion-ios-download:before{content:"\f420"}.ion-ios-download-outline:before{content:"\f41f"}.ion-ios-drag:before{content:"\f421"}.ion-ios-email:before{content:"\f423"}.ion-ios-email-outline:before{content:"\f422"}.ion-ios-eye:before{content:"\f425"}.ion-ios-eye-outline:before{content:"\f424"}.ion-ios-fastforward:before{content:"\f427"}.ion-ios-fastforward-outline:before{content:"\f426"}.ion-ios-filing:before{content:"\f429"}.ion-ios-filing-outline:before{content:"\f428"}.ion-ios-film:before{content:"\f42b"}.ion-ios-film-outline:before{content:"\f42a"}.ion-ios-flag:before{content:"\f42d"}.ion-ios-flag-outline:before{content:"\f42c"}.ion-ios-flame:before{content:"\f42f"}.ion-ios-flame-outline:before{content:"\f42e"}.ion-ios-flask:before{content:"\f431"}.ion-ios-flask-outline:before{content:"\f430"}.ion-ios-flower:before{content:"\f433"}.ion-ios-flower-outline:before{content:"\f432"}.ion-ios-folder:before{content:"\f435"}.ion-ios-folder-outline:before{content:"\f434"}.ion-ios-football:before{content:"\f437"}.ion-ios-football-outline:before{content:"\f436"}.ion-ios-game-controller-a:before{content:"\f439"}.ion-ios-game-controller-a-outline:before{content:"\f438"}.ion-ios-game-controller-b:before{content:"\f43b"}.ion-ios-game-controller-b-outline:before{content:"\f43a"}.ion-ios-gear:before{content:"\f43d"}.ion-ios-gear-outline:before{content:"\f43c"}.ion-ios-glasses:before{content:"\f43f"}.ion-ios-glasses-outline:before{content:"\f43e"}.ion-ios-grid-view:before{content:"\f441"}.ion-ios-grid-view-outline:before{content:"\f440"}.ion-ios-heart:before{content:"\f443"}.ion-ios-heart-outline:before{content:"\f442"}.ion-ios-help:before{content:"\f446"}.ion-ios-help-empty:before{content:"\f444"}.ion-ios-help-outline:before{content:"\f445"}.ion-ios-home:before{content:"\f448"}.ion-ios-home-outline:before{content:"\f447"}.ion-ios-infinite:before{content:"\f44a"}.ion-ios-infinite-outline:before{content:"\f449"}.ion-ios-information:before{content:"\f44d"}.ion-ios-information-empty:before{content:"\f44b"}.ion-ios-information-outline:before{content:"\f44c"}.ion-ios-ionic-outline:before{content:"\f44e"}.ion-ios-keypad:before{content:"\f450"}.ion-ios-keypad-outline:before{content:"\f44f"}.ion-ios-lightbulb:before{content:"\f452"}.ion-ios-lightbulb-outline:before{content:"\f451"}.ion-ios-list:before{content:"\f454"}.ion-ios-list-outline:before{content:"\f453"}.ion-ios-location:before{content:"\f456"}.ion-ios-location-outline:before{content:"\f455"}.ion-ios-locked:before{content:"\f458"}.ion-ios-locked-outline:before{content:"\f457"}.ion-ios-loop:before{content:"\f45a"}.ion-ios-loop-strong:before{content:"\f459"}.ion-ios-medical:before{content:"\f45c"}.ion-ios-medical-outline:before{content:"\f45b"}.ion-ios-medkit:before{content:"\f45e"}.ion-ios-medkit-outline:before{content:"\f45d"}.ion-ios-mic:before{content:"\f461"}.ion-ios-mic-off:before{content:"\f45f"}.ion-ios-mic-outline:before{content:"\f460"}.ion-ios-minus:before{content:"\f464"}.ion-ios-minus-empty:before{content:"\f462"}.ion-ios-minus-outline:before{content:"\f463"}.ion-ios-monitor:before{content:"\f466"}.ion-ios-monitor-outline:before{content:"\f465"}.ion-ios-moon:before{content:"\f468"}.ion-ios-moon-outline:before{content:"\f467"}.ion-ios-more:before{content:"\f46a"}.ion-ios-more-outline:before{content:"\f469"}.ion-ios-musical-note:before{content:"\f46b"}.ion-ios-musical-notes:before{content:"\f46c"}.ion-ios-navigate:before{content:"\f46e"}.ion-ios-navigate-outline:before{content:"\f46d"}.ion-ios-nutrition:before{content:"\f470"}.ion-ios-nutrition-outline:before{content:"\f46f"}.ion-ios-paper:before{content:"\f472"}.ion-ios-paper-outline:before{content:"\f471"}.ion-ios-paperplane:before{content:"\f474"}.ion-ios-paperplane-outline:before{content:"\f473"}.ion-ios-partlysunny:before{content:"\f476"}.ion-ios-partlysunny-outline:before{content:"\f475"}.ion-ios-pause:before{content:"\f478"}.ion-ios-pause-outline:before{content:"\f477"}.ion-ios-paw:before{content:"\f47a"}.ion-ios-paw-outline:before{content:"\f479"}.ion-ios-people:before{content:"\f47c"}.ion-ios-people-outline:before{content:"\f47b"}.ion-ios-person:before{content:"\f47e"}.ion-ios-person-outline:before{content:"\f47d"}.ion-ios-personadd:before{content:"\f480"}.ion-ios-personadd-outline:before{content:"\f47f"}.ion-ios-photos:before{content:"\f482"}.ion-ios-photos-outline:before{content:"\f481"}.ion-ios-pie:before{content:"\f484"}.ion-ios-pie-outline:before{content:"\f483"}.ion-ios-pint:before{content:"\f486"}.ion-ios-pint-outline:before{content:"\f485"}.ion-ios-play:before{content:"\f488"}.ion-ios-play-outline:before{content:"\f487"}.ion-ios-plus:before{content:"\f48b"}.ion-ios-plus-empty:before{content:"\f489"}.ion-ios-plus-outline:before{content:"\f48a"}.ion-ios-pricetag:before{content:"\f48d"}.ion-ios-pricetag-outline:before{content:"\f48c"}.ion-ios-pricetags:before{content:"\f48f"}.ion-ios-pricetags-outline:before{content:"\f48e"}.ion-ios-printer:before{content:"\f491"}.ion-ios-printer-outline:before{content:"\f490"}.ion-ios-pulse:before{content:"\f493"}.ion-ios-pulse-strong:before{content:"\f492"}.ion-ios-rainy:before{content:"\f495"}.ion-ios-rainy-outline:before{content:"\f494"}.ion-ios-recording:before{content:"\f497"}.ion-ios-recording-outline:before{content:"\f496"}.ion-ios-redo:before{content:"\f499"}.ion-ios-redo-outline:before{content:"\f498"}.ion-ios-refresh:before{content:"\f49c"}.ion-ios-refresh-empty:before{content:"\f49a"}.ion-ios-refresh-outline:before{content:"\f49b"}.ion-ios-reload:before{content:"\f49d"}.ion-ios-reverse-camera:before{content:"\f49f"}.ion-ios-reverse-camera-outline:before{content:"\f49e"}.ion-ios-rewind:before{content:"\f4a1"}.ion-ios-rewind-outline:before{content:"\f4a0"}.ion-ios-rose:before{content:"\f4a3"}.ion-ios-rose-outline:before{content:"\f4a2"}.ion-ios-search:before{content:"\f4a5"}.ion-ios-search-strong:before{content:"\f4a4"}.ion-ios-settings:before{content:"\f4a7"}.ion-ios-settings-strong:before{content:"\f4a6"}.ion-ios-shuffle:before{content:"\f4a9"}.ion-ios-shuffle-strong:before{content:"\f4a8"}.ion-ios-skipbackward:before{content:"\f4ab"}.ion-ios-skipbackward-outline:before{content:"\f4aa"}.ion-ios-skipforward:before{content:"\f4ad"}.ion-ios-skipforward-outline:before{content:"\f4ac"}.ion-ios-snowy:before{content:"\f4ae"}.ion-ios-speedometer:before{content:"\f4b0"}.ion-ios-speedometer-outline:before{content:"\f4af"}.ion-ios-star:before{content:"\f4b3"}.ion-ios-star-half:before{content:"\f4b1"}.ion-ios-star-outline:before{content:"\f4b2"}.ion-ios-stopwatch:before{content:"\f4b5"}.ion-ios-stopwatch-outline:before{content:"\f4b4"}.ion-ios-sunny:before{content:"\f4b7"}.ion-ios-sunny-outline:before{content:"\f4b6"}.ion-ios-telephone:before{content:"\f4b9"}.ion-ios-telephone-outline:before{content:"\f4b8"}.ion-ios-tennisball:before{content:"\f4bb"}.ion-ios-tennisball-outline:before{content:"\f4ba"}.ion-ios-thunderstorm:before{content:"\f4bd"}.ion-ios-thunderstorm-outline:before{content:"\f4bc"}.ion-ios-time:before{content:"\f4bf"}.ion-ios-time-outline:before{content:"\f4be"}.ion-ios-timer:before{content:"\f4c1"}.ion-ios-timer-outline:before{content:"\f4c0"}.ion-ios-toggle:before{content:"\f4c3"}.ion-ios-toggle-outline:before{content:"\f4c2"}.ion-ios-trash:before{content:"\f4c5"}.ion-ios-trash-outline:before{content:"\f4c4"}.ion-ios-undo:before{content:"\f4c7"}.ion-ios-undo-outline:before{content:"\f4c6"}.ion-ios-unlocked:before{content:"\f4c9"}.ion-ios-unlocked-outline:before{content:"\f4c8"}.ion-ios-upload:before{content:"\f4cb"}.ion-ios-upload-outline:before{content:"\f4ca"}.ion-ios-videocam:before{content:"\f4cd"}.ion-ios-videocam-outline:before{content:"\f4cc"}.ion-ios-volume-high:before{content:"\f4ce"}.ion-ios-volume-low:before{content:"\f4cf"}.ion-ios-wineglass:before{content:"\f4d1"}.ion-ios-wineglass-outline:before{content:"\f4d0"}.ion-ios-world:before{content:"\f4d3"}.ion-ios-world-outline:before{content:"\f4d2"}.ion-ipad:before{content:"\f1f9"}.ion-iphone:before{content:"\f1fa"}.ion-ipod:before{content:"\f1fb"}.ion-jet:before{content:"\f295"}.ion-key:before{content:"\f296"}.ion-knife:before{content:"\f297"}.ion-laptop:before{content:"\f1fc"}.ion-leaf:before{content:"\f1fd"}.ion-levels:before{content:"\f298"}.ion-lightbulb:before{content:"\f299"}.ion-link:before{content:"\f1fe"}.ion-load-a:before{content:"\f29a"}.ion-load-b:before{content:"\f29b"}.ion-load-c:before{content:"\f29c"}.ion-load-d:before{content:"\f29d"}.ion-location:before{content:"\f1ff"}.ion-lock-combination:before{content:"\f4d4"}.ion-locked:before{content:"\f200"}.ion-log-in:before{content:"\f29e"}.ion-log-out:before{content:"\f29f"}.ion-loop:before{content:"\f201"}.ion-magnet:before{content:"\f2a0"}.ion-male:before{content:"\f2a1"}.ion-man:before{content:"\f202"}.ion-map:before{content:"\f203"}.ion-medkit:before{content:"\f2a2"}.ion-merge:before{content:"\f33f"}.ion-mic-a:before{content:"\f204"}.ion-mic-b:before{content:"\f205"}.ion-mic-c:before{content:"\f206"}.ion-minus:before{content:"\f209"}.ion-minus-circled:before{content:"\f207"}.ion-minus-round:before{content:"\f208"}.ion-model-s:before{content:"\f2c1"}.ion-monitor:before{content:"\f20a"}.ion-more:before{content:"\f20b"}.ion-mouse:before{content:"\f340"}.ion-music-note:before{content:"\f20c"}.ion-navicon:before{content:"\f20e"}.ion-navicon-round:before{content:"\f20d"}.ion-navigate:before{content:"\f2a3"}.ion-network:before{content:"\f341"}.ion-no-smoking:before{content:"\f2c2"}.ion-nuclear:before{content:"\f2a4"}.ion-outlet:before{content:"\f342"}.ion-paintbrush:before{content:"\f4d5"}.ion-paintbucket:before{content:"\f4d6"}.ion-paper-airplane:before{content:"\f2c3"}.ion-paperclip:before{content:"\f20f"}.ion-pause:before{content:"\f210"}.ion-person:before{content:"\f213"}.ion-person-add:before{content:"\f211"}.ion-person-stalker:before{content:"\f212"}.ion-pie-graph:before{content:"\f2a5"}.ion-pin:before{content:"\f2a6"}.ion-pinpoint:before{content:"\f2a7"}.ion-pizza:before{content:"\f2a8"}.ion-plane:before{content:"\f214"}.ion-planet:before{content:"\f343"}.ion-play:before{content:"\f215"}.ion-playstation:before{content:"\f30a"}.ion-plus:before{content:"\f218"}.ion-plus-circled:before{content:"\f216"}.ion-plus-round:before{content:"\f217"}.ion-podium:before{content:"\f344"}.ion-pound:before{content:"\f219"}.ion-power:before{content:"\f2a9"}.ion-pricetag:before{content:"\f2aa"}.ion-pricetags:before{content:"\f2ab"}.ion-printer:before{content:"\f21a"}.ion-pull-request:before{content:"\f345"}.ion-qr-scanner:before{content:"\f346"}.ion-quote:before{content:"\f347"}.ion-radio-waves:before{content:"\f2ac"}.ion-record:before{content:"\f21b"}.ion-refresh:before{content:"\f21c"}.ion-reply:before{content:"\f21e"}.ion-reply-all:before{content:"\f21d"}.ion-ribbon-a:before{content:"\f348"}.ion-ribbon-b:before{content:"\f349"}.ion-sad:before{content:"\f34a"}.ion-sad-outline:before{content:"\f4d7"}.ion-scissors:before{content:"\f34b"}.ion-search:before{content:"\f21f"}.ion-settings:before{content:"\f2ad"}.ion-share:before{content:"\f220"}.ion-shuffle:before{content:"\f221"}.ion-skip-backward:before{content:"\f222"}.ion-skip-forward:before{content:"\f223"}.ion-social-android:before{content:"\f225"}.ion-social-android-outline:before{content:"\f224"}.ion-social-angular:before{content:"\f4d9"}.ion-social-angular-outline:before{content:"\f4d8"}.ion-social-apple:before{content:"\f227"}.ion-social-apple-outline:before{content:"\f226"}.ion-social-bitcoin:before{content:"\f2af"}.ion-social-bitcoin-outline:before{content:"\f2ae"}.ion-social-buffer:before{content:"\f229"}.ion-social-buffer-outline:before{content:"\f228"}.ion-social-chrome:before{content:"\f4db"}.ion-social-chrome-outline:before{content:"\f4da"}.ion-social-codepen:before{content:"\f4dd"}.ion-social-codepen-outline:before{content:"\f4dc"}.ion-social-css3:before{content:"\f4df"}.ion-social-css3-outline:before{content:"\f4de"}.ion-social-designernews:before{content:"\f22b"}.ion-social-designernews-outline:before{content:"\f22a"}.ion-social-dribbble:before{content:"\f22d"}.ion-social-dribbble-outline:before{content:"\f22c"}.ion-social-dropbox:before{content:"\f22f"}.ion-social-dropbox-outline:before{content:"\f22e"}.ion-social-euro:before{content:"\f4e1"}.ion-social-euro-outline:before{content:"\f4e0"}.ion-social-facebook:before{content:"\f231"}.ion-social-facebook-outline:before{content:"\f230"}.ion-social-foursquare:before{content:"\f34d"}.ion-social-foursquare-outline:before{content:"\f34c"}.ion-social-freebsd-devil:before{content:"\f2c4"}.ion-social-github:before{content:"\f233"}.ion-social-github-outline:before{content:"\f232"}.ion-social-google:before{content:"\f34f"}.ion-social-google-outline:before{content:"\f34e"}.ion-social-googleplus:before{content:"\f235"}.ion-social-googleplus-outline:before{content:"\f234"}.ion-social-hackernews:before{content:"\f237"}.ion-social-hackernews-outline:before{content:"\f236"}.ion-social-html5:before{content:"\f4e3"}.ion-social-html5-outline:before{content:"\f4e2"}.ion-social-instagram:before{content:"\f351"}.ion-social-instagram-outline:before{content:"\f350"}.ion-social-javascript:before{content:"\f4e5"}.ion-social-javascript-outline:before{content:"\f4e4"}.ion-social-linkedin:before{content:"\f239"}.ion-social-linkedin-outline:before{content:"\f238"}.ion-social-markdown:before{content:"\f4e6"}.ion-social-nodejs:before{content:"\f4e7"}.ion-social-octocat:before{content:"\f4e8"}.ion-social-pinterest:before{content:"\f2b1"}.ion-social-pinterest-outline:before{content:"\f2b0"}.ion-social-python:before{content:"\f4e9"}.ion-social-reddit:before{content:"\f23b"}.ion-social-reddit-outline:before{content:"\f23a"}.ion-social-rss:before{content:"\f23d"}.ion-social-rss-outline:before{content:"\f23c"}.ion-social-sass:before{content:"\f4ea"}.ion-social-skype:before{content:"\f23f"}.ion-social-skype-outline:before{content:"\f23e"}.ion-social-snapchat:before{content:"\f4ec"}.ion-social-snapchat-outline:before{content:"\f4eb"}.ion-social-tumblr:before{content:"\f241"}.ion-social-tumblr-outline:before{content:"\f240"}.ion-social-tux:before{content:"\f2c5"}.ion-social-twitch:before{content:"\f4ee"}.ion-social-twitch-outline:before{content:"\f4ed"}.ion-social-twitter:before{content:"\f243"}.ion-social-twitter-outline:before{content:"\f242"}.ion-social-usd:before{content:"\f353"}.ion-social-usd-outline:before{content:"\f352"}.ion-social-vimeo:before{content:"\f245"}.ion-social-vimeo-outline:before{content:"\f244"}.ion-social-whatsapp:before{content:"\f4f0"}.ion-social-whatsapp-outline:before{content:"\f4ef"}.ion-social-windows:before{content:"\f247"}.ion-social-windows-outline:before{content:"\f246"}.ion-social-wordpress:before{content:"\f249"}.ion-social-wordpress-outline:before{content:"\f248"}.ion-social-yahoo:before{content:"\f24b"}.ion-social-yahoo-outline:before{content:"\f24a"}.ion-social-yen:before{content:"\f4f2"}.ion-social-yen-outline:before{content:"\f4f1"}.ion-social-youtube:before{content:"\f24d"}.ion-social-youtube-outline:before{content:"\f24c"}.ion-soup-can:before{content:"\f4f4"}.ion-soup-can-outline:before{content:"\f4f3"}.ion-speakerphone:before{content:"\f2b2"}.ion-speedometer:before{content:"\f2b3"}.ion-spoon:before{content:"\f2b4"}.ion-star:before{content:"\f24e"}.ion-stats-bars:before{content:"\f2b5"}.ion-steam:before{content:"\f30b"}.ion-stop:before{content:"\f24f"}.ion-thermometer:before{content:"\f2b6"}.ion-thumbsdown:before{content:"\f250"}.ion-thumbsup:before{content:"\f251"}.ion-toggle:before{content:"\f355"}.ion-toggle-filled:before{content:"\f354"}.ion-transgender:before{content:"\f4f5"}.ion-trash-a:before{content:"\f252"}.ion-trash-b:before{content:"\f253"}.ion-trophy:before{content:"\f356"}.ion-tshirt:before{content:"\f4f7"}.ion-tshirt-outline:before{content:"\f4f6"}.ion-umbrella:before{content:"\f2b7"}.ion-university:before{content:"\f357"}.ion-unlocked:before{content:"\f254"}.ion-upload:before{content:"\f255"}.ion-usb:before{content:"\f2b8"}.ion-videocamera:before{content:"\f256"}.ion-volume-high:before{content:"\f257"}.ion-volume-low:before{content:"\f258"}.ion-volume-medium:before{content:"\f259"}.ion-volume-mute:before{content:"\f25a"}.ion-wand:before{content:"\f358"}.ion-waterdrop:before{content:"\f25b"}.ion-wifi:before{content:"\f25c"}.ion-wineglass:before{content:"\f2b9"}.ion-woman:before{content:"\f25d"}.ion-wrench:before{content:"\f2ba"}.ion-xbox:before{content:"\f30c"}
diff --git a/docs/lib/ionicons/fonts/ionicons.eot b/docs/lib/ionicons/fonts/ionicons.eot
new file mode 100644
index 0000000..92a3f20
Binary files /dev/null and b/docs/lib/ionicons/fonts/ionicons.eot differ
diff --git a/docs/lib/ionicons/fonts/ionicons.svg b/docs/lib/ionicons/fonts/ionicons.svg
new file mode 100644
index 0000000..49fc8f3
--- /dev/null
+++ b/docs/lib/ionicons/fonts/ionicons.svg
@@ -0,0 +1,2230 @@
+<?xml version="1.0" standalone="no"?>
+<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" >
+<!--
+2014-12-4: Created.
+-->
+<svg xmlns="http://www.w3.org/2000/svg">
+<metadata>
+Created by FontForge 20120731 at Thu Dec  4 09:51:48 2014
+ By Adam Bradley
+Created by Adam Bradley with FontForge 2.0 (http://fontforge.sf.net)
+</metadata>
+<defs>
+<font id="Ionicons" horiz-adv-x="448" >
+  <font-face 
+    font-family="Ionicons"
+    font-weight="500"
+    font-stretch="normal"
+    units-per-em="512"
+    panose-1="2 0 6 3 0 0 0 0 0 0"
+    ascent="448"
+    descent="-64"
+    bbox="-0.54049 -64 512.487 448"
+    underline-thickness="25.6"
+    underline-position="-51.2"
+    unicode-range="U+F100-F4F7"
+  />
+    <missing-glyph />
+    <glyph glyph-name="ion-alert-circled" unicode="&#xf100;" 
+d="M445 26c3 -5 5 -13 2 -18s-8 -8 -14 -8h-418c-6 0 -11 3 -14 8s-1 13 2 18l207 349c3 5 8 9 14 9s11 -4 14 -9zM256 48v48h-64v-48h64zM256 128v144h-64v-144h64z" />
+    <glyph glyph-name="ion-alert" unicode="&#xf101;" horiz-adv-x="128" 
+d="M128 -32h-128v96h128v-96zM112 128h-96l-16 288h128z" />
+    <glyph glyph-name="ion-android-add-circle" unicode="&#xf359;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM315 171v42h-86v86h-42v-86h-86v-42h86v-86h42v86h86z" />
+    <glyph glyph-name="ion-android-add" unicode="&#xf2c7;" horiz-adv-x="320" 
+d="M320 171h-139v-139h-42v139h-139v42h139v139h42v-139h139v-42z" />
+    <glyph glyph-name="ion-android-alarm-clock" unicode="&#xf35a;" horiz-adv-x="428" 
+d="M428 323l-28 -33l-98 82l28 33zM125 373l-97 -83l-28 33l97 83zM225 275v0v-111l85 -50l-16 -27l-101 61v127h32zM214 360c106 0 193 -86 193 -191s-87 -191 -193 -191c-107 0 -193 86 -193 191s86 191 193 191zM214 20c82 0 150 66 150 149c0 82 -68 149 -150 149
+s-150 -67 -150 -149s68 -149 150 -149z" />
+    <glyph glyph-name="ion-android-alert" unicode="&#xf35b;" horiz-adv-x="416" 
+d="M208 400c114 0 208 -94 208 -208s-94 -208 -208 -208s-208 94 -208 208s94 208 208 208zM232 88v40h-48v-40h48zM232 176v128h-48v-128h48z" />
+    <glyph glyph-name="ion-android-apps" unicode="&#xf35c;" horiz-adv-x="320" 
+d="M0 272v80h80v-80h-80zM120 32v80h80v-80h-80zM0 32v80h80v-80h-80zM0 152v80h80v-80h-80zM120 152v80h80v-80h-80zM240 352h80v-80h-80v80zM120 272v80h80v-80h-80zM240 152v80h80v-80h-80zM240 32v80h80v-80h-80z" />
+    <glyph glyph-name="ion-android-archive" unicode="&#xf2c9;" horiz-adv-x="416" 
+d="M406 348c7 -7 10 -17 10 -29v-289c0 -25 -21 -46 -46 -46h-324c-25 0 -46 21 -46 46v289c0 12 3 22 10 29l33 39c6 8 16 13 26 13h278c10 0 20 -5 26 -13zM208 65l127 127h-81v46h-92v-46h-81zM49 354h317l-22 23h-277z" />
+    <glyph glyph-name="ion-android-arrow-back" unicode="&#xf2ca;" horiz-adv-x="342" 
+d="M342 213v-42h-260l119 -120l-30 -30l-171 171l171 171l31 -30l-120 -120h260z" />
+    <glyph glyph-name="ion-android-arrow-down" unicode="&#xf35d;" horiz-adv-x="342" 
+d="M192 363v-260l120 120l30 -31l-171 -171l-171 171l30 30l120 -119v260h42z" />
+    <glyph glyph-name="ion-android-arrow-dropdown-circle" unicode="&#xf35e;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM208 128l96 96h-192z" />
+    <glyph glyph-name="ion-android-arrow-dropdown" unicode="&#xf35f;" horiz-adv-x="256" 
+d="M0 256h256l-128 -128z" />
+    <glyph glyph-name="ion-android-arrow-dropleft-circle" unicode="&#xf360;" horiz-adv-x="416" 
+d="M416 192c0 -115 -93 -208 -208 -208s-208 93 -208 208s93 208 208 208s208 -93 208 -208zM144 192l96 -96v192z" />
+    <glyph glyph-name="ion-android-arrow-dropleft" unicode="&#xf361;" horiz-adv-x="128" 
+d="M128 320v-256l-128 128z" />
+    <glyph glyph-name="ion-android-arrow-dropright-circle" unicode="&#xf362;" horiz-adv-x="416" 
+d="M208 -16c-115 0 -208 93 -208 208s93 208 208 208s208 -93 208 -208s-93 -208 -208 -208zM176 96l96 96l-96 96v-192z" />
+    <glyph glyph-name="ion-android-arrow-dropright" unicode="&#xf363;" horiz-adv-x="128" 
+d="M0 320l128 -128l-128 -128v256z" />
+    <glyph glyph-name="ion-android-arrow-dropup-circle" unicode="&#xf364;" horiz-adv-x="416" 
+d="M416 192c0 -115 -93 -208 -208 -208s-208 93 -208 208s93 208 208 208s208 -93 208 -208zM304 160l-96 96l-96 -96h192z" />
+    <glyph glyph-name="ion-android-arrow-dropup" unicode="&#xf365;" horiz-adv-x="256" 
+d="M0 128l128 128l128 -128h-256z" />
+    <glyph glyph-name="ion-android-arrow-forward" unicode="&#xf30f;" horiz-adv-x="342" 
+d="M0 171v42h260l-119 120l30 30l171 -171l-171 -171l-31 30l120 120h-260z" />
+    <glyph glyph-name="ion-android-arrow-up" unicode="&#xf366;" horiz-adv-x="342" 
+d="M192 21h-42v260l-120 -119l-30 30l171 171l171 -171l-30 -31l-120 120v-260z" />
+    <glyph glyph-name="ion-android-attach" unicode="&#xf367;" horiz-adv-x="235" 
+d="M203 320h32v-235c0 -65 -53 -117 -118 -117s-117 52 -117 117v246c0 47 38 85 85 85s86 -38 86 -85v-246c0 -30 -24 -53 -54 -53s-53 23 -53 53v203h32v-203c0 -12 9 -21 21 -21s22 9 22 21v246c0 30 -24 53 -54 53s-53 -23 -53 -53v-246c0 -47 38 -85 85 -85
+s86 38 86 85v235z" />
+    <glyph glyph-name="ion-android-bar" unicode="&#xf368;" horiz-adv-x="384" 
+d="M171 171l-171 170v43h384v-43l-171 -170v-131h107v-40h-256v40h107v131zM96 299h192l43 42h-278z" />
+    <glyph glyph-name="ion-android-bicycle" unicode="&#xf369;" 
+d="M299 317c-19 0 -34 14 -34 33s15 34 34 34s33 -15 33 -34s-14 -33 -33 -33zM355 187c51 0 93 -43 93 -94s-42 -93 -93 -93s-94 42 -94 93s43 94 94 94zM355 28c36 0 65 29 65 65s-29 66 -65 66s-66 -30 -66 -66s30 -65 66 -65zM274 224l-30 45l-43 -45l39 -32v-112h-32
+v86l-61 38c-9 6 -19 15 -19 27c0 8 3 17 9 23l72 69c6 6 14 9 22 9c11 0 22 -7 28 -16l34 -60h59v-32h-78zM93 187c51 0 94 -43 94 -94s-43 -93 -94 -93s-93 42 -93 93s42 94 93 94zM93 28c36 0 66 29 66 65s-30 66 -66 66s-65 -30 -65 -66s29 -65 65 -65z" />
+    <glyph glyph-name="ion-android-boat" unicode="&#xf36a;" 
+d="M52 35l-51 139c-2 6 -1 12 1 17s8 8 13 10l38 13v98c0 23 20 43 43 43h64l16 53h96l16 -53h64c23 0 43 -20 43 -43v-98l38 -13c5 -2 11 -5 13 -10s3 -12 1 -17l-51 -139h-1c-34 0 -65 20 -86 43c-21 -23 -51 -43 -85 -43s-64 19 -85 42c-21 -23 -52 -42 -86 -42h-1z
+M96 312v-84l128 41l128 -41v84h-256zM309 40c0 0 59 -64 107 -64h-21c-30 0 -59 12 -86 26c-53 -28 -117 -28 -170 0c-27 -14 -56 -26 -86 -26h-21c49 0 107 64 107 64c52 -36 118 -36 170 0z" />
+    <glyph glyph-name="ion-android-bookmark" unicode="&#xf36b;" horiz-adv-x="288" 
+d="M248 384c22 0 40 -18 40 -40v-344l-144 64l-144 -64v344c0 22 18 40 40 40h208z" />
+    <glyph glyph-name="ion-android-bulb" unicode="&#xf36c;" 
+d="M224 278c-25 0 -50 -10 -68 -28s-28 -43 -28 -68c0 -34 18 -66 48 -83l16 -10v-18v-71h64v71v18l16 10c15 8 27 20 35 34c9 15 13 31 13 49c0 25 -10 50 -28 68s-43 28 -68 28zM245 416v0v-64h-42v64h42zM374 362v0l30 -30l-38 -38l-30 30zM74 362v0l38 -38l-30 -30
+l-38 38zM224 310v0c70 0 128 -58 128 -128c0 -48 -26 -89 -64 -111v-103h-128v103c-38 22 -64 64 -64 111c0 70 58 128 128 128zM448 203v0v-42h-64v42h64zM64 203v0v-42h-64v42h64z" />
+    <glyph glyph-name="ion-android-bus" unicode="&#xf36d;" horiz-adv-x="352" 
+d="M0 96v204c0 75 82 84 176 84s176 -9 176 -84v-204c0 -18 -14 -24 -27 -36v-39c0 -12 -9 -21 -21 -21h-21c-12 0 -22 9 -22 21v22h-170v-22c0 -12 -10 -21 -22 -21h-21c-12 0 -21 9 -21 21v39c-13 12 -27 17 -27 36zM80 80c18 0 32 14 32 32s-14 32 -32 32
+s-32 -14 -32 -32s14 -32 32 -32zM272 80c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32zM304 203v106h-256v-106h256z" />
+    <glyph glyph-name="ion-android-calendar" unicode="&#xf2d1;" horiz-adv-x="384" 
+d="M304 176v-96h-96v96h96zM272 384h48v-32h24c22 0 40 -18 40 -40v-272c0 -22 -18 -40 -40 -40h-304c-22 0 -40 18 -40 40v272c0 22 18 40 40 40h24v32h48v-32h160v32zM344 40v212h-304v-212h304z" />
+    <glyph glyph-name="ion-android-call" unicode="&#xf2d2;" horiz-adv-x="384" 
+d="M363 117c12 0 21 -9 21 -21v-75c0 -12 -9 -21 -21 -21c-201 0 -363 162 -363 363c0 12 9 21 21 21h75c12 0 21 -9 21 -21c0 -27 4 -52 13 -77c2 -7 0 -16 -5 -21l-47 -47c31 -61 80 -110 141 -141l47 47c5 6 14 7 21 5c23 -7 49 -12 76 -12z" />
+    <glyph glyph-name="ion-android-camera" unicode="&#xf2d3;" 
+d="M161 168c0 42 21 63 63 63s63 -21 63 -63s-21 -63 -63 -63s-63 21 -63 63zM408 352c11 0 20 -4 28 -12s12 -17 12 -28v-272c0 -11 -4 -20 -12 -28s-17 -12 -28 -12h-368c-11 0 -20 4 -28 12s-12 17 -12 28v272c0 11 4 20 12 28s17 12 28 12h88l32 32h128l32 -32h88z
+M224 56c31 0 57 11 79 33s33 48 33 79s-11 57 -33 79s-48 33 -79 33s-57 -11 -79 -33s-33 -48 -33 -79s11 -57 33 -79s48 -33 79 -33z" />
+    <glyph glyph-name="ion-android-cancel" unicode="&#xf36e;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM312 117l-75 75l75 75l-29 29l-75 -75l-75 75l-29 -29l75 -75l-75 -75l29 -29l75 75l75 -75z" />
+    <glyph glyph-name="ion-android-car" unicode="&#xf36f;" horiz-adv-x="384" 
+d="M339 331l45 -118v-160c0 -12 -9 -21 -21 -21h-22c-12 0 -21 9 -21 21v11h-256v-11c0 -12 -9 -21 -21 -21h-22c-12 0 -21 9 -21 21v160l45 118c4 13 16 21 30 21h234c14 0 26 -8 30 -21zM75 128c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32zM309 128
+c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32zM43 235h298l-32 85h-234z" />
+    <glyph glyph-name="ion-android-cart" unicode="&#xf370;" horiz-adv-x="416" 
+d="M122 70c23 0 41 -18 41 -41s-18 -42 -41 -42s-42 19 -42 42s19 41 42 41zM0 397h68l19 -42h308c11 0 21 -9 21 -20c0 -4 -1 -8 -2 -10l-75 -129c-7 -14 -20 -22 -36 -22h-155l-21 -32s-2 -5 -2 -6c0 -3 2 -5 5 -5h238v-40h-243c-26 0 -45 14 -45 42c0 7 2 15 5 20l31 51
+l-74 151h-42v42zM326 70c23 0 42 -18 42 -41s-19 -42 -42 -42s-41 19 -41 42s18 41 41 41z" />
+    <glyph glyph-name="ion-android-chat" unicode="&#xf2d4;" horiz-adv-x="416" 
+d="M344 384c4 0 7 -4 7 -8v-214c0 -4 -3 -9 -7 -9h-187l-90 -89v89h-57c-4 0 -10 5 -10 9v214c0 4 6 8 10 8h334zM408 321c4 0 8 -5 8 -9v-214c0 -4 -4 -9 -8 -9h-57v-89l-90 89h-130l39 39h181c18 0 25 10 25 26v167h32z" />
+    <glyph glyph-name="ion-android-checkbox-blank" unicode="&#xf371;" horiz-adv-x="384" 
+d="M341 384c23 0 43 -20 43 -43v-298c0 -23 -20 -43 -43 -43h-298c-23 0 -43 20 -43 43v298c0 23 20 43 43 43h298z" />
+    <glyph glyph-name="ion-android-checkbox-outline-blank" unicode="&#xf372;" horiz-adv-x="384" 
+d="M341 341h-298v-298h298v298zM341 384v0c23 0 43 -20 43 -43v-298c0 -23 -20 -43 -43 -43h-298c-23 0 -43 20 -43 43v298c0 23 20 43 43 43h298z" />
+    <glyph glyph-name="ion-android-checkbox-outline" unicode="&#xf373;" horiz-adv-x="384" 
+d="M105 233l66 -66l183 183l30 -30l-213 -213l-96 96zM341 43v170h43v-170c0 -23 -20 -43 -43 -43h-298c-23 0 -43 20 -43 43v298c0 23 20 43 43 43h213v-43h-213v-298h298z" />
+    <glyph glyph-name="ion-android-checkbox" unicode="&#xf374;" horiz-adv-x="384" 
+d="M341 384c23 0 43 -20 43 -43v-298c0 -23 -20 -43 -43 -43h-298c-23 0 -43 20 -43 43v298c0 23 20 43 43 43h298zM149 85l192 192l-30 30l-162 -162l-76 77l-30 -30z" />
+    <glyph glyph-name="ion-android-checkmark-circle" unicode="&#xf375;" horiz-adv-x="416" 
+d="M123 232l64 -64l179 178l29 -29l-208 -208l-93 93zM374 192h42c0 -114 -94 -208 -208 -208s-208 94 -208 208s94 208 208 208c28 0 54 -6 78 -16l-32 -32c-15 4 -30 6 -46 6c-92 0 -166 -74 -166 -166s74 -166 166 -166s166 74 166 166z" />
+    <glyph glyph-name="ion-android-clipboard" unicode="&#xf376;" horiz-adv-x="384" 
+d="M341 368c23 0 43 -20 43 -43v-314c0 -23 -20 -43 -43 -43h-298c-23 0 -43 20 -43 43v314c0 23 20 43 43 43h87c7 28 32 48 62 48s55 -20 62 -48h87zM192 368c-12 0 -21 -9 -21 -21s9 -22 21 -22s21 10 21 22s-9 21 -21 21zM344 8v320h-40v-72h-224v72h-40v-320h304z" />
+    <glyph glyph-name="ion-android-close" unicode="&#xf2d7;" horiz-adv-x="298" 
+d="M298 311l-119 -119l119 -119l-30 -30l-119 119l-119 -119l-30 30l119 119l-119 119l30 30l119 -119l119 119z" />
+    <glyph glyph-name="ion-android-cloud-circle" unicode="&#xf377;" horiz-adv-x="416" 
+d="M208 400c114 0 208 -94 208 -208s-94 -208 -208 -208s-208 94 -208 208s94 208 208 208zM302 109c29 0 52 23 52 52s-23 52 -52 52h-11c0 46 -37 83 -83 83c-38 0 -71 -26 -80 -62h-3c-34 0 -63 -29 -63 -63s29 -62 63 -62h177z" />
+    <glyph glyph-name="ion-android-cloud-done" unicode="&#xf378;" horiz-adv-x="480" 
+d="M387 231c52 -3 93 -46 93 -99c0 -55 -45 -100 -100 -100h-260c-66 0 -120 54 -120 120c0 62 47 113 107 119c25 48 75 81 133 81c73 0 133 -52 147 -121zM197 85l141 141l-30 30l-111 -111l-44 45l-30 -30z" />
+    <glyph glyph-name="ion-android-cloud-outline" unicode="&#xf379;" horiz-adv-x="480" 
+d="M387 231c52 -3 93 -46 93 -99c0 -55 -45 -100 -100 -100h-260c-66 0 -120 54 -120 120c0 62 47 113 107 119c25 48 75 81 133 81c73 0 133 -52 147 -121zM380 72c33 0 60 27 60 60s-27 60 -60 60h-30v10c0 61 -49 110 -110 110c-51 0 -93 -34 -106 -80h-14
+c-44 0 -80 -36 -80 -80s36 -80 80 -80h260z" />
+    <glyph glyph-name="ion-android-cloud" unicode="&#xf37a;" horiz-adv-x="480" 
+d="M387 231c52 -3 93 -46 93 -99c0 -55 -45 -100 -100 -100h-260c-66 0 -120 54 -120 120c0 62 47 113 107 119c25 48 75 81 133 81c73 0 133 -52 147 -121z" />
+    <glyph glyph-name="ion-android-color-palette" unicode="&#xf37b;" horiz-adv-x="384" 
+d="M192 384c106 0 192 -77 192 -171c0 -59 -48 -106 -107 -106h-38c-18 0 -32 -14 -32 -32c0 -9 3 -17 8 -22s9 -12 9 -21c0 -18 -14 -32 -32 -32c-106 0 -192 86 -192 192s86 192 192 192zM75 192c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32zM139 277
+c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32zM245 277c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32zM309 192c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32z" />
+    <glyph glyph-name="ion-android-compass" unicode="&#xf37c;" 
+d="M224 217c13 0 25 -12 25 -25s-12 -25 -25 -25s-25 12 -25 25s12 25 25 25zM224 416c123 0 224 -101 224 -224s-101 -224 -224 -224s-224 101 -224 224s101 224 224 224zM273 143l85 183l-183 -85l-85 -183z" />
+    <glyph glyph-name="ion-android-contact" unicode="&#xf2d8;" horiz-adv-x="384" 
+d="M267 110c59 -18 104 -58 117 -110h-384c13 52 58 92 117 110c22 -13 48 -20 75 -20s53 7 75 20zM192 384c73 0 132 -59 132 -132s-59 -132 -132 -132s-132 59 -132 132s59 132 132 132zM192 153c42 0 78 26 92 63h-184c14 -37 50 -63 92 -63z" />
+    <glyph glyph-name="ion-android-contacts" unicode="&#xf2d9;" 
+d="M207 104c47 -14 76 -62 87 -104h-294c11 42 40 90 87 104c18 -10 38 -16 60 -16s42 6 60 16zM147 328c58 0 106 -48 106 -106s-48 -106 -106 -106s-106 48 -106 106s48 106 106 106zM147 141c34 0 62 23 74 51h-148c12 -28 40 -51 74 -51zM291 64c-13 20 -34 43 -60 53
+c11 9 21 23 28 35c13 -5 27 -8 42 -8c22 0 42 6 60 16c47 -14 76 -54 87 -96h-157zM275 248c-8 37 -31 69 -63 87c19 29 52 49 89 49c58 0 106 -48 106 -106s-48 -106 -106 -106c-11 0 -22 2 -32 5c3 8 6 16 7 25c8 -3 16 -4 25 -4c34 0 62 22 74 50h-100z" />
+    <glyph glyph-name="ion-android-contract" unicode="&#xf37d;" horiz-adv-x="384" 
+d="M0 77v51h128v-128h-51v77h-77zM77 307v77h51v-128h-128v51h77zM256 0v128h128v-51h-77v-77h-51zM307 307h77v-51h-128v128h51v-77z" />
+    <glyph glyph-name="ion-android-create" unicode="&#xf37e;" horiz-adv-x="384" 
+d="M0 80l236 236l80 -80l-236 -236h-80v80zM378 298l-40 -40l-80 80l40 40c9 9 20 9 29 0l51 -51c9 -9 9 -20 0 -29z" />
+    <glyph glyph-name="ion-android-delete" unicode="&#xf37f;" horiz-adv-x="320" 
+d="M32 43v245h256v-245c0 -23 -20 -43 -43 -43h-170c-23 0 -43 20 -43 43zM320 352v-32h-320v32h80l27 32h106l27 -32h80z" />
+    <glyph glyph-name="ion-android-desktop" unicode="&#xf380;" 
+d="M405 416c23 0 43 -20 43 -43v-282c0 -23 -20 -43 -43 -43h-138l42 -48v-32h-170v32l42 48h-138c-23 0 -43 20 -43 43v282c0 23 20 43 43 43h362zM405 128v245h-362v-245h362z" />
+    <glyph glyph-name="ion-android-document" unicode="&#xf381;" horiz-adv-x="320" 
+d="M192 400l128 -128v-248c0 -22 -18 -40 -40 -40h-240c-22 0 -40 18 -40 40v336c0 22 18 40 40 40h152zM176 256h112l-112 112v-112z" />
+    <glyph glyph-name="ion-android-done-all" unicode="&#xf382;" horiz-adv-x="512" 
+d="M388 308l-140 -139l-31 31l140 139zM481 339l31 -31l-264 -263l-122 123l30 31l92 -91zM0 168l32 31l122 -123l-31 -31z" />
+    <glyph glyph-name="ion-android-done" unicode="&#xf383;" horiz-adv-x="384" 
+d="M122 108l230 230l32 -31l-262 -261l-122 122l32 31z" />
+    <glyph glyph-name="ion-android-download" unicode="&#xf2dd;" horiz-adv-x="480" 
+d="M387 231c52 -3 93 -46 93 -99c0 -55 -45 -100 -100 -100h-260c-66 0 -120 54 -120 120c0 62 47 113 107 119c25 48 75 81 133 81c73 0 133 -52 147 -121zM208 180h-68l100 -100l100 100h-68v76h-64v-76z" />
+    <glyph glyph-name="ion-android-drafts" unicode="&#xf384;" 
+d="M448 246v-203c0 -23 -20 -43 -43 -43h-362c-23 0 -43 20 -43 43v203c0 15 8 30 20 37l204 101l204 -101c13 -7 20 -22 20 -37zM224 144l171 112l-171 85l-171 -85z" />
+    <glyph glyph-name="ion-android-exit" unicode="&#xf385;" horiz-adv-x="384" 
+d="M151 115l55 56h-206v42h207l-56 56l30 30l107 -107l-107 -107zM341 384c23 0 43 -20 43 -43v-298c0 -23 -20 -43 -43 -43h-298c-23 0 -43 20 -43 43v85h43v-85h298v298h-298v-85h-43v85c0 23 20 43 43 43h298z" />
+    <glyph glyph-name="ion-android-expand" unicode="&#xf386;" horiz-adv-x="384" 
+d="M333 51v77h51v-128h-128v51h77zM333 333h-77v51h128v-128h-51v77zM51 333v-77h-51v128h128v-51h-77zM51 51h77v-51h-128v128h51v-77z" />
+    <glyph glyph-name="ion-android-favorite-outline" unicode="&#xf387;" horiz-adv-x="416" 
+d="M302 384c64 0 114 -50 114 -115c0 -80 -71 -144 -178 -242l-30 -27l-30 27c-107 98 -178 162 -178 242c0 65 50 115 114 115c36 0 71 -17 94 -44c23 27 58 44 94 44zM221 55c50 46 94 86 123 122c28 35 40 63 40 92c0 23 -9 44 -24 59s-35 24 -58 24
+c-26 0 -53 -13 -70 -33l-24 -29l-24 29c-17 20 -44 33 -70 33c-23 0 -43 -9 -58 -24s-24 -36 -24 -59c0 -29 12 -57 40 -92c29 -36 73 -76 123 -122l4 -4l9 -8l9 8z" />
+    <glyph glyph-name="ion-android-favorite" unicode="&#xf388;" horiz-adv-x="416" 
+d="M208 0l-30 27c-107 98 -178 162 -178 242c0 65 50 115 114 115c36 0 71 -17 94 -44c23 27 58 44 94 44c64 0 114 -50 114 -115c0 -80 -71 -144 -178 -242z" />
+    <glyph glyph-name="ion-android-film" unicode="&#xf389;" horiz-adv-x="320" 
+d="M280 384h40v-384h-40v43h-40v-43h-160v43h-40v-43h-40v384h40v-43h40v43h160v-43h40v43zM80 85v43h-40v-43h40zM80 171v42h-40v-42h40zM80 256v43h-40v-43h40zM280 85v43h-40v-43h40zM280 171v42h-40v-42h40zM280 256v43h-40v-43h40z" />
+    <glyph glyph-name="ion-android-folder-open" unicode="&#xf38a;" 
+d="M405 304c23 0 43 -20 43 -43v-186c0 -23 -20 -43 -43 -43h-362c-23 0 -43 20 -43 43v234c0 23 20 43 43 43h138l43 -48h181zM416 75v186c0 6 -5 11 -11 11h-373v-197c0 -6 5 -11 11 -11h362c6 0 11 5 11 11z" />
+    <glyph glyph-name="ion-android-folder" unicode="&#xf2e0;" 
+d="M181 352l43 -48h181c23 0 43 -20 43 -43v-186c0 -23 -20 -43 -43 -43h-362c-23 0 -43 20 -43 43v234c0 23 20 43 43 43h138z" />
+    <glyph glyph-name="ion-android-funnel" unicode="&#xf38b;" 
+d="M176 48v48h96v-48h-96zM0 336h448v-48h-448v48zM80 167v50h288v-50h-288z" />
+    <glyph glyph-name="ion-android-globe" unicode="&#xf38c;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM186 15c6 15 21 29 8 39c-8 7 -16 14 -23 21c-2 2 -11 20 -9 23c5 9 6 14 8 24c3 12 -3 16 -13 22c-15 10 -29 23 -43 34c-7 5 -17 10 -20 19s-5 20 -10 28c-14 20 -12 34 -10 58
+c0 7 -1 16 -2 25c-28 -32 -42 -73 -42 -116c0 -48 18 -92 52 -126c29 -29 65 -46 104 -51zM334 66c23 23 39 51 47 82c-8 -1 -19 2 -19 2s-21 24 -23 45c-2 22 0 39 -3 57c-3 16 -20 31 -27 46c-7 14 -13 28 -20 42c2 -1 5 -2 7 -3c5 1 10 2 14 2c-23 16 -49 25 -76 29v-8
+l4 -9l-14 -13l-9 3l-10 10l-10 12l-14 5c-16 -2 -31 -7 -45 -13v-7c7 3 16 5 23 8c3 1 13 -7 16 -9c-4 -5 -21 -15 -22 -21c0 -2 7 -6 7 -10c0 -6 -1 -11 -1 -17c3 3 20 21 22 21c13 3 35 -19 37 -26s-22 -24 -33 -34c-8 -8 -25 -12 -20 -24c2 -4 10 -20 5 -24
+c-6 -5 -14 9 -17 12c-8 10 -26 7 -38 7c0 -17 -1 -31 15 -43c15 -11 30 -25 47 -33c13 -6 36 7 47 -1c16 -11 29 -21 47 -29c8 -3 33 -20 26 -31c-5 -8 -10 -15 -14 -23s-13 -20 -20 -25c-8 -6 -16 -17 -21 -29c35 7 66 23 92 49z" />
+    <glyph glyph-name="ion-android-hand" unicode="&#xf2e3;" horiz-adv-x="414" 
+d="M401 174c15 -15 18 -36 3 -51c0 0 -96 -103 -126 -121v0c-28 -21 -65 -34 -100 -34c-55 0 -101 36 -117 85v0v1c0 1 -1 2 -1 3l-58 189c-5 15 2 32 17 37s30 -3 35 -18l34 -88c1 -4 2 -2 2 1l-22 161c-3 15 7 30 22 33s30 -8 33 -23l25 -138c0 -2 2 -2 2 0v177
+c0 15 13 28 28 28s28 -13 28 -28l8 -175c0 -5 3 -4 4 -1l23 135c2 15 16 27 31 25s27 -17 25 -32l-21 -172c-1 -12 -3 -30 2 -36c8 -9 20 -9 31 2l42 42c15 15 35 13 50 -2z" />
+    <glyph glyph-name="ion-android-hangout" unicode="&#xf38d;" horiz-adv-x="352" 
+d="M176 400c97 0 176 -77 176 -172c0 -91 -76 -196 -176 -244v71c-97 0 -176 78 -176 173s79 172 176 172zM166 217v61h-62v-61h31l-21 -40h31zM248 217v61h-62v-61h31l-20 -40h31z" />
+    <glyph glyph-name="ion-android-happy" unicode="&#xf38e;" horiz-adv-x="416" 
+d="M208 400c114 0 208 -94 208 -208s-93 -208 -208 -208s-208 94 -208 208s93 208 208 208zM208 26c92 0 166 74 166 166s-74 166 -166 166s-166 -74 -166 -166s74 -166 166 -166zM281 213c-18 0 -31 13 -31 31s13 31 31 31s31 -13 31 -31s-13 -31 -31 -31zM135 213
+c-18 0 -31 13 -31 31s13 31 31 31s31 -13 31 -31s-13 -31 -31 -31zM208 78c-49 0 -89 29 -106 72h212c-17 -43 -57 -72 -106 -72z" />
+    <glyph glyph-name="ion-android-home" unicode="&#xf38f;" horiz-adv-x="416" 
+d="M160 0h-98v192h-62l208 192l208 -192h-62v-192h-98v128h-96v-128z" />
+    <glyph glyph-name="ion-android-image" unicode="&#xf2e4;" horiz-adv-x="384" 
+d="M384 43c0 -23 -20 -43 -43 -43h-298c-23 0 -43 20 -43 43v298c0 23 20 43 43 43h298c23 0 43 -20 43 -43v-298zM117 160l-74 -96h298l-96 128l-74 -96z" />
+    <glyph glyph-name="ion-android-laptop" unicode="&#xf390;" horiz-adv-x="512" 
+d="M437 32h75c0 -23 -64 -32 -96 -32h-320c-32 0 -96 9 -96 32h75c-23 0 -43 20 -43 43v266c0 23 20 43 43 43h362c23 0 43 -20 43 -43v-266c0 -23 -20 -43 -43 -43zM75 341v-272h362v272h-362zM256 13c12 0 21 10 21 22s-9 21 -21 21s-21 -9 -21 -21s9 -22 21 -22z" />
+    <glyph glyph-name="ion-android-list" unicode="&#xf391;" horiz-adv-x="384" 
+d="M344 384c22 0 40 -18 40 -40v-304c0 -22 -18 -40 -40 -40h-304c-22 0 -40 18 -40 40v304c0 22 18 40 40 40h304zM240 80v48h-160v-48h160zM304 168v48h-224v-48h224zM304 256v48h-224v-48h224z" />
+    <glyph glyph-name="ion-android-locate" unicode="&#xf2e9;" 
+d="M224 272c44 0 80 -36 80 -80s-36 -80 -80 -80s-80 36 -80 80s36 80 80 80zM415 213h33v-42h-33c-10 -89 -81 -160 -170 -170v-33h-42v33c-89 10 -160 81 -170 170h-33v42h33c10 89 81 160 170 170v33h42v-33c89 -10 160 -81 170 -170zM224 43c82 0 149 67 149 149
+s-67 149 -149 149s-149 -67 -149 -149s67 -149 149 -149z" />
+    <glyph glyph-name="ion-android-lock" unicode="&#xf392;" horiz-adv-x="320" 
+d="M280 262c22 0 40 -18 40 -40v-200c0 -22 -18 -40 -40 -40h-240c-22 0 -40 18 -40 40v200c0 22 18 40 40 40h20v40c0 55 45 100 100 100s100 -45 100 -100v-40h20zM160 80c22 0 40 18 40 40s-18 40 -40 40s-40 -18 -40 -40s18 -40 40 -40zM222 262v40c0 34 -28 62 -62 62
+s-62 -28 -62 -62v-40h124z" />
+    <glyph glyph-name="ion-android-mail" unicode="&#xf2eb;" 
+d="M405 368c23 0 43 -20 43 -43v-266c0 -23 -20 -43 -43 -43h-362c-23 0 -43 20 -43 43v266c0 23 20 43 43 43h362zM400 277v43l-176 -117l-176 117v-43l176 -117z" />
+    <glyph glyph-name="ion-android-map" unicode="&#xf393;" horiz-adv-x="384" 
+d="M373 384c6 0 11 -5 11 -11v-322c0 -5 -3 -9 -7 -10l-121 -41l-128 45s-105 -41 -108 -42s-7 -3 -9 -3c-6 0 -11 5 -11 11v322c0 5 3 9 7 10l121 41l128 -45s103 40 108 42s7 3 9 3zM256 43v254l-128 44v-254z" />
+    <glyph glyph-name="ion-android-menu" unicode="&#xf394;" horiz-adv-x="384" 
+d="M0 64v43h384v-43h-384zM0 171v42h384v-42h-384zM0 320h384v-43h-384v43z" />
+    <glyph glyph-name="ion-android-microphone-off" unicode="&#xf395;" horiz-adv-x="408" 
+d="M316 93l58 -58l-58 58l58 -58l34 -33l-24 -24l-95 95c-19 -11 -40 -20 -62 -23v-82h-46v82c-75 10 -137 76 -137 153h39c0 -68 58 -117 121 -117c20 0 40 5 57 14l-32 33c-8 -3 -16 -5 -25 -5c-38 0 -69 31 -69 69v29l-135 134l24 24l111 -110v0l140 -140l5 -5l9 -9z
+M273 197c0 -4 0 -8 -1 -12l-137 137v25c0 38 31 69 69 69s69 -31 69 -69v-150zM365 203c0 -31 -10 -60 -27 -84l-27 28c9 17 15 36 15 56h39zM408 2v0l-34 33z" />
+    <glyph glyph-name="ion-android-microphone" unicode="&#xf2ec;" horiz-adv-x="320" 
+d="M160 128c-38 0 -69 31 -69 69v150c0 38 31 69 69 69s69 -31 69 -69v-150c0 -38 -31 -69 -69 -69zM281 203h39c0 -78 -62 -142 -137 -153v-82h-46v82c-75 10 -137 75 -137 153h39c0 -69 58 -116 121 -116s121 47 121 116z" />
+    <glyph glyph-name="ion-android-more-horizontal" unicode="&#xf396;" horiz-adv-x="320" 
+d="M40 232c22 0 40 -18 40 -40s-18 -40 -40 -40s-40 18 -40 40s18 40 40 40zM280 232c22 0 40 -18 40 -40s-18 -40 -40 -40s-40 18 -40 40s18 40 40 40zM160 232c22 0 40 -18 40 -40s-18 -40 -40 -40s-40 18 -40 40s18 40 40 40z" />
+    <glyph glyph-name="ion-android-more-vertical" unicode="&#xf397;" horiz-adv-x="80" 
+d="M80 312c0 -22 -18 -40 -40 -40s-40 18 -40 40s18 40 40 40s40 -18 40 -40zM80 72c0 -22 -18 -40 -40 -40s-40 18 -40 40s18 40 40 40s40 -18 40 -40zM80 192c0 -22 -18 -40 -40 -40s-40 18 -40 40s18 40 40 40s40 -18 40 -40z" />
+    <glyph glyph-name="ion-android-navigate" unicode="&#xf398;" horiz-adv-x="320" 
+d="M160 384l160 -369l-15 -15l-145 64l-145 -64l-15 15z" />
+    <glyph glyph-name="ion-android-notifications-none" unicode="&#xf399;" horiz-adv-x="352" 
+d="M177 328h-2c-6 0 -24 -5 -24 -5c-46 -10 -78 -53 -78 -100v-114v-13l-9 -10l-8 -8h240l-8 8l-9 10v13v114c0 47 -32 90 -78 100c0 0 -17 5 -24 5zM176 400v0c18 0 31 -13 31 -31v-15c59 -14 104 -68 104 -131v-114l41 -42v-21h-352v21l41 42v114c0 63 45 117 104 131v15
+c0 18 13 31 31 31zM217 26v0c0 -23 -18 -42 -41 -42s-41 19 -41 42h82z" />
+    <glyph glyph-name="ion-android-notifications-off" unicode="&#xf39a;" horiz-adv-x="364" 
+d="M182 -16c-23 0 -41 19 -41 42h82c0 -23 -18 -42 -41 -42zM57 341l295 -295v0l12 -12l-24 -24l-36 36h-298v21l41 41v115c0 23 6 44 16 63l-63 64l24 24l33 -33v0zM317 223v-94l-208 207c13 8 27 15 42 18v15c0 18 13 31 31 31s31 -13 31 -31v-15c59 -14 104 -67 104 -131
+z" />
+    <glyph glyph-name="ion-android-notifications" unicode="&#xf39b;" horiz-adv-x="352" 
+d="M176 -16c-23 0 -41 19 -41 42h82c0 -23 -18 -42 -41 -42zM311 109l41 -42v-21h-352v21l41 42v114c0 63 45 117 104 131v15c0 18 13 31 31 31s31 -13 31 -31v-15c59 -14 104 -68 104 -131v-114z" />
+    <glyph glyph-name="ion-android-open" unicode="&#xf39c;" horiz-adv-x="384" 
+d="M341 43v133h43v-133c0 -23 -20 -43 -43 -43h-298c-23 0 -43 20 -43 43v298c0 23 20 43 43 43h133v-43h-133v-298h298zM224 384h160v-160h-43v87l-215 -215l-30 30l215 215h-87v43z" />
+    <glyph glyph-name="ion-android-options" unicode="&#xf39d;" 
+d="M0 32v32h272v-32h-272zM368 32v32h80v-32h-80zM352 0c0 -18 -14 -32 -32 -32v0c-18 0 -32 14 -32 32v96c0 18 14 32 32 32v0c18 0 32 -14 32 -32v-96zM0 176v32h80v-32h-80zM176 176v32h272v-32h-272zM160 144c0 -18 -14 -32 -32 -32v0c-18 0 -32 14 -32 32v96
+c0 18 14 32 32 32v0c18 0 32 -14 32 -32v-96zM0 320v32h272v-32h-272zM368 320v32h80v-32h-80zM352 288c0 -18 -14 -32 -32 -32v0c-18 0 -32 14 -32 32v96c0 18 14 32 32 32v0c18 0 32 -14 32 -32v-96z" />
+    <glyph glyph-name="ion-android-people" unicode="&#xf39e;" 
+d="M305 216c-34 0 -61 27 -61 60s27 60 61 60s62 -27 62 -60s-28 -60 -62 -60zM143 216c-34 0 -62 27 -62 60s28 60 62 60s61 -27 61 -60s-27 -60 -61 -60zM143 172c48 0 145 -23 145 -70v-54h-288v54c0 47 95 70 143 70zM305 161c48 0 143 -12 143 -59v-54h-128v54
+c0 30 -9 41 -32 58c7 1 11 1 17 1z" />
+    <glyph glyph-name="ion-android-person-add" unicode="&#xf39f;" horiz-adv-x="480" 
+d="M288 192c-53 0 -96 43 -96 96s43 96 96 96s96 -43 96 -96s-43 -96 -96 -96zM288 144c64 0 192 -32 192 -96v-48h-384v48c0 64 128 96 192 96zM96 224h64v-32h-64v-64h-32v64h-64v32h64v64h32v-64z" />
+    <glyph glyph-name="ion-android-person" unicode="&#xf3a0;" horiz-adv-x="384" 
+d="M192 192c-53 0 -96 43 -96 96s43 96 96 96s96 -43 96 -96s-43 -96 -96 -96zM192 144c64 0 192 -32 192 -96v-48h-384v48c0 64 128 96 192 96z" />
+    <glyph glyph-name="ion-android-phone-landscape" unicode="&#xf3a1;" 
+d="M448 89c0 -23 -19 -41 -41 -41h-366c-22 0 -41 18 -41 41v206c0 23 19 41 41 41h366c22 0 41 -18 41 -41v-206zM80 84h288v216h-288v-216z" />
+    <glyph glyph-name="ion-android-phone-portrait" unicode="&#xf3a2;" horiz-adv-x="288" 
+d="M247 416c23 0 41 -19 41 -41v-366c0 -22 -18 -41 -41 -41h-206c-23 0 -41 19 -41 41v366c0 22 18 41 41 41h206zM252 48v288h-216v-288h216z" />
+    <glyph glyph-name="ion-android-pin" unicode="&#xf3a3;" horiz-adv-x="320" 
+d="M160 416c88 0 160 -71 160 -157c0 -118 -160 -291 -160 -291s-160 173 -160 291c0 86 72 157 160 157zM160 203c32 0 57 25 57 56s-25 56 -57 56s-57 -25 -57 -56s25 -56 57 -56z" />
+    <glyph glyph-name="ion-android-plane" unicode="&#xf3a4;" horiz-adv-x="384" 
+d="M384 112l-160 48v-114l48 -31v-31l-80 16l-80 -16v31l48 31v114l-160 -48v40l160 104v113c0 18 15 31 32 31s32 -13 32 -31v-113l160 -104v-40z" />
+    <glyph glyph-name="ion-android-playstore" unicode="&#xf2f0;" horiz-adv-x="416" 
+d="M416 296c-19 -214 -13 -312 -13 -312h-390s6 96 -13 312h104c0 57 47 104 104 104s104 -47 104 -104h104zM208 374c-43 0 -78 -35 -78 -78h156c0 43 -35 78 -78 78zM156 50l143 85l-143 84v-169z" />
+    <glyph glyph-name="ion-android-print" unicode="&#xf3a5;" horiz-adv-x="416" 
+d="M352 288c35 0 64 -29 64 -64v-139h-80v-85h-256v85h-80v139c0 35 29 64 64 64h288zM304 32v128h-192v-128h192zM336 384v0v-80h-256v80h256z" />
+    <glyph glyph-name="ion-android-radio-button-off" unicode="&#xf3a6;" horiz-adv-x="416" 
+d="M208 400c114 0 208 -94 208 -208s-94 -208 -208 -208s-208 94 -208 208s94 208 208 208zM208 26c92 0 166 74 166 166s-74 166 -166 166s-166 -74 -166 -166s74 -166 166 -166z" />
+    <glyph glyph-name="ion-android-radio-button-on" unicode="&#xf3a7;" horiz-adv-x="416" 
+d="M208 296c57 0 104 -47 104 -104s-47 -104 -104 -104s-104 47 -104 104s47 104 104 104zM208 400c114 0 208 -94 208 -208s-94 -208 -208 -208s-208 94 -208 208s94 208 208 208zM208 26c92 0 166 74 166 166s-74 166 -166 166s-166 -74 -166 -166s74 -166 166 -166z" />
+    <glyph glyph-name="ion-android-refresh" unicode="&#xf3a8;" horiz-adv-x="352" 
+d="M176 60c56 0 104 34 123 84h46c-21 -74 -88 -128 -169 -128c-98 0 -176 79 -176 176s79 176 176 176c48 0 92 -20 124 -52l52 52v-154h-154l70 70c-23 24 -56 40 -92 40c-73 0 -132 -59 -132 -132s59 -132 132 -132z" />
+    <glyph glyph-name="ion-android-remove-circle" unicode="&#xf3a9;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM315 171v42h-214v-42h214z" />
+    <glyph glyph-name="ion-android-remove" unicode="&#xf2f4;" horiz-adv-x="320" 
+d="M0 171v42h320v-42h-320z" />
+    <glyph glyph-name="ion-android-restaurant" unicode="&#xf3aa;" horiz-adv-x="415" 
+d="M116 168l-91 89c-34 33 -34 86 0 119l153 -148zM264 206l-33 -31l150 -145l-30 -30l-150 146l-150 -146l-30 30s163 159 211 207c-15 32 -4 77 31 111c41 40 101 49 132 17c33 -31 24 -89 -17 -129c-34 -34 -80 -45 -114 -30z" />
+    <glyph glyph-name="ion-android-sad" unicode="&#xf3ab;" horiz-adv-x="416" 
+d="M208 160c45 0 83 -26 102 -64h-204c19 38 57 64 102 64zM208 400c114 0 208 -94 208 -208s-93 -208 -208 -208s-208 94 -208 208s93 208 208 208zM208 26c92 0 166 74 166 166s-74 166 -166 166s-166 -74 -166 -166s74 -166 166 -166zM281 213c-18 0 -31 13 -31 31
+s13 31 31 31s31 -13 31 -31s-13 -31 -31 -31zM135 213c-18 0 -31 13 -31 31s13 31 31 31s31 -13 31 -31s-13 -31 -31 -31z" />
+    <glyph glyph-name="ion-android-search" unicode="&#xf2f5;" horiz-adv-x="384" 
+d="M274 143l110 -110l-33 -33l-109 110v17l-7 6c-25 -21 -58 -34 -93 -34c-79 0 -142 63 -142 142s63 143 141 143c79 0 142 -64 142 -143c0 -36 -13 -68 -34 -93l7 -5h18zM142 143c55 0 99 43 99 98s-44 99 -99 99s-98 -44 -98 -99s43 -98 98 -98z" />
+    <glyph glyph-name="ion-android-send" unicode="&#xf2f6;" horiz-adv-x="416" 
+d="M0 0v149l298 43l-298 43v149l416 -192z" />
+    <glyph glyph-name="ion-android-settings" unicode="&#xf2f7;" horiz-adv-x="416" 
+d="M366 171l47 -34c3 -3 4 -10 2 -14l-43 -71c-2 -4 -7 -7 -12 -5l-54 21c-12 -8 -23 -16 -36 -21l-8 -55c-1 -4 -6 -8 -11 -8h-85c-5 0 -10 3 -11 8l-8 55c-13 5 -25 13 -36 21l-54 -21c-4 -2 -10 1 -12 5l-43 71c-3 5 -2 11 2 14l45 34c0 7 -1 14 -1 21s1 14 1 21l-46 34
+c-3 3 -4 10 -2 14l43 71c2 4 7 7 12 5l54 -21c12 8 23 16 36 21l8 55c1 4 6 8 11 8h85c5 0 10 -4 11 -8l7 -55c13 -5 25 -13 36 -21l53 21c4 2 11 -1 13 -5l43 -71c3 -5 2 -11 -2 -14l-45 -34c0 -7 1 -14 1 -21s0 -15 -1 -21zM207 119c41 0 75 32 75 73s-34 73 -75 73
+s-74 -32 -74 -73s33 -73 74 -73z" />
+    <glyph glyph-name="ion-android-share-alt" unicode="&#xf3ac;" horiz-adv-x="384" 
+d="M320 104c34 0 62 -28 62 -62s-28 -62 -62 -62s-62 28 -62 62c0 5 1 10 2 14l-152 88c-12 -11 -27 -17 -44 -17c-35 0 -64 29 -64 64s28 64 63 64c17 0 32 -6 44 -17l151 87c-1 5 -2 10 -2 15c0 35 29 64 64 64s64 -29 64 -64s-29 -64 -64 -64c-17 0 -32 6 -44 17
+l-151 -87c1 -5 2 -10 2 -15s-1 -10 -2 -15l153 -88c11 11 26 16 42 16z" />
+    <glyph glyph-name="ion-android-share" unicode="&#xf2f8;" horiz-adv-x="384" 
+d="M384 200l-160 -147v88c-107 0 -171 -34 -224 -109c21 107 75 214 224 235v85z" />
+    <glyph glyph-name="ion-android-star-half" unicode="&#xf3ad;" horiz-adv-x="404" 
+d="M404 238l-110 -96l33 -142l-125 75l-125 -75l33 142l-110 96l145 12l57 134l57 -134zM219 103l60 -36l-16 68l-5 19l15 12l53 46l-70 6l-19 2l-8 18l-27 64v-189z" />
+    <glyph glyph-name="ion-android-star-outline" unicode="&#xf3ae;" horiz-adv-x="404" 
+d="M404 238l-110 -96l33 -142l-125 75l-125 -75l33 142l-110 96l145 12l57 134l57 -134zM219 103l60 -36l-16 68l-5 19l15 12l53 46l-70 6l-19 2l-8 18l-27 64l-27 -64l-8 -18l-19 -2l-70 -6l53 -46l15 -12l-5 -19l-16 -68l60 36l17 10z" />
+    <glyph glyph-name="ion-android-star" unicode="&#xf2fc;" horiz-adv-x="404" 
+d="M202 75l-125 -75l33 142l-110 96l145 12l57 134l57 -134l145 -12l-110 -96l33 -142z" />
+    <glyph glyph-name="ion-android-stopwatch" unicode="&#xf2fd;" horiz-adv-x="384" 
+d="M168 141v131h48v-131h-48zM344 278c25 -33 40 -74 40 -118c0 -106 -86 -192 -192 -192s-192 86 -192 192s86 192 192 192c44 0 85 -15 118 -40l31 30l33 -33zM298 54c28 28 44 66 44 106s-16 78 -44 106s-66 44 -106 44s-78 -16 -106 -44s-44 -66 -44 -106
+s16 -78 44 -106s66 -44 106 -44s78 16 106 44zM128 368v48h128v-48h-128z" />
+    <glyph glyph-name="ion-android-subway" unicode="&#xf3af;" horiz-adv-x="352" 
+d="M176 400c94 0 176 -10 176 -85v-214c0 -42 -33 -74 -75 -74l27 -27v-16h-256v16l27 27c-42 0 -75 32 -75 74v214c0 75 82 85 176 85zM80 64c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32zM160 208v96h-112v-96h112zM272 64c18 0 32 14 32 32
+s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32zM304 208v96h-112v-96h112z" />
+    <glyph glyph-name="ion-android-sunny" unicode="&#xf3b0;" 
+d="M224 288c-25 0 -50 -10 -68 -28s-28 -43 -28 -68s10 -50 28 -68s43 -28 68 -28s50 10 68 28s28 43 28 68s-10 50 -28 68s-43 28 -68 28zM245 416v0v-64h-42v64h42zM374 372v0l30 -30l-38 -38l-30 30zM74 372v0l38 -38l-30 -30l-38 38zM224 320v0c70 0 128 -58 128 -128
+s-58 -128 -128 -128s-128 58 -128 128s58 128 128 128zM448 213v0v-42h-64v42h64zM64 213v0v-42h-64v42h64zM366 80v0l38 -38l-30 -30l-38 38zM82 80v0l30 -30l-38 -38l-30 30zM245 32v0v-64h-42v64h42z" />
+    <glyph glyph-name="ion-android-sync" unicode="&#xf3b1;" horiz-adv-x="320" 
+d="M160 355c88 0 160 -73 160 -163c0 -32 -9 -62 -25 -87l-29 30c9 17 14 37 14 57c0 67 -54 122 -120 122v-61l-80 82l80 81v-61zM160 70v61l80 -82l-80 -81v61c-88 0 -160 73 -160 163c0 32 9 63 25 87l29 -30c-9 -17 -14 -37 -14 -57c0 -67 54 -122 120 -122z" />
+    <glyph glyph-name="ion-android-textsms" unicode="&#xf3b2;" horiz-adv-x="384" 
+d="M344 384c22 0 40 -18 40 -40v-240c0 -22 -18 -40 -40 -40h-280l-64 -64v344c0 22 10 40 32 40h312zM134 206v40h-38v-40h38zM211 206v40h-38v-40h38zM288 206v40h-38v-40h38z" />
+    <glyph glyph-name="ion-android-time" unicode="&#xf3b3;" horiz-adv-x="426" 
+d="M213 405c117 0 213 -96 213 -213s-95 -213 -213 -213s-213 96 -213 213s95 213 213 213zM213 22c94 0 170 76 170 170s-76 170 -170 170s-170 -76 -170 -170s76 -170 170 -170zM224 298v-111l96 -57l-16 -26l-112 67v127h32z" />
+    <glyph glyph-name="ion-android-train" unicode="&#xf3b4;" horiz-adv-x="352" 
+d="M0 101v214c0 75 82 85 176 85s176 -10 176 -85v-214c0 -42 -33 -74 -75 -74l27 -27v-16h-256v16l27 27c-42 0 -75 32 -75 74zM176 72c22 0 40 18 40 40s-18 40 -40 40s-40 -18 -40 -40s18 -40 40 -40zM304 224v96h-256v-96h256z" />
+    <glyph glyph-name="ion-android-unlock" unicode="&#xf3b5;" horiz-adv-x="320" 
+d="M280 262c22 0 40 -18 40 -40v-200c0 -22 -18 -40 -40 -40h-240c-22 0 -40 18 -40 40v200c0 22 18 40 40 40h182v40v0c0 34 -28 62 -62 62s-62 -28 -62 -62h-38c0 55 45 100 100 100s100 -45 100 -100v-40h20zM160 80c22 0 40 18 40 40s-18 40 -40 40s-40 -18 -40 -40
+s18 -40 40 -40z" />
+    <glyph glyph-name="ion-android-upload" unicode="&#xf3b6;" horiz-adv-x="480" 
+d="M387 231c52 -3 93 -46 93 -99c0 -55 -45 -100 -100 -100h-260c-66 0 -120 54 -120 120c0 62 47 113 107 119c25 48 75 81 133 81c73 0 133 -52 147 -121zM272 172h68l-100 100l-100 -100h68v-76h64v76z" />
+    <glyph glyph-name="ion-android-volume-down" unicode="&#xf3b7;" horiz-adv-x="288" 
+d="M0 256h85l107 112v-352l-107 112h-85v128zM288 192c0 -38 -21 -73 -53 -88v177c32 -16 53 -51 53 -89z" />
+    <glyph glyph-name="ion-android-volume-mute" unicode="&#xf3b8;" horiz-adv-x="192" 
+d="M0 256h85l107 112v-352l-107 112h-85v128z" />
+    <glyph glyph-name="ion-android-volume-off" unicode="&#xf3b9;" horiz-adv-x="384" 
+d="M342 192c0 69 -45 128 -107 147v45c85 -20 149 -99 149 -192c0 -35 -8 -68 -24 -96l-32 32c9 19 14 41 14 64zM192 368v-104l-51 51zM357 51v0l24 -24l-24 -24l-40 40c-23 -21 -51 -36 -82 -43v45c19 6 37 15 52 28l-95 95v-152l-107 112h-85v128h85l9 10l-91 91l24 24z
+M288 192c0 -7 0 -15 -2 -22l-51 51v60c32 -16 53 -51 53 -89z" />
+    <glyph glyph-name="ion-android-volume-up" unicode="&#xf3ba;" horiz-adv-x="384" 
+d="M0 256h85l107 112v-352l-107 112h-85v128zM288 192c0 -38 -21 -73 -53 -88v177c32 -16 53 -51 53 -89zM235 384c85 -20 149 -99 149 -192s-64 -172 -149 -192v45c62 19 106 78 106 147s-44 128 -106 147v45z" />
+    <glyph glyph-name="ion-android-walk" unicode="&#xf3bb;" horiz-adv-x="272" 
+d="M168 336c-22 0 -40 18 -40 40s18 40 40 40s40 -18 40 -40s-18 -40 -40 -40zM168 216l-20 38l-20 -62l57 -96v-128h-38v96l-50 68l-57 -164h-40l81 320l-41 -16v-80h-40v112l111 38c4 1 10 1 13 1c13 0 23 -6 31 -18l45 -69h72v-40h-104z" />
+    <glyph glyph-name="ion-android-warning" unicode="&#xf3bc;" 
+d="M0 -16l224 416l224 -416h-448zM248 48v48h-48v-48h48zM248 128v96h-48v-96h48z" />
+    <glyph glyph-name="ion-android-watch" unicode="&#xf3bd;" horiz-adv-x="320" 
+d="M320 192c0 -51 -24 -96 -61 -125l-19 -115h-160l-19 115c-37 29 -61 74 -61 125s24 96 61 125l19 115h160l19 -115c37 -29 61 -74 61 -125zM40 192c0 -66 54 -120 120 -120s120 54 120 120s-54 120 -120 120s-120 -54 -120 -120z" />
+    <glyph glyph-name="ion-android-wifi" unicode="&#xf305;" horiz-adv-x="416" 
+d="M208 219c23 0 42 -18 42 -41s-19 -41 -42 -41s-42 18 -42 41s19 41 42 41zM333 178c0 -45 -26 -85 -63 -107l-20 36c25 14 41 40 41 71c0 45 -37 82 -83 82s-83 -37 -83 -82c0 -31 16 -57 41 -71l-20 -36c-37 22 -63 62 -63 107c0 68 56 124 125 124s125 -56 125 -124z
+M208 384c114 0 208 -93 208 -206c0 -76 -42 -142 -104 -178l-21 36c50 28 83 81 83 142c0 91 -74 165 -166 165s-166 -74 -166 -165c0 -61 33 -113 83 -142l-21 -36c-62 36 -104 102 -104 178c0 113 94 206 208 206z" />
+    <glyph glyph-name="ion-aperture" unicode="&#xf313;" 
+d="M224 416c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224s100 224 224 224zM360 56c36 36 56 85 56 136s-20 100 -56 136s-85 56 -136 56s-100 -20 -136 -56s-56 -85 -56 -136s20 -100 56 -136s85 -56 136 -56s100 20 136 56zM168 342l56 -86h-147
+c17 40 50 71 91 86zM381 160h-102l72 129c21 -27 33 -60 33 -97c0 -11 -1 -22 -3 -32zM328 314l-49 -90l-78 126c8 1 15 2 23 2c40 0 76 -14 104 -38zM67 224h102l-72 -129c-21 27 -33 60 -33 97c0 11 1 22 3 32zM280 42l-56 86h147c-17 -40 -50 -71 -91 -86zM120 70l49 90
+l78 -126c-8 -1 -15 -2 -23 -2c-40 0 -76 14 -104 38z" />
+    <glyph glyph-name="ion-archive" unicode="&#xf102;" 
+d="M224 140l-128 116h80v96h96v-96h80zM433 151c11 -6 17 -19 15 -32l-9 -67c-2 -13 -9 -20 -28 -20h-374c-18 0 -26 7 -28 20l-9 67c-2 13 3 26 14 32l72 55h42l-62 -62h50c2 0 5 -1 6 -3l18 -45h168l18 45c1 2 3 3 5 3h51l-62 62h42z" />
+    <glyph glyph-name="ion-arrow-down-a" unicode="&#xf103;" horiz-adv-x="384" 
+d="M192 -0l-192 192h112v192h160v-192h112z" />
+    <glyph glyph-name="ion-arrow-down-b" unicode="&#xf104;" horiz-adv-x="320" 
+d="M3 263c-2 2 -3 6 -3 9c0 9 8 16 17 16v0h286v0c9 0 17 -7 17 -16c0 -3 -1 -6 -3 -8l-2 -3l-136 -156c-5 -5 -11 -9 -19 -9s-14 4 -19 9l-136 156z" />
+    <glyph glyph-name="ion-arrow-down-c" unicode="&#xf105;" horiz-adv-x="274" 
+d="M265 125l-105 -100c-6 -6 -14 -9 -23 -9s-16 3 -22 9l-106 100c-12 12 -12 31 0 43s34 12 46 0l50 -48v217c0 17 14 31 32 31s32 -14 32 -31v-217l50 48c12 12 34 12 46 0s12 -31 0 -43z" />
+    <glyph glyph-name="ion-arrow-expand" unicode="&#xf25e;" horiz-adv-x="320" 
+d="M178 238l64 64l-50 50h128v-128l-50 50l-64 -64zM178 146l28 28l64 -64l50 50v-128h-128l50 50zM142 146l-64 -64l50 -50h-128v128l50 -50l64 64zM142 238l-28 -28l-64 64l-50 -50v128h128l-50 -50z" />
+    <glyph glyph-name="ion-arrow-graph-down-left" unicode="&#xf25f;" 
+d="M0 64v160l61 -61l131 141l107 -112l149 128l-149 -203l-107 107l-94 -98l62 -62h-160z" />
+    <glyph glyph-name="ion-arrow-graph-down-right" unicode="&#xf260;" 
+d="M288 64l62 62l-94 98l-107 -107l-149 203l149 -128l107 112l131 -141l61 61v-160h-160z" />
+    <glyph glyph-name="ion-arrow-graph-up-left" unicode="&#xf261;" 
+d="M160 320l-62 -62l94 -98l107 107l149 -203l-149 128l-107 -112l-131 141l-61 -61v160h160z" />
+    <glyph glyph-name="ion-arrow-graph-up-right" unicode="&#xf262;" 
+d="M288 320h160v-160l-61 61l-131 -141l-107 112l-149 -128l149 203l107 -107l94 98z" />
+    <glyph glyph-name="ion-arrow-left-a" unicode="&#xf106;" horiz-adv-x="384" 
+d="M0 192l192 192v-112h192v-160h-192v-112z" />
+    <glyph glyph-name="ion-arrow-left-b" unicode="&#xf107;" horiz-adv-x="192" 
+d="M167 349c2 2 6 3 9 3c9 0 16 -8 16 -17v0v-286v0c0 -9 -7 -17 -16 -17c-3 0 -7 1 -9 3l-2 2l-156 136c-5 5 -9 11 -9 19s4 14 9 19l156 136z" />
+    <glyph glyph-name="ion-arrow-left-c" unicode="&#xf108;" horiz-adv-x="352" 
+d="M109 320c12 12 32 12 44 0s12 -34 0 -46l-49 -50h217c17 0 31 -14 31 -32s-14 -32 -31 -32h-217l48 -50c12 -12 12 -34 0 -46s-31 -12 -43 0l-100 106c-6 6 -9 13 -9 22s3 17 9 23z" />
+    <glyph glyph-name="ion-arrow-move" unicode="&#xf263;" 
+d="M448 192l-96 -96v76h-109l1 -108h76l-96 -96l-96 96h76v108h-108v-76l-96 96l96 96v-76h108v108h-76l96 96l96 -96h-76v-108h108v76z" />
+    <glyph glyph-name="ion-arrow-resize" unicode="&#xf264;" horiz-adv-x="320" 
+d="M192 352h128v-128l-50 50l-9 -9l-183 -183l50 -50h-128v128l50 -50l128 128v0l64 64z" />
+    <glyph glyph-name="ion-arrow-return-left" unicode="&#xf265;" horiz-adv-x="384" 
+d="M128 352v-64h248c4 0 8 -4 8 -8v-240c0 -4 -4 -8 -8 -8h-304c-4 0 -8 4 -8 8v48c0 4 4 8 8 8h248v128h-192v-64l-128 96z" />
+    <glyph glyph-name="ion-arrow-return-right" unicode="&#xf266;" horiz-adv-x="384" 
+d="M384 256l-128 -96v64h-192v-128h248c4 0 8 -4 8 -8v-48c0 -4 -4 -8 -8 -8h-304c-4 0 -8 4 -8 8v240c0 4 4 8 8 8h248v64z" />
+    <glyph glyph-name="ion-arrow-right-a" unicode="&#xf109;" horiz-adv-x="384" 
+d="M384 192l-192 -192v112h-192v160h192v112z" />
+    <glyph glyph-name="ion-arrow-right-b" unicode="&#xf10a;" horiz-adv-x="192" 
+d="M25 35c-2 -2 -6 -3 -9 -3c-9 0 -16 8 -16 17v0v286v0c0 9 7 17 16 17c3 0 6 -1 8 -3l3 -2l156 -136c5 -5 9 -11 9 -19s-4 -14 -9 -19l-156 -136z" />
+    <glyph glyph-name="ion-arrow-right-c" unicode="&#xf10b;" horiz-adv-x="352" 
+d="M243 320l100 -105c6 -6 9 -14 9 -23s-3 -16 -9 -22l-100 -106c-12 -12 -31 -12 -43 0s-12 34 0 46l48 50h-217c-17 0 -31 14 -31 32s14 32 31 32h217l-49 50c-12 12 -12 34 0 46s32 12 44 0z" />
+    <glyph glyph-name="ion-arrow-shrink" unicode="&#xf267;" horiz-adv-x="384" 
+d="M384 356l-82 -82l50 -50h-128v128l50 -50l82 82zM384 28l-28 -28l-82 82l-50 -50v128h128l-50 -50zM0 28l82 82l-50 50h128v-128l-50 50l-82 -82zM0 356l28 28l82 -82l50 50v-128h-128l50 50z" />
+    <glyph glyph-name="ion-arrow-swap" unicode="&#xf268;" horiz-adv-x="384" 
+d="M0 120c0 4 4 8 8 8h248v64l128 -96l-128 -96v64h-248c-4 0 -8 4 -8 8v48zM384 264c0 -4 -4 -8 -8 -8h-248v-64l-128 96l128 96v-64h248c4 0 8 -4 8 -8v-48z" />
+    <glyph glyph-name="ion-arrow-up-a" unicode="&#xf10c;" horiz-adv-x="384" 
+d="M192 384l192 -192h-112v-192h-160v192h-112z" />
+    <glyph glyph-name="ion-arrow-up-b" unicode="&#xf10d;" horiz-adv-x="320" 
+d="M317 121c2 -2 3 -6 3 -9c0 -9 -8 -16 -17 -16v0h-286v0c-9 0 -17 7 -17 16c0 3 1 6 3 8l2 3l136 156c5 5 11 9 19 9s14 -4 19 -9l136 -156z" />
+    <glyph glyph-name="ion-arrow-up-c" unicode="&#xf10e;" horiz-adv-x="274" 
+d="M9 259l105 100c6 6 14 9 23 9s16 -3 22 -9l106 -100c12 -12 12 -31 0 -43s-34 -12 -46 0l-50 48v-217c0 -17 -14 -31 -32 -31s-32 14 -32 31v217l-50 -49c-12 -12 -34 -12 -46 0s-12 32 0 44z" />
+    <glyph glyph-name="ion-asterisk" unicode="&#xf314;" 
+d="M448 224v-64l-186 10l104 -170l-56 -32l-86 176l-86 -176l-56 32l104 170l-186 -10v64l187 -7l-109 167l60 32l86 -176l86 176l60 -32l-109 -167z" />
+    <glyph glyph-name="ion-at" unicode="&#xf10f;" 
+d="M422 41c-24 -25 -52 -43 -85 -55s-69 -18 -105 -18c-35 0 -66 6 -95 17s-53 26 -73 46s-36 43 -47 71s-17 58 -17 90s6 62 18 89s29 51 50 71s46 35 74 47c28 11 58 17 90 17c28 0 55 -4 81 -12s49 -20 69 -36s36 -36 48 -60s18 -53 18 -85c0 -24 -3 -46 -10 -64
+s-16 -34 -27 -46s-24 -22 -38 -28s-29 -10 -45 -10s-29 4 -39 12s-15 17 -15 29h-3c-6 -10 -15 -19 -28 -28s-28 -13 -46 -13c-28 0 -49 9 -64 27s-23 42 -23 71c0 17 3 34 9 50s14 31 24 44s23 23 38 31s31 12 49 12c15 0 27 -4 38 -10c10 -6 18 -15 21 -24h1l5 24h54
+l-24 -113c-1 -6 -2 -12 -3 -19s-2 -13 -2 -19c0 -7 1 -13 4 -18s7 -7 15 -7c16 0 29 9 39 26s16 40 16 68c0 24 -4 45 -12 64s-20 34 -34 47s-32 23 -52 29s-41 9 -65 9c-26 0 -49 -4 -70 -13s-39 -22 -54 -38s-27 -34 -35 -56c-8 -21 -13 -44 -13 -69c0 -26 4 -51 13 -72
+s21 -39 37 -54s35 -27 57 -35s46 -12 72 -12c33 0 61 6 85 16s45 25 65 43zM231 260c-10 0 -18 -2 -25 -8s-14 -13 -19 -22s-8 -18 -11 -28s-4 -20 -4 -30c0 -5 0 -10 1 -16c1 -5 3 -10 6 -15s7 -8 12 -11s11 -5 19 -5c11 0 20 3 28 8s14 13 19 21s9 16 11 26s3 19 3 27
+c0 6 0 13 -1 19s-4 12 -7 17s-7 9 -12 12s-12 5 -20 5z" />
+    <glyph glyph-name="ion-backspace-outline" unicode="&#xf3be;" horiz-adv-x="512" 
+d="M413 116c2 -2 3 -4 3 -6s-1 -4 -3 -6l-21 -22c-2 -2 -4 -2 -6 -2s-4 0 -6 2l-76 77l-76 -77c-2 -2 -4 -2 -6 -2s-4 0 -6 2l-21 22c-2 2 -3 4 -3 6s1 4 3 6l76 76l-77 76c-3 3 -3 9 0 12l22 22c2 2 4 2 6 2s4 0 6 -2l76 -76l76 76c2 2 4 2 6 2s4 0 6 -2l22 -22
+c3 -3 3 -9 0 -12l-77 -76zM499 354c9 -9 13 -20 13 -33v-256c0 -27 -20 -49 -46 -49h-298c-13 0 -24 3 -34 9c-9 5 -16 11 -23 20v0l-1 1l-110 146l110 148c14 19 34 28 58 28h298c13 0 24 -5 33 -14zM480 65v256c0 9 -5 15 -14 15h-298c-11 0 -22 -3 -32 -16l-96 -128
+l96 -128c8 -10 17 -16 32 -16h298c9 0 14 8 14 17z" />
+    <glyph glyph-name="ion-backspace" unicode="&#xf3bf;" horiz-adv-x="512" 
+d="M499 354c9 -9 13 -20 13 -33v-256c0 -27 -20 -49 -46 -49h-298c-13 0 -24 3 -34 9c-9 5 -16 11 -23 20v0l-1 1l-110 146l110 148c14 19 34 28 58 28h298c13 0 24 -5 33 -14zM413 116l-76 76l77 76c3 3 3 9 0 12l-22 22c-2 2 -4 2 -6 2s-4 0 -6 -2l-76 -76l-76 76
+c-2 2 -4 2 -6 2s-4 0 -6 -2l-22 -22c-3 -3 -3 -9 0 -12l77 -76l-76 -76c-2 -2 -3 -4 -3 -6s1 -4 3 -6l21 -22c2 -2 4 -2 6 -2s4 0 6 2l76 77l76 -77c2 -2 4 -2 6 -2s4 0 6 2l21 22c2 2 3 4 3 6s-1 4 -3 6z" />
+    <glyph glyph-name="ion-bag" unicode="&#xf110;" 
+d="M416 288l32 -320h-448l32 320h64v4c0 68 56 124 124 124h8c68 0 124 -56 124 -124v-4h64zM128 292v-4h192v4c0 51 -41 92 -92 92v0h-8c-51 0 -92 -41 -92 -92zM36 0h376l-25 256h-35v-36c10 -6 16 -16 16 -28c0 -18 -14 -32 -32 -32s-32 14 -32 32c0 12 6 22 16 28v36
+h-192v-36c10 -6 16 -16 16 -28c0 -18 -14 -32 -32 -32s-32 14 -32 32c0 12 6 22 16 28v36h-35z" />
+    <glyph glyph-name="ion-battery-charging" unicode="&#xf111;" 
+d="M10 64c-6 0 -10 4 -10 10v236c0 6 4 10 10 10h381c6 0 10 -4 10 -10v-54h37c6 0 10 -4 10 -10v-108c0 -6 -4 -10 -10 -10h-37v-54c0 -6 -4 -10 -10 -10h-381zM225 288l-100 -111h61l-27 -81l100 111h-61z" />
+    <glyph glyph-name="ion-battery-empty" unicode="&#xf112;" 
+d="M438 256c6 0 10 -4 10 -10v-108c0 -6 -4 -10 -10 -10h-37v-54c0 -6 -4 -10 -10 -10h-381c-6 0 -10 4 -10 10v236c0 6 4 10 10 10h381c6 0 10 -4 10 -10v-54h37zM416 160v64h-15h-32v32v32h-337v-192h337v32v32h32h15z" />
+    <glyph glyph-name="ion-battery-full" unicode="&#xf113;" 
+d="M438 256c6 0 10 -4 10 -10v-108c0 -6 -4 -10 -10 -10h-37v-54c0 -6 -4 -10 -10 -10h-381c-6 0 -10 4 -10 10v236c0 6 4 10 10 10h381c6 0 10 -4 10 -10v-54h37z" />
+    <glyph glyph-name="ion-battery-half" unicode="&#xf114;" 
+d="M438 256c6 0 10 -4 10 -10v-108c0 -6 -4 -10 -10 -10h-37v-54c0 -6 -4 -10 -10 -10h-381c-6 0 -10 4 -10 10v236c0 6 4 10 10 10h381c6 0 10 -4 10 -10v-54h37zM416 160v64h-15h-32v32v32h-81l32 -192h49v32v32h32h15z" />
+    <glyph glyph-name="ion-battery-low" unicode="&#xf115;" 
+d="M10 64c-6 0 -10 4 -10 10v236c0 6 4 10 10 10h381c6 0 10 -4 10 -10v-54h37c6 0 10 -4 10 -10v-108c0 -6 -4 -10 -10 -10h-37v-54c0 -6 -4 -10 -10 -10h-381zM369 288h-209l32 -192h177v32v32h32h15v64h-15h-32v32v32z" />
+    <glyph glyph-name="ion-beaker" unicode="&#xf269;" horiz-adv-x="384" 
+d="M80 256h240v-224c0 -9 -7 -16 -16 -16h-208c-9 0 -16 7 -16 16v224zM296 104v48c0 4 -4 8 -8 8s-8 -4 -8 -8v-48c0 -4 4 -8 8 -8s8 4 8 8zM288 176c4 0 8 4 8 8s-4 8 -8 8s-8 -4 -8 -8s4 -8 8 -8zM381 416c3 0 3 -2 3 -3s-2 -3 -3 -5s-13 -20 -13 -40v-336
+c0 -35 -29 -64 -64 -64h-208c-35 0 -64 29 -64 64v307c0 32 -2 33 -32 37c0 12 11 40 65 40h316zM336 368c0 5 0 16 1 16h-273c-1 0 -3 0 -4 -1c5 -7 4 -32 4 -44v-307c0 -18 14 -32 32 -32h210c17 0 30 14 30 32v336z" />
+    <glyph glyph-name="ion-beer" unicode="&#xf26a;" 
+d="M384 288c35 0 64 -29 64 -64v-96c0 -35 -29 -64 -64 -64h-32v-80c0 -9 -7 -16 -16 -16h-256c-9 0 -16 7 -16 16v223c-26 0 -48 22 -48 48v54v1c-10 11 -16 26 -16 42c0 35 29 64 64 64c18 0 34 -8 46 -20c10 12 26 20 43 20c14 0 27 -6 37 -14c12 9 26 14 42 14
+c17 0 34 -6 46 -16c11 10 26 16 42 16c35 0 64 -29 64 -64c0 -24 -18 -44 -32 -48v-16h32zM296 144c4 0 8 3 8 8v0v48c0 4 -4 8 -8 8s-8 -4 -8 -8v-48c0 -3 2 -6 4 -7c1 -1 2 -1 4 -1zM303 220c1 2 1 4 1 6s-1 4 -3 5s-4 1 -6 1s-4 -2 -5 -4s-2 -4 -2 -6s2 -4 4 -5
+s4 -1 6 -1s4 2 5 4zM320 288v32h-20c-3 -8 -7 -16 -13 -23c-13 -16 -33 -25 -55 -25c-26 0 -48 13 -61 33c-6 -2 -12 -3 -18 -3c-12 0 -23 4 -32 10c-2 1 -3 3 -5 4c-1 -2 -2 -3 -3 -5c-5 -6 -11 -10 -17 -14v-32v-9h80c0 4 4 8 8 8s8 -4 8 -8h128v32zM351 343c1 3 1 6 1 9
+c0 18 -14 32 -32 32c-9 0 -17 -4 -23 -10c-2 -2 -6 -5 -16 -6h-8c-6 1 -12 3 -14 5c-7 7 -16 11 -27 11c-9 0 -18 -4 -25 -9l-7 -7c0 -1 0 -1 -1 -2c-3 -3 -7 -5 -11 -5c-5 0 -8 3 -11 6c-1 2 -2 3 -3 5s-3 4 -5 6c-4 4 -10 6 -16 6c-10 0 -18 -9 -25 -16
+c-7 -8 -27 -8 -34 0s-18 16 -30 16c-18 0 -32 -14 -32 -32c0 -2 1 -5 1 -7c2 -9 7 -17 15 -21v-34v-35c0 -9 7 -16 16 -16v26v23v32c10 0 18 4 24 11c2 2 3 4 4 6c0 0 6 10 12 11s20 6 30 -5c4 -5 11 -9 19 -9c3 0 5 1 7 2c3 1 7 2 9 4v0c3 2 6 4 10 4c7 0 12 -4 14 -10
+c0 0 1 -1 1 -2c1 -3 1 -5 3 -8c7 -12 20 -20 35 -20c13 0 25 6 32 16c5 7 8 15 8 24s9 8 9 8h7h48c6 0 13 -3 15 -9zM416 128v96c0 18 -14 32 -32 32h-32v-160h32c18 0 32 14 32 32zM128 280c0 5 3 8 8 8s8 -3 8 -8s-3 -8 -8 -8s-8 3 -8 8zM288 280c0 5 3 8 8 8s8 -3 8 -8
+s-3 -8 -8 -8s-8 3 -8 8z" />
+    <glyph glyph-name="ion-bluetooth" unicode="&#xf116;" horiz-adv-x="256" 
+d="M12 304c16 16 18 13 19 12l68 -65v0v0c2 -2 10 -10 10 -3v156v0v2c0 6 6 10 12 10c4 0 7 -2 9 -4v0s117 -113 122 -117s5 -10 1 -14l-84 -81s-4 -4 -4 -8s4 -8 4 -8l84 -81c4 -4 4 -10 -1 -14s-122 -117 -122 -117v0c-2 -2 -5 -4 -9 -4c-6 0 -12 4 -12 10v2v0v156
+s-8 -1 -10 -3v0v-1l-68 -64c-1 -1 -3 -4 -19 12s-12 17 -11 18s90 86 90 86s4 3 4 8v0c0 5 -4 8 -4 8s-89 85 -90 86s-5 2 11 18zM152 328v-79c0 -8 8 -1 10 1l30 30s3 5 3 7s-1 5 -3 7l-30 30c-2 2 -10 11 -10 4zM152 135v-79s8 2 10 4l30 30c2 2 3 5 3 7s-1 5 -3 7l-30 30
+c-2 2 -10 9 -10 1z" />
+    <glyph glyph-name="ion-bonfire" unicode="&#xf315;" horiz-adv-x="384" 
+d="M207 97l15 -89c1 -3 1 -5 1 -8c0 -18 -14 -32 -32 -32s-32 14 -32 32c0 2 0 5 1 7l15 92v0c2 7 8 13 16 13s15 -7 16 -15zM242 93v0v0v0zM329 58c9 -8 10 -25 0 -35s-27 -9 -35 0c-1 1 -2 3 -3 4l-49 66c-3 5 -2 11 2 15c5 5 10 5 16 1l64 -47c2 -1 3 -3 5 -4zM309 113v0
+v0v0zM371 126c9 -1 13 -7 13 -19c0 -9 -10 -14 -18 -12l-57 18v0v0c-3 2 -6 5 -5 9s4 7 8 6zM75 113v0v0v0zM75 113v0l-58 -18c-8 -2 -17 3 -17 12c0 12 3 18 12 19l60 2c4 1 7 -2 8 -6s-2 -7 -5 -9v0zM124 109c5 4 11 4 16 -1c4 -4 5 -10 2 -15l-49 -66c-1 -1 -2 -3 -3 -4
+c-10 -10 -25 -10 -35 0s-10 25 0 35c2 2 3 3 5 4zM288 320c0 -32 -9 -58 -50 -86c-37 -26 -94 -46 -110 -106c0 0 -58 24 -48 96s124 106 112 192c24 0 96 -35 96 -96zM288 192c-16 -50 -44 -64 -80 -64c-15 0 -32 9 -43 26c12 15 28 26 47 37c9 5 20 10 29 16
+c21 14 38 31 47 49c5 -15 5 -48 0 -64zM88 288c-6 4 -9 14 -8 27c2 22 34 39 32 69c14 2 31 -3 42 -24c-5 -11 -15 -21 -28 -34s-26 -22 -38 -38z" />
+    <glyph glyph-name="ion-bookmark" unicode="&#xf26b;" horiz-adv-x="192" 
+d="M184 384c4 0 8 -4 8 -8v-56h-192v56c0 4 4 8 8 8h176zM0 0v304h192v-304l-96 96z" />
+    <glyph glyph-name="ion-bowtie" unicode="&#xf3c0;" 
+d="M192 236c0 0 8 5 20 7c21 4 39 5 47 -9c10 -17 19 -53 17 -85c-1 -17 -5 -22 -5 -22s-15 -10 -47 -7c-35 3 -40 15 -40 15s5 12 8 43s0 58 0 58zM152 163c-17 -4 -38 -10 -38 -10s45 4 64 9c-4 -21 -10 -34 -10 -34s-83 -80 -116 -80c-28 0 -52 68 -52 144s26 144 52 144
+c35 0 106 -57 128 -97c0 0 3 -16 2 -32c-10 5 -24 10 -44 14c-28 6 -42 3 -42 3s18 -4 57 -17c15 -5 22 -8 29 -10c0 -3 -1 -7 -1 -10c0 -5 0 -10 -1 -15c-5 -2 -15 -6 -28 -9zM396 336c26 0 52 -68 52 -144s-24 -144 -52 -144c-37 0 -104 68 -112 79c0 0 4 5 5 22v9
+c16 -7 70 -13 70 -13s-21 6 -40 11c-13 4 -25 8 -30 10c-1 11 -2 23 -4 33c17 11 69 34 69 34s-15 -2 -35 -9c-14 -5 -29 -11 -37 -14c-3 10 -7 18 -10 24c0 1 -1 4 -1 4v1c22 40 89 97 125 97z" />
+    <glyph glyph-name="ion-briefcase" unicode="&#xf26c;" 
+d="M240 176v8h208v-176c0 -4 -4 -8 -8 -8h-432c-4 0 -8 4 -8 8v176h208v-8h32zM440 304c4 0 8 -4 8 -8v-96h-208v8h-32v-8h-208v96c0 4 4 8 8 8h120v31c1 28 22 49 51 49h90c30 0 50 -21 51 -49v-31h120zM288 332v1c0 10 -9 19 -19 19h-90c-10 0 -19 -9 -19 -19v-1v-1v-27
+h128v27v1z" />
+    <glyph glyph-name="ion-bug" unicode="&#xf2be;" 
+d="M343 321c-6 -16 -16 -31 -28 -43c-24 -24 -57 -37 -91 -37s-67 13 -91 37c-12 12 -22 27 -28 43c29 39 72 63 119 63s90 -24 119 -63zM95 305c22 -45 68 -77 121 -80v-225c-40 2 -77 22 -104 54c-7 -6 -10 -9 -13 -15c8 -9 7 -22 -1 -31c-9 -10 -24 -11 -34 -2
+s-11 24 -2 34l3 3s2 1 2 1c4 13 13 25 27 36c-15 26 -26 57 -29 90c-7 0 -12 -2 -17 -3c-1 -13 -11 -23 -24 -23s-24 11 -24 24s11 24 24 24h3c4 2 8 5 12 6c7 2 14 4 25 4c1 23 6 45 13 65c-6 4 -11 7 -15 11c-6 5 -11 13 -14 19c-1 0 -3 1 -4 2c-12 6 -15 21 -9 33
+s21 15 33 9c11 -6 15 -20 10 -31c2 -3 3 -7 4 -8c2 -2 5 -3 8 -5c2 3 3 5 5 8zM424 192c13 0 24 -11 24 -24s-11 -24 -24 -24s-23 10 -24 23c-5 1 -10 3 -17 3c-3 -33 -14 -64 -29 -90c14 -11 23 -23 27 -36c0 0 1 0 2 -1l3 -3c9 -10 8 -25 -2 -34s-25 -8 -34 2
+c-8 9 -9 22 -1 31c-3 6 -6 9 -13 15c-27 -32 -64 -52 -104 -54v225c53 3 99 35 121 80c2 -3 3 -5 5 -8c3 2 6 3 8 5c1 1 2 5 4 8c-5 11 -1 25 10 31c12 6 27 3 33 -9s3 -27 -9 -33c-1 -1 -3 -2 -4 -2c-3 -6 -8 -14 -14 -19c-4 -4 -9 -7 -15 -11c7 -20 12 -42 13 -65
+c11 0 18 -2 25 -4c4 -1 8 -4 12 -6h3z" />
+    <glyph glyph-name="ion-calculator" unicode="&#xf26d;" horiz-adv-x="320" 
+d="M304 416c9 0 16 -7 16 -16v-416c0 -9 -7 -16 -16 -16h-288c-9 0 -16 7 -16 16v416c0 9 7 16 16 16h288zM48 240v-32h32v32h-32zM48 176v-32h32v32h-32zM48 112v-32h32v32h-32zM144 16v32h-96v-32h96zM144 80v32h-32v-32h32zM144 144v32h-32v-32h32zM144 208v32h-32v-32
+h32zM208 16v32h-32v-32h32zM208 80v32h-32v-32h32zM208 144v32h-32v-32h32zM208 208v32h-32v-32h32zM272 16v96h-32v-96h32zM272 144v32h-32v-32h32zM272 208v32h-32v-32h32zM272 288v80h-224v-80h224z" />
+    <glyph glyph-name="ion-calendar" unicode="&#xf117;" 
+d="M112 320c-18 0 -32 14 -32 32v32c0 18 14 32 32 32s32 -14 32 -32v-32c0 -18 -14 -32 -32 -32zM336 320c-18 0 -32 14 -32 32v32c0 18 14 32 32 32s32 -14 32 -32v-32c0 -18 -14 -32 -32 -32zM440 384c4 0 8 -4 8 -8v-400c0 -4 -4 -8 -8 -8h-432c-4 0 -8 4 -8 8v400
+c0 4 4 8 8 8h56v-41c0 -22 24 -39 48 -39s48 17 48 39v41h128v-41c0 -22 25 -39 49 -39s47 17 47 39v41h56zM400 16v256h-352v-256h352z" />
+    <glyph glyph-name="ion-camera" unicode="&#xf118;" horiz-adv-x="416" 
+d="M382 301c18 0 34 -14 34 -33v-202c0 -19 -16 -34 -34 -34h-348c-19 0 -34 15 -34 34v202c0 19 15 33 34 33h69l39 40v0c6 7 15 11 25 11h84c9 0 17 -4 23 -10v0v0v0l41 -41h67zM208 82c51 0 92 42 92 93s-41 93 -92 93s-92 -42 -92 -93s41 -93 92 -93zM376 248
+c8 0 14 6 14 14s-6 14 -14 14s-14 -6 -14 -14s6 -14 14 -14zM208 245c38 0 70 -31 70 -70s-32 -70 -70 -70c-39 0 -70 31 -70 70s31 70 70 70z" />
+    <glyph glyph-name="ion-card" unicode="&#xf119;" 
+d="M420 352c16 0 28 -12 28 -28v0v-264v0c0 -16 -12 -28 -28 -28h-392c-16 0 -28 12 -28 28v0v0v264v0v0c0 16 12 28 28 28h392zM45 320c-7 0 -12 -5 -13 -12v-20h384v20c-1 7 -6 12 -13 12h-358zM403 64c7 0 12 5 13 12v116h-384v-116c1 -7 6 -12 13 -12h358zM64 128v16
+h192v-16h-192zM64 96v16h96v-16h-96zM320 96v48h64v-48h-64z" />
+    <glyph glyph-name="ion-cash" unicode="&#xf316;" horiz-adv-x="512" 
+d="M0 352h512v-256h-512v256zM193 128c-20 23 -33 58 -33 96s13 73 33 96h-97c0 -35 -29 -64 -64 -64v-80c27 0 48 -21 48 -48h113zM298 187c3 4 4 9 4 15c0 3 0 5 -1 8s-2 6 -4 8s-4 4 -7 6s-6 4 -10 5c-1 0 -4 1 -7 2s-5 0 -8 1v31c2 -1 5 -2 7 -3c4 -3 6 -7 7 -13h20
+c0 5 -2 9 -4 13s-5 8 -9 11s-9 5 -14 6c-2 1 -5 2 -7 2v9h-18v-9c-2 0 -4 -1 -6 -2c-5 -1 -10 -2 -14 -5s-7 -6 -9 -10s-4 -9 -4 -14c0 -3 0 -5 1 -8s2 -5 4 -7s5 -5 8 -7s7 -4 12 -5c3 -1 6 0 8 -1v-35c-3 1 -6 2 -9 4s-5 4 -6 7s-2 6 -2 9h-20c0 -5 2 -11 4 -16
+c3 -5 6 -8 10 -11s9 -6 15 -7c3 -1 5 -2 8 -2v-9h18v9c3 0 6 1 9 2c5 1 10 2 14 5s7 7 10 11zM480 176v80c-35 0 -64 29 -64 64h-97c20 -23 33 -58 33 -96s-13 -73 -33 -96h113c0 27 22 48 48 48zM64 224c0 21 11 32 32 32s32 -11 32 -32s-11 -32 -32 -32s-32 11 -32 32z
+M384 224c0 21 11 32 32 32s32 -11 32 -32s-11 -32 -32 -32s-32 11 -32 32zM273 213c2 -1 4 -2 6 -4s3 -5 3 -9c0 -2 0 -4 -1 -6s-2 -4 -4 -5s-5 -3 -8 -4c-1 0 -2 -1 -4 -1v31c3 -1 6 -1 8 -2zM236 257c1 2 3 3 5 4s4 2 6 2v-26c-4 1 -7 3 -9 5s-4 4 -4 8c0 3 1 5 2 7zM0 32
+v32h512v-32h-512z" />
+    <glyph glyph-name="ion-chatbox-working" unicode="&#xf11a;" horiz-adv-x="416" 
+d="M76 48c-42 0 -76 31 -76 71v209c0 40 34 72 76 72h264c42 0 76 -32 76 -72v-209c0 -40 -34 -71 -76 -71h-4v-64s-79 54 -86 59s-7 5 -21 5h-153zM304 256c-18 0 -32 -14 -32 -32s14 -32 32 -32s32 14 32 32s-14 32 -32 32zM208 256c-18 0 -32 -14 -32 -32s14 -32 32 -32
+s32 14 32 32s-14 32 -32 32zM112 256c-18 0 -32 -14 -32 -32s14 -32 32 -32s32 14 32 32s-14 32 -32 32z" />
+    <glyph glyph-name="ion-chatbox" unicode="&#xf11b;" horiz-adv-x="416" 
+d="M76 48c-42 0 -76 31 -76 71v209c0 40 34 72 76 72h264c42 0 76 -32 76 -72v-209c0 -40 -34 -71 -76 -71h-4v-64s-79 54 -86 59s-7 5 -21 5h-153z" />
+    <glyph glyph-name="ion-chatboxes" unicode="&#xf11c;" horiz-adv-x="416" 
+d="M246 82l26 -18c-4 -21 -29 -32 -52 -32h-90c-8 0 -11 -2 -13 -3l-53 -45v48h-16c-26 0 -48 16 -48 41v129c0 25 20 45 46 45h2v-101c0 -33 29 -59 64 -59h117c10 0 14 -3 17 -5zM353 400c35 0 63 -27 63 -60v-168c0 -33 -28 -60 -63 -60h-17v-64l-75 60c-2 2 -7 4 -17 4
+h-101c-35 0 -63 27 -63 60v98v70c0 33 21 60 56 60h217z" />
+    <glyph glyph-name="ion-chatbubble-working" unicode="&#xf11d;" horiz-adv-x="416" 
+d="M208 -1c-115 0 -208 89 -208 200s93 201 208 201s208 -90 208 -201c0 -40 -12 -77 -33 -108c-1 -1 -2 -3 -3 -4v0c-2 -4 -4 -10 -4 -15l22 -88l-84 31c-4 2 -8 2 -12 2s-7 -1 -11 -2v0c-1 0 -1 -1 -2 -1c-25 -10 -52 -15 -81 -15zM304 224c-18 0 -32 -14 -32 -32
+s14 -32 32 -32s32 14 32 32s-14 32 -32 32zM208 224c-18 0 -32 -14 -32 -32s14 -32 32 -32s32 14 32 32s-14 32 -32 32zM112 224c-18 0 -32 -14 -32 -32s14 -32 32 -32s32 14 32 32s-14 32 -32 32z" />
+    <glyph glyph-name="ion-chatbubble" unicode="&#xf11e;" horiz-adv-x="416" 
+d="M208 -1c-115 0 -208 89 -208 200s93 201 208 201s208 -90 208 -201c0 -40 -12 -77 -33 -108c-1 -1 -2 -3 -3 -4v0c-2 -4 -4 -10 -4 -15l22 -88l-84 31c-4 2 -8 2 -12 2s-7 -1 -11 -2v0c-1 0 -1 -1 -2 -1c-25 -10 -52 -15 -81 -15z" />
+    <glyph glyph-name="ion-chatbubbles" unicode="&#xf11f;" horiz-adv-x="416" 
+d="M25 57c-1 1 0 2 -1 3c-15 22 -24 49 -24 77c0 42 19 80 49 106c-2 -11 -4 -22 -4 -34c0 -92 78 -168 174 -168c15 0 30 2 44 6c-27 -32 -69 -53 -115 -53c-20 0 -40 5 -58 12h-1v0c-2 1 -5 2 -8 2s-6 -1 -9 -2l-56 -22l12 63c0 4 -1 7 -3 10v0zM242 400
+c96 0 174 -76 174 -168c0 -33 -11 -64 -28 -90c-1 -1 -1 -2 -2 -3v0c-2 -4 -3 -8 -3 -12l17 -74l-69 26c-3 1 -6 2 -10 2c-3 0 -6 -1 -9 -2v0l-2 -1c-8 -3 -16 -5 -24 -7c-14 -4 -29 -6 -44 -6c-96 0 -173 75 -173 167c0 12 1 24 3 35c16 76 86 133 170 133z" />
+    <glyph glyph-name="ion-checkmark-circled" unicode="&#xf120;" 
+d="M224 416c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224s100 224 224 224zM339 267c1 1 1 2 1 3s0 3 -1 4l-31 24c-1 1 -3 1 -4 1s-2 0 -3 -1l-111 -143s-44 42 -45 43s-4 3 -6 3s-3 -2 -4 -3l-25 -25l-1 -1c-1 -1 -1 -3 -1 -4s0 -2 1 -3l2 -1
+s78 -75 79 -76s3 -3 5 -3s4 2 5 3z" />
+    <glyph glyph-name="ion-checkmark-round" unicode="&#xf121;" horiz-adv-x="416" 
+d="M400 376c17 -13 22 -39 9 -57l-207 -302c-13 -18 -37 -22 -54 -9s-137 147 -137 147c-15 16 -15 42 1 58s40 15 55 -2l99 -107l180 263c13 18 37 22 54 9z" />
+    <glyph glyph-name="ion-checkmark" unicode="&#xf122;" horiz-adv-x="416" 
+d="M414 338c1 -2 2 -4 2 -6s-1 -4 -2 -6l-249 -320c-2 -2 -5 -6 -9 -6s-8 3 -10 5s-141 136 -141 136l-3 3c-1 2 -2 4 -2 6s1 3 2 5l2 2c14 15 42 44 44 46s4 6 8 6s8 -4 10 -6s80 -78 80 -78l200 257c2 2 4 2 6 2s5 -1 7 -2z" />
+    <glyph glyph-name="ion-chevron-down" unicode="&#xf123;" 
+d="M224 150v0v0l174 167c4 4 12 4 16 0l31 -30c4 -4 4 -12 0 -16l-213 -204c-2 -2 -5 -3 -8 -3s-6 1 -8 3l-213 204c-4 4 -4 12 0 16l31 30c4 4 12 4 16 0z" />
+    <glyph glyph-name="ion-chevron-left" unicode="&#xf124;" horiz-adv-x="256" 
+d="M86 192l167 -174c4 -4 4 -12 0 -16l-30 -31c-4 -4 -12 -4 -16 0l-204 213c-2 2 -3 5 -3 8s1 6 3 8l204 213c4 4 12 3 16 -1l30 -30c4 -4 4 -12 0 -16l-167 -174v0v0z" />
+    <glyph glyph-name="ion-chevron-right" unicode="&#xf125;" horiz-adv-x="256" 
+d="M170 192v0v0l-167 174c-4 4 -4 12 0 16l30 30c4 4 12 5 16 1l204 -213c2 -2 3 -5 3 -8s-1 -6 -3 -8l-204 -213c-4 -4 -12 -4 -16 0l-30 31c-4 4 -4 12 0 16z" />
+    <glyph glyph-name="ion-chevron-up" unicode="&#xf126;" 
+d="M224 234l-174 -167c-4 -4 -12 -4 -16 0l-31 30c-4 4 -4 12 0 16l213 204c2 2 5 3 8 3s6 -1 8 -3l213 -204c4 -4 4 -12 0 -16l-31 -30c-4 -4 -12 -4 -16 0l-174 167v0v0z" />
+    <glyph glyph-name="ion-clipboard" unicode="&#xf127;" horiz-adv-x="352" 
+d="M80 288c2 20 10 35 28 40l1 1c12 3 21 7 21 20v21c0 26 21 46 46 46s46 -20 46 -46v-21c0 -13 9 -18 21 -21h2c18 -5 25 -20 27 -40h-192zM176 384c-8 0 -13 -6 -13 -14s5 -14 13 -14s14 6 14 14s-6 14 -14 14zM325 384c15 0 27 -12 27 -28v-360c0 -16 -12 -28 -27 -28
+h-149h-148c-15 0 -28 12 -28 28v360c0 16 13 28 28 28h73v-13c0 -11 -9 -19 -19 -19h-37c-7 0 -12 -6 -12 -13v-327c0 -6 5 -12 11 -12h265c6 0 11 6 11 12v327c0 7 -5 13 -12 13h-37c-10 0 -20 8 -20 19v13h74zM64 224v32h112v-32h-112zM64 32v32h160v-32h-160zM64 96v32
+h129v-32h-129zM64 160v32h208v-32h-208z" />
+    <glyph glyph-name="ion-clock" unicode="&#xf26e;" 
+d="M224 416c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224s100 224 224 224zM360 56c10 10 19 21 26 33l-27 16l8 14l27 -16c13 25 21 52 22 81h-32v16h32c-1 29 -9 56 -22 81l-27 -16l-8 14l27 16c-7 12 -16 23 -26 33s-21 19 -33 26l-16 -27l-14 8
+l16 27c-25 13 -52 21 -81 22v-32h-16v32c-29 -1 -56 -9 -81 -22l16 -27l-14 -8l-16 27c-12 -7 -23 -16 -33 -26s-19 -21 -26 -33l27 -16l-8 -14l-27 16c-13 -25 -21 -52 -22 -81h32v-16h-32c1 -29 9 -56 22 -81l27 16l8 -14l-27 -16c7 -12 16 -23 26 -33s21 -19 33 -26
+l16 27l14 -8l-16 -27c25 -13 52 -21 81 -22v32h16v-32c29 1 56 9 81 22l-16 27l14 8l16 -27c12 7 23 16 33 26zM368 207v-32h-117c-6 -9 -16 -15 -27 -15c-18 0 -32 14 -32 32c0 12 6 22 16 28v68h32v-68c5 -3 9 -8 12 -13h116z" />
+    <glyph glyph-name="ion-close-circled" unicode="&#xf128;" 
+d="M224 415c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224s100 224 224 224zM332 116l-75 75l76 75c3 3 3 9 0 12l-22 21c-2 2 -4 3 -6 3s-3 -1 -5 -3l-76 -74l-76 74c-2 2 -3 3 -5 3s-4 -1 -6 -3l-21 -21c-3 -3 -3 -9 0 -12l76 -75l-76 -76
+c-2 -1 -2 -3 -2 -5s0 -4 2 -6l21 -22c2 -2 4 -2 6 -2s4 0 6 2l75 76l76 -75c2 -2 3 -3 5 -3s4 1 6 3l21 21c2 1 3 4 3 6s-1 4 -3 6z" />
+    <glyph glyph-name="ion-close-round" unicode="&#xf129;" horiz-adv-x="384" 
+d="M374 61c14 -14 14 -37 0 -51s-37 -14 -51 0l-131 131l-131 -131c-14 -14 -36 -14 -50 0s-14 37 0 51l130 131l-130 131c-14 14 -14 37 0 51s36 14 50 0l131 -131l131 131c14 14 37 14 51 0s14 -37 0 -51l-131 -131z" />
+    <glyph glyph-name="ion-close" unicode="&#xf12a;" horiz-adv-x="384" 
+d="M380 61c3 -3 4 -6 4 -10s-1 -7 -4 -10l-38 -37c-3 -3 -5 -4 -9 -4s-7 1 -10 4l-131 131l-131 -131c-3 -3 -5 -4 -9 -4s-7 1 -10 4l-38 37c-3 3 -4 6 -4 10s1 7 4 10l132 131l-132 130c-5 5 -5 15 0 20l37 38c3 2 6 4 10 4s7 -1 10 -4l131 -130l131 130c3 2 6 4 10 4
+s7 -1 10 -4l37 -38c5 -5 5 -14 0 -19l-132 -130z" />
+    <glyph glyph-name="ion-closed-captioning" unicode="&#xf317;" horiz-adv-x="512" 
+d="M0 384h512v-384h-512v384zM464 192c0 27 0 44 -4 80s-23 56 -59 60s-91 4 -138 4h-7h-7c-47 0 -102 0 -138 -4s-55 -24 -59 -60s-4 -53 -4 -80s2 -47 4 -80s19 -56 59 -60s96 -4 145 -4s105 0 145 4s57 27 59 60s4 53 4 80zM372 164v4h53c0 -27 -7 -48 -19 -62
+s-32 -21 -61 -21c-14 0 -26 2 -36 5s-18 9 -25 17s-12 19 -15 33s-5 30 -5 51s3 39 7 53s9 25 17 33s17 14 27 17s22 5 34 5c25 0 44 -7 57 -21s19 -37 19 -62h-52v1c0 20 -12 33 -27 33s-25 -11 -28 -30c0 0 -2 -11 -2 -29s2 -28 2 -28c1 -17 12 -29 27 -29s27 10 27 29v1z
+M195 164v4h53c0 -27 -7 -48 -19 -62s-32 -21 -61 -21c-14 0 -26 2 -36 5s-18 9 -25 17s-12 19 -15 33s-5 30 -5 51s3 39 7 53s9 25 17 33s17 14 27 17s22 5 34 5c25 0 44 -7 57 -21s19 -37 19 -62h-52v1c0 20 -12 33 -27 33s-25 -11 -28 -30c0 0 -2 -11 -2 -29s2 -28 2 -28
+c1 -17 12 -29 27 -29s27 10 27 29v1z" />
+    <glyph glyph-name="ion-cloud" unicode="&#xf12b;" 
+d="M366 215c45 0 82 -38 82 -84s-37 -83 -82 -83v0h-276c-49 0 -90 41 -90 91c0 40 26 74 61 86c5 29 29 51 59 51c10 0 18 -3 26 -7c19 40 59 67 105 67c64 0 115 -53 115 -118v-3z" />
+    <glyph glyph-name="ion-code-download" unicode="&#xf26f;" 
+d="M299 164l-63 -63v0l-1 -1v0l-2 -1v0l-1 -1v0l-2 -1v0h-1v0h-1c-1 0 -3 -1 -4 -1s-3 1 -4 1h-1v0h-1v0l-2 1v0l-1 1v0c-1 1 -2 1 -3 2v0l-63 63c-6 6 -6 17 0 23s18 6 24 0l35 -34v118c0 9 7 17 16 17s16 -8 16 -17v-118l35 34c6 6 18 6 24 0s6 -17 0 -23zM136 56
+c-6 0 -12 2 -17 7l-112 112c-9 9 -9 25 0 34l112 112c9 9 25 9 34 0s9 -25 0 -34l-95 -95l95 -95c9 -9 9 -25 0 -34c-5 -5 -11 -7 -17 -7zM312 56c-6 0 -12 2 -17 7c-9 9 -9 25 0 34l95 95l-95 95c-9 9 -9 25 0 34s25 9 34 0l112 -112c9 -9 9 -25 0 -34l-112 -112
+c-5 -5 -11 -7 -17 -7z" />
+    <glyph glyph-name="ion-code-working" unicode="&#xf270;" 
+d="M128 192c0 16 8 24 24 24s24 -8 24 -24s-8 -24 -24 -24s-24 8 -24 24zM200 192c0 16 8 24 24 24s24 -8 24 -24s-8 -24 -24 -24s-24 8 -24 24zM272 192c0 16 8 24 24 24s24 -8 24 -24s-8 -24 -24 -24s-24 8 -24 24zM136 56c-7 0 -12 2 -17 7l-112 112c-5 5 -7 10 -7 17
+s2 12 7 17l112 112c5 5 10 7 17 7s12 -2 17 -7s7 -10 7 -17s-2 -12 -7 -17l-95 -95l95 -95c5 -5 7 -10 7 -17s-2 -12 -7 -17s-10 -7 -17 -7zM312 56c-7 0 -12 2 -17 7s-7 10 -7 17s2 12 7 17l95 95l-95 95c-5 5 -7 10 -7 17s2 12 7 17s10 7 17 7s12 -2 17 -7l112 -112
+c5 -5 7 -10 7 -17s-2 -12 -7 -17l-112 -112c-5 -5 -10 -7 -17 -7z" />
+    <glyph glyph-name="ion-code" unicode="&#xf271;" 
+d="M136 56c-6 0 -12 2 -17 7l-112 112c-9 9 -9 25 0 34l112 112c9 9 25 9 34 0s9 -25 0 -34l-95 -95l95 -95c9 -9 9 -25 0 -34c-5 -5 -11 -7 -17 -7zM312 56c-6 0 -12 2 -17 7c-9 9 -9 25 0 34l95 95l-95 95c-9 9 -9 25 0 34s25 9 34 0l112 -112c9 -9 9 -25 0 -34l-112 -112
+c-5 -5 -11 -7 -17 -7z" />
+    <glyph glyph-name="ion-coffee" unicode="&#xf272;" horiz-adv-x="384" 
+d="M319 191c37 -7 65 -40 65 -79c0 -20 -8 -39 -21 -54c-15 -17 -37 -26 -61 -26c-8 0 -17 1 -25 3c-6 1 -10 3 -15 5c-11 -15 -23 -25 -32 -33v0c-5 -5 -12 -7 -19 -7h-102c-7 0 -14 2 -19 7v0c-17 15 -41 36 -62 86s-28 91 -28 111s3 20 16 20h101c-5 17 -37 19 -37 46
+c0 17 15 32 28 37c-2 -8 -3 -14 -3 -21c0 -19 39 -30 39 -53c0 -3 0 -6 -1 -9h56c1 5 2 10 2 14c0 36 -56 36 -56 84c0 28 21 55 47 62c-4 -14 -9 -23 -9 -35c0 -32 57 -50 57 -88c0 -13 -5 -25 -12 -37h76c13 0 16 0 16 -20c0 -4 0 -8 -1 -13zM302 64c33 0 50 25 50 48
+s-17 43 -39 47c-4 -19 -11 -42 -21 -66c-4 -9 -8 -17 -12 -25c6 -3 13 -4 22 -4z" />
+    <glyph glyph-name="ion-compass" unicode="&#xf273;" 
+d="M224 416c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224c0 39 10 76 27 108c-16 12 -27 30 -27 52c0 35 29 64 64 64c22 0 40 -11 52 -27c32 17 69 27 108 27zM32 352c0 -10 5 -20 13 -26c13 17 28 32 45 45c-6 8 -16 13 -26 13c-18 0 -32 -14 -32 -32z
+M360 56c36 36 56 85 56 136s-20 100 -56 136s-85 56 -136 56s-100 -20 -136 -56s-56 -85 -56 -136s20 -100 56 -136s85 -56 136 -56s100 20 136 56zM320 320c0 0 -54 -130 -72 -152s-120 -104 -120 -104s54 132 72 152s120 104 120 104z" />
+    <glyph glyph-name="ion-compose" unicode="&#xf12c;" horiz-adv-x="384" 
+d="M379 348c7 -7 7 -18 0 -25l-32 -31l-55 55l31 32c7 7 18 7 25 0zM282 338l55 -55l-177 -173l-64 -14l14 64zM320 192l32 32v-201c0 -13 -10 -23 -23 -23h-306c-13 0 -23 10 -23 23v306c0 13 10 23 23 23h201l-32 -32h-149c-6 0 -11 -5 -11 -10v-268s4 -10 10 -10h269
+s9 5 9 10v150z" />
+    <glyph glyph-name="ion-connection-bars" unicode="&#xf274;" horiz-adv-x="352" 
+d="M0 32v64h64v-64h-64zM96 32v128h64v-128h-64zM192 32v224h64v-224h-64zM288 32v320h64v-320h-64z" />
+    <glyph glyph-name="ion-contrast" unicode="&#xf275;" 
+d="M224 416c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224s100 224 224 224zM360 56c36 36 56 85 56 136s-20 100 -56 136s-85 56 -136 56v-384c51 0 100 20 136 56z" />
+    <glyph glyph-name="ion-crop" unicode="&#xf3c1;" 
+d="M320 -32v48h64v-48h-64zM384 96h64v-64h-384v256h-64v64h64v64h64v-320h192v192h-176v64h240v-256z" />
+    <glyph glyph-name="ion-cube" unicode="&#xf318;" 
+d="M435 280c7 0 13 -6 13 -12v-183c0 -9 -6 -17 -14 -22v-1l-175 -92v-1c-2 -1 -4 -1 -6 -1c-7 0 -13 6 -13 12v185c0 9 5 17 13 22v0l3 2l172 89l2 1c2 1 3 1 5 1zM422 329c0 0 8 -3 8 -9c0 -7 -8 -11 -8 -11l-183 -97l-2 -1c-4 -2 -8 -3 -13 -3s-9 1 -13 3l-2 1l-183 96
+s-8 5 -8 12c0 6 8 9 8 9l181 82s11 5 17 5s17 -5 17 -5zM195 187c8 -5 13 -13 13 -22v-185c0 -6 -6 -12 -13 -12c-2 0 -4 1 -6 2v0l-175 92v1c-8 5 -14 13 -14 22v183c0 6 6 12 13 12c2 0 4 0 5 -1l2 -1l171 -89z" />
+    <glyph glyph-name="ion-disc" unicode="&#xf12d;" 
+d="M224 289c54 0 97 -43 97 -97s-43 -97 -97 -97s-97 43 -97 97s43 97 97 97zM224 148c24 0 44 20 44 44s-20 44 -44 44s-44 -20 -44 -44s20 -44 44 -44zM224 416c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224s100 224 224 224zM224 69
+c68 0 123 55 123 123s-55 123 -123 123s-123 -55 -123 -123s55 -123 123 -123z" />
+    <glyph glyph-name="ion-document-text" unicode="&#xf12e;" horiz-adv-x="288" 
+d="M286 279c1 -3 2 -6 2 -10v-245c0 -13 -10 -24 -22 -24h-243c-12 0 -23 11 -23 24v336c0 13 11 24 23 24h160c3 0 6 0 9 -2c2 -1 5 -3 7 -5l84 -92c2 -2 2 -4 3 -6zM48 269v-10c0 -1 1 -3 3 -3h71c2 0 3 2 3 3v10c0 2 -1 3 -3 3h-71c-2 0 -3 -1 -3 -3zM48 141v-10
+c0 -1 1 -3 3 -3h123c2 0 2 2 2 3v10c0 2 0 3 -2 3h-123c-2 0 -3 -1 -3 -3zM208 67v10c0 2 0 3 -2 3h-155c-2 0 -3 -1 -3 -3v-10c0 -1 1 -3 3 -3h155c2 0 2 2 2 3zM240 195v10c0 2 0 3 -2 3h-187c-2 0 -3 -1 -3 -3v-10c0 -1 1 -3 3 -3h187c2 0 2 2 2 3zM193 270h60l-71 78
+v-66c0 -6 5 -12 11 -12z" />
+    <glyph glyph-name="ion-document" unicode="&#xf12f;" horiz-adv-x="288" 
+d="M287 279c1 -3 1 -5 1 -9v-244c0 -13 -9 -26 -21 -26h-243c-12 0 -24 13 -24 26v335c0 13 12 23 24 23h160c3 0 6 0 9 -2c2 -1 5 -2 7 -4l83 -92c2 -2 3 -4 4 -7zM193 337v-63h58zM32 32h224v210h-67c-15 0 -28 13 -28 28v82h-129v-320z" />
+    <glyph glyph-name="ion-drag" unicode="&#xf130;" horiz-adv-x="512" 
+d="M0 272v32h512v-32h-512zM0 176v32h512v-32h-512zM0 80v32h512v-32h-512z" />
+    <glyph glyph-name="ion-earth" unicode="&#xf276;" 
+d="M325 322c2 -4 7 -12 3 -15c-3 -2 -10 -2 -13 5s0 11 -5 9s-7 3 -6 4c1 2 3 3 5 4c0 2 -4 8 2 7c4 -1 12 -10 14 -14zM344 277v0v0zM403 251c0 0 -2 0 0 0v0zM224 416c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224s100 224 224 224zM141 19l8 -4
+c3 -1 6 -2 10 -3c14 -5 28 -8 43 -10c28 -3 56 -1 83 8c15 5 30 11 43 20c6 4 6 16 10 24c8 16 -2 33 12 47c12 14 4 19 4 34c0 10 8 18 4 29c-1 4 -7 -3 -9 1c-5 7 -21 1 -28 2c-13 2 -24 14 -33 23c-5 5 0 20 1 26c4 15 0 33 19 38c5 1 5 9 10 11c5 1 10 3 15 4
+c9 1 17 -2 26 -2c10 0 14 -5 22 -11c7 -6 13 -3 22 -5c7 0 0 5 -2 8c-3 2 -6 2 -8 2c-16 4 -23 22 -36 30c-6 3 -9 2 -11 0c-1 -1 1 -12 1 -12c-1 -3 -10 -4 -13 -5c-9 -2 -29 17 -15 22c4 1 27 5 24 15c-3 6 2 13 -5 14c-8 1 -7 7 -15 8c-5 1 -5 11 -5 14c0 9 2 6 9 7
+c-17 11 -37 19 -57 24c-1 -3 -5 -12 -8 -12c-5 -1 -6 0 -9 -3c-9 -10 -16 -28 -25 -7c-4 11 5 19 2 28h-6h-3c6 -12 -5 -18 -8 -19c-8 0 -10 5 -17 4c-4 -1 -7 4 -11 2s-13 -8 -14 -12c-3 -12 6 -13 14 -6c6 6 17 12 25 6c6 -5 5 -9 5 -14s-1 -18 -9 -16c-4 1 -7 6 -11 3
+c-8 -7 -18 -6 -29 -9c-10 -2 -16 -6 -25 -9c-8 -3 -11 -4 -12 -12c0 -2 0 -14 -3 -15c-5 -2 -8 22 -22 20c-12 -1 -30 -13 -25 -28c2 -5 28 -3 10 -14c-2 -1 2 -17 2 -20c1 -8 13 -18 21 -10c6 6 6 5 14 2c15 -8 33 -15 45 -27c6 -6 9 -24 17 -28c9 -5 19 -5 26 -14
+c6 -7 -2 -19 -8 -23c-4 -2 -12 -24 -16 -29c-2 -4 -12 -6 -16 -7c-3 0 -7 -9 -9 -11c-7 -7 -8 -13 -17 -19c-18 -12 -22 -23 -18 -44c2 -8 5 -13 11 -16zM100 46l2 -2c7 -6 15 -11 23 -16c-21 21 -23 49 -21 78l3 24c1 3 -4 7 -4 11c0 10 0 5 -8 13c-4 4 -10 11 -12 17
+c-7 16 1 30 10 43c9 14 -7 20 -10 32c-1 6 -7 6 -6 12c1 7 -4 5 -9 9c-12 8 -1 20 -7 26c-43 -70 -36 -162 16 -224c1 -1 0 -1 1 -2h1c3 -4 6 -8 9 -11s7 -6 10 -9z" />
+    <glyph glyph-name="ion-easel" unicode="&#xf3c2;" 
+d="M48 112v192h352v-192h-352zM432 352c9 0 16 -7 16 -16v-256c0 -9 -7 -16 -16 -16h-416c-9 0 -16 7 -16 16v256c0 9 7 16 16 16h416zM416 96v224h-384v-224h384zM48 -32l29 80h31l-28 -80h-32zM239 416l17 -48h-64l17 48h30zM340 48h31l29 -80h-32zM208 0v48h32v-48h-32z
+" />
+    <glyph glyph-name="ion-edit" unicode="&#xf2bf;" 
+d="M381 259l-250 -251l-91 91l251 250zM440 360c12 -12 11 -32 -2 -45l-45 -45l-91 91l45 45c13 13 33 14 45 2zM32 85l85 -85l-117 -32z" />
+    <glyph glyph-name="ion-egg" unicode="&#xf277;" horiz-adv-x="320" 
+d="M160 416c64 0 160 -133 160 -257s-64 -191 -160 -191s-160 67 -160 191s96 257 160 257z" />
+    <glyph glyph-name="ion-eject" unicode="&#xf131;" horiz-adv-x="320" 
+d="M303 128h-286v0c-10 0 -17 7 -17 16c0 3 1 5 3 8l138 191c5 5 11 9 19 9s14 -4 19 -9l138 -190c2 -3 3 -6 3 -9c0 -9 -7 -16 -17 -16v0zM308 96c7 0 12 -5 12 -12v-40c0 -7 -5 -12 -12 -12h-296c-7 0 -12 5 -12 12v40c0 7 5 12 12 12h296z" />
+    <glyph glyph-name="ion-email-unread" unicode="&#xf3c3;" horiz-adv-x="480" 
+d="M352 288c0 43 21 64 64 64s64 -21 64 -64s-21 -64 -64 -64s-64 21 -64 64zM209 288h127c0 -17 5 -33 15 -47c-6 -3 -14 -8 -22 -12s-16 -8 -23 -12s-14 -8 -22 -12s-15 -8 -21 -11s-11 -6 -16 -9s-9 -5 -12 -7s-4 -3 -5 -3c-6 -3 -13 -4 -21 -4s-15 1 -21 4
+c-1 1 -15 8 -42 23s-54 29 -81 44s-43 23 -46 25c-7 4 -12 8 -13 11c-1 4 -1 6 1 8s6 2 11 2h191zM277 175c18 11 45 30 83 56c16 -15 34 -23 56 -23v-155c0 -2 -1 -4 -2 -7s-3 -5 -5 -7s-4 -4 -7 -5s-6 -2 -8 -2h-185h-185c-5 0 -11 2 -16 7s-8 9 -8 14v205c0 6 3 8 9 5
+c2 -1 11 -7 26 -17s32 -22 53 -36s39 -26 53 -35l-83 -93c-2 -2 -2 -4 -1 -5c2 -1 4 -1 6 1l98 83c16 -10 25 -16 27 -17c6 -3 13 -4 21 -4s15 1 21 4c2 1 11 7 27 17l98 -83c2 -2 5 -2 6 -1s0 3 -2 5z" />
+    <glyph glyph-name="ion-email" unicode="&#xf132;" horiz-adv-x="416" 
+d="M19 299c-4 2 -11 7 -13 11c-3 8 1 10 12 10h191h191c11 0 15 -2 12 -10c-2 -4 -9 -9 -13 -11c-11 -6 -163 -89 -169 -92s-12 -4 -21 -4s-15 1 -21 4s-158 86 -169 92zM408 295c9 4 8 -1 8 -5v-205c0 -9 -12 -21 -22 -21h-185h-185c-10 0 -24 12 -24 21v205s0 9 9 5
+c8 -4 83 -56 132 -88l-83 -93c-2 -2 -2 -4 -1 -5s4 -1 6 1l98 83c15 -10 25 -16 27 -17c8 -4 14 -4 21 -4s13 0 21 4c2 1 12 7 27 17l98 -83c2 -2 5 -2 6 -1s0 3 -2 5l-82 93c49 32 123 84 131 88z" />
+    <glyph glyph-name="ion-erlenmeyer-flask-bubbles" unicode="&#xf3c4;" horiz-adv-x="384" 
+d="M382 21c2 -4 3 -10 0 -14s-8 -7 -13 -7h-177h-178c-5 0 -9 3 -12 7s-2 10 0 14l118 199v150c0 8 6 14 14 14s15 -6 15 -14v-80c4 3 10 5 16 5c15 0 27 -12 27 -27s-12 -26 -27 -26c-6 0 -12 2 -16 5v-31c0 -2 -1 -4 -2 -6l-35 -59h72c-15 6 -26 20 -26 37
+c0 23 19 42 43 42c15 0 27 -8 35 -19c-1 2 -1 3 -1 5v154c0 8 6 14 14 14s15 -6 15 -14v-150zM218 151h53l-31 54c2 -5 3 -11 3 -17c0 -17 -10 -31 -25 -37zM201 319c-12 0 -22 9 -22 21s10 21 22 21s22 -9 22 -21s-10 -21 -22 -21z" />
+    <glyph glyph-name="ion-erlenmeyer-flask" unicode="&#xf3c5;" horiz-adv-x="384" 
+d="M375 52c6 -9 9 -20 9 -32c0 -28 -16 -52 -63 -52h-258c-47 0 -63 24 -63 52c0 12 3 23 9 32l49 73l49 77c13 20 21 44 21 70v92s-14 34 -16 43c-2 8 1 9 17 9h126c16 0 18 -1 16 -9c-2 -9 -15 -22 -15 -42v-93c0 -26 6 -50 19 -70zM345 7c3 3 7 8 7 14c0 5 -2 10 -4 14
+l-101 150c-16 26 -23 56 -23 87v112h-64v-112c0 -32 -9 -62 -25 -87l-99 -150c-2 -4 -4 -9 -4 -14c0 -6 3 -11 6 -14c4 -4 12 -7 25 -7h258c13 0 20 3 24 7zM325 37c1 -2 3 -6 3 -8c0 -7 -6 -15 -14 -15h-244c-7 0 -14 6 -14 14c0 3 1 6 3 8l81 124h103l82 -124v1zM238 106
+c2 -1 4 -2 6 -2s3 0 5 2c1 2 3 4 3 6s-1 4 -3 6c-1 2 -3 2 -5 2s-4 0 -6 -2c-1 -2 -2 -4 -2 -6s0 -4 2 -6zM285 47c4 2 4 7 2 11l-23 36c-1 2 -4 4 -7 4c-2 0 -3 0 -4 -1c-4 -2 -4 -7 -2 -11l23 -36c1 -2 5 -4 7 -4c1 0 3 0 4 1z" />
+    <glyph glyph-name="ion-eye-disabled" unicode="&#xf306;" 
+d="M344 290c41 -27 76 -66 104 -100c-51 -54 -124 -135 -224 -135c-36 0 -65 8 -92 22l-77 -77l-23 23l71 71c-36 25 -68 61 -103 98c78 85 142 137 224 137c34 0 64 -9 92 -23l77 78l23 -23zM134 192c0 -19 6 -36 16 -51l27 27c-4 7 -5 15 -5 24c0 29 23 53 52 53h8
+c-5 -6 -8 -13 -8 -21c0 -3 0 -5 1 -8l51 50c-15 11 -33 17 -52 17c-49 0 -90 -41 -90 -91zM224 101c49 0 90 41 90 91c0 19 -6 37 -16 52l-50 -51c3 -1 5 -1 8 -1c8 0 14 3 20 7v-7c0 -29 -23 -53 -52 -53c-9 0 -17 2 -24 6l-28 -27c15 -11 33 -17 52 -17z" />
+    <glyph glyph-name="ion-eye" unicode="&#xf133;" 
+d="M224 320c99 0 172 -70 224 -129c-51 -50 -124 -127 -224 -127s-157 60 -224 128c78 79 142 128 224 128zM224 101c49 0 90 41 90 91s-41 91 -90 91s-90 -41 -90 -91s41 -91 90 -91zM224 224c0 -18 14 -32 32 -32c8 0 14 3 20 7v-7c0 -29 -23 -53 -52 -53s-52 24 -52 53
+s23 53 52 53h8c-5 -6 -8 -13 -8 -21z" />
+    <glyph glyph-name="ion-female" unicode="&#xf278;" horiz-adv-x="256" 
+d="M160 164v-68h64v-64h-64v-64h-64v64h-64v64h64v68c-55 14 -96 64 -96 124c0 71 57 128 128 128s128 -57 128 -128c0 -60 -41 -110 -96 -124zM128 208c44 0 80 36 80 80s-36 80 -80 80s-80 -36 -80 -80s36 -80 80 -80z" />
+    <glyph glyph-name="ion-filing" unicode="&#xf134;" horiz-adv-x="384" 
+d="M317 319c12 0 19 0 19 -20v-28h-288v28c0 20 8 20 20 20h249zM269 352c13 0 19 -1 19 -19h-192c0 18 7 19 20 19h153zM368 278c13 -8 17 -17 15 -41l-17 -184c-4 -21 -16 -21 -24 -21h-300c-8 0 -20 0 -24 21l-17 185c-3 26 1 31 15 40l15 10v-32h321v32z" />
+    <glyph glyph-name="ion-film-marker" unicode="&#xf135;" horiz-adv-x="416" 
+d="M400 240c9 0 16 -7 16 -15v-210c0 -8 -7 -15 -16 -15h-384c-9 0 -16 7 -16 15v210c0 8 6 14 13 15c-2 2 -3 4 -4 7l-9 45c-2 8 5 16 13 18l370 74c8 2 16 -4 18 -12l9 -46c2 -8 -4 -16 -12 -18l-342 -68h344zM257 46l-20 58l51 36h-62l-20 58l-19 -58h-63l51 -36l-19 -58
+l50 36z" />
+    <glyph glyph-name="ion-fireball" unicode="&#xf319;" horiz-adv-x="320" 
+d="M297 210c14 -24 23 -52 23 -82c0 -33 -10 -63 -26 -88v0v0c-29 -43 -78 -72 -134 -72c-17 0 -32 1 -46 7s-25 13 -33 25c-11 16 -17 28 -21 52c-6 -25 2 -48 9 -60c-43 26 -69 71 -69 125v4c5 78 65 109 90 151c8 14 13 30 10 48c11 -9 15 -25 15 -39
+c0 -16 -3 -29 -3 -29c4 8 7 18 9 31c6 35 2 85 -37 132l-1 1s7 0 18 -3c95 -16 169 -91 184 -186c2 -12 3 -23 3 -35c0 -16 -2 -32 -5 -47c10 23 13 43 14 55v10z" />
+    <glyph glyph-name="ion-flag" unicode="&#xf279;" horiz-adv-x="384" 
+d="M362 266c0 0 12 2 22 6c0 -16 -7 -32 -9 -36c-28 -50 -99 -123 -181 -84c-65 31 -92 30 -117 24c-1 0 -2 -1 -3 -1c-3 -1 -15 -5 -26 -1v197c0 16 14 31 33 35c39 7 106 5 148 -74c39 -74 97 -72 133 -66zM24 416c4 0 8 -4 8 -8v-432c0 -4 -4 -8 -8 -8h-16
+c-4 0 -8 4 -8 8v432c0 4 4 8 8 8h16z" />
+    <glyph glyph-name="ion-flame" unicode="&#xf31a;" horiz-adv-x="256" 
+d="M1 128c-11 109 72 224 159 288c-26 -145 97 -142 96 -288c-1 -120 -105 -160 -128 -160s-114 26 -127 160zM88 80c0 -44 40 -80 40 -80s41 36 41 80s-41 80 -41 80s-40 -36 -40 -80z" />
+    <glyph glyph-name="ion-flash-off" unicode="&#xf136;" 
+d="M115 -4c-69 38 -115 112 -115 196c0 124 100 224 224 224c24 0 47 -4 68 -11c2 -1 3 -1 5 -2c12 -4 24 -9 35 -15v0c69 -38 116 -112 116 -196c0 -124 -100 -224 -224 -224c-24 0 -47 4 -68 11c-2 1 -3 1 -5 2c-12 4 -24 8 -35 14zM86 291c-20 -28 -32 -62 -32 -99
+c0 -65 36 -121 90 -150c6 -3 13 -7 19 -9c2 -1 3 -1 5 -2c9 -3 19 -5 29 -7c9 -2 18 -2 27 -2c37 0 71 12 99 32l-52 53l36 40l55 -54c20 28 32 62 32 99c0 66 -37 123 -91 151c-6 3 -12 6 -18 8c-2 1 -3 1 -5 2c-9 3 -19 5 -29 7c-9 2 -18 2 -27 2c-37 0 -72 -12 -100 -32
+l53 -52l-36 -41zM178 58l38 113h-85l139 155l-38 -113h85z" />
+    <glyph glyph-name="ion-flash" unicode="&#xf137;" horiz-adv-x="320" 
+d="M0 160l224 256l-51 -192h147l-224 -256l51 192h-147z" />
+    <glyph glyph-name="ion-folder" unicode="&#xf139;" horiz-adv-x="384" 
+d="M366 256c18 0 19 -7 18 -18l-12 -186c-1 -11 -3 -20 -21 -20h-317c-18 0 -20 9 -21 20l-13 184c-1 11 0 20 18 20h348zM362 305l2 -33h-344c0 6 4 46 6 63c2 18 8 17 25 17h75c28 0 23 0 37 -15c16 -18 19 -17 41 -17h143c11 0 15 -3 15 -15z" />
+    <glyph glyph-name="ion-fork-repo" unicode="&#xf2c0;" horiz-adv-x="320" 
+d="M320 368v-64h-48v-48h-64v48h-48v64h48v48h64v-48h48zM208 208h64v-5v0c0 -43 -7 -70 -38 -95c-23 -19 -51 -20 -75 -22c-9 -1 -18 -2 -26 -3c-6 -1 -13 -5 -20 -10c9 -11 15 -25 15 -41c0 -35 -29 -64 -64 -64s-64 29 -64 64c0 24 13 44 32 55v210c-19 11 -32 31 -32 55
+c0 35 29 64 64 64s64 -29 64 -64c0 -24 -13 -44 -32 -55v-160c8 4 18 7 27 9c11 2 21 2 31 3c17 1 33 3 40 9c10 8 14 11 14 50zM64 384c-18 0 -32 -14 -32 -32s14 -32 32 -32s32 14 32 32s-14 32 -32 32zM64 0c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32
+s14 -32 32 -32z" />
+    <glyph glyph-name="ion-fork" unicode="&#xf27a;" horiz-adv-x="128" 
+d="M78 299v0v0v0zM128 282c0 -26 -15 -48 -37 -58c-12 -6 -11 -11 -11 -11s16 -200 16 -213s-3 -18 -9 -24s-15 -8 -23 -8v0v0c-8 0 -16 2 -22 8s-10 13 -10 24s16 213 16 213s0 6 -11 11c-22 10 -37 32 -37 58c0 43 15 93 24 134h8v-117c0 -6 3 -11 9 -11s9 4 10 10v1
+l9 117h8l10 -117v-1c1 -6 3 -10 9 -10s9 5 9 11v117h8v0c9 -40 24 -91 24 -134z" />
+    <glyph glyph-name="ion-forward" unicode="&#xf13a;" horiz-adv-x="384" 
+d="M224 150c-102 0 -171 -9 -224 -102c0 0 37 208 224 208v80l160 -144l-160 -134v92z" />
+    <glyph glyph-name="ion-funnel" unicode="&#xf31b;" 
+d="M224 416c124 0 224 -36 224 -80c0 -8 -3 -15 -9 -22v0c-35 -43 -151 -179 -151 -218v-4v-83v0c0 -23 -29 -41 -64 -41s-64 18 -64 41v0v87c0 39 -117 177 -149 216v0c-7 8 -11 16 -11 24c0 44 100 80 224 80zM224 288c92 0 176 22 176 48s-83 48 -176 48
+s-176 -22 -176 -48s84 -48 176 -48z" />
+    <glyph glyph-name="ion-gear-a" unicode="&#xf13d;" horiz-adv-x="384" 
+d="M347 192c0 -24 15 -43 37 -56c-4 -13 -10 -26 -16 -38c-25 6 -45 -3 -62 -20s-22 -37 -16 -62c-12 -6 -25 -12 -38 -16c-13 22 -36 37 -60 37s-47 -15 -60 -37c-13 4 -27 10 -39 16c6 25 2 45 -15 62s-37 21 -62 15c-6 12 -12 26 -16 39c22 13 37 36 37 60s-15 43 -37 56
+c4 13 9 26 16 38c25 -6 45 3 62 20s21 37 15 62c12 6 26 12 39 16c13 -22 36 -37 60 -37s47 15 60 37c13 -4 27 -10 39 -16c-6 -25 -2 -45 15 -62s37 -26 62 -20c6 -12 12 -25 16 -38c-22 -13 -37 -32 -37 -56zM192 94c54 0 98 44 98 98s-44 98 -98 98s-98 -44 -98 -98
+s44 -98 98 -98z" />
+    <glyph glyph-name="ion-gear-b" unicode="&#xf13e;" horiz-adv-x="384" 
+d="M384 154h-44c-4 -14 -10 -27 -17 -39l32 -32l-54 -54l-33 32c-12 -7 -24 -11 -38 -15v-46h-76v46c-13 4 -26 8 -38 15l-33 -32l-54 54l32 32c-7 12 -13 25 -17 39h-44v76h43c4 14 9 29 16 41l-30 30l54 54l29 -29c13 8 27 13 42 17v41h76v-41c15 -4 29 -9 42 -17l29 29
+l54 -54l-30 -30c7 -12 13 -27 16 -41h43v-76zM192 138c30 0 54 24 54 54s-24 54 -54 54s-54 -24 -54 -54s24 -54 54 -54z" />
+    <glyph glyph-name="ion-grid" unicode="&#xf13f;" horiz-adv-x="320" 
+d="M64 295c0 -4 -3 -7 -7 -7h-50c-4 0 -7 3 -7 7v50c0 4 3 7 7 7h50c4 0 7 -3 7 -7v-50zM192 295c0 -4 -3 -7 -7 -7h-50c-4 0 -7 3 -7 7v50c0 4 3 7 7 7h50c4 0 7 -3 7 -7v-50zM320 295c0 -4 -3 -7 -7 -7h-50c-4 0 -7 3 -7 7v50c0 4 3 7 7 7h50c4 0 7 -3 7 -7v-50zM64 167
+c0 -4 -3 -7 -7 -7h-50c-4 0 -7 3 -7 7v50c0 4 3 7 7 7h50c4 0 7 -3 7 -7v-50zM192 167c0 -4 -3 -7 -7 -7h-50c-4 0 -7 3 -7 7v50c0 4 3 7 7 7h50c4 0 7 -3 7 -7v-50zM320 167c0 -4 -3 -7 -7 -7h-50c-4 0 -7 3 -7 7v50c0 4 3 7 7 7h50c4 0 7 -3 7 -7v-50zM64 39
+c0 -4 -3 -7 -7 -7h-50c-4 0 -7 3 -7 7v50c0 4 3 7 7 7h50c4 0 7 -3 7 -7v-50zM192 39c0 -4 -3 -7 -7 -7h-50c-4 0 -7 3 -7 7v50c0 4 3 7 7 7h50c4 0 7 -3 7 -7v-50zM320 39c0 -4 -3 -7 -7 -7h-50c-4 0 -7 3 -7 7v50c0 4 3 7 7 7h50c4 0 7 -3 7 -7v-50z" />
+    <glyph glyph-name="ion-hammer" unicode="&#xf27b;" horiz-adv-x="320" 
+d="M314 416c3 0 6 -3 6 -6v-84c0 -3 -3 -6 -6 -6h-52c-3 0 -6 3 -6 6v14c-6 5 -16 9 -22 7c-7 -2 -23 -13 -30 -25s-6 -28 -6 -66l8 -2c5 -1 7 -6 7 -9v-70c0 -95 11 -201 11 -201c0 -3 -3 -6 -6 -6h-84c-3 0 -6 3 -6 6c0 0 11 106 11 201v70c0 3 3 8 7 9l7 2
+c0 43 -5 58 -22 74c-18 16 -41 19 -63 17s-51 -35 -58 -45s-10 2 -10 11c1 16 22 60 72 81s91 22 102 22s27 -1 38 -3s16 -18 26 -18c7 0 14 5 18 9v6c0 3 3 6 6 6h52z" />
+    <glyph glyph-name="ion-happy-outline" unicode="&#xf3c6;" 
+d="M355 158c8 -4 11 -13 7 -21c-24 -46 -78 -73 -138 -73c-62 0 -118 29 -139 74c-4 8 0 17 8 21c2 1 5 1 7 1c6 0 11 -3 14 -9c16 -34 60 -55 110 -55c49 0 92 21 110 56c3 5 8 8 14 8c3 0 5 -1 7 -2zM381 217c5 -7 4 -17 -4 -22c-3 -2 -6 -3 -10 -3c-5 0 -11 2 -14 6
+s-7 10 -17 10s-14 -6 -17 -10s-9 -6 -14 -6c-4 0 -7 1 -10 3c-8 6 -9 15 -3 22c11 14 23 23 44 23s35 -9 45 -23zM157 217c5 -7 4 -17 -4 -22c-3 -2 -6 -3 -10 -3c-5 0 -11 2 -14 6s-7 10 -17 10s-14 -6 -17 -10s-9 -6 -14 -6c-4 0 -7 1 -10 3c-8 6 -9 15 -3 22
+c11 14 23 23 44 23s35 -9 45 -23zM224 416c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224s100 224 224 224zM360 56c36 36 56 85 56 136s-20 100 -56 136s-85 56 -136 56s-100 -20 -136 -56s-56 -85 -56 -136s20 -100 56 -136s85 -56 136 -56
+s100 20 136 56z" />
+    <glyph glyph-name="ion-happy" unicode="&#xf31c;" 
+d="M224 416c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224s100 224 224 224zM71 195c3 -2 6 -3 10 -3c5 0 11 2 14 6s7 10 17 10s14 -6 17 -10s9 -6 14 -6c4 0 7 1 10 3c8 5 9 15 4 22c-10 14 -24 23 -45 23s-33 -9 -44 -23c-6 -7 -5 -16 3 -22zM362 137
+c4 8 1 17 -7 21c-2 1 -4 2 -7 2c-6 0 -11 -3 -14 -8c-18 -35 -61 -56 -110 -56c-50 0 -94 21 -110 55c-3 6 -8 9 -14 9c-2 0 -5 0 -7 -1c-8 -4 -12 -13 -8 -21c21 -45 77 -74 139 -74c60 0 114 27 138 73zM377 195c8 5 9 15 4 22c-10 14 -24 23 -45 23s-33 -9 -44 -23
+c-6 -7 -5 -16 3 -22c3 -2 6 -3 10 -3c5 0 11 2 14 6s7 10 17 10s14 -6 17 -10s9 -6 14 -6c4 0 7 1 10 3z" />
+    <glyph glyph-name="ion-headphone" unicode="&#xf140;" horiz-adv-x="384" 
+d="M383 210c3 -51 -3 -130 -13 -162c-20 -67 -40 -80 -72 -80s-58 27 -58 59v106c0 33 23 59 53 59c18 0 34 -9 44 -24c0 0 11 7 13 22s4 34 -5 64s-21 19 -36 38c-2 3 -5 7 -8 10l-10 10c-2 2 -3 3 -5 4c-11 9 -21 17 -34 23c-19 9 -39 13 -60 13s-42 -4 -61 -13
+c-13 -6 -22 -14 -33 -23c-2 -1 -3 -2 -5 -4l-10 -10s-6 -7 -8 -10c-15 -19 -27 -8 -36 -38c-9 -31 -7 -49 -5 -64s13 -22 13 -22c10 15 26 24 44 24c30 0 53 -27 53 -59v-106c0 -32 -26 -59 -58 -59s-52 13 -72 80c-10 32 -16 111 -13 162c3 60 22 108 56 145v0
+c8 8 15 16 24 23s19 13 29 18c25 13 53 20 82 20s57 -7 82 -20c10 -5 19 -11 28 -18s17 -15 25 -23v0c34 -37 53 -85 56 -145z" />
+    <glyph glyph-name="ion-heart-broken" unicode="&#xf31d;" horiz-adv-x="416" 
+d="M181 160c0 -36 -2 -71 4 -107c2 -10 2 -20 2 -31l-153 159c-45 47 -45 124 0 171c40 41 103 43 144 3c-2 -15 -3 -31 -3 -46c-18 -14 -40 -21 -56 -39l11 7c17 11 15 8 35 14c3 1 8 3 11 5c0 -1 -1 -5 -1 -6c1 -20 11 -39 15 -60c0 -5 1 -10 -1 -15c-8 -17 -7 -37 -8 -55
+zM274 147c8 -18 23 -29 38 -39l-104 -108l-17 18c0 13 -4 26 -4 38c-2 48 10 94 21 142v0c1 -1 2 -1 3 -1c30 -6 52 -24 63 -50zM382 352c46 -47 46 -124 0 -171l-68 -70c-28 24 -42 54 -65 81c-12 13 -26 23 -41 32c-3 13 -8 26 -11 39c-3 12 14 21 16 31c3 12 3 26 3 39
+l19 19c40 42 107 42 147 0z" />
+    <glyph glyph-name="ion-heart" unicode="&#xf141;" horiz-adv-x="416" 
+d="M382 352c46 -47 46 -124 0 -171l-174 -181l-174 181c-46 47 -46 124 0 171c40 42 107 42 147 0l27 -28l28 28c40 42 106 42 146 0z" />
+    <glyph glyph-name="ion-help-buoy" unicode="&#xf27c;" 
+d="M224 416c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224s100 224 224 224zM402 264c-10 24 -23 45 -42 64s-41 32 -65 42l-19 -61c14 -6 27 -15 38 -26s21 -24 27 -38zM224 96c53 0 96 43 96 96s-43 96 -96 96s-96 -43 -96 -96s43 -96 96 -96zM88 328
+c-19 -19 -32 -41 -42 -65l61 -19c6 14 15 27 26 38s24 21 38 27l-19 61c-24 -10 -45 -23 -64 -42zM46 120c10 -24 23 -45 42 -64s41 -32 65 -42l19 61c-14 6 -27 15 -38 26s-21 24 -27 38zM360 56c19 19 32 41 42 65l-61 19c-6 -14 -15 -27 -26 -38s-24 -21 -38 -27l19 -61
+c24 10 45 23 64 42z" />
+    <glyph glyph-name="ion-help-circled" unicode="&#xf142;" 
+d="M224 416c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224s100 224 224 224zM244 89c1 18 -12 31 -29 31c-16 0 -30 -11 -30 -29s12 -30 28 -30c17 0 31 10 31 28zM293 217c7 10 12 22 12 36c0 23 -9 40 -25 52c-17 13 -37 18 -62 18
+c-19 0 -34 -4 -47 -13c-19 -13 -28 -34 -28 -68h49c0 9 -1 19 4 27s13 15 26 15s19 -3 25 -11c5 -7 8 -15 8 -23c0 -7 -4 -14 -8 -20c-2 -4 -6 -7 -10 -10c0 0 -26 -15 -35 -30c-7 -11 -9 -24 -10 -41c0 -1 0 -4 4 -4h39s5 3 5 4c0 6 1 15 2 19c2 7 6 12 12 17l14 9
+c12 9 21 17 25 23z" />
+    <glyph glyph-name="ion-help" unicode="&#xf143;" horiz-adv-x="256" 
+d="M217 371c25 -19 39 -46 39 -83c0 -22 -8 -42 -19 -57c-7 -9 -21 -21 -40 -36l-21 -14c-10 -8 -17 -18 -20 -28c-2 -6 -3 -19 -3 -29c0 -2 -1 -6 -7 -6h-62c-7 0 -7 3 -7 5c1 26 4 49 15 66c15 23 57 48 57 48c6 5 11 9 15 15c7 10 12 21 12 32c0 13 -3 26 -11 36
+c-10 12 -21 18 -41 18s-32 -11 -40 -24s-7 -29 -7 -43h-77c0 54 14 88 44 108c20 14 45 20 75 20c39 0 70 -7 98 -28zM114 78c27 -1 47 -20 46 -48s-22 -46 -49 -45c-26 1 -46 19 -45 47s22 47 48 46z" />
+    <glyph glyph-name="ion-home" unicode="&#xf144;" horiz-adv-x="384" 
+d="M384 160h-48v-160h-96v128h-96v-128h-96v160h-48l192 224z" />
+    <glyph glyph-name="ion-icecream" unicode="&#xf27d;" horiz-adv-x="320" 
+d="M32 192h256l-128 -224zM307 275c8 -5 13 -13 13 -23c0 -16 -14 -28 -30 -28h-4h-252h-4c-16 0 -30 13 -30 28c0 10 6 18 14 23c1 0 1 2 2 2c4 3 7 7 8 12v1c-2 6 -2 12 -2 18c0 42 34 76 76 76c8 0 16 -2 23 -4c-3 -12 -4 -31 -4 -31c2 15 11 29 11 29c18 23 46 38 77 38
+c53 0 96 -43 96 -96c0 -11 -2 -21 -5 -30v-1c0 -4 4 -9 8 -12c1 0 2 -2 3 -2z" />
+    <glyph glyph-name="ion-image" unicode="&#xf147;" 
+d="M336 224c-26 0 -48 22 -48 48s22 48 48 48s48 -22 48 -48s-22 -48 -48 -48zM420 384c16 0 28 -12 28 -28v-328c0 -16 -12 -28 -28 -28h-392c-16 0 -28 12 -28 28v328c0 16 12 28 28 28h392zM317 186l99 -106v260c0 7 -6 12 -13 12h-358c-7 0 -12 -5 -13 -12v-260l126 152
+c4 4 10 8 17 8s13 -2 17 -7l54 -59l4 -4c3 -2 7 -4 11 -4s8 2 12 5l18 16c4 3 8 5 13 5s10 -2 13 -6z" />
+    <glyph glyph-name="ion-images" unicode="&#xf148;" 
+d="M426 308c13 -1 23 -12 22 -24l-14 -263c-1 -13 -12 -22 -25 -21l-330 16c-13 1 -23 10 -22 23l2 46l-15 -1c-12 -1 -22 7 -23 18l-21 236c-1 11 7 21 19 22l296 24c12 1 22 -7 23 -18l5 -54zM71 302c1 12 11 22 24 22l219 -11l-2 31h-1v1c-1 5 -5 8 -10 8l-261 -22
+c-5 0 -10 -4 -10 -9v0v-1l16 -178l18 25zM405 66l10 198v1v0c0 6 -5 10 -11 10l-58 3l-29 2l-204 9c-6 0 -11 -4 -12 -9v0v-1l-3 -63l-7 -128v-7l6 7l102 109c4 4 8 6 14 6s11 -3 14 -7l43 -49l3 -3c2 -2 6 -4 10 -4s5 1 9 3l17 12c4 3 7 4 11 4s9 -2 11 -5l27 -33zM341 186
+c-20 0 -35 15 -35 35s16 35 35 35c20 0 35 -16 35 -35s-16 -35 -35 -35z" />
+    <glyph glyph-name="ion-information-circled" unicode="&#xf149;" 
+d="M448 195c2 -124 -97 -225 -221 -227s-225 97 -227 221s97 225 221 227s225 -97 227 -221zM224 336c-18 0 -32 -14 -32 -32s14 -32 32 -32s32 14 32 32s-14 32 -32 32zM268 53v11h-22v172h-66v-12h22v-160h-22v-11h88z" />
+    <glyph glyph-name="ion-information" unicode="&#xf14a;" horiz-adv-x="128" 
+d="M96 0h32v-16h-128v16h32v240h-32v16h96v-256zM64 304c-27 0 -48 21 -48 48s21 48 48 48s48 -21 48 -48s-21 -48 -48 -48z" />
+    <glyph glyph-name="ion-ionic" unicode="&#xf14b;" horiz-adv-x="416" 
+d="M376 315c25 -34 40 -77 40 -123c0 -115 -93 -208 -208 -208s-208 93 -208 208s93 208 208 208c46 0 89 -15 123 -40c5 3 11 5 18 5c18 0 32 -14 32 -32c0 -7 -2 -13 -5 -18zM344 56c18 18 31 38 41 61c10 24 15 49 15 75s-5 51 -15 75c-6 13 -13 26 -21 38
+c-4 -2 -10 -4 -15 -4c-18 0 -32 14 -32 32c0 5 2 11 4 15c-12 8 -25 15 -38 21c-24 10 -49 15 -75 15s-51 -5 -75 -15c-23 -10 -43 -23 -61 -41s-31 -38 -41 -61c-10 -24 -15 -49 -15 -75s5 -51 15 -75c10 -23 23 -43 41 -61s38 -31 61 -41c24 -10 49 -15 75 -15s51 5 75 15
+c23 10 43 23 61 41zM112 192c0 64 32 96 96 96s96 -32 96 -96s-32 -96 -96 -96s-96 32 -96 96z" />
+    <glyph glyph-name="ion-ios-alarm-outline" unicode="&#xf3c7;" horiz-adv-x="404" 
+d="M384 256l-54 52l-9 -9c35 -32 57 -79 57 -130c0 -44 -16 -83 -43 -114l36 -45l-12 -10l-35 43c-32 -30 -75 -49 -122 -49v0v0c-47 0 -90 19 -122 49l-35 -43l-12 10l36 45c-27 31 -43 71 -43 115c0 51 22 97 57 129l-9 9l-54 -52c-12 14 -20 32 -20 52c0 44 35 80 80 82
+h5c20 0 39 -7 54 -18l-54 -52l11 -11c26 19 56 32 90 35v0c0 8 8 16 16 16s15 -8 15 -16v0c34 -3 65 -16 91 -35l11 11l-54 52c15 11 34 18 54 18h5c45 -2 80 -38 80 -82c0 -20 -8 -38 -20 -52zM22 280l91 89c-9 5 -19 7 -32 6c-37 -2 -65 -32 -65 -67c0 -10 2 -19 6 -28z
+M362 172c0 88 -72 158 -160 158s-160 -70 -160 -158s72 -158 160 -158s160 70 160 158zM291 369l91 -89c4 9 6 18 6 28c0 35 -28 65 -65 67c-13 1 -23 -1 -32 -6zM202 288h16v-144h-112v16h96v128z" />
+    <glyph glyph-name="ion-ios-alarm" unicode="&#xf3c8;" horiz-adv-x="404" 
+d="M385 256l-55 52l-9 -9c35 -32 57 -79 57 -130c0 -44 -16 -83 -43 -114l37 -45l-13 -10l-35 43c-32 -30 -75 -49 -122 -49v0v0c-47 0 -90 19 -122 49l-35 -43l-12 10l36 45c-27 31 -43 70 -43 114c0 51 22 98 57 130l-9 9l-54 -52c-12 14 -20 32 -20 52c0 44 35 80 80 82
+h5c20 0 39 -7 54 -18l-54 -53l11 -10c26 19 56 32 90 35v0c0 8 8 16 16 16s15 -8 15 -16v0c34 -3 65 -16 91 -35l11 11l-54 52c15 11 34 18 54 18h5c45 -2 80 -38 80 -82c0 -20 -7 -38 -19 -52zM218 144v144h-16v-128h-96v-16h112z" />
+    <glyph glyph-name="ion-ios-albums-outline" unicode="&#xf3c9;" 
+d="M432 304h-416v-288h416v288zM448 320v0v-320h-448v320h448zM40 336v16h368v-16h-368zM72 368v16h304v-16h-304z" />
+    <glyph glyph-name="ion-ios-albums" unicode="&#xf3ca;" 
+d="M448 320v0v-320h-448v320h448zM40 336v16h368v-16h-368zM72 368v16h304v-16h-304z" />
+    <glyph glyph-name="ion-ios-americanfootball-outline" unicode="&#xf3cb;" horiz-adv-x="416" 
+d="M331 315c112 -112 81 -327 81 -327s-26 -4 -65 -4c-73 0 -189 12 -262 85c-112 112 -81 327 -81 327s26 4 65 4c73 0 189 -12 262 -85zM17 383c-2 -19 -5 -60 0 -107c1 -8 2 -16 3 -23l127 127c-25 3 -51 5 -78 5v0v0c-22 0 -41 -1 -52 -2zM96 80c30 -30 72 -53 124 -66
+c10 -3 20 -5 31 -7l142 142c-4 22 -10 44 -17 63c-14 37 -32 68 -56 92c-30 30 -72 53 -124 66c-10 3 -20 5 -31 7l-142 -142c4 -22 10 -44 17 -63c14 -37 32 -68 56 -92zM399 1c2 19 5 60 0 107c-1 8 -2 16 -3 23l-127 -127c25 -3 51 -5 78 -5c22 0 41 1 52 2zM259 130
+l-28 -29l-12 12l29 28l-23 23l-28 -29l-12 12l29 28l-23 23l-28 -29l-12 12l29 28l-23 23l-28 -29l-12 12l29 28l-22 23l-29 -29l-11 12l67 67l12 -11l-29 -29l23 -22l28 29l12 -12l-29 -28l23 -23l28 29l12 -12l-29 -28l23 -23l28 29l12 -12l-29 -28l22 -23l29 29l12 -12
+l-29 -28l22 -23l29 29l11 -12l-67 -67l-12 11l29 29z" />
+    <glyph glyph-name="ion-ios-americanfootball" unicode="&#xf3cc;" horiz-adv-x="416" 
+d="M331 315c112 -112 81 -327 81 -327s-26 -4 -65 -4c-73 0 -189 12 -262 85c-112 112 -81 327 -81 327s26 4 65 4c73 0 189 -12 262 -85zM20 253l3 -18l142 142l-18 3zM219 113l12 -12l28 29l23 -22l-29 -29l12 -11l67 67l-11 12l-29 -29l-22 23l29 28l-12 12l-28 -29
+l-23 23l29 28l-12 12l-28 -29l-23 23l29 28l-12 12l-28 -29l-23 23l29 28l-12 12l-28 -29l-23 22l29 29l-12 11l-67 -67l11 -12l29 29l22 -23l-29 -28l12 -12l28 29l23 -23l-29 -28l12 -12l28 29l23 -23l-29 -28l12 -12l28 29l23 -23zM269 4l127 127l-3 18l-142 -142z" />
+    <glyph glyph-name="ion-ios-analytics-outline" unicode="&#xf3cd;" 
+d="M224 400c-28 0 -55 -5 -81 -16c-25 -10 -47 -26 -66 -45s-35 -41 -45 -66c-11 -26 -16 -53 -16 -81s5 -55 16 -81c10 -25 26 -47 45 -66s41 -35 66 -45c26 -11 53 -16 81 -16s55 5 81 16c25 10 47 26 66 45s35 41 45 66c11 26 16 53 16 81s-5 55 -16 81
+c-10 25 -26 47 -45 66s-41 35 -66 45c-26 11 -53 16 -81 16zM224 416v0c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224s100 224 224 224zM76 128c-25 0 -41 18 -42 19c-3 3 -2 9 1 12s8 2 11 -1c1 -1 15 -17 36 -14c12 2 27 26 38 42c4 6 9 12 12 16
+c17 21 34 23 45 21c24 -3 45 -28 54 -50c7 -18 18 -28 32 -29c15 -1 31 11 43 30c1 2 3 4 4 7c9 17 24 43 52 43c31 0 52 -35 53 -36c2 -4 1 -9 -3 -11s-9 -1 -11 3c0 0 -5 8 -12 15c-6 6 -16 13 -27 13c-18 0 -29 -19 -38 -35c-1 -3 -3 -5 -4 -7c-15 -25 -36 -40 -58 -38
+c-20 1 -36 15 -46 39s-28 39 -41 41c-11 1 -21 -4 -31 -16c-3 -4 -6 -9 -10 -15c-14 -20 -31 -45 -50 -48c-3 0 -5 -1 -8 -1z" />
+    <glyph glyph-name="ion-ios-analytics" unicode="&#xf3ce;" 
+d="M224 416c124 0 224 -100 224 -224c0 -13 -1 -25 -3 -37c-1 -6 -2 -12 -3 -17c-24 -98 -113 -170 -218 -170c-122 0 -221 98 -224 219v5c0 9 1 17 2 26c13 111 107 198 222 198zM431 168c1 8 1 16 1 24c0 28 -5 55 -16 81c-10 25 -26 47 -45 66s-41 35 -66 45
+c-26 11 -53 16 -81 16s-55 -5 -81 -16c-25 -10 -47 -26 -66 -45s-35 -41 -45 -66c-11 -26 -16 -53 -16 -81v0c14 -21 29 -34 29 -34h1v-1c1 -1 15 -16 36 -13c12 2 27 26 38 42c4 6 9 12 12 16c17 21 34 23 45 21c24 -3 45 -27 54 -50c7 -18 18 -28 32 -29c15 -1 31 9 43 29
+c1 2 3 4 4 7c9 17 24 44 52 44c31 0 52 -35 53 -36c3 -4 9 -12 16 -20z" />
+    <glyph glyph-name="ion-ios-arrow-back" unicode="&#xf3cf;" horiz-adv-x="192" 
+d="M192 320l-127 -128l127 -128l-32 -32l-160 160v0v0l160 160z" />
+    <glyph glyph-name="ion-ios-arrow-down" unicode="&#xf3d0;" horiz-adv-x="320" 
+d="M301 288l19 -21l-160 -171l-160 171l19 21l141 -150z" />
+    <glyph glyph-name="ion-ios-arrow-forward" unicode="&#xf3d1;" horiz-adv-x="192" 
+d="M0 320l32 32l160 -160v0v0l-160 -160l-32 32l127 128z" />
+    <glyph glyph-name="ion-ios-arrow-left" unicode="&#xf3d2;" horiz-adv-x="192" 
+d="M192 333l-150 -141l150 -141l-21 -19l-171 160l171 160z" />
+    <glyph glyph-name="ion-ios-arrow-right" unicode="&#xf3d3;" horiz-adv-x="192" 
+d="M0 333l21 19l171 -160l-171 -160l-21 19l150 141z" />
+    <glyph glyph-name="ion-ios-arrow-thin-down" unicode="&#xf3d4;" horiz-adv-x="192" 
+d="M190 126c2 -2 2 -4 2 -6s0 -4 -2 -6c0 0 -87 -79 -88 -80s-3 -2 -6 -2s-5 1 -6 2s-88 80 -88 80c-3 3 -3 9 0 12s9 3 12 0l74 -67v285c0 4 4 8 8 8s8 -4 8 -8v-285l74 67c3 3 9 3 12 0z" />
+    <glyph glyph-name="ion-ios-arrow-thin-left" unicode="&#xf3d5;" horiz-adv-x="320" 
+d="M94 98c-2 -2 -4 -2 -6 -2s-4 0 -6 2c0 0 -79 87 -80 88s-2 3 -2 6s1 5 2 6s80 88 80 88c3 3 9 3 12 0s3 -9 0 -12l-67 -74h285c4 0 8 -4 8 -8s-4 -8 -8 -8h-285l67 -74c3 -3 3 -9 0 -12z" />
+    <glyph glyph-name="ion-ios-arrow-thin-right" unicode="&#xf3d6;" horiz-adv-x="320" 
+d="M226 98c-3 3 -3 9 0 12l67 74h-285c-4 0 -8 4 -8 8s4 8 8 8h285l-67 74c-3 3 -3 9 0 12s9 3 12 0c0 0 79 -87 80 -88s2 -3 2 -6s-1 -5 -2 -6s-80 -88 -80 -88c-2 -2 -4 -2 -6 -2s-4 0 -6 2z" />
+    <glyph glyph-name="ion-ios-arrow-thin-up" unicode="&#xf3d7;" horiz-adv-x="192" 
+d="M190 258c-3 -3 -9 -3 -12 0l-74 67v-285c0 -4 -4 -8 -8 -8s-8 4 -8 8v285l-74 -67c-3 -3 -9 -3 -12 0s-3 9 0 12c0 0 87 79 88 80s3 2 6 2s5 -1 6 -2s88 -80 88 -80c2 -2 2 -4 2 -6s0 -4 -2 -6z" />
+    <glyph glyph-name="ion-ios-arrow-up" unicode="&#xf3d8;" horiz-adv-x="320" 
+d="M301 96l-141 150l-141 -150l-19 21l160 171l160 -171z" />
+    <glyph glyph-name="ion-ios-at-outline" unicode="&#xf3d9;" horiz-adv-x="255" 
+d="M236 127v1h19l-3 -6c-3 -6 -13 -19 -22 -27s-18 -14 -28 -20s-21 -10 -32 -13s-23 -5 -34 -5c-16 0 -33 3 -49 8s-30 13 -43 24c-12 11 -26 29 -34 46c-7 16 -10 33 -10 58c0 18 4 38 11 55c7 16 17 30 29 42s27 21 43 28c15 6 33 9 53 9c16 0 32 -3 46 -8
+c15 -5 28 -12 39 -22s17 -21 24 -35c6 -13 8 -26 8 -44c0 -14 -2 -28 -7 -40s-9 -20 -17 -30c-8 -9 -13 -15 -23 -21c-11 -6 -20 -9 -29 -9c-8 0 -15 2 -20 7c-3 2 -5 6 -6 9c-6 -6 -11 -10 -17 -12c-10 -3 -18 -4 -26 -4s-15 1 -21 4s-12 7 -17 12s-8 11 -11 18
+s-5 14 -5 22c0 12 3 24 7 36v2c4 11 5 16 13 26c8 11 17 19 28 26s24 11 38 11c12 0 21 -3 31 -9c7 -4 12 -10 16 -16l6 17h18l-38 -102c-2 -5 -4 -10 -5 -14s-1 -7 -1 -10c0 -2 1 -4 3 -5s4 -2 8 -2c6 0 11 2 20 7c8 4 12 9 19 17c6 8 10 14 14 25s6 23 6 35
+c0 15 -2 25 -7 36c-6 13 -10 22 -19 30s-20 15 -33 20s-27 7 -42 7c-19 0 -35 -3 -48 -9c-15 -6 -27 -14 -37 -24c-11 -10 -19 -23 -25 -37c-6 -15 -10 -32 -10 -48c0 -22 2 -36 8 -49c6 -15 17 -31 28 -41s24 -18 38 -23s30 -7 46 -7c10 0 20 1 30 4s18 6 27 11
+s17 11 24 18s14 13 19 21zM147 154c4 5 8 12 11 20l21 57c-2 5 -4 10 -7 13c-3 4 -6 6 -10 8c-1 0 -1 1 -2 1c-3 2 -5 3 -9 4c-5 1 -9 2 -13 2c-10 0 -19 -3 -28 -9s-17 -13 -23 -22c-5 -8 -7 -11 -10 -20c0 -1 -1 -3 -1 -4c-4 -11 -5 -20 -5 -30c0 -6 1 -11 3 -16
+s5 -9 8 -13s7 -6 12 -8s9 -3 15 -3c4 0 9 1 14 2c4 1 8 2 12 5s8 7 12 13z" />
+    <glyph glyph-name="ion-ios-at" unicode="&#xf3da;" horiz-adv-x="256" 
+d="M228 128v0h28c-1 -1 -2 -4 -3 -6c-4 -6 -14 -19 -23 -27s-18 -14 -28 -20s-20 -10 -32 -13c-11 -3 -23 -5 -34 -5c-16 0 -33 3 -49 8s-30 13 -43 24c-12 10 -26 28 -34 46c-7 16 -10 33 -10 58c0 19 4 39 11 55s17 30 29 42s28 21 44 28c15 6 32 9 52 9c16 0 31 -3 46 -8
+s28 -12 39 -22s18 -22 25 -36c6 -14 8 -26 8 -44c0 -14 -2 -28 -7 -40c-4 -11 -9 -20 -17 -30c-7 -9 -14 -16 -24 -22c-12 -6 -21 -9 -30 -9s-16 2 -22 8c-2 1 -3 3 -4 5c-4 -4 -9 -6 -14 -8c-10 -3 -18 -5 -27 -5c-8 0 -16 2 -23 5s-12 7 -17 12s-9 12 -12 19s-4 14 -4 22
+c0 12 2 25 6 37l1 1c4 10 5 17 13 27c8 11 17 20 28 27c12 7 24 10 38 10c12 0 22 -3 33 -9c5 -3 8 -6 12 -10l5 12h25l-39 -104c-2 -5 -3 -9 -4 -13c-1 -3 -1 -7 -1 -9s0 -3 1 -3c0 0 1 -1 5 -1c5 0 11 2 19 7c7 4 10 8 16 16s9 13 13 23s6 20 6 32c0 14 -1 24 -6 34
+c-5 12 -10 21 -18 28c-9 8 -19 14 -31 18s-26 7 -40 7c-18 0 -32 -3 -44 -8c-14 -6 -25 -13 -35 -23s-18 -22 -24 -35c-6 -14 -9 -30 -9 -45c0 -21 3 -34 8 -46c6 -14 16 -30 26 -39s22 -16 35 -21c14 -5 28 -7 43 -7c10 0 20 2 29 4s18 6 26 11s28 20 38 33zM144 157
+c4 5 7 12 10 19l20 55c-1 4 -3 7 -5 9c-3 3 -6 6 -9 8h-1h-1v1c-3 2 -5 2 -8 3c-4 1 -8 1 -12 1c-9 0 -17 -2 -25 -7c-10 -6 -17 -14 -21 -21c-5 -8 -6 -11 -9 -19c0 -1 -1 -2 -1 -3c-3 -10 -6 -19 -6 -28c0 -5 1 -10 3 -14s4 -8 7 -11s7 -6 11 -8s8 -2 13 -2c4 0 8 0 12 1
+v0c4 1 7 2 11 5c3 2 7 5 11 11z" />
+    <glyph glyph-name="ion-ios-barcode-outline" unicode="&#xf3db;" horiz-adv-x="416" 
+d="M0 64v256h80v-16h-64v-224h64v-16h-80zM336 320h80v-256h-80v16h64v224h-64v16zM64 128v128h16v-128h-16zM336 128v128h16v-128h-16zM272 96v192h16v-192h-16zM128 96v192h16v-192h-16zM199 112v160h16v-160h-16z" />
+    <glyph glyph-name="ion-ios-barcode" unicode="&#xf3dc;" horiz-adv-x="416" 
+d="M0 320h416v-256h-416v256zM80 128v128h-16v-128h16zM144 96v192h-16v-192h16zM215 112v160h-16v-160h16zM288 96v192h-16v-192h16zM352 128v128h-16v-128h16z" />
+    <glyph glyph-name="ion-ios-baseball-outline" unicode="&#xf3dd;" horiz-adv-x="416" 
+d="M415 169v-1v0c-11 -97 -90 -174 -187 -183v0h-2c-2 0 -3 -1 -5 -1h-1h-3h-1h-8c-115 0 -208 93 -208 208v8v1v3v1c0 2 1 3 1 5v2v0c9 97 86 176 183 187v0v0c8 1 16 1 24 1c115 0 208 -93 208 -208c0 -7 0 -14 -1 -20v0v-3zM399 192c0 105 -86 191 -191 191
+c-3 0 -5 -1 -8 -1c0 -11 2 -21 4 -31l20 6l5 -15l-21 -7c2 -7 4 -14 7 -21c2 -5 5 -11 8 -16l17 12l9 -13l-19 -13c7 -12 16 -23 26 -33l14 15l12 -12l-15 -15c11 -10 22 -18 34 -25l12 18l14 -9l-12 -17c5 -2 10 -5 15 -7c7 -3 14 -5 22 -7l7 20l15 -5l-6 -19
+c10 -2 20 -4 30 -4c0 3 1 5 1 8zM17 192c0 -105 86 -191 191 -191h4c-1 9 -1 17 -3 26l-22 -7l-5 16l23 7c-2 8 -5 16 -8 24c-2 5 -4 9 -6 14l-20 -13l-9 13l21 14c-7 12 -16 24 -26 35l-17 -17l-11 11l17 17c-10 10 -22 18 -34 25l-14 -21l-14 9l14 20c-5 2 -10 5 -15 7
+c-7 3 -15 6 -23 8l-8 -24l-15 5l7 23c-9 2 -18 2 -27 3v-4zM228 2c88 9 158 78 169 166c-11 1 -23 3 -34 5l-9 -27l-15 5l8 25c-14 4 -28 10 -41 17l-15 -23l-13 9l14 21c-13 8 -26 17 -37 28l-19 -19l-11 11l19 19c-10 11 -19 23 -27 36l-21 -14l-9 13l22 15
+c-7 13 -12 27 -16 41l-25 -8l-5 16l26 8c-2 12 -4 23 -5 35c-88 -11 -157 -81 -166 -169c10 -1 21 -2 31 -4l8 23l15 -5l-7 -22c14 -4 28 -9 42 -16l13 19l14 -9l-13 -18c13 -8 25 -17 36 -28l17 17l11 -11l-17 -17c11 -12 20 -24 28 -37l19 13l9 -14l-20 -13
+c7 -14 12 -28 16 -42l23 7l5 -15l-24 -8c2 -10 3 -20 4 -30z" />
+    <glyph glyph-name="ion-ios-baseball" unicode="&#xf3de;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208c0 -8 0 -16 -1 -24v0v0c-12 -104 -100 -184 -207 -184c-115 0 -208 93 -208 208c0 107 80 195 184 207v0v0c8 1 16 1 24 1zM212 1c5 0 11 0 16 1c-1 10 -2 20 -4 30l24 8l-5 15l-23 -7c-4 14 -9 28 -16 42l20 13l-9 14l-19 -13
+c-8 13 -17 25 -28 37l17 17l-11 11l-17 -17c-11 11 -23 20 -36 28l13 18l-14 9l-13 -19c-14 7 -28 12 -42 16l7 22l-15 5l-8 -23c-10 2 -21 3 -31 4c-1 -5 -1 -11 -1 -16c9 -1 18 -1 27 -3l-7 -23l15 -5l8 24c8 -2 16 -5 23 -8c5 -2 10 -5 15 -7l-14 -20l14 -9l14 21
+c12 -7 24 -15 34 -25l-17 -17l11 -11l17 17c10 -11 19 -23 26 -35l-21 -14l9 -13l20 13c2 -5 4 -9 6 -14c3 -8 6 -16 8 -24l-23 -7l5 -16l22 7c2 -8 2 -17 3 -26zM363 173c11 -2 23 -4 34 -5c1 5 1 11 1 16c-10 1 -20 2 -30 4l6 19l-15 5l-7 -20c-8 2 -15 4 -22 7
+c-5 2 -10 5 -15 7l12 17l-14 9l-12 -18c-12 7 -23 15 -34 25l15 15l-12 12l-15 -15c-10 10 -18 21 -25 33l19 13l-9 13l-17 -12c-3 5 -6 11 -8 16c-3 7 -5 14 -7 21l21 7l-5 15l-20 -6c-2 10 -3 20 -4 31c-5 0 -11 0 -16 -1c1 -12 3 -23 5 -35l-26 -8l5 -16l25 8
+c4 -14 9 -28 16 -41l-22 -15l9 -13l21 14c8 -13 17 -25 27 -36l-19 -19l11 -11l19 19c11 -11 24 -20 37 -28l-14 -21l13 -9l15 23c13 -7 27 -13 41 -17l-8 -25l15 -5z" />
+    <glyph glyph-name="ion-ios-basketball-outline" unicode="&#xf3df;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM399 192c0 55 -24 105 -62 140c-14 -34 -31 -65 -52 -95c15 -12 31 -21 49 -29c21 -9 43 -14 65 -16v0zM325 343c-32 25 -73 40 -117 40v0c2 -22 6 -44 15 -65
+c10 -25 26 -47 45 -66c2 -1 2 -3 4 -4c20 29 38 60 52 93c0 1 1 1 1 2zM192 382c-51 -4 -96 -29 -128 -65c64 -28 121 -69 169 -119c11 12 21 24 30 37c-40 37 -67 89 -71 147zM233 174c-15 -16 -31 -30 -48 -44c28 -35 45 -79 47 -127c33 4 63 17 88 35
+c-22 50 -51 95 -87 136zM214 178l8 8l-10 10c-46 46 -99 82 -158 108c-18 -25 -31 -55 -35 -88c62 -3 116 -31 155 -74c14 11 27 23 40 36zM18 200c0 -3 -1 -5 -1 -8c0 -45 16 -87 43 -120c36 16 71 36 102 60l-7 7c-19 19 -41 35 -66 45c-22 9 -46 15 -71 16zM71 59
+c35 -36 83 -58 137 -58c3 0 5 1 8 1c-1 25 -6 48 -16 71c-7 17 -17 33 -28 47c-31 -24 -65 -45 -101 -61zM333 48c37 32 61 77 65 128c-46 3 -89 21 -123 48c-10 -13 -20 -26 -31 -38c36 -41 67 -87 89 -138z" />
+    <glyph glyph-name="ion-ios-basketball" unicode="&#xf3e0;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM333 48c-22 51 -53 97 -89 138c11 12 21 25 31 38c34 -27 77 -45 123 -48c0 5 1 11 1 16c-22 2 -44 7 -65 16c-18 8 -34 17 -49 29c21 30 38 61 52 95c-4 4 -8 8 -12 11
+c0 -1 -1 -1 -1 -2c-14 -33 -32 -64 -52 -93c-2 1 -2 2 -4 4c-19 19 -35 41 -45 66c-9 21 -13 43 -15 65c-5 0 -11 -1 -16 -1c4 -58 31 -110 71 -147c-9 -13 -19 -25 -30 -37c-48 50 -105 91 -169 119c-4 -4 -7 -9 -10 -13c59 -26 112 -62 158 -108l10 -10l-8 -8
+c-13 -13 -26 -25 -40 -36c-39 43 -93 71 -155 74c-1 -5 -1 -11 -1 -16c25 -1 49 -7 71 -16c25 -10 47 -26 66 -45l7 -7c-31 -24 -66 -44 -102 -60c4 -4 7 -9 11 -13c36 16 70 37 101 61c11 -14 21 -30 28 -47c10 -23 15 -46 16 -71c5 0 11 0 16 1c-2 48 -19 92 -47 127
+c17 14 33 28 48 44c36 -41 65 -86 87 -136c4 3 9 6 13 10z" />
+    <glyph glyph-name="ion-ios-bell-outline" unicode="&#xf3e1;" horiz-adv-x="384" 
+d="M318 222c0 -114 28 -126 66 -158h-384c38 32 66 44 66 158c0 98 53 130 102 138v2c0 12 11 22 24 22s24 -10 24 -22v-2c49 -7 102 -40 102 -138zM43 80h298c-25 25 -40 58 -40 142c0 46 -13 80 -37 101c-23 19 -52 23 -72 23s-49 -4 -72 -23c-25 -21 -37 -55 -37 -101
+c0 -51 -5 -85 -17 -110c-6 -13 -14 -23 -23 -32zM192 0c-27 0 -49 20 -52 43h104c-3 -23 -25 -43 -52 -43z" />
+    <glyph glyph-name="ion-ios-bell" unicode="&#xf3e2;" horiz-adv-x="384" 
+d="M318 222c0 -114 28 -126 66 -158h-384c38 32 66 44 66 158c0 98 53 130 102 138v2c0 12 11 22 24 22s24 -10 24 -22v-2c49 -7 102 -40 102 -138zM192 0c-27 0 -49 20 -52 43h104c-3 -23 -25 -43 -52 -43z" />
+    <glyph glyph-name="ion-ios-body-outline" unicode="&#xf3e3;" horiz-adv-x="384" 
+d="M192 400c-18 0 -32 -14 -32 -32s14 -32 32 -32s32 14 32 32s-14 32 -32 32zM192 416v0c27 0 48 -21 48 -48s-21 -48 -48 -48s-48 21 -48 48s21 48 48 48zM360 304c13 0 24 -11 24 -24s-11 -24 -24 -24h-100c-5 0 -14 -5 -18 -15c-5 -12 -2 -33 1 -51l4 -21v-1v0l32 -172
+c2 -13 -6 -26 -19 -28h-5c-11 0 -22 8 -24 20l-21 120v0s-5 31 -17 31h-2c-12 0 -19 -31 -19 -31v0l-21 -120c-2 -12 -11 -20 -22 -20h-5c-13 2 -21 15 -19 28l32 172v1l4 21c3 18 6 39 1 51c-4 10 -12 15 -18 15h-100c-13 0 -24 11 -24 24s11 24 24 24h336zM24 272
+c-4 0 -8 4 -8 8s4 8 8 8h336c4 0 8 -4 8 -8s-4 -8 -8 -8h-102c-16 0 -26 -15 -30 -24c-5 -13 -6 -32 -1 -61v0v0l3 -19l1 -3l32 -172c0 -3 0 -5 -1 -6s-2 -2 -5 -3h-2c-4 0 -7 2 -8 6l-21 120v0c0 2 -2 10 -5 19c-2 6 -5 11 -8 15c-7 9 -14 11 -20 11h-2
+c-5 0 -13 -2 -20 -11c-3 -4 -6 -9 -8 -15c-4 -9 -6 -17 -6 -18v-1l-21 -120c-1 -4 -3 -6 -7 -6h-2c-3 0 -4 2 -5 3s-2 3 -1 6l32 172v0v1l4 21v0v0c5 29 5 48 0 61c-4 9 -14 24 -32 24z" />
+    <glyph glyph-name="ion-ios-body" unicode="&#xf3e4;" horiz-adv-x="384" 
+d="M144 368c0 32 16 48 48 48s48 -16 48 -48s-16 -48 -48 -48s-48 16 -48 48zM360 304c7 0 12 -2 17 -7s7 -10 7 -17s-2 -12 -7 -17s-10 -7 -17 -7h-98c-8 -2 -15 -6 -18 -14c-4 -9 -3 -27 1 -52l4 -21v-1v0l30 -172c1 -7 0 -13 -4 -18s-8 -9 -15 -10s-13 0 -18 4
+s-9 9 -10 16l-21 120v-1l-2 9c-1 5 -3 11 -6 16s-6 8 -10 8h-2c-8 0 -14 -11 -18 -33v1l-21 -120c-1 -7 -5 -12 -10 -16s-11 -5 -18 -4s-11 5 -15 10s-5 11 -4 18l30 172v0v1l4 21c4 25 5 43 1 52c-3 8 -10 12 -18 14h-98c-7 0 -12 2 -17 7s-7 10 -7 17s2 12 7 17s10 7 17 7
+h336z" />
+    <glyph glyph-name="ion-ios-bolt-outline" unicode="&#xf3e5;" horiz-adv-x="226" 
+d="M131 316l-100 -140h65h19l-3 -19l-17 -89l100 140h-65h-19l3 19zM160 384v0l-30 -160h96l-160 -224l30 160h-96z" />
+    <glyph glyph-name="ion-ios-bolt" unicode="&#xf3e6;" horiz-adv-x="226" 
+d="M160 384v0l-30 -160h96l-160 -224l30 160h-96z" />
+    <glyph glyph-name="ion-ios-book-outline" unicode="&#xf3e7;" horiz-adv-x="384" 
+d="M284 384c55 0 100 -26 100 -79v-1v-4v-261v-17h-6h-11h-5c-17 30 -44 42 -78 42c-40 0 -74 -28 -82 -64h-20c-8 36 -42 64 -82 64c-34 0 -65 -16 -78 -42h-5h-11h-6v9v264v9v1c0 53 45 79 100 79c41 0 78 -14 92 -44c12 30 51 44 92 44zM184 37v254v13v2
+c-1 43 -39 62 -84 62c-44 0 -81 -19 -84 -61v-1v0v-262h1c19 26 48 36 83 36s66 -17 84 -43zM368 300v14v1c-3 42 -40 53 -84 53c-46 0 -84 -20 -84 -64v-1v-266c18 26 49 43 84 43s66 -10 84 -36v256z" />
+    <glyph glyph-name="ion-ios-book" unicode="&#xf3e8;" horiz-adv-x="384" 
+d="M100 384c35 0 67 -10 84 -31v-353h-2c-8 36 -42 64 -82 64c-34 0 -65 -16 -78 -42h-5h-11h-6v9v264v9v1c0 53 45 79 100 79zM284 384c55 0 100 -26 100 -79v-1v-4v-261v-17h-6h-11h-5c-17 30 -44 42 -78 42c-40 0 -74 -28 -82 -64h-2v353c17 21 50 31 84 31z" />
+    <glyph glyph-name="ion-ios-bookmarks-outline" unicode="&#xf3e9;" horiz-adv-x="418" 
+d="M385 384c19 0 33 -13 33 -32v-286c0 -19 -14 -34 -33 -34h-143s-25 -4 -25 -19v-13h-8h-8v13c0 15 -11 19 -25 19h-143c-19 0 -33 15 -33 34v286c0 19 14 32 33 32h150c10 0 20 -5 26 -12v0v0c6 7 16 12 26 12h150zM201 37v309c0 9 -12 22 -25 22h-143
+c-9 0 -16 -7 -16 -16v-286c0 -9 7 -18 16 -18h144c10 0 19 -3 24 -11zM273 368v-100l23 14l9 6l9 -6l23 -14v100h-64zM401 66v286c0 9 -7 16 -16 16h-32v-131l-48 32l-48 -32v131h-15c-13 0 -25 -13 -25 -22v-309c5 9 14 11 24 11h144c9 0 16 9 16 18z" />
+    <glyph glyph-name="ion-ios-bookmarks" unicode="&#xf3ea;" horiz-adv-x="418" 
+d="M296 283l-23 -15v116h64v-116l-23 15l-9 6zM385 384c19 0 33 -13 33 -32v-286c0 -19 -14 -34 -33 -34h-143s-25 -4 -25 -19v-13h-8h-8v13c0 15 -11 19 -25 19h-143c-19 0 -33 15 -33 34v286c0 19 14 32 33 32h150s18 -8 18 -15v-329l8 -6l8 6v329s10 15 18 15h22v-146
+l48 32l48 -32v146h32z" />
+    <glyph glyph-name="ion-ios-box-outline" unicode="&#xf3eb;" horiz-adv-x="320" 
+d="M192 208h-1h-63c-9 0 -16 -7 -16 -16s7 -16 16 -16h64c9 0 16 7 16 16s-7 16 -16 16zM192 224v0c18 0 32 -14 32 -32s-14 -32 -32 -32h-64c-18 0 -32 14 -32 32s14 32 32 32h64zM320 336v-80h-16v-208h-288v208h-16v80h320zM288 64v192h-256v-192h256zM304 272v48h-288
+v-48h288z" />
+    <glyph glyph-name="ion-ios-box" unicode="&#xf3ec;" horiz-adv-x="320" 
+d="M16 48v192h288v-192h-288zM128 208c-9 0 -16 -7 -16 -16s7 -16 16 -16h64c9 0 16 7 16 16s-7 16 -16 16h-64zM0 336h320v-80h-16h-288h-16v80z" />
+    <glyph glyph-name="ion-ios-briefcase-outline" unicode="&#xf3ed;" horiz-adv-x="416" 
+d="M368 320h48v-320h-416v320h48v16h32v-16h48v30v2c0 18 10 32 29 32h99c19 0 32 -14 32 -32v-2v-30h48v16h32v-16zM144 320v0h128v0v30c0 10 -7 18 -17 18h-97c-11 0 -14 -8 -14 -18v-30zM400 16v224h-384v-224h384zM400 256v48h-32v-16h-32v16h-256v-16h-32v16h-32v-48
+h384z" />
+    <glyph glyph-name="ion-ios-briefcase" unicode="&#xf3ee;" horiz-adv-x="416" 
+d="M48 320v16h32v-16h-32zM0 0v240h416v-240h-416zM336 320v16h32v-16h-32zM368 320h48v-64h-416v64h48v-32h32v32h48v30v2c0 18 10 32 29 32h99c19 0 32 -14 32 -32v-2v-30h48v-32h32v32zM272 320v30c0 10 -7 18 -17 18h-97c-11 0 -14 -8 -14 -18v-30v0h128v0z" />
+    <glyph glyph-name="ion-ios-browsers-outline" unicode="&#xf3ef;" horiz-adv-x="384" 
+d="M0 304h304v-304h-304v304zM288 16v272h-272v-272h272zM384 384v-304h-64v16h48v272h-272v-48h-16v64h304z" />
+    <glyph glyph-name="ion-ios-browsers" unicode="&#xf3f0;" horiz-adv-x="384" 
+d="M0 304h304v-304h-304v304zM80 384h304v-304h-64v240h-240v64z" />
+    <glyph glyph-name="ion-ios-calculator-outline" unicode="&#xf3f1;" horiz-adv-x="288" 
+d="M32 288v64h224v-64h-224zM48 336v-32h192v32h-192zM256 384c18 0 32 -14 32 -32v-320c0 -18 -14 -32 -32 -32h-224c-18 0 -32 14 -32 32v320c0 18 14 32 32 32h224zM272 32v320c0 9 -7 16 -16 16h-224c-9 0 -16 -7 -16 -16v-320c0 -9 7 -16 16 -16h224c9 0 16 7 16 16z
+M48 208h32h16v-16h-64v64h16v-16v-32zM48 128h32h16v-16h-64v64h16v-16v-32zM48 48h32h16v-16h-64v64h16v-16v-32zM128 208h32h16v-16h-64v64h16v-16v-32zM208 208h32h16v-16h-64v64h16v-16v-32zM128 128h32h16v-16h-64v64h16v-16v-32zM128 48h32h16v-16h-64v64h16v-16v-32z
+M208 48h32h16v-16h-64v144h16v-96v-32z" />
+    <glyph glyph-name="ion-ios-calculator" unicode="&#xf3f2;" horiz-adv-x="288" 
+d="M256 384c18 0 32 -14 32 -32v-320c0 -18 -14 -32 -32 -32h-224c-18 0 -32 14 -32 32v320c0 18 14 32 32 32h224zM248 168h-48v-128h48v128zM248 248h-48v-48h48v48zM168 88h-48v-48h48v48zM168 168h-48v-48h48v48zM168 248h-48v-48h48v48zM88 88h-48v-48h48v48zM88 168
+h-48v-48h48v48zM88 248h-48v-48h48v48zM40 296h208v48h-208v-48z" />
+    <glyph glyph-name="ion-ios-calendar-outline" unicode="&#xf3f3;" horiz-adv-x="384" 
+d="M16 336v-64h352v64zM288 352h96v-352h-384v352h96v32h16v-32h160v32h16v-32zM368 16v240h-352v-240h352zM368 272v64h-80v-32h-16v32h-160v-32h-16v32h-80v-64h352z" />
+    <glyph glyph-name="ion-ios-calendar" unicode="&#xf3f4;" horiz-adv-x="384" 
+d="M0 0v256h384v-256h-384zM384 352v-80h-384v80h96v-48h16v48h160v-48h16v48h96zM96 352v32h16v-32h-16zM272 352v32h16v-32h-16z" />
+    <glyph glyph-name="ion-ios-camera-outline" unicode="&#xf3f5;" horiz-adv-x="384" 
+d="M354 288c18 0 30 -13 30 -31v-176c0 -18 -12 -33 -30 -33h-320c-18 0 -34 15 -34 33v176c0 18 16 31 34 31h13v16h34v-16h13c32 36 43 48 55 48h88c12 0 23 -12 55 -48h62zM368 81v176c0 9 -5 15 -14 15h-62h-7l-5 3c-3 4 -7 8 -10 11c-12 13 -20 24 -26 30
+c-5 5 -7 4 -7 4h-88s-2 0 -7 -4c-6 -5 -14 -14 -25 -27c-3 -4 -7 -10 -11 -14l-5 -3h-7h-60c-9 0 -18 -7 -18 -15v-176c0 -9 9 -17 18 -17h320c8 0 14 8 14 17zM192 258c47 0 86 -38 86 -85s-39 -85 -86 -85s-86 38 -86 85s39 85 86 85zM192 104c38 0 70 31 70 69
+s-32 69 -70 69s-70 -31 -70 -69s32 -69 70 -69zM288 239v17h17v-17h-17zM160 173c0 21 11 32 32 32s32 -11 32 -32s-11 -32 -32 -32s-32 11 -32 32z" />
+    <glyph glyph-name="ion-ios-camera" unicode="&#xf3f6;" horiz-adv-x="384" 
+d="M354 288c18 0 30 -13 30 -31v-176c0 -18 -12 -33 -30 -33h-320c-18 0 -34 15 -34 33v176c0 18 16 31 34 31h13v16h34v-16h13c32 36 43 48 55 48h88c12 0 23 -12 55 -48h62zM192 88c47 0 86 38 86 85s-39 85 -86 85s-86 -38 -86 -85s39 -85 86 -85zM305 239v17h-17v-17h17
+zM192 242c38 0 70 -31 70 -69s-32 -69 -70 -69s-70 31 -70 69s32 69 70 69zM192 141c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32z" />
+    <glyph glyph-name="ion-ios-cart-outline" unicode="&#xf3f7;" horiz-adv-x="384" 
+d="M96 48c13 0 24 -11 24 -24s-11 -24 -24 -24s-24 11 -24 24s11 24 24 24zM96 16c4 0 8 4 8 8s-4 8 -8 8s-8 -4 -8 -8s4 -8 8 -8zM320 48c13 0 24 -11 24 -24s-11 -24 -24 -24s-24 11 -24 24s11 24 24 24zM320 16c4 0 8 4 8 8s-4 8 -8 8s-8 -4 -8 -8s4 -8 8 -8zM384 320
+l-16 -128l-271 -48l5 -30c7 -34 21 -34 26 -34h240v-16h-240c-11 0 -21 5 -28 14c-6 8 -11 19 -13 33l-43 234v0c-2 8 -3 12 -7 16c-6 5 -18 7 -37 7v16c23 0 38 -4 47 -11c7 -6 10 -14 12 -21zM355 206l11 99l-304 31l32 -176z" />
+    <glyph glyph-name="ion-ios-cart" unicode="&#xf3f8;" horiz-adv-x="384" 
+d="M96 48c13 0 24 -11 24 -24s-11 -24 -24 -24s-24 11 -24 24s11 24 24 24zM320 48c13 0 24 -11 24 -24s-11 -24 -24 -24s-24 11 -24 24s11 24 24 24zM384 320l-16 -128l-271 -48l5 -30c7 -34 21 -34 26 -34h240v-16h-240c-11 0 -21 5 -28 14c-6 8 -11 19 -13 33l-43 234v0
+c-2 8 -3 12 -7 16c-6 5 -18 7 -37 7v16c23 0 38 -4 47 -11c7 -6 10 -14 12 -21z" />
+    <glyph glyph-name="ion-ios-chatboxes-outline" unicode="&#xf3f9;" horiz-adv-x="416" 
+d="M16 384v-192h96v-16h-112v224h288v-112h-16v96h-256zM128 272h288v-224h-48v-64h-13l-64 64h-163v224zM400 64v192h-256v-192h153l55 -55v55h48z" />
+    <glyph glyph-name="ion-ios-chatboxes" unicode="&#xf3fa;" horiz-adv-x="416" 
+d="M288 400v-112h-176v-112h-112v224h288zM128 272h288v-224h-48v-64h-13l-64 64h-163v224z" />
+    <glyph glyph-name="ion-ios-chatbubble-outline" unicode="&#xf3fb;" horiz-adv-x="384" 
+d="M192 336c-97 0 -176 -62 -176 -138c0 -26 10 -51 27 -73c0 -1 0 -2 1 -3s2 -1 2 -2c4 -6 6 -13 6 -20c0 -3 1 -3 -13 -47l39 17v0c2 1 10 4 11 4h1v0c5 2 10 3 16 3c5 0 9 -1 14 -2l1 -1h2c19 -6 41 -10 70 -10c48 0 92 15 125 40c32 25 50 58 50 94
+c0 76 -79 138 -176 138zM192 352v0c106 0 192 -69 192 -154s-85 -150 -191 -150c-27 0 -52 3 -75 11h-2v0c-3 1 -6 2 -10 2s-9 -1 -12 -2h1h-1c-1 0 -9 -4 -10 -4l-50 -22l-2 -1h-3h-3c-6 1 -8 6 -7 10v0s17 57 17 58c0 4 -1 8 -3 11v0v0v0l1 -1l-4 4c-19 24 -30 53 -30 84
+c0 85 86 154 192 154z" />
+    <glyph glyph-name="ion-ios-chatbubble" unicode="&#xf3fc;" horiz-adv-x="384" 
+d="M192 352v0c106 0 192 -69 192 -154s-85 -150 -191 -150c-27 0 -52 3 -75 11h-2v0c-3 1 -6 2 -10 2s-9 -1 -12 -2h1h-1c-1 0 -9 -4 -10 -4l-50 -22l-2 -1h-3h-3c-6 1 -8 6 -7 10v0s17 57 17 58c0 4 -1 8 -3 11v0v0v0l1 -1l-4 4c-19 24 -30 53 -30 84c0 85 86 154 192 154z
+" />
+    <glyph glyph-name="ion-ios-checkmark-empty" unicode="&#xf3fd;" horiz-adv-x="207" 
+d="M74 118c-2 -2 -6 -4 -9 -4s-7 2 -9 4l-56 56l18 18l47 -47l125 126l17 -18z" />
+    <glyph glyph-name="ion-ios-checkmark-outline" unicode="&#xf3fe;" horiz-adv-x="416" 
+d="M292 271l18 -18l-134 -135c-2 -2 -6 -4 -9 -4s-7 2 -9 4l-56 56l18 18l47 -47zM208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM208 1c105 0 191 86 191 191s-86 191 -191 191s-191 -86 -191 -191s86 -191 191 -191z" />
+    <glyph glyph-name="ion-ios-checkmark" unicode="&#xf3ff;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM176 118l134 135l-18 18l-125 -126l-47 47l-18 -18l56 -56c2 -2 6 -4 9 -4s7 2 9 4z" />
+    <glyph glyph-name="ion-ios-circle-filled" unicode="&#xf400;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM208 1c105 0 191 86 191 191s-86 191 -191 191s-191 -86 -191 -191s86 -191 191 -191zM208 352c88 0 160 -72 160 -160s-72 -160 -160 -160s-160 72 -160 160s72 160 160 160z" />
+    <glyph glyph-name="ion-ios-circle-outline" unicode="&#xf401;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM208 1c105 0 191 86 191 191s-86 191 -191 191s-191 -86 -191 -191s86 -191 191 -191z" />
+    <glyph glyph-name="ion-ios-clock-outline" unicode="&#xf402;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM208 1c105 0 191 86 191 191s-86 191 -191 191s-191 -86 -191 -191s86 -191 191 -191zM208 192v128h17v-145h-113v17h96z" />
+    <glyph glyph-name="ion-ios-clock" unicode="&#xf403;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM225 175v145h-17v-128h-96v-17h113z" />
+    <glyph glyph-name="ion-ios-close-empty" unicode="&#xf404;" horiz-adv-x="192" 
+d="M180 288l12 -12l-84 -84l84 -84l-12 -12l-84 84l-84 -84l-12 12l84 84l-84 84l12 12l84 -84z" />
+    <glyph glyph-name="ion-ios-close-outline" unicode="&#xf405;" horiz-adv-x="416" 
+d="M355 339c81 -81 81 -213 0 -294s-213 -81 -294 0s-81 213 0 294s213 81 294 0zM343 57c74 74 74 196 0 270s-196 74 -270 0s-74 -196 0 -270s196 -74 270 0zM292 288l12 -12l-84 -84l84 -84l-12 -12l-84 84l-84 -84l-12 12l84 84l-84 84l12 12l84 -84z" />
+    <glyph glyph-name="ion-ios-close" unicode="&#xf406;" horiz-adv-x="416" 
+d="M355 339c81 -81 81 -213 0 -294s-213 -81 -294 0s-81 213 0 294s213 81 294 0zM304 108l-84 84l84 84l-12 12l-84 -84l-84 84l-12 -12l84 -84l-84 -84l12 -12l84 84l84 -84z" />
+    <glyph glyph-name="ion-ios-cloud-download-outline" unicode="&#xf407;" 
+d="M161 67l55 -54v242h16v-242l55 54l12 -12l-75 -73l-74 73zM367 284c45 0 81 -37 81 -82s-37 -82 -82 -82v0h-101v16h97h4c37 0 66 30 66 66s-29 67 -66 67h-15v20c0 55 -46 97 -101 97c-38 0 -73 -22 -90 -56l-6 -14l-14 7c-6 3 -13 5 -20 5c-22 0 -40 -18 -44 -39l-1 -9
+l-9 -3c-30 -10 -50 -36 -50 -67c0 -40 33 -74 74 -74h91v-16h-91c-50 0 -90 40 -90 89c0 39 26 71 61 83c5 28 29 51 59 51c10 0 18 -2 26 -6c19 39 59 65 105 65c64 0 117 -51 117 -115c0 -1 -1 -2 -1 -3z" />
+    <glyph glyph-name="ion-ios-cloud-download" unicode="&#xf408;" 
+d="M216 13v107h16v-107l55 54l12 -12l-75 -73l-74 73l11 12zM367 284c45 0 81 -37 81 -82s-37 -82 -82 -82h-134v135h-16v-135h-35h-21h-70c-50 0 -90 40 -90 89c0 39 26 71 61 83c5 28 29 51 59 51c10 0 18 -2 26 -6c19 39 59 65 105 65c64 0 117 -51 117 -115
+c0 -1 -1 -2 -1 -3z" />
+    <glyph glyph-name="ion-ios-cloud-outline" unicode="&#xf409;" 
+d="M367 215c45 0 81 -37 81 -83c0 -45 -37 -84 -82 -84h-276c-50 0 -90 42 -90 92c0 40 26 71 61 83c5 28 29 52 59 52c10 0 18 -2 26 -6c19 39 59 67 105 67c64 0 117 -53 117 -117c0 -1 -1 -3 -1 -4zM366 64c37 0 66 32 66 69s-29 67 -66 67h-15v21c0 56 -46 99 -101 99
+c-38 0 -73 -23 -90 -58l-6 -14l-14 7c-6 3 -13 5 -20 5c-22 0 -40 -17 -44 -39l-1 -9l-9 -3c-30 -10 -50 -37 -50 -69c0 -41 33 -76 74 -76h272h4z" />
+    <glyph glyph-name="ion-ios-cloud-upload-outline" unicode="&#xf40a;" 
+d="M161 188l-11 11l74 75l75 -75l-12 -11l-55 54v-242h-16v242zM367 264c45 0 81 -39 81 -85s-37 -83 -82 -83v0h-101v16h97h4c37 0 66 30 66 67s-29 70 -66 70l-15 1v20c0 56 -46 99 -101 99c-38 0 -73 -23 -90 -58l-6 -13l-14 6c-6 3 -13 5 -20 5c-22 0 -40 -17 -44 -39
+l-1 -9l-9 -3c-30 -10 -50 -39 -50 -71c0 -41 33 -75 74 -75h91v-16h-91c-50 0 -90 40 -90 90c0 40 26 74 61 86c5 28 29 52 59 52c10 0 18 -2 26 -6c19 39 59 66 105 66c64 0 117 -52 117 -116c0 -1 -1 -3 -1 -4z" />
+    <glyph glyph-name="ion-ios-cloud-upload" unicode="&#xf40b;" 
+d="M216 0v96h16v-96h-16zM367 264c45 0 81 -39 81 -85s-37 -83 -82 -83h-134v146l55 -54l12 11l-75 75l-74 -75l11 -11l55 54v-146h-35h-31h-60c-50 0 -90 40 -90 90c0 40 26 74 61 86c5 28 29 52 59 52c10 0 18 -2 26 -6c19 39 59 66 105 66c64 0 117 -52 117 -116
+c0 -1 -1 -3 -1 -4z" />
+    <glyph glyph-name="ion-ios-cloud" unicode="&#xf40c;" 
+d="M367 215c45 0 81 -37 81 -83c0 -45 -37 -84 -82 -84h-276c-50 0 -90 42 -90 92c0 40 26 71 61 83c5 28 29 52 59 52c10 0 18 -2 26 -6c19 39 59 67 105 67c64 0 117 -53 117 -117c0 -1 -1 -3 -1 -4z" />
+    <glyph glyph-name="ion-ios-cloudy-night-outline" unicode="&#xf40d;" horiz-adv-x="384" 
+d="M125 224c-34 0 -63 -28 -63 -62v-12s1 -10 1 -10c-5 0 -12 -1 -14 -1c-19 -3 -33 -18 -33 -37c0 -10 3 -19 10 -26s16 -11 26 -11h157c27 0 49 22 49 49s-22 50 -49 50c-2 0 -4 -1 -6 -1l-14 -2l-3 14c-3 14 -11 26 -22 35s-25 14 -39 14zM125 240v0c37 0 68 -26 76 -61
+h8c36 0 65 -29 65 -65s-29 -66 -65 -66h-157c-28 0 -52 24 -52 53c0 27 21 51 47 53v8c0 43 35 78 78 78zM361 142c8 0 15 2 23 4c-4 -7 -9 -14 -14 -20c-21 -24 -50 -41 -84 -45c4 6 6 12 8 19c19 4 36 13 50 25c-18 1 -35 6 -50 13c-23 11 -42 29 -56 51
+c-14 21 -22 48 -22 75c0 15 2 30 7 44c-24 -12 -43 -33 -53 -59c-5 2 -12 4 -18 5c14 36 45 65 82 77c8 2 16 4 24 5c-5 -6 -9 -13 -12 -20c-8 -16 -12 -34 -12 -52c0 -32 12 -63 35 -86s54 -36 86 -36h6z" />
+    <glyph glyph-name="ion-ios-cloudy-night" unicode="&#xf40e;" horiz-adv-x="384" 
+d="M361 142c8 0 15 2 23 4c-4 -7 -9 -15 -14 -21c-21 -24 -50 -40 -84 -44h-3c4 10 7 21 7 32c0 22 -9 43 -24 58c-14 15 -33 23 -53 24c-6 16 -16 29 -29 40c-10 8 -20 13 -32 17v2c14 36 45 65 82 77c8 2 16 4 24 5c-5 -6 -9 -13 -12 -20c-8 -16 -12 -34 -12 -52
+c0 -32 12 -63 35 -86s54 -36 86 -36h6zM125 239v0c37 0 68 -26 76 -61h8c36 0 65 -29 65 -65s-29 -66 -65 -66h-157c-28 0 -52 24 -52 53c0 27 21 51 47 53v7c0 43 35 79 78 79z" />
+    <glyph glyph-name="ion-ios-cloudy-outline" unicode="&#xf40f;" horiz-adv-x="274" 
+d="M125 272c-34 0 -63 -28 -63 -62v-12s1 -10 1 -10c-6 0 -12 -1 -14 -1c-19 -3 -33 -18 -33 -37c0 -10 3 -19 10 -26s16 -11 26 -11h157c27 0 49 22 49 49s-22 50 -49 50c-2 0 -4 -1 -6 -1l-14 -2l-3 14c-3 14 -11 26 -22 35s-25 14 -39 14zM125 288v0c37 0 68 -26 76 -61
+h8c36 0 65 -29 65 -65s-29 -66 -65 -66h-157c-28 0 -52 24 -52 53c0 27 21 51 47 53v8c0 43 35 78 78 78z" />
+    <glyph glyph-name="ion-ios-cloudy" unicode="&#xf410;" horiz-adv-x="274" 
+d="M125 288v0c37 0 68 -26 76 -61h8c36 0 65 -29 65 -65s-29 -66 -65 -66h-157c-28 0 -52 24 -52 53c0 27 21 51 47 53v8c0 43 35 78 78 78z" />
+    <glyph glyph-name="ion-ios-cog-outline" unicode="&#xf411;" horiz-adv-x="384" 
+d="M384 175l-33 -8l-3 -14l27 -20l-12 -30l-34 5l-8 -11l17 -29l-23 -23l-29 17l-10 -7l5 -34l-29 -12l-21 27l-14 -3l-8 -33h-32l-9 33l-13 3l-21 -28l-29 12l4 34l-11 8l-30 -19l-23 23l18 31l-7 11l-35 -5l-12 29l28 22l-2 12l-35 9v32l35 9l2 12l-29 22l12 30l36 -5
+l7 10l-19 32l22 22l32 -19l11 8l-4 35l29 13l22 -29l12 2l9 35h32l9 -35l12 -2l22 28l29 -12l-5 -35l11 -8l30 18l22 -23l-17 -30l7 -10l35 5l12 -30l-28 -21l3 -13l33 -9v-32zM356 127l-26 20l6 33l32 8v7l-32 8l-6 33l26 19l-3 7l-32 -5l-19 27l17 28l-5 6l-28 -17l-28 18
+l5 34l-6 2l-20 -26l-32 6l-8 33h-7l-9 -33l-32 -6l-20 27l-7 -3l5 -34l-28 -18l-9 6l-21 12l-5 -5l18 -30l-18 -27l-33 5l-3 -7l27 -20l-6 -32l-33 -8v-7l33 -9l6 -32l-27 -20l3 -6l33 4l18 -27l-17 -29l5 -6l29 18l28 -18l-5 -33l7 -3l19 27l33 -7l8 -31h8l7 31l33 7
+l20 -26l7 3l-5 32l26 18l28 -16l5 5l-16 27l19 28l32 -4zM192 320c71 0 128 -57 128 -128s-57 -128 -128 -128s-128 57 -128 128s57 128 128 128zM80 192c0 -7 1 -15 2 -22l104 28l28 104c-7 1 -15 2 -22 2c-30 0 -58 -12 -79 -33s-33 -49 -33 -79zM192 80c27 0 53 10 73 27
+l-75 75l-104 -28c6 -15 15 -29 27 -41c21 -21 49 -33 79 -33zM276 118c18 20 28 47 28 74c0 30 -12 58 -33 79c-12 12 -26 22 -42 27l-28 -105z" />
+    <glyph glyph-name="ion-ios-cog" unicode="&#xf412;" horiz-adv-x="384" 
+d="M229 298c16 -5 30 -15 42 -27c21 -21 33 -49 33 -79c0 -27 -10 -54 -28 -74l-75 75zM214 302l-28 -104l-104 -28c-1 7 -2 15 -2 22c0 30 12 58 33 79s49 33 79 33c7 0 15 -1 22 -2zM86 154l104 28l75 -75c-20 -17 -46 -27 -73 -27c-30 0 -58 12 -79 33
+c-12 12 -21 26 -27 41zM384 175l-33 -8l-3 -14l27 -20l-12 -30l-34 5l-8 -11l17 -29l-23 -23l-29 17l-10 -7l5 -34l-29 -12l-21 27l-14 -3l-8 -33h-32l-9 33l-13 3l-21 -28l-29 12l4 34l-11 8l-30 -19l-23 23l18 31l-7 11l-35 -5l-12 29l28 22l-2 12l-35 9v32l35 9l2 12
+l-29 22l12 30l36 -5l7 10l-19 32l22 22l32 -19l11 8l-4 35l29 13l22 -29l12 2l9 35h32l9 -35l12 -2l22 28l29 -12l-5 -35l11 -8l30 18l22 -23l-17 -30l7 -10l35 5l12 -30l-28 -21l3 -13l33 -9v-32zM192 64c71 0 128 57 128 128s-57 128 -128 128s-128 -57 -128 -128
+s57 -128 128 -128z" />
+    <glyph glyph-name="ion-ios-color-filter-outline" unicode="&#xf413;" horiz-adv-x="384" 
+d="M302 236c47 -13 82 -57 82 -108c0 -62 -50 -112 -112 -112c-31 0 -60 13 -80 34c-20 -21 -49 -34 -80 -34c-62 0 -112 50 -112 112c0 51 35 95 82 108c-1 7 -2 13 -2 20c0 62 50 112 112 112s112 -50 112 -112c0 -7 -1 -13 -2 -20zM96 256c0 -6 0 -12 1 -17
+c5 1 10 1 15 1c31 0 60 -13 80 -34c20 21 49 34 80 34c5 0 10 0 15 -1c1 5 1 11 1 17c0 53 -43 96 -96 96s-96 -43 -96 -96zM208 128c0 6 0 12 -1 17c-5 -1 -10 -1 -15 -1s-10 0 -15 1c-1 -5 -1 -11 -1 -17c0 -20 6 -38 16 -53c10 15 16 33 16 53zM192 160c3 0 7 1 10 1
+c-3 7 -6 14 -10 20c-4 -6 -7 -13 -10 -20c3 0 7 -1 10 -1zM166 164c4 11 9 21 16 30c-18 18 -43 30 -70 30c-3 0 -7 -1 -10 -1c10 -29 34 -51 64 -59zM202 194c7 -9 12 -19 16 -30c30 8 54 30 64 59c-3 0 -7 1 -10 1c-27 0 -52 -12 -70 -30zM112 32c27 0 52 12 70 30
+c-14 19 -22 41 -22 66c0 7 1 13 2 20c-36 10 -64 37 -76 72c-40 -11 -70 -48 -70 -92c0 -53 43 -96 96 -96zM272 32c53 0 96 43 96 96c0 44 -30 81 -70 92c-12 -35 -40 -62 -76 -72c1 -7 2 -13 2 -20c0 -25 -8 -47 -22 -66c18 -18 43 -30 70 -30z" />
+    <glyph glyph-name="ion-ios-color-filter" unicode="&#xf414;" horiz-adv-x="384" 
+d="M302 236c47 -13 82 -57 82 -108c0 -62 -50 -112 -112 -112c-31 0 -60 13 -80 34c-20 -21 -49 -34 -80 -34c-62 0 -112 50 -112 112c0 51 35 95 82 108c-1 7 -2 13 -2 20c0 62 50 112 112 112s112 -50 112 -112c0 -7 -1 -13 -2 -20zM192 53l1 -2c3 3 6 7 9 11
+c14 19 22 41 22 66c0 7 -1 13 -2 20c36 10 64 37 76 72c2 5 3 10 4 15c-1 0 -2 1 -3 1v1c-4 1 -8 1 -12 2c-5 1 -10 1 -15 1c-31 0 -60 -13 -80 -34c-20 21 -49 34 -80 34c-5 0 -10 0 -15 -1c-4 -1 -8 -1 -12 -2v-1c-1 0 -2 -1 -3 -1c1 -5 2 -10 4 -15c12 -35 40 -62 76 -72
+c-1 -7 -2 -13 -2 -20c0 -25 8 -47 22 -66c3 -4 6 -8 9 -11zM207 145c1 -5 1 -11 1 -17c0 -20 -6 -38 -16 -53c-10 15 -16 33 -16 53c0 6 0 12 1 17c5 -1 10 -1 15 -1s10 0 15 1zM282 223c-10 -29 -34 -51 -64 -59c-4 11 -9 21 -16 30c18 18 43 30 70 30c3 0 7 -1 10 -1z
+M202 161c-3 0 -7 -1 -10 -1s-7 1 -10 1c3 7 6 14 10 20c4 -6 7 -13 10 -20zM112 224c27 0 52 -12 70 -30c-7 -9 -12 -19 -16 -30c-30 8 -54 30 -64 59c3 0 7 1 10 1z" />
+    <glyph glyph-name="ion-ios-color-wand-outline" unicode="&#xf415;" horiz-adv-x="384" 
+d="M128 298l256 -256l-34 -34l-256 256zM149 232l201 -201l11 11l-201 202zM120 344v40h16v-40h-16zM120 140v40h16v-40h-16zM216 256v16h40v-16h-40zM0 256v16h40v-16h-40zM47 354l29 -29l-12 -11l-28 28zM76 198l-29 -28l-11 11l28 28zM220 342l-28 -28l-12 11l29 29z" />
+    <glyph glyph-name="ion-ios-color-wand" unicode="&#xf416;" horiz-adv-x="396" 
+d="M140 289l256 -257l-34 -34l-256 257zM124 322v64h32v-64h-32zM124 118v64h32v-64h-32zM216 238v32h64v-32h-64zM246 336l-45 -45l-23 22l45 46zM34 336l23 23l45 -46l-23 -22zM34 169l45 45l23 -22l-45 -46zM0 238v32h64v-32h-64z" />
+    <glyph glyph-name="ion-ios-compose-outline" unicode="&#xf417;" horiz-adv-x="384" 
+d="M304 32v208l16 16v-240h-320v304h256l-16 -16h-224v-272h288zM174 164l171 171l11 -11l-180 -180h-32v32l180 180l11 -11l-171 -171zM380 368c2 -3 4 -6 4 -10s-2 -7 -4 -10l-12 -12l-21 21l-11 11v0l12 12c3 2 6 4 10 4s7 -2 10 -4z" />
+    <glyph glyph-name="ion-ios-compose" unicode="&#xf418;" horiz-adv-x="384" 
+d="M192 128l128 128v-240h-320v304h256l-128 -128v-64h64zM324 356l32 -32l-180 -180h-32v32zM380 368c2 -3 4 -6 4 -10s-2 -7 -4 -10l-12 -12l-21 21l-11 11v0l12 12c3 2 6 4 10 4s7 -2 10 -4z" />
+    <glyph glyph-name="ion-ios-contact-outline" unicode="&#xf419;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM208 383c-105 0 -191 -86 -191 -191c0 -47 17 -89 45 -122c18 8 62 24 90 32c2 1 3 0 3 10c0 11 -1 18 -4 24c-4 8 -7 20 -9 31c-4 5 -10 15 -14 33c-3 16 -1 22 1 28v2
+c1 4 0 23 -3 38c-2 10 1 34 15 52c9 12 27 26 58 28h18c32 -2 49 -16 58 -28c14 -18 17 -42 15 -52c-3 -15 -4 -34 -3 -38c0 0 1 -1 1 -2c2 -6 3 -12 0 -28c-4 -18 -10 -27 -14 -32c-2 -11 -5 -24 -9 -32c-3 -7 -6 -15 -6 -23c0 -10 0 -10 2 -11c27 -8 73 -24 93 -32
+c28 33 45 76 45 122c0 105 -86 191 -191 191z" />
+    <glyph glyph-name="ion-ios-contact" unicode="&#xf41a;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM208 1c59 0 111 27 146 69c-20 8 -66 24 -93 32c-2 1 -3 1 -3 11c0 8 4 16 7 23c4 8 7 21 9 32c4 5 10 14 14 32c3 16 2 22 0 28c0 0 -1 1 -1 2c-1 4 0 23 3 38c2 10 -1 34 -15 52
+c-9 12 -26 26 -58 28h-18c-31 -2 -49 -16 -58 -28c-14 -18 -17 -42 -15 -52c3 -15 4 -34 3 -38v-2c-2 -6 -4 -12 -1 -28c4 -18 10 -28 14 -33c2 -11 5 -23 9 -31c3 -6 4 -13 4 -24c0 -10 -1 -9 -3 -10c-28 -8 -72 -24 -90 -32c35 -42 87 -69 146 -69z" />
+    <glyph glyph-name="ion-ios-copy-outline" unicode="&#xf41b;" horiz-adv-x="288" 
+d="M192 352v-64h64v-16h-80v80h16zM213 384l75 -75v-261h-48v-48h-240v336h48v48h165zM224 16v32h-176v272h-32v-304h208zM272 64v238l-65 66h-143v-304h208z" />
+    <glyph glyph-name="ion-ios-copy" unicode="&#xf41c;" horiz-adv-x="288" 
+d="M32 32h16h192v-32h-240v336h32v-288v-16zM213 384l75 -75v-261h-48h-192v288v48h165zM256 272v16h-64v64h-16v-80h80z" />
+    <glyph glyph-name="ion-ios-crop-strong" unicode="&#xf41d;" horiz-adv-x="384" 
+d="M64 336v48h32v-48h-32zM96 96h176v-32h-208v208h32v-176zM336 64v32h48v-32h-48zM0 320h320v-320h-32v288h-288v32z" />
+    <glyph glyph-name="ion-ios-crop" unicode="&#xf41e;" horiz-adv-x="384" 
+d="M64 336v48h16v-48h-16zM80 80h208v-16h-224v224h16v-208zM336 64v16h48v-16h-48zM0 320h320v-320h-16v304h-304v16z" />
+    <glyph glyph-name="ion-ios-download-outline" unicode="&#xf41f;" horiz-adv-x="320" 
+d="M192 304h128v-304h-320v304h128v-16h-112v-272h288v272h-112v16zM97 196l55 -55v243h16v-243l55 55l11 -12l-74 -74l-74 74z" />
+    <glyph glyph-name="ion-ios-download" unicode="&#xf420;" horiz-adv-x="320" 
+d="M168 304h152v-304h-320v304h152v-163l-55 55l-11 -12l74 -74l74 74l-11 12l-55 -55v163zM152 304v80h16v-80h-16z" />
+    <glyph glyph-name="ion-ios-drag" unicode="&#xf421;" horiz-adv-x="352" 
+d="M0 128v16h352v-16h-352zM0 184v16h352v-16h-352zM0 240v16h352v-16h-352z" />
+    <glyph glyph-name="ion-ios-email-outline" unicode="&#xf422;" horiz-adv-x="384" 
+d="M0 320h384v-256h-384v256zM192 180l163 124h-326zM16 80h352v214l-115 -88l68 -77l-2 -2l-79 70l-48 -37l-48 37l-79 -70l-2 2l68 77l-115 88v-214z" />
+    <glyph glyph-name="ion-ios-email" unicode="&#xf423;" horiz-adv-x="384" 
+d="M384 64h-384v242l131 -100l-68 -77l2 -2l79 70l48 -37l48 37l79 -70l2 2l-68 77l131 100v-242zM376 320l-184 -140l-184 140h368z" />
+    <glyph glyph-name="ion-ios-eye-outline" unicode="&#xf424;" horiz-adv-x="384" 
+d="M383 192l1 -1l-6 -6c-21 -21 -47 -48 -78 -69c-36 -24 -72 -36 -108 -36c-83 0 -130 49 -185 105l-7 7l1 1c39 40 67 64 94 81c32 20 63 30 97 30c83 0 146 -60 191 -112zM192 288c-62 0 -111 -36 -170 -96c24 -24 48 -50 76 -68c30 -20 60 -28 94 -28
+c75 0 133 56 171 95c-26 29 -50 50 -74 66c-32 21 -64 31 -97 31zM192 112c-44 0 -80 36 -80 80s36 80 80 80s80 -36 80 -80s-36 -80 -80 -80zM192 256c-35 0 -64 -29 -64 -64s29 -64 64 -64s64 29 64 64s-29 64 -64 64zM224 192h16v0c0 -26 -22 -48 -48 -48s-48 21 -48 48
+s22 48 48 48v-16c-16 0 -32 -13 -32 -31s15 -33 32 -33s32 14 32 32v0z" />
+    <glyph glyph-name="ion-ios-eye" unicode="&#xf425;" horiz-adv-x="384" 
+d="M383 192l1 -1l-6 -6c-21 -21 -47 -48 -78 -69c-36 -24 -72 -36 -108 -36c-83 0 -130 49 -185 105l-7 7l1 1c39 40 67 64 94 81c32 20 63 30 97 30c83 0 146 -60 191 -112zM192 112c44 0 80 36 80 80s-36 80 -80 80s-80 -36 -80 -80s36 -80 80 -80zM186 221
+c0 -19 16 -35 35 -35c7 0 14 2 19 6v0c0 -27 -22 -48 -48 -48s-48 21 -48 48s22 48 48 48c-4 -5 -6 -12 -6 -19z" />
+    <glyph glyph-name="ion-ios-fastforward-outline" unicode="&#xf426;" 
+d="M16 293v-202l184 101zM240 292v0v-78v-27v-95l176 100zM224 320v0l224 -128l-224 -128v123l-224 -123v256l224 -123v123z" />
+    <glyph glyph-name="ion-ios-fastforward" unicode="&#xf427;" 
+d="M224 320v0l224 -128l-224 -128v123l-224 -123v256l224 -123v123z" />
+    <glyph glyph-name="ion-ios-filing-outline" unicode="&#xf428;" horiz-adv-x="352" 
+d="M288 320l64 -96v-160h-176h-176v160l64 96h224zM333 224l-45 68v-68h45zM80 304v-80h48c0 -26 22 -48 48 -48s48 22 48 48h48v80h-192zM64 292l-45 -68h45v68zM336 80v128h-98c-7 -28 -32 -48 -62 -48s-55 20 -62 48h-98v-128h160h160z" />
+    <glyph glyph-name="ion-ios-filing" unicode="&#xf429;" horiz-adv-x="352" 
+d="M176 160c30 0 55 20 62 48h114v-144h-176h-176v144h114c7 -28 32 -48 62 -48zM64 224h-7h-57l64 96v0v-80h16v80h192v-80h16v80v0l64 -96h-56h-8h-16h-8h-40c0 -26 -22 -48 -48 -48s-48 22 -48 48h-39h-9h-16z" />
+    <glyph glyph-name="ion-ios-film-outline" unicode="&#xf42a;" horiz-adv-x="400" 
+d="M0 360h400v-336h-400v336zM72 40v48h-56v-48h56zM72 104v48h-56v-48h56zM72 168v48h-56v-48h56zM72 232v48h-56v-48h56zM72 296v48h-56v-48h56zM312 40v144h-224v-144h224zM312 200v144h-224v-144h224zM384 40v48h-56v-48h56zM384 104v48h-56v-48h56zM384 168v48h-56v-48
+h56zM384 232v48h-56v-48h56zM384 296v48h-56v-48h56z" />
+    <glyph glyph-name="ion-ios-film" unicode="&#xf42b;" horiz-adv-x="400" 
+d="M0 360h400v-336h-400v336zM72 40v48h-56v-48h56zM72 104v48h-56v-48h56zM72 168v48h-56v-48h56zM72 232v48h-56v-48h56zM72 296v48h-56v-48h56zM312 184v16h-224v-16h224zM384 40v48h-56v-48h56zM384 104v48h-56v-48h56zM384 168v48h-56v-48h56zM384 232v48h-56v-48h56z
+M384 296v48h-56v-48h56z" />
+    <glyph glyph-name="ion-ios-flag-outline" unicode="&#xf42c;" horiz-adv-x="256" 
+d="M240 336c6 1 11 1 16 2v-16v-157c-5 -1 -10 -1 -16 -2c-11 -1 -24 -3 -39 -3c-25 0 -47 4 -69 9s-42 13 -64 13c-30 0 -46 -5 -52 -7v-143h-16v142v162v2l3 3c2 1 18 11 65 11c24 0 45 -4 67 -9c21 -4 42 -11 65 -11c15 0 29 3 40 4zM240 179v0v141c-11 -1 -25 -4 -40 -4
+c-25 0 -46 6 -68 11s-42 9 -64 9c-30 0 -46 -5 -52 -7v-137c10 3 26 6 52 6c24 0 45 -8 67 -13c21 -4 43 -9 66 -9c15 0 28 2 39 3z" />
+    <glyph glyph-name="ion-ios-flag" unicode="&#xf42d;" horiz-adv-x="256" 
+d="M240 336c6 1 11 1 16 2v-16v-157c-5 -1 -10 -1 -16 -2c-11 -1 -24 -3 -39 -3c-25 0 -47 4 -69 9s-42 13 -64 13c-30 0 -46 -5 -52 -7v-143h-16v142v162v2l3 3c2 1 18 11 65 11c24 0 45 -4 67 -9c21 -4 42 -11 65 -11c15 0 29 3 40 4z" />
+    <glyph glyph-name="ion-ios-flame-outline" unicode="&#xf42e;" horiz-adv-x="256" 
+d="M96 416c87 -64 170 -179 159 -288c-13 -134 -104 -160 -127 -160s-127 40 -128 160c-1 146 122 143 96 288zM128 -24c0 0 40 36 40 80s-40 80 -40 80s-41 -36 -41 -80s41 -80 41 -80zM239 130c5 47 -10 99 -41 151c-22 36 -50 70 -83 99c0 -57 -24 -91 -49 -123
+c-26 -34 -50 -65 -50 -129c0 -25 5 -48 15 -68c8 -17 20 -32 35 -45c8 -7 16 -12 23 -16c-9 16 -18 35 -18 57c0 51 44 90 46 92l11 9l11 -9c2 -2 45 -41 45 -92c0 -23 -9 -44 -19 -60c7 4 13 8 20 14c14 12 25 27 34 44c11 21 17 47 20 76z" />
+    <glyph glyph-name="ion-ios-flame" unicode="&#xf42f;" horiz-adv-x="256" 
+d="M96 416c87 -64 170 -179 159 -288c-13 -134 -104 -160 -127 -160s-127 40 -128 160c-1 146 122 143 96 288zM128 -24c0 0 40 36 40 80s-40 80 -40 80s-41 -36 -41 -80s41 -80 41 -80z" />
+    <glyph glyph-name="ion-ios-flask-outline" unicode="&#xf430;" horiz-adv-x="384" 
+d="M373 78c8 -16 11 -32 11 -46c-1 -36 -27 -64 -63 -64h-256c-36 0 -64 27 -65 64c0 14 4 30 12 46l116 195v127h-16v16h16h16v-16v-16h48v-16h-48v-32h32v-16h-32v-32h48v-16h-48v-3l-2 -4l-15 -25h49v-16h-58l-92 -154c-13 -25 -14 -43 -2 -63c9 -14 23 -23 41 -23h256
+c17 0 33 8 41 22c5 8 6 17 6 26c0 12 -2 25 -9 38l-116 195l-3 4v131v16h16h16v-16h-16v-127zM44 73l72 119h153l72 -119c7 -11 10 -24 10 -33c-1 -24 -16 -40 -46 -40h-226c-30 0 -46 12 -46 40c0 9 4 22 11 33zM260 176h-135l-67 -111v0v0c-5 -8 -9 -19 -9 -25
+c0 -13 5 -17 6 -18c4 -4 13 -6 24 -6h226c10 0 18 3 23 7c4 4 7 10 7 18c0 6 -3 16 -8 24v0v0z" />
+    <glyph glyph-name="ion-ios-flask" unicode="&#xf431;" horiz-adv-x="384" 
+d="M327 65v0c5 -8 8 -18 8 -24c0 -8 -3 -14 -7 -18c-5 -4 -13 -7 -23 -7h-226c-11 0 -20 2 -24 6c-1 1 -6 5 -6 18c0 6 4 17 9 25v0v0l67 111h135l67 -111v0zM373 78c8 -16 11 -32 11 -46c-1 -36 -27 -64 -63 -64h-256c-36 0 -64 27 -65 64c0 14 4 30 12 46l116 195v127h-16
+v16h160v-16h-16v-127zM144 384v-16h48v16h-48zM144 336v-16h32v16h-32zM144 288v-16h48v16h-48zM127 240l-9 -16h58v16h-49zM351 40c0 9 -3 22 -10 33l-72 119h-154l-71 -119c-7 -11 -11 -24 -11 -33c0 -28 16 -40 46 -40h226c30 0 45 16 46 40z" />
+    <glyph glyph-name="ion-ios-flower-outline" unicode="&#xf432;" 
+d="M363 164c-29 0 -65 7 -93 14c-1 -3 -2 -6 -4 -9c25 -15 56 -36 76 -56c40 -40 53 -68 41 -80c-3 -3 -7 -4 -12 -4c-15 0 -38 15 -68 45c-20 20 -41 51 -56 76c-3 -2 -7 -3 -10 -4c7 -28 15 -64 15 -93c0 -56 -12 -85 -28 -85s-28 29 -28 85c0 29 8 65 15 93
+c-3 1 -7 2 -10 4c-15 -25 -36 -56 -56 -76c-30 -30 -53 -45 -68 -45c-5 0 -9 1 -12 4c-12 12 1 40 41 80c20 20 51 41 76 56c-2 3 -3 6 -4 9c-28 -7 -64 -14 -93 -14c-56 0 -85 12 -85 28s29 28 85 28c29 0 65 -8 93 -15c1 3 2 7 4 10c-25 15 -56 35 -76 55
+c-40 40 -53 68 -41 80c3 3 7 4 12 4c15 0 38 -14 68 -44c20 -20 41 -51 56 -76c3 2 7 3 10 4c-7 28 -15 64 -15 93c0 56 12 85 28 85s28 -29 28 -85c0 -29 -8 -65 -15 -93c3 -1 7 -2 10 -4c15 25 36 56 56 76c30 30 53 44 68 44c5 0 9 -1 12 -4c12 -12 -1 -40 -41 -80
+c-20 -20 -51 -40 -76 -55c2 -3 3 -7 4 -10c28 7 64 15 93 15c56 0 85 -12 85 -28s-29 -28 -85 -28zM288 193v-3c30 -7 56 -10 75 -10c21 0 39 2 52 5c10 3 14 6 16 7c-2 1 -6 4 -16 7c-13 3 -31 5 -52 5c-19 0 -45 -4 -75 -11zM314 299c-14 -14 -30 -35 -46 -61l2 -2
+c26 16 47 32 61 46c15 15 26 28 33 40c5 9 7 14 7 16c-4 0 -22 -4 -57 -39zM178 236l2 2c-16 26 -32 47 -46 61c-35 35 -53 39 -57 39c0 -2 2 -7 7 -16c7 -12 18 -25 33 -40c14 -14 35 -30 61 -46zM85 180c19 0 45 3 75 10v3c-30 7 -56 11 -75 11c-21 0 -39 -2 -52 -5
+c-10 -3 -14 -6 -16 -7c2 -1 5 -4 15 -7c13 -3 32 -5 53 -5zM134 85c14 14 30 35 46 61l-2 2c-26 -16 -47 -32 -61 -46c-15 -15 -26 -29 -33 -41c-5 -9 -7 -14 -7 -16c4 0 22 5 57 40zM270 148l-2 -2c16 -26 32 -47 46 -61c35 -35 53 -40 57 -40c0 2 -2 7 -7 16
+c-7 12 -18 26 -33 41c-14 14 -35 30 -61 46zM217 383c-3 -13 -5 -31 -5 -52c0 -19 4 -45 11 -75h2c7 30 11 56 11 75c0 21 -2 39 -5 52c-3 10 -6 14 -7 16c-1 -2 -4 -6 -7 -16zM231 0c3 13 5 32 5 53c0 19 -4 45 -11 75h-2c-7 -30 -11 -56 -11 -75c0 -21 2 -40 5 -53
+c3 -10 6 -13 7 -15c1 2 4 5 7 15zM224 160c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32zM313 42c10 -34 7 -53 -5 -58c-2 -1 -3 -1 -5 -1c-11 0 -25 13 -37 35c5 35 -2 76 -2 76s24 -34 49 -52zM302 -1c1 4 2 14 -3 34c-5 4 -10 9 -15 14
+c0 -9 0 -17 -1 -25c10 -16 16 -22 19 -23zM182 365c-6 -35 1 -75 1 -75s-27 35 -48 51c-10 35 -7 54 5 59c2 1 3 1 5 1c11 0 24 -12 37 -36zM164 337c0 9 0 17 1 25c-10 16 -16 21 -19 22c-1 -4 -2 -14 3 -34c5 -4 10 -8 15 -13zM50 149c35 -4 76 2 76 2s-34 -24 -51 -48
+c-12 -4 -26 -6 -35 -6c-13 0 -21 4 -24 11c-5 11 7 25 34 41zM66 117c4 5 8 10 13 15c-9 0 -17 0 -25 1c-16 -10 -21 -16 -22 -19c1 0 4 -1 8 -1c7 0 16 1 26 4zM432 276c5 -11 -7 -26 -34 -42c-35 5 -76 -2 -76 -2s33 25 51 49c13 4 26 5 35 5c13 0 21 -3 24 -10zM394 250
+c16 10 21 16 22 19c-1 0 -4 1 -8 1c-7 0 -16 -1 -26 -4c-4 -5 -8 -9 -13 -14c9 0 17 -1 25 -2zM131 39c31 24 53 55 53 55s-7 -39 -3 -71c-15 -26 -28 -39 -39 -39c-2 0 -4 0 -6 1c-11 5 -13 24 -5 54zM143 1c4 2 12 8 22 26c0 6 -1 13 -1 20c-6 -6 -13 -12 -19 -17
+c-4 -18 -3 -26 -2 -29zM312 398c11 -5 13 -22 5 -54c-29 -21 -53 -55 -53 -55s8 48 3 71c13 25 28 39 39 39c2 0 4 0 6 -1zM303 353c5 18 3 27 2 30c-4 -2 -12 -8 -22 -26c0 -6 1 -14 1 -21c6 6 13 12 19 17zM71 285c18 -24 55 -53 55 -53s-40 7 -70 3c-28 15 -43 32 -38 44
+c3 7 10 11 22 11c8 0 21 -1 31 -5zM33 273c2 -4 8 -12 26 -22c6 0 13 1 20 1c-6 6 -12 12 -17 18c-8 2 -16 4 -22 4c-4 0 -6 -1 -7 -1zM392 149c30 -17 43 -33 38 -45c-3 -7 -10 -10 -22 -10c-8 0 -19 1 -31 5c-20 27 -55 52 -55 52s45 -8 70 -2zM408 110c4 0 6 1 7 1
+c-2 4 -8 12 -26 22c-6 0 -13 -1 -20 -1c6 -6 12 -13 17 -19c8 -2 16 -3 22 -3z" />
+    <glyph glyph-name="ion-ios-flower" unicode="&#xf433;" 
+d="M363 220c56 0 85 -12 85 -28s-29 -28 -85 -28c-29 0 -65 7 -93 14c-1 -3 -2 -6 -4 -9c25 -15 56 -36 76 -56c40 -40 53 -68 41 -80s-40 1 -80 41c-20 20 -41 51 -56 76c-3 -2 -7 -3 -10 -4c7 -28 15 -64 15 -93c0 -56 -12 -85 -28 -85s-28 29 -28 85c0 29 8 65 15 93
+c-3 1 -7 2 -10 4c-15 -25 -36 -56 -56 -76c-40 -40 -68 -53 -80 -41s1 40 41 80c20 20 51 41 76 56c-2 3 -3 6 -4 9c-28 -7 -64 -14 -93 -14c-56 0 -85 12 -85 28s29 28 85 28c29 0 65 -8 93 -15c1 3 2 7 4 10c-25 15 -56 35 -76 55c-40 40 -53 68 -41 80s40 0 80 -40
+c20 -20 41 -51 56 -76c3 2 6 3 9 4c-7 28 -14 64 -14 93c0 56 12 85 28 85s28 -29 28 -85c0 -29 -7 -65 -14 -93c3 -1 6 -2 9 -4c15 25 36 56 56 76c40 40 68 52 80 40s-1 -40 -41 -80c-20 -20 -51 -40 -76 -55c2 -3 3 -7 4 -10c28 7 64 15 93 15zM264 94c0 0 24 -34 49 -52
+c10 -34 7 -53 -5 -58c-2 -1 -3 -1 -5 -1c-11 0 -25 13 -37 35c5 35 -2 76 -2 76zM183 290c0 0 -27 35 -48 51c-10 35 -7 54 5 59c2 1 3 1 5 1c11 0 24 -12 37 -36c-6 -35 1 -75 1 -75zM126 151c0 0 -34 -24 -51 -48c-12 -4 -26 -6 -35 -6c-13 0 -21 4 -24 11
+c-5 11 7 25 34 41c35 -4 76 2 76 2zM322 232c0 0 33 25 51 49c13 4 26 5 35 5c13 0 21 -3 24 -10c5 -11 -7 -26 -34 -42c-35 5 -76 -2 -76 -2zM131 39c31 24 53 55 53 55s-7 -39 -3 -71c-15 -26 -28 -39 -39 -39c-2 0 -4 0 -6 1c-11 5 -13 24 -5 54zM317 344
+c-29 -21 -53 -55 -53 -55s8 48 3 71c13 25 28 39 39 39c2 0 4 0 6 -1c11 -5 13 -22 5 -54zM56 235c-28 15 -43 32 -38 44c3 7 10 11 22 11c8 0 21 -1 31 -5c18 -24 55 -53 55 -53s-40 7 -70 3zM392 149c30 -17 43 -33 38 -45c-3 -7 -10 -10 -22 -10c-8 0 -19 1 -31 5
+c-20 27 -55 52 -55 52s45 -8 70 -2z" />
+    <glyph glyph-name="ion-ios-folder-outline" unicode="&#xf434;" 
+d="M425 352c13 0 23 -10 23 -23v-304c0 -14 -10 -25 -23 -25h-400c-13 0 -25 12 -25 25v336c0 13 11 23 25 23h112c8 0 12 -2 17 -7v0l23 -23c2 -2 3 -2 6 -2h242zM25 368c-4 0 -9 -3 -9 -7v-74c3 1 5 1 8 1h400c3 0 5 0 8 -1v42c0 4 -3 7 -7 7h-242c-7 0 -12 2 -17 7
+l-23 23c-2 2 -3 2 -6 2h-112zM432 25v239c0 4 -4 8 -8 8h-400c-4 0 -8 -4 -8 -8v-239c0 -4 5 -9 9 -9h400c4 0 7 5 7 9z" />
+    <glyph glyph-name="ion-ios-folder" unicode="&#xf435;" 
+d="M440 272c4 0 8 -4 8 -8v-239c0 -14 -10 -25 -23 -25h-400c-13 0 -25 12 -25 25v239c0 4 4 8 8 8h432zM425 352c13 0 23 -10 23 -23v-42c-3 1 -5 1 -8 1h-432c-3 0 -5 0 -8 -1v74c0 13 11 23 25 23h112c8 0 12 -2 17 -7v0l23 -23c2 -2 3 -2 6 -2h242z" />
+    <glyph glyph-name="ion-ios-football-outline" unicode="&#xf436;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM249 6c3 1 5 1 8 2l24 64l-20 39v1h-106l-20 -39l25 -65c2 -1 5 -1 7 -2c12 -3 25 -5 38 -5c14 0 30 2 44 5zM41 284c-15 -27 -23 -57 -24 -89l43 37v0zM142 371
+c-36 -14 -68 -38 -90 -69l22 -64l5 -2l49 -23l71 60v58zM277 201l-70 58l-69 -58v-1l18 -72h104l18 72zM399 195c-1 32 -9 63 -24 90l-19 -53v0zM364 302c-22 31 -54 56 -90 69l-58 -40v-58l71 -60l54 24zM18 175c3 -34 15 -66 33 -92l70 -1l21 39l-20 77l-1 1l-49 22z
+M295 82l70 1c18 26 30 58 33 92l-54 46l-50 -23l-20 -77zM207 345l47 32c-15 4 -30 6 -46 6s-32 -2 -47 -6zM118 66l-54 1c20 -23 46 -42 75 -53l-20 50zM277 14c29 11 55 30 75 53l-56 -1l-2 -3z" />
+    <glyph glyph-name="ion-ios-football" unicode="&#xf437;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM249 6c3 1 5 1 8 2l24 64l-20 39v1h-106l-20 -39l25 -65c2 -1 5 -1 7 -2c12 -3 25 -5 38 -5c14 0 30 2 44 5zM142 371c-36 -14 -68 -38 -90 -69l22 -64l5 -2l49 -23l71 60v58z
+M364 302c-22 31 -54 56 -90 69l-58 -40v-58l71 -60l54 24zM18 175c3 -34 15 -66 33 -92l70 -1l21 39l-20 77l-1 1l-49 22zM295 82l70 1c18 26 30 58 33 92l-54 46l-50 -23l-20 -77z" />
+    <glyph glyph-name="ion-ios-game-controller-a-outline" unicode="&#xf438;" 
+d="M163 208c3 0 5 -2 5 -5v-22c0 -3 -2 -5 -5 -5h-35v-35c0 -3 -3 -5 -6 -5h-21c-3 0 -5 2 -5 5v35h-35c-3 0 -5 3 -5 6v21c0 3 2 5 5 5h35v35c0 3 2 5 5 5h22c3 0 5 -2 5 -5v-35h35zM330 169c11 0 20 -8 20 -19s-9 -19 -20 -19s-19 8 -19 19s8 19 19 19zM288 211
+c11 0 19 -8 19 -19s-8 -19 -19 -19s-20 8 -20 19s9 19 20 19zM373 211c11 0 19 -8 19 -19s-8 -19 -19 -19s-20 8 -20 19s9 19 20 19zM330 253c11 0 20 -8 20 -19s-9 -20 -20 -20s-19 9 -19 20s8 19 19 19zM337 286h-226c-26 0 -49 -9 -67 -26s-28 -41 -28 -67s10 -51 28 -68
+s41 -27 67 -27h226c26 0 49 10 67 27s28 42 28 68s-10 50 -28 67s-41 26 -67 26zM337 302v0c61 0 111 -45 111 -109s-50 -111 -111 -111h-226c-61 0 -111 47 -111 111s50 109 111 109h226z" />
+    <glyph glyph-name="ion-ios-game-controller-a" unicode="&#xf439;" 
+d="M337 302c61 0 111 -45 111 -109s-50 -111 -111 -111h-226c-61 0 -111 47 -111 111s50 109 111 109h226zM168 181v0v22c0 3 -2 5 -5 5h-35v35c0 3 -2 5 -5 5h-22c-3 0 -5 -2 -5 -5v-35h-35c-3 0 -5 -2 -5 -5v-21c0 -3 2 -6 5 -6h35v-35c0 -3 2 -5 5 -5h21c3 0 6 2 6 5v35
+h35c3 0 5 2 5 5zM288 173c11 0 19 8 19 19s-8 19 -19 19s-20 -8 -20 -19s9 -19 20 -19zM330 131c11 0 20 8 20 19s-9 19 -20 19s-19 -8 -19 -19s8 -19 19 -19zM330 214c11 0 20 9 20 20s-9 19 -20 19s-19 -8 -19 -19s8 -20 19 -20zM373 173c11 0 19 8 19 19s-8 19 -19 19
+s-20 -8 -20 -19s9 -19 20 -19z" />
+    <glyph glyph-name="ion-ios-game-controller-b-outline" unicode="&#xf43a;" 
+d="M276 244c11 0 20 -9 20 -20s-9 -20 -20 -20s-20 9 -20 20s9 20 20 20zM320 200c11 0 20 -9 20 -20s-9 -20 -20 -20s-20 9 -20 20s9 20 20 20zM103 264c22 0 39 -18 39 -40s-17 -40 -39 -40s-39 18 -39 40s17 40 39 40zM103 205c11 0 19 8 19 19s-8 19 -19 19
+s-19 -8 -19 -19s8 -19 19 -19zM320 288c11 0 20 -9 20 -20s-9 -20 -20 -20s-20 9 -20 20s9 20 20 20zM364 244c11 0 20 -9 20 -20s-9 -20 -20 -20s-20 9 -20 20s9 20 20 20zM434 199c21 -88 18 -152 -7 -164c-4 -2 -9 -3 -13 -3c-22 0 -45 24 -68 52c-26 32 -32 33 -110 33
+h-24c-78 0 -84 -1 -110 -33c-23 -28 -46 -52 -68 -52c-4 0 -9 1 -13 3c-25 12 -28 76 -7 164s43 136 88 149c10 3 18 4 26 4c28 0 47 -15 96 -15s68 15 96 15c8 0 16 -1 26 -4c45 -13 67 -61 88 -149zM420 49c10 5 23 48 -1 146c-21 90 -43 128 -78 138c-8 2 -14 3 -21 3
+c-10 0 -19 -2 -30 -5c-16 -4 -36 -10 -66 -10s-50 6 -66 10c-11 3 -20 5 -30 5c-7 0 -13 -1 -21 -3c-35 -10 -57 -48 -78 -138c-24 -98 -11 -141 -1 -146c2 -1 4 -1 6 -1c6 0 14 4 23 12s19 18 32 34s24 28 44 34c17 5 38 5 79 5h24c41 0 62 0 79 -5c20 -6 31 -18 44 -34
+s23 -26 32 -34s17 -12 23 -12c2 0 4 0 6 1z" />
+    <glyph glyph-name="ion-ios-game-controller-b" unicode="&#xf43b;" 
+d="M103 243c11 0 19 -8 19 -19s-8 -19 -19 -19s-19 8 -19 19s8 19 19 19zM434 199c21 -88 18 -152 -7 -164c-4 -2 -9 -3 -13 -3c-22 0 -45 24 -68 52c-26 32 -32 33 -110 33h-24c-78 0 -84 -1 -110 -33c-23 -28 -46 -52 -68 -52c-4 0 -9 1 -13 3c-25 12 -28 76 -7 164
+s43 136 88 149c10 3 18 4 26 4c28 0 47 -15 96 -15s68 15 96 15c8 0 16 -1 26 -4c45 -13 67 -61 88 -149zM103 184c22 0 39 18 39 40s-17 40 -39 40s-39 -18 -39 -40s17 -40 39 -40zM276 204c11 0 20 9 20 20s-9 20 -20 20s-20 -9 -20 -20s9 -20 20 -20zM320 160
+c11 0 20 9 20 20s-9 20 -20 20s-20 -9 -20 -20s9 -20 20 -20zM320 248c11 0 20 9 20 20s-9 20 -20 20s-20 -9 -20 -20s9 -20 20 -20zM364 204c11 0 20 9 20 20s-9 20 -20 20s-20 -9 -20 -20s9 -20 20 -20z" />
+    <glyph glyph-name="ion-ios-gear-outline" unicode="&#xf43c;" horiz-adv-x="384" 
+d="M193 288c26 0 50 -10 68 -28s28 -42 28 -68s-10 -50 -28 -68s-42 -28 -68 -28s-50 10 -68 28s-28 42 -28 68s10 50 28 68s42 28 68 28zM193 112c44 0 80 36 80 80s-36 80 -80 80s-80 -36 -80 -80s36 -80 80 -80zM138 365c-10 -3 -20 -7 -30 -12c2 -8 1 -16 0 -24
+c-2 -13 -8 -25 -18 -35c-12 -12 -29 -19 -46 -19c-4 0 -9 0 -13 1c-5 -10 -9 -20 -12 -30c7 -4 12 -10 17 -17c8 -11 12 -24 12 -37s-4 -26 -12 -37c-5 -7 -10 -13 -17 -17c3 -10 7 -20 12 -30c4 1 9 1 13 1c17 0 34 -7 46 -19c10 -10 16 -22 18 -35c1 -8 2 -16 0 -24
+c10 -5 20 -9 30 -12c4 7 10 12 17 17c11 8 24 12 37 12s26 -4 37 -12c7 -5 13 -10 17 -17c10 3 20 7 30 12c-2 8 -1 16 0 24c2 13 8 25 18 35c12 12 29 19 46 19c4 0 9 0 13 -1c5 10 9 20 12 30c-7 4 -12 10 -17 17c-8 11 -12 24 -12 37s4 26 12 37c5 7 10 13 17 17
+c-3 10 -7 20 -12 30c-4 -1 -9 -1 -13 -1c-17 0 -34 7 -46 19c-10 10 -16 22 -18 35c-1 8 -2 16 0 24c-10 5 -20 9 -30 12c-4 -7 -10 -12 -17 -17c-11 -8 -24 -12 -37 -12s-26 4 -37 12c-7 5 -13 10 -17 17zM238 384v0c20 -5 40 -13 57 -24c-8 -18 -5 -40 10 -55
+c10 -10 22 -14 35 -14c7 0 14 1 20 4c11 -17 19 -37 24 -57c-19 -7 -32 -25 -32 -46s14 -39 32 -46c-5 -20 -13 -40 -24 -57c-6 3 -13 4 -20 4c-13 0 -25 -4 -35 -14c-15 -15 -18 -37 -10 -55c-17 -11 -37 -19 -57 -24c-7 18 -25 32 -46 32s-39 -14 -46 -32
+c-20 5 -40 13 -57 24c8 18 5 40 -10 55c-10 10 -22 14 -35 14c-7 0 -14 -1 -20 -4c-11 17 -19 37 -24 57c18 7 32 25 32 46s-13 39 -32 46c5 20 13 40 24 57c6 -3 13 -4 20 -4c13 0 25 4 35 14c15 15 18 37 10 55c17 11 37 19 57 24c7 -19 25 -32 46 -32s39 13 46 32z" />
+    <glyph glyph-name="ion-ios-gear" unicode="&#xf43d;" horiz-adv-x="384" 
+d="M352 192c0 -21 14 -39 32 -46c-5 -20 -13 -40 -24 -57c-6 3 -13 4 -20 4c-13 0 -25 -4 -35 -14c-15 -15 -18 -37 -10 -55c-17 -11 -37 -19 -57 -24c-7 18 -25 32 -46 32s-39 -14 -46 -32c-20 5 -40 13 -57 24c8 18 5 40 -10 55c-10 10 -22 14 -35 14c-7 0 -14 -1 -20 -4
+c-11 17 -19 37 -24 57c18 7 32 25 32 46s-13 39 -32 46c5 20 13 40 24 57c6 -3 13 -4 20 -4c13 0 25 4 35 14c15 15 18 37 10 55c17 11 37 19 57 24c7 -19 25 -32 46 -32s39 13 46 32c20 -5 40 -13 57 -24c-8 -18 -5 -40 10 -55c10 -10 22 -14 35 -14c7 0 14 1 20 4
+c11 -17 19 -37 24 -57c-19 -7 -32 -25 -32 -46zM193 112c44 0 80 36 80 80s-36 80 -80 80s-80 -36 -80 -80s36 -80 80 -80z" />
+    <glyph glyph-name="ion-ios-glasses-outline" unicode="&#xf43e;" 
+d="M433 201v0h15v-18h-15c-2 -22 -13 -43 -29 -58c-17 -16 -39 -25 -62 -25c-51 0 -92 41 -92 92v0v0c0 10 -12 22 -26 22s-26 -12 -26 -22v0v0c0 -51 -41 -92 -92 -92c-23 0 -45 9 -62 25c-16 15 -27 36 -29 58h-15v18h15c2 22 13 43 29 59c17 16 39 24 62 24
+c42 0 78 -27 89 -67c7 7 18 12 29 12s22 -5 29 -12c11 40 47 67 89 67c23 0 45 -9 62 -25c16 -15 27 -36 29 -58zM342 115c42 0 77 35 77 77s-35 77 -77 77s-77 -35 -77 -77s35 -77 77 -77zM106 115c42 0 77 35 77 77s-35 77 -77 77s-77 -35 -77 -77s35 -77 77 -77z" />
+    <glyph glyph-name="ion-ios-glasses" unicode="&#xf43f;" 
+d="M433 201v0h15v-18h-15c-2 -22 -13 -43 -29 -58c-17 -16 -39 -25 -62 -25c-51 0 -92 41 -92 92v0v0c0 10 -12 22 -26 22s-26 -12 -26 -22v0v0c0 -51 -41 -92 -92 -92c-23 0 -45 9 -62 25c-16 15 -27 36 -29 58h-15v18h15c2 22 13 43 29 59c17 16 39 24 62 24
+c42 0 78 -27 89 -67c7 7 18 12 29 12s22 -5 29 -12c11 40 47 67 89 67c23 0 45 -9 62 -25c16 -15 27 -36 29 -58z" />
+    <glyph glyph-name="ion-ios-grid-view-outline" unicode="&#xf440;" horiz-adv-x="384" 
+d="M384 256h-112v-128h112v-16h-112v-112h-16v112h-128v-112h-16v112h-112v16h112v128h-112v16h112v112h16v-112h128v112h16v-112h112v-16zM256 128v128h-128v-128h128z" />
+    <glyph glyph-name="ion-ios-grid-view" unicode="&#xf441;" horiz-adv-x="384" 
+d="M128 128v128h128v-128h-128zM0 384h384v-384h-384v384zM352 256v16h-80v80h-16v-80h-128v80h-16v-80h-80v-16h80v-128h-80v-16h80v-80h16v80h128v-80h16v80h80v16h-80v128h80z" />
+    <glyph glyph-name="ion-ios-heart-outline" unicode="&#xf442;" 
+d="M327 368c69 0 121 -43 121 -116c0 -31 -13 -71 -41 -105s-45 -52 -100 -88s-83 -43 -83 -43s-28 7 -83 43s-72 54 -100 88s-41 74 -41 105c0 73 52 116 121 116c39 0 82 -18 103 -53c21 35 64 53 103 53zM395 157c12 14 22 31 28 49c6 16 9 31 9 46c0 30 -10 56 -29 74
+c-9 8 -20 15 -33 19c-13 5 -28 7 -43 7c-38 0 -73 -18 -89 -45l-14 -23l-14 23c-16 27 -51 45 -89 45c-15 0 -30 -2 -43 -7c-13 -4 -24 -11 -33 -19c-19 -18 -29 -44 -29 -74c0 -15 3 -30 9 -46c6 -18 16 -35 28 -49c27 -32 42 -49 97 -85c40 -27 65 -36 74 -39
+c9 3 34 12 74 39c55 36 70 53 97 85z" />
+    <glyph glyph-name="ion-ios-heart" unicode="&#xf443;" 
+d="M327 368c69 0 121 -43 121 -116c0 -31 -13 -71 -41 -105s-45 -52 -100 -88s-83 -43 -83 -43s-28 7 -83 43s-72 54 -100 88s-41 74 -41 105c0 73 52 116 121 116c39 0 82 -18 103 -53c21 35 64 53 103 53z" />
+    <glyph glyph-name="ion-ios-help-empty" unicode="&#xf444;" horiz-adv-x="128" 
+d="M68 82c-9 0 -17 8 -17 17s8 17 17 17s17 -8 17 -17s-8 -17 -17 -17zM102 197c-23 -22 -22 -27 -23 -53h-19c1 28 7 43 30 64c11 10 19 24 19 39c0 24 -19 39 -42 39c-32 0 -49 -16 -48 -46h-19c0 42 25 62 68 62c33 0 60 -20 60 -54c0 -22 -11 -37 -26 -51z" />
+    <glyph glyph-name="ion-ios-help-outline" unicode="&#xf445;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM208 1c105 0 191 86 191 191s-86 191 -191 191s-191 -86 -191 -191s86 -191 191 -191zM212 302c33 0 60 -21 60 -55c0 -22 -11 -36 -26 -50c-23 -23 -22 -27 -23 -53h-19
+c1 28 7 43 30 64c11 10 19 23 19 38c0 24 -19 40 -42 40c-32 0 -49 -16 -48 -46h-19c0 42 25 62 68 62zM212 116c9 0 17 -8 17 -17s-8 -17 -17 -17s-17 8 -17 17s8 17 17 17z" />
+    <glyph glyph-name="ion-ios-help" unicode="&#xf446;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM212 82c9 0 17 8 17 17s-8 17 -17 17s-17 -8 -17 -17s8 -17 17 -17zM246 197c15 14 26 29 26 51c0 34 -27 54 -60 54c-43 0 -68 -20 -68 -62h19c-1 30 16 46 48 46
+c23 0 42 -15 42 -39c0 -15 -8 -29 -19 -39c-23 -21 -29 -36 -30 -64h19c1 26 0 31 23 53z" />
+    <glyph glyph-name="ion-ios-home-outline" unicode="&#xf447;" horiz-adv-x="384" 
+d="M192 336l160 -128v-208h-112v128h-96v-128h-112v208zM336 16v184l-144 116l-144 -116v-184h80v128h128v-128h80zM192 384l192 -153l-12 -12l-180 145l-180 -145l-12 12l32 25v96h64v-45zM80 294v42h-32v-67z" />
+    <glyph glyph-name="ion-ios-home" unicode="&#xf448;" horiz-adv-x="384" 
+d="M192 336l160 -128v-208h-112v128h-96v-128h-112v208zM192 384l192 -153l-12 -12l-180 145l-180 -145l-12 12l32 25v96h64v-45z" />
+    <glyph glyph-name="ion-ios-infinite-outline" unicode="&#xf449;" 
+d="M419 260c19 -19 29 -43 29 -68s-10 -49 -29 -68c-19 -18 -44 -28 -70 -28s-50 10 -69 28l-126 123c-15 15 -35 22 -56 22s-40 -7 -55 -22c-31 -30 -31 -80 0 -110c15 -15 34 -22 55 -22s41 7 56 22l43 42l13 -14l-42 -41c-19 -18 -44 -28 -70 -28s-50 10 -69 28
+c-19 19 -29 43 -29 68s10 49 29 68c19 18 43 28 69 28s51 -10 70 -28l126 -123c15 -15 34 -22 55 -22s41 7 56 22c31 30 31 80 0 110c-15 15 -35 22 -56 22s-40 -7 -55 -22l-43 -42l-13 14l42 41c19 18 44 28 70 28s50 -10 69 -28z" />
+    <glyph glyph-name="ion-ios-infinite" unicode="&#xf44a;" horiz-adv-x="464" 
+d="M433 266c20 -20 31 -46 31 -74s-11 -54 -31 -74s-48 -30 -76 -30s-55 10 -75 30l-125 123c-13 13 -32 20 -51 20s-37 -7 -50 -20s-21 -31 -21 -49c0 -19 8 -36 21 -49s31 -20 50 -20s38 7 51 20l39 38l25 -25l-39 -38c-20 -20 -48 -30 -76 -30s-55 10 -75 30
+s-31 46 -31 74s11 54 31 74s47 30 75 30s56 -10 76 -30l125 -123c13 -13 31 -20 50 -20s38 7 51 20s20 31 20 49c0 19 -7 36 -20 49s-32 20 -51 20s-37 -7 -50 -20l-39 -38l-25 25l39 38c20 20 48 30 76 30s55 -10 75 -30z" />
+    <glyph glyph-name="ion-ios-information-empty" unicode="&#xf44b;" horiz-adv-x="64" 
+d="M8 276c0 13 7 20 20 20s20 -7 20 -20s-7 -20 -20 -20s-20 7 -20 20zM48 104h16v-8h-64v8h16v120h-16v8h48v-128z" />
+    <glyph glyph-name="ion-ios-information-outline" unicode="&#xf44c;" horiz-adv-x="416" 
+d="M184 276c0 13 7 20 20 20s20 -7 20 -20s-7 -20 -20 -20s-20 7 -20 20zM224 104h16v-8h-64v8h16v120h-16v8h48v-128zM208 400c57 0 106 -20 147 -61s61 -90 61 -147s-20 -106 -61 -147s-90 -61 -147 -61s-106 20 -147 61s-61 90 -61 147s20 106 61 147s90 61 147 61z
+M208 1c53 0 98 19 135 56s56 82 56 135s-19 98 -56 135s-82 56 -135 56s-98 -19 -135 -56s-56 -82 -56 -135s19 -98 56 -135s82 -56 135 -56z" />
+    <glyph glyph-name="ion-ios-information" unicode="&#xf44d;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM204 296c-11 0 -20 -9 -20 -20s9 -20 20 -20s20 9 20 20s-9 20 -20 20zM240 96v8h-16v128h-48v-8h16v-120h-16v-8h64z" />
+    <glyph glyph-name="ion-ios-ionic-outline" unicode="&#xf44e;" horiz-adv-x="416" 
+d="M378 313c24 -34 38 -76 38 -121c0 -115 -92 -208 -207 -208s-209 93 -209 208s94 208 209 208c45 0 86 -14 120 -38c6 5 13 8 21 8c19 0 35 -16 35 -35c0 -8 -2 -16 -7 -22zM350 357c-12 0 -22 -10 -22 -22s10 -22 22 -22s22 10 22 22s-10 22 -22 22zM344 56
+c18 18 31 39 41 62c10 24 15 48 15 74s-5 51 -15 75c-5 13 -12 25 -20 36c-5 -2 -10 -3 -15 -3c-19 0 -35 16 -35 35c0 5 2 11 4 15c-11 8 -23 15 -36 20c-24 10 -49 14 -75 14s-51 -4 -75 -14c-23 -10 -43 -24 -61 -42s-31 -38 -41 -61c-10 -24 -15 -49 -15 -75
+s5 -50 15 -74c10 -23 23 -44 41 -62s38 -31 61 -41c24 -10 49 -15 75 -15s51 5 75 15c23 10 43 23 61 41zM208 288c53 0 96 -43 96 -96s-43 -96 -96 -96s-96 43 -96 96s43 96 96 96zM208 112c44 0 80 36 80 80s-36 80 -80 80s-79 -36 -79 -80s35 -80 79 -80z" />
+    <glyph glyph-name="ion-ios-keypad-outline" unicode="&#xf44f;" horiz-adv-x="384" 
+d="M331 107c30 0 53 -24 53 -54s-23 -53 -53 -53s-54 23 -54 53s24 54 54 54zM331 16c21 0 37 16 37 37s-16 38 -37 38s-38 -17 -38 -38s17 -37 38 -37zM192 107c30 0 53 -24 53 -54s-23 -53 -53 -53s-53 23 -53 53s23 54 53 54zM192 16c21 0 37 16 37 37s-16 38 -37 38
+s-37 -17 -37 -38s16 -37 37 -37zM53 107c30 0 54 -24 54 -54s-24 -53 -54 -53s-53 23 -53 53s23 54 53 54zM53 16c21 0 38 16 38 37s-17 38 -38 38s-37 -17 -37 -38s16 -37 37 -37zM331 245c30 0 53 -23 53 -53s-23 -53 -53 -53s-54 23 -54 53s24 53 54 53zM331 155
+c21 0 37 16 37 37s-16 37 -37 37s-38 -16 -38 -37s17 -37 38 -37zM192 245c30 0 53 -23 53 -53s-23 -53 -53 -53s-53 23 -53 53s23 53 53 53zM192 155c21 0 37 16 37 37s-16 37 -37 37s-37 -16 -37 -37s16 -37 37 -37zM53 245c30 0 54 -23 54 -53s-24 -53 -54 -53
+s-53 23 -53 53s23 53 53 53zM53 155c21 0 38 16 38 37s-17 37 -38 37s-37 -16 -37 -37s16 -37 37 -37zM331 277c-30 0 -54 24 -54 54s24 53 54 53s53 -23 53 -53s-23 -54 -53 -54zM331 368c-21 0 -38 -16 -38 -37s17 -38 38 -38s37 17 37 38s-16 37 -37 37zM192 384
+c30 0 53 -23 53 -53s-23 -54 -53 -54s-53 24 -53 54s23 53 53 53zM192 293c21 0 37 17 37 38s-16 37 -37 37s-37 -16 -37 -37s16 -38 37 -38zM53 384c30 0 54 -23 54 -53s-24 -54 -54 -54s-53 24 -53 54s23 53 53 53zM53 293c21 0 38 17 38 38s-17 37 -38 37
+s-37 -16 -37 -37s16 -38 37 -38z" />
+    <glyph glyph-name="ion-ios-keypad" unicode="&#xf450;" horiz-adv-x="384" 
+d="M331 107c30 0 53 -24 53 -54s-23 -53 -53 -53s-54 23 -54 53s24 54 54 54zM192 107c30 0 53 -24 53 -54s-23 -53 -53 -53s-53 23 -53 53s23 54 53 54zM53 107c30 0 54 -24 54 -54s-24 -53 -54 -53s-53 23 -53 53s23 54 53 54zM331 245c30 0 53 -23 53 -53
+s-23 -53 -53 -53s-54 23 -54 53s24 53 54 53zM192 245c30 0 53 -23 53 -53s-23 -53 -53 -53s-53 23 -53 53s23 53 53 53zM53 245c30 0 54 -23 54 -53s-24 -53 -54 -53s-53 23 -53 53s23 53 53 53zM331 277c-30 0 -54 24 -54 54s24 53 54 53s53 -23 53 -53s-23 -54 -53 -54z
+M192 384c30 0 53 -23 53 -53s-23 -54 -53 -54s-53 24 -53 54s23 53 53 53zM53 384c30 0 54 -23 54 -53s-24 -54 -54 -54s-53 24 -53 54s23 53 53 53z" />
+    <glyph glyph-name="ion-ios-lightbulb-outline" unicode="&#xf451;" horiz-adv-x="288" 
+d="M288 275c0 -31 -13 -59 -30 -83v0c-11 -15 -22 -28 -32 -45c-22 -38 -18 -73 -18 -82v-1h-128v1c0 7 3 44 -19 82c-10 17 -20 30 -31 45v0c-17 24 -30 52 -30 83c0 78 66 141 144 141s144 -63 144 -141zM239 194l6 8c16 22 27 47 27 73c0 33 -16 65 -40 89s-55 36 -88 36
+s-64 -12 -88 -36s-40 -56 -40 -89c0 -26 11 -51 27 -73l19 -26v0c5 -6 9 -13 13 -21c17 -29 21 -58 21 -75h16v112l-32 64h17l31 -64v-112h32v112l31 64h17l-32 -64v-112h16c0 17 4 45 21 75c8 14 16 25 24 36c1 1 1 2 2 3zM112 -32v16h64v-16h-64zM96 0v16h96v-16h-96z
+M96 32v16h96v-16h-96z" />
+    <glyph glyph-name="ion-ios-lightbulb" unicode="&#xf452;" horiz-adv-x="288" 
+d="M288 275c0 -31 -13 -59 -30 -83v0c-11 -15 -22 -28 -32 -45c-22 -38 -18 -73 -18 -82v-1h-32v128l32 64h-16l-32 -64v-128h-32v128l-31 64h-17l32 -64v-128h-32v1c0 7 3 44 -19 82c-10 17 -20 30 -31 45v0c-17 24 -30 52 -30 83c0 78 66 141 144 141s144 -63 144 -141z
+M112 -32v16h64v-16h-64zM96 0v16h96v-16h-96zM96 32v16h96v-16h-96z" />
+    <glyph glyph-name="ion-ios-list-outline" unicode="&#xf453;" horiz-adv-x="384" 
+d="M368 368h-352v-352h352v352zM384 384v0v-384h-384v384h384zM128 280v16h192v-16h-192zM128 184v16h192v-16h-192zM128 88v16h192v-16h-192zM64 288c0 11 5 16 16 16s16 -5 16 -16s-5 -16 -16 -16s-16 5 -16 16zM64 192c0 11 5 16 16 16s16 -5 16 -16s-5 -16 -16 -16
+s-16 5 -16 16zM64 96c0 11 5 16 16 16s16 -5 16 -16s-5 -16 -16 -16s-16 5 -16 16z" />
+    <glyph glyph-name="ion-ios-list" unicode="&#xf454;" horiz-adv-x="384" 
+d="M0 384h384v-384h-384v384zM80 80c9 0 16 7 16 16s-7 16 -16 16s-16 -7 -16 -16s7 -16 16 -16zM80 176c9 0 16 7 16 16s-7 16 -16 16s-16 -7 -16 -16s7 -16 16 -16zM80 272c9 0 16 7 16 16s-7 16 -16 16s-16 -7 -16 -16s7 -16 16 -16zM320 88v16h-192v-16h192zM320 184v16
+h-192v-16h192zM320 280v16h-192v-16h192z" />
+    <glyph glyph-name="ion-ios-location-outline" unicode="&#xf455;" horiz-adv-x="288" 
+d="M144 400c-34 0 -67 -13 -91 -37s-37 -57 -37 -91c0 -43 24 -107 70 -186c22 -38 44 -72 58 -91c14 19 36 53 58 91c46 79 70 143 70 186c0 34 -13 67 -37 91s-57 37 -91 37zM144 416v0c80 0 144 -64 144 -144c0 -112 -144 -304 -144 -304s-144 192 -144 304
+c0 80 64 144 144 144zM144 336c35 0 64 -29 64 -64s-29 -64 -64 -64s-64 29 -64 64s29 64 64 64zM144 225c26 0 47 21 47 47s-21 47 -47 47s-47 -21 -47 -47s21 -47 47 -47z" />
+    <glyph glyph-name="ion-ios-location" unicode="&#xf456;" horiz-adv-x="288" 
+d="M144 416c80 0 144 -64 144 -144c0 -112 -144 -304 -144 -304s-144 192 -144 304c0 80 64 144 144 144zM144 225c26 0 47 21 47 47s-21 47 -47 47s-47 -21 -47 -47s21 -47 47 -47z" />
+    <glyph glyph-name="ion-ios-locked-outline" unicode="&#xf457;" horiz-adv-x="320" 
+d="M264 224h56v-240h-320v240h56v72c0 57 47 104 104 104s104 -47 104 -104v-72zM72 296v-72h176v72c0 49 -39 88 -88 88s-88 -39 -88 -88zM304 0v208h-288v-208h288zM160 160c18 0 32 -14 32 -32c0 -15 -10 -27 -24 -31v-33h-16v33c-14 4 -24 16 -24 31c0 18 14 32 32 32z
+M160 112c9 0 16 7 16 16s-7 16 -16 16s-16 -7 -16 -16s7 -16 16 -16z" />
+    <glyph glyph-name="ion-ios-locked" unicode="&#xf458;" horiz-adv-x="320" 
+d="M264 224h56v-240h-320v240h56v72c0 57 47 104 104 104s104 -47 104 -104v-72zM168 97c14 4 24 16 24 31c0 18 -14 32 -32 32s-32 -14 -32 -32c0 -15 10 -27 24 -31v-33h16v33zM248 224v72c0 49 -39 88 -88 88s-88 -39 -88 -88v-72h176zM160 144c9 0 16 -7 16 -16
+s-7 -16 -16 -16s-16 7 -16 16s7 16 16 16z" />
+    <glyph glyph-name="ion-ios-loop-strong" unicode="&#xf459;" horiz-adv-x="512" 
+d="M256 400c115 0 208 -93 208 -208c0 -14 -1 -28 -4 -42l-1 -4l-24 5l1 4c2 12 4 24 4 37c0 101 -83 184 -184 184c-66 0 -127 -36 -160 -94l-2 -3l-21 11l2 4c37 65 106 106 181 106zM416 102l2 3l21 -11l-2 -4c-37 -65 -106 -106 -181 -106c-115 0 -208 93 -208 208
+c0 14 1 28 4 42l1 4l24 -5l-1 -4c-2 -12 -4 -24 -4 -37c0 -101 83 -184 184 -184c66 0 127 36 160 94zM384 192h128l-64 -64zM0 192l64 64l64 -64h-128z" />
+    <glyph glyph-name="ion-ios-loop" unicode="&#xf45a;" horiz-adv-x="489" 
+d="M478 192l11 -11l-52 -53l-53 53l10 11l43 -41zM449 192v0v0c0 -7 0 -14 -1 -21l-16 1c1 7 1 14 1 21c-1 103 -85 187 -188 187c-68 0 -131 -37 -164 -96l-14 8c36 64 104 104 178 104c112 0 203 -91 204 -202v0v-2zM409 100l14 -8c-36 -64 -104 -104 -178 -104
+c-111 0 -202 90 -204 200v0v3v1v0c0 7 0 14 1 21l16 -1c-1 -7 -1 -14 -1 -21c0 -103 85 -187 188 -187c68 0 131 37 164 96zM53 256l52 -53l-11 -11l-41 41l-42 -41l-11 11z" />
+    <glyph glyph-name="ion-ios-medical-outline" unicode="&#xf45b;" horiz-adv-x="364" 
+d="M364 260l-118 -68l118 -68l-32 -56l-118 69v-137h-64v137l-118 -69l-32 56l118 68l-118 68l32 56l118 -69v137h64v-137l118 69zM342 118l-128 74l128 74l-16 28l-128 -74v148h-32v-148l-128 74l-16 -28l128 -74l-128 -74l16 -28l128 74v-148h32v148l128 -74z" />
+    <glyph glyph-name="ion-ios-medical" unicode="&#xf45c;" horiz-adv-x="364" 
+d="M364 260l-118 -68l118 -68l-32 -56l-118 69v-137h-64v137l-118 -69l-32 56l118 68l-118 68l32 56l118 -69v137h64v-137l118 69z" />
+    <glyph glyph-name="ion-ios-medkit-outline" unicode="&#xf45d;" horiz-adv-x="416" 
+d="M224 240h-32v-48v-16h-16h-48v-32h48h16v-16v-48h32v48v16h16h48v32h-48h-16v16v48zM240 256v0v-64h64v-64h-64v-64h-64v64h-64v64h64v64h64zM288 320h128v-320h-416v320h128v32c0 18 10 32 29 32h99c19 0 32 -14 32 -32v-32zM144 350v-30h128v30c0 10 -7 18 -17 18h-97
+c-11 0 -14 -8 -14 -18zM400 16v288h-384v-288h384z" />
+    <glyph glyph-name="ion-ios-medkit" unicode="&#xf45e;" horiz-adv-x="416" 
+d="M224 176h16h48v-32h-48h-16v-16v-48h-32v48v16h-16h-48v32h48h16v16v48h32v-48v-16zM288 320h128v-320h-416v320h128v32c0 18 10 32 29 32h99c19 0 32 -14 32 -32v-32zM144 350v-30h128v30c0 10 -7 18 -17 18h-97c-11 0 -14 -8 -14 -18zM304 128v64h-64v64h-64v-64h-64
+v-64h64v-64h64v64h64z" />
+    <glyph glyph-name="ion-ios-mic-off" unicode="&#xf45f;" horiz-adv-x="280" 
+d="M266 -32l-258 440l14 8l258 -440zM128 95c-44 0 -79 37 -79 83v118l113 -193c-10 -5 -22 -8 -34 -8zM207 178c0 -10 -2 -19 -5 -28l-136 234c14 20 37 32 62 32c44 0 79 -38 79 -84v-154zM256 176c0 -28 -9 -54 -24 -75l-10 17c11 17 17 36 17 58v80h17v-80zM139 49v0
+v-63h69v-18h-161v18h73v63c-67 5 -120 60 -120 127v80h19v-80c0 -60 50 -109 110 -109c17 0 34 4 48 11l9 -16c-14 -7 -30 -12 -47 -13z" />
+    <glyph glyph-name="ion-ios-mic-outline" unicode="&#xf460;" horiz-adv-x="256" 
+d="M128 416c44 0 79 -38 79 -84v-154c0 -46 -35 -84 -79 -84s-79 38 -79 84v154c0 46 35 84 79 84zM191 178v154c0 37 -28 68 -63 68s-63 -31 -63 -68v-154c0 -37 28 -68 63 -68s63 31 63 68zM239 256h17v-80c0 -67 -51 -122 -117 -127v-63h69v-18h-161v18h73v63
+c-67 5 -120 60 -120 127v80h19v-80c0 -60 50 -109 110 -109s110 49 110 109v80z" />
+    <glyph glyph-name="ion-ios-mic" unicode="&#xf461;" horiz-adv-x="256" 
+d="M128 94c-44 0 -79 38 -79 84v154c0 46 35 84 79 84s79 -38 79 -84v-154c0 -46 -35 -84 -79 -84zM239 256h17v-80c0 -67 -51 -122 -117 -127v-63h69v-18h-161v18h73v63c-67 5 -120 60 -120 127v80h19v-80c0 -60 50 -109 110 -109s110 49 110 109v80z" />
+    <glyph glyph-name="ion-ios-minus-empty" unicode="&#xf462;" horiz-adv-x="256" 
+d="M256 183h-256v17h256v-17z" />
+    <glyph glyph-name="ion-ios-minus-outline" unicode="&#xf463;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM208 1c105 0 191 86 191 191s-86 191 -191 191s-191 -86 -191 -191s86 -191 191 -191zM80 183v17h256v-17h-256z" />
+    <glyph glyph-name="ion-ios-minus" unicode="&#xf464;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM336 183v17h-256v-17h256z" />
+    <glyph glyph-name="ion-ios-monitor-outline" unicode="&#xf465;" horiz-adv-x="480" 
+d="M480 64h-176v-16h64v-16h-257v16h64v16h-175v288h480v-288zM16 336v-256h448v256h-448z" />
+    <glyph glyph-name="ion-ios-monitor" unicode="&#xf466;" horiz-adv-x="480" 
+d="M480 64h-176v-16h64v-16h-257v16h64v16h-175v288h480v-288zM16 336v-256h448v256h-448zM32 96v224h416v-224h-416z" />
+    <glyph glyph-name="ion-ios-moon-outline" unicode="&#xf467;" horiz-adv-x="216" 
+d="M195 133c7 0 14 1 21 3c-4 -7 -7 -12 -12 -18c-21 -25 -53 -41 -88 -41c-64 0 -116 51 -116 115c0 52 34 96 81 111c7 2 14 3 22 4c-4 -6 -8 -12 -11 -18c-7 -14 -11 -30 -11 -47c0 -29 11 -56 32 -77s48 -32 77 -32h5zM116 93c25 0 48 9 65 24c-65 5 -116 59 -116 125
+c0 14 2 28 6 40c-33 -16 -55 -51 -55 -90c0 -55 45 -99 100 -99z" />
+    <glyph glyph-name="ion-ios-moon" unicode="&#xf468;" horiz-adv-x="216" 
+d="M195 133c7 0 14 1 21 3c-4 -7 -7 -12 -12 -18c-21 -25 -53 -41 -88 -41c-64 0 -116 51 -116 115c0 52 34 96 81 111c7 2 14 3 22 4c-4 -6 -8 -12 -11 -18c-7 -14 -11 -30 -11 -47c0 -29 11 -56 32 -77s48 -32 77 -32h5z" />
+    <glyph glyph-name="ion-ios-more-outline" unicode="&#xf469;" horiz-adv-x="320" 
+d="M160 210c-10 0 -18 -8 -18 -18s8 -18 18 -18s18 8 18 18s-8 18 -18 18zM160 224v0c18 0 32 -14 32 -32s-14 -32 -32 -32s-32 14 -32 32s14 32 32 32zM32 210c-10 0 -18 -8 -18 -18s8 -18 18 -18s18 8 18 18s-8 18 -18 18zM32 224v0c18 0 32 -14 32 -32s-14 -32 -32 -32
+s-32 14 -32 32s14 32 32 32zM288 210c-10 0 -18 -8 -18 -18s8 -18 18 -18s18 8 18 18s-8 18 -18 18zM288 224v0c18 0 32 -14 32 -32s-14 -32 -32 -32s-32 14 -32 32s14 32 32 32z" />
+    <glyph glyph-name="ion-ios-more" unicode="&#xf46a;" horiz-adv-x="320" 
+d="M160 224v0c18 0 32 -14 32 -32s-14 -32 -32 -32s-32 14 -32 32s14 32 32 32zM32 224v0c18 0 32 -14 32 -32s-14 -32 -32 -32s-32 14 -32 32s14 32 32 32zM288 224v0c18 0 32 -14 32 -32s-14 -32 -32 -32s-32 14 -32 32s14 32 32 32z" />
+    <glyph glyph-name="ion-ios-musical-note" unicode="&#xf46b;" horiz-adv-x="192" 
+d="M192 346v-1v-65c0 -3 -3 -6 -6 -5v0l-73 13v-192c0 -33 1 -80 -51 -82c-48 -2 -62 16 -62 41c0 19 9 39 51 41c22 1 37 1 45 1v273l90 -19l2 -1c2 0 3 -1 4 -3v0v-1v0z" />
+    <glyph glyph-name="ion-ios-musical-notes" unicode="&#xf46c;" horiz-adv-x="320" 
+d="M320 128c0 -34 4 -80 -49 -82c-49 -2 -62 16 -62 41c0 20 9 39 52 41c23 1 34 2 43 2v160l-191 -32v-161c0 -34 3 -81 -50 -83c-49 -2 -63 17 -63 42c0 20 9 39 52 41c23 1 35 1 44 1v237l224 35v-242z" />
+    <glyph glyph-name="ion-ios-navigate-outline" unicode="&#xf46d;" horiz-adv-x="416" 
+d="M208 384c-51 0 -99 -21 -135 -57s-57 -84 -57 -135s21 -99 57 -135s84 -57 135 -57s99 21 135 57s57 84 57 135s-21 99 -57 135s-84 57 -135 57zM208 400v0c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM304 288l-96 -224v128h-128z" />
+    <glyph glyph-name="ion-ios-navigate" unicode="&#xf46e;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM208 64l96 224l-224 -96h128v-128z" />
+    <glyph glyph-name="ion-ios-nutrition-outline" unicode="&#xf46f;" horiz-adv-x="384" 
+d="M294 214v0c6 -6 10 -14 10 -23c0 -11 -5 -20 -13 -26v0s-51 -37 -106 -77l-38 31c-2 2 -4 3 -6 3c-1 0 -2 0 -3 -1v0c-2 -2 -2 -6 1 -10l29 -35l-115 -84c-6 -4 -13 -8 -21 -8c-18 0 -32 14 -32 32c0 7 1 13 4 18v0c2 2 17 25 37 57l21 -17c2 -2 4 -2 6 -2c1 0 3 0 4 1v0
+c2 2 1 6 -2 10l-19 23c27 43 60 96 84 134l36 -30c2 -2 4 -3 6 -3c1 0 2 1 3 2v0c2 2 2 5 -1 9l-33 40c11 18 19 29 19 29v0c6 10 15 16 27 16c9 0 18 -4 24 -10v0l78 -79v0v0zM282 178c4 3 6 8 6 13c0 4 -2 9 -5 12l-5 4v1l-69 69v0l-5 5c-3 3 -8 5 -12 5
+c-6 0 -10 -3 -13 -8l-5 -8c-2 -3 -5 -7 -8 -12l25 -30v0l1 -1c8 -10 8 -22 0 -30l-1 -1l-1 -1c-4 -3 -8 -5 -13 -5s-11 2 -16 6v1h-1l-21 18l-24 -39l-44 -70l12 -14v0v0c8 -10 8 -23 0 -31v0c-4 -4 -9 -6 -15 -6c-5 0 -11 2 -16 6v0v0l-7 5c-3 -5 -5 -9 -8 -13
+c-12 -19 -16 -26 -18 -29c-1 -3 -2 -6 -2 -9c0 -9 7 -16 16 -16c3 0 6 2 11 5l101 74l-18 22h-1v0c-8 10 -8 23 0 31v0v0v0c4 4 10 6 15 6s11 -2 16 -6v0h1l28 -24c49 36 93 68 96 70zM376 333l8 -14l-5 -3l-103 -60l-17 17l71 123l2 4l14 -8l-3 -4l-63 -111l91 53z" />
+    <glyph glyph-name="ion-ios-nutrition" unicode="&#xf470;" horiz-adv-x="384" 
+d="M295 214v0c6 -6 9 -13 9 -22c0 -11 -5 -20 -13 -26v0s-51 -38 -106 -78l-38 32c-4 3 -8 3 -10 1v0c-2 -2 -2 -6 1 -10l29 -35l-114 -84c-6 -4 -13 -8 -21 -8c-18 0 -32 14 -32 32c0 7 2 13 5 18v0c1 2 16 25 36 57l20 -17c4 -3 8 -3 10 -1v0c2 2 2 6 -1 10l-20 23
+c27 43 60 96 84 134l36 -30c4 -3 8 -3 10 -1v0c2 2 2 6 -1 10l-33 40c11 18 18 29 18 29v0c6 10 16 16 28 16c9 0 18 -4 24 -10v0l78 -79l1 -1v0zM384 309l-103 -59l-28 29l70 121l28 -16l-50 -85l67 38z" />
+    <glyph glyph-name="ion-ios-paper-outline" unicode="&#xf471;" horiz-adv-x="384" 
+d="M48 384h336v-353c0 -17 -14 -31 -31 -31h-322c-17 0 -31 14 -31 31v305h32v-16h-16v-289c0 -8 7 -15 15 -15h322c8 0 15 7 15 15v337h-304v-320h-16v320v16zM96 320v16h128v-16h-128zM96 240v16h240v-16h-240zM96 160v16h192v-16h-192zM96 80v16h240v-16h-240z" />
+    <glyph glyph-name="ion-ios-paper" unicode="&#xf472;" horiz-adv-x="384" 
+d="M48 384h336v-353c0 -17 -14 -31 -31 -31h-322c-17 0 -31 14 -31 31v305h32v-288h16v288v32v16zM96 336v-16h128v16h-128zM96 176v-16h192v16h-192zM336 80v16h-240v-16h240zM336 240v16h-240v-16h240z" />
+    <glyph glyph-name="ion-ios-paperplane-outline" unicode="&#xf473;" horiz-adv-x="320" 
+d="M0 198l320 154l-146 -320l-57 115zM132 152l41 -83l115 249zM286 320l-248 -121l83 -36z" />
+    <glyph glyph-name="ion-ios-paperplane" unicode="&#xf474;" horiz-adv-x="320" 
+d="M0 198l320 154l-214 -200zM320 352l-146 -320l-52 104z" />
+    <glyph glyph-name="ion-ios-partlysunny-outline" unicode="&#xf475;" horiz-adv-x="384" 
+d="M144 298v54h16v-54h-16zM0 192v16h55v-16h-55zM44 299l10 11l32 -32l-11 -11zM223 268l-11 11l32 32l11 -11zM56 96l-10 11l31 31l11 -11zM129 153c-4 -3 -8 -7 -12 -12c-23 12 -39 36 -39 63c0 39 32 71 71 71c21 0 40 -10 53 -25c-4 -2 -9 -4 -14 -8
+c-10 11 -23 17 -39 17c-30 0 -55 -25 -55 -55c0 -23 15 -43 35 -51zM235 208c-34 0 -63 -28 -63 -62v-12s1 -10 1 -10c-5 0 -12 -1 -14 -1c-19 -3 -33 -18 -33 -37c0 -10 3 -19 10 -26s16 -11 26 -11h157c27 0 49 22 49 49s-22 50 -49 50c-2 0 -4 -1 -6 -1l-14 -2l-3 14
+c-3 14 -11 26 -22 35s-25 14 -39 14zM235 224v0c37 0 68 -26 76 -61h8c36 0 65 -29 65 -65s-29 -66 -65 -66h-157c-28 0 -52 24 -52 53c0 27 21 51 47 53v8c0 43 35 78 78 78z" />
+    <glyph glyph-name="ion-ios-partlysunny" unicode="&#xf476;" horiz-adv-x="384" 
+d="M144 298v54h16v-54h-16zM0 192v16h55v-16h-55zM44 299l10 11l32 -32l-11 -11zM223 268l-11 11l32 32l11 -11zM56 96l-10 11l31 31l11 -11zM235 224v0c37 0 68 -26 76 -61h8c36 0 65 -29 65 -65s-29 -66 -65 -66h-157c-28 0 -52 24 -52 53c0 27 21 51 47 53v8
+c0 43 35 78 78 78zM201 252l1 -2v0c-31 -5 -62 -43 -62 -75c0 -2 1 -5 1 -7l-1 -1h-1c-11 -6 -18 -14 -22 -26v1v-1c-23 12 -39 36 -39 63c0 39 32 71 71 71c21 0 39 -9 52 -23z" />
+    <glyph glyph-name="ion-ios-pause-outline" unicode="&#xf477;" horiz-adv-x="256" 
+d="M63 336h-47v-288h47v288zM79 352v0v-320h-79v320h79zM240 336h-47v-288h47v288zM256 352v0v-320h-79v320h79z" />
+    <glyph glyph-name="ion-ios-pause" unicode="&#xf478;" horiz-adv-x="256" 
+d="M0 32v320h79v-320h-79zM177 32v320h79v-320h-79z" />
+    <glyph glyph-name="ion-ios-paw-outline" unicode="&#xf479;" horiz-adv-x="384" 
+d="M380 252c6 -17 5 -38 -3 -57c-10 -25 -31 -43 -51 -43c-5 0 -10 1 -15 3c-22 10 -30 45 -17 79c10 28 31 46 51 46c5 0 10 -1 14 -3c10 -4 17 -13 21 -25zM362 202c6 15 7 31 2 44c-2 5 -5 12 -12 15c-2 1 -4 2 -7 2c-13 0 -28 -15 -36 -36c-9 -25 -6 -50 8 -56
+c2 -1 5 -1 8 -1c14 0 29 13 37 32zM90 234c13 -34 5 -69 -17 -79c-5 -2 -10 -3 -15 -3c-20 0 -41 18 -51 43c-8 19 -9 40 -3 57c4 12 11 21 21 25c4 2 9 3 14 3c20 0 41 -18 51 -46zM67 171c14 6 17 31 8 56c-8 21 -23 36 -36 36c-3 0 -5 -1 -7 -2c-7 -3 -10 -10 -12 -15
+c-5 -13 -4 -29 2 -44c8 -19 23 -32 37 -32c3 0 6 0 8 1zM134 237c-28 1 -52 32 -56 69c-2 23 4 45 16 60c8 10 19 17 31 18h6c27 -1 46 -29 50 -67c3 -24 -1 -48 -13 -63c-8 -9 -17 -15 -28 -16c-2 0 -4 -1 -6 -1zM107 356c-10 -12 -14 -29 -12 -48c3 -29 21 -53 40 -54h3
+c6 1 12 4 17 10c10 12 12 31 10 51c-3 29 -17 52 -35 53h-3c-9 -1 -16 -7 -20 -12zM192 208c64 0 128 -76 128 -149c0 -22 -11 -40 -22 -47c-13 -9 -23 -12 -42 -12c-23 0 -29 8 -40 15c-8 5 -14 10 -24 10s-16 -5 -24 -10c-11 -7 -17 -15 -40 -15c-19 0 -29 3 -42 12
+c-11 7 -22 25 -22 47c0 73 64 149 128 149zM290 27c6 4 14 16 14 32c0 30 -14 64 -36 91c-11 13 -23 24 -36 31c-13 8 -27 11 -40 11s-27 -3 -40 -11c-13 -7 -25 -18 -36 -31c-22 -27 -36 -61 -36 -91c0 -16 8 -28 14 -32c11 -7 18 -10 34 -10c14 0 19 4 26 9c2 1 4 3 6 4
+c9 6 18 12 32 12s23 -6 32 -12c2 -1 4 -3 6 -4c7 -5 12 -9 26 -9c16 0 23 3 34 10zM244 238c-11 1 -20 7 -28 16c-12 15 -16 39 -13 63c4 38 23 66 50 67h7c12 -1 22 -8 30 -18c12 -15 18 -37 16 -60c-4 -37 -28 -67 -56 -68h-6zM219 315c-2 -20 0 -39 10 -51
+c5 -6 11 -9 17 -10h3c19 1 38 25 41 54c2 19 -3 36 -13 48c-4 5 -10 11 -19 12h-4c-18 -1 -32 -24 -35 -53z" />
+    <glyph glyph-name="ion-ios-paw" unicode="&#xf47a;" horiz-adv-x="384" 
+d="M380 252c6 -17 5 -38 -3 -57c-10 -25 -31 -43 -51 -43c-5 0 -10 1 -15 3c-22 10 -30 45 -17 79c10 28 31 46 51 46c5 0 10 -1 14 -3c10 -4 17 -13 21 -25zM90 234c13 -34 5 -69 -17 -79c-5 -2 -10 -3 -15 -3c-20 0 -41 18 -51 43c-8 19 -9 40 -3 57c4 12 11 21 21 25
+c4 2 9 3 14 3c20 0 41 -18 51 -46zM134 237c-28 1 -52 32 -56 69c-2 23 4 45 16 60c8 10 19 17 31 18h6c27 -1 46 -29 50 -67c3 -24 -1 -48 -13 -63c-8 -9 -17 -15 -28 -16c-2 0 -4 -1 -6 -1zM192 208c64 0 128 -76 128 -149c0 -22 -11 -40 -22 -47c-13 -9 -23 -12 -42 -12
+c-23 0 -29 8 -40 15c-8 5 -14 10 -24 10s-16 -5 -24 -10c-11 -7 -17 -15 -40 -15c-19 0 -29 3 -42 12c-11 7 -22 25 -22 47c0 73 64 149 128 149zM244 238c-11 1 -20 7 -28 16c-12 15 -16 39 -13 63c4 38 23 66 50 67h7c12 -1 22 -8 30 -18c12 -15 18 -37 16 -60
+c-4 -37 -28 -67 -56 -68h-6z" />
+    <glyph glyph-name="ion-ios-people-outline" unicode="&#xf47b;" 
+d="M224 336v0v0zM317 113c11 -4 -11 4 0 0c28 -10 46 -35 46 -65h-28h-250c0 22 9 42 27 55c15 11 31 12 49 16c7 1 24 5 26 13s1 15 1 23c0 3 0 3 -2 5c-4 4 -6 9 -8 14c-2 8 -3 16 -4 24c-9 -2 -10 16 -12 21c-1 4 -7 24 3 21c-3 5 -4 13 -5 19c-2 13 -2 26 3 39
+c10 26 37 39 64 38c26 -1 51 -16 59 -42c4 -12 3 -26 1 -39c-1 -5 -2 -11 -4 -15c10 3 4 -20 3 -23c-2 -5 -3 -21 -12 -19c-1 -10 -2 -22 -7 -31c-1 -2 -7 -8 -7 -10v-11c0 -5 0 -10 2 -15s10 -7 14 -8c14 -5 27 -5 41 -10zM115 84c-6 -6 9 10 0 0c-6 -6 -10 -12 -12 -20h4
+h238c-4 15 -17 27 -30 33s-28 4 -41 9s-25 9 -28 25c-2 11 -2 22 -2 33c0 2 7 7 8 9c3 5 4 11 5 17c1 5 0 12 4 15c5 4 7 7 9 13c2 8 3 12 -1 19c-3 5 0 8 1 13c3 11 4 24 2 36c-8 37 -62 45 -86 19c-12 -13 -12 -31 -9 -47c1 -6 6 -14 3 -19c-1 -3 -5 -6 -4 -10
+c2 -5 2 -11 4 -16c2 -4 4 -6 7 -8s3 -6 3 -9c1 -7 2 -17 6 -23c3 -4 8 -6 8 -11v-21c-1 -8 -2 -18 -8 -24c-7 -6 -18 -10 -27 -12c-11 -3 -23 -3 -33 -7c-8 -3 -15 -8 -21 -14zM112 126c-15 -7 9 4 0 0c-9 -5 -18 -11 -25 -19c-1 -2 -6 -11 -7 -11h-25h-55c0 20 13 34 31 40
+c6 2 27 4 30 11c2 5 0 11 0 16c-10 -1 -24 1 -32 7c-2 2 3 9 4 12l3 12c1 9 1 19 1 28c0 16 -1 34 8 48c8 13 23 18 38 18c24 0 43 -13 47 -37c3 -16 1 -32 2 -48c0 -8 2 -16 5 -24c1 -2 5 -7 3 -9l-6 -3c-5 -2 -11 -3 -17 -4c-1 0 -8 0 -9 -1s0 -9 0 -11c0 -4 1 -6 5 -7
+c6 -2 19 -3 23 -8c2 -3 1 -5 -2 -5c-8 -1 -15 -1 -22 -5zM71 112c6 10 16 18 26 24c-9 9 -5 26 -4 37c0 2 0 5 2 5h8c6 0 11 1 17 2c-7 23 0 47 -5 70c-3 16 -15 23 -31 23c-17 0 -27 -9 -30 -25c-4 -22 3 -46 -4 -68c9 -1 17 -2 26 -2c1 0 1 -28 1 -29
+c-1 -12 -8 -18 -19 -22c-12 -4 -29 -3 -36 -15h49zM368 96c-2 8 -10 14 -16 19c-8 6 -18 13 -28 15c-3 1 -16 -1 -13 5c2 4 9 5 13 6s15 2 16 7c0 1 1 14 0 14c-6 0 -12 1 -18 2c-4 1 -7 2 -11 4c-6 3 -2 6 0 11c14 32 -10 88 32 105c15 6 34 5 48 -3c15 -9 20 -27 20 -44
+c0 -20 -4 -44 7 -62c2 -3 4 -4 0 -6c-2 -1 -4 -1 -6 -2l-12 -3s-9 -1 -13 -1c0 -4 -2 -13 1 -17c6 -7 21 -7 29 -10c18 -6 31 -20 31 -40h-80zM367 123c4 -4 -5 5 0 0s8 -11 15 -11h16h28c-7 12 -26 11 -38 16c-11 4 -16 12 -17 24c0 2 -1 27 1 27c9 0 18 0 26 1
+c-7 23 1 47 -4 70c-3 15 -15 23 -30 23c-17 0 -28 -8 -31 -25c-4 -23 2 -46 -5 -68c6 -2 12 -2 18 -2s8 1 9 -5c1 -11 5 -28 -4 -37c6 -4 11 -8 16 -13z" />
+    <glyph glyph-name="ion-ios-people" unicode="&#xf47c;" 
+d="M317 113c11 -4 -11 4 0 0v0zM317 113c28 -10 46 -35 46 -65h-28h-250c0 22 9 42 27 55c15 11 31 12 49 16c7 1 24 5 26 13s1 15 1 23c0 3 0 3 -2 5c-4 4 -6 9 -8 14c-2 8 -3 16 -4 24c-9 -2 -10 16 -12 21c-1 4 -7 24 3 21c-3 5 -4 13 -5 19c-2 13 -2 26 3 39
+c10 26 37 39 64 38c26 -1 51 -16 59 -42c4 -12 3 -26 1 -39c-1 -5 -2 -11 -4 -15c10 3 4 -20 3 -23c-2 -5 -3 -21 -12 -19c-1 -10 -2 -22 -7 -31c-1 -2 -7 -8 -7 -10v-11c0 -5 0 -10 2 -15s10 -7 14 -8c14 -5 27 -5 41 -10zM111 126h2h-1h-1zM111 126c-9 -5 -17 -11 -24 -19
+c-1 -2 -6 -11 -7 -11h-25h-55c0 20 12 34 30 40c6 2 27 4 30 11c2 5 1 11 1 16c-10 -1 -24 1 -32 7c-2 2 3 9 4 12c1 4 2 7 3 11c1 9 1 19 1 28c0 16 -1 35 8 49c8 13 23 18 38 18c24 0 43 -13 47 -37c3 -16 1 -32 2 -48c0 -8 2 -16 5 -24c1 -2 5 -7 3 -9l-6 -3
+c-5 -2 -11 -3 -17 -4c-1 0 -8 0 -9 -1s0 -9 0 -11c0 -4 1 -6 5 -7c6 -2 19 -3 23 -8c2 -3 1 -5 -2 -5c-7 -1 -14 -2 -21 -5c2 1 2 2 -1 0c-8 -4 -4 -2 -1 0zM417 136c18 -6 31 -20 31 -40h-80c-2 8 -10 14 -16 19c-8 6 -18 13 -28 15c-3 1 -16 -1 -13 5c2 4 9 5 13 6
+s15 2 16 7c0 1 1 14 0 14c-6 0 -12 1 -18 2c-4 1 -7 2 -11 4c-6 3 -2 6 0 11c14 32 -10 88 32 105c15 6 34 5 48 -3c15 -9 20 -27 20 -44c0 -20 -4 -44 7 -62c2 -3 4 -4 0 -6c-2 -1 -4 -1 -6 -2l-12 -3s-9 -1 -13 -1c0 -4 -2 -13 1 -17c6 -7 21 -7 29 -10z" />
+    <glyph glyph-name="ion-ios-person-outline" unicode="&#xf47d;" horiz-adv-x="320" 
+d="M106 246v0v0zM267 84c13 -5 53 -20 53 -52h-160h-160c0 32 40 47 53 52s31 6 43 9c7 2 17 5 20 9s1 41 1 41s-6 10 -9 18s-7 32 -7 32s-7 0 -9 12c-2 13 -6 17 -6 27c0 9 5 10 5 10v0s-4 13 -5 42c-1 34 25 68 74 68s75 -34 74 -68c-1 -29 -5 -42 -5 -42v0s5 -1 5 -10
+c0 -10 -3 -15 -6 -28c-2 -12 -9 -12 -9 -12s-4 -23 -7 -31s-9 -18 -9 -18s-2 -37 1 -41s13 -7 20 -9c12 -3 30 -4 43 -9zM160 48v0h137c-2 3 -4 6 -8 8c-7 5 -16 9 -27 13c-7 2 -17 4 -26 5c-6 1 -10 2 -15 3c-3 1 -21 5 -29 15c-4 5 -6 12 -6 32c0 10 1 20 1 20v4l2 4
+c1 2 6 9 8 15c2 5 5 19 6 28c0 0 0 -1 1 4s8 4 9 8s3 7 5 18s-5 12 -5 17c0 4 1 5 1 5v0c0 1 4 14 4 38c0 13 -5 26 -14 35c-11 11 -25 16 -44 16c-18 0 -34 -5 -45 -16c-9 -9 -13 -22 -13 -35c1 -24 4 -37 4 -38v0s1 -3 0 -6c-1 -5 -6 -5 -4 -16s4 -14 5 -18s8 -3 9 -8
+s1 -4 1 -4c1 -9 4 -23 6 -28c2 -6 6 -13 8 -15l2 -4v-4s1 -10 1 -20c0 -20 -2 -27 -6 -32c-8 -10 -26 -14 -29 -15c-5 -1 -10 -2 -16 -3c-9 -1 -18 -3 -25 -5c-11 -4 -20 -8 -27 -13c-4 -2 -6 -5 -8 -8h137z" />
+    <glyph glyph-name="ion-ios-person" unicode="&#xf47e;" horiz-adv-x="320" 
+d="M267 84c13 -5 53 -20 53 -52h-160h-160c0 32 40 47 53 52s31 6 43 9c7 2 17 5 20 9s1 41 1 41s-6 10 -9 18s-7 32 -7 32s-7 0 -9 12c-2 13 -6 17 -6 27c0 9 5 10 5 10v0s-4 13 -5 42c-1 34 25 68 74 68s75 -34 74 -68c-1 -29 -5 -42 -5 -42v0s5 -1 5 -10
+c0 -10 -3 -15 -6 -28c-2 -12 -9 -12 -9 -12s-4 -23 -7 -31s-9 -18 -9 -18s-2 -37 1 -41s13 -7 20 -9c12 -3 30 -4 43 -9z" />
+    <glyph glyph-name="ion-ios-personadd-outline" unicode="&#xf47f;" horiz-adv-x="320" 
+d="M320 295v-14h-25v-25h-14v25h-25v14h25v25h14v-25h25zM106 246v0v0zM267 84c13 -5 53 -20 53 -52h-160h-160c0 32 40 47 53 52s31 6 43 9c7 2 17 5 20 9s1 41 1 41s-6 10 -9 18s-7 32 -7 32s-7 0 -9 12c-2 13 -6 17 -6 27c0 9 5 10 5 10v0s-4 13 -5 42c-1 34 25 68 74 68
+s75 -34 74 -68c-1 -29 -5 -42 -5 -42v0s5 -1 5 -10c0 -10 -3 -15 -6 -28c-2 -12 -9 -12 -9 -12s-4 -23 -7 -31s-9 -18 -9 -18s-2 -37 1 -41s13 -7 20 -9c12 -3 30 -4 43 -9zM160 48v0h137c-2 3 -4 6 -8 8c-7 5 -16 9 -27 13c-7 2 -17 4 -26 5c-6 1 -10 2 -15 3
+c-3 1 -21 5 -29 15c-4 5 -6 12 -6 32c0 10 1 20 1 20v4l2 4c1 2 6 9 8 15c2 5 5 19 6 28c0 0 0 -1 1 4s8 4 9 8s3 7 5 18s-5 12 -5 17c0 4 1 5 1 5v0c0 1 4 14 4 38c0 13 -5 26 -14 35c-11 11 -25 16 -44 16c-18 0 -34 -5 -45 -16c-9 -9 -13 -22 -13 -35c1 -24 4 -37 4 -38
+v0s1 -3 0 -6c-1 -5 -6 -5 -4 -16s4 -14 5 -18s8 -3 9 -8s1 -4 1 -4c1 -9 4 -23 6 -28c2 -6 6 -13 8 -15l2 -4v-4s1 -10 1 -20c0 -20 -2 -27 -6 -32c-8 -10 -26 -14 -29 -15c-5 -1 -10 -2 -16 -3c-9 -1 -18 -3 -25 -5c-11 -4 -20 -8 -27 -13c-4 -2 -6 -5 -8 -8h137z" />
+    <glyph glyph-name="ion-ios-personadd" unicode="&#xf480;" horiz-adv-x="320" 
+d="M320 295v-14h-25v-25h-14v25h-25v14h25v25h14v-25h25zM267 84c13 -5 53 -20 53 -52h-160h-160c0 32 40 47 53 52s31 6 43 9c7 2 17 5 20 9s1 41 1 41s-6 10 -9 18s-7 32 -7 32s-7 0 -9 12c-2 13 -6 17 -6 27c0 9 5 10 5 10v0s-4 13 -5 42c-1 34 25 68 74 68
+s75 -34 74 -68c-1 -29 -5 -42 -5 -42v0s5 -1 5 -10c0 -10 -3 -15 -6 -28c-2 -12 -9 -12 -9 -12s-4 -23 -7 -31s-9 -18 -9 -18s-2 -37 1 -41s13 -7 20 -9c12 -3 30 -4 43 -9z" />
+    <glyph glyph-name="ion-ios-photos-outline" unicode="&#xf481;" 
+d="M64 320h384v-320h-384v320zM432 16v288h-352v-288h352zM0 384h384v-48h-16v32h-352v-288h32v-16h-48v320z" />
+    <glyph glyph-name="ion-ios-photos" unicode="&#xf482;" 
+d="M64 320h384v-320h-384v320zM384 384v-48h-336v-272h-48v320h384z" />
+    <glyph glyph-name="ion-ios-pie-outline" unicode="&#xf483;" 
+d="M256 367v0v-207v-12l-12 -4l-180 -45c6 -13 13 -25 21 -36c12 -16 25 -30 41 -42c33 -24 73 -37 114 -37c26 0 51 5 75 15c23 10 43 23 61 41s31 38 41 61c10 24 15 49 15 75c0 51 -20 100 -56 136c-32 32 -75 51 -120 55zM240 384v0c115 0 208 -93 208 -208
+s-93 -208 -208 -208c-92 0 -171 60 -198 143l198 49v224zM208 400c-31 -1 -60 -7 -85 -18c-24 -11 -44 -26 -61 -46c-29 -34 -46 -80 -46 -127v0v0c0 -13 3 -46 12 -70l180 46v215zM224 416v0v-244l-205 -52c-19 32 -19 89 -19 89c0 91 58 207 218 207h6z" />
+    <glyph glyph-name="ion-ios-pie" unicode="&#xf484;" 
+d="M240 384v0c115 0 208 -93 208 -208s-93 -208 -208 -208c-92 0 -171 60 -198 143l198 49v224zM224 416v0v-244l-205 -52c-19 32 -19 89 -19 89c0 91 58 207 218 207h6z" />
+    <glyph glyph-name="ion-ios-pint-outline" unicode="&#xf485;" horiz-adv-x="224" 
+d="M224 278c0 -98 -32 -101 -32 -181c0 -40 16 -71 16 -99c0 -27 -9 -30 -32 -30h-128c-23 0 -32 2 -32 29c0 28 16 60 16 100c0 80 -32 83 -32 181c0 21 1 89 19 125c4 9 13 13 32 13h122c19 0 28 -4 32 -13c18 -36 19 -104 19 -125zM34 396c-8 -16 -14 -43 -17 -76h190
+c-3 33 -9 60 -17 76c-1 2 -1 1 -2 2c-2 1 -6 2 -15 2h-122c-9 0 -13 -1 -15 -2c-1 -1 -1 0 -2 -2zM191 -15c0 1 1 5 1 13c0 11 -4 23 -7 37c-4 18 -9 39 -9 62c0 41 8 64 16 86c8 23 16 46 16 95c0 9 -1 18 -1 26h-190c0 -8 -1 -17 -1 -26c0 -49 8 -72 16 -95
+c8 -22 16 -45 16 -86c0 -23 -5 -44 -9 -62c-3 -14 -7 -26 -7 -37c0 -8 1 -12 1 -13c2 -1 7 -1 15 -1h128c8 0 13 0 15 1z" />
+    <glyph glyph-name="ion-ios-pint" unicode="&#xf486;" horiz-adv-x="224" 
+d="M224 278c0 -98 -32 -101 -32 -181c0 -40 16 -71 16 -99c0 -27 -9 -30 -32 -30h-128c-23 0 -32 2 -32 29c0 28 16 60 16 100c0 80 -32 83 -32 181c0 21 1 89 19 125c4 9 13 13 32 13h122c19 0 28 -4 32 -13c18 -36 19 -104 19 -125zM34 396c-8 -16 -14 -43 -17 -76h190
+c-3 33 -9 60 -17 76c-1 2 -1 1 -2 2c-2 1 -6 2 -15 2h-122c-9 0 -13 -1 -15 -2c-1 -1 -1 0 -2 -2z" />
+    <glyph glyph-name="ion-ios-play-outline" unicode="&#xf487;" horiz-adv-x="256" 
+d="M16 323v-262l210 131zM0 352v0l256 -160l-256 -160v320z" />
+    <glyph glyph-name="ion-ios-play" unicode="&#xf488;" horiz-adv-x="256" 
+d="M0 352v0l256 -160l-256 -160v320z" />
+    <glyph glyph-name="ion-ios-plus-empty" unicode="&#xf489;" horiz-adv-x="256" 
+d="M256 183h-120v-119h-17v119h-119v17h119v120h17v-120h120v-17z" />
+    <glyph glyph-name="ion-ios-plus-outline" unicode="&#xf48a;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM208 1c105 0 191 86 191 191s-86 191 -191 191s-191 -86 -191 -191s86 -191 191 -191zM216 320v-120h120v-17h-120v-119h-17v119h-119v17h119v120h17z" />
+    <glyph glyph-name="ion-ios-plus" unicode="&#xf48b;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM336 183v17h-120v120h-17v-120h-119v-17h119v-119h17v119h120z" />
+    <glyph glyph-name="ion-ios-pricetag-outline" unicode="&#xf48c;" horiz-adv-x="416" 
+d="M416 416v-160l-256 -288l-160 160l256 288h160zM400 264v136h-136l-240 -272l136 -136zM320 288c-18 0 -32 14 -32 32s14 32 32 32s32 -14 32 -32s-14 -32 -32 -32zM320 336c-9 0 -16 -7 -16 -16s7 -16 16 -16s16 7 16 16s-7 16 -16 16z" />
+    <glyph glyph-name="ion-ios-pricetag" unicode="&#xf48d;" horiz-adv-x="416" 
+d="M304 320c0 11 5 16 16 16s16 -5 16 -16s-5 -16 -16 -16s-16 5 -16 16zM256 416h160v-160l-256 -288l-160 160zM320 288c9 0 16 4 22 10s10 13 10 22s-4 16 -10 22s-13 10 -22 10s-16 -4 -22 -10s-10 -13 -10 -22s4 -16 10 -22s13 -10 22 -10z" />
+    <glyph glyph-name="ion-ios-pricetags-outline" unicode="&#xf48e;" 
+d="M416 384h32v-144l-240 -272l-25 24l-23 -24l-160 160l256 288h160v-32zM160 -9l12 12l11 12l217 248v105v16v16h-137l-241 -272zM432 247v121h-16v-112l-221 -253l13 -12zM320 288c-18 0 -32 14 -32 32s14 32 32 32s32 -14 32 -32s-14 -32 -32 -32zM320 336
+c-9 0 -16 -7 -16 -16s7 -16 16 -16s16 7 16 16s-7 16 -16 16z" />
+    <glyph glyph-name="ion-ios-pricetags" unicode="&#xf48f;" 
+d="M432 384h16v-144l-240 -272l-13 13l237 266v137zM256 416h160v-32v-16v-112l-221 -253l-12 -11l-23 -24l-160 160zM320 288c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32zM304 320c0 11 5 16 16 16s16 -5 16 -16s-5 -16 -16 -16s-16 5 -16 16z" />
+    <glyph glyph-name="ion-ios-printer-outline" unicode="&#xf490;" horiz-adv-x="416" 
+d="M384 336c18 0 32 -13 32 -31v-159c0 -18 -14 -32 -32 -32h-48v-114h-256v114h-48c-18 0 -32 14 -32 32v159c0 18 14 31 32 31h32v48h288v-48h32zM80 368v-32h256v32h-256zM320 16v192h-224v-192h224zM400 146v159c0 9 -7 15 -16 15v0h-352c-9 0 -16 -6 -16 -15v-159
+c0 -9 7 -16 16 -16h48v94h256v-94h48c9 0 16 7 16 16z" />
+    <glyph glyph-name="ion-ios-printer" unicode="&#xf491;" horiz-adv-x="416" 
+d="M80 0v224h256v-224h-256zM80 -0v224h256v-224h-256zM64 352v32h288v-32h-288zM385 336c18 0 31 -14 31 -31v-158c0 -17 -13 -34 -31 -34h-33v126h-288v-126h-31c-18 0 -33 17 -33 34v158c0 17 15 31 33 31h352z" />
+    <glyph glyph-name="ion-ios-pulse-strong" unicode="&#xf492;" horiz-adv-x="480" 
+d="M432 175c27 0 48 -20 48 -47s-21 -49 -48 -49c-21 0 -38 13 -45 31h-51c-7 0 -13 4 -15 11l-16 47l-50 -173c-2 -7 -8 -11 -15 -11h-1c-7 0 -14 5 -15 12l-51 308l-45 -182c-2 -7 -9 -12 -16 -12h-112v32h99l61 245c2 7 8 13 16 13s15 -7 16 -14l52 -314l45 155
+c2 7 8 11 15 11v0c7 0 13 -4 15 -11l29 -85h38c6 19 25 33 46 33z" />
+    <glyph glyph-name="ion-ios-pulse" unicode="&#xf493;" 
+d="M416 160c18 0 32 -14 32 -32s-14 -32 -32 -32c-15 0 -27 10 -31 23h-65c-3 0 -7 2 -8 5l-23 72l-57 -198c-1 -3 -4 -6 -8 -6v0c-4 0 -7 3 -8 7l-58 346l-54 -220c-1 -4 -4 -6 -8 -6h-96v16h90l62 251c1 4 4 6 8 6s7 -3 8 -7l58 -349l54 190c1 3 4 5 8 5s7 -2 8 -5l30 -91
+h59c3 14 16 25 31 25z" />
+    <glyph glyph-name="ion-ios-rainy-outline" unicode="&#xf494;" horiz-adv-x="288" 
+d="M220 269c38 0 68 -33 68 -71c0 -29 -19 -56 -45 -66l-55 -80c-2 -2 -5 -4 -8 -4c-5 0 -8 3 -8 8c0 2 1 4 2 6l46 66v0h-35l-31 -44c-2 -2 -4 -4 -7 -4c-5 0 -9 3 -9 8c0 2 1 3 2 5l25 35h-37l-53 -76c-2 -2 -4 -4 -7 -4c-5 0 -9 3 -9 8c0 2 2 4 3 6l46 66h-36l-32 -44
+c-2 -2 -4 -4 -7 -4c-5 0 -8 3 -8 8c0 2 1 4 2 6l25 34c-29 2 -52 27 -52 56c0 28 22 58 50 60c0 3 -1 5 -1 8c0 46 31 84 82 84c45 0 73 -31 81 -68c3 0 5 1 8 1zM220 146c28 0 52 24 52 52s-24 54 -52 54h-6l-15 -2l-3 15c-3 14 -11 31 -23 40c-12 10 -26 14 -41 14
+c-36 0 -66 -31 -66 -67v-12v-10c-6 0 -12 -2 -14 -2c-20 -3 -35 -23 -35 -43c0 -10 4 -20 11 -27s16 -12 26 -12h124v0v0h42z" />
+    <glyph glyph-name="ion-ios-rainy" unicode="&#xf495;" horiz-adv-x="288" 
+d="M220 269c38 0 68 -33 68 -71c0 -29 -19 -56 -45 -66l-55 -80c-2 -2 -5 -4 -8 -4c-5 0 -8 3 -8 8c0 2 1 4 2 6l46 66v0h-35l-31 -44c-2 -2 -4 -4 -7 -4c-5 0 -9 3 -9 8c0 2 1 3 2 5l25 35h-37l-53 -76c-2 -2 -4 -4 -7 -4c-5 0 -9 3 -9 8c0 2 2 4 3 6l46 66h-36l-32 -44
+c-2 -2 -4 -4 -7 -4c-5 0 -8 3 -8 8c0 2 1 4 2 6l25 34c-29 2 -52 27 -52 56c0 28 22 58 50 60c0 3 -1 5 -1 8c0 46 31 84 82 84c45 0 73 -31 81 -68c3 0 5 1 8 1z" />
+    <glyph glyph-name="ion-ios-recording-outline" unicode="&#xf496;" horiz-adv-x="480" 
+d="M370 304c61 0 110 -50 110 -112s-49 -112 -110 -112h-260c-61 0 -110 50 -110 112s49 112 110 112s110 -50 110 -112c0 -40 -21 -75 -53 -95h146c-32 20 -53 55 -53 95c0 62 49 112 110 112zM16 192c0 -53 42 -95 94 -95s93 42 93 95s-41 95 -93 95s-94 -42 -94 -95z
+M370 97c52 0 94 42 94 95s-42 95 -94 95s-93 -42 -93 -95s41 -95 93 -95zM368 240c-26 0 -48 -22 -48 -48s22 -48 48 -48s48 22 48 48s-22 48 -48 48zM368 256v0c35 0 64 -29 64 -64s-29 -64 -64 -64s-64 29 -64 64s29 64 64 64zM112 240c-26 0 -48 -22 -48 -48
+s22 -48 48 -48s48 22 48 48s-22 48 -48 48zM112 256v0c35 0 64 -29 64 -64s-29 -64 -64 -64s-64 29 -64 64s29 64 64 64z" />
+    <glyph glyph-name="ion-ios-recording" unicode="&#xf497;" horiz-adv-x="480" 
+d="M370 304c61 0 110 -50 110 -112s-49 -112 -110 -112h-260c-61 0 -110 50 -110 112s49 112 110 112s110 -50 110 -112c0 -40 -21 -76 -53 -95h146c-32 19 -53 55 -53 95c0 62 49 112 110 112zM112 128c35 0 64 29 64 64s-29 64 -64 64s-64 -29 -64 -64s29 -64 64 -64z
+M368 128c35 0 64 29 64 64s-29 64 -64 64s-64 -29 -64 -64s29 -64 64 -64zM368 240c26 0 48 -22 48 -48s-22 -48 -48 -48s-48 22 -48 48s22 48 48 48zM112 240c26 0 48 -22 48 -48s-22 -48 -48 -48s-48 22 -48 48s22 48 48 48z" />
+    <glyph glyph-name="ion-ios-redo-outline" unicode="&#xf498;" horiz-adv-x="384" 
+d="M0 48v32c0 17 -3 83 49 136c35 36 80 53 143 56v80l192 -128l-192 -128v80c-40 -1 -63 -9 -87 -20c-31 -14 -55 -44 -75 -77l-20 -31h-10zM208 256c-201 0 -192 -169 -192 -169c48 81 101 105 192 105v-65l148 97l-148 97v-65z" />
+    <glyph glyph-name="ion-ios-redo" unicode="&#xf499;" horiz-adv-x="384" 
+d="M0 48v32c0 17 -3 83 49 136c35 36 80 53 143 56v80l192 -128l-192 -128v80c-40 -1 -63 -9 -87 -20c-31 -14 -55 -44 -75 -77l-20 -31h-10z" />
+    <glyph glyph-name="ion-ios-refresh-empty" unicode="&#xf49a;" horiz-adv-x="256" 
+d="M128 64c-71 0 -128 57 -128 128s57 128 128 128v44l96 -64l-96 -56v56c-60 0 -108 -48 -108 -108s48 -108 108 -108s108 48 108 108h20c0 -71 -57 -128 -128 -128z" />
+    <glyph glyph-name="ion-ios-refresh-outline" unicode="&#xf49b;" horiz-adv-x="416" 
+d="M316 192v0h20c0 -71 -57 -128 -128 -128s-128 57 -128 128s57 128 128 128v44l96 -64l-96 -56v56c-60 0 -108 -48 -108 -108s48 -108 108 -108s108 48 108 108zM208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM208 1
+c105 0 191 86 191 191s-86 191 -191 191s-191 -86 -191 -191s86 -191 191 -191z" />
+    <glyph glyph-name="ion-ios-refresh" unicode="&#xf49c;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM208 64c71 0 128 57 128 128h-20c0 -60 -48 -108 -108 -108s-108 48 -108 108s48 108 108 108v-56l96 56l-96 64v-44c-71 0 -128 -57 -128 -128s57 -128 128 -128z" />
+    <glyph glyph-name="ion-ios-reload" unicode="&#xf49d;" 
+d="M192 384c106 0 192 -86 192 -192l55 53l9 -9l-70 -68l-67 68l9 9l51 -52c0 98 -80 178 -179 178s-179 -80 -179 -179s80 -179 179 -179c79 0 146 50 170 121l12 -3c-26 -76 -97 -131 -182 -131c-106 0 -192 86 -192 192s86 192 192 192z" />
+    <glyph glyph-name="ion-ios-reverse-camera-outline" unicode="&#xf49e;" horiz-adv-x="384" 
+d="M238 129l2 2l11 -12l-2 -2c-16 -14 -36 -21 -57 -21c-45 0 -82 36 -87 78h-30l38 50l39 -50h-31c5 -33 35 -62 71 -62c17 0 33 6 46 17zM252 249c16 -14 25 -37 27 -57h30l-38 -51l-39 51h31c-5 35 -35 64 -71 64c-17 0 -33 -6 -46 -17l-2 -2l-11 12l2 2
+c16 14 36 21 57 21c22 0 44 -8 60 -23zM354 288c18 0 30 -14 30 -31v-176c0 -17 -12 -33 -30 -33h-320c-18 0 -34 16 -34 33v176c0 17 16 31 34 31h13v16h34v-16h13c32 36 43 48 55 48h88c12 0 23 -12 55 -48h62zM368 81v176c0 9 -5 15 -14 15h-62h-6s-4 1 -6 3s-6 8 -9 11
+c-12 13 -21 24 -27 30c-5 5 -7 4 -7 4h-88s-1 0 -6 -4c-6 -5 -15 -14 -26 -27c-3 -4 -8 -11 -11 -14s-4 -3 -6 -3h-6h-60c-9 0 -18 -7 -18 -15v-176c0 -9 9 -17 18 -17h320c8 0 14 8 14 17z" />
+    <glyph glyph-name="ion-ios-reverse-camera" unicode="&#xf49f;" horiz-adv-x="384" 
+d="M354 288c18 0 30 -14 30 -31v-176c0 -17 -12 -33 -30 -33h-320c-18 0 -34 16 -34 33v176c0 17 16 31 34 31h13v16h34v-16h13c32 36 43 48 55 48h88c12 0 23 -12 55 -48h62zM249 117l2 2l-11 12l-2 -2c-13 -11 -29 -17 -46 -17c-36 0 -66 29 -71 62h31l-39 50l-38 -50h30
+c5 -42 42 -78 87 -78c21 0 41 7 57 21zM271 141l38 51h-30c-2 20 -11 43 -27 57c-16 15 -38 23 -60 23c-21 0 -41 -7 -57 -21l-2 -2l11 -12l2 2c13 11 29 17 46 17c36 0 66 -29 71 -64h-31z" />
+    <glyph glyph-name="ion-ios-rewind-outline" unicode="&#xf4a0;" 
+d="M432 293l-184 -101l184 -101v202zM208 292v0l-176 -100l176 -100v95v27v78zM224 320v0v-123l224 123v-256l-224 123v-123l-224 128z" />
+    <glyph glyph-name="ion-ios-rewind" unicode="&#xf4a1;" 
+d="M224 320v0v-123l224 123v-256l-224 123v-123l-224 128z" />
+    <glyph glyph-name="ion-ios-rose-outline" unicode="&#xf4a2;" horiz-adv-x="320" 
+d="M284 295c-4 -1 -9 -3 -13 -4c-37 -11 -71 -24 -103 -39c-17 -8 -24 -12 -44 -24l-7 -4c-31 -18 -50 -33 -63 -51c-15 -21 -22 -45 -22 -77c0 -16 3 -30 9 -44c6 -13 14 -26 25 -36c23 -21 55 -32 94 -32s71 11 94 32c11 10 19 23 25 36c6 14 9 28 9 44c0 20 -5 40 -11 60
+c-11 40 -23 83 7 139zM320 320v0c-77 -96 -16 -151 -16 -224s-56 -128 -144 -128s-144 55 -144 128s35 109 93 142c25 14 33 19 52 28c30 14 65 28 105 40c17 5 35 10 54 14zM38 325c14 -28 18 -57 19 -83c9 7 20 13 30 20c7 4 14 9 21 13c5 3 10 6 16 9c-5 4 -11 7 -17 11
+c-22 13 -48 23 -69 30zM0 352v0s66 -15 115 -43c15 -8 28 -18 37 -29c-12 -6 -24 -12 -36 -19c-7 -4 -14 -8 -20 -12c-25 -16 -44 -31 -57 -42c5 41 2 98 -39 145zM249 367c-8 -1 -20 -2 -35 -7c-25 -8 -47 -20 -64 -36c8 -6 15 -12 21 -18c29 12 65 26 95 34
+c-5 10 -12 20 -17 27zM256 384v0s26 -32 32 -55c-33 -8 -84 -25 -121 -42l-3 3c-9 11 -22 22 -39 32c52 60 131 62 131 62zM85 394c-6 -10 -10 -20 -14 -28c12 -4 22 -10 36 -17c4 5 9 10 14 14c-13 15 -27 25 -36 31zM80 416v0s35 -16 64 -56c-12 -9 -23 -20 -33 -31
+c-26 13 -40 21 -61 27c5 15 15 38 30 60z" />
+    <glyph glyph-name="ion-ios-rose" unicode="&#xf4a3;" horiz-adv-x="320" 
+d="M320 320v0c-77 -96 -16 -151 -16 -224s-56 -128 -144 -128s-144 55 -144 128s35 109 93 142c25 14 33 19 52 28c30 14 65 28 105 40c17 5 35 10 54 14zM0 352v0s66 -15 115 -43c15 -8 28 -18 37 -29c-12 -6 -24 -12 -36 -19c-7 -4 -14 -8 -20 -12
+c-25 -16 -44 -31 -57 -42c5 41 2 98 -39 145zM256 384v0s26 -32 32 -55c-33 -8 -84 -25 -121 -42l-3 3c-9 11 -22 22 -39 32c52 60 131 62 131 62zM80 416v0s35 -16 64 -56c-12 -9 -23 -20 -33 -31c-26 13 -40 21 -61 27c5 15 15 38 30 60z" />
+    <glyph glyph-name="ion-ios-search-strong" unicode="&#xf4a4;" horiz-adv-x="384" 
+d="M280 150l-4 -7l108 -109l-34 -34l-108 109l-7 -5c-24 -15 -53 -25 -83 -25c-84 0 -152 69 -152 153s68 152 152 152s152 -68 152 -152c0 -30 -9 -58 -24 -82zM237 317c-23 23 -53 35 -85 35s-62 -12 -85 -35s-35 -53 -35 -85s12 -62 35 -85s53 -35 85 -35s62 12 85 35
+s36 53 36 85s-13 62 -36 85z" />
+    <glyph glyph-name="ion-ios-search" unicode="&#xf4a5;" horiz-adv-x="384" 
+d="M384 23l-23 -23l-113 113c-26 -21 -60 -33 -96 -33c-84 0 -152 68 -152 152s68 152 152 152s152 -68 152 -152c0 -36 -12 -69 -33 -95zM56 135c26 -26 60 -39 96 -39s70 14 96 40s40 60 40 96s-14 70 -40 96s-60 40 -96 40s-70 -14 -96 -40s-40 -60 -40 -96
+s14 -71 40 -97z" />
+    <glyph glyph-name="ion-ios-settings-strong" unicode="&#xf4a6;" 
+d="M0 72h283c6 14 21 24 37 24s31 -10 37 -24h91v-32h-91c-6 -14 -21 -24 -37 -24s-31 10 -37 24h-283zM0 208h91c6 14 21 24 37 24s31 -10 37 -24h283v-32h-283c-6 -14 -21 -24 -37 -24s-31 10 -37 24h-91zM0 344h283c6 14 21 24 37 24s31 -10 37 -24h91v-32h-91
+c-6 -14 -21 -24 -37 -24s-31 10 -37 24h-283z" />
+    <glyph glyph-name="ion-ios-settings" unicode="&#xf4a7;" 
+d="M320 344c-9 0 -16 -7 -16 -16s7 -16 16 -16s16 7 16 16s-7 16 -16 16zM320 360v0c18 0 32 -14 32 -32s-14 -32 -32 -32s-32 14 -32 32s14 32 32 32zM320 72c-9 0 -16 -7 -16 -16s7 -16 16 -16s16 7 16 16s-7 16 -16 16zM320 88v0c18 0 32 -14 32 -32s-14 -32 -32 -32
+s-32 14 -32 32s14 32 32 32zM128 208c-9 0 -16 -7 -16 -16s7 -16 16 -16s16 7 16 16s-7 16 -16 16zM128 224v0c18 0 32 -14 32 -32s-14 -32 -32 -32s-32 14 -32 32s14 32 32 32zM175 200h273v-16h-273c0 3 1 5 1 8s-1 5 -1 8zM80 192c0 -3 1 -5 1 -8h-81v16h81
+c0 -3 -1 -5 -1 -8zM367 64h81v-16h-81c0 3 1 5 1 8s-1 5 -1 8zM272 56c0 -3 1 -5 1 -8h-273v16h273c0 -3 -1 -5 -1 -8zM367 336h81v-16h-81c0 3 1 5 1 8s-1 5 -1 8zM273 336c0 -3 -1 -5 -1 -8s1 -5 1 -8h-273v16h273z" />
+    <glyph glyph-name="ion-ios-shuffle-strong" unicode="&#xf4a8;" horiz-adv-x="384" 
+d="M301 296c-85 0 -119 -64 -152 -126c-1 -3 -3 -5 -4 -8l-1 -1c-2 -3 -2 -5 -4 -8c-21 -38 -43 -68 -68 -83c-15 -9 -34 -18 -72 -18v32c45 0 76 18 112 84c2 3 2 6 4 9h1c1 2 3 4 4 7c34 64 76 144 180 144h15l-52 43l21 25l99 -84l-99 -82l-21 24l51 42h-14zM285 154
+l99 -82l-99 -84l-21 25l52 43h-15c-78 0 -122 45 -153 95l18 33c29 -51 64 -96 135 -96h14l-51 42zM112 216c-36 66 -67 84 -112 84v32c38 0 57 -9 72 -18c25 -15 47 -44 67 -81c-7 -11 -13 -22 -19 -33c-1 2 -2 5 -3 7h-1c-2 3 -2 6 -4 9z" />
+    <glyph glyph-name="ion-ios-shuffle" unicode="&#xf4a9;" horiz-adv-x="384" 
+d="M298 241l-10 12l62 51h-46c-93 0 -129 -75 -164 -139c-2 -3 -3 -6 -5 -9c-20 -37 -41 -61 -65 -75c-14 -8 -33 -17 -70 -17v16c48 0 83 14 121 84c2 3 3 6 5 9c35 65 75 147 178 147h46l-62 52l10 12l86 -72zM135 228c0 -1 1 -2 1 -3c-3 -5 -6 -11 -9 -16c0 1 -1 1 -1 2
+c-2 3 -3 6 -5 9c-38 70 -73 84 -121 84v16c37 0 56 -9 70 -17c24 -14 45 -38 65 -75zM298 143l86 -71l-86 -72l-10 12l62 52h-46c-76 0 -118 45 -149 95c1 2 2 5 3 7c2 3 4 7 6 10c30 -50 67 -96 140 -96h46l-62 51z" />
+    <glyph glyph-name="ion-ios-skipbackward-outline" unicode="&#xf4aa;" horiz-adv-x="320" 
+d="M0 352h79v-142l241 142v-320l-241 142v-142h-79v320zM80 192l7 -4l217 -128v264v0l-217 -128zM16 336v-288h47v126v8v28v126h-47z" />
+    <glyph glyph-name="ion-ios-skipbackward" unicode="&#xf4ab;" horiz-adv-x="320" 
+d="M0 352h79v-142l241 142v-320l-241 142v-142h-79v320z" />
+    <glyph glyph-name="ion-ios-skipforward-outline" unicode="&#xf4ac;" horiz-adv-x="320" 
+d="M241 352h79v-320h-79v142l-241 -142v320l241 -142v142zM233 188l7 4l-7 4l-217 128v0v-264zM304 48v288h-47v-126v-28v-8v-126h47z" />
+    <glyph glyph-name="ion-ios-skipforward" unicode="&#xf4ad;" horiz-adv-x="320" 
+d="M241 352h79v-320h-79v142l-241 -142v320l241 -142v142z" />
+    <glyph glyph-name="ion-ios-snowy" unicode="&#xf4ae;" horiz-adv-x="256" 
+d="M252 131c4 -2 5 -7 3 -11s-7 -5 -11 -3l-29 17c-2 -8 -2 -16 0 -24c1 -4 -3 -9 -7 -10s-8 2 -9 6c-2 12 -3 24 1 36l-64 36v-73c11 -3 22 -8 31 -16c3 -3 4 -8 1 -11s-8 -4 -11 -1c-6 5 -13 10 -21 12v-33c0 -4 -4 -8 -8 -8s-8 4 -8 8v33c-8 -2 -15 -7 -21 -12
+c-3 -3 -8 -2 -11 1s-3 8 0 11c9 8 20 13 32 16v73l-65 -36c4 -12 4 -23 2 -35c-1 -4 -5 -8 -9 -7s-8 6 -7 10c2 8 2 16 0 24l-29 -17c-4 -2 -9 -1 -11 3s-1 9 3 11l29 16c-6 6 -13 10 -21 13c-4 1 -6 6 -5 10c2 4 6 6 10 5c12 -4 22 -11 30 -19l65 36l-65 37
+c-8 -9 -18 -15 -30 -19c-4 -1 -9 0 -10 4s1 10 5 11c8 3 15 6 21 12l-29 16c-4 2 -5 7 -3 11s7 5 11 3l29 -16c2 8 2 15 0 23c-1 4 3 9 7 10s8 -2 9 -6c2 -12 1 -25 -2 -36l65 -36v73c-12 3 -23 8 -32 16c-3 3 -3 8 0 11s8 4 11 1c6 -5 13 -10 21 -12v33c0 4 4 8 8 8
+s8 -4 8 -8v-33c8 2 15 7 21 12c3 3 8 2 11 -1s2 -8 -1 -11c-9 -8 -20 -13 -31 -16v-73l64 36c-3 11 -4 24 -2 36c1 4 6 7 10 6s7 -6 6 -10c-2 -8 -1 -15 1 -23l29 16c4 2 9 1 11 -3s1 -9 -3 -11l-29 -16c6 -6 13 -10 21 -13c4 -1 6 -6 5 -10s-6 -6 -10 -5
+c-12 4 -23 10 -31 19l-64 -36l64 -36c8 8 19 15 31 19c4 1 9 -1 10 -5s-1 -9 -5 -10c-8 -3 -15 -7 -21 -13z" />
+    <glyph glyph-name="ion-ios-speedometer-outline" unicode="&#xf4af;" 
+d="M224 384c124 0 224 -100 224 -224c0 -57 -21 -108 -56 -148c-4 -4 -7 -8 -11 -12l-10 10l-1 2c-19 18 -41 33 -65 43c-26 11 -53 16 -81 16s-55 -5 -81 -16c-24 -10 -46 -25 -65 -43l-1 -2l-10 -10c-4 4 -7 8 -11 12c-35 40 -56 91 -56 148c0 124 100 224 224 224z
+M416 79c10 23 15 48 16 73h-32v16h32c-1 25 -6 50 -16 73c-9 22 -23 42 -39 60l-27 -27l-6 6l-5 5v0h-1l27 27c-18 17 -38 31 -60 40c-23 10 -48 15 -74 16v-38h-16v38c-25 -1 -49 -6 -72 -16c-22 -10 -43 -23 -61 -40l27 -27v0v0l-6 -6l-5 -5l-27 27
+c-16 -18 -30 -38 -39 -60c-10 -23 -15 -49 -16 -74h32v-16h-32c1 -25 6 -49 16 -72c9 -20 20 -39 35 -56c40 40 96 64 157 64s117 -24 157 -64c15 17 26 36 35 56zM336 273l2 -1l-75 -84c6 -8 9 -18 9 -28c0 -26 -22 -48 -48 -48c-10 0 -19 4 -27 9l-13 -12l-11 11l12 12
+c-6 8 -9 18 -9 28c0 26 22 48 48 48c10 0 19 -3 27 -8zM224 128c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32z" />
+    <glyph glyph-name="ion-ios-speedometer" unicode="&#xf4b0;" 
+d="M385 169v-15h30c-1 -22 -6 -44 -15 -65c-8 -18 -19 -35 -32 -50c-39 37 -90 58 -144 58s-105 -21 -144 -58c-13 15 -24 32 -32 50c-9 21 -14 43 -15 65h28h1v16h-29c1 23 6 45 15 66c9 20 20 38 35 54l25 -24l10 10l1 1v0v0l-25 25c16 15 36 26 56 35c21 9 43 14 66 15
+v-34h14h1v34c23 -1 46 -6 67 -15s39 -20 55 -35l-24 -25l11 -11l25 25c15 -16 26 -35 35 -55c9 -21 14 -43 15 -66h-30v-1zM272 160c0 10 -3 20 -9 28l63 76l-2 1l-73 -65c-8 5 -17 8 -27 8c-26 0 -48 -22 -48 -48c0 -10 3 -20 9 -28l-12 -12l11 -11l13 12c8 -5 17 -9 27 -9
+c26 0 48 22 48 48zM224 384c124 0 224 -100 224 -224c0 -57 -21 -108 -56 -148c-4 -4 -7 -8 -11 -12h-23c-32 39 -80 64 -134 64s-102 -25 -134 -64h-23c-4 4 -7 8 -11 12c-35 40 -56 91 -56 148c0 124 100 224 224 224zM379 27c34 37 52 86 52 136c0 55 -22 106 -61 145
+s-91 60 -146 60s-107 -21 -146 -60s-61 -90 -61 -145c0 -50 18 -99 52 -136l10 -10l1 -1v1l9 9l1 1v0c17 17 38 30 60 39c24 10 48 15 74 15s50 -5 74 -15c22 -9 43 -22 60 -39v0l1 -1l9 -9v-1l1 1zM192 160c0 21 11 32 32 32s32 -11 32 -32s-11 -32 -32 -32s-32 11 -32 32z
+" />
+    <glyph glyph-name="ion-ios-star-half" unicode="&#xf4b1;" 
+d="M140 143l-140 98h171l53 159l53 -159h171l-140 -98l54 -159l-138 99l-138 -99zM224 347v-244l107 -76l-43 122l108 75h-131z" />
+    <glyph glyph-name="ion-ios-star-outline" unicode="&#xf4b2;" 
+d="M448 241l-140 -98l54 -159l-138 99l-138 -99l54 159l-140 98h171l53 159l53 -159h171zM331 27l-43 122l108 75h-131l-41 123l-41 -123h-131l108 -75l-43 -122l107 76z" />
+    <glyph glyph-name="ion-ios-star" unicode="&#xf4b3;" 
+d="M448 241l-140 -98l54 -159l-138 99l-138 -99l54 159l-140 98h171l53 159l53 -159h171z" />
+    <glyph glyph-name="ion-ios-stopwatch-outline" unicode="&#xf4b4;" horiz-adv-x="384" 
+d="M334 301c32 -35 50 -80 50 -128c0 -104 -86 -189 -192 -189s-192 85 -192 189c0 48 18 94 51 129l1 1h-18l-8 -8l-23 23l41 40l23 -22l-9 -9v-18c31 30 72 50 116 53h2v38h32v-38c43 -4 82 -21 113 -49l5 -5v19l-9 9l23 22l41 -40l-22 -23l-9 8h-18zM192 2
+c96 0 173 77 173 171s-77 171 -173 171c-95 0 -173 -77 -173 -171s77 -171 173 -171zM200 191c14 -4 24 -17 24 -31c0 -15 -10 -26 -24 -30l-8 -18v0l-8 18c-14 4 -24 15 -24 30c0 14 12 27 24 31v129h16v-129z" />
+    <glyph glyph-name="ion-ios-stopwatch" unicode="&#xf4b5;" horiz-adv-x="384" 
+d="M334 301c32 -35 50 -80 50 -128c0 -104 -86 -189 -192 -189s-192 85 -192 189c0 48 18 94 51 129l1 1h-18l-8 -8l-23 23l41 40l23 -22l-9 -9v-18c31 30 72 50 116 53h2v38h32v-38c43 -4 82 -21 113 -49l5 -5v19l-9 9l23 22l41 -40l-22 -23l-9 8h-18zM200 130
+c14 4 24 15 24 30c0 14 -10 27 -24 31v129h-16v-129c-12 -4 -24 -17 -24 -31c0 -15 10 -26 24 -30l8 -18z" />
+    <glyph glyph-name="ion-ios-sunny-outline" unicode="&#xf4b6;" horiz-adv-x="320" 
+d="M151 296v56h18v-56h-18zM151 32v60h18v-60h-18zM264 183v18h56v-18h-56zM0 183v18h60v-18h-60zM240 130l34 -34l-12 -12l-33 34zM64 306l34 -33l-12 -12l-34 34zM229 272l33 34l12 -12l-34 -33zM52 96l34 34l11 -12l-33 -34zM160 116c-42 0 -76 34 -76 76s34 76 76 76
+s76 -34 76 -76s-34 -76 -76 -76zM160 251c-32 0 -59 -27 -59 -59s27 -59 59 -59s59 27 59 59s-27 59 -59 59z" />
+    <glyph glyph-name="ion-ios-sunny" unicode="&#xf4b7;" horiz-adv-x="320" 
+d="M151 296v56h18v-56h-18zM151 32v60h18v-60h-18zM264 183v18h56v-18h-56zM0 183v18h60v-18h-60zM240 130l34 -34l-12 -12l-33 34zM64 306l34 -33l-12 -12l-34 34zM229 272l33 34l12 -12l-34 -33zM52 96l34 34l11 -12l-33 -34zM160 116c-42 0 -76 34 -76 76s34 76 76 76
+s76 -34 76 -76s-34 -76 -76 -76z" />
+    <glyph glyph-name="ion-ios-telephone-outline" unicode="&#xf4b8;" horiz-adv-x="352" 
+d="M336 112c16 -16 26 -35 0 -66c-25 -30 -42 -30 -64 -30c-24 0 -58 14 -93 40c-32 23 -46 34 -78 67c-34 35 -55 64 -79 107c-27 50 -24 74 -18 92c4 12 14 24 28 33l1 1c6 4 18 12 32 12c13 0 24 -6 34 -18l1 -1c11 -14 24 -31 32 -47c10 -21 10 -38 -1 -53
+c-9 -12 -12 -19 -12 -23s5 -9 13 -18l1 -1c16 -18 20 -23 26 -29c1 -1 3 -2 4 -3l2 -2c7 -7 11 -12 29 -28l1 -1c7 -6 9 -8 12 -8c5 0 16 7 29 15c4 3 11 5 17 5c27 0 68 -29 83 -44zM324 57c19 22 13 31 1 43c-13 14 -50 39 -72 39c-3 0 -6 -1 -8 -2
+c-19 -12 -28 -18 -37 -18s-15 6 -23 13h-1c-19 16 -23 21 -30 29l-2 2c-1 1 -3 2 -4 3c-6 6 -11 12 -27 30v1c-10 11 -17 18 -18 28s5 20 16 34c15 20 -5 48 -31 79l-1 1c-7 8 -14 12 -22 12c-10 0 -18 -6 -23 -9c-1 0 -2 -1 -2 -1c-11 -7 -18 -16 -21 -24
+c-5 -16 -7 -35 17 -79c23 -42 43 -70 76 -104c31 -32 45 -42 76 -64c32 -23 64 -38 84 -38c21 0 32 1 52 25z" />
+    <glyph glyph-name="ion-ios-telephone" unicode="&#xf4b9;" horiz-adv-x="352" 
+d="M336 112c16 -16 26 -35 0 -66c-25 -30 -42 -30 -64 -30c-24 0 -58 14 -93 40c-32 23 -46 34 -78 67c-34 35 -55 64 -79 107c-27 50 -24 74 -18 92c4 12 14 24 28 33l1 1c6 4 18 12 32 12c13 0 24 -6 34 -18l1 -1c11 -14 24 -31 32 -47c10 -21 10 -38 -1 -53
+c-9 -12 -12 -19 -12 -23s5 -9 13 -18l1 -1c16 -18 20 -23 26 -29c1 -1 3 -2 4 -3l2 -2c7 -7 11 -12 29 -28l1 -1c7 -6 9 -8 12 -8c5 0 16 7 29 15c4 3 11 5 17 5c27 0 68 -29 83 -44z" />
+    <glyph glyph-name="ion-ios-tennisball-outline" unicode="&#xf4ba;" horiz-adv-x="416" 
+d="M416 192v-8v0c0 -5 0 -11 -1 -16v0c-11 -97 -90 -174 -187 -183v0h-4h-2s-1 -1 -2 -1h-3h-1h-8c-115 0 -208 93 -208 208s93 208 208 208s208 -93 208 -208zM399 192c0 105 -86 191 -191 191c-3 0 -5 -1 -8 -1c1 -24 6 -46 15 -68c10 -26 26 -49 46 -69s43 -36 69 -46
+c22 -9 44 -14 68 -15c0 3 1 5 1 8zM17 192c0 -105 86 -191 191 -191h4c-1 22 -7 45 -15 66c-10 26 -26 48 -46 68s-42 36 -68 46c-21 8 -44 14 -66 15v-4zM228 2c88 9 158 78 169 166c-54 3 -106 25 -147 66s-63 93 -66 147c-88 -11 -157 -81 -166 -169
+c53 -3 105 -25 145 -65s62 -92 65 -145z" />
+    <glyph glyph-name="ion-ios-tennisball" unicode="&#xf4bb;" horiz-adv-x="416" 
+d="M0 196v0v0v0zM212 -16h1h-1v0zM208 400c115 0 208 -93 208 -208c0 -8 0 -16 -1 -24v0v0c-11 -97 -90 -174 -187 -183v0v0c-6 -1 -13 -1 -20 -1c-115 0 -208 93 -208 208v4v0v0c0 6 0 11 1 16v0v0c9 97 86 176 183 187v0v0c6 1 11 1 16 1v0v0h8zM83 181
+c26 -10 48 -26 68 -46s36 -42 46 -68c8 -21 14 -44 15 -66c5 0 11 0 16 1c-3 53 -25 105 -65 145s-92 62 -145 65c-1 -5 -1 -11 -1 -16c22 -1 45 -7 66 -15zM250 234c41 -41 93 -63 147 -66c1 5 1 11 1 16c-24 1 -46 6 -68 15c-26 10 -49 26 -69 46s-36 43 -46 69
+c-9 22 -14 44 -15 68c-5 0 -11 0 -16 -1c3 -54 25 -106 66 -147z" />
+    <glyph glyph-name="ion-ios-thunderstorm-outline" unicode="&#xf4bc;" horiz-adv-x="274" 
+d="M193 176l-88 -128l29 96h-52l15 80h72l-16 -48h40zM209 275c36 0 65 -29 65 -65s-29 -66 -65 -66h-8v17h8c27 0 49 22 49 49s-22 50 -49 50h-6l-14 -2l-3 14c-3 14 -11 26 -22 35s-25 13 -39 13c-34 0 -63 -27 -63 -62v-12s1 -9 1 -9c-5 0 -12 -2 -14 -2
+c-19 -3 -33 -18 -33 -37c0 -10 3 -19 10 -26s16 -11 26 -11h11v-17h-11c-28 0 -52 24 -52 53c0 27 21 51 47 53v8c0 43 35 78 78 78c37 0 68 -26 76 -61h8z" />
+    <glyph glyph-name="ion-ios-thunderstorm" unicode="&#xf4bd;" horiz-adv-x="274" 
+d="M153 176h40l-22 -32l-66 -96l29 96h-52l15 80h72zM84 240h107l-16 -48h18h30l-33 -48h19c36 0 65 30 65 66s-29 65 -65 65h-8c-8 35 -39 61 -76 61c-43 0 -78 -35 -78 -78v-8c-26 -2 -47 -26 -47 -53c0 -29 24 -53 52 -53h14z" />
+    <glyph glyph-name="ion-ios-time-outline" unicode="&#xf4be;" 
+d="M224 416c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224s100 224 224 224zM371 45c19 19 35 41 45 66c11 26 16 53 16 81s-5 55 -16 81c-10 25 -26 47 -45 66s-41 35 -66 45c-26 11 -53 16 -81 16s-55 -5 -81 -16c-25 -10 -47 -26 -66 -45
+s-35 -41 -45 -66c-11 -26 -16 -53 -16 -81s5 -55 16 -81c10 -25 26 -47 45 -66s41 -35 66 -45c26 -11 53 -16 81 -16s55 5 81 16c25 10 47 26 66 45zM216 368c0 5 3 8 8 8s8 -3 8 -8s-3 -8 -8 -8s-8 3 -8 8zM216 16c0 5 3 8 8 8s8 -3 8 -8s-3 -8 -8 -8s-8 3 -8 8zM392 192
+c0 5 3 8 8 8s8 -3 8 -8s-3 -8 -8 -8s-8 3 -8 8zM40 192c0 5 3 8 8 8s8 -3 8 -8s-3 -8 -8 -8s-8 3 -8 8zM128 344c0 5 3 8 8 8s8 -3 8 -8s-3 -8 -8 -8s-8 3 -8 8zM304 40c0 5 3 8 8 8s8 -3 8 -8s-3 -8 -8 -8s-8 3 -8 8zM368 280c0 5 3 8 8 8s8 -3 8 -8s-3 -8 -8 -8s-8 3 -8 8
+zM64 104c0 5 3 8 8 8s8 -3 8 -8s-3 -8 -8 -8s-8 3 -8 8zM64 280c0 5 3 8 8 8s8 -3 8 -8s-3 -8 -8 -8s-8 3 -8 8zM368 104c0 5 3 8 8 8s8 -3 8 -8s-3 -8 -8 -8s-8 3 -8 8zM304 344c0 5 3 8 8 8s8 -3 8 -8s-3 -8 -8 -8s-8 3 -8 8zM128 40c0 5 3 8 8 8s8 -3 8 -8s-3 -8 -8 -8
+s-8 3 -8 8zM238 200c4 -8 2 -18 -6 -22v-122c0 -4 -4 -8 -8 -8s-8 4 -8 8v122c-2 1 -4 4 -6 6c-3 5 -3 11 0 16l-37 63c-2 4 -1 9 3 11s8 1 10 -3l38 -63c5 0 11 -3 14 -8z" />
+    <glyph glyph-name="ion-ios-time" unicode="&#xf4bf;" 
+d="M224 416c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224s100 224 224 224zM224 376c-4 0 -8 -4 -8 -8s4 -8 8 -8s8 4 8 8s-4 8 -8 8zM48 184c4 0 8 4 8 8s-4 8 -8 8s-8 -4 -8 -8s4 -8 8 -8zM76 97c4 2 4 7 2 11s-6 5 -10 3s-5 -7 -3 -11s7 -5 11 -3z
+M78 276c2 4 2 9 -2 11s-9 1 -11 -3s-1 -9 3 -11s8 -1 10 3zM132 351c-4 -2 -5 -7 -3 -11s7 -4 11 -2s5 6 3 10s-7 5 -11 3zM143 36c2 4 1 8 -3 10s-9 2 -11 -2s-1 -9 3 -11s9 -1 11 3zM224 8c4 0 8 4 8 8s-4 8 -8 8s-8 -4 -8 -8s4 -8 8 -8zM232 178c8 4 10 14 6 22
+c-3 5 -9 8 -14 8l-38 64c-2 4 -7 4 -11 2s-4 -7 -2 -11l37 -63c-3 -5 -3 -11 0 -16c2 -2 4 -5 6 -6v-122c0 -4 4 -8 8 -8s8 4 8 8v122zM316 33c4 2 5 7 3 11s-7 4 -11 2s-5 -6 -3 -10s7 -5 11 -3zM319 340c2 4 1 9 -3 11s-9 1 -11 -3s-1 -8 3 -10s9 -2 11 2zM383 100
+c2 4 1 9 -3 11s-8 1 -10 -3s-2 -9 2 -11s9 -1 11 3zM380 273c4 2 5 7 3 11s-7 5 -11 3s-4 -7 -2 -11s6 -5 10 -3zM400 184c4 0 8 4 8 8s-4 8 -8 8s-8 -4 -8 -8s4 -8 8 -8z" />
+    <glyph glyph-name="ion-ios-timer-outline" unicode="&#xf4c0;" horiz-adv-x="416" 
+d="M189 176l-1 2s-89 118 -86 120s121 -85 121 -85c1 -1 1 -2 2 -3c5 -5 8 -11 8 -18c0 -14 -11 -25 -25 -25c-8 0 -14 3 -19 9zM208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208c0 57 23 109 61 147l12 -12c-35 -35 -56 -82 -56 -135
+c0 -106 85 -191 191 -191s191 85 191 191c0 100 -77 183 -175 191v-95h-16v112v0v0z" />
+    <glyph glyph-name="ion-ios-timer" unicode="&#xf4c1;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208s-208 93 -208 208s93 208 208 208zM102 298c-2 -2 86 -120 86 -120l1 -1c5 -6 11 -10 19 -10c14 0 25 11 25 25c0 7 -3 13 -8 18l-3 3c0 0 -117 87 -120 85zM208 1c106 0 192 85 192 191s-86 192 -192 192v-96h16v78
+c88 -9 158 -84 158 -174c0 -96 -78 -174 -174 -174s-175 78 -175 174c0 48 19 92 51 124l-11 12c-35 -35 -56 -83 -56 -136c0 -106 85 -191 191 -191z" />
+    <glyph glyph-name="ion-ios-toggle-outline" unicode="&#xf4c2;" 
+d="M96 128c-26 0 -48 -22 -48 -48s22 -48 48 -48s48 22 48 48s-22 48 -48 48zM96 144v0c35 0 64 -29 64 -64s-29 -64 -64 -64s-64 29 -64 64s29 64 64 64zM351 160v0h-255c-44 0 -80 -36 -80 -80s36 -80 80 -80h256c44 0 80 36 80 80s-37 80 -81 80zM352 176v0
+c53 0 96 -43 96 -96s-43 -96 -96 -96h-256c-53 0 -96 43 -96 96s43 96 96 96h256zM352 352c-26 0 -48 -22 -48 -48s22 -48 48 -48s48 22 48 48s-22 48 -48 48zM352 368v0c35 0 64 -29 64 -64s-29 -64 -64 -64s-64 29 -64 64s29 64 64 64zM97 384v0c-44 0 -81 -36 -81 -80
+s36 -80 80 -80h256c44 0 80 36 80 80s-36 80 -80 80h-255zM96 400v0h256c53 0 96 -43 96 -96s-43 -96 -96 -96h-256c-53 0 -96 43 -96 96s43 96 96 96z" />
+    <glyph glyph-name="ion-ios-toggle" unicode="&#xf4c3;" 
+d="M96 128c26 0 48 -22 48 -48s-22 -48 -48 -48s-48 22 -48 48s22 48 48 48zM352 176c53 0 96 -43 96 -96s-43 -96 -96 -96h-256c-53 0 -96 43 -96 96s43 96 96 96h256zM96 16c35 0 64 29 64 64s-29 64 -64 64s-64 -29 -64 -64s29 -64 64 -64zM352 256c-26 0 -48 22 -48 48
+s22 48 48 48s48 -22 48 -48s-22 -48 -48 -48zM96 208c-53 0 -96 43 -96 96s43 96 96 96h256c53 0 96 -43 96 -96s-43 -96 -96 -96h-256zM352 368c-35 0 -64 -29 -64 -64s29 -64 64 -64s64 29 64 64s-29 64 -64 64z" />
+    <glyph glyph-name="ion-ios-trash-outline" unicode="&#xf4c4;" horiz-adv-x="288" 
+d="M288 335v-15h-20l-24 -291c0 -16 -13 -29 -29 -29h-141c-16 0 -29 13 -29 29l-24 291h-21v15h80v20c0 16 13 29 29 29h70c16 0 29 -13 29 -29v-20h80zM95 355v-20h98v20c0 8 -6 14 -14 14h-70c-8 0 -14 -6 -14 -14zM230 30l23 290h-217l23 -290v0v-1c0 -8 7 -14 15 -14
+h141c8 0 15 6 15 14v1v0zM137 47v241h14v-241h-14zM208 288l-11 -241h-14l10 241h15zM94 288l11 -241h-14l-11 241h14z" />
+    <glyph glyph-name="ion-ios-trash" unicode="&#xf4c5;" horiz-adv-x="288" 
+d="M208 335h80v-15h-20l-24 -291c0 -16 -13 -29 -29 -29h-141c-16 0 -29 13 -29 29l-24 291h-21v15h80v20c0 16 13 29 29 29h70c16 0 29 -13 29 -29v-20zM95 355v0v-20h98v20c0 8 -6 14 -14 14h-70c-8 0 -14 -6 -14 -14zM91 47h14l-11 241h-14zM151 47v241h-14v-241h14z
+M197 47l11 241h-14l-11 -241h14z" />
+    <glyph glyph-name="ion-ios-undo-outline" unicode="&#xf4c6;" horiz-adv-x="384" 
+d="M384 80v-32h-10l-20 31c-20 33 -44 63 -75 77c-24 11 -47 19 -87 20v-80l-192 128l192 128v-80c63 -3 108 -21 143 -56c52 -53 49 -119 49 -136zM368 87c0 0 9 169 -192 169v65l-148 -97l148 -97v65c91 0 144 -24 192 -105z" />
+    <glyph glyph-name="ion-ios-undo" unicode="&#xf4c7;" horiz-adv-x="384" 
+d="M384 80v-32h-10l-20 31c-20 33 -44 63 -75 77c-24 11 -47 19 -87 20v-80l-192 128l192 128v-80c63 -3 108 -21 143 -56c52 -53 49 -119 49 -136z" />
+    <glyph glyph-name="ion-ios-unlocked-outline" unicode="&#xf4c8;" horiz-adv-x="320" 
+d="M160 160c18 0 32 -14 32 -32c0 -15 -10 -27 -24 -31v-33h-16v33c-14 4 -24 16 -24 31c0 18 14 32 32 32zM160 112c9 0 16 7 16 16s-7 16 -16 16s-16 -7 -16 -16s7 -16 16 -16zM72 224h248v-240h-320v240h56v72c0 57 47 104 104 104s104 -47 104 -104v-8h-16v8
+c0 49 -39 88 -88 88s-88 -39 -88 -88v-72zM304 0v208h-288v-208h288z" />
+    <glyph glyph-name="ion-ios-unlocked" unicode="&#xf4c9;" horiz-adv-x="320" 
+d="M160 144c9 0 16 -7 16 -16s-7 -16 -16 -16s-16 7 -16 16s7 16 16 16zM72 224h248v-240h-320v240h56v72c0 57 47 104 104 104s104 -47 104 -104v-8h-16v8c0 49 -39 88 -88 88s-88 -39 -88 -88v-72zM168 97c14 4 24 16 24 31c0 18 -14 32 -32 32s-32 -14 -32 -32
+c0 -15 10 -27 24 -31v-33h16v33z" />
+    <glyph glyph-name="ion-ios-upload-outline" unicode="&#xf4ca;" horiz-adv-x="320" 
+d="M192 304h128v-304h-320v304h128v-16h-112v-272h288v272h-112v16zM97 330l-11 12l74 74l74 -74l-11 -12l-55 55v-243h-16v243z" />
+    <glyph glyph-name="ion-ios-upload" unicode="&#xf4cb;" horiz-adv-x="320" 
+d="M168 304h152v-304h-320v304h152v-162h16v162zM168 385v-81h-16v81l-55 -55l-11 12l74 74l74 -74l-11 -12z" />
+    <glyph glyph-name="ion-ios-videocam-outline" unicode="&#xf4cc;" horiz-adv-x="418" 
+d="M257 320c19 0 33 -14 33 -33v-188c0 -19 -14 -35 -33 -35h-221c-19 0 -36 16 -36 35v188c0 19 17 33 36 33h221zM273 99v188c0 9 -8 16 -17 16h-221c-9 0 -18 -7 -18 -16v-188c0 -9 10 -18 19 -18h221c9 0 16 9 16 18zM320 235l98 53v-192l-98 53v86zM401 258v0l-64 -33
+v-66l64 -33v132z" />
+    <glyph glyph-name="ion-ios-videocam" unicode="&#xf4cd;" horiz-adv-x="418" 
+d="M257 320c19 0 33 -14 33 -33v-188c0 -19 -14 -35 -33 -35h-221c-19 0 -36 16 -36 35v188c0 19 17 33 36 33h221zM320 235l98 53v-192l-98 53v86z" />
+    <glyph glyph-name="ion-ios-volume-high" unicode="&#xf4ce;" horiz-adv-x="320" 
+d="M278 320c26 -36 42 -80 42 -128s-16 -92 -42 -128l-14 10c24 33 39 74 39 118s-15 85 -39 118zM224 96l-14 10c18 24 29 54 29 86s-11 62 -29 86l14 10c20 -27 32 -60 32 -96s-12 -69 -32 -96zM177 128l-13 10c12 15 18 34 18 54s-6 39 -18 54l13 10
+c14 -18 22 -40 22 -64s-8 -46 -22 -64zM58 232l70 56v-192l-70 56h-58v80h58z" />
+    <glyph glyph-name="ion-ios-volume-low" unicode="&#xf4cf;" horiz-adv-x="128" 
+d="M58 232l70 56v-192l-70 56h-58v80h58z" />
+    <glyph glyph-name="ion-ios-wineglass-outline" unicode="&#xf4d0;" horiz-adv-x="192" 
+d="M104 139v-155h72v-16h-80h-80v16h72v155c0 22 -20 39 -40 55c-8 6 -16 13 -22 19c-27 28 -26 52 -26 71v4c0 44 31 125 32 128h64h64c1 -3 32 -84 32 -128v-4c0 -19 1 -43 -26 -71c-6 -6 -14 -13 -22 -19c-20 -16 -40 -33 -40 -55zM43 400c-5 -16 -20 -63 -25 -96h156
+c-5 33 -20 80 -25 96h-53h-53zM96 175c3 0 5 0 7 2v0c9 11 20 20 31 29c8 6 15 12 20 18c22 23 22 41 22 60v4h-160v-4c0 -19 0 -37 22 -60c5 -6 12 -12 20 -18c11 -9 22 -18 31 -29v0c2 -2 4 -2 7 -2z" />
+    <glyph glyph-name="ion-ios-wineglass" unicode="&#xf4d1;" horiz-adv-x="192" 
+d="M104 139v-155h72v-16h-80h-80v16h72v155c0 22 -20 39 -40 55c-8 6 -16 13 -22 19c-27 28 -26 52 -26 71v4c0 44 31 125 32 128h64h64c1 -3 32 -84 32 -128v-4c0 -19 1 -43 -26 -71c-6 -6 -14 -13 -22 -19c-20 -16 -40 -33 -40 -55zM43 400c-5 -16 -20 -63 -25 -96h156
+c-5 33 -20 80 -25 96h-53h-53z" />
+    <glyph glyph-name="ion-ios-world-outline" unicode="&#xf4d2;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208v0v0v0c-115 0 -208 93 -208 208s93 208 208 208v0v0v0zM216 276v-76h75c-1 31 -5 60 -11 84c-21 -5 -42 -7 -64 -8zM216 292c20 1 41 3 60 8c-14 46 -38 76 -60 82v-90zM200 382c-23 -6 -45 -36 -60 -82
+c19 -5 39 -7 60 -8v90zM200 276c-22 1 -44 3 -65 8c-6 -24 -10 -53 -11 -84h76v76zM108 200c1 32 4 62 11 88c-21 6 -41 15 -59 25c-26 -31 -41 -70 -43 -113h91zM108 184h-91c2 -43 17 -82 43 -113c19 10 38 19 59 25c-7 26 -10 56 -11 88zM124 184c1 -31 5 -60 11 -84
+c21 5 43 8 65 9v75h-76zM200 92c-21 -1 -41 -3 -60 -8c15 -46 37 -76 60 -82v90zM216 2c22 6 46 36 60 82c-19 5 -40 7 -60 8v-90zM216 109c22 -1 43 -4 64 -9c6 24 10 53 11 84h-75v-75zM308 184c-1 -32 -5 -62 -12 -88c21 -6 41 -15 60 -25c26 31 41 70 43 113h-91z
+M308 200v0h91c-2 43 -17 82 -43 113c-19 -10 -38 -19 -59 -25c7 -26 10 -56 11 -88zM344 326c-25 25 -56 44 -91 52c16 -17 29 -43 39 -74c18 6 35 13 52 22zM163 378c-35 -8 -67 -27 -91 -52c16 -9 34 -15 52 -21c10 31 23 56 39 73zM72 58c25 -25 56 -44 91 -52
+c-16 17 -30 43 -40 74c-18 -6 -35 -13 -51 -22zM253 6c35 8 66 27 91 52c-17 9 -34 16 -52 22c-10 -31 -23 -57 -39 -74z" />
+    <glyph glyph-name="ion-ios-world" unicode="&#xf4d3;" horiz-adv-x="416" 
+d="M208 400c115 0 208 -93 208 -208s-93 -208 -208 -208v0v0v0c-115 0 -208 93 -208 208s93 208 208 208v0v0v0zM208 1c106 0 191 85 191 191s-85 191 -191 191v0v0v0c-106 0 -191 -85 -191 -191s86 -191 191 -191v0v0v0zM274 276c6 -22 9 -48 10 -76h-68v68c20 1 39 4 58 8
+zM216 366c20 -6 41 -34 54 -75c-17 -4 -36 -6 -54 -7v82zM145 291c13 42 35 69 55 75v-82c-19 1 -37 3 -55 7zM333 315c-15 -8 -31 -15 -48 -20c-9 29 -21 52 -36 67c32 -8 61 -24 84 -47zM299 200c-1 29 -4 56 -10 80c19 6 37 14 54 23c23 -28 38 -64 40 -103h-84zM132 200
+c1 28 3 54 9 76c19 -5 39 -7 59 -8v-68h-68zM284 184c-1 -28 -4 -54 -10 -76c-19 5 -38 7 -58 8v68h68zM141 108c-6 22 -8 48 -9 76h68v-68c-20 -1 -40 -3 -59 -8zM200 18c-20 6 -42 33 -55 75c18 4 36 6 55 7v-82zM249 22c15 15 27 38 36 67c17 -5 33 -11 48 -19
+c-23 -23 -52 -40 -84 -48zM167 362c-15 -15 -27 -39 -36 -67c-16 5 -33 11 -48 19c22 23 52 40 84 48zM289 104c6 24 9 51 10 80h84c-2 -39 -17 -75 -40 -103c-17 9 -35 17 -54 23zM216 100c18 -1 37 -3 54 -7c-13 -42 -34 -69 -54 -75v82zM127 280c-6 -24 -11 -51 -11 -80
+h-83c2 39 17 75 40 103c17 -9 35 -17 54 -23zM116 184c1 -29 4 -56 10 -80c-19 -6 -36 -14 -53 -23c-23 28 -38 64 -40 103h83zM83 70c15 8 32 14 48 19c9 -28 21 -52 36 -67c-32 8 -62 25 -84 48z" />
+    <glyph glyph-name="ion-ipad" unicode="&#xf1f9;" horiz-adv-x="288" 
+d="M0 375c0 5 4 9 9 9h270c5 0 9 -4 9 -9v-366c0 -5 -4 -9 -9 -9h-270c-5 0 -9 4 -9 9v366zM144 10c8 0 14 6 14 14s-7 14 -14 14c-8 0 -14 -6 -14 -14s6 -14 14 -14zM32 329v-275c0 -4 3 -6 6 -6h211c3 0 7 2 7 6v275c0 4 -4 7 -7 7h-211c-3 0 -6 -3 -6 -7z" />
+    <glyph glyph-name="ion-iphone" unicode="&#xf1fa;" horiz-adv-x="192" 
+d="M168 384c13 0 24 -11 24 -24v-336c0 -13 -11 -24 -24 -24h-144c-13 0 -24 11 -24 24v336c0 13 11 24 24 24h144zM80 348v0c0 -2 2 -4 4 -4h24c2 0 4 2 4 4v0c0 2 -2 4 -4 4h-24c-2 0 -4 -2 -4 -4zM68 352c-2 0 -4 -2 -4 -4s2 -4 4 -4s4 2 4 4s-2 4 -4 4zM96 16
+c9 0 16 7 16 16s-7 16 -16 16s-16 -7 -16 -16s7 -16 16 -16zM176 64v256h-160v-256h160z" />
+    <glyph glyph-name="ion-ipod" unicode="&#xf1fb;" horiz-adv-x="224" 
+d="M112 137c18 0 32 -14 32 -32s-14 -32 -32 -32s-32 14 -32 32s14 32 32 32zM196 384c15 0 28 -12 28 -28v-328c0 -16 -13 -28 -28 -28h-168c-15 0 -28 12 -28 28v328c0 16 13 28 28 28h168zM112 32c40 0 72 32 72 72s-32 72 -72 72s-72 -32 -72 -72s32 -72 72 -72z
+M192 221v118c-1 7 -6 12 -12 13h-136c-7 -1 -12 -7 -12 -15v-114c0 -8 6 -15 14 -15h131c8 0 14 5 15 13z" />
+    <glyph glyph-name="ion-jet" unicode="&#xf295;" horiz-adv-x="326" 
+d="M222 80l-2 -13l53 -58l-18 -27l-74 9l-18 -55l-19 55l-73 -9l-18 27l53 58l-2 13l-104 -35l3 53l114 103s26 173 28 192c5 40 18 55 18 55s13 -15 18 -55c2 -19 28 -192 28 -192l114 -103l3 -53z" />
+    <glyph glyph-name="ion-key" unicode="&#xf296;" horiz-adv-x="192" 
+d="M144 147c28 -17 48 -48 48 -83c0 -53 -43 -96 -96 -96s-96 43 -96 96c0 36 19 67 48 84c0 0 7 16 12 41c0 4 11 6 11 12v20c0 5 -7 9 -7 11v8v8c0 2 0 4 1 6c0 1 1 1 1 2l2 1l4 4v1c2 2 3 4 3 6c0 1 1 8 1 9c0 3 -2 6 -4 8l-1 1l-4 4v0l-1 1v0c-2 2 -3 5 -3 8v7
+c0 3 2 7 4 9v0l5 5v0c2 2 4 3 4 6v24c0 3 -2 6 -4 8v1l-4 4l-1 1c-2 2 -3 5 -3 8v18c0 11 0 19 9 23c3 1 14 3 23 3c20 0 30 -8 32 -36c0 0 7 -81 9 -143s7 -90 7 -90zM96 0c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32z" />
+    <glyph glyph-name="ion-knife" unicode="&#xf297;" horiz-adv-x="64" 
+d="M62 416c2 0 2 -1 2 -6v-412c0 -15 -10 -30 -24 -30v0v0c-14 0 -24 15 -24 30c1 19 14 83 16 130v0c1 30 -32 31 -32 70c0 134 35 191 54 214c2 2 5 4 8 4z" />
+    <glyph glyph-name="ion-laptop" unicode="&#xf1fc;" horiz-adv-x="512" 
+d="M480 342v-262h-448v262c0 6 4 10 10 10h428c6 0 10 -4 10 -10zM448 112v208h-384v-208h384zM0 59v5h512v-5c-70 -20 -116 -27 -256 -27s-186 7 -256 27z" />
+    <glyph glyph-name="ion-leaf" unicode="&#xf1fd;" horiz-adv-x="422" 
+d="M412 69c18 -3 10 -41 -5 -39c0 0 -21 -1 -63 12c0 0 -16 -19 -39 -30c-26 -12 -118 -33 -197 38c-108 97 -120 354 -100 333c86 -90 197 -47 270 -106c55 -44 88 -127 77 -192c0 0 5 -8 57 -16zM316 65c5 5 10 16 10 24c-161 52 -252 160 -252 160s104 -143 242 -184z
+" />
+    <glyph glyph-name="ion-levels" unicode="&#xf298;" horiz-adv-x="350" 
+d="M46 349c11 -5 18 -16 18 -29s-7 -24 -18 -29v-275c0 -9 -7 -16 -16 -16s-16 7 -16 16v278c-8 6 -14 15 -14 26s6 20 14 26v22c0 9 7 16 16 16s16 -7 16 -16v-19zM142 155c9 -6 15 -16 15 -27s-6 -21 -15 -27v-85c0 -9 -7 -16 -16 -16s-16 7 -16 16v84
+c-10 5 -17 16 -17 28s7 23 17 28v212c0 9 7 16 16 16s16 -7 16 -16v-213zM238 285c10 -6 16 -16 16 -28s-6 -22 -16 -28v-213c0 -9 -7 -16 -16 -16s-16 7 -16 16v213c-10 6 -16 16 -16 28s6 22 16 28v83c0 9 7 16 16 16s16 -7 16 -16v-83zM350 65c0 -12 -6 -22 -16 -28v-21
+c0 -9 -7 -16 -16 -16s-16 7 -16 16v21c-10 6 -16 16 -16 28s6 22 16 28v275c0 9 7 16 16 16s16 -7 16 -16v-275c10 -6 16 -16 16 -28z" />
+    <glyph glyph-name="ion-lightbulb" unicode="&#xf299;" horiz-adv-x="256" 
+d="M128 416c71 0 128 -56 128 -124c0 -5 0 -9 -1 -14s-2 -11 -3 -16v-2c-17 -63 -45 -71 -59 -167v-1c-2 -9 -10 -12 -20 -12h-90c-10 0 -18 3 -20 12v1c-14 96 -42 104 -59 167v2c-1 5 -2 11 -3 16s-1 9 -1 14c0 68 57 124 128 124zM190 52v-1c-2 -3 -3 -4 -3 -7s1 -5 3 -8
+v-1c1 -2 2 -3 2 -5s-1 -4 -2 -6v-1c-2 -3 -3 -4 -3 -7s1 -5 3 -8v-1c1 -2 2 -4 2 -6c0 -5 -4 -9 -10 -11h-1c-6 -1 -13 -2 -19 -3h-2c-6 -1 -11 -5 -14 -9v0c-4 -5 -10 -10 -18 -10s-15 6 -19 11v0c-3 4 -7 7 -13 8h-2c-6 1 -13 2 -19 3h-1c-6 2 -10 6 -10 11c0 2 1 4 2 6v1
+c2 2 3 4 3 7s-1 5 -3 8v1c-1 2 -2 4 -2 6s1 3 2 5v1c2 3 3 5 3 8s-1 4 -3 7v1v0c-1 2 -2 4 -2 6c0 4 -1 6 7 6h114c8 0 7 -2 7 -6c0 -2 -1 -4 -2 -6v0z" />
+    <glyph glyph-name="ion-link" unicode="&#xf1fe;" horiz-adv-x="384" 
+d="M192 240v0v0v0zM304 288c44 0 80 -36 80 -80v-32c0 -44 -36 -80 -80 -80h-112c-33 0 -60 20 -73 48c-4 10 -7 20 -7 32v32h48v-32c0 -18 14 -32 32 -32h112c18 0 32 14 32 32v32c0 18 -14 32 -32 32v0h-16c-6 31 -32 48 -32 48h48zM266 240c4 -10 6 -21 6 -32v-32v0h-48
+v0v32c0 18 -14 32 -32 32v0h-112c-18 0 -32 -14 -32 -32v-32c0 -18 14 -32 32 -32h16c6 -31 32 -48 32 -48h-48c-44 0 -80 36 -80 80v32c0 44 36 80 80 80h112c33 0 62 -20 74 -48z" />
+    <glyph glyph-name="ion-load-a" unicode="&#xf29a;" horiz-adv-x="384" 
+d="M144 352c0 43 21 64 64 64s64 -21 64 -64s-21 -64 -64 -64s-64 21 -64 64zM0 192c0 32 16 48 48 48s48 -16 48 -48s-16 -48 -48 -48s-48 16 -48 48zM312 304c0 5 3 8 8 8s8 -3 8 -8s-3 -8 -8 -8s-8 3 -8 8zM132 340c10 -10 15 -22 15 -36s-5 -26 -15 -36s-22 -15 -36 -15
+s-26 5 -36 15s-15 22 -15 36s5 26 15 36s22 15 36 15s26 -5 36 -15zM352 192c0 11 5 16 16 16s16 -5 16 -16s-5 -16 -16 -16s-16 5 -16 16zM297 79c0 16 8 24 24 24s24 -8 24 -24s-8 -24 -24 -24s-24 8 -24 24zM176 32c0 21 11 32 32 32s32 -11 32 -32s-11 -32 -32 -32
+s-32 11 -32 32zM56 80c0 27 13 40 40 40s40 -13 40 -40s-13 -40 -40 -40s-40 13 -40 40z" />
+    <glyph glyph-name="ion-load-b" unicode="&#xf29b;" 
+d="M256 288c0 -18 -14 -32 -32 -32v0c-18 0 -32 14 -32 32v96c0 18 14 32 32 32v0c18 0 32 -14 32 -32v-96zM224 128v0c18 0 32 -14 32 -32v-96c0 -18 -14 -32 -32 -32s-32 14 -32 32v96c0 18 14 32 32 32zM416 224v0c18 0 32 -14 32 -32s-14 -32 -32 -32h-96
+c-18 0 -32 14 -32 32s14 32 32 32h96zM128 224v0c18 0 32 -14 32 -32s-14 -32 -32 -32h-96c-18 0 -32 14 -32 32s14 32 32 32h96zM314 237c-12 -12 -33 -12 -45 0v0c-12 12 -12 34 0 46l68 67c12 12 33 12 45 0v0c12 -12 12 -33 0 -45zM179 147v0c12 -12 12 -33 0 -46
+l-68 -67c-12 -12 -33 -12 -45 0s-12 33 0 45l67 68c12 12 34 12 46 0zM382 79v0c12 -12 12 -33 0 -45s-33 -12 -45 0l-68 68c-12 12 -12 33 0 45s33 12 45 0zM179 282v0c12 -12 12 -33 0 -45s-34 -12 -46 0l-67 68c-12 12 -12 33 0 45s33 12 45 0z" />
+    <glyph glyph-name="ion-load-c" unicode="&#xf29c;" 
+d="M448 222c0 -3 0 -6 -1 -9c-4 -8 -15 -12 -23 -7c-4 2 -6 7 -7 11c-1 5 -1 9 -2 14c-4 20 -12 40 -22 58c-12 21 -28 41 -47 56c-18 15 -40 26 -62 33c-21 6 -42 9 -64 9h-4c-3 0 -6 -1 -9 -1c-6 0 -14 -1 -20 -2c-13 -2 -25 -6 -37 -11c-21 -8 -40 -20 -57 -35
+s-31 -33 -42 -52c-12 -22 -20 -45 -24 -70c-2 -11 -2 -23 -2 -34c0 -6 0 -11 1 -16c1 -6 2 -13 3 -19c5 -24 14 -47 28 -67c13 -20 29 -38 48 -52c20 -15 42 -26 65 -33c25 -7 50 -9 76 -7c25 2 50 9 73 20c11 5 22 12 32 19s19 15 27 24c4 4 8 9 12 14s7 10 10 15
+c6 10 12 20 17 31c4 8 8 16 11 25c2 4 3 9 4 13s1 7 2 11c1 -9 1 -18 -1 -26c-1 -5 -2 -11 -4 -16c-1 -5 -3 -10 -5 -15c-4 -10 -8 -19 -13 -28c-6 -11 -12 -21 -20 -30s-16 -18 -25 -26c-18 -15 -40 -27 -62 -36c-23 -9 -48 -14 -73 -15s-51 3 -75 11c-23 7 -45 19 -65 33
+c-19 14 -36 31 -50 50c-7 10 -13 20 -18 31s-9 21 -13 33c-6 18 -9 37 -10 56c-1 20 1 39 5 58c5 24 15 47 28 68c12 19 26 35 42 50s35 27 55 36c23 11 48 19 74 21c10 1 19 1 29 1c13 0 26 -2 38 -4c24 -5 47 -14 68 -26s41 -29 57 -48c15 -18 27 -37 36 -58
+c4 -10 7 -21 10 -32c2 -8 5 -17 6 -26z" />
+    <glyph glyph-name="ion-load-d" unicode="&#xf29d;" horiz-adv-x="384" 
+d="M368 208c9 0 16 -7 16 -16s-7 -16 -16 -16h-80c-9 0 -16 7 -16 16s7 16 16 16h80zM112 192c0 -9 -7 -16 -16 -16h-80c-9 0 -16 7 -16 16s7 16 16 16h80c9 0 16 -7 16 -16zM192 112c9 0 16 -7 16 -16v-80c0 -9 -7 -16 -16 -16s-16 7 -16 16v80c0 9 7 16 16 16zM192 384
+c9 0 16 -7 16 -16v-80c0 -9 -7 -16 -16 -16s-16 7 -16 16v80c0 9 7 16 16 16zM261 232c-4 8 -2 18 6 22l69 40c8 4 18 2 22 -6s2 -18 -6 -22l-69 -40c-8 -4 -18 -2 -22 6zM123 152c4 -8 2 -18 -6 -22l-69 -40c-8 -4 -18 -2 -22 6s-2 18 6 22l69 40c8 4 18 2 22 -6zM254 117
+l40 -69c4 -8 2 -18 -6 -22s-18 -2 -22 6l-40 69c-4 8 -2 18 6 22s18 2 22 -6zM118 352l40 -69c4 -8 2 -18 -6 -22s-18 -2 -22 6l-40 69c-4 8 -2 18 6 22s18 2 22 -6zM232 261c-8 4 -10 14 -6 22l40 69c4 8 14 10 22 6s10 -14 6 -22l-40 -69c-4 -8 -14 -10 -22 -6zM152 123
+c8 -4 10 -14 6 -22l-40 -69c-4 -8 -14 -10 -22 -6s-10 14 -6 22l40 69c4 8 14 10 22 6zM352 118c8 -4 10 -14 6 -22s-14 -10 -22 -6l-69 40c-8 4 -10 14 -6 22s14 10 22 6zM32 266c-8 4 -10 14 -6 22s14 10 22 6l69 -40c8 -4 10 -14 6 -22s-14 -10 -22 -6z" />
+    <glyph glyph-name="ion-location" unicode="&#xf1ff;" horiz-adv-x="239" 
+d="M119 384c66 0 120 -54 120 -120c0 -115 -120 -264 -120 -264s-119 149 -119 264c0 66 53 120 119 120zM119 206c31 0 57 25 57 56s-26 57 -57 57s-56 -26 -56 -57s25 -56 56 -56z" />
+    <glyph glyph-name="ion-lock-combination" unicode="&#xf4d4;" horiz-adv-x="384" 
+d="M320 271c39 -35 64 -86 64 -143c0 -106 -86 -192 -192 -192s-192 86 -192 192c0 57 25 108 64 143v49c0 71 57 128 128 128s128 -57 128 -128v-49zM96 320v-26c28 16 61 26 96 26s68 -10 96 -26v26c0 53 -43 96 -96 96s-96 -43 -96 -96zM192 -32c88 0 160 72 160 160
+s-72 160 -160 160s-160 -72 -160 -160s72 -160 160 -160zM192 272c80 0 144 -64 144 -144s-64 -144 -144 -144s-144 64 -144 144s64 144 144 144zM315 95c2 9 4 18 4 29h-7v7h8c0 11 -2 20 -5 30l-25 -7l-4 12l25 8c-4 10 -8 18 -14 26l-11 -8l-4 6l11 8c-6 8 -13 16 -21 22
+l-15 -21l-11 8l15 20c-8 6 -17 11 -27 14l-4 -13l-6 2l5 13c-9 3 -20 5 -29 5v-13v-6h-16v6v13c-11 -1 -19 -2 -29 -5l4 -12l-6 -2l-4 12c-10 -3 -19 -8 -27 -14l15 -20l-10 -8l-15 21c-8 -6 -16 -14 -22 -22l11 -8l-4 -5l-10 8c-6 -8 -10 -17 -14 -27l24 -8l-5 -12l-25 7
+c-3 -10 -3 -19 -3 -30h6v-7h-5c0 -11 2 -20 4 -29l24 7l4 -12l-24 -8c4 -10 8 -19 14 -27l9 7l4 -5l-9 -7c6 -8 13 -16 21 -22l15 21l10 -8l-15 -20c8 -5 17 -11 27 -14l3 11l7 -2l-4 -11c10 -3 18 -4 29 -5v13v6h16v-6v-13c9 1 19 2 29 5l-5 12l6 2l4 -12c10 3 19 8 27 14
+l-15 20l11 8l15 -21c8 6 15 14 21 22l-11 7l4 6l10 -8c6 8 11 17 15 27l-25 8l4 12zM111 128c0 54 27 81 81 81s81 -27 81 -81s-27 -81 -81 -81s-81 27 -81 81z" />
+    <glyph glyph-name="ion-locked" unicode="&#xf200;" horiz-adv-x="384" 
+d="M22 -32c-12 0 -22 10 -22 22v212c0 12 10 22 22 22h3h19v31c0 42 17 87 43 115s64 46 105 46v0v0c41 0 79 -18 105 -46s43 -73 43 -115v-31h22c12 0 22 -10 22 -22v-212c0 -12 -10 -22 -22 -22h-340zM97 255v-31h17h155h18v31c0 27 -10 61 -28 80v0v1
+c-18 19 -42 29 -67 29v0v0c-25 0 -49 -10 -67 -29v-1v0c-18 -19 -28 -53 -28 -80z" />
+    <glyph glyph-name="ion-log-in" unicode="&#xf29e;" 
+d="M224 416c124 0 224 -100 224 -224s-100 -224 -224 -224c-96 0 -177 60 -209 144h34c9 -20 23 -40 39 -56c36 -36 85 -56 136 -56s100 20 136 56s56 85 56 136s-20 100 -56 136s-85 56 -136 56s-100 -20 -136 -56c-16 -16 -30 -36 -39 -56h-34c32 84 113 144 209 144z
+M175 124l52 52h-227v32h227l-52 52l22 23l91 -91l-91 -91z" />
+    <glyph glyph-name="ion-log-out" unicode="&#xf29f;" 
+d="M335 124l52 52h-227v32h227l-52 52l22 23l91 -91l-91 -91zM359 56c3 3 6 5 8 8h41c-40 -58 -108 -96 -184 -96c-124 0 -224 100 -224 224s100 224 224 224c76 0 144 -38 184 -96h-41c-2 3 -5 5 -8 8c-36 36 -84 56 -135 56s-100 -20 -136 -56s-56 -85 -56 -136
+s20 -100 56 -136s85 -56 136 -56s99 20 135 56z" />
+    <glyph glyph-name="ion-loop" unicode="&#xf201;" horiz-adv-x="334" 
+d="M184 148v-58c49 8 86 50 86 102c0 16 -4 30 -10 44c-3 6 -5 12 -9 17l47 43c1 -1 2 -3 3 -4c21 -28 33 -62 33 -100v-4c-2 -72 -47 -131 -111 -154c-12 -4 -26 -8 -39 -9v-57l-76 67l-26 23l44 39zM0 196c2 72 48 133 113 155c12 4 24 7 37 8v57l76 -67l26 -23l-44 -39
+l-59 -51l1 58c-49 -8 -86 -51 -86 -102c0 -16 4 -31 10 -45c3 -6 5 -11 9 -16l-47 -44c-1 2 -2 3 -3 5c-20 28 -33 63 -33 100v4z" />
+    <glyph glyph-name="ion-magnet" unicode="&#xf2a0;" horiz-adv-x="384" 
+d="M192 416c115 0 192 -78 192 -200c0 -49 -3 -77 -15 -128c-16 -66 -39 -113 -39 -113v-1c-2 -3 -6 -6 -10 -6c-1 0 -3 1 -4 1l-2 1l-50 20l-2 1c-3 2 -5 5 -5 9c0 1 0 3 1 4v1c7 16 27 59 37 101s13 63 13 108c0 71 -52 122 -116 122s-116 -51 -116 -122
+c0 -45 3 -66 13 -108s30 -85 37 -101v-1c1 -1 1 -3 1 -4c0 -4 -2 -7 -5 -9l-2 -1l-50 -20l-2 -1c-1 0 -3 -1 -4 -1c-4 0 -8 3 -10 6v1s-24 47 -40 113c-12 51 -14 79 -14 128c0 122 77 200 192 200zM109 4c-9 19 -27 59 -36 98l-42 -12c13 -53 30 -92 35 -104l43 17v1z
+M317 -14c5 12 23 51 36 104l-43 12c-9 -39 -26 -79 -35 -98v-1z" />
+    <glyph glyph-name="ion-male" unicode="&#xf2a1;" 
+d="M448 256l-63 63l-69 -69c22 -30 36 -66 36 -106c0 -97 -79 -176 -176 -176s-176 79 -176 176s79 176 176 176c40 0 76 -14 106 -36l69 69l-63 63h160v-160zM266 54c24 24 38 56 38 90s-14 66 -38 90s-56 38 -90 38s-66 -14 -90 -38s-38 -56 -38 -90s14 -66 38 -90
+s56 -38 90 -38s66 14 90 38z" />
+    <glyph glyph-name="ion-man" unicode="&#xf202;" horiz-adv-x="168" 
+d="M84 341c-21 0 -37 17 -37 38s16 37 37 37s37 -16 37 -37s-16 -38 -37 -38zM121 333c28 0 47 -24 47 -48v-114c0 -22 -32 -22 -32 0v105h-5v-286c0 -28 -41 -31 -43 0v165h-1h-7v-165c-1 -29 -43 -30 -43 0v286h-6v-105c0 -22 -31 -22 -31 0v114c0 24 19 48 47 48h37h37z
+" />
+    <glyph glyph-name="ion-map" unicode="&#xf203;" 
+d="M441 311c4 -3 7 -8 7 -14v-281c0 -6 -2 -11 -7 -14c-2 -1 -5 -2 -7 -2c-3 0 -6 0 -8 2l-97 66l-97 -66c-5 -3 -10 -3 -15 0l-97 66l-97 -66c-5 -3 -10 -3 -15 0s-8 8 -8 14v281c0 6 3 11 7 14l105 71c5 3 10 3 15 0l97 -66l98 66c5 3 10 3 15 0zM103 95v242l-71 -50v-242
+zM135 95l73 -49v129l-4 -11c-7 2 -13 6 -20 10l8 13c5 -3 11 -6 16 -8v109l-73 49v-101c4 -2 9 -4 13 -7l-10 -13c-1 1 -2 1 -3 2v-123zM240 46l73 49v109c0 -1 -1 -1 -1 -2l-6 -6l-12 11l6 6c3 3 5 7 8 10l5 -5v119l-73 -49v-112h7l3 -15c-3 0 -6 -1 -9 -1h-1v-114zM416 46
+v242l-71 49v-88c3 1 5 1 8 2l4 -16c-4 -1 -8 -1 -12 -3v-137zM97 227c-3 -1 -11 -5 -14 -7l-11 12c4 3 8 6 12 8c3 2 6 3 9 4l5 -15c-2 -1 1 -1 -1 -2zM265 182c5 3 10 5 15 10l11 -12c-6 -6 -12 -10 -19 -13zM67 192v-1l-15 5v1c2 7 4 13 9 20l13 -9c-4 -5 -5 -10 -7 -16z
+M166 210c3 -4 7 -8 11 -11l-11 -12c-4 4 -8 9 -12 13l-3 3l12 11c1 -1 2 -3 3 -4zM376 218l-11 12l10 10l-10 10l11 12l10 -11l11 11l11 -12l-10 -10l10 -10l-11 -12l-11 11z" />
+    <glyph glyph-name="ion-medkit" unicode="&#xf2a2;" 
+d="M440 304c4 0 8 -4 8 -8v-288c0 -4 -4 -8 -8 -8h-432c-4 0 -8 4 -8 8v288c0 4 4 8 8 8h120v31c1 28 22 49 51 49h45h45c30 0 50 -21 51 -49v-31h120zM160 331v-27h128v27v1v1c0 10 -9 19 -19 19h-45h-45c-10 0 -19 -9 -19 -19v-1v-1zM320 128v64h-64v64h-64v-64h-64v-64
+h64v-64h64v64h64z" />
+    <glyph glyph-name="ion-merge" unicode="&#xf33f;" horiz-adv-x="384" 
+d="M320 224c35 0 64 -29 64 -64s-29 -64 -64 -64c-24 0 -44 13 -55 32h-10c-61 0 -115 25 -159 74v-115c19 -11 32 -31 32 -55c0 -35 -29 -64 -64 -64s-64 29 -64 64c0 24 13 44 32 55v210c-19 11 -32 31 -32 55c0 35 29 64 64 64s64 -29 64 -64c0 -19 -8 -37 -22 -49
+c4 -9 17 -35 37 -58c32 -35 70 -53 112 -53h10c11 19 31 32 55 32zM64 384c-18 0 -32 -14 -32 -32s14 -32 32 -32s32 14 32 32s-14 32 -32 32zM64 0c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32zM320 128c18 0 32 14 32 32s-14 32 -32 32
+s-32 -14 -32 -32s14 -32 32 -32z" />
+    <glyph glyph-name="ion-mic-a" unicode="&#xf204;" horiz-adv-x="288" 
+d="M0 210c0 10 9 19 20 19s19 -9 19 -19v-14c0 -28 12 -53 31 -72s45 -31 74 -31s55 12 74 31s31 44 31 72v14c0 10 8 19 19 19s20 -9 20 -19v-14c0 -66 -46 -120 -108 -136c-1 0 -3 -1 -4 -1c-6 -2 -10 -7 -12 -13v-58c0 -11 -9 -20 -20 -20v0c-11 0 -20 9 -20 20v58
+c-2 6 -6 11 -12 13c-1 0 -3 1 -4 1c-62 16 -108 70 -108 136v14zM67 340c0 42 34 76 77 76s78 -34 78 -76v-144c0 -42 -35 -75 -78 -75s-77 33 -77 75v144z" />
+    <glyph glyph-name="ion-mic-b" unicode="&#xf205;" horiz-adv-x="160" 
+d="M80 416c35 0 65 -23 76 -59c6 -18 4 -45 2 -55s-8 -20 -14 -28c-3 -4 -7 -7 -11 -9c-1 0 -1 -1 -2 -1c-3 -1 -6 -2 -10 -3c-12 -3 -25 -5 -39 -5v0h-1h-1v0c-14 0 -29 2 -41 5c-4 1 -7 2 -10 3c-1 0 -1 1 -2 1c-4 2 -8 5 -11 9c-6 8 -12 18 -14 28s-4 37 2 55
+c11 36 41 59 76 59zM119 247c6 0 12 -5 12 -12v-2c-5 -67 -18 -241 -19 -252c0 0 -3 -13 -32 -13v0c-29 0 -32 13 -32 13c-1 11 -13 185 -18 252v2c0 7 5 12 11 12h1c1 0 1 -1 2 -1c2 0 4 -1 6 -1c9 -2 21 -2 31 -2s20 0 29 2c2 0 4 1 6 1c1 0 1 1 2 1h1zM90 166v33
+c0 6 -4 11 -10 11s-10 -5 -10 -11v-33c0 -6 4 -11 10 -11s10 5 10 11z" />
+    <glyph glyph-name="ion-mic-c" unicode="&#xf206;" horiz-adv-x="256" 
+d="M201 416c30 0 55 -23 55 -52v-28h-59v-37h59v-43h-59v-37h59v-43h-59v-37h59v-42c0 -29 -25 -52 -55 -52h-30v-77h-86v77h-30c-30 0 -55 23 -55 52v42h152v37h-152v43h152v37h-152v43h152v37h-152v28c0 29 25 52 55 52h146z" />
+    <glyph glyph-name="ion-minus-circled" unicode="&#xf207;" 
+d="M224 416c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224s100 224 224 224zM352 176v32h-256v-32h256z" />
+    <glyph glyph-name="ion-minus-round" unicode="&#xf208;" horiz-adv-x="384" 
+d="M353 224c17 0 31 -14 31 -32s-14 -32 -31 -32h-322c-17 0 -31 14 -31 32s14 32 31 32h322z" />
+    <glyph glyph-name="ion-minus" unicode="&#xf209;" horiz-adv-x="384" 
+d="M0 160v64h384v-64h-384z" />
+    <glyph glyph-name="ion-model-s" unicode="&#xf2c1;" horiz-adv-x="512" 
+d="M509 57v-8v0v-1v-3v0c0 -3 -1 -5 -1 -7c-1 -12 -2 -18 -6 -20c-3 -2 -6 -2 -10 -2h-43s-10 1 -11 16v8c20 1 39 1 52 0c10 0 13 0 16 6c2 3 2 7 3 11zM3 57c1 -4 1 -8 3 -11c3 -6 6 -6 16 -6c13 1 32 1 52 0v-8c-1 -15 -8 -16 -11 -16h-43s-7 0 -10 2c-4 2 -6 8 -7 20v7
+v0v3v1v0v8zM512 151c0 -31 -2 -58 -2 -68c0 -4 0 -11 -1 -18c-1 -4 -1 -8 -3 -11c-3 -6 -6 -6 -16 -6c-13 1 -32 1 -52 0c-13 0 -27 -2 -39 -2c-30 -1 -21 4 -34 4s-63 -2 -109 -2s-97 2 -110 2s-4 -5 -34 -4c-12 0 -25 2 -38 2c-20 1 -39 1 -52 0c-10 0 -13 0 -16 6
+c-2 3 -2 7 -3 11c-1 7 -1 14 -1 18c0 10 -2 37 -2 68s4 61 6 64c1 2 8 9 26 21s17 10 20 18c-3 1 -5 3 -7 3c-4 0 -4 -3 -12 -3s-24 1 -28 5c-4 3 -5 5 -5 8s2 9 5 13s19 6 27 7s10 0 12 -1c4 -2 3 -22 3 -22l9 -1c5 13 12 41 24 62c13 23 26 30 32 32s10 2 48 6s69 5 96 5
+s58 -1 96 -5s42 -4 48 -6s19 -9 32 -32c12 -21 19 -49 24 -62l9 1s-1 20 3 22c2 1 4 2 12 1s24 -3 27 -7s5 -10 5 -13s-1 -4 -5 -8s-20 -5 -28 -5s-8 3 -12 3c-2 0 -4 -2 -7 -3c3 -8 2 -6 20 -18s25 -19 26 -21c2 -3 6 -33 6 -64zM86 303c-5 -11 -11 -33 -10 -36
+s-1 -5 15 -4s117 3 165 3s149 -2 165 -3s14 1 15 4s-5 25 -10 36s-17 31 -26 37c-2 1 -17 7 -54 9c-34 2 -72 3 -90 3s-56 -1 -90 -3c-37 -2 -52 -8 -54 -9c-7 -4 -21 -26 -26 -37zM123 178c7 2 11 2 11 2s-17 16 -48 25s-49 11 -66 10c0 0 -3 -16 0 -27s8 -10 16 -12
+s13 -5 16 -4s7 4 12 4s29 -4 38 -4s14 4 21 6zM358 99c15 2 34 19 21 33c-18 19 -15 19 -55 24c-35 4 -61 4 -68 4s-33 0 -68 -4c-40 -5 -37 -5 -55 -24c-13 -14 6 -31 21 -33c14 -2 74 -3 102 -3s88 1 102 3zM492 188c3 11 0 27 0 27c-17 1 -35 -1 -66 -10s-48 -26 -48 -26
+s4 1 11 -1s12 -6 21 -6s33 4 38 4s9 -3 12 -4s8 2 16 4s13 1 16 12z" />
+    <glyph glyph-name="ion-monitor" unicode="&#xf20a;" 
+d="M437 384c6 0 11 -5 11 -11v-266c0 -6 -5 -11 -11 -11h-426c-6 0 -11 5 -11 11v266c0 6 5 11 11 11h426zM416 128v224h-384v-224h384zM270 0h-92c-28 0 -42 3 -30 12s30 16 30 23c0 4 1 45 1 45h45h45s1 -41 1 -45c0 -7 18 -14 30 -23s-2 -12 -30 -12z" />
+    <glyph glyph-name="ion-more" unicode="&#xf20b;" horiz-adv-x="384" 
+d="M50 144c-28 0 -50 21 -50 48c0 26 22 48 50 48s50 -22 50 -48c0 -27 -22 -48 -50 -48zM192 144c-28 0 -50 21 -50 48c0 26 22 48 50 48s50 -22 50 -48c0 -27 -22 -48 -50 -48zM334 144c-28 0 -50 21 -50 48c0 26 22 48 50 48s50 -22 50 -48c0 -27 -22 -48 -50 -48z" />
+    <glyph glyph-name="ion-mouse" unicode="&#xf340;" horiz-adv-x="256" 
+d="M128 416h-1h5h-4zM251 255c2 1 2 1 4 1h1v-176c0 -37 -21 -71 -53 -91c-5 -3 -9 -5 -14 -7v-1v0c-18 -9 -39 -13 -61 -13c-71 0 -128 50 -128 112v176h1c2 0 3 0 5 -1v0c34 -13 76 -23 122 -23s88 10 122 23h1zM189 -18c5 2 10 4 14 7c-5 -3 -9 -5 -14 -7v0v-1v1v0z
+M203 -11c-4 -3 -9 -5 -14 -7c5 2 9 4 14 7zM132 416c69 -2 124 -51 124 -112v-23c-2 -2 -4 -4 -6 -5c-1 -1 -3 0 -4 -1c-23 -10 -50 -16 -82 -19h-1h-2c-11 0 -17 0 -17 10v86c0 9 -7 16 -16 16s-16 -7 -16 -16v-85c0 -11 -6 -11 -17 -11h-2c-32 3 -61 9 -84 19v0
+c-1 0 -1 1 -2 1c-3 1 -5 3 -7 5v23c0 61 57 111 127 112h5z" />
+    <glyph glyph-name="ion-music-note" unicode="&#xf20c;" horiz-adv-x="384" 
+d="M362 416c12 0 22 -9 22 -21v-303s-3 -43 -12 -55v0c-9 -15 -25 -21 -43 -21h-37c-28 0 -52 20 -52 48s24 48 52 48h60v192l-208 -38v-232c0 -8 -3 -27 -13 -41c-1 -2 -2 -3 -3 -5c0 -1 -1 -1 -2 -2v0c-9 -11 -23 -18 -38 -18h-37c-28 0 -51 20 -51 48s23 48 51 48v0h61
+v286c1 14 13 28 27 32l218 33s3 1 5 1z" />
+    <glyph glyph-name="ion-navicon-round" unicode="&#xf20d;" horiz-adv-x="384" 
+d="M353 224c17 0 31 -14 31 -32s-14 -32 -31 -32h-322c-17 0 -31 14 -31 32s14 32 31 32h322zM353 352c17 0 31 -14 31 -32s-14 -32 -31 -32h-322c-17 0 -31 14 -31 32s14 32 31 32h322zM353 96c17 0 31 -14 31 -32s-14 -32 -31 -32h-322c-17 0 -31 14 -31 32s14 32 31 32
+h322z" />
+    <glyph glyph-name="ion-navicon" unicode="&#xf20e;" horiz-adv-x="320" 
+d="M0 175v32h320v-32h-320zM0 271v32h320v-32h-320zM0 79v32h320v-32h-320z" />
+    <glyph glyph-name="ion-navigate" unicode="&#xf2a3;" 
+d="M448 416l-192 -448v256h-256z" />
+    <glyph glyph-name="ion-network" unicode="&#xf341;" horiz-adv-x="384" 
+d="M384 352c0 -24 -13 -44 -32 -55v-93l-128 -64v-53c19 -11 32 -31 32 -55c0 -35 -29 -64 -64 -64s-64 29 -64 64c0 24 13 44 32 55v53l-128 64v93c-19 11 -32 31 -32 55c0 35 29 64 64 64s64 -29 64 -64c0 -24 -13 -44 -32 -55v-53l96 -48l96 48v53c-19 11 -32 31 -32 55
+c0 35 29 64 64 64s64 -29 64 -64zM64 384c-18 0 -32 -14 -32 -32s14 -32 32 -32s32 14 32 32s-14 32 -32 32zM192 0c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32zM320 320c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32z" />
+    <glyph glyph-name="ion-no-smoking" unicode="&#xf2c2;" 
+d="M328 144v48h16v-48h-16zM80 144v48h90l48 -48h-138zM332 388c69 -38 116 -112 116 -196c0 -124 -100 -224 -224 -224c-24 0 -47 4 -68 11c-2 1 -3 1 -5 2c-12 4 -24 9 -35 15h-1c-69 38 -115 112 -115 196c0 124 100 224 224 224c24 0 47 -4 68 -11c2 -1 3 -1 5 -2
+c12 -4 24 -9 35 -15v0zM224 22c37 0 72 12 100 32l-238 238c-20 -28 -32 -63 -32 -100c0 -65 36 -121 90 -150c6 -3 13 -7 19 -9c2 -1 3 -1 5 -2c9 -3 19 -5 29 -7c9 -2 18 -2 27 -2zM362 93c20 28 32 62 32 99c0 66 -37 123 -91 151c-6 3 -12 6 -18 8c-2 1 -3 1 -5 2
+c-9 3 -19 5 -29 7c-9 2 -18 2 -27 2c-37 0 -71 -12 -99 -32zM320 150l-42 42h42v-42zM352 144v48h16v-48h-16zM328 235c16 -7 16 -27 16 -34v-1h-16v1c0 8 -1 17 -7 20c-4 2 -13 4 -39 4h-3c-13 0 -24 0 -33 13c-5 8 -5 19 -2 29c-4 1 -8 1 -12 3c-17 7 -26 20 -26 38
+c0 33 27 44 39 44v-16c-1 0 -23 -2 -23 -28c0 -11 5 -19 16 -23c9 -4 18 -3 18 -3c3 0 6 -2 7 -5s2 -6 0 -8c-5 -7 -7 -18 -4 -22c4 -6 7 -6 20 -6h3c24 0 37 -2 46 -6zM368 200v0h-16c0 28 -4 41 -7 46c-6 10 -14 14 -25 14h-30c-3 0 -5 2 -6 4s-1 6 0 8c0 0 8 18 6 32
+c-1 8 -6 17 -27 17v16c24 0 40 -11 43 -30c2 -11 0 -23 -3 -31h17c16 0 30 -8 39 -22c6 -10 9 -28 9 -54z" />
+    <glyph glyph-name="ion-nuclear" unicode="&#xf2a4;" 
+d="M176 176c0 32 16 48 48 48s48 -16 48 -48s-16 -48 -48 -48s-48 16 -48 48zM176 176c0 32 16 48 48 48s48 -16 48 -48s-16 -48 -48 -48s-48 16 -48 48zM448 176c0 -27 -5 -53 -15 -78s-23 -47 -40 -66s-36 -35 -59 -48l-79 136c22 12 33 31 33 56h160zM224 240
+c-12 0 -23 -3 -33 -9l-80 138c35 20 73 31 113 31s78 -10 113 -30l-81 -139c-10 6 -21 9 -32 9zM160 176c0 -25 11 -44 33 -56l-79 -136c-35 20 -62 46 -83 80s-31 71 -31 112h160z" />
+    <glyph glyph-name="ion-outlet" unicode="&#xf342;" 
+d="M338 416c61 0 110 -51 110 -113v-222c0 -62 -49 -113 -110 -113h-228c-61 0 -110 51 -110 113v222c0 62 49 113 110 113h228zM143 197v102c0 11 -9 21 -20 21h-23c-11 0 -19 -9 -20 -20v-2v-101v-1c0 -11 9 -20 20 -20h23c11 0 20 9 20 20v1zM265 52v29
+c0 23 -18 42 -41 42s-41 -19 -41 -42v-29v0c0 -11 9 -20 20 -20h21h21c11 0 20 7 20 18v2zM368 197v102c0 11 -9 21 -20 21h-24c-11 0 -19 -9 -20 -20v-2v-101v-1c0 -11 9 -20 20 -20h24c11 0 20 9 20 20v1z" />
+    <glyph glyph-name="ion-paintbrush" unicode="&#xf4d5;" 
+d="M118 165c52 0 102 -41 90 -102c-11 -52 -54 -71 -90 -77c-30 -5 -100 0 -118 35c24 9 34 26 34 49c0 49 32 95 84 95zM436 388c13 -13 17 -30 5 -45l-154 -175c2 -9 1 -17 -3 -23l-50 -58v0v0c-2 -2 -4 -2 -6 0c-1 1 -1 2 -1 3v1c2 53 -41 87 -89 90v0h-2s-2 0 -2 1
+c-2 2 -2 4 0 6l59 49c6 4 14 4 23 2l175 154c15 12 32 8 45 -5zM134 188v0v0v0z" />
+    <glyph glyph-name="ion-paintbucket" unicode="&#xf4d6;" horiz-adv-x="480" 
+d="M112 384l32 32l275 -276l-58 -12l-163 -160l-198 192l152 152zM309 160l-110 110l-110 -110h220zM419 140c0 0 61 -66 61 -99s-27 -60 -61 -60s-60 27 -60 60s60 99 60 99z" />
+    <glyph glyph-name="ion-paper-airplane" unicode="&#xf2c3;" 
+d="M0 176l448 240l-112 -448l-112 112l-80 -112l-16 160zM319 31l80 323l-322 -173l83 -31l192 154l-128 -176z" />
+    <glyph glyph-name="ion-paperclip" unicode="&#xf20f;" horiz-adv-x="160" 
+d="M149 293c6 0 11 -5 11 -12v-195c0 -28 -10 -49 -24 -63c-15 -15 -36 -23 -56 -23c-40 0 -80 31 -80 88v234c0 24 11 44 29 54s39 11 57 0s29 -30 29 -54l-1 -225c0 -13 -3 -24 -9 -32s-16 -12 -25 -12c-17 0 -34 15 -34 44v173c0 6 6 12 12 12s11 -6 11 -12v-173
+c0 -14 5 -21 11 -21c2 0 5 2 7 4c3 4 5 10 5 17v225c0 15 -6 28 -17 34s-24 6 -35 0s-17 -19 -17 -34v-234c0 -44 29 -64 57 -64s57 19 57 63v195c0 6 6 11 12 11z" />
+    <glyph glyph-name="ion-pause" unicode="&#xf210;" horiz-adv-x="256" 
+d="M96 12c0 -7 -5 -12 -12 -12h-72c-7 0 -12 5 -12 12v360c0 7 5 12 12 12h72c7 0 12 -5 12 -12v-360zM244 384c7 0 12 -5 12 -12v-360c0 -7 -5 -12 -12 -12h-72c-7 0 -12 5 -12 12v360c0 7 5 12 12 12h72z" />
+    <glyph glyph-name="ion-person-add" unicode="&#xf211;" 
+d="M397 120h-42v51h-51v42h51v51h42v-51h51v-42h-51v-51zM384 0h-192h-192s0 26 2 40c2 11 17 25 81 49c63 23 60 12 60 55c0 28 -14 11 -23 64c-4 21 -6 7 -14 40c-4 17 3 19 2 27s-2 16 -4 33c-2 21 18 76 88 76s90 -55 88 -76c-2 -17 -3 -25 -4 -33s6 -10 2 -27
+c-8 -33 -10 -19 -14 -40c-9 -53 -23 -36 -23 -64c0 -43 -3 -32 60 -55c64 -24 79 -38 81 -49c2 -14 2 -40 2 -40z" />
+    <glyph glyph-name="ion-person-stalker" unicode="&#xf212;" 
+d="M393 123c42 -16 52 -26 53 -33c2 -9 2 -90 2 -90h-98c0 18 0 71 -1 77c-1 10 -1 29 -55 50c-8 3 -14 5 -19 7c18 8 15 15 15 28c0 19 -9 11 -15 47c-2 14 -4 5 -9 28c-3 12 1 12 1 18s-1 10 -2 22c-1 14 11 52 57 52s59 -38 58 -52c-1 -12 -2 -16 -2 -22
+c-1 -6 4 -6 1 -18c-5 -23 -7 -14 -9 -28c-6 -36 -16 -28 -16 -47c0 -29 -2 -23 39 -39zM325 0h-163h-162s0 65 2 77c2 10 15 22 69 43c54 20 50 17 50 55c0 24 -12 8 -20 54c-3 18 -5 7 -11 36c-3 15 2 16 1 23s-2 14 -3 29c-2 19 15 67 74 67s77 -49 75 -67
+c-1 -15 -2 -22 -3 -29s5 -8 2 -23c-6 -29 -9 -18 -12 -36c-8 -46 -20 -30 -20 -54c0 -32 -2 -36 31 -48c6 -2 11 -4 19 -7c54 -21 67 -33 69 -43c1 -6 2 -28 2 -47v-30z" />
+    <glyph glyph-name="ion-person" unicode="&#xf213;" horiz-adv-x="384" 
+d="M384 0h-192h-192s0 26 2 40c2 11 17 25 81 49c63 23 60 12 60 55c0 28 -14 11 -23 64c-4 21 -6 7 -14 40c-4 17 3 19 2 27s-2 16 -4 33c-2 21 18 76 88 76s90 -55 88 -76c-2 -17 -3 -25 -4 -33s6 -10 2 -27c-8 -33 -10 -19 -14 -40c-9 -53 -23 -36 -23 -64
+c0 -43 -3 -32 60 -55c64 -24 79 -38 81 -49c2 -14 2 -40 2 -40z" />
+    <glyph glyph-name="ion-pie-graph" unicode="&#xf2a5;" 
+d="M1 192c0 5 -1 11 -1 16c0 115 93 208 208 208c5 0 11 -1 16 -1v-32v-191h-191h-32zM78 46c-26 32 -42 71 -45 114h223v223c43 -3 82 -19 114 -45c47 -38 78 -96 78 -162c0 -115 -93 -208 -208 -208c-66 0 -124 31 -162 78z" />
+    <glyph glyph-name="ion-pin" unicode="&#xf2a6;" horiz-adv-x="224" 
+d="M188 220c20 -10 36 -31 36 -55c0 -17 -3 -21 -15 -21h-81l-12 -176h-8l-12 176h-81c-12 0 -15 5 -15 21c0 24 16 45 36 55v0c1 0 3 1 4 2c7 4 12 11 14 19l18 118v5c0 7 -4 10 -10 13v0c-1 0 -1 1 -2 1c-7 3 -12 9 -12 17c0 20 6 21 18 21h92c12 0 18 -1 18 -21
+c0 -8 -5 -14 -12 -17c-1 0 -1 -1 -2 -1v0c-6 -3 -10 -6 -10 -13v-5l18 -118c2 -8 7 -15 14 -19c1 -1 3 -2 4 -2v0z" />
+    <glyph glyph-name="ion-pinpoint" unicode="&#xf2a7;" 
+d="M224 416c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224s100 224 224 224zM360 56c32 32 51 75 55 120l-63 8v16l63 8c-4 45 -23 88 -55 120s-75 51 -120 55l-8 -63h-16l-8 63c-45 -4 -88 -23 -120 -55s-51 -75 -55 -120l63 -8v-16l-63 -8
+c4 -45 23 -88 55 -120s75 -51 120 -55l8 63h16l8 -63c45 4 88 23 120 55z" />
+    <glyph glyph-name="ion-pizza" unicode="&#xf2a8;" horiz-adv-x="352" 
+d="M315 318c10 -4 12 -13 9 -20l-148 -330s-143 320 -148 331s2 16 9 19c39 18 90 28 139 28s96 -9 139 -28zM112 256c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32zM176 109c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32zM240 224
+c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32zM342 382c6 -3 10 -6 10 -13c0 -1 0 -3 -1 -5l-8 -19c-3 -5 -8 -9 -14 -9c-1 0 -3 1 -6 2c-41 18 -95 30 -147 30s-102 -11 -147 -30c-3 -1 -4 -2 -6 -2c-6 0 -11 4 -14 9l-8 19s-1 2 -1 5c0 8 6 12 10 14
+c49 21 107 33 166 33s118 -13 166 -34z" />
+    <glyph glyph-name="ion-plane" unicode="&#xf214;" 
+d="M250 136c0 -7 1 -69 -6 -102c-1 -4 3 -4 5 -7l51 -33c2 -2 3 -8 3 -8l1 -18l-68 16l-12 -32l-12 32l-68 -16l1 18s0 6 2 8l52 33c2 3 6 3 5 7c-7 33 -6 95 -6 102s-8 5 -8 5l-62 -13l-128 -49c0 23 2 26 9 31l183 131s5 63 5 113c0 24 12 78 27 78s27 -54 27 -78
+c0 -53 5 -113 5 -113l183 -131c6 -4 9 -7 9 -31l-128 49l-62 13s-8 2 -8 -5z" />
+    <glyph glyph-name="ion-planet" unicode="&#xf343;" horiz-adv-x="512" 
+d="M96 182c39 -24 85 -48 134 -69c44 -19 87 -35 126 -46c-27 -22 -62 -35 -100 -35c-85 0 -155 66 -160 150zM107 251c1 4 3 8 5 11c10 21 26 40 44 55c27 22 62 35 100 35c85 0 155 -66 160 -150v-10c0 -21 -4 -41 -11 -59c-1 -4 -3 -8 -5 -11c-6 1 -13 3 -19 5
+c-39 11 -82 26 -126 45c-56 24 -108 52 -148 79zM430 163c57 -35 87 -62 81 -82c-4 -12 -19 -17 -44 -17c-50 0 -136 23 -231 64c-141 61 -246 140 -235 175c4 12 20 20 44 17c22 -3 47 -9 73 -18c-8 -9 -8 -12 -14 -22c-23 5 -44 8 -59 8h-6c2 -2 5 -6 8 -9
+c11 -11 27 -24 46 -37c41 -29 97 -59 156 -85c44 -19 89 -35 128 -46c36 -10 68 -15 90 -15h6c-2 2 -5 6 -8 9c-10 10 -24 22 -41 34c4 11 5 12 6 24z" />
+    <glyph glyph-name="ion-play" unicode="&#xf215;" horiz-adv-x="320" 
+d="M309 215c7 -6 11 -14 11 -23s-4 -17 -11 -23l-278 -166c-4 -2 -7 -3 -11 -3c-11 0 -20 9 -20 20v0v344v0c0 11 9 20 20 20c4 0 8 -1 11 -3z" />
+    <glyph glyph-name="ion-playstation" unicode="&#xf30a;" horiz-adv-x="512" 
+d="M400 245c0 -11 0 -22 -2 -33c-2 -10 -5 -20 -10 -28c-4 -7 -10 -13 -18 -17c-7 -4 -16 -6 -24 -6c-13 0 -31 4 -42 9v131v2c0 9 -7 17 -15 17h-1c-9 0 -16 -8 -16 -17v-3v-300l-80 26v358s28 -4 75 -18s67 -21 84 -31c8 -5 15 -11 21 -17c7 -7 13 -14 17 -23
+c8 -16 10 -33 11 -50zM87 90c-4 -2 -8 -3 -11 -6c-1 -1 -3 -3 -2 -5s4 -4 6 -5c6 -2 13 -3 19 -3c7 0 15 0 22 2c5 1 9 3 14 5c30 10 41 12 41 12v-42c-14 -2 -36 -4 -50 -4c-30 -1 -60 4 -88 13c-9 3 -19 6 -27 12c-4 3 -8 8 -10 13c-2 4 -1 9 1 13s5 8 9 11
+c9 6 18 10 28 14c8 4 17 7 26 10c35 12 111 37 111 37v-47s-62 -20 -89 -30zM512 102c0 -5 -2 -9 -5 -13c-6 -7 -14 -11 -22 -15s-17 -8 -26 -11c-54 -19 -171 -59 -171 -59v48s92 30 133 44c6 2 11 4 16 8c2 2 4 3 3 6c-1 2 -4 4 -6 5c-6 2 -13 3 -19 3
+c-10 0 -20 -2 -30 -5c-29 -10 -97 -32 -97 -32v49s45 14 67 16c8 1 23 1 31 1c26 0 54 -3 79 -11c5 -2 8 -3 14 -5c9 -3 18 -8 25 -14c4 -4 8 -9 8 -15z" />
+    <glyph glyph-name="ion-plus-circled" unicode="&#xf216;" 
+d="M224 416c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224s100 224 224 224zM352 176v32h-112v112h-32v-112h-112v-32h112v-112h32v112h112z" />
+    <glyph glyph-name="ion-plus-round" unicode="&#xf217;" horiz-adv-x="384" 
+d="M353 224c17 0 31 -14 31 -32s-14 -32 -31 -32h-129v-129c0 -17 -14 -31 -32 -31s-32 14 -32 31v129h-129c-17 0 -31 14 -31 32s14 32 31 32h129v129c0 17 14 31 32 31s32 -14 32 -31v-129h129z" />
+    <glyph glyph-name="ion-plus" unicode="&#xf218;" horiz-adv-x="384" 
+d="M384 224v-64h-160v-160h-64v160h-160v64h160v160h64v-160h160z" />
+    <glyph glyph-name="ion-podium" unicode="&#xf344;" 
+d="M0 0v192h128v-192h-128zM160 0v288h128v-288h-128zM320 0v128h128v-128h-128z" />
+    <glyph glyph-name="ion-pound" unicode="&#xf219;" 
+d="M93 96h-93v54h101l13 84h-99v54h107l22 128h64l-22 -128h106l22 128h63l-22 -128h93v-54h-102l-12 -84h99v-54h-107l-22 -128h-63l22 128h-107l-22 -128h-63zM177 234l-12 -84h106l12 84h-106v0z" />
+    <glyph glyph-name="ion-power" unicode="&#xf2a9;" 
+d="M224 192c-18 0 -32 14 -32 32v160c0 18 14 32 32 32s32 -14 32 -32v-160c0 -18 -14 -32 -32 -32zM347 379c61 -40 101 -109 101 -187c0 -124 -100 -224 -224 -224s-224 100 -224 224c0 78 40 147 101 187v0c5 3 11 5 17 5c18 0 32 -14 32 -32c0 -6 -2 -12 -5 -17
+c-2 -3 -4 -6 -7 -8c-1 -1 -3 -2 -4 -3c-8 -6 -16 -12 -23 -19c-30 -30 -47 -70 -47 -113s17 -83 47 -113s70 -47 113 -47s83 17 113 47s47 70 47 113s-17 83 -47 113c-7 7 -15 13 -23 19c-1 1 -3 2 -4 3c-3 2 -5 5 -7 8c-3 5 -5 11 -5 17c0 18 14 32 32 32c6 0 12 -2 17 -5
+v0z" />
+    <glyph glyph-name="ion-pricetag" unicode="&#xf2aa;" 
+d="M439 187c12 -12 12 -31 0 -43l-165 -167c-11 -11 -30 -11 -42 -1l-3 3l-206 209l-6 5c-6 7 -9 15 -10 24v0v2v0l-7 98v4v0c0 12 4 24 13 33l49 49c8 9 20 13 31 13h4l100 -4v0c12 0 22 -4 30 -12v0l2 -2v0l210 -211v0v0zM112 256c26 0 48 22 48 48s-22 48 -48 48
+s-48 -22 -48 -48s22 -48 48 -48z" />
+    <glyph glyph-name="ion-pricetags" unicode="&#xf2ab;" 
+d="M440 209c10 -11 11 -28 0 -39l-29 -29c11 11 10 28 0 39v0v0l-190 191v0l-1 1h-1c-8 7 -16 12 -27 12v0l-90 3h-4c-9 0 -19 -3 -26 -10l28 27c8 8 17 12 27 12h4l90 -4v0c11 0 19 -4 27 -11h1l1 -1v0l190 -191v0v0zM396 166v0c11 -11 11 -29 0 -40l-108 -109v1l-26 -27
+l-2 -2l-13 -13c-10 -10 -26 -10 -37 -1l-3 3l-186 188l-5 5c-5 6 -9 14 -10 22v0v2v0l-6 88v3v1c0 11 4 21 12 29l44 45l1 1l1 1c7 6 17 9 26 9h4l90 -3v0c11 0 19 -4 27 -11v0l2 -1v0l189 -191v0zM79 308c-12 -8 -21 -21 -21 -37c0 -24 19 -43 43 -43c16 0 29 9 37 21
+c4 7 7 14 7 22c0 24 -20 44 -44 44c-8 0 -15 -3 -22 -7z" />
+    <glyph glyph-name="ion-printer" unicode="&#xf21a;" 
+d="M392 320c28 0 56 -19 56 -55v-131c0 -31 -28 -54 -56 -54h-40v-112h-8h-8h-224h-11h-5v112h-40c-28 0 -56 24 -56 62v123c0 38 28 55 56 55h40v64h256v-64h40zM336 -16v176h-224v-176h224zM336 320v48h-224v-48h224zM384 256v16h-17v-16h17zM128 112v16h192v-16h-192z
+M128 64v16h192v-16h-192zM128 16v16h192v-16h-192z" />
+    <glyph glyph-name="ion-pull-request" unicode="&#xf345;" horiz-adv-x="384" 
+d="M64 384c35 0 64 -29 64 -64c0 -24 -13 -44 -32 -55v-178c19 -11 32 -31 32 -55c0 -35 -29 -64 -64 -64s-64 29 -64 64c0 24 13 44 32 55v178c-19 11 -32 31 -32 55c0 35 29 64 64 64zM64 0c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32zM64 288
+c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32zM351 88c20 -11 33 -32 33 -56c0 -35 -29 -64 -64 -64s-64 29 -64 64c0 23 12 44 31 55v156c0 16 -4 26 -11 33c-10 9 -26 12 -52 12v-64l-96 96l96 96v-64c42 1 74 -8 96 -29c21 -19 31 -46 31 -80v-155z
+M320 0c18 0 32 14 32 32s-14 32 -32 32s-32 -14 -32 -32s14 -32 32 -32z" />
+    <glyph glyph-name="ion-qr-scanner" unicode="&#xf346;" horiz-adv-x="416" 
+d="M48 324v-68h-48v68c0 33 28 60 61 60h67v-48h-68c-7 0 -12 -5 -12 -12zM356 384c33 0 60 -27 60 -60v-68h-48v68c0 7 -6 12 -13 12h-67v48h68zM368 61v67h48v-67c0 -33 -27 -61 -60 -61h-68v49h68c7 0 12 5 12 12zM60 49h68v-49h-67c-33 0 -61 28 -61 61v67h48v-67
+c0 -7 5 -12 12 -12z" />
+    <glyph glyph-name="ion-quote" unicode="&#xf347;" horiz-adv-x="384" 
+d="M128 384c-41 0 -73 -11 -95 -33s-33 -54 -33 -95v-256h160v256h-96c0 23 5 39 15 49s26 15 49 15zM352 384c-41 0 -73 -11 -95 -33s-33 -54 -33 -95v-256h160v256h-96c0 23 5 39 15 49s26 15 49 15z" />
+    <glyph glyph-name="ion-radio-waves" unicode="&#xf2ac;" 
+d="M160 192c0 43 21 64 64 64s64 -21 64 -64s-21 -64 -64 -64s-64 21 -64 64zM112 192c0 -18 5 -35 13 -50s19 -28 33 -37l-23 -25c-6 5 -13 10 -18 16c-25 26 -37 59 -37 96s12 70 37 96c5 6 12 11 18 16l23 -25c-14 -9 -25 -22 -33 -37s-13 -32 -13 -50zM336 192
+c0 18 -5 35 -13 50s-19 28 -33 37l23 25c6 -5 13 -10 18 -16c25 -26 37 -59 37 -96s-12 -70 -37 -96c-5 -6 -12 -11 -18 -16l-23 25c14 9 25 22 33 37s13 32 13 50zM32 192c0 -27 6 -53 17 -77s27 -43 47 -59l-23 -24c-6 5 -12 10 -17 16c-18 19 -31 41 -41 65
+c-10 25 -15 51 -15 79s5 54 15 79c10 24 23 46 41 65c5 6 11 11 17 16l23 -24c-10 -8 -18 -17 -26 -27s-14 -21 -20 -32s-10 -24 -13 -37s-5 -26 -5 -40zM416 192c0 27 -6 53 -17 77s-27 43 -47 59l23 24c6 -5 12 -10 17 -16c18 -19 31 -41 41 -65c10 -25 15 -51 15 -79
+s-5 -54 -15 -79c-10 -24 -23 -46 -41 -65c-4 -5 -10 -10 -17 -16l-23 24c20 16 36 35 47 59s17 50 17 77z" />
+    <glyph glyph-name="ion-record" unicode="&#xf21b;" horiz-adv-x="416" 
+d="M208 -16c-115 0 -208 93 -208 208s93 208 208 208s208 -93 208 -208s-93 -208 -208 -208z" />
+    <glyph glyph-name="ion-refresh" unicode="&#xf21c;" 
+d="M352 96l-104 112h74c-7 65 -64 112 -130 112c-71 0 -128 -57 -128 -128s57 -128 128 -128c28 0 53 8 75 24l6 5l43 -46l-7 -6c-34 -26 -74 -41 -117 -41c-91 0 -167 64 -187 149v0c0 1 -1 2 -1 3v1v2s-1 2 -1 3v1c0 1 -1 3 -1 4v0c-1 6 -2 13 -2 19v1v4v5v5v4v1
+c0 6 1 13 2 19v0c0 1 1 3 1 4v1c0 1 1 1 1 2v3v1c0 1 1 2 1 3v0c20 85 96 149 187 149v0v0c11 0 21 -1 31 -3h2h2c57 -10 106 -47 133 -96c13 -23 21 -49 23 -77h65z" />
+    <glyph glyph-name="ion-reply-all" unicode="&#xf21d;" horiz-adv-x="416" 
+d="M257 256c153 0 159 -208 159 -208c-51 93 -91 102 -159 102v-92l-152 134l152 144v-80zM0 192l144 136v-57l-82 -79l82 -68v-58z" />
+    <glyph glyph-name="ion-reply" unicode="&#xf21e;" horiz-adv-x="384" 
+d="M384 48c-53 93 -122 102 -224 102v-92l-160 134l160 144v-80c187 0 224 -208 224 -208z" />
+    <glyph glyph-name="ion-ribbon-a" unicode="&#xf348;" horiz-adv-x="352" 
+d="M272 416l80 -96l-64 -134c-24 30 -59 49 -99 53zM80 416l83 -177c-40 -4 -75 -23 -99 -53l-64 134zM189 416h67l-53 -112h-27h-27l-53 112h80h13zM176 224c71 0 128 -57 128 -128s-57 -128 -128 -128s-128 57 -128 128s57 128 128 128zM176 0c53 0 96 43 96 96
+s-43 96 -96 96s-96 -43 -96 -96s43 -96 96 -96zM176 184c49 0 88 -39 88 -88s-39 -88 -88 -88s-88 39 -88 88s39 88 88 88z" />
+    <glyph glyph-name="ion-ribbon-b" unicode="&#xf349;" horiz-adv-x="384" 
+d="M192 376c49 0 88 -39 88 -88s-39 -88 -88 -88s-88 39 -88 88s39 88 88 88zM192 416c71 0 128 -57 128 -128s-57 -128 -128 -128s-128 57 -128 128s57 128 128 128zM192 192c53 0 96 43 96 96s-43 96 -96 96s-96 -43 -96 -96s43 -96 96 -96zM83 194c26 -30 65 -50 109 -50
+c12 0 23 1 34 4l-34 -74l-48 -106l-48 80h-96zM301 194l83 -146h-96l-48 -80l-40 88l45 98c22 9 41 23 56 40z" />
+    <glyph glyph-name="ion-sad-outline" unicode="&#xf4d7;" 
+d="M367 164c3 -9 -2 -17 -11 -19c-3 -1 -7 0 -10 1c-5 2 -9 5 -11 10s-4 12 -13 15s-14 0 -19 -3c-4 -3 -10 -3 -15 -1c-3 1 -7 3 -9 6c-6 8 -3 17 5 22c15 9 29 13 49 6s29 -21 34 -37zM165 195c8 -5 10 -14 4 -22c-2 -3 -6 -5 -9 -6c-5 -2 -11 -2 -15 1c-5 3 -10 6 -19 3
+s-11 -10 -13 -15s-6 -8 -11 -10c-3 -1 -7 -2 -10 -1c-9 2 -14 10 -11 19c5 16 14 30 34 37s35 3 50 -6zM224 416c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224s100 224 224 224zM360 56c36 36 56 85 56 136s-20 100 -56 136s-85 56 -136 56
+s-100 -20 -136 -56s-56 -85 -56 -136s20 -100 56 -136s85 -56 136 -56s100 20 136 56zM317 89c5 -7 3 -17 -4 -22c-3 -2 -6 -3 -9 -3c-5 0 -10 3 -13 7c0 0 -19 25 -67 25s-67 -25 -67 -25c-3 -4 -8 -7 -13 -7c-3 0 -6 1 -9 3c-7 5 -9 15 -4 22c1 2 28 39 93 39
+s92 -37 93 -39z" />
+    <glyph glyph-name="ion-sad" unicode="&#xf34a;" 
+d="M224 416c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224s100 224 224 224zM113 156c2 5 4 12 13 15s14 0 19 -3c4 -3 10 -3 15 -1c3 1 7 3 9 6c6 8 4 17 -4 22c-15 9 -30 13 -50 6s-29 -21 -34 -37c-3 -9 2 -17 11 -19c3 -1 7 0 10 1c5 2 9 5 11 10z
+M313 67c7 5 9 15 4 22c-1 2 -28 39 -93 39s-92 -37 -93 -39c-5 -7 -3 -17 4 -22c3 -2 6 -3 9 -3c5 0 10 3 13 7c0 0 19 25 67 25s67 -25 67 -25c3 -4 8 -7 13 -7c3 0 6 1 9 3zM356 145c9 2 14 10 11 19c-5 16 -14 30 -34 37s-34 3 -49 -6c-8 -5 -11 -14 -5 -22
+c2 -3 6 -5 9 -6c5 -2 11 -2 15 1c5 3 10 6 19 3s11 -10 13 -15s6 -8 11 -10c3 -1 7 -2 10 -1z" />
+    <glyph glyph-name="ion-scissors" unicode="&#xf34b;" horiz-adv-x="384" 
+d="M341 332c-13 -33 -117 -172 -117 -172l-32 -32s-31 -13 -50 -43s-33 -71 -33 -71v0c-7 -26 -28 -46 -53 -46c-31 0 -56 29 -56 64s25 64 56 64c13 0 25 -5 34 -13c2 -1 3 -3 4 -4v0l2 -2c4 -4 7 -2 14 11c8 15 17 35 27 54s38 59 38 59l17 23l144 192
+c23 -20 18 -51 5 -84zM56 0c15 0 28 14 28 32s-13 32 -28 32s-28 -14 -28 -32s13 -32 28 -32zM192 160c9 0 16 7 16 16s-7 16 -16 16s-16 -7 -16 -16s7 -16 16 -16zM143 183c-30 41 -90 125 -100 149c-13 33 -18 64 5 84l134 -178l-3 -4v0v0l-17 -23v-1v0
+c-1 -1 -10 -13 -19 -27zM328 96c31 0 56 -29 56 -64s-25 -64 -56 -64c-25 0 -47 20 -54 46v0s-13 41 -32 71c-11 17 -26 28 -36 35l29 29l1 1h1c1 1 1 2 2 4c3 -4 5 -9 7 -12c10 -19 20 -39 28 -54c7 -13 10 -15 14 -11c1 1 0 1 1 2h1c1 1 2 3 4 4c9 8 21 13 34 13zM328 0
+c15 0 28 14 28 32s-13 32 -28 32s-28 -14 -28 -32s13 -32 28 -32z" />
+    <glyph glyph-name="ion-search" unicode="&#xf21f;" horiz-adv-x="384" 
+d="M381 61c4 -4 4 -10 0 -14l-43 -44c-2 -2 -5 -3 -8 -3s-5 1 -7 3l-84 86c-25 -15 -52 -23 -80 -23c-87 0 -159 71 -159 159s72 159 159 159s158 -71 158 -159c0 -27 -7 -54 -21 -78zM159 322c-53 0 -97 -43 -97 -97s44 -97 97 -97s96 43 96 97s-43 97 -96 97z" />
+    <glyph glyph-name="ion-settings" unicode="&#xf2ad;" horiz-adv-x="416" 
+d="M402 310c10 -6 15 -25 14 -36c-1 -17 -7 -36 -25 -54c-1 -1 -2 -1 -3 -2c-26 -25 -62 -30 -94 -20c-1 1 -2 2 -4 2c-5 1 -10 0 -13 -4l-36 -39c52 -50 107 -96 107 -96c2 -2 2 -5 0 -7l-50 -51c-2 -2 -5 -2 -7 0c0 0 -44 55 -93 107l-92 -98c-14 -16 -40 -15 -55 0
+c-15 16 -15 42 1 56l97 93l-12 12c-2 2 -3 7 -1 10l2 5c-25 26 -36 33 -56 32s-36 -13 -48 -28s-10 -52 -8 -62s-7 -6 -12 0c-9 10 -23 50 -6 93s42 69 48 75s16 15 24 21s21 -1 27 5c4 4 5 11 5 16l-4 4c-2 2 -2 5 0 7l31 31c2 2 5 2 7 0l50 -50c2 -2 2 -6 0 -8l-31 -31
+c-2 -2 -5 -2 -7 0l-8 9c-7 0 -15 -5 -17 -10c-3 -6 -6 -21 -3 -33c3 -11 13 -20 36 -43l5 3c4 2 8 1 10 -1c0 0 1 -2 13 -14l38 37c4 3 5 7 4 13c0 2 0 4 -1 5c-10 33 -6 69 19 96l2 2c18 18 36 25 53 26c10 1 30 -5 35 -15l-48 -48l-2 -3l-1 -1c-1 -1 -1 -2 -1 -4
+s0 -3 1 -5l2 -2l2 -2l41 -42l3 -3l1 -1c1 -1 2 -1 4 -1s3 0 4 1l2 1l2 3z" />
+    <glyph glyph-name="ion-share" unicode="&#xf220;" horiz-adv-x="384" 
+d="M288 70v59l38 31v-109c0 -11 -8 -19 -19 -19h-288c-11 0 -19 9 -19 19v218c0 11 8 19 19 19h120c-29 -18 -43 -38 -43 -38h-58v-180h250zM256 224c-84 0 -116 -24 -160 -96c0 0 5 164 160 164v60l128 -96l-128 -96v64z" />
+    <glyph glyph-name="ion-shuffle" unicode="&#xf221;" 
+d="M338 267c-52 0 -83 -43 -120 -92c-41 -55 -88 -120 -171 -120h-47v63h47c52 0 84 47 121 96c41 55 87 116 170 116h29v54l81 -81l-81 -84v48h-29zM121 230c-21 21 -42 35 -74 36c-34 1 -47 0 -47 0v63h47c48 0 83 -20 113 -48c-10 -12 -19 -24 -28 -36
+c-4 -5 -7 -10 -11 -15zM367 118v47l81 -84l-81 -81v54h-29c-50 0 -87 23 -117 53c12 14 22 28 32 41c2 3 5 6 7 9c22 -24 46 -39 78 -39h29z" />
+    <glyph glyph-name="ion-skip-backward" unicode="&#xf222;" horiz-adv-x="384" 
+d="M12 352h8c7 0 12 -5 12 -12v-113l187 122c2 2 5 3 8 3c8 0 16 -7 16 -17v-63l118 78c2 2 5 2 8 2c8 0 15 -7 15 -17v-286c0 -10 -7 -17 -15 -17c-3 0 -5 1 -8 3l-118 78v-64c0 -10 -8 -17 -16 -17c-3 0 -5 1 -8 3l-187 122v-113c0 -7 -5 -12 -12 -12h-8
+c-7 0 -12 5 -12 12v296c0 7 5 12 12 12z" />
+    <glyph glyph-name="ion-skip-forward" unicode="&#xf223;" horiz-adv-x="384" 
+d="M372 352c7 0 12 -5 12 -12v-296c0 -7 -5 -12 -12 -12h-8c-7 0 -12 5 -12 12v113l-187 -122c-3 -2 -5 -3 -8 -3c-8 0 -15 7 -15 17v64l-119 -78c-3 -2 -5 -3 -8 -3c-8 0 -15 7 -15 17v286c0 10 7 17 15 17c3 0 6 0 8 -2l119 -78v63c0 10 7 17 15 17c3 0 6 -1 8 -3
+l187 -122v113c0 7 5 12 12 12h8z" />
+    <glyph glyph-name="ion-social-android-outline" unicode="&#xf224;" horiz-adv-x="352" 
+d="M272 240h-192v-60v-89h24h16v-15v-52c0 -4 4 -8 8 -8s8 4 8 8v52v15h17h49h15v-15v-52c0 -2 1 -4 3 -6h1v0c1 -1 2 -2 4 -2h1v0v0c4 0 7 4 7 8v52v15h17h22v89v60zM288 256v0v-76v-90c0 -7 -3 -15 -10 -15h-29v-51c0 -13 -10 -24 -23 -24v0h-1c-6 0 -11 2 -15 5
+c-5 4 -9 11 -9 19v51h-49v-51c0 -13 -11 -24 -24 -24s-24 11 -24 24v51h-28c-7 0 -12 8 -12 15v90v76h224zM328 256c-4 0 -8 -4 -8 -8v-96c0 -4 4 -8 8 -8s8 4 8 8v96c0 4 -4 8 -8 8zM328 272v0c13 0 24 -11 24 -24v-96c0 -13 -11 -24 -24 -24s-24 11 -24 24v96
+c0 13 11 24 24 24zM24 256c-4 0 -8 -4 -8 -8v-96c0 -4 4 -8 8 -8s8 4 8 8v96c0 4 -4 8 -8 8zM24 272v0c13 0 24 -11 24 -24v-96c0 -13 -11 -24 -24 -24s-24 11 -24 24v96c0 13 11 24 24 24zM175 354c-14 0 -27 -3 -38 -6l-10 -4c-28 -12 -40 -37 -44 -56h186
+c-4 18 -15 43 -44 56l-10 4c-12 4 -25 6 -39 6v0v0h-1zM105 384v0h1l19 -23c13 5 30 9 50 9h1c20 0 36 -4 50 -9l20 23v0s1 -1 2 -1c1 -1 2 -3 2 -3l-19 -22c48 -21 56 -71 57 -86h-224c1 15 9 66 57 87l-19 22c0 1 1 1 2 2zM127 309c-7 0 -14 6 -14 13s6 14 14 14
+c7 0 13 -7 13 -14s-5 -13 -13 -13zM225 309c-7 0 -13 6 -13 13s5 14 13 14c7 0 13 -7 13 -14s-6 -13 -13 -13z" />
+    <glyph glyph-name="ion-social-android" unicode="&#xf225;" horiz-adv-x="352" 
+d="M64 180v76h224v-76v-90c0 -7 -4 -14 -11 -14h-28v-52c0 -13 -11 -24 -24 -24v0h-1c-6 0 -10 2 -14 5c-5 4 -9 11 -9 19v52h-49v-52c0 -13 -11 -24 -24 -24s-24 11 -24 24v52h-29c-7 0 -11 7 -11 14v90zM328 272c13 0 24 -11 24 -24v-96c0 -13 -11 -24 -24 -24
+s-24 11 -24 24v96c0 13 11 24 24 24zM24 272c13 0 24 -11 24 -24v-96c0 -13 -11 -24 -24 -24s-24 11 -24 24v96c0 13 11 24 24 24zM231 359c48 -21 56 -72 57 -87h-224c1 15 8 66 56 87l-18 22c0 1 0 1 1 2s3 1 3 1l19 -23c14 5 31 9 51 9s36 -4 50 -9l20 23c0 1 1 0 2 -1
+l2 -2zM127 309c8 0 13 6 13 13s-6 14 -13 14c-8 0 -14 -7 -14 -14s7 -13 14 -13zM225 309c7 0 14 6 14 13s-7 14 -14 14c-8 0 -13 -7 -13 -14s6 -13 13 -13z" />
+    <glyph glyph-name="ion-social-angular-outline" unicode="&#xf4d8;" 
+d="M224 384l-188 -69l39 -230l149 -80l149 80l39 230zM224 416v0l224 -80l-46 -272l-178 -96l-178 96l-46 272zM312 96l-27 56h-122l-27 -56h-40l128 280l128 -280h-40zM182 192h84l-42 89z" />
+    <glyph glyph-name="ion-social-angular" unicode="&#xf4d9;" 
+d="M182 192l42 89l42 -89h-84zM224 416l224 -80l-46 -272l-178 -96l-178 96l-46 272zM312 96h40l-128 280l-128 -280h40l27 56h122z" />
+    <glyph glyph-name="ion-social-apple-outline" unicode="&#xf226;" horiz-adv-x="320" 
+d="M238 278c-15 0 -26 -4 -37 -8c-10 -4 -21 -8 -35 -8s-25 4 -37 8c-11 4 -22 8 -34 8c-11 0 -23 -3 -34 -10c-12 -7 -23 -18 -31 -31c-12 -18 -16 -47 -13 -77c3 -34 16 -69 35 -99c13 -21 30 -45 50 -45h1c8 0 13 3 20 6c10 5 23 10 44 10v0c21 0 34 -5 44 -10
+c7 -3 12 -6 19 -6v0c22 0 44 35 52 48c8 12 12 20 17 31c-12 7 -22 16 -30 28c-10 15 -17 33 -18 52c-1 18 2 37 10 53c6 12 14 22 24 30c-14 13 -31 20 -47 20zM238 294v0c25 0 52 -14 71 -39c-63 -36 -53 -128 11 -153c-9 -20 -13 -28 -24 -46c-16 -25 -37 -56 -65 -56h-1
+c-24 0 -31 16 -63 16v0c-33 0 -40 -16 -64 -16h-1c-28 0 -48 28 -64 53c-44 69 -48 150 -21 193c19 30 50 48 78 48c29 0 47 -16 71 -16c23 0 38 16 72 16zM214 364c-11 -5 -21 -13 -28 -22c-4 -5 -9 -13 -13 -23c-1 -3 -2 -6 -2 -9c11 4 21 11 28 21c4 5 12 18 15 33z
+M230 384v0c3 -23 -6 -46 -18 -62c-13 -17 -35 -30 -56 -30h-1c-4 22 6 44 18 60c14 17 37 31 57 32z" />
+    <glyph glyph-name="ion-social-apple" unicode="&#xf227;" horiz-adv-x="320" 
+d="M238 294v0c25 0 52 -14 71 -39c-63 -36 -53 -128 11 -153c-9 -20 -13 -28 -24 -46c-16 -25 -37 -56 -65 -56h-1c-24 0 -31 16 -63 16v0c-33 0 -40 -16 -64 -16h-1c-28 0 -48 28 -64 53c-44 69 -48 150 -21 193c19 30 50 48 78 48c29 0 47 -16 71 -16c23 0 38 16 72 16z
+M230 384v0c3 -23 -6 -46 -18 -62c-13 -17 -35 -30 -56 -30h-1c-4 22 6 44 18 60c14 17 37 31 57 32z" />
+    <glyph glyph-name="ion-social-bitcoin-outline" unicode="&#xf2ae;" horiz-adv-x="320" 
+d="M184 400h-8v-48v-16h-16h-32h-16v16v48h-9v-48v-16h-16h-72v-16h13c11 0 19 0 25 -3s10 -7 13 -13s3 -8 3 -20v-178c0 -11 0 -18 -3 -24v-1c-1 -3 -4 -10 -12 -14h-1c-5 -3 -8 -3 -17 -3h-13l-3 -16h67h16v-16v-48h9v48v16h16h32h16v-16v-48h8v49v16h15c23 1 41 5 55 10
+c16 6 28 15 37 26c8 11 12 29 13 42c1 14 -1 29 -4 36s-8 16 -21 23c-7 4 -14 6 -21 8l-46 11l43 19c4 2 7 4 12 9c6 5 9 12 11 16c2 5 4 13 3 22c-1 17 -4 29 -10 37c-7 9 -17 16 -31 21c-12 5 -24 7 -41 8l-15 1v15v47zM200 416v0v-63c20 -1 32 -4 45 -9
+c16 -6 29 -15 38 -27s12 -28 13 -45c1 -10 0 -20 -3 -28s-8 -16 -16 -23c-6 -6 -11 -9 -16 -11c9 -2 17 -6 25 -10c15 -8 24 -18 29 -30c4 -10 6 -30 5 -44c-1 -16 -6 -37 -16 -51c-11 -14 -26 -24 -45 -31c-15 -6 -33 -10 -59 -11v-65h-40v64h-32v-64h-41v64h-87l8 48h28
+c9 0 8 1 11 2s4 3 5 6s1 9 1 18v178c0 9 0 10 -1 12s-3 4 -6 6s-9 2 -18 2h-28v48h87v64h41v-64h32v64h40zM160 298v-74h-32v74h32zM160 176v0v-90h-32v90h32zM200 294v0c6 -2 10 -7 14 -12c4 -6 6 -13 6 -21s-2 -15 -7 -21c-4 -5 -7 -9 -13 -12v66zM200 174v0
+c5 -1 8 -1 12 -3c8 -3 14 -7 19 -13s8 -15 8 -24c0 -11 -2 -19 -10 -26s-13 -11 -23 -15c-2 -1 -4 0 -6 -1v82z" />
+    <glyph glyph-name="ion-social-bitcoin" unicode="&#xf2af;" horiz-adv-x="320" 
+d="M314 169c4 -10 7 -30 6 -44c-1 -16 -5 -37 -16 -51s-26 -24 -45 -31c-15 -6 -33 -10 -59 -11v-64h-40v64h-32v-64h-41v64h-87l9 48h26c9 0 9 0 12 1s4 4 5 7s2 8 2 17v173c0 9 -1 16 -2 18s-3 4 -6 6s-9 2 -18 2h-28v48h87v64h41v-64h32v64h40v-64c20 -1 33 -4 46 -9
+c16 -6 28 -15 37 -27s12 -28 13 -45c1 -10 0 -20 -3 -28c-2 -8 -8 -16 -16 -23c-6 -6 -11 -9 -16 -11c9 -2 17 -6 25 -10c15 -8 23 -18 28 -30zM128 298v-74h32v74h-32zM128 86h32v90h-32v-90zM200 294v-66c6 3 9 7 13 12c5 6 7 12 7 20s-2 15 -6 21c-4 5 -8 11 -14 13z
+M229 107c8 7 10 15 10 26c0 9 -3 19 -8 25s-12 10 -20 13c-4 2 -6 2 -11 3v-82c2 0 5 1 7 2c10 4 14 6 22 13z" />
+    <glyph glyph-name="ion-social-buffer-outline" unicode="&#xf228;" horiz-adv-x="384" 
+d="M7 284c-9 4 -9 11 0 15l169 82c4 2 10 3 16 3s12 -1 16 -3l169 -82c9 -4 9 -11 0 -15l-169 -82c-4 -2 -10 -3 -16 -3s-12 1 -16 3zM183 366l-156 -75l156 -75c2 -1 5 -1 9 -1s7 0 9 1l156 75l-156 75c-2 1 -5 2 -9 2s-7 -1 -9 -2zM377 200c9 -4 9 -12 0 -16l-169 -81
+c-4 -2 -10 -4 -16 -4s-12 2 -16 4l-169 81c-9 4 -9 12 0 16c0 0 27 13 33 16c5 3 7 3 13 0s123 -60 123 -60c4 -2 10 -3 16 -3s12 1 16 3c0 0 121 59 125 61s5 2 9 0s35 -17 35 -17zM201 117l156 75l-19 9l-123 -59c-6 -3 -15 -5 -23 -5s-17 2 -23 5l-123 59l-19 -9l156 -75
+c2 -1 5 -2 9 -2s7 1 9 2zM377 100c9 -4 9 -11 0 -15l-169 -82c-4 -2 -10 -3 -16 -3s-12 1 -16 3l-169 82c-9 4 -9 11 0 15c0 0 27 14 33 17c5 3 7 2 13 -1s123 -59 123 -59c4 -2 10 -3 16 -3s12 1 16 3c0 0 121 58 125 60s5 2 9 0s35 -17 35 -17zM201 18l156 75l-19 9
+l-123 -60c-6 -3 -15 -4 -23 -4s-17 1 -23 4l-123 60l-19 -9l156 -75c2 -1 5 -2 9 -2s7 1 9 2z" />
+    <glyph glyph-name="ion-social-buffer" unicode="&#xf229;" horiz-adv-x="384" 
+d="M7 284c-9 4 -9 11 0 15l169 82c4 2 10 3 16 3s12 -1 16 -3l169 -82c9 -4 9 -11 0 -15l-169 -82c-4 -2 -10 -3 -16 -3s-12 1 -16 3zM377 200c9 -4 9 -12 0 -16l-169 -81c-4 -2 -10 -4 -16 -4s-12 2 -16 4l-169 81c-9 4 -9 12 0 16c0 0 27 13 33 16c5 3 7 3 13 0
+s123 -60 123 -60c4 -2 10 -3 16 -3s12 1 16 3c0 0 121 59 125 61s5 2 9 0s35 -17 35 -17zM377 100c9 -4 9 -11 0 -15l-169 -82c-4 -2 -10 -3 -16 -3s-12 1 -16 3l-169 82c-9 4 -9 11 0 15c0 0 27 14 33 17c5 3 7 2 13 -1s123 -59 123 -59c4 -2 10 -3 16 -3s12 1 16 3
+c0 0 121 58 125 60s5 2 9 0s35 -17 35 -17z" />
+    <glyph glyph-name="ion-social-chrome-outline" unicode="&#xf4da;" 
+d="M224 416c123 0 224 -101 224 -224s-101 -224 -224 -224s-224 101 -224 224s101 224 224 224zM224 371c-57 0 -109 -27 -141 -68l54 -93c8 40 43 72 87 72h155c-30 54 -89 89 -155 89zM291 192c0 37 -30 67 -67 67s-67 -30 -67 -67s30 -67 67 -67s67 30 67 67zM45 192
+c0 -91 67 -166 154 -177l54 93c-9 -3 -19 -6 -29 -6c-34 0 -61 18 -77 45v0l-78 135c-16 -27 -24 -58 -24 -90zM224 13c99 0 179 80 179 179c0 24 -4 46 -13 67h-108c19 -17 32 -40 32 -67c0 -17 -5 -32 -13 -45v0z" />
+    <glyph glyph-name="ion-social-chrome" unicode="&#xf4db;" 
+d="M157 192c0 37 30 67 67 67s67 -30 67 -67s-30 -67 -67 -67s-67 30 -67 67zM445 230c2 -12 3 -25 3 -38c0 -106 -74 -195 -174 -218c-10 -2 -20 -4 -30 -5c-7 -1 -13 -1 -20 -1c-8 0 -17 0 -25 1v0v0v0v1l102 177c8 13 13 28 13 45c0 27 -13 50 -32 67h156
+c3 -9 5 -19 7 -29v0c-2 10 -4 20 -7 29v0c3 -9 5 -19 7 -29v0zM224 103c10 0 20 2 29 5l-78 -135v0c-42 9 -79 30 -108 59c-42 41 -67 97 -67 160c0 31 6 61 18 88c7 16 16 31 26 45v0l103 -178c16 -27 43 -44 77 -44zM59 343v0v1c24 26 55 47 90 59c23 8 49 13 75 13
+c73 0 138 -36 179 -90h1c10 -14 18 -29 25 -44v0c-7 15 -15 30 -25 44h-1c10 -14 19 -29 26 -44h-205c-44 0 -79 -32 -87 -72z" />
+    <glyph glyph-name="ion-social-codepen-outline" unicode="&#xf4dc;" 
+d="M356 244c5 -3 7 -6 7 -12v-81c0 -6 -3 -10 -8 -13c-41 -27 -82 -55 -123 -82c-6 -4 -11 -4 -17 0c-41 27 -81 55 -122 82c-5 3 -8 7 -8 13v80c0 6 3 11 8 14c41 27 81 54 122 81c6 4 11 4 17 0c41 -27 83 -55 124 -82zM236 296v-54c0 -1 1 -2 2 -3c16 -11 31 -21 47 -32
+c1 -1 3 -1 4 0l40 26zM212 295c0 0 -62 -41 -93 -62c14 -9 27 -17 40 -26c1 -1 3 -1 4 0c15 10 31 21 46 31c1 1 3 4 3 6v51zM109 211v-40l30 20zM212 87v53c0 1 -2 3 -3 4c-15 10 -31 21 -46 31c-2 1 -3 1 -5 0l-39 -26c31 -21 93 -62 93 -62zM227 165l39 26s-34 23 -40 27
+c-1 1 -4 0 -5 -1c-5 -3 -9 -6 -14 -9c-8 -6 -25 -17 -25 -17l39 -26c2 -1 4 -1 6 0zM236 87l93 62l-38 26c-2 2 -5 2 -7 0c-15 -10 -30 -21 -45 -31c-2 -2 -3 -3 -3 -6v-51zM338 171v40l-30 -20zM224 384c-51 0 -100 -20 -136 -56s-56 -85 -56 -136s20 -100 56 -136
+s85 -56 136 -56s100 20 136 56s56 85 56 136s-20 100 -56 136s-85 56 -136 56zM224 416v0c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224s100 224 224 224z" />
+    <glyph glyph-name="ion-social-codepen" unicode="&#xf4dd;" 
+d="M209 144c1 -1 3 -3 3 -4v-53s-62 41 -93 62l39 26c2 1 3 1 5 0c15 -10 31 -21 46 -31zM163 207c-1 -1 -3 -1 -4 0c-13 9 -26 17 -40 26c31 21 93 62 93 62v-51c0 -2 -2 -5 -3 -6c-15 -10 -31 -21 -46 -31zM238 239c-1 1 -2 2 -2 3v54l93 -63l-40 -26c-1 -1 -3 -1 -4 0
+c-16 11 -31 21 -47 32zM226 218c6 -4 40 -27 40 -27l-39 -26c-2 -1 -4 -1 -6 0l-39 26s17 11 25 17c5 3 9 6 14 9c1 1 4 2 5 1zM109 211l30 -20l-30 -20v40zM224 416c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224s100 224 224 224zM363 151v81
+c0 6 -2 9 -7 12c-41 27 -83 55 -124 82c-6 4 -11 4 -17 0c-41 -27 -81 -54 -122 -81c-5 -3 -8 -8 -8 -14v-80c0 -6 3 -10 8 -13c41 -27 81 -55 122 -82c6 -4 11 -4 17 0c41 27 82 55 123 82c5 3 8 7 8 13zM284 175c2 2 5 2 7 0l38 -26l-93 -62v51c0 3 1 4 3 6
+c15 10 30 21 45 31zM338 171l-30 20l30 20v-40z" />
+    <glyph glyph-name="ion-social-css3-outline" unicode="&#xf4de;" horiz-adv-x="384" 
+d="M291 81l-99 -28l-98 28l-7 78h48l4 -40l53 -15v0v0l54 15l5 64h-112l-4 50h121l4 51h-184l-4 49h241zM0 416h384l-35 -403l-157 -45l-157 45zM319 37l30 347h-314l30 -347l127 -36z" />
+    <glyph glyph-name="ion-social-css3" unicode="&#xf4df;" horiz-adv-x="384" 
+d="M192 109v0zM0 416h384l-35 -403l-157 -45l-157 45zM291 81l22 252h-241l4 -49h184l-4 -51h-121l4 -50h112l-5 -64l-54 -15v0v0l-53 15l-4 40h-48l7 -78l98 -28z" />
+    <glyph glyph-name="ion-social-designernews-outline" unicode="&#xf22a;" 
+d="M259 302v-53l-65 103zM0 188zM297 352l151 -119v-201h-248l-200 156h63c46 0 77 33 77 82c0 20 -5 37 -15 51l-3 3l37 -29v-107h41l-2 98l63 -98h36v84v80zM432 48v178l-119 92v1v-47v-83v-17h-15h-37h-9l-4 8l-33 50l1 -42v-16h-16h-41h-16v16v29c-3 -6 -7 -12 -12 -17
+c-8 -9 -18 -16 -30 -21s-24 -7 -38 -7h-16l159 -124h226zM59 298h-1h-3v-57h4c8 0 13 2 17 6c5 6 6 15 6 22c0 26 -12 29 -23 29zM59 314v0c25 0 39 -16 39 -45c0 -28 -14 -44 -40 -44h-19v89h20z" />
+    <glyph glyph-name="ion-social-designernews" unicode="&#xf22b;" 
+d="M258 303l1 -53l-64 102zM297 352l151 -118v-202h-248l-200 157v0h63c46 0 77 33 77 82c0 20 -5 37 -15 51l-3 3l37 -29v-107h40l-2 99l64 -99h36v83v80zM98 270c0 -28 -14 -44 -40 -44h-19v89h19c26 0 40 -16 40 -45z" />
+    <glyph glyph-name="ion-social-dribbble-outline" unicode="&#xf22c;" horiz-adv-x="384" 
+d="M192 384c106 0 192 -86 192 -192s-86 -192 -192 -192s-192 86 -192 192s86 192 192 192zM314 296c-17 -25 -47 -47 -85 -64c5 -10 9 -20 13 -31c33 3 75 4 110 2c-2 35 -16 68 -38 93zM192 352c-14 0 -26 -2 -39 -5c23 -23 43 -53 62 -87c34 14 62 33 79 55
+c-28 23 -63 37 -102 37zM120 334c-41 -21 -71 -58 -83 -103h25c44 0 85 6 121 17c-19 34 -40 63 -63 86zM32 200v-8c0 -40 15 -78 40 -106c24 45 67 83 122 106c4 2 8 3 14 4c-3 8 -6 16 -10 24c-40 -13 -88 -20 -138 -21c-9 0 -19 1 -28 1zM192 32c20 0 39 3 57 10
+c-3 25 -8 53 -15 79c-4 17 -10 33 -16 49c-7 -2 -13 -4 -17 -6c-48 -22 -86 -56 -107 -98c27 -21 61 -34 98 -34zM278 58c40 26 68 67 73 116c-30 2 -68 3 -99 0c4 -12 9 -25 12 -38c7 -27 11 -52 14 -78z" />
+    <glyph glyph-name="ion-social-dribbble" unicode="&#xf22d;" horiz-adv-x="384" 
+d="M192 384c106 0 192 -86 192 -192s-86 -192 -192 -192s-192 86 -192 192s86 192 192 192zM192 32c88 0 160 72 160 160s-72 160 -160 160s-160 -72 -160 -160s72 -160 160 -160zM242 201c-4 11 -8 21 -13 31c25 11 47 24 63 39c15 -19 26 -42 28 -67c-26 0 -55 -1 -78 -3z
+M271 292c-15 -12 -34 -23 -56 -32c-12 22 -24 41 -38 59c5 1 10 1 15 1c30 0 57 -11 79 -28zM142 310c15 -18 28 -39 41 -62c-34 -10 -72 -16 -113 -17c11 36 38 65 72 79zM319 176c-4 -33 -21 -63 -46 -83c-3 14 -5 28 -9 43c-3 13 -8 26 -12 38c21 2 45 3 67 2zM194 192
+c-43 -18 -79 -46 -104 -78c-16 22 -26 49 -26 78v7c49 1 95 8 134 21c4 -8 7 -16 10 -24c-6 -1 -10 -2 -14 -4zM219 170c6 -16 11 -32 15 -49c4 -15 7 -31 10 -46c-16 -7 -34 -11 -52 -11c-31 0 -59 11 -81 29c22 30 53 54 90 71c4 2 11 4 18 6z" />
+    <glyph glyph-name="ion-social-dropbox-outline" unicode="&#xf22e;" horiz-adv-x="384" 
+d="M113 371l79 -66l-114 -71l-78 63zM27 295l52 -42l86 53l-53 46zM306 235l78 -63l-78 -51v-39l-114 -69l-114 68v39l-78 52l78 63l114 -71l-79 -66l-19 12v-20l98 -59l98 59v20l-19 -12l-79 66zM79 217l-52 -44l85 -55l53 44zM219 162l53 -44l85 56l-52 43zM384 297
+l-78 -63l-114 71l79 66zM219 305l86 -52l52 42l-85 56z" />
+    <glyph glyph-name="ion-social-dropbox" unicode="&#xf22f;" horiz-adv-x="384" 
+d="M113 371l79 -66l-114 -71l-78 63zM0 172l78 62l114 -70l-79 -66zM192 164l114 70l78 -62l-113 -74zM384 297l-78 -63l-114 71l79 66zM192 150l80 -66l34 22v-25l-114 -68l-114 68v25l34 -22z" />
+    <glyph glyph-name="ion-social-euro-outline" unicode="&#xf4e0;" horiz-adv-x="320" 
+d="M214 384c-53 0 -91 -9 -115 -27c-22 -16 -33 -40 -33 -74v-11v-17h-16h-34v-16h34h16v-15v-48v-17h-16h-34v-16h34h16v-15v-27c0 -34 11 -58 33 -74c24 -18 62 -27 115 -27c31 0 59 2 88 8l-5 35c-30 -4 -55 -7 -80 -7c-36 0 -59 6 -74 19c-19 16 -21 40 -21 60v13v15h16
+h103l3 16h-106h-16v17v48v15h16h118l2 16h-120h-16v17v2c0 16 2 39 21 55c16 13 39 19 74 19c24 0 51 -3 80 -7l5 35c-29 6 -57 8 -88 8zM214 400v0c35 0 68 -3 106 -12l-9 -65c-37 6 -68 9 -94 9c-64 0 -79 -22 -79 -58v-3h139l-8 -48h-131v-48h124l-7 -48h-117v-12
+c0 -44 15 -63 79 -63c26 0 57 3 94 9l9 -65c-38 -9 -71 -12 -106 -12c-115 0 -164 41 -164 117v26h-50v48h50v48h-50v48h50v12c0 76 49 117 164 117z" />
+    <glyph glyph-name="ion-social-euro" unicode="&#xf4e1;" horiz-adv-x="320" 
+d="M138 176h124l-7 -48h-117v-13c0 -44 15 -63 79 -63c26 0 56 3 93 9l10 -65c-38 -9 -71 -12 -106 -12c-115 0 -164 41 -164 117v27h-50v48h50v48h-50v48h50v11c0 76 49 117 164 117c35 0 68 -3 106 -12l-10 -65c-37 6 -67 9 -93 9c-64 0 -79 -22 -79 -58v-2h138l-7 -48
+h-131v-48z" />
+    <glyph glyph-name="ion-social-facebook-outline" unicode="&#xf230;" horiz-adv-x="192" 
+d="M128 256h64l-8 -64h-56v-192h-83v192h-45v64h45v43c0 54 23 85 91 85h56v-64h-34c-27 0 -30 -9 -30 -26v-38zM170 208l4 32h-45h-17v17v37c0 10 1 21 9 30c10 11 25 12 37 12h18v32h-40c-28 0 -49 -6 -60 -18c-10 -11 -15 -27 -15 -51v-43v-16h-15h-30v-32h30h15v-16
+v-176h51v176v16h17h41z" />
+    <glyph glyph-name="ion-social-facebook" unicode="&#xf231;" horiz-adv-x="192" 
+d="M128 256h64l-8 -64h-56v-192h-83v192h-45v64h45v43c0 54 23 85 91 85h56v-64h-34c-27 0 -30 -9 -30 -26v-38z" />
+    <glyph glyph-name="ion-social-foursquare-outline" unicode="&#xf34c;" horiz-adv-x="320" 
+d="M302 284c-12 -60 -25 -131 -27 -138zM281 416c35 0 45 -20 37 -57c-3 -16 -10 -44 -16 -75l-27 -137c-3 -13 -8 -35 -39 -35h-72c-3 0 -3 0 -6 -3c-2 -2 -115 -133 -115 -133c-9 -10 -23 -8 -28 -6s-15 8 -15 26v380s10 40 43 40h238zM280 352c6 31 6 32 -24 32h-195
+c-29 0 -29 -3 -29 -28v-297c0 -38 1 -38 3 -38s10 8 29 31c0 0 78 89 79 90c2 2 3 2 6 2h62c26 0 28 6 33 31c4 21 36 177 36 177zM302 284c6 31 13 59 16 75zM233 352c5 0 9 -5 8 -11l-8 -44c-1 -4 -6 -9 -11 -9h-75c-8 0 -8 -5 -8 -13v-6c0 -8 0 -13 8 -13h64
+s11 -6 10 -12s-11 -51 -12 -54s-4 -9 -11 -9h-62c-9 0 -11 -1 -17 -8l-54 -63c-1 -1 -1 -1 -1 0v231c0 5 5 11 11 11h158z" />
+    <glyph glyph-name="ion-social-foursquare" unicode="&#xf34d;" horiz-adv-x="320" 
+d="M281 416c35 0 45 -20 37 -57c-10 -49 -40 -202 -43 -213c-3 -13 -8 -34 -39 -34h-72c-3 0 -3 0 -6 -3c-2 -2 -115 -133 -115 -133c-9 -10 -23 -8 -28 -6s-15 8 -15 26v380s10 40 43 40h238zM275 146c3 11 33 164 43 213zM267 351c2 9 -5 16 -12 16h-191
+c-9 0 -15 -8 -15 -15v-296c0 -1 1 -1 2 0c0 0 70 84 78 94s11 11 23 11h64c9 0 14 8 15 12s8 43 10 51s-6 16 -13 16h-82c-10 0 -18 8 -18 18v13c0 10 8 17 18 17h96s14 6 15 12z" />
+    <glyph glyph-name="ion-social-freebsd-devil" unicode="&#xf2c4;" horiz-adv-x="512" 
+d="M503 333c19 -37 8 -81 -20 -108s-60 -33 -60 -33c2 -32 16 -59 -41 -102c-43 -32 2 -90 2 -90c10 -14 23 -19 32 -32h-272s15 14 -7 32c0 0 -20 17 -18 29s6 13 9 15s0 7 0 7l-19 19s-13 -13 -44 -13c-38 0 -65 39 -65 39h46s-6 -8 -7 -13c-1 -4 1 -5 1 -5s11 -6 22 -6
+c17 0 33 12 33 12l-24 22l-15 -4l-16 37l39 -10l-1 -15l28 -18s9 9 7 27s-9 26 -9 26s-4 0 -9 -4s-6 -6 -6 -6l-10 44s43 -19 50 -63c3 -20 -6 -35 -6 -35l17 -10s6 5 17 7s23 2 29 -8s5 -12 4 -19s0 -9 6 -11s6 -6 11 -8s15 -6 21 -2s8 11 8 18v16s-9 8 -32 20
+s-54 22 -66 40s-12 44 0 57c9 10 23 25 26 35c4 14 4 42 4 42s-10 16 -8 40c2 30 22 84 96 114c0 0 -40 -55 -20 -80c0 0 37 11 77 9c31 -2 56 -12 73 -28s25 -23 47 -17s28 17 28 33c0 19 -16 51 -16 51s36 -7 58 -51zM195 245c14 4 21 -11 21 -11c14 25 30 60 22 64
+s-64 -25 -66 -88c0 0 6 31 23 35zM232 230c5 7 34 8 37 -17c4 -35 -24 -57 -24 -57s7 -2 23 2c17 4 43 29 43 70s-21 66 -41 62s-38 -60 -38 -60z" />
+    <glyph glyph-name="ion-social-github-outline" unicode="&#xf232;" 
+d="M224 416c124 0 224 -103 224 -230c0 -101 -64 -188 -153 -218h-4c-8 0 -12 7 -12 12c0 8 1 31 1 62c0 21 -8 36 -16 43c50 6 103 25 103 113c0 25 -9 46 -23 62c2 6 10 29 -2 61h-5c-8 0 -27 -3 -57 -24c-18 5 -37 8 -56 8s-38 -3 -56 -8c-30 21 -49 24 -57 24h-5
+c-12 -32 -4 -55 -2 -61c-14 -16 -23 -37 -23 -62c0 -88 52 -107 102 -113c-6 -6 -12 -16 -14 -31c-6 -3 -16 -6 -26 -6c-13 0 -28 5 -39 25c0 0 -13 22 -35 24v0c-2 0 -21 0 -1 -14c0 0 15 -8 25 -34c0 0 10 -33 53 -33c7 0 14 0 22 2v-39c0 -5 -3 -11 -11 -11h-4
+c-89 30 -153 116 -153 218c0 127 100 230 224 230zM146 -0c-15 0 -28 4 -38 9c14 -10 28 -17 44 -23v6v8h-6zM157 73c-16 4 -35 10 -52 24c6 -6 11 -11 13 -16c7 -12 14 -17 25 -17c4 0 9 1 12 2c1 2 1 5 2 7zM347 14c17 13 32 28 45 46c26 37 40 80 40 126
+c0 29 -5 58 -16 84c-10 25 -26 48 -45 68s-41 34 -66 45c-26 11 -53 17 -81 17s-55 -6 -81 -17c-25 -11 -47 -25 -66 -45s-35 -42 -45 -68c-11 -26 -16 -55 -16 -84c0 -46 14 -89 40 -126c10 -14 22 -27 35 -38c-7 8 -11 16 -13 22c-7 18 -15 24 -17 25h-2v1
+c-5 3 -20 13 -15 28c3 9 12 15 25 15h1v0v0c13 -1 24 -6 32 -13c-21 19 -37 48 -37 98c0 24 7 47 21 66c-3 13 -6 34 5 62l3 8l7 2c2 0 5 1 10 1c12 0 31 -3 60 -22c17 4 35 6 53 6v0v0c18 0 36 -2 53 -6c29 19 48 22 60 22c5 0 8 -1 10 -1l7 -2l3 -7c11 -27 8 -50 5 -63
+c14 -19 21 -41 21 -66c0 -92 -55 -117 -92 -125c3 -8 5 -18 5 -30v-51v-6c18 7 35 16 51 28z" />
+    <glyph glyph-name="ion-social-github" unicode="&#xf233;" 
+d="M224 416c124 0 224 -103 224 -230c0 -101 -64 -188 -153 -218h-4c-8 0 -12 7 -12 12c0 8 1 31 1 62c0 21 -8 36 -16 43c50 6 103 25 103 113c0 25 -9 46 -23 62c2 6 10 29 -2 61h-5c-8 0 -27 -3 -57 -24c-18 5 -37 8 -56 8s-38 -3 -56 -8c-30 21 -49 24 -57 24h-5
+c-12 -32 -4 -55 -2 -61c-14 -16 -23 -37 -23 -62c0 -88 52 -107 102 -113c-6 -6 -12 -16 -14 -31c-6 -3 -16 -6 -26 -6c-13 0 -28 5 -39 25c0 0 -13 22 -35 24v0c-2 0 -21 0 -1 -14c0 0 15 -8 25 -34c0 0 10 -33 53 -33c7 0 14 0 22 2v-39c0 -5 -3 -11 -11 -11h-4
+c-89 30 -153 116 -153 218c0 127 100 230 224 230z" />
+    <glyph glyph-name="ion-social-google-outline" unicode="&#xf34e;" horiz-adv-x="256" 
+d="M191 366c12 -10 37 -30 37 -68c0 -37 -21 -55 -43 -72c-7 -7 -15 -13 -15 -24s8 -17 14 -22l18 -14c23 -19 43 -36 43 -71c0 -47 -47 -95 -135 -95c-74 0 -110 35 -110 72c0 18 10 44 40 62c32 19 75 21 98 23c-7 9 -16 18 -16 34c0 9 2 14 5 20c-6 0 -11 -1 -16 -1
+c-54 0 -85 40 -85 79c0 23 11 48 33 67c29 24 63 28 91 28h106l-33 -18h-32zM155 142c-4 1 -7 1 -12 1s-32 -1 -54 -8c-11 -4 -44 -16 -44 -52s36 -62 91 -62c49 0 75 24 75 55c0 26 -17 39 -56 66zM170 238c12 12 13 28 13 37c0 36 -22 92 -65 92c-13 0 -28 -6 -36 -16
+c-9 -11 -11 -25 -11 -38c0 -34 20 -89 64 -89c13 0 27 6 35 14z" />
+    <glyph glyph-name="ion-social-google" unicode="&#xf34f;" horiz-adv-x="288" 
+d="M210 172c22 -18 45 -36 45 -73c0 -49 -48 -99 -140 -99c-80 0 -115 39 -115 77c0 10 3 42 42 65c27 16 61 20 85 22c-4 7 -8 16 -8 27c0 4 0 7 1 10h-4c-19 0 -46 4 -67 26c-15 15 -24 36 -24 57c0 26 13 53 35 71v0c32 25 70 29 95 29h133l-60 -33h-13
+c11 -13 23 -31 23 -58c0 -40 -25 -59 -45 -74v-1c-6 -6 -11 -10 -11 -17c0 -6 4 -10 10 -15v0zM85 308c0 -13 4 -33 14 -51c7 -12 20 -27 41 -27c10 0 21 4 28 11c10 10 10 25 10 30c0 18 -6 38 -15 54c-7 13 -20 27 -40 27c-11 0 -22 -5 -29 -13c-6 -7 -9 -18 -9 -31z
+M206 80c0 20 -13 31 -50 56c-3 0 -4 1 -8 1c-6 0 -32 -2 -51 -8c-16 -6 -37 -16 -37 -42c0 -31 32 -51 80 -51c41 0 66 17 66 44z" />
+    <glyph glyph-name="ion-social-googleplus-outline" unicode="&#xf234;" 
+d="M192 366c12 -10 36 -30 36 -68c0 -37 -21 -55 -43 -72c-7 -7 -15 -13 -15 -24s8 -18 14 -22l18 -14c23 -19 43 -36 43 -71c0 -47 -47 -95 -135 -95c-74 0 -110 35 -110 72c0 18 10 44 40 62c32 19 75 21 98 23c-7 9 -16 18 -16 34c0 9 3 14 5 20c-6 0 -11 -1 -16 -1
+c-54 0 -85 40 -85 79c0 23 10 48 32 67c29 24 64 28 92 28h106l-33 -18h-31zM155 142c-4 0 -7 1 -12 1s-32 -1 -54 -8c-11 -4 -44 -16 -44 -52s36 -62 91 -62c49 0 75 24 75 55c0 26 -17 39 -56 66zM170 238c12 12 13 28 13 37c0 36 -22 92 -65 92c-13 0 -28 -6 -36 -16
+c-9 -11 -11 -24 -11 -37c0 -34 20 -90 64 -90c13 0 27 6 35 14zM448 306v-18h-78v-81h-18v81h-80v18h80v78h18v-78h78z" />
+    <glyph glyph-name="ion-social-googleplus" unicode="&#xf235;" 
+d="M210 172c22 -18 45 -36 45 -73c0 -49 -47 -99 -139 -99c-80 0 -116 39 -116 77c0 10 3 42 42 65c27 16 61 21 85 23c-4 7 -8 15 -8 26c0 4 0 7 1 10h-4c-19 0 -46 4 -67 26c-15 15 -24 36 -24 57c0 26 13 53 35 71v0c32 25 69 29 94 29h134l-60 -33h-13
+c11 -13 23 -31 23 -58c0 -40 -25 -59 -45 -74v-1c-6 -6 -11 -10 -11 -17c0 -6 4 -10 10 -15v0zM85 308c0 -13 4 -33 14 -51c7 -12 21 -27 41 -27c10 0 21 4 28 11c10 10 10 25 10 30c0 18 -6 37 -15 53c-8 13 -20 28 -40 28c-11 0 -23 -5 -29 -13c-6 -7 -9 -18 -9 -31z
+M206 80c0 20 -13 31 -50 56c-3 0 -4 1 -8 1c-6 0 -31 -2 -50 -8c-16 -6 -38 -16 -38 -42c0 -31 32 -51 80 -51c41 0 66 17 66 44zM370 306h78v-34h-78v-81h-34v81h-80v34h80v78h34v-78z" />
+    <glyph glyph-name="ion-social-hackernews-outline" unicode="&#xf236;" horiz-adv-x="384" 
+d="M352 352h-320v-320h320v320zM384 384v0v-384h-384v384h384zM233 289h45l-64 -120v-72h-40v72l-66 120h47l40 -84z" />
+    <glyph glyph-name="ion-social-hackernews" unicode="&#xf237;" horiz-adv-x="384" 
+d="M0 384h384v-384h-384v384zM214 169l64 120h-45l-38 -84l-40 84h-47l66 -120v-72h40v72z" />
+    <glyph glyph-name="ion-social-html5-outline" unicode="&#xf4e2;" horiz-adv-x="384" 
+d="M0 416h384l-35 -403l-157 -45l-157 45zM319 37l30 347h-314l30 -347l127 -36zM84 184l-13 150h241l-4 -50h-184l4 -51h176l-14 -151l-98 -28l-99 28l-6 77h48l3 -39l54 -15l53 15l6 64h-167z" />
+    <glyph glyph-name="ion-social-html5" unicode="&#xf4e3;" horiz-adv-x="384" 
+d="M0 416h384l-35 -403l-157 -45l-157 45zM308 284l4 50h-241l13 -150h167l-6 -64l-53 -15l-54 15l-3 39h-48l6 -78l99 -27l98 28l14 151h-176l-4 51h184z" />
+    <glyph glyph-name="ion-social-instagram-outline" unicode="&#xf350;" horiz-adv-x="384" 
+d="M384 336v-289c0 -26 -22 -47 -48 -47h-288c-26 0 -48 21 -48 47v289c0 26 22 48 48 48h288c26 0 48 -22 48 -48zM192 272c-44 0 -80 -36 -80 -80s36 -80 80 -80s80 36 80 80s-36 80 -80 80zM352 288v48c0 9 -7 16 -16 16h-48c-9 0 -16 -7 -16 -16v-48c0 -9 7 -16 16 -16
+h48c9 0 16 7 16 16zM337 32c9 0 15 7 15 16v176h-52c3 -10 4 -21 4 -32c0 -30 -11 -58 -32 -79s-50 -33 -80 -33s-58 12 -79 33s-33 49 -33 79c0 11 2 22 5 32h-53v-176c0 -9 8 -16 17 -16h288z" />
+    <glyph glyph-name="ion-social-instagram" unicode="&#xf351;" horiz-adv-x="384" 
+d="M112 192c0 53 27 80 80 80s80 -27 80 -80s-27 -80 -80 -80s-80 27 -80 80zM113 271c-14 -14 -23 -29 -28 -47h-85v112c0 13 4 25 14 34s22 14 35 14h288c13 0 24 -5 33 -14s14 -21 14 -34v-112h-84c-5 18 -14 33 -28 47c-22 22 -49 33 -80 33s-57 -11 -79 -33zM352 300
+v39c0 4 -2 7 -4 9s-5 4 -9 4h-38c-4 0 -7 -2 -9 -4s-4 -5 -4 -9v-39c0 -4 2 -7 4 -9s5 -3 9 -3h38c4 0 7 1 9 3s4 5 4 9zM272 113c22 22 32 48 32 79h80v-144c0 -13 -5 -24 -14 -34s-20 -14 -33 -14h-288c-13 0 -24 4 -34 14s-15 21 -15 34v144h81c0 -31 10 -57 32 -79
+s48 -33 79 -33s58 11 80 33z" />
+    <glyph glyph-name="ion-social-javascript-outline" unicode="&#xf4e4;" 
+d="M160 344h-48v-196c0 -30 -6 -50 -17 -64c-11 -13 -26 -20 -48 -20c-9 0 -18 1 -25 2l-4 -30c11 -2 25 -4 37 -4c34 0 59 8 76 25c19 18 29 48 29 90v197zM176 360v0v-213c0 -97 -49 -131 -121 -131c-18 0 -40 3 -55 8l8 62c10 -4 24 -6 39 -6c31 0 49 15 49 68v212h80z
+M350 352c-34 0 -62 -9 -82 -26c-19 -15 -28 -36 -28 -60c0 -20 7 -36 21 -51c14 -14 34 -26 61 -36c23 -8 38 -15 48 -24c12 -11 18 -23 18 -38c0 -16 -7 -31 -20 -40c-12 -9 -28 -14 -48 -14c-28 0 -52 8 -70 15l-7 -32c18 -8 44 -14 72 -14c38 0 70 9 90 27
+c18 16 27 38 27 63c0 21 -5 36 -17 50s-31 27 -58 37v0v0c-38 15 -72 28 -72 63c0 14 7 27 19 36c11 9 26 13 45 13c24 0 43 -5 57 -11l10 32c-19 6 -42 10 -66 10zM350 368v0c38 0 65 -7 85 -16l-19 -64c-13 7 -35 17 -67 17s-48 -16 -48 -33c0 -22 19 -31 62 -48
+c58 -22 85 -53 85 -102c0 -57 -42 -106 -133 -106c-38 0 -72 10 -91 21l15 63v0c20 -11 49 -21 81 -21c34 0 52 15 52 38c0 21 -15 33 -55 47c-55 20 -93 52 -93 102c0 58 49 102 126 102z" />
+    <glyph glyph-name="ion-social-javascript" unicode="&#xf4e5;" 
+d="M176 360v0v-213c0 -97 -49 -131 -121 -131c-18 0 -40 3 -55 8l8 62c10 -4 24 -6 39 -6c31 0 49 15 49 68v212h80zM350 368v0c38 0 65 -7 85 -16l-19 -64c-13 7 -35 17 -67 17s-48 -16 -48 -33c0 -22 19 -31 62 -48c58 -22 85 -53 85 -102c0 -57 -42 -106 -133 -106
+c-38 0 -72 10 -91 21l15 63v0c20 -11 49 -21 81 -21c34 0 52 15 52 38c0 21 -15 33 -55 47c-55 20 -93 52 -93 102c0 58 49 102 126 102z" />
+    <glyph glyph-name="ion-social-linkedin-outline" unicode="&#xf238;" horiz-adv-x="384" 
+d="M119 64v0h-55v171h55v-171zM93 261v0v0c-18 0 -29 13 -29 29c0 17 12 30 30 30s29 -13 29 -30c0 -16 -12 -29 -30 -29zM257 239c36 0 63 -24 63 -75v-100h-55v94c0 22 -8 37 -28 37c-15 0 -24 -10 -28 -20c-2 -4 -2 -9 -2 -14v-97h-55v171h55v-24c8 11 21 28 50 28z
+M353 384c18 0 31 -13 31 -30v-321c0 -17 -13 -33 -31 -33h-320c-18 0 -33 16 -33 33v321c0 17 15 30 33 30h320zM350 32c1 0 2 1 2 2v316c0 1 -1 2 -2 2h-316s-2 -1 -2 -2v-315s1 -3 3 -3h315z" />
+    <glyph glyph-name="ion-social-linkedin" unicode="&#xf239;" horiz-adv-x="384" 
+d="M353 384c18 0 31 -13 31 -30v-321c0 -17 -13 -33 -31 -33h-320c-18 0 -33 16 -33 33v321c0 17 15 30 33 30h320zM119 64v171h-55v-171h55zM93 261c18 0 30 13 30 29c0 17 -11 30 -29 30s-30 -13 -30 -30c0 -16 11 -29 29 -29v0zM320 64v100c0 51 -27 75 -63 75
+c-29 0 -42 -17 -50 -28v24h-55v-171h55v97c0 5 0 10 2 14c4 10 13 20 28 20c20 0 28 -15 28 -37v-94h55z" />
+    <glyph glyph-name="ion-social-markdown" unicode="&#xf4e6;" 
+d="M416 352c18 0 32 -14 32 -32v-256c0 -18 -14 -32 -32 -32h-384c-18 0 -32 14 -32 32v256c0 18 14 32 32 32h384zM252 96v0v192h-56l-42 -68l-42 68h-56v-192h56v96l42 -54l42 54v-96h56zM336 96v0l70 96h-42v96h-56v-96h-42z" />
+    <glyph glyph-name="ion-social-nodejs" unicode="&#xf4e7;" horiz-adv-x="384" 
+d="M192 -32c-6 0 -12 2 -17 5l-53 32c-8 5 -4 6 -1 7c11 4 14 5 25 12c1 1 3 1 4 0l39 -23c1 -1 4 -1 5 0l156 92c1 1 2 2 2 4v187c0 2 0 4 -2 5l-156 94c-1 1 -3 1 -4 0l-155 -94c-2 -1 -3 -3 -3 -5v-187c0 -2 0 -3 2 -4l40 -24c24 -12 38 1 38 15v183c0 3 2 5 5 5h22
+c3 0 5 -2 5 -5v-183c0 -33 -19 -52 -49 -52c-9 0 -17 1 -37 11l-41 24c-10 6 -17 18 -17 30v190c0 12 7 24 17 30l158 95c10 6 24 6 34 0l158 -95c10 -6 17 -18 17 -30v-190c0 -12 -7 -24 -17 -30l-158 -94c-5 -3 -11 -5 -17 -5v0zM241 96c-65 0 -84 31 -84 59c0 3 1 5 4 5
+h21c2 0 5 -2 5 -4c3 -22 16 -31 54 -31c33 0 47 11 47 29c0 11 -3 18 -55 23c-43 4 -71 15 -71 51c0 33 28 52 73 52c46 0 76 -14 79 -51c0 -1 -1 -2 -2 -3s-2 -2 -3 -2h-20c-2 0 -5 2 -5 4c-4 17 -16 23 -49 23c-36 0 -41 -12 -41 -22c0 -12 5 -16 54 -23s72 -16 72 -51
+c0 -36 -29 -59 -79 -59v0v0z" />
+    <glyph glyph-name="ion-social-octocat" unicode="&#xf4e8;" 
+d="M146 161c9 0 16 -4 22 -13s10 -20 10 -32s-4 -22 -10 -31s-14 -13 -22 -13c-9 0 -17 4 -23 13s-9 19 -9 31s3 24 9 32c6 9 14 13 23 13zM303 161c9 0 16 -4 22 -13s9 -20 9 -32s-3 -22 -9 -31s-13 -13 -22 -13s-18 4 -24 13s-9 19 -9 31s3 24 9 32c6 9 15 13 24 13z
+M414 276c24 -27 34 -66 34 -96c0 -24 -1 -46 -6 -65c-6 -19 -13 -35 -21 -47c-9 -12 -19 -23 -32 -32s-24 -17 -34 -21s-22 -8 -36 -10c-13 -2 -24 -4 -31 -4c0 0 -28 -1 -64 -1s-64 1 -64 1c-7 0 -18 2 -31 4c-14 2 -26 6 -36 10s-22 12 -34 21c-13 9 -23 20 -32 32
+c-8 12 -15 28 -21 47c-5 19 -6 41 -6 65c0 31 10 70 34 96c0 0 -2 14 0 39s7 48 16 69c30 -3 67 -20 112 -51c15 4 36 6 62 6c28 0 48 -2 62 -6c20 14 39 24 58 33c19 8 33 13 41 15s13 3 13 3c9 -21 14 -44 16 -69s0 -39 0 -39v0zM348 42c28 13 42 40 42 81
+c0 24 -8 43 -26 59c-9 9 -20 13 -32 15s-31 1 -56 -1s-40 -4 -52 -4s-25 2 -42 3s-30 3 -39 3c-10 0 -20 1 -31 -2s-21 -7 -28 -14c-17 -15 -25 -35 -25 -59c0 -41 13 -68 41 -81c27 -13 69 -18 123 -18h2c54 0 95 5 123 18z" />
+    <glyph glyph-name="ion-social-pinterest-outline" unicode="&#xf2b0;" 
+d="M224 416c124 0 224 -100 224 -224s-100 -224 -224 -224s-224 100 -224 224s100 224 224 224zM360 56c36 36 56 85 56 136s-20 100 -56 136s-85 56 -136 56s-100 -20 -136 -56s-56 -85 -56 -136s20 -100 56 -136c14 -14 31 -25 48 -34c1 6 2 10 3 16c4 18 29 122 29 122
+s-8 15 -8 36c0 33 20 58 44 58c20 0 30 -16 30 -34c0 -20 -13 -51 -20 -79c-6 -24 12 -43 35 -43c42 0 71 54 71 119c0 49 -33 85 -93 85c-68 0 -110 -50 -110 -107c0 -20 6 -33 15 -44c4 -5 5 -6 3 -12c-1 -4 -4 -14 -5 -18c-2 -6 -6 -8 -11 -6c-31 13 -46 48 -46 86
+c0 64 54 140 160 140c86 0 142 -63 142 -129c0 -88 -49 -153 -121 -153c-24 0 -47 13 -55 28c0 0 -12 -52 -15 -62c-2 -6 -4 -13 -7 -19c15 -4 31 -6 47 -6c51 0 100 20 136 56z" />
+    <glyph glyph-name="ion-social-pinterest" unicode="&#xf2b1;" 
+d="M224 416c124 0 224 -100 224 -224s-100 -224 -224 -224c-22 0 -44 3 -64 9c8 14 18 31 23 48c3 10 16 62 16 62c8 -15 30 -28 54 -28c72 0 121 65 121 153c0 66 -56 129 -142 129c-106 0 -160 -76 -160 -140c0 -39 15 -73 46 -86c5 -2 10 0 12 6c1 4 3 14 4 18
+c2 6 1 7 -3 12c-9 11 -15 24 -15 44c0 57 42 107 110 107c60 0 94 -36 94 -85c0 -65 -29 -119 -71 -119c-24 0 -42 19 -36 43c7 28 20 59 20 79c0 18 -10 34 -30 34c-24 0 -43 -25 -43 -58c0 -21 7 -36 7 -36s-25 -104 -29 -122c-4 -17 -5 -35 -4 -51
+c-79 35 -134 113 -134 205c0 124 100 224 224 224z" />
+    <glyph glyph-name="ion-social-python" unicode="&#xf4e9;" horiz-adv-x="384" 
+d="M129 199c-29 -5 -49 -30 -49 -57v-43v-3h-15c-29 0 -54 29 -62 69c-2 9 -3 17 -3 27v1c0 53 29 95 65 95h127v16h-96v29c0 26 7 40 46 47c13 2 29 4 45 4s39 -1 55 -4c25 -4 46 -22 46 -47v-57v-31c0 -21 -14 -38 -33 -43c-4 -1 -8 -2 -13 -2h-104h3c-4 0 -8 0 -12 -1z
+M140 321c10 0 17 7 17 17s-7 18 -17 18s-18 -8 -18 -18s8 -17 18 -17zM380 225c3 -10 4 -21 4 -33c0 -16 -3 -30 -7 -43c-11 -31 -33 -53 -58 -53h-127v-16h96v-26c0 -26 -23 -40 -46 -47c-35 -10 -68 -9 -97 0c-25 7 -49 22 -49 47v54v33c0 21 14 36 33 41c4 1 8 2 13 2
+h104c3 0 6 1 9 1c27 4 49 28 49 62v38v3h15c28 0 52 -26 61 -63zM244 65c-10 0 -18 -7 -18 -17s8 -18 18 -18s17 8 17 18s-7 17 -17 17z" />
+    <glyph glyph-name="ion-social-reddit-outline" unicode="&#xf23a;" horiz-adv-x="449" 
+d="M259 160c0 21 11 31 32 31s32 -10 32 -31s-11 -32 -32 -32s-32 11 -32 32zM127 160c0 21 11 31 32 31s32 -10 32 -31s-11 -32 -32 -32s-32 11 -32 32zM449 197c0 -20 -9 -36 -27 -45c1 -5 1 -9 1 -14c0 -38 -19 -71 -58 -98s-85 -40 -140 -40s-102 13 -141 40
+s-58 59 -58 97c0 5 0 10 1 15c-18 9 -27 24 -27 45c0 14 5 25 15 35s21 15 35 15c13 0 24 -4 33 -13c36 25 79 39 129 41h7l29 98l86 -17c8 19 21 28 41 28c12 0 22 -4 31 -13s13 -20 13 -32s-4 -23 -13 -32s-19 -13 -31 -13s-23 4 -32 13s-13 19 -13 31l-69 14l-24 -77
+c50 -2 94 -16 129 -41c10 9 21 13 34 13c9 0 16 -3 24 -7s14 -10 18 -18s7 -16 7 -25zM375 366c-4 0 -8 -1 -11 -2s-6 -4 -8 -6s-5 -6 -6 -9s-2 -6 -2 -10c0 -8 3 -14 8 -19s12 -8 19 -8c5 0 9 1 13 3s8 6 10 10s4 9 4 14c0 8 -3 14 -8 19s-12 8 -19 8zM18 197
+c0 -11 5 -20 14 -27c7 19 19 37 37 53c-6 4 -12 6 -19 6c-3 0 -7 0 -10 -1s-6 -3 -9 -5s-5 -4 -7 -7s-4 -6 -5 -9s-1 -6 -1 -10zM355 55c34 23 50 51 50 83v9c-1 6 -3 12 -5 18c-6 16 -15 30 -30 43c-5 4 -10 9 -15 12v0c-36 25 -79 37 -130 37s-95 -12 -131 -37v0
+c-5 -3 -10 -8 -15 -12c-15 -13 -24 -27 -30 -43c-2 -6 -4 -12 -5 -18v-9c0 -32 16 -60 50 -83c36 -25 80 -37 131 -37s94 12 130 37zM417 170c9 6 14 16 14 27c0 9 -3 17 -9 23s-13 9 -22 9c-7 0 -14 -2 -20 -6c18 -16 30 -34 37 -53zM289 90l13 -12
+c-20 -20 -45 -30 -77 -30s-58 10 -78 30l13 12c16 -16 38 -24 65 -24s48 8 64 24z" />
+    <glyph glyph-name="ion-social-reddit" unicode="&#xf23b;" horiz-adv-x="449" 
+d="M449 197c0 -20 -11 -37 -27 -45c1 -5 1 -9 1 -14c0 -76 -89 -138 -199 -138s-198 61 -198 137c0 5 0 10 1 15c-16 8 -27 25 -27 45c0 28 23 50 50 50c13 0 24 -5 33 -13c33 23 79 39 129 41h2l31 103l90 -18c8 14 22 24 39 24v0h1c25 0 44 -20 44 -45s-19 -45 -44 -45h-1
+v0c-23 0 -42 17 -44 40l-67 14l-22 -74c49 -3 93 -17 125 -40c9 8 21 13 34 13c27 0 49 -22 49 -50zM34 177c5 15 15 29 29 41c-4 3 -9 5 -15 5c-14 0 -25 -11 -25 -25c0 -9 4 -17 11 -21zM358 339c0 -9 7 -17 16 -17s17 8 17 17s-8 17 -17 17s-16 -8 -16 -17zM127 160
+c0 -18 14 -32 32 -32s32 14 32 32s-14 31 -32 31s-32 -13 -32 -31zM224 48c48 0 77 29 78 30l-13 12s-25 -24 -65 -24c-41 0 -64 24 -64 24l-13 -12c1 -1 29 -30 77 -30zM291 128c18 0 32 14 32 32s-14 31 -32 31s-32 -13 -32 -31s14 -32 32 -32zM415 176c7 5 11 13 11 22
+c0 14 -11 25 -25 25c-6 0 -11 -2 -15 -5c14 -12 24 -27 29 -42z" />
+    <glyph glyph-name="ion-social-rss-outline" unicode="&#xf23c;" horiz-adv-x="384" 
+d="M56 112c31 0 56 -25 56 -56s-25 -56 -56 -56s-56 25 -56 56s25 56 56 56zM56 16c22 0 40 18 40 40s-18 40 -40 40s-40 -18 -40 -40s18 -40 40 -40zM0 256c140 0 256 -116 256 -256h-80c0 48 -14 94 -48 128s-80 48 -128 48v80zM240 16c-2 26 -8 52 -19 77
+c-12 28 -30 54 -52 76s-48 40 -76 52c-25 10 -51 16 -77 18v-47c50 -3 92 -22 123 -53s50 -73 53 -123h48zM0 384c212 0 384 -172 384 -384h-80c0 171 -133 304 -304 304v80zM227 228c56 -56 89 -131 93 -212h48c-8 190 -162 344 -352 352v-48c81 -4 155 -36 211 -92z" />
+    <glyph glyph-name="ion-social-rss" unicode="&#xf23d;" horiz-adv-x="384" 
+d="M56 112c31 0 56 -25 56 -56s-25 -56 -56 -56s-56 25 -56 56s25 56 56 56zM0 256c140 0 256 -116 256 -256h-80c0 48 -14 94 -48 128s-80 48 -128 48v80zM0 384c212 0 384 -172 384 -384h-80c0 171 -133 304 -304 304v80z" />
+    <glyph glyph-name="ion-social-sass" unicode="&#xf4ea;" horiz-adv-x="512" 
+d="M512 119v-8c-1 -9 -7 -17 -15 -22s-12 -4 -13 -3s1 3 4 5c13 8 17 20 10 33c-5 10 -15 16 -26 20c-24 8 -48 7 -72 0c4 -12 7 -23 -2 -34c-10 -12 -23 -19 -39 -22c-7 -2 -14 2 -15 9c-3 19 17 36 30 47c-7 11 -11 24 -14 37c-15 -17 -31 -40 -26 -61
+c3 -14 -1 -27 -14 -36s-30 -14 -46 -11c-4 1 -6 5 -5 8c2 14 25 32 35 43c2 2 3 4 1 7c-6 12 -10 23 -14 36c-13 -29 -30 -80 -57 -98c-9 -6 -17 -4 -21 5c-3 8 -2 20 -1 29c-6 -13 -11 -27 -20 -38c-7 -8 -24 -7 -30 1c-16 21 -13 50 -5 73l-29 -15c7 -16 8 -32 4 -49
+c-5 -19 -17 -35 -35 -46c-19 -12 -64 -24 -77 4c-7 16 -4 30 6 44c17 24 48 37 74 50c-32 23 -80 42 -96 80c-15 35 17 68 43 89c59 48 166 95 244 59c15 -7 36 -24 31 -52c-4 -24 -13 -39 -28 -54c-32 -32 -152 -77 -176 -15c-1 1 -1 4 1 4c2 -1 20 -15 43 -16
+c17 -1 36 3 52 8c33 11 71 33 80 67c4 13 -2 28 -15 34c-49 24 -116 -4 -159 -26c-33 -17 -84 -45 -82 -87c1 -37 56 -60 81 -82c15 7 42 15 52 27c11 13 26 25 44 26c8 0 14 -3 16 -10c2 -6 1 -11 0 -19c5 4 11 4 15 -1c12 -14 -22 -50 -10 -66c14 14 21 42 30 59
+c4 8 17 51 26 53c7 2 18 4 25 0c2 -1 3 -3 2 -5c-7 -19 -7 -33 3 -52c14 20 29 43 34 67c1 2 3 3 5 4c7 2 18 3 25 0c3 -1 3 -2 2 -5c-7 -22 -6 -38 6 -58c31 11 69 15 97 -5c-3 2 -7 5 0 0c5 -4 3 -2 0 0c12 -8 19 -18 21 -32zM113 94v0c1 7 -1 13 -3 20
+c-24 -8 -66 -35 -64 -62c1 -10 8 -13 17 -12s19 7 27 13c14 11 22 24 23 41zM216 166c1 3 -2 5 -5 4c-29 -8 -43 -57 -33 -81c1 -3 4 -3 6 -1c17 16 28 56 32 78zM286 84c8 -3 27 17 26 27c-8 -9 -18 -18 -26 -27zM367 102c11 6 16 19 12 30c-8 -6 -21 -19 -20 -31
+c0 -2 6 0 8 1z" />
+    <glyph glyph-name="ion-social-skype-outline" unicode="&#xf23e;" horiz-adv-x="384" 
+d="M106 352c-41 0 -74 -33 -74 -73c0 -13 4 -25 10 -36l6 -11l-2 -12c-2 -10 -3 -20 -3 -30c0 -40 16 -77 44 -105s67 -44 107 -44c9 0 19 1 28 3l11 2l9 -5c11 -6 24 -9 36 -9c41 0 74 33 74 73c0 11 -3 22 -8 32l-5 10l3 11c2 10 3 21 3 32c0 40 -16 77 -44 105
+s-67 43 -107 43c-9 0 -18 0 -26 -2l-12 -2l-10 7c-12 7 -26 11 -40 11zM106 384v0c21 0 40 -6 56 -16c10 2 21 2 32 2c101 0 183 -80 183 -180c0 -13 -1 -27 -4 -39c7 -14 11 -29 11 -46c0 -58 -47 -105 -106 -105c-18 0 -35 4 -50 12c-11 -2 -22 -3 -34 -3
+c-101 0 -183 81 -183 181c0 12 2 24 4 36c-9 16 -15 34 -15 53c0 58 47 105 106 105zM288 104c-8 -12 -21 -21 -37 -28s-36 -10 -58 -10c-26 0 -48 5 -65 14c-12 7 -22 15 -30 26s-12 22 -12 33c0 7 3 12 8 17s11 7 19 7c6 0 12 -2 16 -6s7 -8 10 -15s7 -13 11 -18
+s8 -9 15 -12s16 -5 27 -5c15 0 28 4 37 10s13 13 13 22c0 7 -2 13 -7 17c-5 5 -11 9 -19 11c-8 3 -20 5 -34 8c-19 4 -35 9 -48 14c-13 6 -24 13 -32 23s-11 22 -11 36s4 25 12 36c8 10 20 19 36 25c15 6 34 8 54 8c16 0 30 -1 42 -5s23 -9 31 -15s14 -13 18 -20
+s5 -14 5 -21c0 -6 -2 -12 -7 -17s-11 -8 -19 -8c-7 0 -12 2 -16 5c-3 3 -7 7 -11 14c-5 8 -10 15 -16 20s-17 8 -31 8c-13 0 -23 -3 -31 -8s-12 -11 -12 -18c0 -4 2 -7 4 -10c3 -3 6 -6 11 -8s10 -5 15 -6s13 -3 25 -6c15 -3 28 -6 40 -10s23 -8 32 -14s15 -13 20 -22
+s8 -20 8 -32c0 -15 -5 -28 -13 -40z" />
+    <glyph glyph-name="ion-social-skype" unicode="&#xf23f;" horiz-adv-x="384" 
+d="M373 151c7 -14 11 -29 11 -46c0 -58 -47 -105 -106 -105c-18 0 -35 4 -50 12c-11 -2 -22 -3 -34 -3c-101 0 -183 81 -183 181c0 12 2 24 4 36c-9 16 -15 34 -15 53c0 58 47 105 106 105c21 0 41 -6 57 -16c10 2 20 2 31 2c101 0 183 -80 183 -180c0 -13 -1 -27 -4 -39z
+M288 104c9 12 12 25 12 40c0 12 -2 23 -7 32s-12 16 -21 22s-19 10 -31 14s-26 7 -41 10c-12 3 -20 5 -25 6s-10 4 -15 6s-7 5 -10 8c-2 3 -4 6 -4 10c0 7 3 13 11 18s19 7 32 7c14 0 25 -2 31 -7s11 -12 16 -20c4 -7 8 -11 11 -14c4 -3 9 -5 16 -5c8 0 13 3 18 8s8 11 8 17
+c0 7 -2 14 -6 21s-10 14 -18 20s-18 11 -30 15s-27 5 -43 5c-20 0 -38 -2 -53 -8c-16 -6 -28 -15 -36 -25c-8 -11 -12 -22 -12 -36s3 -26 11 -36s19 -17 32 -23c13 -5 29 -10 48 -14c14 -3 26 -5 34 -8c8 -2 14 -6 19 -11c5 -4 7 -10 7 -17c0 -9 -4 -17 -13 -23
+s-22 -9 -37 -9c-11 0 -20 2 -27 5s-11 6 -15 11s-8 12 -11 19s-6 11 -10 15s-10 6 -16 6c-8 0 -14 -2 -19 -7s-8 -10 -8 -17c0 -11 4 -22 12 -33s18 -19 30 -26c17 -9 39 -14 65 -14c22 0 42 3 58 10s29 16 37 28z" />
+    <glyph glyph-name="ion-social-snapchat-outline" unicode="&#xf4eb;" horiz-adv-x="480" 
+d="M240 400v0v0c-71 0 -128 -54 -118 -128c2 -15 3 -32 4 -45c0 0 -2 -5 -12 -5c-6 0 -15 2 -28 7c-2 1 -4 1 -6 1c-8 0 -13 -6 -14 -12c0 -5 4 -11 8 -13c14 -7 47 -10 47 -33s-23 -47 -41 -64s-64 -21 -64 -21s0 -21 32 -29s32 -5 33 -13c2 -15 1 -22 11 -22c2 0 4 1 6 1
+c8 1 20 3 32 3c11 0 23 -2 34 -9c23 -15 41 -34 76 -34s53 19 76 34c11 7 24 9 35 9c12 0 23 -2 31 -3c2 0 4 -1 6 -1c10 0 9 7 11 22c1 8 1 5 33 13s32 29 32 29s-46 4 -64 21s-41 41 -41 64s33 26 47 33c4 2 9 8 9 13c-1 6 -6 12 -14 12c-2 0 -5 0 -7 -1
+c-13 -5 -21 -6 -27 -6c-10 0 -13 4 -13 4c1 13 2 30 4 45c10 74 -47 128 -118 128zM240 416v0c41 0 80 -16 105 -45c24 -28 34 -63 29 -101c-1 -11 -2 -22 -3 -31c4 1 10 2 18 5c4 1 8 2 12 2c16 0 29 -12 30 -27c1 -13 -9 -25 -18 -29c-4 -2 -9 -3 -14 -5
+c-7 -2 -14 -5 -19 -8c-4 -3 -5 -4 -5 -5c0 -16 20 -37 36 -52c11 -10 39 -16 54 -17l15 -1v-14c0 -2 0 -11 -6 -21c-5 -8 -16 -19 -38 -24c-6 -1 -11 -3 -15 -4c-2 -1 -5 -1 -7 -1v-1c-1 -7 -1 -13 -4 -18c-2 -5 -9 -12 -22 -12c-2 0 -6 0 -9 1c-2 0 -3 1 -5 1
+c-7 1 -15 2 -23 2c-10 0 -19 -2 -26 -6c-4 -3 -9 -7 -14 -10c-18 -13 -38 -27 -71 -27s-53 14 -71 27c-5 3 -9 7 -14 10c-7 4 -15 6 -25 6c-8 0 -17 -1 -24 -2c-2 0 -3 -1 -5 -1c-3 -1 -7 -1 -9 -1c-13 0 -20 7 -22 12c-3 5 -3 11 -4 18v1c-2 0 -4 0 -6 1c-4 1 -10 3 -16 4
+c-22 5 -33 16 -38 24c-6 10 -6 18 -6 20v15l15 1c16 1 44 7 54 17c29 27 36 43 36 52c0 1 0 2 -4 5c-5 3 -13 6 -20 8c-5 2 -10 3 -14 5c-9 4 -18 16 -17 29c1 15 14 27 30 27c4 0 8 0 12 -2c8 -3 13 -4 17 -5c-1 9 -2 19 -3 30c-5 38 5 74 29 102c25 29 64 45 105 45v0z
+M240 219c-21 0 -41 8 -56 23c-3 3 -3 9 0 12s9 3 12 0c12 -12 27 -19 44 -19c16 0 32 7 44 19c3 3 9 3 12 0s3 -9 0 -12c-15 -15 -35 -23 -56 -23zM176 296c0 16 5 24 16 24s16 -8 16 -24s-5 -24 -16 -24s-16 8 -16 24zM272 296c0 16 5 24 16 24s16 -8 16 -24
+s-5 -24 -16 -24s-16 8 -16 24z" />
+    <glyph glyph-name="ion-social-snapchat" unicode="&#xf4ec;" horiz-adv-x="480" 
+d="M480 88c0 -2 0 -11 -6 -21c-5 -8 -16 -19 -38 -24c-6 -1 -11 -3 -15 -4c-2 -1 -5 -1 -7 -1v-1c-1 -7 -1 -13 -4 -18c-2 -5 -9 -12 -22 -12c-2 0 -6 0 -9 1c-2 0 -3 1 -5 1c-7 1 -15 2 -23 2c-10 0 -19 -2 -26 -6c-4 -3 -9 -7 -14 -10c-18 -13 -38 -27 -71 -27
+s-53 14 -71 27c-5 3 -9 7 -14 10c-7 4 -15 6 -25 6c-8 0 -17 -1 -24 -2c-2 0 -3 -1 -5 -1c-3 -1 -7 -1 -9 -1c-13 0 -20 7 -22 12c-3 5 -3 11 -4 18v1c-2 0 -4 0 -6 1c-4 1 -10 3 -16 4c-22 5 -33 16 -38 24c-6 10 -6 18 -6 20v15l15 1c16 1 44 7 54 17c29 27 36 43 36 52
+c0 1 0 2 -4 5c-5 3 -13 6 -20 8c-5 2 -10 3 -14 5c-9 4 -18 16 -17 29c1 15 14 27 30 27c4 0 8 0 12 -2c8 -3 13 -4 17 -5c-1 9 -2 19 -3 30c-5 38 5 74 29 102c25 29 64 45 105 45v0c41 0 80 -16 105 -45c24 -28 34 -63 29 -101c-1 -11 -2 -22 -3 -31c4 1 10 2 18 5
+c4 1 8 2 12 2c16 0 29 -12 30 -27c1 -13 -9 -25 -18 -29c-4 -2 -9 -3 -14 -5c-7 -2 -14 -5 -19 -8c-4 -3 -5 -4 -5 -5c0 -16 20 -37 36 -52c11 -10 39 -16 54 -17l15 -1v-14zM192 320c-9 0 -16 -11 -16 -24s7 -24 16 -24s16 11 16 24s-7 24 -16 24zM296 242c3 3 3 9 0 12
+s-9 3 -12 0c-12 -12 -28 -19 -44 -19c-17 0 -32 7 -44 19c-3 3 -9 3 -12 0s-3 -9 0 -12c15 -15 35 -23 56 -23s41 8 56 23zM288 272c9 0 16 11 16 24s-7 24 -16 24s-16 -11 -16 -24s7 -24 16 -24z" />
+    <glyph glyph-name="ion-social-tumblr-outline" unicode="&#xf240;" horiz-adv-x="256" 
+d="M193 52c21 0 42 6 63 20v-65c-18 -8 -34 -15 -48 -18s-28 -5 -45 -5c-19 0 -35 2 -50 7c-14 5 -28 12 -38 21s-17 18 -21 28s-6 25 -6 44v140h-48v58c16 5 30 14 42 24s19 21 26 35s11 37 14 59h62v-112h96v-64h-96v-101c0 -24 1 -40 4 -47c2 -7 7 -12 14 -16
+c9 -6 19 -8 31 -8zM240 17v29c-15 -6 -31 -10 -47 -10c-15 0 -28 3 -40 10c-10 6 -17 15 -21 25c-2 6 -4 17 -4 52v117h96v32h-96v112h-32c-2 -16 -7 -36 -14 -50c-8 -16 -17 -29 -30 -40c-11 -9 -23 -17 -36 -23v-31h48v-156c0 -21 2 -32 4 -38c3 -8 10 -15 18 -22
+c9 -8 19 -14 31 -18c13 -4 29 -6 46 -6c16 0 28 2 41 5c11 2 23 6 36 12z" />
+    <glyph glyph-name="ion-social-tumblr" unicode="&#xf241;" horiz-adv-x="256" 
+d="M193 52c21 0 42 6 63 20v-65c-18 -8 -34 -15 -48 -18s-28 -5 -45 -5c-19 0 -35 2 -50 7c-14 5 -28 12 -38 21s-17 18 -21 28s-6 25 -6 44v140h-48v58c16 5 30 14 42 24s19 21 26 35s11 37 14 59h62v-112h96v-64h-96v-101c0 -24 1 -40 4 -47c2 -7 7 -12 14 -16
+c9 -6 19 -8 31 -8z" />
+    <glyph glyph-name="ion-social-tux" unicode="&#xf2c5;" horiz-adv-x="383" 
+d="M189 347c2 2 -1 -1 0 0c2 2 4 4 6 5c-3 -2 -5 -4 -7 -8c0 1 0 2 1 3zM361 52c7 -4 23 -11 21 -22c-2 -10 -17 -15 -24 -19c-15 -8 -28 -14 -41 -25c-9 -8 -17 -15 -29 -17c-11 -2 -25 -1 -33 8c-5 5 -7 11 -15 12c-25 5 -54 4 -79 0c-13 -2 -21 -11 -32 -17
+c-10 -5 -20 -5 -30 -1c-13 5 -27 10 -41 13s-29 5 -43 9c-31 8 -5 30 -11 50c-3 12 -10 29 8 30c9 1 27 -1 31 11c2 7 -2 15 2 22s-1 17 1 25c4 18 19 32 25 49c5 14 8 25 18 37c9 11 22 22 29 34c10 18 9 35 8 55c-1 17 -1 33 -2 50c0 33 20 60 58 60h14
+c38 0 63 -32 64 -69c0 -19 -5 -38 5 -67c15 -27 36 -48 52 -73c10 -16 16 -31 20 -49c3 -14 9 -31 7 -45c-1 -6 -2 -9 -4 -11c3 -1 7 -2 9 -5c3 -4 2 -11 0 -26c-1 -8 5 -15 12 -19zM137 -3c2 20 -15 39 -25 56c-10 16 -21 43 -39 52c-8 4 -19 5 -23 -5c-2 -7 0 -19 -2 -22
+c-4 -9 -14 -10 -23 -11c-6 0 -17 0 -17 -8c1 -10 10 -20 7 -30c-2 -7 -8 -12 -8 -19c0 -14 38 -15 47 -17c19 -4 37 -14 57 -16c12 -1 25 7 26 20zM253 62c-2 10 2 -10 0 0s-5 28 1 35c4 5 10 6 17 5c0 4 1 9 3 12c8 13 29 8 39 0l-1 2c-3 4 -8 9 -13 10c0 0 4 12 2 34
+c-4 40 -33 62 -33 62c27 -30 27 -58 27 -72c0 -6 -1 -18 -4 -24c-4 -1 -7 -2 -11 -4c-10 -5 -8 2 -8 10c0 18 -2 36 -7 54c-3 9 -7 17 -13 24c-4 5 -4 9 -5 15c-3 12 -9 22 -16 32c-7 9 -7 17 -5 28c1 7 2 14 -6 17c-6 2 -26 5 -27 14c-1 6 -1 16 5 20c16 14 30 -11 17 -24
+c-3 -3 7 -4 8 -4c4 1 4 7 5 10c1 4 1 9 1 13c0 17 -18 32 -34 21c-6 -4 -9 -11 -10 -17c0 -2 -1 -20 0 -20c-4 0 -7 5 -11 5c-3 0 -7 0 -10 -1c0 0 2 14 -2 22c-4 9 -18 16 -24 4s-3 -25 0 -31s4 -6 4 -6c2 1 5 4 5 4s-6 3 -7 11c-1 9 3 14 7 15s10 -2 12 -8s0 -13 0 -13
+c-7 -6 -30 -18 -22 -28c14 -18 33 -15 52 -9c8 3 18 5 24 12c3 3 11 2 8 -4c-2 -5 -18 -7 -22 -9c-9 -4 -18 -8 -28 -10c-6 -1 -13 -5 -28 9c7 -6 8 -16 17 -20c13 -6 33 9 44 15c1 1 16 5 14 0c-1 -4 -11 -7 -15 -9c-11 -6 -23 -21 -36 -22c-8 -1 -21 16 -25 22
+c-1 1 -5 9 -6 4c-1 -8 2 -14 -3 -21c-6 -9 -11 -18 -13 -29c-1 -6 0 -11 -3 -16c-11 -15 -17 -33 -19 -51c0 -4 3 -43 -5 -41c-18 5 -17 33 -14 47c-3 -12 -8 -30 2 -44c12 -15 99 -55 53 -80c7 -14 14 -25 12 -41c8 7 2 20 -1 28c0 0 17 -12 38 -10c17 2 32 7 46 16
+c6 4 11 9 16 14c1 2 4 6 6 7l1 -11c2 -17 -12 -27 -10 -34c4 8 11 14 13 24c3 12 0 24 -2 36zM155 323v0v-3c2 0 2 5 1 8c-1 4 -3 6 -4 6h-2c3 -2 5 -6 5 -11zM210 335c3 -2 0 0 0 0c3 -2 5 -5 5 -10v-3c2 0 3 4 2 7s-3 6 -5 6h-2zM347 15c24 11 -24 -10 0 0
+c24 11 35 17 20 26c-17 10 -26 13 -26 29c0 5 4 16 2 22c-1 4 -6 5 -9 5c-10 -10 -17 -25 -34 -25c-14 0 -25 11 -28 24c-4 2 -10 1 -13 -4c-6 -12 1 -29 3 -41c2 -18 -4 -35 -2 -53c2 -21 26 -22 40 -13c16 10 29 22 47 30z" />
+    <glyph glyph-name="ion-social-twitch-outline" unicode="&#xf4ed;" horiz-adv-x="416" 
+d="M32 416h384v-272l-112 -112h-80l-64 -64h-64v64h-96v304zM368 160v208h-304v-272h80v-64l64 64h96zM272 176v129h48v-129h-48zM160 176v129h48v-129h-48z" />
+    <glyph glyph-name="ion-social-twitch" unicode="&#xf4ee;" horiz-adv-x="416" 
+d="M32 416h384v-272l-112 -112h-80l-64 -64h-64v64h-96v304zM208 176v129h-48v-129h48zM320 176v129h-48v-129h48z" />
+    <glyph glyph-name="ion-social-twitter-outline" unicode="&#xf242;" horiz-adv-x="472" 
+d="M472 338c-13 -20 -29 -36 -48 -50v-12c0 -128 -98 -276 -276 -276c-55 0 -105 16 -148 44c8 -1 15 -2 23 -2c45 0 87 16 120 42c-42 1 -78 29 -90 67c6 -1 12 -2 18 -2c9 0 18 2 26 4c-44 9 -78 48 -78 95v1c13 -7 28 -12 44 -12c-26 17 -43 47 -43 81c0 18 5 34 13 48
+c48 -59 119 -97 199 -101c-2 7 -2 14 -2 22c0 54 43 97 97 97c28 0 52 -12 70 -31c22 4 43 13 62 24c-7 -23 -23 -42 -43 -54c20 2 39 7 56 15zM414 301c3 2 8 6 11 8c-2 0 -11 -2 -19 -1s-21 5 -21 5s14 13 18 17l11 11c-4 -1 -10 -2 -14 -3l-8 -2l-6 6
+c-15 16 -37 26 -59 26c-45 0 -81 -37 -81 -81c0 -6 1 -12 2 -18l5 -21l-22 1c-42 2 -81 13 -118 32c-28 14 -53 34 -75 56c-1 -6 -2 -13 -2 -19c0 -27 14 -53 36 -68c0 0 33 -23 46 -29c-24 -2 -56 0 -56 0c-8 0 -16 1 -24 3c8 -28 32 -50 62 -56l61 -10l-61 -21
+c-7 -2 -14 -3 -21 -3c15 -20 38 -34 64 -34l45 -1l-35 -28c-18 -14 -38 -25 -60 -33c-10 -3 -19 -6 -29 -8c27 -9 55 -14 84 -14c40 0 78 8 112 24c31 14 58 34 81 60c22 24 38 53 50 84c11 30 17 62 17 92v12l-1 8z" />
+    <glyph glyph-name="ion-social-twitter" unicode="&#xf243;" horiz-adv-x="472" 
+d="M472 338c-13 -20 -29 -36 -48 -50v-12c0 -128 -98 -276 -276 -276c-55 0 -105 16 -148 44c8 -1 15 -2 23 -2c45 0 87 16 120 42c-42 1 -78 29 -90 67c6 -1 12 -2 18 -2c9 0 18 2 26 4c-44 9 -78 48 -78 95v1c13 -7 28 -12 44 -12c-26 17 -43 47 -43 81c0 18 5 34 13 48
+c48 -59 119 -97 199 -101c-2 7 -2 14 -2 22c0 54 43 97 97 97c28 0 52 -12 70 -31c22 4 43 13 62 24c-7 -23 -23 -42 -43 -54c20 2 39 7 56 15z" />
+    <glyph glyph-name="ion-social-usd-outline" unicode="&#xf352;" horiz-adv-x="320" 
+d="M125 345c11 2 19 3 19 3v-131l-22 6c-15 5 -27 11 -36 19c-12 10 -19 25 -19 43c0 13 4 24 11 33c6 8 13 14 22 19c7 4 17 6 25 8zM128 238v92c-7 -2 -15 -4 -21 -7c-7 -4 -12 -9 -17 -15s-7 -14 -7 -23c0 -13 4 -24 13 -31c8 -7 20 -12 32 -16zM252 151
+c10 -10 15 -24 15 -42c0 -9 -1 -18 -5 -27s-11 -17 -20 -24c-8 -6 -18 -11 -31 -15c-6 -2 -11 -3 -17 -4s-18 -1 -18 -1v145l20 -5c10 -3 19 -6 28 -9c10 -4 20 -10 28 -18zM247 89c3 7 4 13 4 20c0 14 -3 24 -10 31s-15 11 -23 14s-16 5 -26 8v-107c6 1 10 2 14 3
+c11 3 20 8 27 13s11 11 14 18zM315 145c3 -10 5 -19 5 -29c0 -21 -5 -38 -14 -53s-20 -26 -35 -35s-31 -17 -50 -21c-10 -2 -19 -3 -29 -4v-35h-64v35c-9 1 -19 4 -28 6c-20 5 -36 12 -51 23s-26 24 -35 41c-8 16 -13 34 -14 55h69c0 -12 2 -24 7 -33c5 -10 12 -17 21 -23
+s20 -11 31 -14v120c-8 2 -18 4 -27 6c-17 4 -30 9 -41 16s-20 15 -27 23s-11 17 -14 26s-4 18 -4 28c0 18 4 34 12 48s19 25 33 34s29 16 46 20c7 2 15 3 22 4v33h64v-33c9 -1 16 -4 24 -6c18 -5 34 -12 48 -22s25 -22 33 -37c7 -13 11 -28 12 -46h-69c-3 21 -12 37 -26 46
+c-7 4 -13 8 -22 10v-106c9 -2 16 -4 25 -6c12 -3 22 -6 27 -7c13 -4 23 -9 33 -15c10 -7 18 -14 24 -22s11 -17 14 -27zM293 72c7 12 11 27 11 44c0 8 -1 16 -4 24s-7 15 -12 22s-12 13 -20 19c-8 5 -18 10 -29 13c-5 1 -13 3 -24 6h-1l-4 1c-7 2 -13 4 -21 6l-13 3v137
+s9 -1 19 -4s19 -6 28 -12c15 -9 25 -24 30 -43h38c-2 8 -4 15 -8 22c-7 13 -16 24 -28 32c-12 9 -27 16 -43 20c-8 2 -16 4 -23 5l-13 2v31h-32v-31l-14 -2c-7 -1 -14 -2 -20 -4c-15 -4 -29 -10 -41 -18s-21 -16 -28 -28c-7 -11 -10 -24 -10 -40c0 -8 1 -15 3 -23
+c2 -7 6 -14 11 -21s14 -13 23 -19c10 -6 22 -10 37 -14v0v0c4 -1 8 -2 11 -3c5 -1 11 -3 16 -4l12 -3v-151s-8 1 -20 4s-26 8 -36 15c-11 8 -20 18 -26 30c-4 7 -6 16 -8 24h-36c2 -11 5 -23 10 -32c8 -14 17 -26 30 -35c13 -10 28 -16 46 -21c8 -2 17 -4 26 -5l14 -2v-33
+h32v33l15 1c9 1 17 3 26 5c17 4 32 10 45 18s23 19 31 31z" />
+    <glyph glyph-name="ion-social-usd" unicode="&#xf353;" horiz-adv-x="320" 
+d="M315 145c3 -10 5 -19 5 -29c0 -21 -5 -38 -14 -53s-20 -26 -35 -35s-31 -17 -50 -21c-10 -2 -19 -3 -29 -4v-35h-64v35c-9 1 -19 4 -28 6c-20 5 -36 12 -51 23s-26 24 -35 41c-8 16 -13 34 -14 55h69c0 -12 2 -24 7 -33c5 -10 12 -17 21 -23s20 -11 31 -14v120
+c-8 2 -18 4 -27 6c-17 4 -30 9 -41 16s-20 15 -27 23s-11 17 -14 26s-4 18 -4 28c0 18 4 34 12 48s19 25 33 34s29 16 46 20c7 2 15 3 22 4v33h64v-33c9 -1 16 -4 24 -6c18 -5 34 -12 48 -22s25 -22 33 -37c7 -13 11 -28 12 -46h-69c-3 21 -12 37 -26 46c-7 4 -13 8 -22 10
+v-106c9 -2 16 -4 25 -6c12 -3 22 -6 27 -7c13 -4 23 -9 33 -15c10 -7 18 -14 24 -22s11 -17 14 -27zM128 238v92c-7 -2 -15 -4 -21 -7c-7 -4 -12 -9 -17 -15s-7 -14 -7 -23c0 -13 4 -24 13 -31c8 -7 20 -12 32 -16zM247 89c3 7 4 13 4 20c0 14 -3 24 -10 31s-15 11 -23 14
+s-16 5 -26 8v-107c6 1 10 2 14 3c11 3 20 8 27 13s11 11 14 18z" />
+    <glyph glyph-name="ion-social-vimeo-outline" unicode="&#xf244;" 
+d="M445 334c7 -33 1 -66 -13 -97s-31 -59 -51 -87c-26 -36 -52 -71 -85 -101c-19 -18 -41 -35 -66 -44c-10 -4 -19 -5 -27 -5c-17 0 -31 9 -44 27c-14 19 -22 40 -28 63c-12 45 -25 90 -38 134c-4 12 -9 22 -15 33c-3 5 -8 10 -12 14c-2 2 -5 3 -8 3s-6 -1 -9 -3
+c-10 -6 -28 -18 -28 -18l-21 27c26 24 82 71 82 71c11 9 33 25 48 27h8c18 0 32 -7 42 -22c11 -17 15 -37 18 -57c7 -41 12 -82 24 -122c3 -10 7 -20 12 -29c4 -7 9 -10 14 -10c4 0 7 2 11 5s7 6 10 10c20 24 37 52 48 81c3 9 3 17 3 27c0 13 -10 25 -25 26h-7
+c-11 0 -20 -2 -32 -7c6 24 24 62 54 84c20 14 45 20 67 20c10 0 20 -2 27 -4c23 -8 36 -23 41 -46zM418 244c13 30 17 59 11 87c-4 19 -13 28 -30 34c-6 2 -14 3 -22 3c-21 0 -42 -6 -57 -17c-16 -12 -29 -30 -38 -48h6h8c23 -1 39 -19 40 -41c0 -10 0 -22 -4 -34
+c-11 -29 -29 -58 -51 -85c-4 -4 -7 -9 -12 -13c-7 -6 -15 -8 -22 -8c-8 0 -18 3 -27 18c-7 11 -11 22 -14 32c-10 31 -14 64 -19 95c-2 10 -3 19 -5 29c-3 17 -6 36 -16 51c-7 10 -16 15 -28 15h-6c-8 -1 -25 -11 -40 -23c-2 -2 -43 -37 -70 -61l2 -3c5 4 12 7 16 10
+c6 3 12 5 18 5c7 0 13 -3 18 -7c8 -7 13 -12 16 -18c6 -11 12 -24 16 -37c13 -44 26 -88 38 -133c5 -19 13 -41 26 -59s23 -20 31 -20c6 0 13 1 21 4c23 8 43 25 61 41c32 29 57 63 83 99v0c21 28 37 55 50 84z" />
+    <glyph glyph-name="ion-social-vimeo" unicode="&#xf245;" 
+d="M445 334c7 -33 1 -66 -13 -97s-31 -59 -51 -87c-26 -36 -52 -71 -85 -101c-19 -18 -41 -35 -66 -44c-31 -11 -52 -5 -71 22c-14 19 -22 40 -28 63c-12 45 -25 90 -38 134c-4 12 -9 22 -15 33c-3 5 -8 10 -12 14c-5 4 -11 3 -17 0c-10 -6 -28 -18 -28 -18l-21 27
+c26 24 82 71 82 71c11 9 33 25 48 27c21 3 38 -4 50 -22c11 -17 15 -37 18 -57c7 -41 11 -82 23 -122c3 -10 8 -20 13 -29c7 -11 15 -13 25 -5c4 3 7 6 10 10c20 24 37 52 48 81c3 9 3 17 3 27c0 13 -10 25 -25 26s-24 -1 -39 -7c6 24 24 62 54 84c29 21 71 24 94 16
+s36 -23 41 -46z" />
+    <glyph glyph-name="ion-social-whatsapp-outline" unicode="&#xf4ef;" 
+d="M178 294c4 -11 15 -39 16 -42s2 -6 0 -10s-3 -6 -6 -9s-6 -7 -9 -9c-3 -3 -6 -6 -3 -12s14 -24 30 -39c21 -20 38 -27 44 -30s9 -3 12 1s15 16 19 21s8 5 13 3s31 -17 37 -20s10 -5 11 -7s0 -13 -5 -26s-28 -24 -38 -25s-11 -8 -67 16s-90 84 -93 88s-22 31 -21 58
+s17 41 22 46s11 7 15 7h10s9 0 13 -11zM228 384c-50 0 -97 -20 -133 -55c-35 -35 -55 -81 -55 -131c0 -34 9 -67 27 -96l8 -13l-5 -14l-19 -57l61 19l13 4l12 -6c28 -15 59 -23 91 -23c50 0 97 19 133 54c35 35 55 82 55 132s-20 96 -55 131c-36 35 -83 55 -133 55zM228 416
+v0c121 0 220 -97 220 -218s-99 -218 -220 -218c-39 0 -74 10 -106 27l-122 -39l40 117c-20 33 -32 72 -32 113c0 121 99 218 220 218z" />
+    <glyph glyph-name="ion-social-whatsapp" unicode="&#xf4f0;" 
+d="M228 416c121 0 220 -97 220 -218s-99 -218 -220 -218c-39 0 -74 10 -106 27l-122 -39l40 117c-20 33 -32 72 -32 113c0 121 99 218 220 218zM337 115c5 13 6 24 5 26s-5 4 -11 7s-32 18 -37 20s-9 2 -13 -3s-16 -17 -19 -21s-6 -4 -12 -1s-23 10 -44 30
+c-16 15 -27 33 -30 39s0 9 3 12c3 2 6 6 9 9s4 5 6 9s1 7 0 10s-12 31 -16 42s-10 11 -13 11h-10s-10 -2 -15 -7s-21 -19 -22 -46s18 -54 21 -58s37 -64 93 -88s57 -17 67 -16s33 12 38 25z" />
+    <glyph glyph-name="ion-social-windows-outline" unicode="&#xf246;" 
+d="M432 167h-216v-149l216 -32v181zM448 183v0v-215l-248 36v179h248zM168 167h-152v-120l152 -22v142zM184 183v0v-177l-184 27v150h184zM432 398v0l-216 -31v-152h216v183zM448 416v0v-217h-248v182zM168 360v0l-152 -22v-123h152v145zM184 378v0v-179h-184v153z" />
+    <glyph glyph-name="ion-social-windows" unicode="&#xf247;" 
+d="M448 183v0v-215l-248 36v179h248zM184 183v0v-177l-184 27v150h184zM448 416v0v-217h-248v182zM184 378v0v-179h-184v153z" />
+    <glyph glyph-name="ion-social-wordpress-outline" unicode="&#xf248;" horiz-adv-x="384" 
+d="M192 384c106 0 192 -86 192 -192c0 -9 -1 -18 -2 -26c-12 -85 -79 -153 -165 -164c-8 -1 -17 -2 -25 -2c-106 0 -192 86 -192 192s86 192 192 192zM19 192c0 -68 40 -127 98 -155l-83 225c-10 -21 -15 -45 -15 -70zM214 21c12 2 24 4 35 8c0 1 -1 2 -1 3l-53 145l-33 -96
+v0l-19 -55c15 -5 32 -7 49 -7c8 0 15 1 22 2zM216 273l62 -186l17 58c9 22 13 41 13 56c0 21 -7 35 -14 47c-9 14 -17 27 -17 41c0 16 12 30 29 30h2c-31 28 -71 45 -116 45c-60 0 -113 -30 -144 -77c4 0 8 -1 11 -1c18 0 46 3 46 3c9 1 10 -14 1 -15c0 0 -10 -1 -20 -1
+l63 -187l38 113l-27 74c-9 0 -18 1 -18 1c-9 0 -8 16 1 15c0 0 28 -3 45 -3c18 0 46 3 46 3c9 1 11 -14 2 -15c0 0 -10 -1 -20 -1zM279 43c45 26 77 71 84 125c1 8 2 16 2 24c0 30 -8 58 -22 83c1 -6 1 -12 1 -18c0 -18 -3 -37 -13 -62l-39 -113z" />
+    <glyph glyph-name="ion-social-wordpress" unicode="&#xf249;" horiz-adv-x="384" 
+d="M195 177l53 -146c0 -1 6 -13 9 -19c-3 -1 -5 -2 -8 -3v0c-10 -3 -21 -6 -32 -7c-8 -1 -17 -2 -25 -2c-17 0 -34 2 -50 6v0c-2 0 -3 2 -5 2l25 73v0zM17 268c6 0 7 -1 15 -1l93 -255c-3 1 -5 2 -8 3c-63 27 -109 87 -116 158c-1 6 -1 13 -1 19c0 25 7 53 17 76zM366 273
+c11 -24 18 -52 18 -81c0 -9 -1 -18 -2 -26c-9 -65 -50 -120 -107 -147c-2 -1 -3 -1 -5 -2l22 65l39 113c10 25 13 45 13 62v19v0c-1 18 -10 44 -36 43h-2c-17 0 -29 -14 -29 -30c0 -14 8 -27 17 -41c7 -12 14 -26 14 -47c0 -15 -4 -34 -13 -56l-17 -58l-62 186
+c10 0 20 1 20 1c9 1 7 16 -2 15c0 0 -28 -3 -46 -3c-17 0 -45 3 -45 3c-9 1 -10 -15 -1 -15c0 0 9 -1 18 -1l27 -74l-38 -113l-63 187c10 0 20 2 20 2c9 1 8 15 -1 14c0 0 -28 -2 -46 -2h-34c5 9 11 17 17 25c35 44 90 72 150 72c24 0 48 -5 69 -13c34 -13 63 -36 85 -65
+c2 -2 3 -5 5 -7c6 -8 11 -17 15 -26z" />
+    <glyph glyph-name="ion-social-yahoo-outline" unicode="&#xf24a;" horiz-adv-x="320" 
+d="M289 380c11 0 21 1 31 4l-128 -213v-171c-10 4 -21 4 -32 4s-22 0 -32 -4v171l-128 213c10 -4 21 -4 32 -4s22 0 32 4l96 -160l96 160c10 -4 22 -4 33 -4zM178 180l111 184h-1c-7 0 -15 0 -24 2l-90 -150l-14 -23l-14 23l-89 150c-9 -2 -17 -2 -25 -2h-1l111 -184l2 -4
+v-5v-151c6 1 11 0 16 0s11 1 16 0v151v5z" />
+    <glyph glyph-name="ion-social-yahoo" unicode="&#xf24b;" horiz-adv-x="320" 
+d="M289 380c11 0 21 1 31 4l-128 -213v-171c-10 4 -21 4 -32 4s-22 0 -32 -4v171l-128 213c10 -4 21 -4 32 -4s22 0 32 4l96 -160l96 160c10 -4 22 -4 33 -4z" />
+    <glyph glyph-name="ion-social-yen-outline" unicode="&#xf4f1;" horiz-adv-x="384" 
+d="M384 416l-112 -208h48v-48h-73l-15 -31v-17h88v-48h-88v-96h-80v96h-88v48h88v17l-14 31h-74v48h48l-112 208h80l112 -221l112 221h80zM304 192h-59l13 24l99 184v0h-43l-122 -240l-122 240h-43l99 -184l13 -24h-59v-16h68l20 -44v-36h-88v-16h88v-96h48v96h88v16h-88v37
+l21 43h67v16z" />
+    <glyph glyph-name="ion-social-yen" unicode="&#xf4f2;" horiz-adv-x="384" 
+d="M384 416l-112 -208h48v-48h-73l-15 -31v-17h88v-48h-88v-96h-80v96h-88v48h88v17l-14 31h-74v48h48l-112 208h80l112 -221l112 221h80z" />
+    <glyph glyph-name="ion-social-youtube-outline" unicode="&#xf24c;" horiz-adv-x="512" 
+d="M265 352v0h-9h-9c-65 0 -118 -2 -168 -4h-1h-1c-23 0 -42 -22 -42 -49v-1v-1c-2 -34 -3 -70 -3 -105v0v0c0 -35 1 -70 3 -104v-2v-1c0 -14 5 -26 14 -36c8 -9 17 -13 28 -13h1h1c52 -2 108 -4 166 -4h11v0v0h11c58 0 113 2 166 4h1h1c11 0 20 4 28 13c9 10 14 22 14 36v1
+v2c2 34 3 68 3 104v0v0c0 36 -1 71 -3 105v1v2c0 27 -19 49 -42 49h-1h-1c-49 2 -103 3 -168 3zM265 384v0c58 0 115 0 170 -3c41 0 74 -36 74 -81c2 -36 3 -72 3 -108s-1 -71 -3 -107c0 -45 -33 -81 -74 -81c-55 -3 -111 -4 -168 -4h-11h-11c-57 0 -113 1 -168 4
+c-41 0 -74 36 -74 81c-2 36 -3 71 -3 107s2 71 4 107c0 45 32 82 73 82c55 2 112 3 170 3h9h9zM207 94v197l145 -99z" />
+    <glyph glyph-name="ion-social-youtube" unicode="&#xf24d;" horiz-adv-x="512" 
+d="M509 299c2 -36 3 -71 3 -107s-1 -71 -3 -107c0 -45 -33 -81 -74 -81c-58 -3 -118 -4 -179 -4s-121 1 -179 4c-41 0 -74 36 -74 81c-2 36 -3 71 -3 107s2 71 4 107c0 45 32 81 73 81c55 3 112 4 170 4h9h9c58 0 115 -1 170 -4c41 0 74 -36 74 -81zM207 94l145 98l-145 99
+v-197z" />
+    <glyph glyph-name="ion-soup-can-outline" unicode="&#xf4f3;" horiz-adv-x="320" 
+d="M160 304c-88 0 -160 29 -160 64s72 64 160 64s160 -29 160 -64s-72 -64 -160 -64zM160 415c-70 0 -126 -19 -126 -43s56 -43 126 -43s126 19 126 43s-56 43 -126 43zM161 288c88 0 158 29 159 64c0 -5 0 -33 -8 -40v-240c0 -35 -64 -64 -152 -64s-152 29 -152 64v240
+c-8 6 -8 40 -8 40c0 -35 73 -64 161 -64zM280 72v80c-18 -10 -43 -17 -72 -21h-2c-6 -20 -24 -35 -46 -35s-40 15 -46 35h-2c-29 4 -54 11 -72 21v-80c1 -2 9 -10 30 -18c24 -9 55 -14 90 -14s67 5 91 14c21 8 29 16 29 18zM280 184v91c-33 -12 -75 -19 -119 -19
+c-45 0 -87 7 -121 19v-91c18 -10 43 -17 73 -21h3c7 17 24 29 44 29s37 -12 44 -29h3c30 4 55 11 73 21zM178 -16zM160 -16h1h-1v0zM312 32l8 -16c0 -7 -3 -14 -8 -20c-21 -26 -81 -44 -152 -44s-131 18 -152 44c-5 6 -8 13 -8 20l8 16v16c0 -35 63 -64 152 -64
+s152 28 152 64v-16z" />
+    <glyph glyph-name="ion-soup-can" unicode="&#xf4f4;" horiz-adv-x="320" 
+d="M0 368c0 43 53 64 160 64s160 -21 160 -64s-53 -64 -160 -64s-160 21 -160 64zM160 8c-44 0 -80 6 -109 18s-43 28 -43 46v128c0 -9 4 -19 13 -27s21 -15 37 -21s33 -10 54 -13c1 -12 7 -23 16 -31s20 -12 32 -12s23 4 32 12s15 19 16 31c31 4 56 12 75 23s29 24 29 38
+v-128c0 -18 -14 -34 -43 -46s-65 -18 -109 -18zM160 288c44 0 82 6 113 18s47 28 47 46v-8c0 -5 -1 -11 -2 -18s-3 -11 -6 -14v-96c0 -14 -10 -27 -29 -38s-44 -19 -76 -23c-2 11 -8 19 -17 26s-19 11 -30 11s-21 -4 -30 -11s-15 -15 -17 -26c-32 4 -57 12 -76 23
+s-29 24 -29 38v96c-5 5 -8 18 -8 40c0 -18 16 -34 47 -46s69 -18 113 -18zM312 56v-24l8 -16c0 -7 -3 -14 -8 -20c-11 -13 -30 -24 -58 -32s-59 -12 -94 -12s-66 4 -94 12s-47 19 -58 32c-5 6 -8 13 -8 20l8 16v24c0 -18 14 -34 43 -46s65 -18 109 -18s80 6 109 18
+s43 28 43 46z" />
+    <glyph glyph-name="ion-speakerphone" unicode="&#xf2b2;" 
+d="M39 266c0 -37 20 -69 50 -86c-1 0 -2 1 -3 1s-4 1 -5 1v0c-35 3 -62 33 -69 69c-6 0 -12 7 -12 16c0 8 5 15 11 16c6 42 40 75 81 75h8c-36 -15 -61 -51 -61 -92zM433 357c10 -25 15 -56 15 -88s-5 -63 -15 -88l-3 -9c-6 -14 -15 -26 -24 -34c-10 -10 -22 -19 -34 -20h-3
+c-7 0 -15 2 -22 5c-3 2 -10 5 -10 5c-22 10 -84 28 -115 29c-4 -8 -10 -20 -12 -30c-2 -9 -6 -27 -7 -61c-1 -32 1 -59 3 -82c0 -2 1 -5 1 -7c0 -6 -2 -9 -9 -9h-77c-6 0 -9 3 -9 6v7c2 72 25 140 26 145c2 9 5 17 7 30c2 12 -27 13 -40 24c-29 17 -47 49 -47 86
+c0 41 25 77 59 92h42h19c58 3 114 21 163 50c1 1 3 1 4 2v0c8 4 16 6 24 6c13 0 26 -6 37 -16c9 -9 18 -21 24 -35c1 -3 2 -5 3 -8zM410 180c9 22 15 54 15 89s-6 66 -15 88c-8 18 -19 29 -30 29s-21 -11 -29 -29c-9 -22 -15 -53 -15 -88s6 -67 15 -89c8 -19 18 -33 29 -33
+s22 15 30 33z" />
+    <glyph glyph-name="ion-speedometer" unicode="&#xf2b3;" 
+d="M312 192l8 -8l-64 -84v-4c0 -18 -14 -32 -32 -32s-32 14 -32 32s14 32 32 32h4zM224 352c124 0 224 -100 224 -224c0 -34 -8 -67 -22 -96h-36c15 27 25 57 26 88h-32v16h32c-1 29 -9 56 -22 81l-27 -15l-8 13l27 16c-8 12 -16 23 -26 33s-21 18 -33 26l-16 -27l-14 8
+l16 27c-25 13 -52 21 -81 22v-32h-16v32c-29 -1 -56 -9 -81 -22l16 -27l-14 -8l-16 27c-12 -8 -23 -16 -33 -26s-19 -21 -26 -33l28 -16l-8 -13l-28 15c-13 -25 -21 -52 -22 -81h32v-16h-32c1 -31 11 -61 26 -88h-36c-14 29 -22 62 -22 96c0 124 100 224 224 224z" />
+    <glyph glyph-name="ion-spoon" unicode="&#xf2b4;" horiz-adv-x="128" 
+d="M128 288c0 64 -26 128 -64 128s-64 -64 -64 -128v0c1 -25 16 -54 37 -64l1 -1v0c3 -2 10 -6 10 -10c0 0 -16 -199 -16 -210s4 -20 10 -26s14 -9 22 -9v0v0c8 0 16 3 22 9s10 13 10 26s-16 210 -16 210c0 4 7 8 10 10l1 1c22 10 37 38 37 64z" />
+    <glyph glyph-name="ion-star" unicode="&#xf24e;" 
+d="M448 248l-139 -104l55 -176l-140 112l-140 -112l55 176l-139 104h172l52 168l53 -168h171z" />
+    <glyph glyph-name="ion-stats-bars" unicode="&#xf2b5;" horiz-adv-x="352" 
+d="M96 32v320h64v-320h-64zM0 32v96h64v-96h-64zM192 32v160h64v-160h-64zM288 32v224h64v-224h-64z" />
+    <glyph glyph-name="ion-steam" unicode="&#xf30b;" horiz-adv-x="512" 
+d="M480 240c0 -20 -16 -37 -37 -37c-20 0 -37 16 -37 37c0 20 16 37 37 37c20 0 37 -17 37 -37zM443 309c38 0 69 -31 69 -69s-31 -70 -69 -70l-67 -48c-2 -26 -24 -47 -51 -47c-25 0 -46 18 -51 41l-196 78c-8 -5 -16 -7 -26 -7c-28 0 -52 24 -52 52s24 52 52 52
+c25 0 45 -18 50 -41l196 -79c8 5 17 8 27 8c2 0 3 -1 5 -1l43 62c0 38 32 69 70 69zM443 286c-26 0 -47 -20 -47 -46s21 -47 47 -47s46 21 46 47s-20 46 -46 46zM52 277c-21 0 -38 -17 -38 -38s17 -38 38 -38c3 0 5 0 8 1l-16 6v0c-15 7 -22 24 -16 39s24 23 39 17v0l19 -7
+c-6 12 -19 20 -34 20zM325 165c-3 0 -6 -1 -9 -1l16 -6c16 -6 23 -24 17 -40s-23 -23 -39 -17c-6 3 -13 6 -19 8c6 -12 19 -20 34 -20c21 0 38 17 38 38s-17 38 -38 38z" />
+    <glyph glyph-name="ion-stop" unicode="&#xf24f;" horiz-adv-x="384" 
+d="M373 384c6 0 11 -5 11 -11v-362c0 -6 -5 -11 -11 -11h-362c-6 0 -11 5 -11 11v362c0 6 5 11 11 11h362z" />
+    <glyph glyph-name="ion-thermometer" unicode="&#xf2b6;" horiz-adv-x="160" 
+d="M127 112c20 -14 33 -38 33 -64c0 -44 -36 -80 -80 -80s-80 36 -80 80c0 27 13 51 33 65v257c0 26 21 46 47 46s47 -20 47 -46v-258zM65 370v-50h30v50c0 8 -7 14 -15 14s-15 -6 -15 -14zM96 160v16h-16v-16h16zM96 192v64h-16v-64h16z" />
+    <glyph glyph-name="ion-thumbsdown" unicode="&#xf250;" horiz-adv-x="384" 
+d="M24 195c-10 5 -18 17 -18 29c0 14 8 25 20 30c-4 5 -6 12 -6 19c0 14 8 25 20 30c-3 5 -5 11 -5 17c0 18 11 24 35 30s74 12 126 9c23 -1 55 -7 76 -7v32h112v-240h-112v16c-15 -1 -31 -4 -40 -14c-22 -23 -40 -65 -40 -108c0 -19 1 -29 -4 -34c-13 -13 -44 9 -52 37
+c-9 34 -1 62 1 87h-103c-19 0 -34 15 -34 34c0 15 10 29 24 33zM336 352c-9 0 -16 -7 -16 -16s7 -16 16 -16s16 7 16 16s-7 16 -16 16z" />
+    <glyph glyph-name="ion-thumbsup" unicode="&#xf251;" horiz-adv-x="384" 
+d="M360 189c10 -5 18 -17 18 -29c0 -14 -8 -25 -20 -30c4 -5 6 -12 6 -19c0 -14 -8 -25 -20 -30c3 -5 5 -11 5 -17c0 -18 -11 -24 -35 -30s-74 -12 -126 -9c-23 1 -55 7 -76 7v-32h-112v240h112v-16c15 1 31 4 40 14c22 23 40 65 40 108c0 19 -1 29 4 34c13 13 44 -9 52 -37
+c9 -34 1 -62 -1 -87h103c19 0 34 -15 34 -34c0 -15 -10 -29 -24 -33zM48 32c9 0 16 7 16 16s-7 16 -16 16s-16 -7 -16 -16s7 -16 16 -16z" />
+    <glyph glyph-name="ion-toggle-filled" unicode="&#xf354;" 
+d="M320 240c26 0 48 -22 48 -48s-22 -48 -48 -48s-48 22 -48 48s22 48 48 48zM320 320c71 0 128 -57 128 -128s-57 -128 -128 -128h-192c-71 0 -128 57 -128 128s57 128 128 128h192zM320 112c44 0 80 36 80 80s-36 80 -80 80s-80 -36 -80 -80s36 -80 80 -80z" />
+    <glyph glyph-name="ion-toggle" unicode="&#xf355;" 
+d="M320 288h-192c-53 0 -96 -43 -96 -96s43 -96 96 -96h192c53 0 96 43 96 96s-43 96 -96 96zM320 320v0c71 0 128 -57 128 -128s-57 -128 -128 -128h-192c-71 0 -128 57 -128 128s57 128 128 128h192zM128 240c-26 0 -48 -22 -48 -48s22 -48 48 -48s48 22 48 48
+s-22 48 -48 48zM128 272v0c44 0 80 -36 80 -80s-36 -80 -80 -80s-80 36 -80 80s36 80 80 80z" />
+    <glyph glyph-name="ion-transgender" unicode="&#xf4f5;" horiz-adv-x="512" 
+d="M368 448h144v-144h-40v76l-101 -100c8 -17 13 -36 13 -56c0 -63 -46 -115 -104 -126v-52h72v-46h-72v-64h-48v64h-72v46h72v52c-59 11 -104 63 -104 126c0 20 5 39 13 56l-22 22l-36 -36l-33 33l36 36l-46 45v-76h-40v144h144v-40h-70l43 -42l36 36l33 -33l-36 -36
+l17 -17c23 22 54 36 89 36c27 0 53 -8 74 -23c0 0 6 -5 15 -13l93 92h-70v40zM256 144c44 0 80 36 80 80s-36 80 -80 80s-80 -36 -80 -80s36 -80 80 -80z" />
+    <glyph glyph-name="ion-trash-a" unicode="&#xf252;" horiz-adv-x="352" 
+d="M261 320v0h91v-32h-9s-5 -1 -8 -4s-4 -9 -4 -9l-19 -241c-2 -29 -2 -34 -36 -34h-200c-34 0 -34 5 -36 34l-19 242s-1 6 -4 9s-8 3 -8 3h-9v32h91v29c0 19 14 35 34 35h101c20 0 35 -16 35 -35v-29zM112 349v-29h128v29c0 10 -9 15 -19 15h-91c-10 0 -18 -5 -18 -15z
+M104 64h20l-10 192h-21zM187 64v192h-22v-192h22zM249 64l10 192h-20l-11 -192h21z" />
+    <glyph glyph-name="ion-trash-b" unicode="&#xf253;" horiz-adv-x="320" 
+d="M318 315c3 -12 4 -11 -7 -11h-302c-11 0 -10 -1 -7 11c2 9 4 13 4 13c3 9 9 9 19 11l53 7c7 1 7 1 10 7c9 20 10 31 20 31h103c10 0 12 -11 21 -31c3 -6 3 -6 10 -7l53 -6c10 -2 16 -2 19 -11c0 0 2 -5 4 -14zM283 272c17 0 18 -2 17 -15l-19 -242c-2 -12 -2 -15 -17 -15
+h-208c-15 0 -15 3 -17 15l-19 242c-1 12 0 15 17 15h246z" />
+    <glyph glyph-name="ion-trophy" unicode="&#xf356;" 
+d="M448 345c0 -25 2 -73 -22 -122c-15 -30 -36 -55 -63 -75c-23 -16 -49 -28 -77 -35c-16 -17 -32 -27 -46 -31v-33s0 -49 99 -49h13v-32h-256v32h13c85 0 97 35 99 46v36c-14 4 -30 14 -46 31c-28 7 -55 19 -77 35c-27 20 -48 45 -63 75c-17 36 -21 71 -22 97v0v11v0v21v0
+h80c-2 35 0 64 0 64h143h1h1h142s2 -29 0 -64h81v-7zM51 237c17 -34 43 -61 77 -78c-22 40 -33 84 -42 135c-1 8 -2 17 -3 26h-51c1 -23 5 -53 19 -83zM397 237c14 30 18 60 19 83h-51c-1 -9 -3 -18 -4 -26c-9 -51 -20 -95 -42 -135c34 17 61 43 78 78z" />
+    <glyph glyph-name="ion-tshirt-outline" unicode="&#xf4f6;" 
+d="M146 362l-104 -31l11 -32l39 4l38 5l-2 -38l-14 -255h220l-14 255l-2 38l38 -5l39 -4l11 32l-104 31c-6 -8 -13 -14 -21 -19c-15 -10 -34 -15 -57 -15v0v0c-34 1 -59 11 -78 34zM288 400v0l160 -48l-32 -88l-64 8l16 -289h-288l16 289l-64 -8l-32 88l160 48
+c14 -27 31 -39 64 -40c33 0 50 13 64 40z" />
+    <glyph glyph-name="ion-tshirt" unicode="&#xf4f7;" 
+d="M448 352l-32 -88l-64 8l16 -288h-288l16 288l-64 -8l-32 88l160 48c14 -27 31 -39 64 -40c33 0 50 13 64 40z" />
+    <glyph glyph-name="ion-umbrella" unicode="&#xf2b7;" 
+d="M344 160v0v0v0zM104 160v0v0v0zM240 399c116 -8 208 -109 208 -227v-12c-4 25 -26 52 -52 52c-29 0 -52 -23 -52 -52v0c0 29 -23 52 -52 52s-49 -12 -52 -45v-135c0 -17 -6 -33 -18 -45s-29 -19 -46 -19c-35 0 -63 29 -63 64c0 9 7 16 16 16s16 -7 16 -16
+c0 -18 14 -32 31 -32c18 0 32 14 32 32v134c-1 24 -26 46 -52 46c-29 0 -52 -23 -52 -52v0c0 29 -23 52 -52 52c-27 0 -49 -26 -52 -52v18c0 118 92 213 208 221v1c0 9 7 16 16 16s16 -7 16 -16v-1z" />
+    <glyph glyph-name="ion-university" unicode="&#xf357;" 
+d="M224 384l224 -111l-92 -60l-132 -85l-160 102v-198l-32 16v203l-32 21zM358 192l10 -82c-16 -12 -112 -78 -144 -110c-32 32 -128 98 -144 110l9 82l135 -88z" />
+    <glyph glyph-name="ion-unlocked" unicode="&#xf254;" horiz-adv-x="384" 
+d="M22 -32c-12 0 -22 10 -22 22v212c0 12 10 22 22 22h3h19v31c0 42 17 87 43 115s64 46 105 46v0v0c41 0 79 -18 105 -46c20 -21 33 -51 39 -82h-53c-5 18 -13 35 -24 47v0v1c-18 19 -42 29 -67 29v0v0c-25 0 -49 -10 -67 -29v-1v0c-18 -19 -28 -53 -28 -80v-31h265
+c12 0 22 -10 22 -22v-212c0 -12 -10 -22 -22 -22h-340z" />
+    <glyph glyph-name="ion-upload" unicode="&#xf255;" 
+d="M366 215c45 0 82 -37 82 -83s-37 -84 -82 -84h-110v80h48l-80 84l-80 -84h48v-80h-102c-49 0 -90 41 -90 91c0 40 26 74 61 86c5 29 29 51 59 51c10 0 18 -3 26 -7c19 40 59 67 105 67c64 0 115 -53 115 -118v-3z" />
+    <glyph glyph-name="ion-usb" unicode="&#xf2b8;" horiz-adv-x="256" 
+d="M16 228v0v0zM256 320c0 -11 -6 -21 -14 -27v0c-2 -1 -3 -5 -3 -7c-1 -20 -3 -36 -9 -50c-7 -19 -20 -33 -39 -46c-17 -12 -29 -21 -36 -34c-7 -12 -11 -28 -11 -53v-24c0 -7 2 -13 10 -18c4 -2 7 -6 10 -9c8 -9 14 -21 14 -34c0 -28 -22 -50 -50 -50s-50 22 -50 50v1v0
+c0 18 10 33 24 42c5 4 9 5 9 18v0c0 14 -3 17 -10 27s-18 17 -32 26c-19 13 -33 27 -40 46c-6 15 -8 31 -9 39s-2 9 -4 11c-10 6 -16 16 -16 28c0 18 14 32 32 32s32 -14 32 -32c0 -10 -4 -20 -12 -26c-3 -2 -4 -11 -4 -14v0v0c0 -9 3 -18 7 -28c10 -21 45 -44 52 -44
+s8 5 8 12v196s-1 2 -3 4h-1v1v0c-9 6 -15 16 -15 27c0 18 14 32 32 32s32 -14 32 -32c0 -11 -5 -21 -14 -27v0c-2 -2 -2 -3 -2 -5v-140c0 -10 2 -12 8 -11c13 3 48 30 52 43c3 10 6 23 7 41v1c0 2 -2 4 -3 6c-10 6 -16 16 -16 28c0 18 14 32 32 32s32 -14 32 -32zM32 240
+c9 0 16 7 16 16s-7 16 -16 16s-16 -7 -16 -16s7 -16 16 -16zM128 368c9 0 16 7 16 16s-7 16 -16 16s-16 -7 -16 -16s7 -16 16 -16zM224 304c9 0 16 7 16 16s-7 16 -16 16s-16 -7 -16 -16s7 -16 16 -16z" />
+    <glyph glyph-name="ion-videocamera" unicode="&#xf256;" 
+d="M335 263v-66l113 35v-89v-88l-113 35v-65c0 -5 -4 -9 -9 -9h-317c-5 0 -9 4 -9 9v12v55v171c0 5 4 9 9 9h208v38c0 4 -6 10 -10 10h-176v48h178c36 0 65 -29 65 -64v-32h52c5 0 9 -4 9 -9zM226 107c20 0 36 16 36 36s-16 35 -36 35s-36 -15 -36 -35c0 -10 4 -19 11 -26
+h-68c7 7 11 16 11 26c0 20 -16 36 -36 36s-36 -16 -36 -36s16 -36 36 -36h12h95h11z" />
+    <glyph glyph-name="ion-volume-high" unicode="&#xf257;" 
+d="M199 40l-95 88h-104v128h104l95 88v-304zM255 92l-20 16c17 24 27 52 27 84s-10 60 -27 84l20 16c20 -28 33 -63 33 -100s-13 -72 -33 -100zM322 46l-21 16c27 36 43 81 43 130s-16 94 -43 130l21 16c30 -41 48 -91 48 -146s-18 -105 -48 -146zM365 369l20 15
+c39 -54 63 -120 63 -192s-24 -138 -63 -192l-20 15c36 49 58 111 58 177s-22 128 -58 177z" />
+    <glyph glyph-name="ion-volume-low" unicode="&#xf258;" horiz-adv-x="288" 
+d="M199 40l-95 88h-104v128h104l95 88v-304zM255 92l-20 16c17 24 28 52 28 84s-11 60 -28 84l20 16c20 -28 33 -63 33 -100s-13 -72 -33 -100z" />
+    <glyph glyph-name="ion-volume-medium" unicode="&#xf259;" horiz-adv-x="370" 
+d="M199 40l-95 88h-104v128h104l95 88v-304zM255 92l-20 16c17 24 28 52 28 84s-11 60 -28 84l20 16c20 -28 33 -63 33 -100s-13 -72 -33 -100zM322 46l-21 16c27 36 43 81 43 130s-16 94 -43 130l21 16c30 -41 48 -91 48 -146s-18 -105 -48 -146z" />
+    <glyph glyph-name="ion-volume-mute" unicode="&#xf25a;" 
+d="M224 231l47 51v-180l-47 51h-65v78h65zM332 388c69 -38 116 -112 116 -196c0 -124 -100 -224 -224 -224c-39 0 -76 10 -108 27l-1 1c-69 38 -115 112 -115 196c0 124 100 224 224 224c39 0 75 -10 107 -28h1zM362 93c20 28 33 62 33 99c0 66 -38 123 -92 151
+c-6 3 -11 6 -17 8c-19 7 -40 11 -62 11c-37 0 -71 -12 -99 -32l73 -74h-76l-36 35c-20 -28 -32 -62 -32 -99c0 -65 36 -121 90 -150c6 -3 13 -7 19 -9c19 -7 39 -11 61 -11c37 0 72 12 100 32l-20 20v77z" />
+    <glyph glyph-name="ion-wand" unicode="&#xf358;" 
+d="M192 208l48 48l48 -48l-48 -48zM0 16l176 176l48 -48l-176 -176zM224 352v64h32v-64h-32zM398 344l-45 -45l-23 22l46 45zM127 299l-45 45l22 22l45 -45zM376 50l-46 45l23 23l45 -46zM384 192v32h64v-32h-64z" />
+    <glyph glyph-name="ion-waterdrop" unicode="&#xf25b;" horiz-adv-x="320" 
+d="M175 409c40 -41 145 -160 145 -288c0 -85 -72 -153 -160 -153c-56 0 -106 27 -134 69c-6 9 -11 19 -15 29c-7 17 -11 35 -11 55v4c1 67 31 131 64 183c20 31 42 57 59 77c9 10 16 18 22 24l1 1v0c4 3 8 6 14 6c5 0 10 -3 14 -6v0zM160 24c55 0 100 45 100 100
+c0 14 -3 28 -8 40c-17 -65 -70 -116 -136 -130c13 -6 28 -10 44 -10z" />
+    <glyph glyph-name="ion-wifi" unicode="&#xf25c;" 
+d="M224 352c80 0 156 -30 214 -84l10 -10l-10 -9l-32 -32l-10 -10l-9 9c-44 41 -103 64 -163 64s-119 -23 -163 -64l-9 -9l-10 10l-32 32l-10 9l10 10c58 54 134 84 214 84v0zM365 192l11 -10l-10 -10l-33 -32l-9 -9l-10 8c-25 22 -57 35 -90 35s-65 -13 -90 -35l-10 -8
+l-9 9l-33 32l-10 10l11 10c37 33 83 52 132 54v0h9v0v0c52 0 102 -19 141 -54zM224 32l-10 10l-52 52l-11 10l12 10c17 11 32 20 61 20s47 -9 62 -20l11 -10l-10 -10l-53 -52z" />
+    <glyph glyph-name="ion-wineglass" unicode="&#xf2b9;" horiz-adv-x="256" 
+d="M167 153c-11 -4 -24 -8 -24 -32v-94c0 -11 4 -19 12 -25c3 -2 7 -4 15 -6c32 -9 48 -16 50 -18c2 -1 4 -3 4 -7c0 0 -14 -3 -96 -3s-96 3 -96 3c0 4 2 6 4 7c2 2 18 9 50 18c8 2 11 4 14 6c8 6 11 14 11 25v94c0 24 -11 28 -22 32s-18 6 -26 11c-12 7 -23 16 -32 26
+c-20 23 -31 52 -31 87c0 50 4 100 8 114s14 25 31 25h178c17 0 27 -11 31 -25s8 -65 8 -115c0 -35 -11 -63 -31 -86c-9 -10 -20 -19 -32 -26c-8 -5 -15 -7 -26 -11zM128 178c26 0 50 11 67 28l6 6c16 18 22 35 23 65s-2 83 -8 107h-177c-7 -35 -8 -80 -7 -108s7 -46 23 -64
+c2 -3 4 -6 7 -8c17 -16 41 -26 66 -26zM208 277c0 -10 -1 -20 -4 -29s-8 -18 -15 -25l-5 -5c-14 -14 -34 -23 -56 -23c-21 0 -41 8 -55 22l-6 6c-7 7 -12 16 -15 25s-3 15 -4 29c-1 9 0 34 1 53c1 10 2 19 3 22h153c1 -6 2 -14 2 -22c1 -21 1 -45 1 -53zM192 269v0v26
+c0 4 -4 8 -8 8s-8 -4 -8 -8v-26c0 -3 1 -6 3 -7c1 -1 3 -1 5 -1c4 0 8 3 8 8zM191 316c1 2 1 4 1 6s-2 4 -4 5s-4 1 -6 1s-4 -1 -5 -3s-1 -4 -1 -6s2 -4 4 -5s4 -1 6 -1s4 1 5 3z" />
+    <glyph glyph-name="ion-woman" unicode="&#xf25d;" horiz-adv-x="192" 
+d="M30 299c3 12 17 33 42 34h48c24 -1 38 -22 42 -34l29 -104c6 -23 -21 -32 -27 -10l-26 96h-9l46 -169h-43v-127c0 -23 -31 -23 -31 0v127h-10v-127c0 -23 -32 -23 -32 0v127h-42l45 169h-7l-27 -96c-7 -21 -33 -13 -27 10zM133 379c0 -21 -17 -37 -37 -37s-37 16 -37 37
+s17 37 37 37s37 -16 37 -37z" />
+    <glyph glyph-name="ion-wrench" unicode="&#xf2ba;" 
+d="M430 333c14 -14 19 -31 18 -44s-6 -39 -32 -65s-77 -42 -113 -24c-5 3 -13 5 -21 -3c-10 -9 -202 -215 -202 -215c-17 -19 -48 -18 -66 0s-19 49 0 66c0 0 207 194 215 202s5 16 3 22c-20 47 2 89 24 112c22 24 51 31 65 32c13 1 31 -5 44 -18l-57 -56l10 -56l55 -10z
+M59 5c6 6 6 17 0 23s-16 6 -22 0s-6 -17 0 -23s16 -6 22 0z" />
+    <glyph glyph-name="ion-xbox" unicode="&#xf30c;" 
+d="M95 200c-49 -72 -50 -139 -50 -143c-28 38 -45 84 -45 135c0 67 30 128 77 169l3 -1c51 -18 93 -68 93 -68s-38 -33 -78 -92zM448 192c0 -51 -17 -97 -45 -135c0 4 -1 71 -50 143c-40 59 -78 92 -78 92s42 50 93 68l3 1c47 -41 77 -102 77 -169zM169 367
+c-37 17 -65 12 -72 10c36 25 80 39 127 39s91 -14 127 -39c-7 2 -35 6 -72 -10c-29 -13 -55 -35 -55 -35s-26 22 -55 35zM327 155c40 -49 54 -85 62 -108l2 -5c-41 -46 -101 -74 -167 -74s-126 28 -167 74l1 5c8 23 23 59 63 108c46 57 103 94 103 94s57 -37 103 -94z" />
+  </font>
+</defs></svg>
diff --git a/docs/lib/ionicons/fonts/ionicons.ttf b/docs/lib/ionicons/fonts/ionicons.ttf
new file mode 100644
index 0000000..c4e4632
Binary files /dev/null and b/docs/lib/ionicons/fonts/ionicons.ttf differ
diff --git a/docs/lib/ionicons/fonts/ionicons.woff b/docs/lib/ionicons/fonts/ionicons.woff
new file mode 100644
index 0000000..5f3a14e
Binary files /dev/null and b/docs/lib/ionicons/fonts/ionicons.woff differ
diff --git a/docs/lib/jquery/jquery-migrate.min.js b/docs/lib/jquery/jquery-migrate.min.js
new file mode 100644
index 0000000..a2813c5
--- /dev/null
+++ b/docs/lib/jquery/jquery-migrate.min.js
@@ -0,0 +1,2 @@
+/*! jQuery Migrate v3.0.0 | (c) jQuery Foundation and other contributors | jquery.org/license */
+"undefined"==typeof jQuery.migrateMute&&(jQuery.migrateMute=!0),function(a,b){"use strict";function c(c){var d=b.console;e[c]||(e[c]=!0,a.migrateWarnings.push(c),d&&d.warn&&!a.migrateMute&&(d.warn("JQMIGRATE: "+c),a.migrateTrace&&d.trace&&d.trace()))}function d(a,b,d,e){Object.defineProperty(a,b,{configurable:!0,enumerable:!0,get:function(){return c(e),d}})}a.migrateVersion="3.0.0",function(){var c=b.console&&b.console.log&&function(){b.console.log.apply(b.console,arguments)},d=/^[12]\./;c&&(a&&!d.test(a.fn.jquery)||c("JQMIGRATE: jQuery 3.0.0+ REQUIRED"),a.migrateWarnings&&c("JQMIGRATE: Migrate plugin loaded multiple times"),c("JQMIGRATE: Migrate is installed"+(a.migrateMute?"":" with logging active")+", version "+a.migrateVersion))}();var e={};a.migrateWarnings=[],void 0===a.migrateTrace&&(a.migrateTrace=!0),a.migrateReset=function(){e={},a.migrateWarnings.length=0},"BackCompat"===document.compatMode&&c("jQuery is not compatible with Quirks Mode");var f=a.fn.init,g=a.isNumeric,h=a.find,i=/\[(\s*[-\w]+\s*)([~|^$*]?=)\s*([-\w#]*?#[-\w#]*)\s*\]/,j=/\[(\s*[-\w]+\s*)([~|^$*]?=)\s*([-\w#]*?#[-\w#]*)\s*\]/g;a.fn.init=function(a){var b=Array.prototype.slice.call(arguments);return"string"==typeof a&&"#"===a&&(c("jQuery( '#' ) is not a valid selector"),b[0]=[]),f.apply(this,b)},a.fn.init.prototype=a.fn,a.find=function(a){var b=Array.prototype.slice.call(arguments);if("string"==typeof a&&i.test(a))try{document.querySelector(a)}catch(d){a=a.replace(j,function(a,b,c,d){return"["+b+c+'"'+d+'"]'});try{document.querySelector(a),c("Attribute selector with '#' must be quoted: "+b[0]),b[0]=a}catch(e){c("Attribute selector with '#' was not fixed: "+b[0])}}return h.apply(this,b)};var k;for(k in h)Object.prototype.hasOwnProperty.call(h,k)&&(a.find[k]=h[k]);a.fn.size=function(){return c("jQuery.fn.size() is deprecated; use the .length property"),this.length},a.parseJSON=function(){return c("jQuery.parseJSON is deprecated; use JSON.parse"),JSON.parse.apply(null,arguments)},a.isNumeric=function(b){function d(b){var c=b&&b.toString();return!a.isArray(b)&&c-parseFloat(c)+1>=0}var e=g(b),f=d(b);return e!==f&&c("jQuery.isNumeric() should not be called on constructed objects"),f},d(a,"unique",a.uniqueSort,"jQuery.unique is deprecated, use jQuery.uniqueSort"),d(a.expr,"filters",a.expr.pseudos,"jQuery.expr.filters is now jQuery.expr.pseudos"),d(a.expr,":",a.expr.pseudos,'jQuery.expr[":"] is now jQuery.expr.pseudos');var l=a.ajax;a.ajax=function(){var a=l.apply(this,arguments);return a.promise&&(d(a,"success",a.done,"jQXHR.success is deprecated and removed"),d(a,"error",a.fail,"jQXHR.error is deprecated and removed"),d(a,"complete",a.always,"jQXHR.complete is deprecated and removed")),a};var m=a.fn.removeAttr,n=a.fn.toggleClass,o=/\S+/g;a.fn.removeAttr=function(b){var d=this;return a.each(b.match(o),function(b,e){a.expr.match.bool.test(e)&&(c("jQuery.fn.removeAttr no longer sets boolean properties: "+e),d.prop(e,!1))}),m.apply(this,arguments)},a.fn.toggleClass=function(b){return void 0!==b&&"boolean"!=typeof b?n.apply(this,arguments):(c("jQuery.fn.toggleClass( boolean ) is deprecated"),this.each(function(){var c=this.getAttribute&&this.getAttribute("class")||"";c&&a.data(this,"__className__",c),this.setAttribute&&this.setAttribute("class",c||b===!1?"":a.data(this,"__className__")||"")}))};var p=!1;a.swap&&a.each(["height","width","reliableMarginRight"],function(b,c){var d=a.cssHooks[c]&&a.cssHooks[c].get;d&&(a.cssHooks[c].get=function(){var a;return p=!0,a=d.apply(this,arguments),p=!1,a})}),a.swap=function(a,b,d,e){var f,g,h={};p||c("jQuery.swap() is undocumented and deprecated");for(g in b)h[g]=a.style[g],a.style[g]=b[g];f=d.apply(a,e||[]);for(g in b)a.style[g]=h[g];return f};var q=a.data;a.data=function(b,d,e){var f;return d&&d!==a.camelCase(d)&&(f=a.hasData(b)&&q.call(this,b),f&&d in f)?(c("jQuery.data() always sets/gets camelCased names: "+d),arguments.length>2&&(f[d]=e),f[d]):q.apply(this,arguments)};var r=a.Tween.prototype.run;a.Tween.prototype.run=function(b){a.easing[this.easing].length>1&&(c('easing function "jQuery.easing.'+this.easing.toString()+'" should use only first argument'),a.easing[this.easing]=a.easing[this.easing].bind(a.easing,b,this.options.duration*b,0,1,this.options.duration)),r.apply(this,arguments)};var s=a.fn.load,t=a.event.fix;a.event.props=[],a.event.fixHooks={},a.event.fix=function(b){var d,e=b.type,f=this.fixHooks[e],g=a.event.props;if(g.length)for(c("jQuery.event.props are deprecated and removed: "+g.join());g.length;)a.event.addProp(g.pop());if(f&&!f._migrated_&&(f._migrated_=!0,c("jQuery.event.fixHooks are deprecated and removed: "+e),(g=f.props)&&g.length))for(;g.length;)a.event.addProp(g.pop());return d=t.call(this,b),f&&f.filter?f.filter(d,b):d},a.each(["load","unload","error"],function(b,d){a.fn[d]=function(){var a=Array.prototype.slice.call(arguments,0);return"load"===d&&"string"==typeof a[0]?s.apply(this,a):(c("jQuery.fn."+d+"() is deprecated"),a.splice(0,0,d),arguments.length?this.on.apply(this,a):(this.triggerHandler.apply(this,a),this))}}),a(function(){a(document).triggerHandler("ready")}),a.event.special.ready={setup:function(){this===document&&c("'ready' event is deprecated")}},a.fn.extend({bind:function(a,b,d){return c("jQuery.fn.bind() is deprecated"),this.on(a,null,b,d)},unbind:function(a,b){return c("jQuery.fn.unbind() is deprecated"),this.off(a,null,b)},delegate:function(a,b,d,e){return c("jQuery.fn.delegate() is deprecated"),this.on(b,a,d,e)},undelegate:function(a,b,d){return c("jQuery.fn.undelegate() is deprecated"),1===arguments.length?this.off(a,"**"):this.off(b,a||"**",d)}});var u=a.fn.offset;a.fn.offset=function(){var b,d=this[0],e={top:0,left:0};return d&&d.nodeType?(b=(d.ownerDocument||document).documentElement,a.contains(b,d)?u.apply(this,arguments):(c("jQuery.fn.offset() requires an element connected to a document"),e)):(c("jQuery.fn.offset() requires a valid DOM element"),e)};var v=a.param;a.param=function(b,d){var e=a.ajaxSettings&&a.ajaxSettings.traditional;return void 0===d&&e&&(c("jQuery.param() no longer uses jQuery.ajaxSettings.traditional"),d=e),v.call(this,b,d)};var w=a.fn.andSelf||a.fn.addBack;a.fn.andSelf=function(){return c("jQuery.fn.andSelf() replaced by jQuery.fn.addBack()"),w.apply(this,arguments)};var x=a.Deferred,y=[["resolve","done",a.Callbacks("once memory"),a.Callbacks("once memory"),"resolved"],["reject","fail",a.Callbacks("once memory"),a.Callbacks("once memory"),"rejected"],["notify","progress",a.Callbacks("memory"),a.Callbacks("memory")]];a.Deferred=function(b){var d=x(),e=d.promise();return d.pipe=e.pipe=function(){var b=arguments;return c("deferred.pipe() is deprecated"),a.Deferred(function(c){a.each(y,function(f,g){var h=a.isFunction(b[f])&&b[f];d[g[1]](function(){var b=h&&h.apply(this,arguments);b&&a.isFunction(b.promise)?b.promise().done(c.resolve).fail(c.reject).progress(c.notify):c[g[0]+"With"](this===e?c.promise():this,h?[b]:arguments)})}),b=null}).promise()},b&&b.call(d,d),d}}(jQuery,window);
\ No newline at end of file
diff --git a/docs/lib/jquery/jquery.min.js b/docs/lib/jquery/jquery.min.js
new file mode 100644
index 0000000..644d35e
--- /dev/null
+++ b/docs/lib/jquery/jquery.min.js
@@ -0,0 +1,4 @@
+/*! jQuery v3.2.1 | (c) JS Foundation and other contributors | jquery.org/license */
+!function(a,b){"use strict";"object"==typeof module&&"object"==typeof module.exports?module.exports=a.document?b(a,!0):function(a){if(!a.document)throw new Error("jQuery requires a window with a document");return b(a)}:b(a)}("undefined"!=typeof window?window:this,function(a,b){"use strict";var c=[],d=a.document,e=Object.getPrototypeOf,f=c.slice,g=c.concat,h=c.push,i=c.indexOf,j={},k=j.toString,l=j.hasOwnProperty,m=l.toString,n=m.call(Object),o={};function p(a,b){b=b||d;var c=b.createElement("script");c.text=a,b.head.appendChild(c).parentNode.removeChild(c)}var q="3.2.1",r=function(a,b){return new r.fn.init(a,b)},s=/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,t=/^-ms-/,u=/-([a-z])/g,v=function(a,b){return b.toUpperCase()};r.fn=r.prototype={jquery:q,constructor:r,length:0,toArray:function(){return f.call(this)},get:function(a){return null==a?f.call(this):a<0?this[a+this.length]:this[a]},pushStack:function(a){var b=r.merge(this.constructor(),a);return b.prevObject=this,b},each:function(a){return r.each(this,a)},map:function(a){return this.pushStack(r.map(this,function(b,c){return a.call(b,c,b)}))},slice:function(){return this.pushStack(f.apply(this,arguments))},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},eq:function(a){var b=this.length,c=+a+(a<0?b:0);return this.pushStack(c>=0&&c<b?[this[c]]:[])},end:function(){return this.prevObject||this.constructor()},push:h,sort:c.sort,splice:c.splice},r.extend=r.fn.extend=function(){var a,b,c,d,e,f,g=arguments[0]||{},h=1,i=arguments.length,j=!1;for("boolean"==typeof g&&(j=g,g=arguments[h]||{},h++),"object"==typeof g||r.isFunction(g)||(g={}),h===i&&(g=this,h--);h<i;h++)if(null!=(a=arguments[h]))for(b in a)c=g[b],d=a[b],g!==d&&(j&&d&&(r.isPlainObject(d)||(e=Array.isArray(d)))?(e?(e=!1,f=c&&Array.isArray(c)?c:[]):f=c&&r.isPlainObject(c)?c:{},g[b]=r.extend(j,f,d)):void 0!==d&&(g[b]=d));return g},r.extend({expando:"jQuery"+(q+Math.random()).replace(/\D/g,""),isReady:!0,error:function(a){throw new Error(a)},noop:function(){},isFunction:function(a){return"function"===r.type(a)},isWindow:function(a){return null!=a&&a===a.window},isNumeric:function(a){var b=r.type(a);return("number"===b||"string"===b)&&!isNaN(a-parseFloat(a))},isPlainObject:function(a){var b,c;return!(!a||"[object Object]"!==k.call(a))&&(!(b=e(a))||(c=l.call(b,"constructor")&&b.constructor,"function"==typeof c&&m.call(c)===n))},isEmptyObject:function(a){var b;for(b in a)return!1;return!0},type:function(a){return null==a?a+"":"object"==typeof a||"function"==typeof a?j[k.call(a)]||"object":typeof a},globalEval:function(a){p(a)},camelCase:function(a){return a.replace(t,"ms-").replace(u,v)},each:function(a,b){var c,d=0;if(w(a)){for(c=a.length;d<c;d++)if(b.call(a[d],d,a[d])===!1)break}else for(d in a)if(b.call(a[d],d,a[d])===!1)break;return a},trim:function(a){return null==a?"":(a+"").replace(s,"")},makeArray:function(a,b){var c=b||[];return null!=a&&(w(Object(a))?r.merge(c,"string"==typeof a?[a]:a):h.call(c,a)),c},inArray:function(a,b,c){return null==b?-1:i.call(b,a,c)},merge:function(a,b){for(var c=+b.length,d=0,e=a.length;d<c;d++)a[e++]=b[d];return a.length=e,a},grep:function(a,b,c){for(var d,e=[],f=0,g=a.length,h=!c;f<g;f++)d=!b(a[f],f),d!==h&&e.push(a[f]);return e},map:function(a,b,c){var d,e,f=0,h=[];if(w(a))for(d=a.length;f<d;f++)e=b(a[f],f,c),null!=e&&h.push(e);else for(f in a)e=b(a[f],f,c),null!=e&&h.push(e);return g.apply([],h)},guid:1,proxy:function(a,b){var c,d,e;if("string"==typeof b&&(c=a[b],b=a,a=c),r.isFunction(a))return d=f.call(arguments,2),e=function(){return a.apply(b||this,d.concat(f.call(arguments)))},e.guid=a.guid=a.guid||r.guid++,e},now:Date.now,support:o}),"function"==typeof Symbol&&(r.fn[Symbol.iterator]=c[Symbol.iterator]),r.each("Boolean Number String Function Array Date RegExp Object Error Symbol".split(" "),function(a,b){j["[object "+b+"]"]=b.toLowerCase()});function w(a){var b=!!a&&"length"in a&&a.length,c=r.type(a);return"function"!==c&&!r.isWindow(a)&&("array"===c||0===b||"number"==typeof b&&b>0&&b-1 in a)}var x=function(a){var b,c,d,e,f,g,h,i,j,k,l,m,n,o,p,q,r,s,t,u="sizzle"+1*new Date,v=a.document,w=0,x=0,y=ha(),z=ha(),A=ha(),B=function(a,b){return a===b&&(l=!0),0},C={}.hasOwnProperty,D=[],E=D.pop,F=D.push,G=D.push,H=D.slice,I=function(a,b){for(var c=0,d=a.length;c<d;c++)if(a[c]===b)return c;return-1},J="checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",K="[\\x20\\t\\r\\n\\f]",L="(?:\\\\.|[\\w-]|[^\0-\\xa0])+",M="\\["+K+"*("+L+")(?:"+K+"*([*^$|!~]?=)"+K+"*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|("+L+"))|)"+K+"*\\]",N=":("+L+")(?:\\((('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|((?:\\\\.|[^\\\\()[\\]]|"+M+")*)|.*)\\)|)",O=new RegExp(K+"+","g"),P=new RegExp("^"+K+"+|((?:^|[^\\\\])(?:\\\\.)*)"+K+"+$","g"),Q=new RegExp("^"+K+"*,"+K+"*"),R=new RegExp("^"+K+"*([>+~]|"+K+")"+K+"*"),S=new RegExp("="+K+"*([^\\]'\"]*?)"+K+"*\\]","g"),T=new RegExp(N),U=new RegExp("^"+L+"$"),V={ID:new RegExp("^#("+L+")"),CLASS:new RegExp("^\\.("+L+")"),TAG:new RegExp("^("+L+"|[*])"),ATTR:new RegExp("^"+M),PSEUDO:new RegExp("^"+N),CHILD:new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+K+"*(even|odd|(([+-]|)(\\d*)n|)"+K+"*(?:([+-]|)"+K+"*(\\d+)|))"+K+"*\\)|)","i"),bool:new RegExp("^(?:"+J+")$","i"),needsContext:new RegExp("^"+K+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+K+"*((?:-\\d)?\\d*)"+K+"*\\)|)(?=[^-]|$)","i")},W=/^(?:input|select|textarea|button)$/i,X=/^h\d$/i,Y=/^[^{]+\{\s*\[native \w/,Z=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,$=/[+~]/,_=new RegExp("\\\\([\\da-f]{1,6}"+K+"?|("+K+")|.)","ig"),aa=function(a,b,c){var d="0x"+b-65536;return d!==d||c?b:d<0?String.fromCharCode(d+65536):String.fromCharCode(d>>10|55296,1023&d|56320)},ba=/([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g,ca=function(a,b){return b?"\0"===a?"\ufffd":a.slice(0,-1)+"\\"+a.charCodeAt(a.length-1).toString(16)+" ":"\\"+a},da=function(){m()},ea=ta(function(a){return a.disabled===!0&&("form"in a||"label"in a)},{dir:"parentNode",next:"legend"});try{G.apply(D=H.call(v.childNodes),v.childNodes),D[v.childNodes.length].nodeType}catch(fa){G={apply:D.length?function(a,b){F.apply(a,H.call(b))}:function(a,b){var c=a.length,d=0;while(a[c++]=b[d++]);a.length=c-1}}}function ga(a,b,d,e){var f,h,j,k,l,o,r,s=b&&b.ownerDocument,w=b?b.nodeType:9;if(d=d||[],"string"!=typeof a||!a||1!==w&&9!==w&&11!==w)return d;if(!e&&((b?b.ownerDocument||b:v)!==n&&m(b),b=b||n,p)){if(11!==w&&(l=Z.exec(a)))if(f=l[1]){if(9===w){if(!(j=b.getElementById(f)))return d;if(j.id===f)return d.push(j),d}else if(s&&(j=s.getElementById(f))&&t(b,j)&&j.id===f)return d.push(j),d}else{if(l[2])return G.apply(d,b.getElementsByTagName(a)),d;if((f=l[3])&&c.getElementsByClassName&&b.getElementsByClassName)return G.apply(d,b.getElementsByClassName(f)),d}if(c.qsa&&!A[a+" "]&&(!q||!q.test(a))){if(1!==w)s=b,r=a;else if("object"!==b.nodeName.toLowerCase()){(k=b.getAttribute("id"))?k=k.replace(ba,ca):b.setAttribute("id",k=u),o=g(a),h=o.length;while(h--)o[h]="#"+k+" "+sa(o[h]);r=o.join(","),s=$.test(a)&&qa(b.parentNode)||b}if(r)try{return G.apply(d,s.querySelectorAll(r)),d}catch(x){}finally{k===u&&b.removeAttribute("id")}}}return i(a.replace(P,"$1"),b,d,e)}function ha(){var a=[];function b(c,e){return a.push(c+" ")>d.cacheLength&&delete b[a.shift()],b[c+" "]=e}return b}function ia(a){return a[u]=!0,a}function ja(a){var b=n.createElement("fieldset");try{return!!a(b)}catch(c){return!1}finally{b.parentNode&&b.parentNode.removeChild(b),b=null}}function ka(a,b){var c=a.split("|"),e=c.length;while(e--)d.attrHandle[c[e]]=b}function la(a,b){var c=b&&a,d=c&&1===a.nodeType&&1===b.nodeType&&a.sourceIndex-b.sourceIndex;if(d)return d;if(c)while(c=c.nextSibling)if(c===b)return-1;return a?1:-1}function ma(a){return function(b){var c=b.nodeName.toLowerCase();return"input"===c&&b.type===a}}function na(a){return function(b){var c=b.nodeName.toLowerCase();return("input"===c||"button"===c)&&b.type===a}}function oa(a){return function(b){return"form"in b?b.parentNode&&b.disabled===!1?"label"in b?"label"in b.parentNode?b.parentNode.disabled===a:b.disabled===a:b.isDisabled===a||b.isDisabled!==!a&&ea(b)===a:b.disabled===a:"label"in b&&b.disabled===a}}function pa(a){return ia(function(b){return b=+b,ia(function(c,d){var e,f=a([],c.length,b),g=f.length;while(g--)c[e=f[g]]&&(c[e]=!(d[e]=c[e]))})})}function qa(a){return a&&"undefined"!=typeof a.getElementsByTagName&&a}c=ga.support={},f=ga.isXML=function(a){var b=a&&(a.ownerDocument||a).documentElement;return!!b&&"HTML"!==b.nodeName},m=ga.setDocument=function(a){var b,e,g=a?a.ownerDocument||a:v;return g!==n&&9===g.nodeType&&g.documentElement?(n=g,o=n.documentElement,p=!f(n),v!==n&&(e=n.defaultView)&&e.top!==e&&(e.addEventListener?e.addEventListener("unload",da,!1):e.attachEvent&&e.attachEvent("onunload",da)),c.attributes=ja(function(a){return a.className="i",!a.getAttribute("className")}),c.getElementsByTagName=ja(function(a){return a.appendChild(n.createComment("")),!a.getElementsByTagName("*").length}),c.getElementsByClassName=Y.test(n.getElementsByClassName),c.getById=ja(function(a){return o.appendChild(a).id=u,!n.getElementsByName||!n.getElementsByName(u).length}),c.getById?(d.filter.ID=function(a){var b=a.replace(_,aa);return function(a){return a.getAttribute("id")===b}},d.find.ID=function(a,b){if("undefined"!=typeof b.getElementById&&p){var c=b.getElementById(a);return c?[c]:[]}}):(d.filter.ID=function(a){var b=a.replace(_,aa);return function(a){var c="undefined"!=typeof a.getAttributeNode&&a.getAttributeNode("id");return c&&c.value===b}},d.find.ID=function(a,b){if("undefined"!=typeof b.getElementById&&p){var c,d,e,f=b.getElementById(a);if(f){if(c=f.getAttributeNode("id"),c&&c.value===a)return[f];e=b.getElementsByName(a),d=0;while(f=e[d++])if(c=f.getAttributeNode("id"),c&&c.value===a)return[f]}return[]}}),d.find.TAG=c.getElementsByTagName?function(a,b){return"undefined"!=typeof b.getElementsByTagName?b.getElementsByTagName(a):c.qsa?b.querySelectorAll(a):void 0}:function(a,b){var c,d=[],e=0,f=b.getElementsByTagName(a);if("*"===a){while(c=f[e++])1===c.nodeType&&d.push(c);return d}return f},d.find.CLASS=c.getElementsByClassName&&function(a,b){if("undefined"!=typeof b.getElementsByClassName&&p)return b.getElementsByClassName(a)},r=[],q=[],(c.qsa=Y.test(n.querySelectorAll))&&(ja(function(a){o.appendChild(a).innerHTML="<a id='"+u+"'></a><select id='"+u+"-\r\\' msallowcapture=''><option selected=''></option></select>",a.querySelectorAll("[msallowcapture^='']").length&&q.push("[*^$]="+K+"*(?:''|\"\")"),a.querySelectorAll("[selected]").length||q.push("\\["+K+"*(?:value|"+J+")"),a.querySelectorAll("[id~="+u+"-]").length||q.push("~="),a.querySelectorAll(":checked").length||q.push(":checked"),a.querySelectorAll("a#"+u+"+*").length||q.push(".#.+[+~]")}),ja(function(a){a.innerHTML="<a href='' disabled='disabled'></a><select disabled='disabled'><option/></select>";var b=n.createElement("input");b.setAttribute("type","hidden"),a.appendChild(b).setAttribute("name","D"),a.querySelectorAll("[name=d]").length&&q.push("name"+K+"*[*^$|!~]?="),2!==a.querySelectorAll(":enabled").length&&q.push(":enabled",":disabled"),o.appendChild(a).disabled=!0,2!==a.querySelectorAll(":disabled").length&&q.push(":enabled",":disabled"),a.querySelectorAll("*,:x"),q.push(",.*:")})),(c.matchesSelector=Y.test(s=o.matches||o.webkitMatchesSelector||o.mozMatchesSelector||o.oMatchesSelector||o.msMatchesSelector))&&ja(function(a){c.disconnectedMatch=s.call(a,"*"),s.call(a,"[s!='']:x"),r.push("!=",N)}),q=q.length&&new RegExp(q.join("|")),r=r.length&&new RegExp(r.join("|")),b=Y.test(o.compareDocumentPosition),t=b||Y.test(o.contains)?function(a,b){var c=9===a.nodeType?a.documentElement:a,d=b&&b.parentNode;return a===d||!(!d||1!==d.nodeType||!(c.contains?c.contains(d):a.compareDocumentPosition&&16&a.compareDocumentPosition(d)))}:function(a,b){if(b)while(b=b.parentNode)if(b===a)return!0;return!1},B=b?function(a,b){if(a===b)return l=!0,0;var d=!a.compareDocumentPosition-!b.compareDocumentPosition;return d?d:(d=(a.ownerDocument||a)===(b.ownerDocument||b)?a.compareDocumentPosition(b):1,1&d||!c.sortDetached&&b.compareDocumentPosition(a)===d?a===n||a.ownerDocument===v&&t(v,a)?-1:b===n||b.ownerDocument===v&&t(v,b)?1:k?I(k,a)-I(k,b):0:4&d?-1:1)}:function(a,b){if(a===b)return l=!0,0;var c,d=0,e=a.parentNode,f=b.parentNode,g=[a],h=[b];if(!e||!f)return a===n?-1:b===n?1:e?-1:f?1:k?I(k,a)-I(k,b):0;if(e===f)return la(a,b);c=a;while(c=c.parentNode)g.unshift(c);c=b;while(c=c.parentNode)h.unshift(c);while(g[d]===h[d])d++;return d?la(g[d],h[d]):g[d]===v?-1:h[d]===v?1:0},n):n},ga.matches=function(a,b){return ga(a,null,null,b)},ga.matchesSelector=function(a,b){if((a.ownerDocument||a)!==n&&m(a),b=b.replace(S,"='$1']"),c.matchesSelector&&p&&!A[b+" "]&&(!r||!r.test(b))&&(!q||!q.test(b)))try{var d=s.call(a,b);if(d||c.disconnectedMatch||a.document&&11!==a.document.nodeType)return d}catch(e){}return ga(b,n,null,[a]).length>0},ga.contains=function(a,b){return(a.ownerDocument||a)!==n&&m(a),t(a,b)},ga.attr=function(a,b){(a.ownerDocument||a)!==n&&m(a);var e=d.attrHandle[b.toLowerCase()],f=e&&C.call(d.attrHandle,b.toLowerCase())?e(a,b,!p):void 0;return void 0!==f?f:c.attributes||!p?a.getAttribute(b):(f=a.getAttributeNode(b))&&f.specified?f.value:null},ga.escape=function(a){return(a+"").replace(ba,ca)},ga.error=function(a){throw new Error("Syntax error, unrecognized expression: "+a)},ga.uniqueSort=function(a){var b,d=[],e=0,f=0;if(l=!c.detectDuplicates,k=!c.sortStable&&a.slice(0),a.sort(B),l){while(b=a[f++])b===a[f]&&(e=d.push(f));while(e--)a.splice(d[e],1)}return k=null,a},e=ga.getText=function(a){var b,c="",d=0,f=a.nodeType;if(f){if(1===f||9===f||11===f){if("string"==typeof a.textContent)return a.textContent;for(a=a.firstChild;a;a=a.nextSibling)c+=e(a)}else if(3===f||4===f)return a.nodeValue}else while(b=a[d++])c+=e(b);return c},d=ga.selectors={cacheLength:50,createPseudo:ia,match:V,attrHandle:{},find:{},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(a){return a[1]=a[1].replace(_,aa),a[3]=(a[3]||a[4]||a[5]||"").replace(_,aa),"~="===a[2]&&(a[3]=" "+a[3]+" "),a.slice(0,4)},CHILD:function(a){return a[1]=a[1].toLowerCase(),"nth"===a[1].slice(0,3)?(a[3]||ga.error(a[0]),a[4]=+(a[4]?a[5]+(a[6]||1):2*("even"===a[3]||"odd"===a[3])),a[5]=+(a[7]+a[8]||"odd"===a[3])):a[3]&&ga.error(a[0]),a},PSEUDO:function(a){var b,c=!a[6]&&a[2];return V.CHILD.test(a[0])?null:(a[3]?a[2]=a[4]||a[5]||"":c&&T.test(c)&&(b=g(c,!0))&&(b=c.indexOf(")",c.length-b)-c.length)&&(a[0]=a[0].slice(0,b),a[2]=c.slice(0,b)),a.slice(0,3))}},filter:{TAG:function(a){var b=a.replace(_,aa).toLowerCase();return"*"===a?function(){return!0}:function(a){return a.nodeName&&a.nodeName.toLowerCase()===b}},CLASS:function(a){var b=y[a+" "];return b||(b=new RegExp("(^|"+K+")"+a+"("+K+"|$)"))&&y(a,function(a){return b.test("string"==typeof a.className&&a.className||"undefined"!=typeof a.getAttribute&&a.getAttribute("class")||"")})},ATTR:function(a,b,c){return function(d){var e=ga.attr(d,a);return null==e?"!="===b:!b||(e+="","="===b?e===c:"!="===b?e!==c:"^="===b?c&&0===e.indexOf(c):"*="===b?c&&e.indexOf(c)>-1:"$="===b?c&&e.slice(-c.length)===c:"~="===b?(" "+e.replace(O," ")+" ").indexOf(c)>-1:"|="===b&&(e===c||e.slice(0,c.length+1)===c+"-"))}},CHILD:function(a,b,c,d,e){var f="nth"!==a.slice(0,3),g="last"!==a.slice(-4),h="of-type"===b;return 1===d&&0===e?function(a){return!!a.parentNode}:function(b,c,i){var j,k,l,m,n,o,p=f!==g?"nextSibling":"previousSibling",q=b.parentNode,r=h&&b.nodeName.toLowerCase(),s=!i&&!h,t=!1;if(q){if(f){while(p){m=b;while(m=m[p])if(h?m.nodeName.toLowerCase()===r:1===m.nodeType)return!1;o=p="only"===a&&!o&&"nextSibling"}return!0}if(o=[g?q.firstChild:q.lastChild],g&&s){m=q,l=m[u]||(m[u]={}),k=l[m.uniqueID]||(l[m.uniqueID]={}),j=k[a]||[],n=j[0]===w&&j[1],t=n&&j[2],m=n&&q.childNodes[n];while(m=++n&&m&&m[p]||(t=n=0)||o.pop())if(1===m.nodeType&&++t&&m===b){k[a]=[w,n,t];break}}else if(s&&(m=b,l=m[u]||(m[u]={}),k=l[m.uniqueID]||(l[m.uniqueID]={}),j=k[a]||[],n=j[0]===w&&j[1],t=n),t===!1)while(m=++n&&m&&m[p]||(t=n=0)||o.pop())if((h?m.nodeName.toLowerCase()===r:1===m.nodeType)&&++t&&(s&&(l=m[u]||(m[u]={}),k=l[m.uniqueID]||(l[m.uniqueID]={}),k[a]=[w,t]),m===b))break;return t-=e,t===d||t%d===0&&t/d>=0}}},PSEUDO:function(a,b){var c,e=d.pseudos[a]||d.setFilters[a.toLowerCase()]||ga.error("unsupported pseudo: "+a);return e[u]?e(b):e.length>1?(c=[a,a,"",b],d.setFilters.hasOwnProperty(a.toLowerCase())?ia(function(a,c){var d,f=e(a,b),g=f.length;while(g--)d=I(a,f[g]),a[d]=!(c[d]=f[g])}):function(a){return e(a,0,c)}):e}},pseudos:{not:ia(function(a){var b=[],c=[],d=h(a.replace(P,"$1"));return d[u]?ia(function(a,b,c,e){var f,g=d(a,null,e,[]),h=a.length;while(h--)(f=g[h])&&(a[h]=!(b[h]=f))}):function(a,e,f){return b[0]=a,d(b,null,f,c),b[0]=null,!c.pop()}}),has:ia(function(a){return function(b){return ga(a,b).length>0}}),contains:ia(function(a){return a=a.replace(_,aa),function(b){return(b.textContent||b.innerText||e(b)).indexOf(a)>-1}}),lang:ia(function(a){return U.test(a||"")||ga.error("unsupported lang: "+a),a=a.replace(_,aa).toLowerCase(),function(b){var c;do if(c=p?b.lang:b.getAttribute("xml:lang")||b.getAttribute("lang"))return c=c.toLowerCase(),c===a||0===c.indexOf(a+"-");while((b=b.parentNode)&&1===b.nodeType);return!1}}),target:function(b){var c=a.location&&a.location.hash;return c&&c.slice(1)===b.id},root:function(a){return a===o},focus:function(a){return a===n.activeElement&&(!n.hasFocus||n.hasFocus())&&!!(a.type||a.href||~a.tabIndex)},enabled:oa(!1),disabled:oa(!0),checked:function(a){var b=a.nodeName.toLowerCase();return"input"===b&&!!a.checked||"option"===b&&!!a.selected},selected:function(a){return a.parentNode&&a.parentNode.selectedIndex,a.selected===!0},empty:function(a){for(a=a.firstChild;a;a=a.nextSibling)if(a.nodeType<6)return!1;return!0},parent:function(a){return!d.pseudos.empty(a)},header:function(a){return X.test(a.nodeName)},input:function(a){return W.test(a.nodeName)},button:function(a){var b=a.nodeName.toLowerCase();return"input"===b&&"button"===a.type||"button"===b},text:function(a){var b;return"input"===a.nodeName.toLowerCase()&&"text"===a.type&&(null==(b=a.getAttribute("type"))||"text"===b.toLowerCase())},first:pa(function(){return[0]}),last:pa(function(a,b){return[b-1]}),eq:pa(function(a,b,c){return[c<0?c+b:c]}),even:pa(function(a,b){for(var c=0;c<b;c+=2)a.push(c);return a}),odd:pa(function(a,b){for(var c=1;c<b;c+=2)a.push(c);return a}),lt:pa(function(a,b,c){for(var d=c<0?c+b:c;--d>=0;)a.push(d);return a}),gt:pa(function(a,b,c){for(var d=c<0?c+b:c;++d<b;)a.push(d);return a})}},d.pseudos.nth=d.pseudos.eq;for(b in{radio:!0,checkbox:!0,file:!0,password:!0,image:!0})d.pseudos[b]=ma(b);for(b in{submit:!0,reset:!0})d.pseudos[b]=na(b);function ra(){}ra.prototype=d.filters=d.pseudos,d.setFilters=new ra,g=ga.tokenize=function(a,b){var c,e,f,g,h,i,j,k=z[a+" "];if(k)return b?0:k.slice(0);h=a,i=[],j=d.preFilter;while(h){c&&!(e=Q.exec(h))||(e&&(h=h.slice(e[0].length)||h),i.push(f=[])),c=!1,(e=R.exec(h))&&(c=e.shift(),f.push({value:c,type:e[0].replace(P," ")}),h=h.slice(c.length));for(g in d.filter)!(e=V[g].exec(h))||j[g]&&!(e=j[g](e))||(c=e.shift(),f.push({value:c,type:g,matches:e}),h=h.slice(c.length));if(!c)break}return b?h.length:h?ga.error(a):z(a,i).slice(0)};function sa(a){for(var b=0,c=a.length,d="";b<c;b++)d+=a[b].value;return d}function ta(a,b,c){var d=b.dir,e=b.next,f=e||d,g=c&&"parentNode"===f,h=x++;return b.first?function(b,c,e){while(b=b[d])if(1===b.nodeType||g)return a(b,c,e);return!1}:function(b,c,i){var j,k,l,m=[w,h];if(i){while(b=b[d])if((1===b.nodeType||g)&&a(b,c,i))return!0}else while(b=b[d])if(1===b.nodeType||g)if(l=b[u]||(b[u]={}),k=l[b.uniqueID]||(l[b.uniqueID]={}),e&&e===b.nodeName.toLowerCase())b=b[d]||b;else{if((j=k[f])&&j[0]===w&&j[1]===h)return m[2]=j[2];if(k[f]=m,m[2]=a(b,c,i))return!0}return!1}}function ua(a){return a.length>1?function(b,c,d){var e=a.length;while(e--)if(!a[e](b,c,d))return!1;return!0}:a[0]}function va(a,b,c){for(var d=0,e=b.length;d<e;d++)ga(a,b[d],c);return c}function wa(a,b,c,d,e){for(var f,g=[],h=0,i=a.length,j=null!=b;h<i;h++)(f=a[h])&&(c&&!c(f,d,e)||(g.push(f),j&&b.push(h)));return g}function xa(a,b,c,d,e,f){return d&&!d[u]&&(d=xa(d)),e&&!e[u]&&(e=xa(e,f)),ia(function(f,g,h,i){var j,k,l,m=[],n=[],o=g.length,p=f||va(b||"*",h.nodeType?[h]:h,[]),q=!a||!f&&b?p:wa(p,m,a,h,i),r=c?e||(f?a:o||d)?[]:g:q;if(c&&c(q,r,h,i),d){j=wa(r,n),d(j,[],h,i),k=j.length;while(k--)(l=j[k])&&(r[n[k]]=!(q[n[k]]=l))}if(f){if(e||a){if(e){j=[],k=r.length;while(k--)(l=r[k])&&j.push(q[k]=l);e(null,r=[],j,i)}k=r.length;while(k--)(l=r[k])&&(j=e?I(f,l):m[k])>-1&&(f[j]=!(g[j]=l))}}else r=wa(r===g?r.splice(o,r.length):r),e?e(null,g,r,i):G.apply(g,r)})}function ya(a){for(var b,c,e,f=a.length,g=d.relative[a[0].type],h=g||d.relative[" "],i=g?1:0,k=ta(function(a){return a===b},h,!0),l=ta(function(a){return I(b,a)>-1},h,!0),m=[function(a,c,d){var e=!g&&(d||c!==j)||((b=c).nodeType?k(a,c,d):l(a,c,d));return b=null,e}];i<f;i++)if(c=d.relative[a[i].type])m=[ta(ua(m),c)];else{if(c=d.filter[a[i].type].apply(null,a[i].matches),c[u]){for(e=++i;e<f;e++)if(d.relative[a[e].type])break;return xa(i>1&&ua(m),i>1&&sa(a.slice(0,i-1).concat({value:" "===a[i-2].type?"*":""})).replace(P,"$1"),c,i<e&&ya(a.slice(i,e)),e<f&&ya(a=a.slice(e)),e<f&&sa(a))}m.push(c)}return ua(m)}function za(a,b){var c=b.length>0,e=a.length>0,f=function(f,g,h,i,k){var l,o,q,r=0,s="0",t=f&&[],u=[],v=j,x=f||e&&d.find.TAG("*",k),y=w+=null==v?1:Math.random()||.1,z=x.length;for(k&&(j=g===n||g||k);s!==z&&null!=(l=x[s]);s++){if(e&&l){o=0,g||l.ownerDocument===n||(m(l),h=!p);while(q=a[o++])if(q(l,g||n,h)){i.push(l);break}k&&(w=y)}c&&((l=!q&&l)&&r--,f&&t.push(l))}if(r+=s,c&&s!==r){o=0;while(q=b[o++])q(t,u,g,h);if(f){if(r>0)while(s--)t[s]||u[s]||(u[s]=E.call(i));u=wa(u)}G.apply(i,u),k&&!f&&u.length>0&&r+b.length>1&&ga.uniqueSort(i)}return k&&(w=y,j=v),t};return c?ia(f):f}return h=ga.compile=function(a,b){var c,d=[],e=[],f=A[a+" "];if(!f){b||(b=g(a)),c=b.length;while(c--)f=ya(b[c]),f[u]?d.push(f):e.push(f);f=A(a,za(e,d)),f.selector=a}return f},i=ga.select=function(a,b,c,e){var f,i,j,k,l,m="function"==typeof a&&a,n=!e&&g(a=m.selector||a);if(c=c||[],1===n.length){if(i=n[0]=n[0].slice(0),i.length>2&&"ID"===(j=i[0]).type&&9===b.nodeType&&p&&d.relative[i[1].type]){if(b=(d.find.ID(j.matches[0].replace(_,aa),b)||[])[0],!b)return c;m&&(b=b.parentNode),a=a.slice(i.shift().value.length)}f=V.needsContext.test(a)?0:i.length;while(f--){if(j=i[f],d.relative[k=j.type])break;if((l=d.find[k])&&(e=l(j.matches[0].replace(_,aa),$.test(i[0].type)&&qa(b.parentNode)||b))){if(i.splice(f,1),a=e.length&&sa(i),!a)return G.apply(c,e),c;break}}}return(m||h(a,n))(e,b,!p,c,!b||$.test(a)&&qa(b.parentNode)||b),c},c.sortStable=u.split("").sort(B).join("")===u,c.detectDuplicates=!!l,m(),c.sortDetached=ja(function(a){return 1&a.compareDocumentPosition(n.createElement("fieldset"))}),ja(function(a){return a.innerHTML="<a href='#'></a>","#"===a.firstChild.getAttribute("href")})||ka("type|href|height|width",function(a,b,c){if(!c)return a.getAttribute(b,"type"===b.toLowerCase()?1:2)}),c.attributes&&ja(function(a){return a.innerHTML="<input/>",a.firstChild.setAttribute("value",""),""===a.firstChild.getAttribute("value")})||ka("value",function(a,b,c){if(!c&&"input"===a.nodeName.toLowerCase())return a.defaultValue}),ja(function(a){return null==a.getAttribute("disabled")})||ka(J,function(a,b,c){var d;if(!c)return a[b]===!0?b.toLowerCase():(d=a.getAttributeNode(b))&&d.specified?d.value:null}),ga}(a);r.find=x,r.expr=x.selectors,r.expr[":"]=r.expr.pseudos,r.uniqueSort=r.unique=x.uniqueSort,r.text=x.getText,r.isXMLDoc=x.isXML,r.contains=x.contains,r.escapeSelector=x.escape;var y=function(a,b,c){var d=[],e=void 0!==c;while((a=a[b])&&9!==a.nodeType)if(1===a.nodeType){if(e&&r(a).is(c))break;d.push(a)}return d},z=function(a,b){for(var c=[];a;a=a.nextSibling)1===a.nodeType&&a!==b&&c.push(a);return c},A=r.expr.match.needsContext;function B(a,b){return a.nodeName&&a.nodeName.toLowerCase()===b.toLowerCase()}var C=/^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i,D=/^.[^:#\[\.,]*$/;function E(a,b,c){return r.isFunction(b)?r.grep(a,function(a,d){return!!b.call(a,d,a)!==c}):b.nodeType?r.grep(a,function(a){return a===b!==c}):"string"!=typeof b?r.grep(a,function(a){return i.call(b,a)>-1!==c}):D.test(b)?r.filter(b,a,c):(b=r.filter(b,a),r.grep(a,function(a){return i.call(b,a)>-1!==c&&1===a.nodeType}))}r.filter=function(a,b,c){var d=b[0];return c&&(a=":not("+a+")"),1===b.length&&1===d.nodeType?r.find.matchesSelector(d,a)?[d]:[]:r.find.matches(a,r.grep(b,function(a){return 1===a.nodeType}))},r.fn.extend({find:function(a){var b,c,d=this.length,e=this;if("string"!=typeof a)return this.pushStack(r(a).filter(function(){for(b=0;b<d;b++)if(r.contains(e[b],this))return!0}));for(c=this.pushStack([]),b=0;b<d;b++)r.find(a,e[b],c);return d>1?r.uniqueSort(c):c},filter:function(a){return this.pushStack(E(this,a||[],!1))},not:function(a){return this.pushStack(E(this,a||[],!0))},is:function(a){return!!E(this,"string"==typeof a&&A.test(a)?r(a):a||[],!1).length}});var F,G=/^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/,H=r.fn.init=function(a,b,c){var e,f;if(!a)return this;if(c=c||F,"string"==typeof a){if(e="<"===a[0]&&">"===a[a.length-1]&&a.length>=3?[null,a,null]:G.exec(a),!e||!e[1]&&b)return!b||b.jquery?(b||c).find(a):this.constructor(b).find(a);if(e[1]){if(b=b instanceof r?b[0]:b,r.merge(this,r.parseHTML(e[1],b&&b.nodeType?b.ownerDocument||b:d,!0)),C.test(e[1])&&r.isPlainObject(b))for(e in b)r.isFunction(this[e])?this[e](b[e]):this.attr(e,b[e]);return this}return f=d.getElementById(e[2]),f&&(this[0]=f,this.length=1),this}return a.nodeType?(this[0]=a,this.length=1,this):r.isFunction(a)?void 0!==c.ready?c.ready(a):a(r):r.makeArray(a,this)};H.prototype=r.fn,F=r(d);var I=/^(?:parents|prev(?:Until|All))/,J={children:!0,contents:!0,next:!0,prev:!0};r.fn.extend({has:function(a){var b=r(a,this),c=b.length;return this.filter(function(){for(var a=0;a<c;a++)if(r.contains(this,b[a]))return!0})},closest:function(a,b){var c,d=0,e=this.length,f=[],g="string"!=typeof a&&r(a);if(!A.test(a))for(;d<e;d++)for(c=this[d];c&&c!==b;c=c.parentNode)if(c.nodeType<11&&(g?g.index(c)>-1:1===c.nodeType&&r.find.matchesSelector(c,a))){f.push(c);break}return this.pushStack(f.length>1?r.uniqueSort(f):f)},index:function(a){return a?"string"==typeof a?i.call(r(a),this[0]):i.call(this,a.jquery?a[0]:a):this[0]&&this[0].parentNode?this.first().prevAll().length:-1},add:function(a,b){return this.pushStack(r.uniqueSort(r.merge(this.get(),r(a,b))))},addBack:function(a){return this.add(null==a?this.prevObject:this.prevObject.filter(a))}});function K(a,b){while((a=a[b])&&1!==a.nodeType);return a}r.each({parent:function(a){var b=a.parentNode;return b&&11!==b.nodeType?b:null},parents:function(a){return y(a,"parentNode")},parentsUntil:function(a,b,c){return y(a,"parentNode",c)},next:function(a){return K(a,"nextSibling")},prev:function(a){return K(a,"previousSibling")},nextAll:function(a){return y(a,"nextSibling")},prevAll:function(a){return y(a,"previousSibling")},nextUntil:function(a,b,c){return y(a,"nextSibling",c)},prevUntil:function(a,b,c){return y(a,"previousSibling",c)},siblings:function(a){return z((a.parentNode||{}).firstChild,a)},children:function(a){return z(a.firstChild)},contents:function(a){return B(a,"iframe")?a.contentDocument:(B(a,"template")&&(a=a.content||a),r.merge([],a.childNodes))}},function(a,b){r.fn[a]=function(c,d){var e=r.map(this,b,c);return"Until"!==a.slice(-5)&&(d=c),d&&"string"==typeof d&&(e=r.filter(d,e)),this.length>1&&(J[a]||r.uniqueSort(e),I.test(a)&&e.reverse()),this.pushStack(e)}});var L=/[^\x20\t\r\n\f]+/g;function M(a){var b={};return r.each(a.match(L)||[],function(a,c){b[c]=!0}),b}r.Callbacks=function(a){a="string"==typeof a?M(a):r.extend({},a);var b,c,d,e,f=[],g=[],h=-1,i=function(){for(e=e||a.once,d=b=!0;g.length;h=-1){c=g.shift();while(++h<f.length)f[h].apply(c[0],c[1])===!1&&a.stopOnFalse&&(h=f.length,c=!1)}a.memory||(c=!1),b=!1,e&&(f=c?[]:"")},j={add:function(){return f&&(c&&!b&&(h=f.length-1,g.push(c)),function d(b){r.each(b,function(b,c){r.isFunction(c)?a.unique&&j.has(c)||f.push(c):c&&c.length&&"string"!==r.type(c)&&d(c)})}(arguments),c&&!b&&i()),this},remove:function(){return r.each(arguments,function(a,b){var c;while((c=r.inArray(b,f,c))>-1)f.splice(c,1),c<=h&&h--}),this},has:function(a){return a?r.inArray(a,f)>-1:f.length>0},empty:function(){return f&&(f=[]),this},disable:function(){return e=g=[],f=c="",this},disabled:function(){return!f},lock:function(){return e=g=[],c||b||(f=c=""),this},locked:function(){return!!e},fireWith:function(a,c){return e||(c=c||[],c=[a,c.slice?c.slice():c],g.push(c),b||i()),this},fire:function(){return j.fireWith(this,arguments),this},fired:function(){return!!d}};return j};function N(a){return a}function O(a){throw a}function P(a,b,c,d){var e;try{a&&r.isFunction(e=a.promise)?e.call(a).done(b).fail(c):a&&r.isFunction(e=a.then)?e.call(a,b,c):b.apply(void 0,[a].slice(d))}catch(a){c.apply(void 0,[a])}}r.extend({Deferred:function(b){var c=[["notify","progress",r.Callbacks("memory"),r.Callbacks("memory"),2],["resolve","done",r.Callbacks("once memory"),r.Callbacks("once memory"),0,"resolved"],["reject","fail",r.Callbacks("once memory"),r.Callbacks("once memory"),1,"rejected"]],d="pending",e={state:function(){return d},always:function(){return f.done(arguments).fail(arguments),this},"catch":function(a){return e.then(null,a)},pipe:function(){var a=arguments;return r.Deferred(function(b){r.each(c,function(c,d){var e=r.isFunction(a[d[4]])&&a[d[4]];f[d[1]](function(){var a=e&&e.apply(this,arguments);a&&r.isFunction(a.promise)?a.promise().progress(b.notify).done(b.resolve).fail(b.reject):b[d[0]+"With"](this,e?[a]:arguments)})}),a=null}).promise()},then:function(b,d,e){var f=0;function g(b,c,d,e){return function(){var h=this,i=arguments,j=function(){var a,j;if(!(b<f)){if(a=d.apply(h,i),a===c.promise())throw new TypeError("Thenable self-resolution");j=a&&("object"==typeof a||"function"==typeof a)&&a.then,r.isFunction(j)?e?j.call(a,g(f,c,N,e),g(f,c,O,e)):(f++,j.call(a,g(f,c,N,e),g(f,c,O,e),g(f,c,N,c.notifyWith))):(d!==N&&(h=void 0,i=[a]),(e||c.resolveWith)(h,i))}},k=e?j:function(){try{j()}catch(a){r.Deferred.exceptionHook&&r.Deferred.exceptionHook(a,k.stackTrace),b+1>=f&&(d!==O&&(h=void 0,i=[a]),c.rejectWith(h,i))}};b?k():(r.Deferred.getStackHook&&(k.stackTrace=r.Deferred.getStackHook()),a.setTimeout(k))}}return r.Deferred(function(a){c[0][3].add(g(0,a,r.isFunction(e)?e:N,a.notifyWith)),c[1][3].add(g(0,a,r.isFunction(b)?b:N)),c[2][3].add(g(0,a,r.isFunction(d)?d:O))}).promise()},promise:function(a){return null!=a?r.extend(a,e):e}},f={};return r.each(c,function(a,b){var g=b[2],h=b[5];e[b[1]]=g.add,h&&g.add(function(){d=h},c[3-a][2].disable,c[0][2].lock),g.add(b[3].fire),f[b[0]]=function(){return f[b[0]+"With"](this===f?void 0:this,arguments),this},f[b[0]+"With"]=g.fireWith}),e.promise(f),b&&b.call(f,f),f},when:function(a){var b=arguments.length,c=b,d=Array(c),e=f.call(arguments),g=r.Deferred(),h=function(a){return function(c){d[a]=this,e[a]=arguments.length>1?f.call(arguments):c,--b||g.resolveWith(d,e)}};if(b<=1&&(P(a,g.done(h(c)).resolve,g.reject,!b),"pending"===g.state()||r.isFunction(e[c]&&e[c].then)))return g.then();while(c--)P(e[c],h(c),g.reject);return g.promise()}});var Q=/^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;r.Deferred.exceptionHook=function(b,c){a.console&&a.console.warn&&b&&Q.test(b.name)&&a.console.warn("jQuery.Deferred exception: "+b.message,b.stack,c)},r.readyException=function(b){a.setTimeout(function(){throw b})};var R=r.Deferred();r.fn.ready=function(a){return R.then(a)["catch"](function(a){r.readyException(a)}),this},r.extend({isReady:!1,readyWait:1,ready:function(a){(a===!0?--r.readyWait:r.isReady)||(r.isReady=!0,a!==!0&&--r.readyWait>0||R.resolveWith(d,[r]))}}),r.ready.then=R.then;function S(){d.removeEventListener("DOMContentLoaded",S),
+a.removeEventListener("load",S),r.ready()}"complete"===d.readyState||"loading"!==d.readyState&&!d.documentElement.doScroll?a.setTimeout(r.ready):(d.addEventListener("DOMContentLoaded",S),a.addEventListener("load",S));var T=function(a,b,c,d,e,f,g){var h=0,i=a.length,j=null==c;if("object"===r.type(c)){e=!0;for(h in c)T(a,b,h,c[h],!0,f,g)}else if(void 0!==d&&(e=!0,r.isFunction(d)||(g=!0),j&&(g?(b.call(a,d),b=null):(j=b,b=function(a,b,c){return j.call(r(a),c)})),b))for(;h<i;h++)b(a[h],c,g?d:d.call(a[h],h,b(a[h],c)));return e?a:j?b.call(a):i?b(a[0],c):f},U=function(a){return 1===a.nodeType||9===a.nodeType||!+a.nodeType};function V(){this.expando=r.expando+V.uid++}V.uid=1,V.prototype={cache:function(a){var b=a[this.expando];return b||(b={},U(a)&&(a.nodeType?a[this.expando]=b:Object.defineProperty(a,this.expando,{value:b,configurable:!0}))),b},set:function(a,b,c){var d,e=this.cache(a);if("string"==typeof b)e[r.camelCase(b)]=c;else for(d in b)e[r.camelCase(d)]=b[d];return e},get:function(a,b){return void 0===b?this.cache(a):a[this.expando]&&a[this.expando][r.camelCase(b)]},access:function(a,b,c){return void 0===b||b&&"string"==typeof b&&void 0===c?this.get(a,b):(this.set(a,b,c),void 0!==c?c:b)},remove:function(a,b){var c,d=a[this.expando];if(void 0!==d){if(void 0!==b){Array.isArray(b)?b=b.map(r.camelCase):(b=r.camelCase(b),b=b in d?[b]:b.match(L)||[]),c=b.length;while(c--)delete d[b[c]]}(void 0===b||r.isEmptyObject(d))&&(a.nodeType?a[this.expando]=void 0:delete a[this.expando])}},hasData:function(a){var b=a[this.expando];return void 0!==b&&!r.isEmptyObject(b)}};var W=new V,X=new V,Y=/^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,Z=/[A-Z]/g;function $(a){return"true"===a||"false"!==a&&("null"===a?null:a===+a+""?+a:Y.test(a)?JSON.parse(a):a)}function _(a,b,c){var d;if(void 0===c&&1===a.nodeType)if(d="data-"+b.replace(Z,"-$&").toLowerCase(),c=a.getAttribute(d),"string"==typeof c){try{c=$(c)}catch(e){}X.set(a,b,c)}else c=void 0;return c}r.extend({hasData:function(a){return X.hasData(a)||W.hasData(a)},data:function(a,b,c){return X.access(a,b,c)},removeData:function(a,b){X.remove(a,b)},_data:function(a,b,c){return W.access(a,b,c)},_removeData:function(a,b){W.remove(a,b)}}),r.fn.extend({data:function(a,b){var c,d,e,f=this[0],g=f&&f.attributes;if(void 0===a){if(this.length&&(e=X.get(f),1===f.nodeType&&!W.get(f,"hasDataAttrs"))){c=g.length;while(c--)g[c]&&(d=g[c].name,0===d.indexOf("data-")&&(d=r.camelCase(d.slice(5)),_(f,d,e[d])));W.set(f,"hasDataAttrs",!0)}return e}return"object"==typeof a?this.each(function(){X.set(this,a)}):T(this,function(b){var c;if(f&&void 0===b){if(c=X.get(f,a),void 0!==c)return c;if(c=_(f,a),void 0!==c)return c}else this.each(function(){X.set(this,a,b)})},null,b,arguments.length>1,null,!0)},removeData:function(a){return this.each(function(){X.remove(this,a)})}}),r.extend({queue:function(a,b,c){var d;if(a)return b=(b||"fx")+"queue",d=W.get(a,b),c&&(!d||Array.isArray(c)?d=W.access(a,b,r.makeArray(c)):d.push(c)),d||[]},dequeue:function(a,b){b=b||"fx";var c=r.queue(a,b),d=c.length,e=c.shift(),f=r._queueHooks(a,b),g=function(){r.dequeue(a,b)};"inprogress"===e&&(e=c.shift(),d--),e&&("fx"===b&&c.unshift("inprogress"),delete f.stop,e.call(a,g,f)),!d&&f&&f.empty.fire()},_queueHooks:function(a,b){var c=b+"queueHooks";return W.get(a,c)||W.access(a,c,{empty:r.Callbacks("once memory").add(function(){W.remove(a,[b+"queue",c])})})}}),r.fn.extend({queue:function(a,b){var c=2;return"string"!=typeof a&&(b=a,a="fx",c--),arguments.length<c?r.queue(this[0],a):void 0===b?this:this.each(function(){var c=r.queue(this,a,b);r._queueHooks(this,a),"fx"===a&&"inprogress"!==c[0]&&r.dequeue(this,a)})},dequeue:function(a){return this.each(function(){r.dequeue(this,a)})},clearQueue:function(a){return this.queue(a||"fx",[])},promise:function(a,b){var c,d=1,e=r.Deferred(),f=this,g=this.length,h=function(){--d||e.resolveWith(f,[f])};"string"!=typeof a&&(b=a,a=void 0),a=a||"fx";while(g--)c=W.get(f[g],a+"queueHooks"),c&&c.empty&&(d++,c.empty.add(h));return h(),e.promise(b)}});var aa=/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source,ba=new RegExp("^(?:([+-])=|)("+aa+")([a-z%]*)$","i"),ca=["Top","Right","Bottom","Left"],da=function(a,b){return a=b||a,"none"===a.style.display||""===a.style.display&&r.contains(a.ownerDocument,a)&&"none"===r.css(a,"display")},ea=function(a,b,c,d){var e,f,g={};for(f in b)g[f]=a.style[f],a.style[f]=b[f];e=c.apply(a,d||[]);for(f in b)a.style[f]=g[f];return e};function fa(a,b,c,d){var e,f=1,g=20,h=d?function(){return d.cur()}:function(){return r.css(a,b,"")},i=h(),j=c&&c[3]||(r.cssNumber[b]?"":"px"),k=(r.cssNumber[b]||"px"!==j&&+i)&&ba.exec(r.css(a,b));if(k&&k[3]!==j){j=j||k[3],c=c||[],k=+i||1;do f=f||".5",k/=f,r.style(a,b,k+j);while(f!==(f=h()/i)&&1!==f&&--g)}return c&&(k=+k||+i||0,e=c[1]?k+(c[1]+1)*c[2]:+c[2],d&&(d.unit=j,d.start=k,d.end=e)),e}var ga={};function ha(a){var b,c=a.ownerDocument,d=a.nodeName,e=ga[d];return e?e:(b=c.body.appendChild(c.createElement(d)),e=r.css(b,"display"),b.parentNode.removeChild(b),"none"===e&&(e="block"),ga[d]=e,e)}function ia(a,b){for(var c,d,e=[],f=0,g=a.length;f<g;f++)d=a[f],d.style&&(c=d.style.display,b?("none"===c&&(e[f]=W.get(d,"display")||null,e[f]||(d.style.display="")),""===d.style.display&&da(d)&&(e[f]=ha(d))):"none"!==c&&(e[f]="none",W.set(d,"display",c)));for(f=0;f<g;f++)null!=e[f]&&(a[f].style.display=e[f]);return a}r.fn.extend({show:function(){return ia(this,!0)},hide:function(){return ia(this)},toggle:function(a){return"boolean"==typeof a?a?this.show():this.hide():this.each(function(){da(this)?r(this).show():r(this).hide()})}});var ja=/^(?:checkbox|radio)$/i,ka=/<([a-z][^\/\0>\x20\t\r\n\f]+)/i,la=/^$|\/(?:java|ecma)script/i,ma={option:[1,"<select multiple='multiple'>","</select>"],thead:[1,"<table>","</table>"],col:[2,"<table><colgroup>","</colgroup></table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],_default:[0,"",""]};ma.optgroup=ma.option,ma.tbody=ma.tfoot=ma.colgroup=ma.caption=ma.thead,ma.th=ma.td;function na(a,b){var c;return c="undefined"!=typeof a.getElementsByTagName?a.getElementsByTagName(b||"*"):"undefined"!=typeof a.querySelectorAll?a.querySelectorAll(b||"*"):[],void 0===b||b&&B(a,b)?r.merge([a],c):c}function oa(a,b){for(var c=0,d=a.length;c<d;c++)W.set(a[c],"globalEval",!b||W.get(b[c],"globalEval"))}var pa=/<|&#?\w+;/;function qa(a,b,c,d,e){for(var f,g,h,i,j,k,l=b.createDocumentFragment(),m=[],n=0,o=a.length;n<o;n++)if(f=a[n],f||0===f)if("object"===r.type(f))r.merge(m,f.nodeType?[f]:f);else if(pa.test(f)){g=g||l.appendChild(b.createElement("div")),h=(ka.exec(f)||["",""])[1].toLowerCase(),i=ma[h]||ma._default,g.innerHTML=i[1]+r.htmlPrefilter(f)+i[2],k=i[0];while(k--)g=g.lastChild;r.merge(m,g.childNodes),g=l.firstChild,g.textContent=""}else m.push(b.createTextNode(f));l.textContent="",n=0;while(f=m[n++])if(d&&r.inArray(f,d)>-1)e&&e.push(f);else if(j=r.contains(f.ownerDocument,f),g=na(l.appendChild(f),"script"),j&&oa(g),c){k=0;while(f=g[k++])la.test(f.type||"")&&c.push(f)}return l}!function(){var a=d.createDocumentFragment(),b=a.appendChild(d.createElement("div")),c=d.createElement("input");c.setAttribute("type","radio"),c.setAttribute("checked","checked"),c.setAttribute("name","t"),b.appendChild(c),o.checkClone=b.cloneNode(!0).cloneNode(!0).lastChild.checked,b.innerHTML="<textarea>x</textarea>",o.noCloneChecked=!!b.cloneNode(!0).lastChild.defaultValue}();var ra=d.documentElement,sa=/^key/,ta=/^(?:mouse|pointer|contextmenu|drag|drop)|click/,ua=/^([^.]*)(?:\.(.+)|)/;function va(){return!0}function wa(){return!1}function xa(){try{return d.activeElement}catch(a){}}function ya(a,b,c,d,e,f){var g,h;if("object"==typeof b){"string"!=typeof c&&(d=d||c,c=void 0);for(h in b)ya(a,h,c,d,b[h],f);return a}if(null==d&&null==e?(e=c,d=c=void 0):null==e&&("string"==typeof c?(e=d,d=void 0):(e=d,d=c,c=void 0)),e===!1)e=wa;else if(!e)return a;return 1===f&&(g=e,e=function(a){return r().off(a),g.apply(this,arguments)},e.guid=g.guid||(g.guid=r.guid++)),a.each(function(){r.event.add(this,b,e,d,c)})}r.event={global:{},add:function(a,b,c,d,e){var f,g,h,i,j,k,l,m,n,o,p,q=W.get(a);if(q){c.handler&&(f=c,c=f.handler,e=f.selector),e&&r.find.matchesSelector(ra,e),c.guid||(c.guid=r.guid++),(i=q.events)||(i=q.events={}),(g=q.handle)||(g=q.handle=function(b){return"undefined"!=typeof r&&r.event.triggered!==b.type?r.event.dispatch.apply(a,arguments):void 0}),b=(b||"").match(L)||[""],j=b.length;while(j--)h=ua.exec(b[j])||[],n=p=h[1],o=(h[2]||"").split(".").sort(),n&&(l=r.event.special[n]||{},n=(e?l.delegateType:l.bindType)||n,l=r.event.special[n]||{},k=r.extend({type:n,origType:p,data:d,handler:c,guid:c.guid,selector:e,needsContext:e&&r.expr.match.needsContext.test(e),namespace:o.join(".")},f),(m=i[n])||(m=i[n]=[],m.delegateCount=0,l.setup&&l.setup.call(a,d,o,g)!==!1||a.addEventListener&&a.addEventListener(n,g)),l.add&&(l.add.call(a,k),k.handler.guid||(k.handler.guid=c.guid)),e?m.splice(m.delegateCount++,0,k):m.push(k),r.event.global[n]=!0)}},remove:function(a,b,c,d,e){var f,g,h,i,j,k,l,m,n,o,p,q=W.hasData(a)&&W.get(a);if(q&&(i=q.events)){b=(b||"").match(L)||[""],j=b.length;while(j--)if(h=ua.exec(b[j])||[],n=p=h[1],o=(h[2]||"").split(".").sort(),n){l=r.event.special[n]||{},n=(d?l.delegateType:l.bindType)||n,m=i[n]||[],h=h[2]&&new RegExp("(^|\\.)"+o.join("\\.(?:.*\\.|)")+"(\\.|$)"),g=f=m.length;while(f--)k=m[f],!e&&p!==k.origType||c&&c.guid!==k.guid||h&&!h.test(k.namespace)||d&&d!==k.selector&&("**"!==d||!k.selector)||(m.splice(f,1),k.selector&&m.delegateCount--,l.remove&&l.remove.call(a,k));g&&!m.length&&(l.teardown&&l.teardown.call(a,o,q.handle)!==!1||r.removeEvent(a,n,q.handle),delete i[n])}else for(n in i)r.event.remove(a,n+b[j],c,d,!0);r.isEmptyObject(i)&&W.remove(a,"handle events")}},dispatch:function(a){var b=r.event.fix(a),c,d,e,f,g,h,i=new Array(arguments.length),j=(W.get(this,"events")||{})[b.type]||[],k=r.event.special[b.type]||{};for(i[0]=b,c=1;c<arguments.length;c++)i[c]=arguments[c];if(b.delegateTarget=this,!k.preDispatch||k.preDispatch.call(this,b)!==!1){h=r.event.handlers.call(this,b,j),c=0;while((f=h[c++])&&!b.isPropagationStopped()){b.currentTarget=f.elem,d=0;while((g=f.handlers[d++])&&!b.isImmediatePropagationStopped())b.rnamespace&&!b.rnamespace.test(g.namespace)||(b.handleObj=g,b.data=g.data,e=((r.event.special[g.origType]||{}).handle||g.handler).apply(f.elem,i),void 0!==e&&(b.result=e)===!1&&(b.preventDefault(),b.stopPropagation()))}return k.postDispatch&&k.postDispatch.call(this,b),b.result}},handlers:function(a,b){var c,d,e,f,g,h=[],i=b.delegateCount,j=a.target;if(i&&j.nodeType&&!("click"===a.type&&a.button>=1))for(;j!==this;j=j.parentNode||this)if(1===j.nodeType&&("click"!==a.type||j.disabled!==!0)){for(f=[],g={},c=0;c<i;c++)d=b[c],e=d.selector+" ",void 0===g[e]&&(g[e]=d.needsContext?r(e,this).index(j)>-1:r.find(e,this,null,[j]).length),g[e]&&f.push(d);f.length&&h.push({elem:j,handlers:f})}return j=this,i<b.length&&h.push({elem:j,handlers:b.slice(i)}),h},addProp:function(a,b){Object.defineProperty(r.Event.prototype,a,{enumerable:!0,configurable:!0,get:r.isFunction(b)?function(){if(this.originalEvent)return b(this.originalEvent)}:function(){if(this.originalEvent)return this.originalEvent[a]},set:function(b){Object.defineProperty(this,a,{enumerable:!0,configurable:!0,writable:!0,value:b})}})},fix:function(a){return a[r.expando]?a:new r.Event(a)},special:{load:{noBubble:!0},focus:{trigger:function(){if(this!==xa()&&this.focus)return this.focus(),!1},delegateType:"focusin"},blur:{trigger:function(){if(this===xa()&&this.blur)return this.blur(),!1},delegateType:"focusout"},click:{trigger:function(){if("checkbox"===this.type&&this.click&&B(this,"input"))return this.click(),!1},_default:function(a){return B(a.target,"a")}},beforeunload:{postDispatch:function(a){void 0!==a.result&&a.originalEvent&&(a.originalEvent.returnValue=a.result)}}}},r.removeEvent=function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c)},r.Event=function(a,b){return this instanceof r.Event?(a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||void 0===a.defaultPrevented&&a.returnValue===!1?va:wa,this.target=a.target&&3===a.target.nodeType?a.target.parentNode:a.target,this.currentTarget=a.currentTarget,this.relatedTarget=a.relatedTarget):this.type=a,b&&r.extend(this,b),this.timeStamp=a&&a.timeStamp||r.now(),void(this[r.expando]=!0)):new r.Event(a,b)},r.Event.prototype={constructor:r.Event,isDefaultPrevented:wa,isPropagationStopped:wa,isImmediatePropagationStopped:wa,isSimulated:!1,preventDefault:function(){var a=this.originalEvent;this.isDefaultPrevented=va,a&&!this.isSimulated&&a.preventDefault()},stopPropagation:function(){var a=this.originalEvent;this.isPropagationStopped=va,a&&!this.isSimulated&&a.stopPropagation()},stopImmediatePropagation:function(){var a=this.originalEvent;this.isImmediatePropagationStopped=va,a&&!this.isSimulated&&a.stopImmediatePropagation(),this.stopPropagation()}},r.each({altKey:!0,bubbles:!0,cancelable:!0,changedTouches:!0,ctrlKey:!0,detail:!0,eventPhase:!0,metaKey:!0,pageX:!0,pageY:!0,shiftKey:!0,view:!0,"char":!0,charCode:!0,key:!0,keyCode:!0,button:!0,buttons:!0,clientX:!0,clientY:!0,offsetX:!0,offsetY:!0,pointerId:!0,pointerType:!0,screenX:!0,screenY:!0,targetTouches:!0,toElement:!0,touches:!0,which:function(a){var b=a.button;return null==a.which&&sa.test(a.type)?null!=a.charCode?a.charCode:a.keyCode:!a.which&&void 0!==b&&ta.test(a.type)?1&b?1:2&b?3:4&b?2:0:a.which}},r.event.addProp),r.each({mouseenter:"mouseover",mouseleave:"mouseout",pointerenter:"pointerover",pointerleave:"pointerout"},function(a,b){r.event.special[a]={delegateType:b,bindType:b,handle:function(a){var c,d=this,e=a.relatedTarget,f=a.handleObj;return e&&(e===d||r.contains(d,e))||(a.type=f.origType,c=f.handler.apply(this,arguments),a.type=b),c}}}),r.fn.extend({on:function(a,b,c,d){return ya(this,a,b,c,d)},one:function(a,b,c,d){return ya(this,a,b,c,d,1)},off:function(a,b,c){var d,e;if(a&&a.preventDefault&&a.handleObj)return d=a.handleObj,r(a.delegateTarget).off(d.namespace?d.origType+"."+d.namespace:d.origType,d.selector,d.handler),this;if("object"==typeof a){for(e in a)this.off(e,b,a[e]);return this}return b!==!1&&"function"!=typeof b||(c=b,b=void 0),c===!1&&(c=wa),this.each(function(){r.event.remove(this,a,c,b)})}});var za=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([a-z][^\/\0>\x20\t\r\n\f]*)[^>]*)\/>/gi,Aa=/<script|<style|<link/i,Ba=/checked\s*(?:[^=]|=\s*.checked.)/i,Ca=/^true\/(.*)/,Da=/^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g;function Ea(a,b){return B(a,"table")&&B(11!==b.nodeType?b:b.firstChild,"tr")?r(">tbody",a)[0]||a:a}function Fa(a){return a.type=(null!==a.getAttribute("type"))+"/"+a.type,a}function Ga(a){var b=Ca.exec(a.type);return b?a.type=b[1]:a.removeAttribute("type"),a}function Ha(a,b){var c,d,e,f,g,h,i,j;if(1===b.nodeType){if(W.hasData(a)&&(f=W.access(a),g=W.set(b,f),j=f.events)){delete g.handle,g.events={};for(e in j)for(c=0,d=j[e].length;c<d;c++)r.event.add(b,e,j[e][c])}X.hasData(a)&&(h=X.access(a),i=r.extend({},h),X.set(b,i))}}function Ia(a,b){var c=b.nodeName.toLowerCase();"input"===c&&ja.test(a.type)?b.checked=a.checked:"input"!==c&&"textarea"!==c||(b.defaultValue=a.defaultValue)}function Ja(a,b,c,d){b=g.apply([],b);var e,f,h,i,j,k,l=0,m=a.length,n=m-1,q=b[0],s=r.isFunction(q);if(s||m>1&&"string"==typeof q&&!o.checkClone&&Ba.test(q))return a.each(function(e){var f=a.eq(e);s&&(b[0]=q.call(this,e,f.html())),Ja(f,b,c,d)});if(m&&(e=qa(b,a[0].ownerDocument,!1,a,d),f=e.firstChild,1===e.childNodes.length&&(e=f),f||d)){for(h=r.map(na(e,"script"),Fa),i=h.length;l<m;l++)j=e,l!==n&&(j=r.clone(j,!0,!0),i&&r.merge(h,na(j,"script"))),c.call(a[l],j,l);if(i)for(k=h[h.length-1].ownerDocument,r.map(h,Ga),l=0;l<i;l++)j=h[l],la.test(j.type||"")&&!W.access(j,"globalEval")&&r.contains(k,j)&&(j.src?r._evalUrl&&r._evalUrl(j.src):p(j.textContent.replace(Da,""),k))}return a}function Ka(a,b,c){for(var d,e=b?r.filter(b,a):a,f=0;null!=(d=e[f]);f++)c||1!==d.nodeType||r.cleanData(na(d)),d.parentNode&&(c&&r.contains(d.ownerDocument,d)&&oa(na(d,"script")),d.parentNode.removeChild(d));return a}r.extend({htmlPrefilter:function(a){return a.replace(za,"<$1></$2>")},clone:function(a,b,c){var d,e,f,g,h=a.cloneNode(!0),i=r.contains(a.ownerDocument,a);if(!(o.noCloneChecked||1!==a.nodeType&&11!==a.nodeType||r.isXMLDoc(a)))for(g=na(h),f=na(a),d=0,e=f.length;d<e;d++)Ia(f[d],g[d]);if(b)if(c)for(f=f||na(a),g=g||na(h),d=0,e=f.length;d<e;d++)Ha(f[d],g[d]);else Ha(a,h);return g=na(h,"script"),g.length>0&&oa(g,!i&&na(a,"script")),h},cleanData:function(a){for(var b,c,d,e=r.event.special,f=0;void 0!==(c=a[f]);f++)if(U(c)){if(b=c[W.expando]){if(b.events)for(d in b.events)e[d]?r.event.remove(c,d):r.removeEvent(c,d,b.handle);c[W.expando]=void 0}c[X.expando]&&(c[X.expando]=void 0)}}}),r.fn.extend({detach:function(a){return Ka(this,a,!0)},remove:function(a){return Ka(this,a)},text:function(a){return T(this,function(a){return void 0===a?r.text(this):this.empty().each(function(){1!==this.nodeType&&11!==this.nodeType&&9!==this.nodeType||(this.textContent=a)})},null,a,arguments.length)},append:function(){return Ja(this,arguments,function(a){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var b=Ea(this,a);b.appendChild(a)}})},prepend:function(){return Ja(this,arguments,function(a){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var b=Ea(this,a);b.insertBefore(a,b.firstChild)}})},before:function(){return Ja(this,arguments,function(a){this.parentNode&&this.parentNode.insertBefore(a,this)})},after:function(){return Ja(this,arguments,function(a){this.parentNode&&this.parentNode.insertBefore(a,this.nextSibling)})},empty:function(){for(var a,b=0;null!=(a=this[b]);b++)1===a.nodeType&&(r.cleanData(na(a,!1)),a.textContent="");return this},clone:function(a,b){return a=null!=a&&a,b=null==b?a:b,this.map(function(){return r.clone(this,a,b)})},html:function(a){return T(this,function(a){var b=this[0]||{},c=0,d=this.length;if(void 0===a&&1===b.nodeType)return b.innerHTML;if("string"==typeof a&&!Aa.test(a)&&!ma[(ka.exec(a)||["",""])[1].toLowerCase()]){a=r.htmlPrefilter(a);try{for(;c<d;c++)b=this[c]||{},1===b.nodeType&&(r.cleanData(na(b,!1)),b.innerHTML=a);b=0}catch(e){}}b&&this.empty().append(a)},null,a,arguments.length)},replaceWith:function(){var a=[];return Ja(this,arguments,function(b){var c=this.parentNode;r.inArray(this,a)<0&&(r.cleanData(na(this)),c&&c.replaceChild(b,this))},a)}}),r.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){r.fn[a]=function(a){for(var c,d=[],e=r(a),f=e.length-1,g=0;g<=f;g++)c=g===f?this:this.clone(!0),r(e[g])[b](c),h.apply(d,c.get());return this.pushStack(d)}});var La=/^margin/,Ma=new RegExp("^("+aa+")(?!px)[a-z%]+$","i"),Na=function(b){var c=b.ownerDocument.defaultView;return c&&c.opener||(c=a),c.getComputedStyle(b)};!function(){function b(){if(i){i.style.cssText="box-sizing:border-box;position:relative;display:block;margin:auto;border:1px;padding:1px;top:1%;width:50%",i.innerHTML="",ra.appendChild(h);var b=a.getComputedStyle(i);c="1%"!==b.top,g="2px"===b.marginLeft,e="4px"===b.width,i.style.marginRight="50%",f="4px"===b.marginRight,ra.removeChild(h),i=null}}var c,e,f,g,h=d.createElement("div"),i=d.createElement("div");i.style&&(i.style.backgroundClip="content-box",i.cloneNode(!0).style.backgroundClip="",o.clearCloneStyle="content-box"===i.style.backgroundClip,h.style.cssText="border:0;width:8px;height:0;top:0;left:-9999px;padding:0;margin-top:1px;position:absolute",h.appendChild(i),r.extend(o,{pixelPosition:function(){return b(),c},boxSizingReliable:function(){return b(),e},pixelMarginRight:function(){return b(),f},reliableMarginLeft:function(){return b(),g}}))}();function Oa(a,b,c){var d,e,f,g,h=a.style;return c=c||Na(a),c&&(g=c.getPropertyValue(b)||c[b],""!==g||r.contains(a.ownerDocument,a)||(g=r.style(a,b)),!o.pixelMarginRight()&&Ma.test(g)&&La.test(b)&&(d=h.width,e=h.minWidth,f=h.maxWidth,h.minWidth=h.maxWidth=h.width=g,g=c.width,h.width=d,h.minWidth=e,h.maxWidth=f)),void 0!==g?g+"":g}function Pa(a,b){return{get:function(){return a()?void delete this.get:(this.get=b).apply(this,arguments)}}}var Qa=/^(none|table(?!-c[ea]).+)/,Ra=/^--/,Sa={position:"absolute",visibility:"hidden",display:"block"},Ta={letterSpacing:"0",fontWeight:"400"},Ua=["Webkit","Moz","ms"],Va=d.createElement("div").style;function Wa(a){if(a in Va)return a;var b=a[0].toUpperCase()+a.slice(1),c=Ua.length;while(c--)if(a=Ua[c]+b,a in Va)return a}function Xa(a){var b=r.cssProps[a];return b||(b=r.cssProps[a]=Wa(a)||a),b}function Ya(a,b,c){var d=ba.exec(b);return d?Math.max(0,d[2]-(c||0))+(d[3]||"px"):b}function Za(a,b,c,d,e){var f,g=0;for(f=c===(d?"border":"content")?4:"width"===b?1:0;f<4;f+=2)"margin"===c&&(g+=r.css(a,c+ca[f],!0,e)),d?("content"===c&&(g-=r.css(a,"padding"+ca[f],!0,e)),"margin"!==c&&(g-=r.css(a,"border"+ca[f]+"Width",!0,e))):(g+=r.css(a,"padding"+ca[f],!0,e),"padding"!==c&&(g+=r.css(a,"border"+ca[f]+"Width",!0,e)));return g}function $a(a,b,c){var d,e=Na(a),f=Oa(a,b,e),g="border-box"===r.css(a,"boxSizing",!1,e);return Ma.test(f)?f:(d=g&&(o.boxSizingReliable()||f===a.style[b]),"auto"===f&&(f=a["offset"+b[0].toUpperCase()+b.slice(1)]),f=parseFloat(f)||0,f+Za(a,b,c||(g?"border":"content"),d,e)+"px")}r.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=Oa(a,"opacity");return""===c?"1":c}}}},cssNumber:{animationIterationCount:!0,columnCount:!0,fillOpacity:!0,flexGrow:!0,flexShrink:!0,fontWeight:!0,lineHeight:!0,opacity:!0,order:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":"cssFloat"},style:function(a,b,c,d){if(a&&3!==a.nodeType&&8!==a.nodeType&&a.style){var e,f,g,h=r.camelCase(b),i=Ra.test(b),j=a.style;return i||(b=Xa(h)),g=r.cssHooks[b]||r.cssHooks[h],void 0===c?g&&"get"in g&&void 0!==(e=g.get(a,!1,d))?e:j[b]:(f=typeof c,"string"===f&&(e=ba.exec(c))&&e[1]&&(c=fa(a,b,e),f="number"),null!=c&&c===c&&("number"===f&&(c+=e&&e[3]||(r.cssNumber[h]?"":"px")),o.clearCloneStyle||""!==c||0!==b.indexOf("background")||(j[b]="inherit"),g&&"set"in g&&void 0===(c=g.set(a,c,d))||(i?j.setProperty(b,c):j[b]=c)),void 0)}},css:function(a,b,c,d){var e,f,g,h=r.camelCase(b),i=Ra.test(b);return i||(b=Xa(h)),g=r.cssHooks[b]||r.cssHooks[h],g&&"get"in g&&(e=g.get(a,!0,c)),void 0===e&&(e=Oa(a,b,d)),"normal"===e&&b in Ta&&(e=Ta[b]),""===c||c?(f=parseFloat(e),c===!0||isFinite(f)?f||0:e):e}}),r.each(["height","width"],function(a,b){r.cssHooks[b]={get:function(a,c,d){if(c)return!Qa.test(r.css(a,"display"))||a.getClientRects().length&&a.getBoundingClientRect().width?$a(a,b,d):ea(a,Sa,function(){return $a(a,b,d)})},set:function(a,c,d){var e,f=d&&Na(a),g=d&&Za(a,b,d,"border-box"===r.css(a,"boxSizing",!1,f),f);return g&&(e=ba.exec(c))&&"px"!==(e[3]||"px")&&(a.style[b]=c,c=r.css(a,b)),Ya(a,c,g)}}}),r.cssHooks.marginLeft=Pa(o.reliableMarginLeft,function(a,b){if(b)return(parseFloat(Oa(a,"marginLeft"))||a.getBoundingClientRect().left-ea(a,{marginLeft:0},function(){return a.getBoundingClientRect().left}))+"px"}),r.each({margin:"",padding:"",border:"Width"},function(a,b){r.cssHooks[a+b]={expand:function(c){for(var d=0,e={},f="string"==typeof c?c.split(" "):[c];d<4;d++)e[a+ca[d]+b]=f[d]||f[d-2]||f[0];return e}},La.test(a)||(r.cssHooks[a+b].set=Ya)}),r.fn.extend({css:function(a,b){return T(this,function(a,b,c){var d,e,f={},g=0;if(Array.isArray(b)){for(d=Na(a),e=b.length;g<e;g++)f[b[g]]=r.css(a,b[g],!1,d);return f}return void 0!==c?r.style(a,b,c):r.css(a,b)},a,b,arguments.length>1)}});function _a(a,b,c,d,e){return new _a.prototype.init(a,b,c,d,e)}r.Tween=_a,_a.prototype={constructor:_a,init:function(a,b,c,d,e,f){this.elem=a,this.prop=c,this.easing=e||r.easing._default,this.options=b,this.start=this.now=this.cur(),this.end=d,this.unit=f||(r.cssNumber[c]?"":"px")},cur:function(){var a=_a.propHooks[this.prop];return a&&a.get?a.get(this):_a.propHooks._default.get(this)},run:function(a){var b,c=_a.propHooks[this.prop];return this.options.duration?this.pos=b=r.easing[this.easing](a,this.options.duration*a,0,1,this.options.duration):this.pos=b=a,this.now=(this.end-this.start)*b+this.start,this.options.step&&this.options.step.call(this.elem,this.now,this),c&&c.set?c.set(this):_a.propHooks._default.set(this),this}},_a.prototype.init.prototype=_a.prototype,_a.propHooks={_default:{get:function(a){var b;return 1!==a.elem.nodeType||null!=a.elem[a.prop]&&null==a.elem.style[a.prop]?a.elem[a.prop]:(b=r.css(a.elem,a.prop,""),b&&"auto"!==b?b:0)},set:function(a){r.fx.step[a.prop]?r.fx.step[a.prop](a):1!==a.elem.nodeType||null==a.elem.style[r.cssProps[a.prop]]&&!r.cssHooks[a.prop]?a.elem[a.prop]=a.now:r.style(a.elem,a.prop,a.now+a.unit)}}},_a.propHooks.scrollTop=_a.propHooks.scrollLeft={set:function(a){a.elem.nodeType&&a.elem.parentNode&&(a.elem[a.prop]=a.now)}},r.easing={linear:function(a){return a},swing:function(a){return.5-Math.cos(a*Math.PI)/2},_default:"swing"},r.fx=_a.prototype.init,r.fx.step={};var ab,bb,cb=/^(?:toggle|show|hide)$/,db=/queueHooks$/;function eb(){bb&&(d.hidden===!1&&a.requestAnimationFrame?a.requestAnimationFrame(eb):a.setTimeout(eb,r.fx.interval),r.fx.tick())}function fb(){return a.setTimeout(function(){ab=void 0}),ab=r.now()}function gb(a,b){var c,d=0,e={height:a};for(b=b?1:0;d<4;d+=2-b)c=ca[d],e["margin"+c]=e["padding"+c]=a;return b&&(e.opacity=e.width=a),e}function hb(a,b,c){for(var d,e=(kb.tweeners[b]||[]).concat(kb.tweeners["*"]),f=0,g=e.length;f<g;f++)if(d=e[f].call(c,b,a))return d}function ib(a,b,c){var d,e,f,g,h,i,j,k,l="width"in b||"height"in b,m=this,n={},o=a.style,p=a.nodeType&&da(a),q=W.get(a,"fxshow");c.queue||(g=r._queueHooks(a,"fx"),null==g.unqueued&&(g.unqueued=0,h=g.empty.fire,g.empty.fire=function(){g.unqueued||h()}),g.unqueued++,m.always(function(){m.always(function(){g.unqueued--,r.queue(a,"fx").length||g.empty.fire()})}));for(d in b)if(e=b[d],cb.test(e)){if(delete b[d],f=f||"toggle"===e,e===(p?"hide":"show")){if("show"!==e||!q||void 0===q[d])continue;p=!0}n[d]=q&&q[d]||r.style(a,d)}if(i=!r.isEmptyObject(b),i||!r.isEmptyObject(n)){l&&1===a.nodeType&&(c.overflow=[o.overflow,o.overflowX,o.overflowY],j=q&&q.display,null==j&&(j=W.get(a,"display")),k=r.css(a,"display"),"none"===k&&(j?k=j:(ia([a],!0),j=a.style.display||j,k=r.css(a,"display"),ia([a]))),("inline"===k||"inline-block"===k&&null!=j)&&"none"===r.css(a,"float")&&(i||(m.done(function(){o.display=j}),null==j&&(k=o.display,j="none"===k?"":k)),o.display="inline-block")),c.overflow&&(o.overflow="hidden",m.always(function(){o.overflow=c.overflow[0],o.overflowX=c.overflow[1],o.overflowY=c.overflow[2]})),i=!1;for(d in n)i||(q?"hidden"in q&&(p=q.hidden):q=W.access(a,"fxshow",{display:j}),f&&(q.hidden=!p),p&&ia([a],!0),m.done(function(){p||ia([a]),W.remove(a,"fxshow");for(d in n)r.style(a,d,n[d])})),i=hb(p?q[d]:0,d,m),d in q||(q[d]=i.start,p&&(i.end=i.start,i.start=0))}}function jb(a,b){var c,d,e,f,g;for(c in a)if(d=r.camelCase(c),e=b[d],f=a[c],Array.isArray(f)&&(e=f[1],f=a[c]=f[0]),c!==d&&(a[d]=f,delete a[c]),g=r.cssHooks[d],g&&"expand"in g){f=g.expand(f),delete a[d];for(c in f)c in a||(a[c]=f[c],b[c]=e)}else b[d]=e}function kb(a,b,c){var d,e,f=0,g=kb.prefilters.length,h=r.Deferred().always(function(){delete i.elem}),i=function(){if(e)return!1;for(var b=ab||fb(),c=Math.max(0,j.startTime+j.duration-b),d=c/j.duration||0,f=1-d,g=0,i=j.tweens.length;g<i;g++)j.tweens[g].run(f);return h.notifyWith(a,[j,f,c]),f<1&&i?c:(i||h.notifyWith(a,[j,1,0]),h.resolveWith(a,[j]),!1)},j=h.promise({elem:a,props:r.extend({},b),opts:r.extend(!0,{specialEasing:{},easing:r.easing._default},c),originalProperties:b,originalOptions:c,startTime:ab||fb(),duration:c.duration,tweens:[],createTween:function(b,c){var d=r.Tween(a,j.opts,b,c,j.opts.specialEasing[b]||j.opts.easing);return j.tweens.push(d),d},stop:function(b){var c=0,d=b?j.tweens.length:0;if(e)return this;for(e=!0;c<d;c++)j.tweens[c].run(1);return b?(h.notifyWith(a,[j,1,0]),h.resolveWith(a,[j,b])):h.rejectWith(a,[j,b]),this}}),k=j.props;for(jb(k,j.opts.specialEasing);f<g;f++)if(d=kb.prefilters[f].call(j,a,k,j.opts))return r.isFunction(d.stop)&&(r._queueHooks(j.elem,j.opts.queue).stop=r.proxy(d.stop,d)),d;return r.map(k,hb,j),r.isFunction(j.opts.start)&&j.opts.start.call(a,j),j.progress(j.opts.progress).done(j.opts.done,j.opts.complete).fail(j.opts.fail).always(j.opts.always),r.fx.timer(r.extend(i,{elem:a,anim:j,queue:j.opts.queue})),j}r.Animation=r.extend(kb,{tweeners:{"*":[function(a,b){var c=this.createTween(a,b);return fa(c.elem,a,ba.exec(b),c),c}]},tweener:function(a,b){r.isFunction(a)?(b=a,a=["*"]):a=a.match(L);for(var c,d=0,e=a.length;d<e;d++)c=a[d],kb.tweeners[c]=kb.tweeners[c]||[],kb.tweeners[c].unshift(b)},prefilters:[ib],prefilter:function(a,b){b?kb.prefilters.unshift(a):kb.prefilters.push(a)}}),r.speed=function(a,b,c){var d=a&&"object"==typeof a?r.extend({},a):{complete:c||!c&&b||r.isFunction(a)&&a,duration:a,easing:c&&b||b&&!r.isFunction(b)&&b};return r.fx.off?d.duration=0:"number"!=typeof d.duration&&(d.duration in r.fx.speeds?d.duration=r.fx.speeds[d.duration]:d.duration=r.fx.speeds._default),null!=d.queue&&d.queue!==!0||(d.queue="fx"),d.old=d.complete,d.complete=function(){r.isFunction(d.old)&&d.old.call(this),d.queue&&r.dequeue(this,d.queue)},d},r.fn.extend({fadeTo:function(a,b,c,d){return this.filter(da).css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,d){var e=r.isEmptyObject(a),f=r.speed(b,c,d),g=function(){var b=kb(this,r.extend({},a),f);(e||W.get(this,"finish"))&&b.stop(!0)};return g.finish=g,e||f.queue===!1?this.each(g):this.queue(f.queue,g)},stop:function(a,b,c){var d=function(a){var b=a.stop;delete a.stop,b(c)};return"string"!=typeof a&&(c=b,b=a,a=void 0),b&&a!==!1&&this.queue(a||"fx",[]),this.each(function(){var b=!0,e=null!=a&&a+"queueHooks",f=r.timers,g=W.get(this);if(e)g[e]&&g[e].stop&&d(g[e]);else for(e in g)g[e]&&g[e].stop&&db.test(e)&&d(g[e]);for(e=f.length;e--;)f[e].elem!==this||null!=a&&f[e].queue!==a||(f[e].anim.stop(c),b=!1,f.splice(e,1));!b&&c||r.dequeue(this,a)})},finish:function(a){return a!==!1&&(a=a||"fx"),this.each(function(){var b,c=W.get(this),d=c[a+"queue"],e=c[a+"queueHooks"],f=r.timers,g=d?d.length:0;for(c.finish=!0,r.queue(this,a,[]),e&&e.stop&&e.stop.call(this,!0),b=f.length;b--;)f[b].elem===this&&f[b].queue===a&&(f[b].anim.stop(!0),f.splice(b,1));for(b=0;b<g;b++)d[b]&&d[b].finish&&d[b].finish.call(this);delete c.finish})}}),r.each(["toggle","show","hide"],function(a,b){var c=r.fn[b];r.fn[b]=function(a,d,e){return null==a||"boolean"==typeof a?c.apply(this,arguments):this.animate(gb(b,!0),a,d,e)}}),r.each({slideDown:gb("show"),slideUp:gb("hide"),slideToggle:gb("toggle"),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){r.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),r.timers=[],r.fx.tick=function(){var a,b=0,c=r.timers;for(ab=r.now();b<c.length;b++)a=c[b],a()||c[b]!==a||c.splice(b--,1);c.length||r.fx.stop(),ab=void 0},r.fx.timer=function(a){r.timers.push(a),r.fx.start()},r.fx.interval=13,r.fx.start=function(){bb||(bb=!0,eb())},r.fx.stop=function(){bb=null},r.fx.speeds={slow:600,fast:200,_default:400},r.fn.delay=function(b,c){return b=r.fx?r.fx.speeds[b]||b:b,c=c||"fx",this.queue(c,function(c,d){var e=a.setTimeout(c,b);d.stop=function(){a.clearTimeout(e)}})},function(){var a=d.createElement("input"),b=d.createElement("select"),c=b.appendChild(d.createElement("option"));a.type="checkbox",o.checkOn=""!==a.value,o.optSelected=c.selected,a=d.createElement("input"),a.value="t",a.type="radio",o.radioValue="t"===a.value}();var lb,mb=r.expr.attrHandle;r.fn.extend({attr:function(a,b){return T(this,r.attr,a,b,arguments.length>1)},removeAttr:function(a){return this.each(function(){r.removeAttr(this,a)})}}),r.extend({attr:function(a,b,c){var d,e,f=a.nodeType;if(3!==f&&8!==f&&2!==f)return"undefined"==typeof a.getAttribute?r.prop(a,b,c):(1===f&&r.isXMLDoc(a)||(e=r.attrHooks[b.toLowerCase()]||(r.expr.match.bool.test(b)?lb:void 0)),void 0!==c?null===c?void r.removeAttr(a,b):e&&"set"in e&&void 0!==(d=e.set(a,c,b))?d:(a.setAttribute(b,c+""),c):e&&"get"in e&&null!==(d=e.get(a,b))?d:(d=r.find.attr(a,b),
+null==d?void 0:d))},attrHooks:{type:{set:function(a,b){if(!o.radioValue&&"radio"===b&&B(a,"input")){var c=a.value;return a.setAttribute("type",b),c&&(a.value=c),b}}}},removeAttr:function(a,b){var c,d=0,e=b&&b.match(L);if(e&&1===a.nodeType)while(c=e[d++])a.removeAttribute(c)}}),lb={set:function(a,b,c){return b===!1?r.removeAttr(a,c):a.setAttribute(c,c),c}},r.each(r.expr.match.bool.source.match(/\w+/g),function(a,b){var c=mb[b]||r.find.attr;mb[b]=function(a,b,d){var e,f,g=b.toLowerCase();return d||(f=mb[g],mb[g]=e,e=null!=c(a,b,d)?g:null,mb[g]=f),e}});var nb=/^(?:input|select|textarea|button)$/i,ob=/^(?:a|area)$/i;r.fn.extend({prop:function(a,b){return T(this,r.prop,a,b,arguments.length>1)},removeProp:function(a){return this.each(function(){delete this[r.propFix[a]||a]})}}),r.extend({prop:function(a,b,c){var d,e,f=a.nodeType;if(3!==f&&8!==f&&2!==f)return 1===f&&r.isXMLDoc(a)||(b=r.propFix[b]||b,e=r.propHooks[b]),void 0!==c?e&&"set"in e&&void 0!==(d=e.set(a,c,b))?d:a[b]=c:e&&"get"in e&&null!==(d=e.get(a,b))?d:a[b]},propHooks:{tabIndex:{get:function(a){var b=r.find.attr(a,"tabindex");return b?parseInt(b,10):nb.test(a.nodeName)||ob.test(a.nodeName)&&a.href?0:-1}}},propFix:{"for":"htmlFor","class":"className"}}),o.optSelected||(r.propHooks.selected={get:function(a){var b=a.parentNode;return b&&b.parentNode&&b.parentNode.selectedIndex,null},set:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex)}}),r.each(["tabIndex","readOnly","maxLength","cellSpacing","cellPadding","rowSpan","colSpan","useMap","frameBorder","contentEditable"],function(){r.propFix[this.toLowerCase()]=this});function pb(a){var b=a.match(L)||[];return b.join(" ")}function qb(a){return a.getAttribute&&a.getAttribute("class")||""}r.fn.extend({addClass:function(a){var b,c,d,e,f,g,h,i=0;if(r.isFunction(a))return this.each(function(b){r(this).addClass(a.call(this,b,qb(this)))});if("string"==typeof a&&a){b=a.match(L)||[];while(c=this[i++])if(e=qb(c),d=1===c.nodeType&&" "+pb(e)+" "){g=0;while(f=b[g++])d.indexOf(" "+f+" ")<0&&(d+=f+" ");h=pb(d),e!==h&&c.setAttribute("class",h)}}return this},removeClass:function(a){var b,c,d,e,f,g,h,i=0;if(r.isFunction(a))return this.each(function(b){r(this).removeClass(a.call(this,b,qb(this)))});if(!arguments.length)return this.attr("class","");if("string"==typeof a&&a){b=a.match(L)||[];while(c=this[i++])if(e=qb(c),d=1===c.nodeType&&" "+pb(e)+" "){g=0;while(f=b[g++])while(d.indexOf(" "+f+" ")>-1)d=d.replace(" "+f+" "," ");h=pb(d),e!==h&&c.setAttribute("class",h)}}return this},toggleClass:function(a,b){var c=typeof a;return"boolean"==typeof b&&"string"===c?b?this.addClass(a):this.removeClass(a):r.isFunction(a)?this.each(function(c){r(this).toggleClass(a.call(this,c,qb(this),b),b)}):this.each(function(){var b,d,e,f;if("string"===c){d=0,e=r(this),f=a.match(L)||[];while(b=f[d++])e.hasClass(b)?e.removeClass(b):e.addClass(b)}else void 0!==a&&"boolean"!==c||(b=qb(this),b&&W.set(this,"__className__",b),this.setAttribute&&this.setAttribute("class",b||a===!1?"":W.get(this,"__className__")||""))})},hasClass:function(a){var b,c,d=0;b=" "+a+" ";while(c=this[d++])if(1===c.nodeType&&(" "+pb(qb(c))+" ").indexOf(b)>-1)return!0;return!1}});var rb=/\r/g;r.fn.extend({val:function(a){var b,c,d,e=this[0];{if(arguments.length)return d=r.isFunction(a),this.each(function(c){var e;1===this.nodeType&&(e=d?a.call(this,c,r(this).val()):a,null==e?e="":"number"==typeof e?e+="":Array.isArray(e)&&(e=r.map(e,function(a){return null==a?"":a+""})),b=r.valHooks[this.type]||r.valHooks[this.nodeName.toLowerCase()],b&&"set"in b&&void 0!==b.set(this,e,"value")||(this.value=e))});if(e)return b=r.valHooks[e.type]||r.valHooks[e.nodeName.toLowerCase()],b&&"get"in b&&void 0!==(c=b.get(e,"value"))?c:(c=e.value,"string"==typeof c?c.replace(rb,""):null==c?"":c)}}}),r.extend({valHooks:{option:{get:function(a){var b=r.find.attr(a,"value");return null!=b?b:pb(r.text(a))}},select:{get:function(a){var b,c,d,e=a.options,f=a.selectedIndex,g="select-one"===a.type,h=g?null:[],i=g?f+1:e.length;for(d=f<0?i:g?f:0;d<i;d++)if(c=e[d],(c.selected||d===f)&&!c.disabled&&(!c.parentNode.disabled||!B(c.parentNode,"optgroup"))){if(b=r(c).val(),g)return b;h.push(b)}return h},set:function(a,b){var c,d,e=a.options,f=r.makeArray(b),g=e.length;while(g--)d=e[g],(d.selected=r.inArray(r.valHooks.option.get(d),f)>-1)&&(c=!0);return c||(a.selectedIndex=-1),f}}}}),r.each(["radio","checkbox"],function(){r.valHooks[this]={set:function(a,b){if(Array.isArray(b))return a.checked=r.inArray(r(a).val(),b)>-1}},o.checkOn||(r.valHooks[this].get=function(a){return null===a.getAttribute("value")?"on":a.value})});var sb=/^(?:focusinfocus|focusoutblur)$/;r.extend(r.event,{trigger:function(b,c,e,f){var g,h,i,j,k,m,n,o=[e||d],p=l.call(b,"type")?b.type:b,q=l.call(b,"namespace")?b.namespace.split("."):[];if(h=i=e=e||d,3!==e.nodeType&&8!==e.nodeType&&!sb.test(p+r.event.triggered)&&(p.indexOf(".")>-1&&(q=p.split("."),p=q.shift(),q.sort()),k=p.indexOf(":")<0&&"on"+p,b=b[r.expando]?b:new r.Event(p,"object"==typeof b&&b),b.isTrigger=f?2:3,b.namespace=q.join("."),b.rnamespace=b.namespace?new RegExp("(^|\\.)"+q.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,b.result=void 0,b.target||(b.target=e),c=null==c?[b]:r.makeArray(c,[b]),n=r.event.special[p]||{},f||!n.trigger||n.trigger.apply(e,c)!==!1)){if(!f&&!n.noBubble&&!r.isWindow(e)){for(j=n.delegateType||p,sb.test(j+p)||(h=h.parentNode);h;h=h.parentNode)o.push(h),i=h;i===(e.ownerDocument||d)&&o.push(i.defaultView||i.parentWindow||a)}g=0;while((h=o[g++])&&!b.isPropagationStopped())b.type=g>1?j:n.bindType||p,m=(W.get(h,"events")||{})[b.type]&&W.get(h,"handle"),m&&m.apply(h,c),m=k&&h[k],m&&m.apply&&U(h)&&(b.result=m.apply(h,c),b.result===!1&&b.preventDefault());return b.type=p,f||b.isDefaultPrevented()||n._default&&n._default.apply(o.pop(),c)!==!1||!U(e)||k&&r.isFunction(e[p])&&!r.isWindow(e)&&(i=e[k],i&&(e[k]=null),r.event.triggered=p,e[p](),r.event.triggered=void 0,i&&(e[k]=i)),b.result}},simulate:function(a,b,c){var d=r.extend(new r.Event,c,{type:a,isSimulated:!0});r.event.trigger(d,null,b)}}),r.fn.extend({trigger:function(a,b){return this.each(function(){r.event.trigger(a,b,this)})},triggerHandler:function(a,b){var c=this[0];if(c)return r.event.trigger(a,b,c,!0)}}),r.each("blur focus focusin focusout resize scroll click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup contextmenu".split(" "),function(a,b){r.fn[b]=function(a,c){return arguments.length>0?this.on(b,null,a,c):this.trigger(b)}}),r.fn.extend({hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}}),o.focusin="onfocusin"in a,o.focusin||r.each({focus:"focusin",blur:"focusout"},function(a,b){var c=function(a){r.event.simulate(b,a.target,r.event.fix(a))};r.event.special[b]={setup:function(){var d=this.ownerDocument||this,e=W.access(d,b);e||d.addEventListener(a,c,!0),W.access(d,b,(e||0)+1)},teardown:function(){var d=this.ownerDocument||this,e=W.access(d,b)-1;e?W.access(d,b,e):(d.removeEventListener(a,c,!0),W.remove(d,b))}}});var tb=a.location,ub=r.now(),vb=/\?/;r.parseXML=function(b){var c;if(!b||"string"!=typeof b)return null;try{c=(new a.DOMParser).parseFromString(b,"text/xml")}catch(d){c=void 0}return c&&!c.getElementsByTagName("parsererror").length||r.error("Invalid XML: "+b),c};var wb=/\[\]$/,xb=/\r?\n/g,yb=/^(?:submit|button|image|reset|file)$/i,zb=/^(?:input|select|textarea|keygen)/i;function Ab(a,b,c,d){var e;if(Array.isArray(b))r.each(b,function(b,e){c||wb.test(a)?d(a,e):Ab(a+"["+("object"==typeof e&&null!=e?b:"")+"]",e,c,d)});else if(c||"object"!==r.type(b))d(a,b);else for(e in b)Ab(a+"["+e+"]",b[e],c,d)}r.param=function(a,b){var c,d=[],e=function(a,b){var c=r.isFunction(b)?b():b;d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(null==c?"":c)};if(Array.isArray(a)||a.jquery&&!r.isPlainObject(a))r.each(a,function(){e(this.name,this.value)});else for(c in a)Ab(c,a[c],b,e);return d.join("&")},r.fn.extend({serialize:function(){return r.param(this.serializeArray())},serializeArray:function(){return this.map(function(){var a=r.prop(this,"elements");return a?r.makeArray(a):this}).filter(function(){var a=this.type;return this.name&&!r(this).is(":disabled")&&zb.test(this.nodeName)&&!yb.test(a)&&(this.checked||!ja.test(a))}).map(function(a,b){var c=r(this).val();return null==c?null:Array.isArray(c)?r.map(c,function(a){return{name:b.name,value:a.replace(xb,"\r\n")}}):{name:b.name,value:c.replace(xb,"\r\n")}}).get()}});var Bb=/%20/g,Cb=/#.*$/,Db=/([?&])_=[^&]*/,Eb=/^(.*?):[ \t]*([^\r\n]*)$/gm,Fb=/^(?:about|app|app-storage|.+-extension|file|res|widget):$/,Gb=/^(?:GET|HEAD)$/,Hb=/^\/\//,Ib={},Jb={},Kb="*/".concat("*"),Lb=d.createElement("a");Lb.href=tb.href;function Mb(a){return function(b,c){"string"!=typeof b&&(c=b,b="*");var d,e=0,f=b.toLowerCase().match(L)||[];if(r.isFunction(c))while(d=f[e++])"+"===d[0]?(d=d.slice(1)||"*",(a[d]=a[d]||[]).unshift(c)):(a[d]=a[d]||[]).push(c)}}function Nb(a,b,c,d){var e={},f=a===Jb;function g(h){var i;return e[h]=!0,r.each(a[h]||[],function(a,h){var j=h(b,c,d);return"string"!=typeof j||f||e[j]?f?!(i=j):void 0:(b.dataTypes.unshift(j),g(j),!1)}),i}return g(b.dataTypes[0])||!e["*"]&&g("*")}function Ob(a,b){var c,d,e=r.ajaxSettings.flatOptions||{};for(c in b)void 0!==b[c]&&((e[c]?a:d||(d={}))[c]=b[c]);return d&&r.extend(!0,a,d),a}function Pb(a,b,c){var d,e,f,g,h=a.contents,i=a.dataTypes;while("*"===i[0])i.shift(),void 0===d&&(d=a.mimeType||b.getResponseHeader("Content-Type"));if(d)for(e in h)if(h[e]&&h[e].test(d)){i.unshift(e);break}if(i[0]in c)f=i[0];else{for(e in c){if(!i[0]||a.converters[e+" "+i[0]]){f=e;break}g||(g=e)}f=f||g}if(f)return f!==i[0]&&i.unshift(f),c[f]}function Qb(a,b,c,d){var e,f,g,h,i,j={},k=a.dataTypes.slice();if(k[1])for(g in a.converters)j[g.toLowerCase()]=a.converters[g];f=k.shift();while(f)if(a.responseFields[f]&&(c[a.responseFields[f]]=b),!i&&d&&a.dataFilter&&(b=a.dataFilter(b,a.dataType)),i=f,f=k.shift())if("*"===f)f=i;else if("*"!==i&&i!==f){if(g=j[i+" "+f]||j["* "+f],!g)for(e in j)if(h=e.split(" "),h[1]===f&&(g=j[i+" "+h[0]]||j["* "+h[0]])){g===!0?g=j[e]:j[e]!==!0&&(f=h[0],k.unshift(h[1]));break}if(g!==!0)if(g&&a["throws"])b=g(b);else try{b=g(b)}catch(l){return{state:"parsererror",error:g?l:"No conversion from "+i+" to "+f}}}return{state:"success",data:b}}r.extend({active:0,lastModified:{},etag:{},ajaxSettings:{url:tb.href,type:"GET",isLocal:Fb.test(tb.protocol),global:!0,processData:!0,async:!0,contentType:"application/x-www-form-urlencoded; charset=UTF-8",accepts:{"*":Kb,text:"text/plain",html:"text/html",xml:"application/xml, text/xml",json:"application/json, text/javascript"},contents:{xml:/\bxml\b/,html:/\bhtml/,json:/\bjson\b/},responseFields:{xml:"responseXML",text:"responseText",json:"responseJSON"},converters:{"* text":String,"text html":!0,"text json":JSON.parse,"text xml":r.parseXML},flatOptions:{url:!0,context:!0}},ajaxSetup:function(a,b){return b?Ob(Ob(a,r.ajaxSettings),b):Ob(r.ajaxSettings,a)},ajaxPrefilter:Mb(Ib),ajaxTransport:Mb(Jb),ajax:function(b,c){"object"==typeof b&&(c=b,b=void 0),c=c||{};var e,f,g,h,i,j,k,l,m,n,o=r.ajaxSetup({},c),p=o.context||o,q=o.context&&(p.nodeType||p.jquery)?r(p):r.event,s=r.Deferred(),t=r.Callbacks("once memory"),u=o.statusCode||{},v={},w={},x="canceled",y={readyState:0,getResponseHeader:function(a){var b;if(k){if(!h){h={};while(b=Eb.exec(g))h[b[1].toLowerCase()]=b[2]}b=h[a.toLowerCase()]}return null==b?null:b},getAllResponseHeaders:function(){return k?g:null},setRequestHeader:function(a,b){return null==k&&(a=w[a.toLowerCase()]=w[a.toLowerCase()]||a,v[a]=b),this},overrideMimeType:function(a){return null==k&&(o.mimeType=a),this},statusCode:function(a){var b;if(a)if(k)y.always(a[y.status]);else for(b in a)u[b]=[u[b],a[b]];return this},abort:function(a){var b=a||x;return e&&e.abort(b),A(0,b),this}};if(s.promise(y),o.url=((b||o.url||tb.href)+"").replace(Hb,tb.protocol+"//"),o.type=c.method||c.type||o.method||o.type,o.dataTypes=(o.dataType||"*").toLowerCase().match(L)||[""],null==o.crossDomain){j=d.createElement("a");try{j.href=o.url,j.href=j.href,o.crossDomain=Lb.protocol+"//"+Lb.host!=j.protocol+"//"+j.host}catch(z){o.crossDomain=!0}}if(o.data&&o.processData&&"string"!=typeof o.data&&(o.data=r.param(o.data,o.traditional)),Nb(Ib,o,c,y),k)return y;l=r.event&&o.global,l&&0===r.active++&&r.event.trigger("ajaxStart"),o.type=o.type.toUpperCase(),o.hasContent=!Gb.test(o.type),f=o.url.replace(Cb,""),o.hasContent?o.data&&o.processData&&0===(o.contentType||"").indexOf("application/x-www-form-urlencoded")&&(o.data=o.data.replace(Bb,"+")):(n=o.url.slice(f.length),o.data&&(f+=(vb.test(f)?"&":"?")+o.data,delete o.data),o.cache===!1&&(f=f.replace(Db,"$1"),n=(vb.test(f)?"&":"?")+"_="+ub++ +n),o.url=f+n),o.ifModified&&(r.lastModified[f]&&y.setRequestHeader("If-Modified-Since",r.lastModified[f]),r.etag[f]&&y.setRequestHeader("If-None-Match",r.etag[f])),(o.data&&o.hasContent&&o.contentType!==!1||c.contentType)&&y.setRequestHeader("Content-Type",o.contentType),y.setRequestHeader("Accept",o.dataTypes[0]&&o.accepts[o.dataTypes[0]]?o.accepts[o.dataTypes[0]]+("*"!==o.dataTypes[0]?", "+Kb+"; q=0.01":""):o.accepts["*"]);for(m in o.headers)y.setRequestHeader(m,o.headers[m]);if(o.beforeSend&&(o.beforeSend.call(p,y,o)===!1||k))return y.abort();if(x="abort",t.add(o.complete),y.done(o.success),y.fail(o.error),e=Nb(Jb,o,c,y)){if(y.readyState=1,l&&q.trigger("ajaxSend",[y,o]),k)return y;o.async&&o.timeout>0&&(i=a.setTimeout(function(){y.abort("timeout")},o.timeout));try{k=!1,e.send(v,A)}catch(z){if(k)throw z;A(-1,z)}}else A(-1,"No Transport");function A(b,c,d,h){var j,m,n,v,w,x=c;k||(k=!0,i&&a.clearTimeout(i),e=void 0,g=h||"",y.readyState=b>0?4:0,j=b>=200&&b<300||304===b,d&&(v=Pb(o,y,d)),v=Qb(o,v,y,j),j?(o.ifModified&&(w=y.getResponseHeader("Last-Modified"),w&&(r.lastModified[f]=w),w=y.getResponseHeader("etag"),w&&(r.etag[f]=w)),204===b||"HEAD"===o.type?x="nocontent":304===b?x="notmodified":(x=v.state,m=v.data,n=v.error,j=!n)):(n=x,!b&&x||(x="error",b<0&&(b=0))),y.status=b,y.statusText=(c||x)+"",j?s.resolveWith(p,[m,x,y]):s.rejectWith(p,[y,x,n]),y.statusCode(u),u=void 0,l&&q.trigger(j?"ajaxSuccess":"ajaxError",[y,o,j?m:n]),t.fireWith(p,[y,x]),l&&(q.trigger("ajaxComplete",[y,o]),--r.active||r.event.trigger("ajaxStop")))}return y},getJSON:function(a,b,c){return r.get(a,b,c,"json")},getScript:function(a,b){return r.get(a,void 0,b,"script")}}),r.each(["get","post"],function(a,b){r[b]=function(a,c,d,e){return r.isFunction(c)&&(e=e||d,d=c,c=void 0),r.ajax(r.extend({url:a,type:b,dataType:e,data:c,success:d},r.isPlainObject(a)&&a))}}),r._evalUrl=function(a){return r.ajax({url:a,type:"GET",dataType:"script",cache:!0,async:!1,global:!1,"throws":!0})},r.fn.extend({wrapAll:function(a){var b;return this[0]&&(r.isFunction(a)&&(a=a.call(this[0])),b=r(a,this[0].ownerDocument).eq(0).clone(!0),this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstElementChild)a=a.firstElementChild;return a}).append(this)),this},wrapInner:function(a){return r.isFunction(a)?this.each(function(b){r(this).wrapInner(a.call(this,b))}):this.each(function(){var b=r(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){var b=r.isFunction(a);return this.each(function(c){r(this).wrapAll(b?a.call(this,c):a)})},unwrap:function(a){return this.parent(a).not("body").each(function(){r(this).replaceWith(this.childNodes)}),this}}),r.expr.pseudos.hidden=function(a){return!r.expr.pseudos.visible(a)},r.expr.pseudos.visible=function(a){return!!(a.offsetWidth||a.offsetHeight||a.getClientRects().length)},r.ajaxSettings.xhr=function(){try{return new a.XMLHttpRequest}catch(b){}};var Rb={0:200,1223:204},Sb=r.ajaxSettings.xhr();o.cors=!!Sb&&"withCredentials"in Sb,o.ajax=Sb=!!Sb,r.ajaxTransport(function(b){var c,d;if(o.cors||Sb&&!b.crossDomain)return{send:function(e,f){var g,h=b.xhr();if(h.open(b.type,b.url,b.async,b.username,b.password),b.xhrFields)for(g in b.xhrFields)h[g]=b.xhrFields[g];b.mimeType&&h.overrideMimeType&&h.overrideMimeType(b.mimeType),b.crossDomain||e["X-Requested-With"]||(e["X-Requested-With"]="XMLHttpRequest");for(g in e)h.setRequestHeader(g,e[g]);c=function(a){return function(){c&&(c=d=h.onload=h.onerror=h.onabort=h.onreadystatechange=null,"abort"===a?h.abort():"error"===a?"number"!=typeof h.status?f(0,"error"):f(h.status,h.statusText):f(Rb[h.status]||h.status,h.statusText,"text"!==(h.responseType||"text")||"string"!=typeof h.responseText?{binary:h.response}:{text:h.responseText},h.getAllResponseHeaders()))}},h.onload=c(),d=h.onerror=c("error"),void 0!==h.onabort?h.onabort=d:h.onreadystatechange=function(){4===h.readyState&&a.setTimeout(function(){c&&d()})},c=c("abort");try{h.send(b.hasContent&&b.data||null)}catch(i){if(c)throw i}},abort:function(){c&&c()}}}),r.ajaxPrefilter(function(a){a.crossDomain&&(a.contents.script=!1)}),r.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/\b(?:java|ecma)script\b/},converters:{"text script":function(a){return r.globalEval(a),a}}}),r.ajaxPrefilter("script",function(a){void 0===a.cache&&(a.cache=!1),a.crossDomain&&(a.type="GET")}),r.ajaxTransport("script",function(a){if(a.crossDomain){var b,c;return{send:function(e,f){b=r("<script>").prop({charset:a.scriptCharset,src:a.url}).on("load error",c=function(a){b.remove(),c=null,a&&f("error"===a.type?404:200,a.type)}),d.head.appendChild(b[0])},abort:function(){c&&c()}}}});var Tb=[],Ub=/(=)\?(?=&|$)|\?\?/;r.ajaxSetup({jsonp:"callback",jsonpCallback:function(){var a=Tb.pop()||r.expando+"_"+ub++;return this[a]=!0,a}}),r.ajaxPrefilter("json jsonp",function(b,c,d){var e,f,g,h=b.jsonp!==!1&&(Ub.test(b.url)?"url":"string"==typeof b.data&&0===(b.contentType||"").indexOf("application/x-www-form-urlencoded")&&Ub.test(b.data)&&"data");if(h||"jsonp"===b.dataTypes[0])return e=b.jsonpCallback=r.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,h?b[h]=b[h].replace(Ub,"$1"+e):b.jsonp!==!1&&(b.url+=(vb.test(b.url)?"&":"?")+b.jsonp+"="+e),b.converters["script json"]=function(){return g||r.error(e+" was not called"),g[0]},b.dataTypes[0]="json",f=a[e],a[e]=function(){g=arguments},d.always(function(){void 0===f?r(a).removeProp(e):a[e]=f,b[e]&&(b.jsonpCallback=c.jsonpCallback,Tb.push(e)),g&&r.isFunction(f)&&f(g[0]),g=f=void 0}),"script"}),o.createHTMLDocument=function(){var a=d.implementation.createHTMLDocument("").body;return a.innerHTML="<form></form><form></form>",2===a.childNodes.length}(),r.parseHTML=function(a,b,c){if("string"!=typeof a)return[];"boolean"==typeof b&&(c=b,b=!1);var e,f,g;return b||(o.createHTMLDocument?(b=d.implementation.createHTMLDocument(""),e=b.createElement("base"),e.href=d.location.href,b.head.appendChild(e)):b=d),f=C.exec(a),g=!c&&[],f?[b.createElement(f[1])]:(f=qa([a],b,g),g&&g.length&&r(g).remove(),r.merge([],f.childNodes))},r.fn.load=function(a,b,c){var d,e,f,g=this,h=a.indexOf(" ");return h>-1&&(d=pb(a.slice(h)),a=a.slice(0,h)),r.isFunction(b)?(c=b,b=void 0):b&&"object"==typeof b&&(e="POST"),g.length>0&&r.ajax({url:a,type:e||"GET",dataType:"html",data:b}).done(function(a){f=arguments,g.html(d?r("<div>").append(r.parseHTML(a)).find(d):a)}).always(c&&function(a,b){g.each(function(){c.apply(this,f||[a.responseText,b,a])})}),this},r.each(["ajaxStart","ajaxStop","ajaxComplete","ajaxError","ajaxSuccess","ajaxSend"],function(a,b){r.fn[b]=function(a){return this.on(b,a)}}),r.expr.pseudos.animated=function(a){return r.grep(r.timers,function(b){return a===b.elem}).length},r.offset={setOffset:function(a,b,c){var d,e,f,g,h,i,j,k=r.css(a,"position"),l=r(a),m={};"static"===k&&(a.style.position="relative"),h=l.offset(),f=r.css(a,"top"),i=r.css(a,"left"),j=("absolute"===k||"fixed"===k)&&(f+i).indexOf("auto")>-1,j?(d=l.position(),g=d.top,e=d.left):(g=parseFloat(f)||0,e=parseFloat(i)||0),r.isFunction(b)&&(b=b.call(a,c,r.extend({},h))),null!=b.top&&(m.top=b.top-h.top+g),null!=b.left&&(m.left=b.left-h.left+e),"using"in b?b.using.call(a,m):l.css(m)}},r.fn.extend({offset:function(a){if(arguments.length)return void 0===a?this:this.each(function(b){r.offset.setOffset(this,a,b)});var b,c,d,e,f=this[0];if(f)return f.getClientRects().length?(d=f.getBoundingClientRect(),b=f.ownerDocument,c=b.documentElement,e=b.defaultView,{top:d.top+e.pageYOffset-c.clientTop,left:d.left+e.pageXOffset-c.clientLeft}):{top:0,left:0}},position:function(){if(this[0]){var a,b,c=this[0],d={top:0,left:0};return"fixed"===r.css(c,"position")?b=c.getBoundingClientRect():(a=this.offsetParent(),b=this.offset(),B(a[0],"html")||(d=a.offset()),d={top:d.top+r.css(a[0],"borderTopWidth",!0),left:d.left+r.css(a[0],"borderLeftWidth",!0)}),{top:b.top-d.top-r.css(c,"marginTop",!0),left:b.left-d.left-r.css(c,"marginLeft",!0)}}},offsetParent:function(){return this.map(function(){var a=this.offsetParent;while(a&&"static"===r.css(a,"position"))a=a.offsetParent;return a||ra})}}),r.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(a,b){var c="pageYOffset"===b;r.fn[a]=function(d){return T(this,function(a,d,e){var f;return r.isWindow(a)?f=a:9===a.nodeType&&(f=a.defaultView),void 0===e?f?f[b]:a[d]:void(f?f.scrollTo(c?f.pageXOffset:e,c?e:f.pageYOffset):a[d]=e)},a,d,arguments.length)}}),r.each(["top","left"],function(a,b){r.cssHooks[b]=Pa(o.pixelPosition,function(a,c){if(c)return c=Oa(a,b),Ma.test(c)?r(a).position()[b]+"px":c})}),r.each({Height:"height",Width:"width"},function(a,b){r.each({padding:"inner"+a,content:b,"":"outer"+a},function(c,d){r.fn[d]=function(e,f){var g=arguments.length&&(c||"boolean"!=typeof e),h=c||(e===!0||f===!0?"margin":"border");return T(this,function(b,c,e){var f;return r.isWindow(b)?0===d.indexOf("outer")?b["inner"+a]:b.document.documentElement["client"+a]:9===b.nodeType?(f=b.documentElement,Math.max(b.body["scroll"+a],f["scroll"+a],b.body["offset"+a],f["offset"+a],f["client"+a])):void 0===e?r.css(b,c,h):r.style(b,c,e,h)},b,g?e:void 0,g)}})}),r.fn.extend({bind:function(a,b,c){return this.on(a,null,b,c)},unbind:function(a,b){return this.off(a,null,b)},delegate:function(a,b,c,d){return this.on(b,a,c,d)},undelegate:function(a,b,c){return 1===arguments.length?this.off(a,"**"):this.off(b,a||"**",c)}}),r.holdReady=function(a){a?r.readyWait++:r.ready(!0)},r.isArray=Array.isArray,r.parseJSON=JSON.parse,r.nodeName=B,"function"==typeof define&&define.amd&&define("jquery",[],function(){return r});var Vb=a.jQuery,Wb=a.$;return r.noConflict=function(b){return a.$===r&&(a.$=Wb),b&&a.jQuery===r&&(a.jQuery=Vb),r},b||(a.jQuery=a.$=r),r});
diff --git a/docs/lib/magnific-popup/magnific-popup.css b/docs/lib/magnific-popup/magnific-popup.css
new file mode 100644
index 0000000..8561e18
--- /dev/null
+++ b/docs/lib/magnific-popup/magnific-popup.css
@@ -0,0 +1,351 @@
+/* Magnific Popup CSS */
+.mfp-bg {
+  top: 0;
+  left: 0;
+  width: 100%;
+  height: 100%;
+  z-index: 1042;
+  overflow: hidden;
+  position: fixed;
+  background: #0b0b0b;
+  opacity: 0.8; }
+
+.mfp-wrap {
+  top: 0;
+  left: 0;
+  width: 100%;
+  height: 100%;
+  z-index: 1043;
+  position: fixed;
+  outline: none !important;
+  -webkit-backface-visibility: hidden; }
+
+.mfp-container {
+  text-align: center;
+  position: absolute;
+  width: 100%;
+  height: 100%;
+  left: 0;
+  top: 0;
+  padding: 0 8px;
+  box-sizing: border-box; }
+
+.mfp-container:before {
+  content: '';
+  display: inline-block;
+  height: 100%;
+  vertical-align: middle; }
+
+.mfp-align-top .mfp-container:before {
+  display: none; }
+
+.mfp-content {
+  position: relative;
+  display: inline-block;
+  vertical-align: middle;
+  margin: 0 auto;
+  text-align: left;
+  z-index: 1045; }
+
+.mfp-inline-holder .mfp-content,
+.mfp-ajax-holder .mfp-content {
+  width: 100%;
+  cursor: auto; }
+
+.mfp-ajax-cur {
+  cursor: progress; }
+
+.mfp-zoom-out-cur, .mfp-zoom-out-cur .mfp-image-holder .mfp-close {
+  cursor: -moz-zoom-out;
+  cursor: -webkit-zoom-out;
+  cursor: zoom-out; }
+
+.mfp-zoom {
+  cursor: pointer;
+  cursor: -webkit-zoom-in;
+  cursor: -moz-zoom-in;
+  cursor: zoom-in; }
+
+.mfp-auto-cursor .mfp-content {
+  cursor: auto; }
+
+.mfp-close,
+.mfp-arrow,
+.mfp-preloader,
+.mfp-counter {
+  -webkit-user-select: none;
+  -moz-user-select: none;
+  user-select: none; }
+
+.mfp-loading.mfp-figure {
+  display: none; }
+
+.mfp-hide {
+  display: none !important; }
+
+.mfp-preloader {
+  color: #CCC;
+  position: absolute;
+  top: 50%;
+  width: auto;
+  text-align: center;
+  margin-top: -0.8em;
+  left: 8px;
+  right: 8px;
+  z-index: 1044; }
+  .mfp-preloader a {
+    color: #CCC; }
+    .mfp-preloader a:hover {
+      color: #FFF; }
+
+.mfp-s-ready .mfp-preloader {
+  display: none; }
+
+.mfp-s-error .mfp-content {
+  display: none; }
+
+button.mfp-close,
+button.mfp-arrow {
+  overflow: visible;
+  cursor: pointer;
+  background: transparent;
+  border: 0;
+  -webkit-appearance: none;
+  display: block;
+  outline: none;
+  padding: 0;
+  z-index: 1046;
+  box-shadow: none;
+  touch-action: manipulation; }
+
+button::-moz-focus-inner {
+  padding: 0;
+  border: 0; }
+
+.mfp-close {
+  width: 44px;
+  height: 44px;
+  line-height: 44px;
+  position: absolute;
+  right: 0;
+  top: 0;
+  text-decoration: none;
+  text-align: center;
+  opacity: 0.65;
+  padding: 0 0 18px 10px;
+  color: #FFF;
+  font-style: normal;
+  font-size: 28px;
+  font-family: Arial, Baskerville, monospace; }
+  .mfp-close:hover,
+  .mfp-close:focus {
+    opacity: 1; }
+  .mfp-close:active {
+    top: 1px; }
+
+.mfp-close-btn-in .mfp-close {
+  color: #333; }
+
+.mfp-image-holder .mfp-close,
+.mfp-iframe-holder .mfp-close {
+  color: #FFF;
+  right: -6px;
+  text-align: right;
+  padding-right: 6px;
+  width: 100%; }
+
+.mfp-counter {
+  position: absolute;
+  top: 0;
+  right: 0;
+  color: #CCC;
+  font-size: 12px;
+  line-height: 18px;
+  white-space: nowrap; }
+
+.mfp-arrow {
+  position: absolute;
+  opacity: 0.65;
+  margin: 0;
+  top: 50%;
+  margin-top: -55px;
+  padding: 0;
+  width: 90px;
+  height: 110px;
+  -webkit-tap-highlight-color: transparent; }
+  .mfp-arrow:active {
+    margin-top: -54px; }
+  .mfp-arrow:hover,
+  .mfp-arrow:focus {
+    opacity: 1; }
+  .mfp-arrow:before,
+  .mfp-arrow:after {
+    content: '';
+    display: block;
+    width: 0;
+    height: 0;
+    position: absolute;
+    left: 0;
+    top: 0;
+    margin-top: 35px;
+    margin-left: 35px;
+    border: medium inset transparent; }
+  .mfp-arrow:after {
+    border-top-width: 13px;
+    border-bottom-width: 13px;
+    top: 8px; }
+  .mfp-arrow:before {
+    border-top-width: 21px;
+    border-bottom-width: 21px;
+    opacity: 0.7; }
+
+.mfp-arrow-left {
+  left: 0; }
+  .mfp-arrow-left:after {
+    border-right: 17px solid #FFF;
+    margin-left: 31px; }
+  .mfp-arrow-left:before {
+    margin-left: 25px;
+    border-right: 27px solid #3F3F3F; }
+
+.mfp-arrow-right {
+  right: 0; }
+  .mfp-arrow-right:after {
+    border-left: 17px solid #FFF;
+    margin-left: 39px; }
+  .mfp-arrow-right:before {
+    border-left: 27px solid #3F3F3F; }
+
+.mfp-iframe-holder {
+  padding-top: 40px;
+  padding-bottom: 40px; }
+  .mfp-iframe-holder .mfp-content {
+    line-height: 0;
+    width: 100%;
+    max-width: 900px; }
+  .mfp-iframe-holder .mfp-close {
+    top: -40px; }
+
+.mfp-iframe-scaler {
+  width: 100%;
+  height: 0;
+  overflow: hidden;
+  padding-top: 56.25%; }
+  .mfp-iframe-scaler iframe {
+    position: absolute;
+    display: block;
+    top: 0;
+    left: 0;
+    width: 100%;
+    height: 100%;
+    box-shadow: 0 0 8px rgba(0, 0, 0, 0.6);
+    background: #000; }
+
+/* Main image in popup */
+img.mfp-img {
+  width: auto;
+  max-width: 100%;
+  height: auto;
+  display: block;
+  line-height: 0;
+  box-sizing: border-box;
+  padding: 40px 0 40px;
+  margin: 0 auto; }
+
+/* The shadow behind the image */
+.mfp-figure {
+  line-height: 0; }
+  .mfp-figure:after {
+    content: '';
+    position: absolute;
+    left: 0;
+    top: 40px;
+    bottom: 40px;
+    display: block;
+    right: 0;
+    width: auto;
+    height: auto;
+    z-index: -1;
+    box-shadow: 0 0 8px rgba(0, 0, 0, 0.6);
+    background: #444; }
+  .mfp-figure small {
+    color: #BDBDBD;
+    display: block;
+    font-size: 12px;
+    line-height: 14px; }
+  .mfp-figure figure {
+    margin: 0; }
+
+.mfp-bottom-bar {
+  margin-top: -36px;
+  position: absolute;
+  top: 100%;
+  left: 0;
+  width: 100%;
+  cursor: auto; }
+
+.mfp-title {
+  text-align: left;
+  line-height: 18px;
+  color: #F3F3F3;
+  word-wrap: break-word;
+  padding-right: 36px; }
+
+.mfp-image-holder .mfp-content {
+  max-width: 100%; }
+
+.mfp-gallery .mfp-image-holder .mfp-figure {
+  cursor: pointer; }
+
+@media screen and (max-width: 800px) and (orientation: landscape), screen and (max-height: 300px) {
+  /**
+       * Remove all paddings around the image on small screen
+       */
+  .mfp-img-mobile .mfp-image-holder {
+    padding-left: 0;
+    padding-right: 0; }
+  .mfp-img-mobile img.mfp-img {
+    padding: 0; }
+  .mfp-img-mobile .mfp-figure:after {
+    top: 0;
+    bottom: 0; }
+  .mfp-img-mobile .mfp-figure small {
+    display: inline;
+    margin-left: 5px; }
+  .mfp-img-mobile .mfp-bottom-bar {
+    background: rgba(0, 0, 0, 0.6);
+    bottom: 0;
+    margin: 0;
+    top: auto;
+    padding: 3px 5px;
+    position: fixed;
+    box-sizing: border-box; }
+    .mfp-img-mobile .mfp-bottom-bar:empty {
+      padding: 0; }
+  .mfp-img-mobile .mfp-counter {
+    right: 5px;
+    top: 3px; }
+  .mfp-img-mobile .mfp-close {
+    top: 0;
+    right: 0;
+    width: 35px;
+    height: 35px;
+    line-height: 35px;
+    background: rgba(0, 0, 0, 0.6);
+    position: fixed;
+    text-align: center;
+    padding: 0; } }
+
+@media all and (max-width: 900px) {
+  .mfp-arrow {
+    -webkit-transform: scale(0.75);
+    transform: scale(0.75); }
+  .mfp-arrow-left {
+    -webkit-transform-origin: 0;
+    transform-origin: 0; }
+  .mfp-arrow-right {
+    -webkit-transform-origin: 100%;
+    transform-origin: 100%; }
+  .mfp-container {
+    padding-left: 6px;
+    padding-right: 6px; } }
diff --git a/docs/lib/magnific-popup/magnific-popup.js b/docs/lib/magnific-popup/magnific-popup.js
new file mode 100644
index 0000000..927b3c1
--- /dev/null
+++ b/docs/lib/magnific-popup/magnific-popup.js
@@ -0,0 +1,1860 @@
+/*! Magnific Popup - v1.1.0 - 2016-02-20
+* http://dimsemenov.com/plugins/magnific-popup/
+* Copyright (c) 2016 Dmitry Semenov; */
+;(function (factory) { 
+if (typeof define === 'function' && define.amd) { 
+ // AMD. Register as an anonymous module. 
+ define(['jquery'], factory); 
+ } else if (typeof exports === 'object') { 
+ // Node/CommonJS 
+ factory(require('jquery')); 
+ } else { 
+ // Browser globals 
+ factory(window.jQuery || window.Zepto); 
+ } 
+ }(function($) { 
+
+/*>>core*/
+/**
+ * 
+ * Magnific Popup Core JS file
+ * 
+ */
+
+
+/**
+ * Private static constants
+ */
+var CLOSE_EVENT = 'Close',
+	BEFORE_CLOSE_EVENT = 'BeforeClose',
+	AFTER_CLOSE_EVENT = 'AfterClose',
+	BEFORE_APPEND_EVENT = 'BeforeAppend',
+	MARKUP_PARSE_EVENT = 'MarkupParse',
+	OPEN_EVENT = 'Open',
+	CHANGE_EVENT = 'Change',
+	NS = 'mfp',
+	EVENT_NS = '.' + NS,
+	READY_CLASS = 'mfp-ready',
+	REMOVING_CLASS = 'mfp-removing',
+	PREVENT_CLOSE_CLASS = 'mfp-prevent-close';
+
+
+/**
+ * Private vars 
+ */
+/*jshint -W079 */
+var mfp, // As we have only one instance of MagnificPopup object, we define it locally to not to use 'this'
+	MagnificPopup = function(){},
+	_isJQ = !!(window.jQuery),
+	_prevStatus,
+	_window = $(window),
+	_document,
+	_prevContentType,
+	_wrapClasses,
+	_currPopupType;
+
+
+/**
+ * Private functions
+ */
+var _mfpOn = function(name, f) {
+		mfp.ev.on(NS + name + EVENT_NS, f);
+	},
+	_getEl = function(className, appendTo, html, raw) {
+		var el = document.createElement('div');
+		el.className = 'mfp-'+className;
+		if(html) {
+			el.innerHTML = html;
+		}
+		if(!raw) {
+			el = $(el);
+			if(appendTo) {
+				el.appendTo(appendTo);
+			}
+		} else if(appendTo) {
+			appendTo.appendChild(el);
+		}
+		return el;
+	},
+	_mfpTrigger = function(e, data) {
+		mfp.ev.triggerHandler(NS + e, data);
+
+		if(mfp.st.callbacks) {
+			// converts "mfpEventName" to "eventName" callback and triggers it if it's present
+			e = e.charAt(0).toLowerCase() + e.slice(1);
+			if(mfp.st.callbacks[e]) {
+				mfp.st.callbacks[e].apply(mfp, $.isArray(data) ? data : [data]);
+			}
+		}
+	},
+	_getCloseBtn = function(type) {
+		if(type !== _currPopupType || !mfp.currTemplate.closeBtn) {
+			mfp.currTemplate.closeBtn = $( mfp.st.closeMarkup.replace('%title%', mfp.st.tClose ) );
+			_currPopupType = type;
+		}
+		return mfp.currTemplate.closeBtn;
+	},
+	// Initialize Magnific Popup only when called at least once
+	_checkInstance = function() {
+		if(!$.magnificPopup.instance) {
+			/*jshint -W020 */
+			mfp = new MagnificPopup();
+			mfp.init();
+			$.magnificPopup.instance = mfp;
+		}
+	},
+	// CSS transition detection, http://stackoverflow.com/questions/7264899/detect-css-transitions-using-javascript-and-without-modernizr
+	supportsTransitions = function() {
+		var s = document.createElement('p').style, // 's' for style. better to create an element if body yet to exist
+			v = ['ms','O','Moz','Webkit']; // 'v' for vendor
+
+		if( s['transition'] !== undefined ) {
+			return true; 
+		}
+			
+		while( v.length ) {
+			if( v.pop() + 'Transition' in s ) {
+				return true;
+			}
+		}
+				
+		return false;
+	};
+
+
+
+/**
+ * Public functions
+ */
+MagnificPopup.prototype = {
+
+	constructor: MagnificPopup,
+
+	/**
+	 * Initializes Magnific Popup plugin. 
+	 * This function is triggered only once when $.fn.magnificPopup or $.magnificPopup is executed
+	 */
+	init: function() {
+		var appVersion = navigator.appVersion;
+		mfp.isLowIE = mfp.isIE8 = document.all && !document.addEventListener;
+		mfp.isAndroid = (/android/gi).test(appVersion);
+		mfp.isIOS = (/iphone|ipad|ipod/gi).test(appVersion);
+		mfp.supportsTransition = supportsTransitions();
+
+		// We disable fixed positioned lightbox on devices that don't handle it nicely.
+		// If you know a better way of detecting this - let me know.
+		mfp.probablyMobile = (mfp.isAndroid || mfp.isIOS || /(Opera Mini)|Kindle|webOS|BlackBerry|(Opera Mobi)|(Windows Phone)|IEMobile/i.test(navigator.userAgent) );
+		_document = $(document);
+
+		mfp.popupsCache = {};
+	},
+
+	/**
+	 * Opens popup
+	 * @param  data [description]
+	 */
+	open: function(data) {
+
+		var i;
+
+		if(data.isObj === false) { 
+			// convert jQuery collection to array to avoid conflicts later
+			mfp.items = data.items.toArray();
+
+			mfp.index = 0;
+			var items = data.items,
+				item;
+			for(i = 0; i < items.length; i++) {
+				item = items[i];
+				if(item.parsed) {
+					item = item.el[0];
+				}
+				if(item === data.el[0]) {
+					mfp.index = i;
+					break;
+				}
+			}
+		} else {
+			mfp.items = $.isArray(data.items) ? data.items : [data.items];
+			mfp.index = data.index || 0;
+		}
+
+		// if popup is already opened - we just update the content
+		if(mfp.isOpen) {
+			mfp.updateItemHTML();
+			return;
+		}
+		
+		mfp.types = []; 
+		_wrapClasses = '';
+		if(data.mainEl && data.mainEl.length) {
+			mfp.ev = data.mainEl.eq(0);
+		} else {
+			mfp.ev = _document;
+		}
+
+		if(data.key) {
+			if(!mfp.popupsCache[data.key]) {
+				mfp.popupsCache[data.key] = {};
+			}
+			mfp.currTemplate = mfp.popupsCache[data.key];
+		} else {
+			mfp.currTemplate = {};
+		}
+
+
+
+		mfp.st = $.extend(true, {}, $.magnificPopup.defaults, data ); 
+		mfp.fixedContentPos = mfp.st.fixedContentPos === 'auto' ? !mfp.probablyMobile : mfp.st.fixedContentPos;
+
+		if(mfp.st.modal) {
+			mfp.st.closeOnContentClick = false;
+			mfp.st.closeOnBgClick = false;
+			mfp.st.showCloseBtn = false;
+			mfp.st.enableEscapeKey = false;
+		}
+		
+
+		// Building markup
+		// main containers are created only once
+		if(!mfp.bgOverlay) {
+
+			// Dark overlay
+			mfp.bgOverlay = _getEl('bg').on('click'+EVENT_NS, function() {
+				mfp.close();
+			});
+
+			mfp.wrap = _getEl('wrap').attr('tabindex', -1).on('click'+EVENT_NS, function(e) {
+				if(mfp._checkIfClose(e.target)) {
+					mfp.close();
+				}
+			});
+
+			mfp.container = _getEl('container', mfp.wrap);
+		}
+
+		mfp.contentContainer = _getEl('content');
+		if(mfp.st.preloader) {
+			mfp.preloader = _getEl('preloader', mfp.container, mfp.st.tLoading);
+		}
+
+
+		// Initializing modules
+		var modules = $.magnificPopup.modules;
+		for(i = 0; i < modules.length; i++) {
+			var n = modules[i];
+			n = n.charAt(0).toUpperCase() + n.slice(1);
+			mfp['init'+n].call(mfp);
+		}
+		_mfpTrigger('BeforeOpen');
+
+
+		if(mfp.st.showCloseBtn) {
+			// Close button
+			if(!mfp.st.closeBtnInside) {
+				mfp.wrap.append( _getCloseBtn() );
+			} else {
+				_mfpOn(MARKUP_PARSE_EVENT, function(e, template, values, item) {
+					values.close_replaceWith = _getCloseBtn(item.type);
+				});
+				_wrapClasses += ' mfp-close-btn-in';
+			}
+		}
+
+		if(mfp.st.alignTop) {
+			_wrapClasses += ' mfp-align-top';
+		}
+
+	
+
+		if(mfp.fixedContentPos) {
+			mfp.wrap.css({
+				overflow: mfp.st.overflowY,
+				overflowX: 'hidden',
+				overflowY: mfp.st.overflowY
+			});
+		} else {
+			mfp.wrap.css({ 
+				top: _window.scrollTop(),
+				position: 'absolute'
+			});
+		}
+		if( mfp.st.fixedBgPos === false || (mfp.st.fixedBgPos === 'auto' && !mfp.fixedContentPos) ) {
+			mfp.bgOverlay.css({
+				height: _document.height(),
+				position: 'absolute'
+			});
+		}
+
+		
+
+		if(mfp.st.enableEscapeKey) {
+			// Close on ESC key
+			_document.on('keyup' + EVENT_NS, function(e) {
+				if(e.keyCode === 27) {
+					mfp.close();
+				}
+			});
+		}
+
+		_window.on('resize' + EVENT_NS, function() {
+			mfp.updateSize();
+		});
+
+
+		if(!mfp.st.closeOnContentClick) {
+			_wrapClasses += ' mfp-auto-cursor';
+		}
+		
+		if(_wrapClasses)
+			mfp.wrap.addClass(_wrapClasses);
+
+
+		// this triggers recalculation of layout, so we get it once to not to trigger twice
+		var windowHeight = mfp.wH = _window.height();
+
+		
+		var windowStyles = {};
+
+		if( mfp.fixedContentPos ) {
+            if(mfp._hasScrollBar(windowHeight)){
+                var s = mfp._getScrollbarSize();
+                if(s) {
+                    windowStyles.marginRight = s;
+                }
+            }
+        }
+
+		if(mfp.fixedContentPos) {
+			if(!mfp.isIE7) {
+				windowStyles.overflow = 'hidden';
+			} else {
+				// ie7 double-scroll bug
+				$('body, html').css('overflow', 'hidden');
+			}
+		}
+
+		
+		
+		var classesToadd = mfp.st.mainClass;
+		if(mfp.isIE7) {
+			classesToadd += ' mfp-ie7';
+		}
+		if(classesToadd) {
+			mfp._addClassToMFP( classesToadd );
+		}
+
+		// add content
+		mfp.updateItemHTML();
+
+		_mfpTrigger('BuildControls');
+
+		// remove scrollbar, add margin e.t.c
+		$('html').css(windowStyles);
+		
+		// add everything to DOM
+		mfp.bgOverlay.add(mfp.wrap).prependTo( mfp.st.prependTo || $(document.body) );
+
+		// Save last focused element
+		mfp._lastFocusedEl = document.activeElement;
+		
+		// Wait for next cycle to allow CSS transition
+		setTimeout(function() {
+			
+			if(mfp.content) {
+				mfp._addClassToMFP(READY_CLASS);
+				mfp._setFocus();
+			} else {
+				// if content is not defined (not loaded e.t.c) we add class only for BG
+				mfp.bgOverlay.addClass(READY_CLASS);
+			}
+			
+			// Trap the focus in popup
+			_document.on('focusin' + EVENT_NS, mfp._onFocusIn);
+
+		}, 16);
+
+		mfp.isOpen = true;
+		mfp.updateSize(windowHeight);
+		_mfpTrigger(OPEN_EVENT);
+
+		return data;
+	},
+
+	/**
+	 * Closes the popup
+	 */
+	close: function() {
+		if(!mfp.isOpen) return;
+		_mfpTrigger(BEFORE_CLOSE_EVENT);
+
+		mfp.isOpen = false;
+		// for CSS3 animation
+		if(mfp.st.removalDelay && !mfp.isLowIE && mfp.supportsTransition )  {
+			mfp._addClassToMFP(REMOVING_CLASS);
+			setTimeout(function() {
+				mfp._close();
+			}, mfp.st.removalDelay);
+		} else {
+			mfp._close();
+		}
+	},
+
+	/**
+	 * Helper for close() function
+	 */
+	_close: function() {
+		_mfpTrigger(CLOSE_EVENT);
+
+		var classesToRemove = REMOVING_CLASS + ' ' + READY_CLASS + ' ';
+
+		mfp.bgOverlay.detach();
+		mfp.wrap.detach();
+		mfp.container.empty();
+
+		if(mfp.st.mainClass) {
+			classesToRemove += mfp.st.mainClass + ' ';
+		}
+
+		mfp._removeClassFromMFP(classesToRemove);
+
+		if(mfp.fixedContentPos) {
+			var windowStyles = {marginRight: ''};
+			if(mfp.isIE7) {
+				$('body, html').css('overflow', '');
+			} else {
+				windowStyles.overflow = '';
+			}
+			$('html').css(windowStyles);
+		}
+		
+		_document.off('keyup' + EVENT_NS + ' focusin' + EVENT_NS);
+		mfp.ev.off(EVENT_NS);
+
+		// clean up DOM elements that aren't removed
+		mfp.wrap.attr('class', 'mfp-wrap').removeAttr('style');
+		mfp.bgOverlay.attr('class', 'mfp-bg');
+		mfp.container.attr('class', 'mfp-container');
+
+		// remove close button from target element
+		if(mfp.st.showCloseBtn &&
+		(!mfp.st.closeBtnInside || mfp.currTemplate[mfp.currItem.type] === true)) {
+			if(mfp.currTemplate.closeBtn)
+				mfp.currTemplate.closeBtn.detach();
+		}
+
+
+		if(mfp.st.autoFocusLast && mfp._lastFocusedEl) {
+			$(mfp._lastFocusedEl).focus(); // put tab focus back
+		}
+		mfp.currItem = null;	
+		mfp.content = null;
+		mfp.currTemplate = null;
+		mfp.prevHeight = 0;
+
+		_mfpTrigger(AFTER_CLOSE_EVENT);
+	},
+	
+	updateSize: function(winHeight) {
+
+		if(mfp.isIOS) {
+			// fixes iOS nav bars https://github.com/dimsemenov/Magnific-Popup/issues/2
+			var zoomLevel = document.documentElement.clientWidth / window.innerWidth;
+			var height = window.innerHeight * zoomLevel;
+			mfp.wrap.css('height', height);
+			mfp.wH = height;
+		} else {
+			mfp.wH = winHeight || _window.height();
+		}
+		// Fixes #84: popup incorrectly positioned with position:relative on body
+		if(!mfp.fixedContentPos) {
+			mfp.wrap.css('height', mfp.wH);
+		}
+
+		_mfpTrigger('Resize');
+
+	},
+
+	/**
+	 * Set content of popup based on current index
+	 */
+	updateItemHTML: function() {
+		var item = mfp.items[mfp.index];
+
+		// Detach and perform modifications
+		mfp.contentContainer.detach();
+
+		if(mfp.content)
+			mfp.content.detach();
+
+		if(!item.parsed) {
+			item = mfp.parseEl( mfp.index );
+		}
+
+		var type = item.type;
+
+		_mfpTrigger('BeforeChange', [mfp.currItem ? mfp.currItem.type : '', type]);
+		// BeforeChange event works like so:
+		// _mfpOn('BeforeChange', function(e, prevType, newType) { });
+
+		mfp.currItem = item;
+
+		if(!mfp.currTemplate[type]) {
+			var markup = mfp.st[type] ? mfp.st[type].markup : false;
+
+			// allows to modify markup
+			_mfpTrigger('FirstMarkupParse', markup);
+
+			if(markup) {
+				mfp.currTemplate[type] = $(markup);
+			} else {
+				// if there is no markup found we just define that template is parsed
+				mfp.currTemplate[type] = true;
+			}
+		}
+
+		if(_prevContentType && _prevContentType !== item.type) {
+			mfp.container.removeClass('mfp-'+_prevContentType+'-holder');
+		}
+
+		var newContent = mfp['get' + type.charAt(0).toUpperCase() + type.slice(1)](item, mfp.currTemplate[type]);
+		mfp.appendContent(newContent, type);
+
+		item.preloaded = true;
+
+		_mfpTrigger(CHANGE_EVENT, item);
+		_prevContentType = item.type;
+
+		// Append container back after its content changed
+		mfp.container.prepend(mfp.contentContainer);
+
+		_mfpTrigger('AfterChange');
+	},
+
+
+	/**
+	 * Set HTML content of popup
+	 */
+	appendContent: function(newContent, type) {
+		mfp.content = newContent;
+
+		if(newContent) {
+			if(mfp.st.showCloseBtn && mfp.st.closeBtnInside &&
+				mfp.currTemplate[type] === true) {
+				// if there is no markup, we just append close button element inside
+				if(!mfp.content.find('.mfp-close').length) {
+					mfp.content.append(_getCloseBtn());
+				}
+			} else {
+				mfp.content = newContent;
+			}
+		} else {
+			mfp.content = '';
+		}
+
+		_mfpTrigger(BEFORE_APPEND_EVENT);
+		mfp.container.addClass('mfp-'+type+'-holder');
+
+		mfp.contentContainer.append(mfp.content);
+	},
+
+
+	/**
+	 * Creates Magnific Popup data object based on given data
+	 * @param  {int} index Index of item to parse
+	 */
+	parseEl: function(index) {
+		var item = mfp.items[index],
+			type;
+
+		if(item.tagName) {
+			item = { el: $(item) };
+		} else {
+			type = item.type;
+			item = { data: item, src: item.src };
+		}
+
+		if(item.el) {
+			var types = mfp.types;
+
+			// check for 'mfp-TYPE' class
+			for(var i = 0; i < types.length; i++) {
+				if( item.el.hasClass('mfp-'+types[i]) ) {
+					type = types[i];
+					break;
+				}
+			}
+
+			item.src = item.el.attr('data-mfp-src');
+			if(!item.src) {
+				item.src = item.el.attr('href');
+			}
+		}
+
+		item.type = type || mfp.st.type || 'inline';
+		item.index = index;
+		item.parsed = true;
+		mfp.items[index] = item;
+		_mfpTrigger('ElementParse', item);
+
+		return mfp.items[index];
+	},
+
+
+	/**
+	 * Initializes single popup or a group of popups
+	 */
+	addGroup: function(el, options) {
+		var eHandler = function(e) {
+			e.mfpEl = this;
+			mfp._openClick(e, el, options);
+		};
+
+		if(!options) {
+			options = {};
+		}
+
+		var eName = 'click.magnificPopup';
+		options.mainEl = el;
+
+		if(options.items) {
+			options.isObj = true;
+			el.off(eName).on(eName, eHandler);
+		} else {
+			options.isObj = false;
+			if(options.delegate) {
+				el.off(eName).on(eName, options.delegate , eHandler);
+			} else {
+				options.items = el;
+				el.off(eName).on(eName, eHandler);
+			}
+		}
+	},
+	_openClick: function(e, el, options) {
+		var midClick = options.midClick !== undefined ? options.midClick : $.magnificPopup.defaults.midClick;
+
+
+		if(!midClick && ( e.which === 2 || e.ctrlKey || e.metaKey || e.altKey || e.shiftKey ) ) {
+			return;
+		}
+
+		var disableOn = options.disableOn !== undefined ? options.disableOn : $.magnificPopup.defaults.disableOn;
+
+		if(disableOn) {
+			if($.isFunction(disableOn)) {
+				if( !disableOn.call(mfp) ) {
+					return true;
+				}
+			} else { // else it's number
+				if( _window.width() < disableOn ) {
+					return true;
+				}
+			}
+		}
+
+		if(e.type) {
+			e.preventDefault();
+
+			// This will prevent popup from closing if element is inside and popup is already opened
+			if(mfp.isOpen) {
+				e.stopPropagation();
+			}
+		}
+
+		options.el = $(e.mfpEl);
+		if(options.delegate) {
+			options.items = el.find(options.delegate);
+		}
+		mfp.open(options);
+	},
+
+
+	/**
+	 * Updates text on preloader
+	 */
+	updateStatus: function(status, text) {
+
+		if(mfp.preloader) {
+			if(_prevStatus !== status) {
+				mfp.container.removeClass('mfp-s-'+_prevStatus);
+			}
+
+			if(!text && status === 'loading') {
+				text = mfp.st.tLoading;
+			}
+
+			var data = {
+				status: status,
+				text: text
+			};
+			// allows to modify status
+			_mfpTrigger('UpdateStatus', data);
+
+			status = data.status;
+			text = data.text;
+
+			mfp.preloader.html(text);
+
+			mfp.preloader.find('a').on('click', function(e) {
+				e.stopImmediatePropagation();
+			});
+
+			mfp.container.addClass('mfp-s-'+status);
+			_prevStatus = status;
+		}
+	},
+
+
+	/*
+		"Private" helpers that aren't private at all
+	 */
+	// Check to close popup or not
+	// "target" is an element that was clicked
+	_checkIfClose: function(target) {
+
+		if($(target).hasClass(PREVENT_CLOSE_CLASS)) {
+			return;
+		}
+
+		var closeOnContent = mfp.st.closeOnContentClick;
+		var closeOnBg = mfp.st.closeOnBgClick;
+
+		if(closeOnContent && closeOnBg) {
+			return true;
+		} else {
+
+			// We close the popup if click is on close button or on preloader. Or if there is no content.
+			if(!mfp.content || $(target).hasClass('mfp-close') || (mfp.preloader && target === mfp.preloader[0]) ) {
+				return true;
+			}
+
+			// if click is outside the content
+			if(  (target !== mfp.content[0] && !$.contains(mfp.content[0], target))  ) {
+				if(closeOnBg) {
+					// last check, if the clicked element is in DOM, (in case it's removed onclick)
+					if( $.contains(document, target) ) {
+						return true;
+					}
+				}
+			} else if(closeOnContent) {
+				return true;
+			}
+
+		}
+		return false;
+	},
+	_addClassToMFP: function(cName) {
+		mfp.bgOverlay.addClass(cName);
+		mfp.wrap.addClass(cName);
+	},
+	_removeClassFromMFP: function(cName) {
+		this.bgOverlay.removeClass(cName);
+		mfp.wrap.removeClass(cName);
+	},
+	_hasScrollBar: function(winHeight) {
+		return (  (mfp.isIE7 ? _document.height() : document.body.scrollHeight) > (winHeight || _window.height()) );
+	},
+	_setFocus: function() {
+		(mfp.st.focus ? mfp.content.find(mfp.st.focus).eq(0) : mfp.wrap).focus();
+	},
+	_onFocusIn: function(e) {
+		if( e.target !== mfp.wrap[0] && !$.contains(mfp.wrap[0], e.target) ) {
+			mfp._setFocus();
+			return false;
+		}
+	},
+	_parseMarkup: function(template, values, item) {
+		var arr;
+		if(item.data) {
+			values = $.extend(item.data, values);
+		}
+		_mfpTrigger(MARKUP_PARSE_EVENT, [template, values, item] );
+
+		$.each(values, function(key, value) {
+			if(value === undefined || value === false) {
+				return true;
+			}
+			arr = key.split('_');
+			if(arr.length > 1) {
+				var el = template.find(EVENT_NS + '-'+arr[0]);
+
+				if(el.length > 0) {
+					var attr = arr[1];
+					if(attr === 'replaceWith') {
+						if(el[0] !== value[0]) {
+							el.replaceWith(value);
+						}
+					} else if(attr === 'img') {
+						if(el.is('img')) {
+							el.attr('src', value);
+						} else {
+							el.replaceWith( $('<img>').attr('src', value).attr('class', el.attr('class')) );
+						}
+					} else {
+						el.attr(arr[1], value);
+					}
+				}
+
+			} else {
+				template.find(EVENT_NS + '-'+key).html(value);
+			}
+		});
+	},
+
+	_getScrollbarSize: function() {
+		// thx David
+		if(mfp.scrollbarSize === undefined) {
+			var scrollDiv = document.createElement("div");
+			scrollDiv.style.cssText = 'width: 99px; height: 99px; overflow: scroll; position: absolute; top: -9999px;';
+			document.body.appendChild(scrollDiv);
+			mfp.scrollbarSize = scrollDiv.offsetWidth - scrollDiv.clientWidth;
+			document.body.removeChild(scrollDiv);
+		}
+		return mfp.scrollbarSize;
+	}
+
+}; /* MagnificPopup core prototype end */
+
+
+
+
+/**
+ * Public static functions
+ */
+$.magnificPopup = {
+	instance: null,
+	proto: MagnificPopup.prototype,
+	modules: [],
+
+	open: function(options, index) {
+		_checkInstance();
+
+		if(!options) {
+			options = {};
+		} else {
+			options = $.extend(true, {}, options);
+		}
+
+		options.isObj = true;
+		options.index = index || 0;
+		return this.instance.open(options);
+	},
+
+	close: function() {
+		return $.magnificPopup.instance && $.magnificPopup.instance.close();
+	},
+
+	registerModule: function(name, module) {
+		if(module.options) {
+			$.magnificPopup.defaults[name] = module.options;
+		}
+		$.extend(this.proto, module.proto);
+		this.modules.push(name);
+	},
+
+	defaults: {
+
+		// Info about options is in docs:
+		// http://dimsemenov.com/plugins/magnific-popup/documentation.html#options
+
+		disableOn: 0,
+
+		key: null,
+
+		midClick: false,
+
+		mainClass: '',
+
+		preloader: true,
+
+		focus: '', // CSS selector of input to focus after popup is opened
+
+		closeOnContentClick: false,
+
+		closeOnBgClick: true,
+
+		closeBtnInside: true,
+
+		showCloseBtn: true,
+
+		enableEscapeKey: true,
+
+		modal: false,
+
+		alignTop: false,
+
+		removalDelay: 0,
+
+		prependTo: null,
+
+		fixedContentPos: 'auto',
+
+		fixedBgPos: 'auto',
+
+		overflowY: 'auto',
+
+		closeMarkup: '<button title="%title%" type="button" class="mfp-close">&#215;</button>',
+
+		tClose: 'Close (Esc)',
+
+		tLoading: 'Loading...',
+
+		autoFocusLast: true
+
+	}
+};
+
+
+
+$.fn.magnificPopup = function(options) {
+	_checkInstance();
+
+	var jqEl = $(this);
+
+	// We call some API method of first param is a string
+	if (typeof options === "string" ) {
+
+		if(options === 'open') {
+			var items,
+				itemOpts = _isJQ ? jqEl.data('magnificPopup') : jqEl[0].magnificPopup,
+				index = parseInt(arguments[1], 10) || 0;
+
+			if(itemOpts.items) {
+				items = itemOpts.items[index];
+			} else {
+				items = jqEl;
+				if(itemOpts.delegate) {
+					items = items.find(itemOpts.delegate);
+				}
+				items = items.eq( index );
+			}
+			mfp._openClick({mfpEl:items}, jqEl, itemOpts);
+		} else {
+			if(mfp.isOpen)
+				mfp[options].apply(mfp, Array.prototype.slice.call(arguments, 1));
+		}
+
+	} else {
+		// clone options obj
+		options = $.extend(true, {}, options);
+
+		/*
+		 * As Zepto doesn't support .data() method for objects
+		 * and it works only in normal browsers
+		 * we assign "options" object directly to the DOM element. FTW!
+		 */
+		if(_isJQ) {
+			jqEl.data('magnificPopup', options);
+		} else {
+			jqEl[0].magnificPopup = options;
+		}
+
+		mfp.addGroup(jqEl, options);
+
+	}
+	return jqEl;
+};
+
+/*>>core*/
+
+/*>>inline*/
+
+var INLINE_NS = 'inline',
+	_hiddenClass,
+	_inlinePlaceholder,
+	_lastInlineElement,
+	_putInlineElementsBack = function() {
+		if(_lastInlineElement) {
+			_inlinePlaceholder.after( _lastInlineElement.addClass(_hiddenClass) ).detach();
+			_lastInlineElement = null;
+		}
+	};
+
+$.magnificPopup.registerModule(INLINE_NS, {
+	options: {
+		hiddenClass: 'hide', // will be appended with `mfp-` prefix
+		markup: '',
+		tNotFound: 'Content not found'
+	},
+	proto: {
+
+		initInline: function() {
+			mfp.types.push(INLINE_NS);
+
+			_mfpOn(CLOSE_EVENT+'.'+INLINE_NS, function() {
+				_putInlineElementsBack();
+			});
+		},
+
+		getInline: function(item, template) {
+
+			_putInlineElementsBack();
+
+			if(item.src) {
+				var inlineSt = mfp.st.inline,
+					el = $(item.src);
+
+				if(el.length) {
+
+					// If target element has parent - we replace it with placeholder and put it back after popup is closed
+					var parent = el[0].parentNode;
+					if(parent && parent.tagName) {
+						if(!_inlinePlaceholder) {
+							_hiddenClass = inlineSt.hiddenClass;
+							_inlinePlaceholder = _getEl(_hiddenClass);
+							_hiddenClass = 'mfp-'+_hiddenClass;
+						}
+						// replace target inline element with placeholder
+						_lastInlineElement = el.after(_inlinePlaceholder).detach().removeClass(_hiddenClass);
+					}
+
+					mfp.updateStatus('ready');
+				} else {
+					mfp.updateStatus('error', inlineSt.tNotFound);
+					el = $('<div>');
+				}
+
+				item.inlineElement = el;
+				return el;
+			}
+
+			mfp.updateStatus('ready');
+			mfp._parseMarkup(template, {}, item);
+			return template;
+		}
+	}
+});
+
+/*>>inline*/
+
+/*>>ajax*/
+var AJAX_NS = 'ajax',
+	_ajaxCur,
+	_removeAjaxCursor = function() {
+		if(_ajaxCur) {
+			$(document.body).removeClass(_ajaxCur);
+		}
+	},
+	_destroyAjaxRequest = function() {
+		_removeAjaxCursor();
+		if(mfp.req) {
+			mfp.req.abort();
+		}
+	};
+
+$.magnificPopup.registerModule(AJAX_NS, {
+
+	options: {
+		settings: null,
+		cursor: 'mfp-ajax-cur',
+		tError: '<a href="%url%">The content</a> could not be loaded.'
+	},
+
+	proto: {
+		initAjax: function() {
+			mfp.types.push(AJAX_NS);
+			_ajaxCur = mfp.st.ajax.cursor;
+
+			_mfpOn(CLOSE_EVENT+'.'+AJAX_NS, _destroyAjaxRequest);
+			_mfpOn('BeforeChange.' + AJAX_NS, _destroyAjaxRequest);
+		},
+		getAjax: function(item) {
+
+			if(_ajaxCur) {
+				$(document.body).addClass(_ajaxCur);
+			}
+
+			mfp.updateStatus('loading');
+
+			var opts = $.extend({
+				url: item.src,
+				success: function(data, textStatus, jqXHR) {
+					var temp = {
+						data:data,
+						xhr:jqXHR
+					};
+
+					_mfpTrigger('ParseAjax', temp);
+
+					mfp.appendContent( $(temp.data), AJAX_NS );
+
+					item.finished = true;
+
+					_removeAjaxCursor();
+
+					mfp._setFocus();
+
+					setTimeout(function() {
+						mfp.wrap.addClass(READY_CLASS);
+					}, 16);
+
+					mfp.updateStatus('ready');
+
+					_mfpTrigger('AjaxContentAdded');
+				},
+				error: function() {
+					_removeAjaxCursor();
+					item.finished = item.loadError = true;
+					mfp.updateStatus('error', mfp.st.ajax.tError.replace('%url%', item.src));
+				}
+			}, mfp.st.ajax.settings);
+
+			mfp.req = $.ajax(opts);
+
+			return '';
+		}
+	}
+});
+
+/*>>ajax*/
+
+/*>>image*/
+var _imgInterval,
+	_getTitle = function(item) {
+		if(item.data && item.data.title !== undefined)
+			return item.data.title;
+
+		var src = mfp.st.image.titleSrc;
+
+		if(src) {
+			if($.isFunction(src)) {
+				return src.call(mfp, item);
+			} else if(item.el) {
+				return item.el.attr(src) || '';
+			}
+		}
+		return '';
+	};
+
+$.magnificPopup.registerModule('image', {
+
+	options: {
+		markup: '<div class="mfp-figure">'+
+					'<div class="mfp-close"></div>'+
+					'<figure>'+
+						'<div class="mfp-img"></div>'+
+						'<figcaption>'+
+							'<div class="mfp-bottom-bar">'+
+								'<div class="mfp-title"></div>'+
+								'<div class="mfp-counter"></div>'+
+							'</div>'+
+						'</figcaption>'+
+					'</figure>'+
+				'</div>',
+		cursor: 'mfp-zoom-out-cur',
+		titleSrc: 'title',
+		verticalFit: true,
+		tError: '<a href="%url%">The image</a> could not be loaded.'
+	},
+
+	proto: {
+		initImage: function() {
+			var imgSt = mfp.st.image,
+				ns = '.image';
+
+			mfp.types.push('image');
+
+			_mfpOn(OPEN_EVENT+ns, function() {
+				if(mfp.currItem.type === 'image' && imgSt.cursor) {
+					$(document.body).addClass(imgSt.cursor);
+				}
+			});
+
+			_mfpOn(CLOSE_EVENT+ns, function() {
+				if(imgSt.cursor) {
+					$(document.body).removeClass(imgSt.cursor);
+				}
+				_window.off('resize' + EVENT_NS);
+			});
+
+			_mfpOn('Resize'+ns, mfp.resizeImage);
+			if(mfp.isLowIE) {
+				_mfpOn('AfterChange', mfp.resizeImage);
+			}
+		},
+		resizeImage: function() {
+			var item = mfp.currItem;
+			if(!item || !item.img) return;
+
+			if(mfp.st.image.verticalFit) {
+				var decr = 0;
+				// fix box-sizing in ie7/8
+				if(mfp.isLowIE) {
+					decr = parseInt(item.img.css('padding-top'), 10) + parseInt(item.img.css('padding-bottom'),10);
+				}
+				item.img.css('max-height', mfp.wH-decr);
+			}
+		},
+		_onImageHasSize: function(item) {
+			if(item.img) {
+
+				item.hasSize = true;
+
+				if(_imgInterval) {
+					clearInterval(_imgInterval);
+				}
+
+				item.isCheckingImgSize = false;
+
+				_mfpTrigger('ImageHasSize', item);
+
+				if(item.imgHidden) {
+					if(mfp.content)
+						mfp.content.removeClass('mfp-loading');
+
+					item.imgHidden = false;
+				}
+
+			}
+		},
+
+		/**
+		 * Function that loops until the image has size to display elements that rely on it asap
+		 */
+		findImageSize: function(item) {
+
+			var counter = 0,
+				img = item.img[0],
+				mfpSetInterval = function(delay) {
+
+					if(_imgInterval) {
+						clearInterval(_imgInterval);
+					}
+					// decelerating interval that checks for size of an image
+					_imgInterval = setInterval(function() {
+						if(img.naturalWidth > 0) {
+							mfp._onImageHasSize(item);
+							return;
+						}
+
+						if(counter > 200) {
+							clearInterval(_imgInterval);
+						}
+
+						counter++;
+						if(counter === 3) {
+							mfpSetInterval(10);
+						} else if(counter === 40) {
+							mfpSetInterval(50);
+						} else if(counter === 100) {
+							mfpSetInterval(500);
+						}
+					}, delay);
+				};
+
+			mfpSetInterval(1);
+		},
+
+		getImage: function(item, template) {
+
+			var guard = 0,
+
+				// image load complete handler
+				onLoadComplete = function() {
+					if(item) {
+						if (item.img[0].complete) {
+							item.img.off('.mfploader');
+
+							if(item === mfp.currItem){
+								mfp._onImageHasSize(item);
+
+								mfp.updateStatus('ready');
+							}
+
+							item.hasSize = true;
+							item.loaded = true;
+
+							_mfpTrigger('ImageLoadComplete');
+
+						}
+						else {
+							// if image complete check fails 200 times (20 sec), we assume that there was an error.
+							guard++;
+							if(guard < 200) {
+								setTimeout(onLoadComplete,100);
+							} else {
+								onLoadError();
+							}
+						}
+					}
+				},
+
+				// image error handler
+				onLoadError = function() {
+					if(item) {
+						item.img.off('.mfploader');
+						if(item === mfp.currItem){
+							mfp._onImageHasSize(item);
+							mfp.updateStatus('error', imgSt.tError.replace('%url%', item.src) );
+						}
+
+						item.hasSize = true;
+						item.loaded = true;
+						item.loadError = true;
+					}
+				},
+				imgSt = mfp.st.image;
+
+
+			var el = template.find('.mfp-img');
+			if(el.length) {
+				var img = document.createElement('img');
+				img.className = 'mfp-img';
+				if(item.el && item.el.find('img').length) {
+					img.alt = item.el.find('img').attr('alt');
+				}
+				item.img = $(img).on('load.mfploader', onLoadComplete).on('error.mfploader', onLoadError);
+				img.src = item.src;
+
+				// without clone() "error" event is not firing when IMG is replaced by new IMG
+				// TODO: find a way to avoid such cloning
+				if(el.is('img')) {
+					item.img = item.img.clone();
+				}
+
+				img = item.img[0];
+				if(img.naturalWidth > 0) {
+					item.hasSize = true;
+				} else if(!img.width) {
+					item.hasSize = false;
+				}
+			}
+
+			mfp._parseMarkup(template, {
+				title: _getTitle(item),
+				img_replaceWith: item.img
+			}, item);
+
+			mfp.resizeImage();
+
+			if(item.hasSize) {
+				if(_imgInterval) clearInterval(_imgInterval);
+
+				if(item.loadError) {
+					template.addClass('mfp-loading');
+					mfp.updateStatus('error', imgSt.tError.replace('%url%', item.src) );
+				} else {
+					template.removeClass('mfp-loading');
+					mfp.updateStatus('ready');
+				}
+				return template;
+			}
+
+			mfp.updateStatus('loading');
+			item.loading = true;
+
+			if(!item.hasSize) {
+				item.imgHidden = true;
+				template.addClass('mfp-loading');
+				mfp.findImageSize(item);
+			}
+
+			return template;
+		}
+	}
+});
+
+/*>>image*/
+
+/*>>zoom*/
+var hasMozTransform,
+	getHasMozTransform = function() {
+		if(hasMozTransform === undefined) {
+			hasMozTransform = document.createElement('p').style.MozTransform !== undefined;
+		}
+		return hasMozTransform;
+	};
+
+$.magnificPopup.registerModule('zoom', {
+
+	options: {
+		enabled: false,
+		easing: 'ease-in-out',
+		duration: 300,
+		opener: function(element) {
+			return element.is('img') ? element : element.find('img');
+		}
+	},
+
+	proto: {
+
+		initZoom: function() {
+			var zoomSt = mfp.st.zoom,
+				ns = '.zoom',
+				image;
+
+			if(!zoomSt.enabled || !mfp.supportsTransition) {
+				return;
+			}
+
+			var duration = zoomSt.duration,
+				getElToAnimate = function(image) {
+					var newImg = image.clone().removeAttr('style').removeAttr('class').addClass('mfp-animated-image'),
+						transition = 'all '+(zoomSt.duration/1000)+'s ' + zoomSt.easing,
+						cssObj = {
+							position: 'fixed',
+							zIndex: 9999,
+							left: 0,
+							top: 0,
+							'-webkit-backface-visibility': 'hidden'
+						},
+						t = 'transition';
+
+					cssObj['-webkit-'+t] = cssObj['-moz-'+t] = cssObj['-o-'+t] = cssObj[t] = transition;
+
+					newImg.css(cssObj);
+					return newImg;
+				},
+				showMainContent = function() {
+					mfp.content.css('visibility', 'visible');
+				},
+				openTimeout,
+				animatedImg;
+
+			_mfpOn('BuildControls'+ns, function() {
+				if(mfp._allowZoom()) {
+
+					clearTimeout(openTimeout);
+					mfp.content.css('visibility', 'hidden');
+
+					// Basically, all code below does is clones existing image, puts in on top of the current one and animated it
+
+					image = mfp._getItemToZoom();
+
+					if(!image) {
+						showMainContent();
+						return;
+					}
+
+					animatedImg = getElToAnimate(image);
+
+					animatedImg.css( mfp._getOffset() );
+
+					mfp.wrap.append(animatedImg);
+
+					openTimeout = setTimeout(function() {
+						animatedImg.css( mfp._getOffset( true ) );
+						openTimeout = setTimeout(function() {
+
+							showMainContent();
+
+							setTimeout(function() {
+								animatedImg.remove();
+								image = animatedImg = null;
+								_mfpTrigger('ZoomAnimationEnded');
+							}, 16); // avoid blink when switching images
+
+						}, duration); // this timeout equals animation duration
+
+					}, 16); // by adding this timeout we avoid short glitch at the beginning of animation
+
+
+					// Lots of timeouts...
+				}
+			});
+			_mfpOn(BEFORE_CLOSE_EVENT+ns, function() {
+				if(mfp._allowZoom()) {
+
+					clearTimeout(openTimeout);
+
+					mfp.st.removalDelay = duration;
+
+					if(!image) {
+						image = mfp._getItemToZoom();
+						if(!image) {
+							return;
+						}
+						animatedImg = getElToAnimate(image);
+					}
+
+					animatedImg.css( mfp._getOffset(true) );
+					mfp.wrap.append(animatedImg);
+					mfp.content.css('visibility', 'hidden');
+
+					setTimeout(function() {
+						animatedImg.css( mfp._getOffset() );
+					}, 16);
+				}
+
+			});
+
+			_mfpOn(CLOSE_EVENT+ns, function() {
+				if(mfp._allowZoom()) {
+					showMainContent();
+					if(animatedImg) {
+						animatedImg.remove();
+					}
+					image = null;
+				}
+			});
+		},
+
+		_allowZoom: function() {
+			return mfp.currItem.type === 'image';
+		},
+
+		_getItemToZoom: function() {
+			if(mfp.currItem.hasSize) {
+				return mfp.currItem.img;
+			} else {
+				return false;
+			}
+		},
+
+		// Get element postion relative to viewport
+		_getOffset: function(isLarge) {
+			var el;
+			if(isLarge) {
+				el = mfp.currItem.img;
+			} else {
+				el = mfp.st.zoom.opener(mfp.currItem.el || mfp.currItem);
+			}
+
+			var offset = el.offset();
+			var paddingTop = parseInt(el.css('padding-top'),10);
+			var paddingBottom = parseInt(el.css('padding-bottom'),10);
+			offset.top -= ( $(window).scrollTop() - paddingTop );
+
+
+			/*
+
+			Animating left + top + width/height looks glitchy in Firefox, but perfect in Chrome. And vice-versa.
+
+			 */
+			var obj = {
+				width: el.width(),
+				// fix Zepto height+padding issue
+				height: (_isJQ ? el.innerHeight() : el[0].offsetHeight) - paddingBottom - paddingTop
+			};
+
+			// I hate to do this, but there is no another option
+			if( getHasMozTransform() ) {
+				obj['-moz-transform'] = obj['transform'] = 'translate(' + offset.left + 'px,' + offset.top + 'px)';
+			} else {
+				obj.left = offset.left;
+				obj.top = offset.top;
+			}
+			return obj;
+		}
+
+	}
+});
+
+
+
+/*>>zoom*/
+
+/*>>iframe*/
+
+var IFRAME_NS = 'iframe',
+	_emptyPage = '//about:blank',
+
+	_fixIframeBugs = function(isShowing) {
+		if(mfp.currTemplate[IFRAME_NS]) {
+			var el = mfp.currTemplate[IFRAME_NS].find('iframe');
+			if(el.length) {
+				// reset src after the popup is closed to avoid "video keeps playing after popup is closed" bug
+				if(!isShowing) {
+					el[0].src = _emptyPage;
+				}
+
+				// IE8 black screen bug fix
+				if(mfp.isIE8) {
+					el.css('display', isShowing ? 'block' : 'none');
+				}
+			}
+		}
+	};
+
+$.magnificPopup.registerModule(IFRAME_NS, {
+
+	options: {
+		markup: '<div class="mfp-iframe-scaler">'+
+					'<div class="mfp-close"></div>'+
+					'<iframe class="mfp-iframe" src="//about:blank" frameborder="0" allowfullscreen></iframe>'+
+				'</div>',
+
+		srcAction: 'iframe_src',
+
+		// we don't care and support only one default type of URL by default
+		patterns: {
+			youtube: {
+				index: 'youtube.com',
+				id: 'v=',
+				src: '//www.youtube.com/embed/%id%?autoplay=1'
+			},
+			vimeo: {
+				index: 'vimeo.com/',
+				id: '/',
+				src: '//player.vimeo.com/video/%id%?autoplay=1'
+			},
+			gmaps: {
+				index: '//maps.google.',
+				src: '%id%&output=embed'
+			}
+		}
+	},
+
+	proto: {
+		initIframe: function() {
+			mfp.types.push(IFRAME_NS);
+
+			_mfpOn('BeforeChange', function(e, prevType, newType) {
+				if(prevType !== newType) {
+					if(prevType === IFRAME_NS) {
+						_fixIframeBugs(); // iframe if removed
+					} else if(newType === IFRAME_NS) {
+						_fixIframeBugs(true); // iframe is showing
+					}
+				}// else {
+					// iframe source is switched, don't do anything
+				//}
+			});
+
+			_mfpOn(CLOSE_EVENT + '.' + IFRAME_NS, function() {
+				_fixIframeBugs();
+			});
+		},
+
+		getIframe: function(item, template) {
+			var embedSrc = item.src;
+			var iframeSt = mfp.st.iframe;
+
+			$.each(iframeSt.patterns, function() {
+				if(embedSrc.indexOf( this.index ) > -1) {
+					if(this.id) {
+						if(typeof this.id === 'string') {
+							embedSrc = embedSrc.substr(embedSrc.lastIndexOf(this.id)+this.id.length, embedSrc.length);
+						} else {
+							embedSrc = this.id.call( this, embedSrc );
+						}
+					}
+					embedSrc = this.src.replace('%id%', embedSrc );
+					return false; // break;
+				}
+			});
+
+			var dataObj = {};
+			if(iframeSt.srcAction) {
+				dataObj[iframeSt.srcAction] = embedSrc;
+			}
+			mfp._parseMarkup(template, dataObj, item);
+
+			mfp.updateStatus('ready');
+
+			return template;
+		}
+	}
+});
+
+
+
+/*>>iframe*/
+
+/*>>gallery*/
+/**
+ * Get looped index depending on number of slides
+ */
+var _getLoopedId = function(index) {
+		var numSlides = mfp.items.length;
+		if(index > numSlides - 1) {
+			return index - numSlides;
+		} else  if(index < 0) {
+			return numSlides + index;
+		}
+		return index;
+	},
+	_replaceCurrTotal = function(text, curr, total) {
+		return text.replace(/%curr%/gi, curr + 1).replace(/%total%/gi, total);
+	};
+
+$.magnificPopup.registerModule('gallery', {
+
+	options: {
+		enabled: false,
+		arrowMarkup: '<button title="%title%" type="button" class="mfp-arrow mfp-arrow-%dir%"></button>',
+		preload: [0,2],
+		navigateByImgClick: true,
+		arrows: true,
+
+		tPrev: 'Previous (Left arrow key)',
+		tNext: 'Next (Right arrow key)',
+		tCounter: '%curr% of %total%'
+	},
+
+	proto: {
+		initGallery: function() {
+
+			var gSt = mfp.st.gallery,
+				ns = '.mfp-gallery';
+
+			mfp.direction = true; // true - next, false - prev
+
+			if(!gSt || !gSt.enabled ) return false;
+
+			_wrapClasses += ' mfp-gallery';
+
+			_mfpOn(OPEN_EVENT+ns, function() {
+
+				if(gSt.navigateByImgClick) {
+					mfp.wrap.on('click'+ns, '.mfp-img', function() {
+						if(mfp.items.length > 1) {
+							mfp.next();
+							return false;
+						}
+					});
+				}
+
+				_document.on('keydown'+ns, function(e) {
+					if (e.keyCode === 37) {
+						mfp.prev();
+					} else if (e.keyCode === 39) {
+						mfp.next();
+					}
+				});
+			});
+
+			_mfpOn('UpdateStatus'+ns, function(e, data) {
+				if(data.text) {
+					data.text = _replaceCurrTotal(data.text, mfp.currItem.index, mfp.items.length);
+				}
+			});
+
+			_mfpOn(MARKUP_PARSE_EVENT+ns, function(e, element, values, item) {
+				var l = mfp.items.length;
+				values.counter = l > 1 ? _replaceCurrTotal(gSt.tCounter, item.index, l) : '';
+			});
+
+			_mfpOn('BuildControls' + ns, function() {
+				if(mfp.items.length > 1 && gSt.arrows && !mfp.arrowLeft) {
+					var markup = gSt.arrowMarkup,
+						arrowLeft = mfp.arrowLeft = $( markup.replace(/%title%/gi, gSt.tPrev).replace(/%dir%/gi, 'left') ).addClass(PREVENT_CLOSE_CLASS),
+						arrowRight = mfp.arrowRight = $( markup.replace(/%title%/gi, gSt.tNext).replace(/%dir%/gi, 'right') ).addClass(PREVENT_CLOSE_CLASS);
+
+					arrowLeft.click(function() {
+						mfp.prev();
+					});
+					arrowRight.click(function() {
+						mfp.next();
+					});
+
+					mfp.container.append(arrowLeft.add(arrowRight));
+				}
+			});
+
+			_mfpOn(CHANGE_EVENT+ns, function() {
+				if(mfp._preloadTimeout) clearTimeout(mfp._preloadTimeout);
+
+				mfp._preloadTimeout = setTimeout(function() {
+					mfp.preloadNearbyImages();
+					mfp._preloadTimeout = null;
+				}, 16);
+			});
+
+
+			_mfpOn(CLOSE_EVENT+ns, function() {
+				_document.off(ns);
+				mfp.wrap.off('click'+ns);
+				mfp.arrowRight = mfp.arrowLeft = null;
+			});
+
+		},
+		next: function() {
+			mfp.direction = true;
+			mfp.index = _getLoopedId(mfp.index + 1);
+			mfp.updateItemHTML();
+		},
+		prev: function() {
+			mfp.direction = false;
+			mfp.index = _getLoopedId(mfp.index - 1);
+			mfp.updateItemHTML();
+		},
+		goTo: function(newIndex) {
+			mfp.direction = (newIndex >= mfp.index);
+			mfp.index = newIndex;
+			mfp.updateItemHTML();
+		},
+		preloadNearbyImages: function() {
+			var p = mfp.st.gallery.preload,
+				preloadBefore = Math.min(p[0], mfp.items.length),
+				preloadAfter = Math.min(p[1], mfp.items.length),
+				i;
+
+			for(i = 1; i <= (mfp.direction ? preloadAfter : preloadBefore); i++) {
+				mfp._preloadItem(mfp.index+i);
+			}
+			for(i = 1; i <= (mfp.direction ? preloadBefore : preloadAfter); i++) {
+				mfp._preloadItem(mfp.index-i);
+			}
+		},
+		_preloadItem: function(index) {
+			index = _getLoopedId(index);
+
+			if(mfp.items[index].preloaded) {
+				return;
+			}
+
+			var item = mfp.items[index];
+			if(!item.parsed) {
+				item = mfp.parseEl( index );
+			}
+
+			_mfpTrigger('LazyLoad', item);
+
+			if(item.type === 'image') {
+				item.img = $('<img class="mfp-img" />').on('load.mfploader', function() {
+					item.hasSize = true;
+				}).on('error.mfploader', function() {
+					item.hasSize = true;
+					item.loadError = true;
+					_mfpTrigger('LazyLoadError', item);
+				}).attr('src', item.src);
+			}
+
+
+			item.preloaded = true;
+		}
+	}
+});
+
+/*>>gallery*/
+
+/*>>retina*/
+
+var RETINA_NS = 'retina';
+
+$.magnificPopup.registerModule(RETINA_NS, {
+	options: {
+		replaceSrc: function(item) {
+			return item.src.replace(/\.\w+$/, function(m) { return '@2x' + m; });
+		},
+		ratio: 1 // Function or number.  Set to 1 to disable.
+	},
+	proto: {
+		initRetina: function() {
+			if(window.devicePixelRatio > 1) {
+
+				var st = mfp.st.retina,
+					ratio = st.ratio;
+
+				ratio = !isNaN(ratio) ? ratio : ratio();
+
+				if(ratio > 1) {
+					_mfpOn('ImageHasSize' + '.' + RETINA_NS, function(e, item) {
+						item.img.css({
+							'max-width': item.img[0].naturalWidth / ratio,
+							'width': '100%'
+						});
+					});
+					_mfpOn('ElementParse' + '.' + RETINA_NS, function(e, item) {
+						item.src = st.replaceSrc(item, ratio);
+					});
+				}
+			}
+
+		}
+	}
+});
+
+/*>>retina*/
+ _checkInstance(); }));
\ No newline at end of file
diff --git a/docs/lib/magnific-popup/magnific-popup.min.js b/docs/lib/magnific-popup/magnific-popup.min.js
new file mode 100644
index 0000000..6ee3a3b
--- /dev/null
+++ b/docs/lib/magnific-popup/magnific-popup.min.js
@@ -0,0 +1,4 @@
+/*! Magnific Popup - v1.1.0 - 2016-02-20
+* http://dimsemenov.com/plugins/magnific-popup/
+* Copyright (c) 2016 Dmitry Semenov; */
+!function(a){"function"==typeof define&&define.amd?define(["jquery"],a):a("object"==typeof exports?require("jquery"):window.jQuery||window.Zepto)}(function(a){var b,c,d,e,f,g,h="Close",i="BeforeClose",j="AfterClose",k="BeforeAppend",l="MarkupParse",m="Open",n="Change",o="mfp",p="."+o,q="mfp-ready",r="mfp-removing",s="mfp-prevent-close",t=function(){},u=!!window.jQuery,v=a(window),w=function(a,c){b.ev.on(o+a+p,c)},x=function(b,c,d,e){var f=document.createElement("div");return f.className="mfp-"+b,d&&(f.innerHTML=d),e?c&&c.appendChild(f):(f=a(f),c&&f.appendTo(c)),f},y=function(c,d){b.ev.triggerHandler(o+c,d),b.st.callbacks&&(c=c.charAt(0).toLowerCase()+c.slice(1),b.st.callbacks[c]&&b.st.callbacks[c].apply(b,a.isArray(d)?d:[d]))},z=function(c){return c===g&&b.currTemplate.closeBtn||(b.currTemplate.closeBtn=a(b.st.closeMarkup.replace("%title%",b.st.tClose)),g=c),b.currTemplate.closeBtn},A=function(){a.magnificPopup.instance||(b=new t,b.init(),a.magnificPopup.instance=b)},B=function(){var a=document.createElement("p").style,b=["ms","O","Moz","Webkit"];if(void 0!==a.transition)return!0;for(;b.length;)if(b.pop()+"Transition"in a)return!0;return!1};t.prototype={constructor:t,init:function(){var c=navigator.appVersion;b.isLowIE=b.isIE8=document.all&&!document.addEventListener,b.isAndroid=/android/gi.test(c),b.isIOS=/iphone|ipad|ipod/gi.test(c),b.supportsTransition=B(),b.probablyMobile=b.isAndroid||b.isIOS||/(Opera Mini)|Kindle|webOS|BlackBerry|(Opera Mobi)|(Windows Phone)|IEMobile/i.test(navigator.userAgent),d=a(document),b.popupsCache={}},open:function(c){var e;if(c.isObj===!1){b.items=c.items.toArray(),b.index=0;var g,h=c.items;for(e=0;e<h.length;e++)if(g=h[e],g.parsed&&(g=g.el[0]),g===c.el[0]){b.index=e;break}}else b.items=a.isArray(c.items)?c.items:[c.items],b.index=c.index||0;if(b.isOpen)return void b.updateItemHTML();b.types=[],f="",c.mainEl&&c.mainEl.length?b.ev=c.mainEl.eq(0):b.ev=d,c.key?(b.popupsCache[c.key]||(b.popupsCache[c.key]={}),b.currTemplate=b.popupsCache[c.key]):b.currTemplate={},b.st=a.extend(!0,{},a.magnificPopup.defaults,c),b.fixedContentPos="auto"===b.st.fixedContentPos?!b.probablyMobile:b.st.fixedContentPos,b.st.modal&&(b.st.closeOnContentClick=!1,b.st.closeOnBgClick=!1,b.st.showCloseBtn=!1,b.st.enableEscapeKey=!1),b.bgOverlay||(b.bgOverlay=x("bg").on("click"+p,function(){b.close()}),b.wrap=x("wrap").attr("tabindex",-1).on("click"+p,function(a){b._checkIfClose(a.target)&&b.close()}),b.container=x("container",b.wrap)),b.contentContainer=x("content"),b.st.preloader&&(b.preloader=x("preloader",b.container,b.st.tLoading));var i=a.magnificPopup.modules;for(e=0;e<i.length;e++){var j=i[e];j=j.charAt(0).toUpperCase()+j.slice(1),b["init"+j].call(b)}y("BeforeOpen"),b.st.showCloseBtn&&(b.st.closeBtnInside?(w(l,function(a,b,c,d){c.close_replaceWith=z(d.type)}),f+=" mfp-close-btn-in"):b.wrap.append(z())),b.st.alignTop&&(f+=" mfp-align-top"),b.fixedContentPos?b.wrap.css({overflow:b.st.overflowY,overflowX:"hidden",overflowY:b.st.overflowY}):b.wrap.css({top:v.scrollTop(),position:"absolute"}),(b.st.fixedBgPos===!1||"auto"===b.st.fixedBgPos&&!b.fixedContentPos)&&b.bgOverlay.css({height:d.height(),position:"absolute"}),b.st.enableEscapeKey&&d.on("keyup"+p,function(a){27===a.keyCode&&b.close()}),v.on("resize"+p,function(){b.updateSize()}),b.st.closeOnContentClick||(f+=" mfp-auto-cursor"),f&&b.wrap.addClass(f);var k=b.wH=v.height(),n={};if(b.fixedContentPos&&b._hasScrollBar(k)){var o=b._getScrollbarSize();o&&(n.marginRight=o)}b.fixedContentPos&&(b.isIE7?a("body, html").css("overflow","hidden"):n.overflow="hidden");var r=b.st.mainClass;return b.isIE7&&(r+=" mfp-ie7"),r&&b._addClassToMFP(r),b.updateItemHTML(),y("BuildControls"),a("html").css(n),b.bgOverlay.add(b.wrap).prependTo(b.st.prependTo||a(document.body)),b._lastFocusedEl=document.activeElement,setTimeout(function(){b.content?(b._addClassToMFP(q),b._setFocus()):b.bgOverlay.addClass(q),d.on("focusin"+p,b._onFocusIn)},16),b.isOpen=!0,b.updateSize(k),y(m),c},close:function(){b.isOpen&&(y(i),b.isOpen=!1,b.st.removalDelay&&!b.isLowIE&&b.supportsTransition?(b._addClassToMFP(r),setTimeout(function(){b._close()},b.st.removalDelay)):b._close())},_close:function(){y(h);var c=r+" "+q+" ";if(b.bgOverlay.detach(),b.wrap.detach(),b.container.empty(),b.st.mainClass&&(c+=b.st.mainClass+" "),b._removeClassFromMFP(c),b.fixedContentPos){var e={marginRight:""};b.isIE7?a("body, html").css("overflow",""):e.overflow="",a("html").css(e)}d.off("keyup"+p+" focusin"+p),b.ev.off(p),b.wrap.attr("class","mfp-wrap").removeAttr("style"),b.bgOverlay.attr("class","mfp-bg"),b.container.attr("class","mfp-container"),!b.st.showCloseBtn||b.st.closeBtnInside&&b.currTemplate[b.currItem.type]!==!0||b.currTemplate.closeBtn&&b.currTemplate.closeBtn.detach(),b.st.autoFocusLast&&b._lastFocusedEl&&a(b._lastFocusedEl).focus(),b.currItem=null,b.content=null,b.currTemplate=null,b.prevHeight=0,y(j)},updateSize:function(a){if(b.isIOS){var c=document.documentElement.clientWidth/window.innerWidth,d=window.innerHeight*c;b.wrap.css("height",d),b.wH=d}else b.wH=a||v.height();b.fixedContentPos||b.wrap.css("height",b.wH),y("Resize")},updateItemHTML:function(){var c=b.items[b.index];b.contentContainer.detach(),b.content&&b.content.detach(),c.parsed||(c=b.parseEl(b.index));var d=c.type;if(y("BeforeChange",[b.currItem?b.currItem.type:"",d]),b.currItem=c,!b.currTemplate[d]){var f=b.st[d]?b.st[d].markup:!1;y("FirstMarkupParse",f),f?b.currTemplate[d]=a(f):b.currTemplate[d]=!0}e&&e!==c.type&&b.container.removeClass("mfp-"+e+"-holder");var g=b["get"+d.charAt(0).toUpperCase()+d.slice(1)](c,b.currTemplate[d]);b.appendContent(g,d),c.preloaded=!0,y(n,c),e=c.type,b.container.prepend(b.contentContainer),y("AfterChange")},appendContent:function(a,c){b.content=a,a?b.st.showCloseBtn&&b.st.closeBtnInside&&b.currTemplate[c]===!0?b.content.find(".mfp-close").length||b.content.append(z()):b.content=a:b.content="",y(k),b.container.addClass("mfp-"+c+"-holder"),b.contentContainer.append(b.content)},parseEl:function(c){var d,e=b.items[c];if(e.tagName?e={el:a(e)}:(d=e.type,e={data:e,src:e.src}),e.el){for(var f=b.types,g=0;g<f.length;g++)if(e.el.hasClass("mfp-"+f[g])){d=f[g];break}e.src=e.el.attr("data-mfp-src"),e.src||(e.src=e.el.attr("href"))}return e.type=d||b.st.type||"inline",e.index=c,e.parsed=!0,b.items[c]=e,y("ElementParse",e),b.items[c]},addGroup:function(a,c){var d=function(d){d.mfpEl=this,b._openClick(d,a,c)};c||(c={});var e="click.magnificPopup";c.mainEl=a,c.items?(c.isObj=!0,a.off(e).on(e,d)):(c.isObj=!1,c.delegate?a.off(e).on(e,c.delegate,d):(c.items=a,a.off(e).on(e,d)))},_openClick:function(c,d,e){var f=void 0!==e.midClick?e.midClick:a.magnificPopup.defaults.midClick;if(f||!(2===c.which||c.ctrlKey||c.metaKey||c.altKey||c.shiftKey)){var g=void 0!==e.disableOn?e.disableOn:a.magnificPopup.defaults.disableOn;if(g)if(a.isFunction(g)){if(!g.call(b))return!0}else if(v.width()<g)return!0;c.type&&(c.preventDefault(),b.isOpen&&c.stopPropagation()),e.el=a(c.mfpEl),e.delegate&&(e.items=d.find(e.delegate)),b.open(e)}},updateStatus:function(a,d){if(b.preloader){c!==a&&b.container.removeClass("mfp-s-"+c),d||"loading"!==a||(d=b.st.tLoading);var e={status:a,text:d};y("UpdateStatus",e),a=e.status,d=e.text,b.preloader.html(d),b.preloader.find("a").on("click",function(a){a.stopImmediatePropagation()}),b.container.addClass("mfp-s-"+a),c=a}},_checkIfClose:function(c){if(!a(c).hasClass(s)){var d=b.st.closeOnContentClick,e=b.st.closeOnBgClick;if(d&&e)return!0;if(!b.content||a(c).hasClass("mfp-close")||b.preloader&&c===b.preloader[0])return!0;if(c===b.content[0]||a.contains(b.content[0],c)){if(d)return!0}else if(e&&a.contains(document,c))return!0;return!1}},_addClassToMFP:function(a){b.bgOverlay.addClass(a),b.wrap.addClass(a)},_removeClassFromMFP:function(a){this.bgOverlay.removeClass(a),b.wrap.removeClass(a)},_hasScrollBar:function(a){return(b.isIE7?d.height():document.body.scrollHeight)>(a||v.height())},_setFocus:function(){(b.st.focus?b.content.find(b.st.focus).eq(0):b.wrap).focus()},_onFocusIn:function(c){return c.target===b.wrap[0]||a.contains(b.wrap[0],c.target)?void 0:(b._setFocus(),!1)},_parseMarkup:function(b,c,d){var e;d.data&&(c=a.extend(d.data,c)),y(l,[b,c,d]),a.each(c,function(c,d){if(void 0===d||d===!1)return!0;if(e=c.split("_"),e.length>1){var f=b.find(p+"-"+e[0]);if(f.length>0){var g=e[1];"replaceWith"===g?f[0]!==d[0]&&f.replaceWith(d):"img"===g?f.is("img")?f.attr("src",d):f.replaceWith(a("<img>").attr("src",d).attr("class",f.attr("class"))):f.attr(e[1],d)}}else b.find(p+"-"+c).html(d)})},_getScrollbarSize:function(){if(void 0===b.scrollbarSize){var a=document.createElement("div");a.style.cssText="width: 99px; height: 99px; overflow: scroll; position: absolute; top: -9999px;",document.body.appendChild(a),b.scrollbarSize=a.offsetWidth-a.clientWidth,document.body.removeChild(a)}return b.scrollbarSize}},a.magnificPopup={instance:null,proto:t.prototype,modules:[],open:function(b,c){return A(),b=b?a.extend(!0,{},b):{},b.isObj=!0,b.index=c||0,this.instance.open(b)},close:function(){return a.magnificPopup.instance&&a.magnificPopup.instance.close()},registerModule:function(b,c){c.options&&(a.magnificPopup.defaults[b]=c.options),a.extend(this.proto,c.proto),this.modules.push(b)},defaults:{disableOn:0,key:null,midClick:!1,mainClass:"",preloader:!0,focus:"",closeOnContentClick:!1,closeOnBgClick:!0,closeBtnInside:!0,showCloseBtn:!0,enableEscapeKey:!0,modal:!1,alignTop:!1,removalDelay:0,prependTo:null,fixedContentPos:"auto",fixedBgPos:"auto",overflowY:"auto",closeMarkup:'<button title="%title%" type="button" class="mfp-close">&#215;</button>',tClose:"Close (Esc)",tLoading:"Loading...",autoFocusLast:!0}},a.fn.magnificPopup=function(c){A();var d=a(this);if("string"==typeof c)if("open"===c){var e,f=u?d.data("magnificPopup"):d[0].magnificPopup,g=parseInt(arguments[1],10)||0;f.items?e=f.items[g]:(e=d,f.delegate&&(e=e.find(f.delegate)),e=e.eq(g)),b._openClick({mfpEl:e},d,f)}else b.isOpen&&b[c].apply(b,Array.prototype.slice.call(arguments,1));else c=a.extend(!0,{},c),u?d.data("magnificPopup",c):d[0].magnificPopup=c,b.addGroup(d,c);return d};var C,D,E,F="inline",G=function(){E&&(D.after(E.addClass(C)).detach(),E=null)};a.magnificPopup.registerModule(F,{options:{hiddenClass:"hide",markup:"",tNotFound:"Content not found"},proto:{initInline:function(){b.types.push(F),w(h+"."+F,function(){G()})},getInline:function(c,d){if(G(),c.src){var e=b.st.inline,f=a(c.src);if(f.length){var g=f[0].parentNode;g&&g.tagName&&(D||(C=e.hiddenClass,D=x(C),C="mfp-"+C),E=f.after(D).detach().removeClass(C)),b.updateStatus("ready")}else b.updateStatus("error",e.tNotFound),f=a("<div>");return c.inlineElement=f,f}return b.updateStatus("ready"),b._parseMarkup(d,{},c),d}}});var H,I="ajax",J=function(){H&&a(document.body).removeClass(H)},K=function(){J(),b.req&&b.req.abort()};a.magnificPopup.registerModule(I,{options:{settings:null,cursor:"mfp-ajax-cur",tError:'<a href="%url%">The content</a> could not be loaded.'},proto:{initAjax:function(){b.types.push(I),H=b.st.ajax.cursor,w(h+"."+I,K),w("BeforeChange."+I,K)},getAjax:function(c){H&&a(document.body).addClass(H),b.updateStatus("loading");var d=a.extend({url:c.src,success:function(d,e,f){var g={data:d,xhr:f};y("ParseAjax",g),b.appendContent(a(g.data),I),c.finished=!0,J(),b._setFocus(),setTimeout(function(){b.wrap.addClass(q)},16),b.updateStatus("ready"),y("AjaxContentAdded")},error:function(){J(),c.finished=c.loadError=!0,b.updateStatus("error",b.st.ajax.tError.replace("%url%",c.src))}},b.st.ajax.settings);return b.req=a.ajax(d),""}}});var L,M=function(c){if(c.data&&void 0!==c.data.title)return c.data.title;var d=b.st.image.titleSrc;if(d){if(a.isFunction(d))return d.call(b,c);if(c.el)return c.el.attr(d)||""}return""};a.magnificPopup.registerModule("image",{options:{markup:'<div class="mfp-figure"><div class="mfp-close"></div><figure><div class="mfp-img"></div><figcaption><div class="mfp-bottom-bar"><div class="mfp-title"></div><div class="mfp-counter"></div></div></figcaption></figure></div>',cursor:"mfp-zoom-out-cur",titleSrc:"title",verticalFit:!0,tError:'<a href="%url%">The image</a> could not be loaded.'},proto:{initImage:function(){var c=b.st.image,d=".image";b.types.push("image"),w(m+d,function(){"image"===b.currItem.type&&c.cursor&&a(document.body).addClass(c.cursor)}),w(h+d,function(){c.cursor&&a(document.body).removeClass(c.cursor),v.off("resize"+p)}),w("Resize"+d,b.resizeImage),b.isLowIE&&w("AfterChange",b.resizeImage)},resizeImage:function(){var a=b.currItem;if(a&&a.img&&b.st.image.verticalFit){var c=0;b.isLowIE&&(c=parseInt(a.img.css("padding-top"),10)+parseInt(a.img.css("padding-bottom"),10)),a.img.css("max-height",b.wH-c)}},_onImageHasSize:function(a){a.img&&(a.hasSize=!0,L&&clearInterval(L),a.isCheckingImgSize=!1,y("ImageHasSize",a),a.imgHidden&&(b.content&&b.content.removeClass("mfp-loading"),a.imgHidden=!1))},findImageSize:function(a){var c=0,d=a.img[0],e=function(f){L&&clearInterval(L),L=setInterval(function(){return d.naturalWidth>0?void b._onImageHasSize(a):(c>200&&clearInterval(L),c++,void(3===c?e(10):40===c?e(50):100===c&&e(500)))},f)};e(1)},getImage:function(c,d){var e=0,f=function(){c&&(c.img[0].complete?(c.img.off(".mfploader"),c===b.currItem&&(b._onImageHasSize(c),b.updateStatus("ready")),c.hasSize=!0,c.loaded=!0,y("ImageLoadComplete")):(e++,200>e?setTimeout(f,100):g()))},g=function(){c&&(c.img.off(".mfploader"),c===b.currItem&&(b._onImageHasSize(c),b.updateStatus("error",h.tError.replace("%url%",c.src))),c.hasSize=!0,c.loaded=!0,c.loadError=!0)},h=b.st.image,i=d.find(".mfp-img");if(i.length){var j=document.createElement("img");j.className="mfp-img",c.el&&c.el.find("img").length&&(j.alt=c.el.find("img").attr("alt")),c.img=a(j).on("load.mfploader",f).on("error.mfploader",g),j.src=c.src,i.is("img")&&(c.img=c.img.clone()),j=c.img[0],j.naturalWidth>0?c.hasSize=!0:j.width||(c.hasSize=!1)}return b._parseMarkup(d,{title:M(c),img_replaceWith:c.img},c),b.resizeImage(),c.hasSize?(L&&clearInterval(L),c.loadError?(d.addClass("mfp-loading"),b.updateStatus("error",h.tError.replace("%url%",c.src))):(d.removeClass("mfp-loading"),b.updateStatus("ready")),d):(b.updateStatus("loading"),c.loading=!0,c.hasSize||(c.imgHidden=!0,d.addClass("mfp-loading"),b.findImageSize(c)),d)}}});var N,O=function(){return void 0===N&&(N=void 0!==document.createElement("p").style.MozTransform),N};a.magnificPopup.registerModule("zoom",{options:{enabled:!1,easing:"ease-in-out",duration:300,opener:function(a){return a.is("img")?a:a.find("img")}},proto:{initZoom:function(){var a,c=b.st.zoom,d=".zoom";if(c.enabled&&b.supportsTransition){var e,f,g=c.duration,j=function(a){var b=a.clone().removeAttr("style").removeAttr("class").addClass("mfp-animated-image"),d="all "+c.duration/1e3+"s "+c.easing,e={position:"fixed",zIndex:9999,left:0,top:0,"-webkit-backface-visibility":"hidden"},f="transition";return e["-webkit-"+f]=e["-moz-"+f]=e["-o-"+f]=e[f]=d,b.css(e),b},k=function(){b.content.css("visibility","visible")};w("BuildControls"+d,function(){if(b._allowZoom()){if(clearTimeout(e),b.content.css("visibility","hidden"),a=b._getItemToZoom(),!a)return void k();f=j(a),f.css(b._getOffset()),b.wrap.append(f),e=setTimeout(function(){f.css(b._getOffset(!0)),e=setTimeout(function(){k(),setTimeout(function(){f.remove(),a=f=null,y("ZoomAnimationEnded")},16)},g)},16)}}),w(i+d,function(){if(b._allowZoom()){if(clearTimeout(e),b.st.removalDelay=g,!a){if(a=b._getItemToZoom(),!a)return;f=j(a)}f.css(b._getOffset(!0)),b.wrap.append(f),b.content.css("visibility","hidden"),setTimeout(function(){f.css(b._getOffset())},16)}}),w(h+d,function(){b._allowZoom()&&(k(),f&&f.remove(),a=null)})}},_allowZoom:function(){return"image"===b.currItem.type},_getItemToZoom:function(){return b.currItem.hasSize?b.currItem.img:!1},_getOffset:function(c){var d;d=c?b.currItem.img:b.st.zoom.opener(b.currItem.el||b.currItem);var e=d.offset(),f=parseInt(d.css("padding-top"),10),g=parseInt(d.css("padding-bottom"),10);e.top-=a(window).scrollTop()-f;var h={width:d.width(),height:(u?d.innerHeight():d[0].offsetHeight)-g-f};return O()?h["-moz-transform"]=h.transform="translate("+e.left+"px,"+e.top+"px)":(h.left=e.left,h.top=e.top),h}}});var P="iframe",Q="//about:blank",R=function(a){if(b.currTemplate[P]){var c=b.currTemplate[P].find("iframe");c.length&&(a||(c[0].src=Q),b.isIE8&&c.css("display",a?"block":"none"))}};a.magnificPopup.registerModule(P,{options:{markup:'<div class="mfp-iframe-scaler"><div class="mfp-close"></div><iframe class="mfp-iframe" src="//about:blank" frameborder="0" allowfullscreen></iframe></div>',srcAction:"iframe_src",patterns:{youtube:{index:"youtube.com",id:"v=",src:"//www.youtube.com/embed/%id%?autoplay=1"},vimeo:{index:"vimeo.com/",id:"/",src:"//player.vimeo.com/video/%id%?autoplay=1"},gmaps:{index:"//maps.google.",src:"%id%&output=embed"}}},proto:{initIframe:function(){b.types.push(P),w("BeforeChange",function(a,b,c){b!==c&&(b===P?R():c===P&&R(!0))}),w(h+"."+P,function(){R()})},getIframe:function(c,d){var e=c.src,f=b.st.iframe;a.each(f.patterns,function(){return e.indexOf(this.index)>-1?(this.id&&(e="string"==typeof this.id?e.substr(e.lastIndexOf(this.id)+this.id.length,e.length):this.id.call(this,e)),e=this.src.replace("%id%",e),!1):void 0});var g={};return f.srcAction&&(g[f.srcAction]=e),b._parseMarkup(d,g,c),b.updateStatus("ready"),d}}});var S=function(a){var c=b.items.length;return a>c-1?a-c:0>a?c+a:a},T=function(a,b,c){return a.replace(/%curr%/gi,b+1).replace(/%total%/gi,c)};a.magnificPopup.registerModule("gallery",{options:{enabled:!1,arrowMarkup:'<button title="%title%" type="button" class="mfp-arrow mfp-arrow-%dir%"></button>',preload:[0,2],navigateByImgClick:!0,arrows:!0,tPrev:"Previous (Left arrow key)",tNext:"Next (Right arrow key)",tCounter:"%curr% of %total%"},proto:{initGallery:function(){var c=b.st.gallery,e=".mfp-gallery";return b.direction=!0,c&&c.enabled?(f+=" mfp-gallery",w(m+e,function(){c.navigateByImgClick&&b.wrap.on("click"+e,".mfp-img",function(){return b.items.length>1?(b.next(),!1):void 0}),d.on("keydown"+e,function(a){37===a.keyCode?b.prev():39===a.keyCode&&b.next()})}),w("UpdateStatus"+e,function(a,c){c.text&&(c.text=T(c.text,b.currItem.index,b.items.length))}),w(l+e,function(a,d,e,f){var g=b.items.length;e.counter=g>1?T(c.tCounter,f.index,g):""}),w("BuildControls"+e,function(){if(b.items.length>1&&c.arrows&&!b.arrowLeft){var d=c.arrowMarkup,e=b.arrowLeft=a(d.replace(/%title%/gi,c.tPrev).replace(/%dir%/gi,"left")).addClass(s),f=b.arrowRight=a(d.replace(/%title%/gi,c.tNext).replace(/%dir%/gi,"right")).addClass(s);e.click(function(){b.prev()}),f.click(function(){b.next()}),b.container.append(e.add(f))}}),w(n+e,function(){b._preloadTimeout&&clearTimeout(b._preloadTimeout),b._preloadTimeout=setTimeout(function(){b.preloadNearbyImages(),b._preloadTimeout=null},16)}),void w(h+e,function(){d.off(e),b.wrap.off("click"+e),b.arrowRight=b.arrowLeft=null})):!1},next:function(){b.direction=!0,b.index=S(b.index+1),b.updateItemHTML()},prev:function(){b.direction=!1,b.index=S(b.index-1),b.updateItemHTML()},goTo:function(a){b.direction=a>=b.index,b.index=a,b.updateItemHTML()},preloadNearbyImages:function(){var a,c=b.st.gallery.preload,d=Math.min(c[0],b.items.length),e=Math.min(c[1],b.items.length);for(a=1;a<=(b.direction?e:d);a++)b._preloadItem(b.index+a);for(a=1;a<=(b.direction?d:e);a++)b._preloadItem(b.index-a)},_preloadItem:function(c){if(c=S(c),!b.items[c].preloaded){var d=b.items[c];d.parsed||(d=b.parseEl(c)),y("LazyLoad",d),"image"===d.type&&(d.img=a('<img class="mfp-img" />').on("load.mfploader",function(){d.hasSize=!0}).on("error.mfploader",function(){d.hasSize=!0,d.loadError=!0,y("LazyLoadError",d)}).attr("src",d.src)),d.preloaded=!0}}}});var U="retina";a.magnificPopup.registerModule(U,{options:{replaceSrc:function(a){return a.src.replace(/\.\w+$/,function(a){return"@2x"+a})},ratio:1},proto:{initRetina:function(){if(window.devicePixelRatio>1){var a=b.st.retina,c=a.ratio;c=isNaN(c)?c():c,c>1&&(w("ImageHasSize."+U,function(a,b){b.img.css({"max-width":b.img[0].naturalWidth/c,width:"100%"})}),w("ElementParse."+U,function(b,d){d.src=a.replaceSrc(d,c)}))}}}}),A()});
\ No newline at end of file
diff --git a/docs/lib/superfish/hoverIntent.js b/docs/lib/superfish/hoverIntent.js
new file mode 100644
index 0000000..5167de8
--- /dev/null
+++ b/docs/lib/superfish/hoverIntent.js
@@ -0,0 +1,158 @@
+/*!
+ * hoverIntent v1.8.1 // 2014.08.11 // jQuery v1.9.1+
+ * http://briancherne.github.io/jquery-hoverIntent/
+ *
+ * You may use hoverIntent under the terms of the MIT license. Basically that
+ * means you are free to use hoverIntent as long as this header is left intact.
+ * Copyright 2007, 2014 Brian Cherne
+ */
+
+/* hoverIntent is similar to jQuery's built-in "hover" method except that
+ * instead of firing the handlerIn function immediately, hoverIntent checks
+ * to see if the user's mouse has slowed down (beneath the sensitivity
+ * threshold) before firing the event. The handlerOut function is only
+ * called after a matching handlerIn.
+ *
+ * // basic usage ... just like .hover()
+ * .hoverIntent( handlerIn, handlerOut )
+ * .hoverIntent( handlerInOut )
+ *
+ * // basic usage ... with event delegation!
+ * .hoverIntent( handlerIn, handlerOut, selector )
+ * .hoverIntent( handlerInOut, selector )
+ *
+ * // using a basic configuration object
+ * .hoverIntent( config )
+ *
+ * @param  handlerIn   function OR configuration object
+ * @param  handlerOut  function OR selector for delegation OR undefined
+ * @param  selector    selector OR undefined
+ * @author Brian Cherne <brian(at)cherne(dot)net>
+ */
+
+;(function(factory) {
+    'use strict';
+    if (typeof define === 'function' && define.amd) {
+        define(['jquery'], factory);
+    } else if (jQuery && !jQuery.fn.hoverIntent) {
+        factory(jQuery);
+    }
+})(function($) {
+    'use strict';
+
+    // default configuration values
+    var _cfg = {
+        interval: 100,
+        sensitivity: 6,
+        timeout: 0
+    };
+
+    // counter used to generate an ID for each instance
+    var INSTANCE_COUNT = 0;
+
+    // current X and Y position of mouse, updated during mousemove tracking (shared across instances)
+    var cX, cY;
+
+    // saves the current pointer position coordinates based on the given mousemove event
+    var track = function(ev) {
+        cX = ev.pageX;
+        cY = ev.pageY;
+    };
+
+    // compares current and previous mouse positions
+    var compare = function(ev,$el,s,cfg) {
+        // compare mouse positions to see if pointer has slowed enough to trigger `over` function
+        if ( Math.sqrt( (s.pX-cX)*(s.pX-cX) + (s.pY-cY)*(s.pY-cY) ) < cfg.sensitivity ) {
+            $el.off(s.event,track);
+            delete s.timeoutId;
+            // set hoverIntent state as active for this element (permits `out` handler to trigger)
+            s.isActive = true;
+            // overwrite old mouseenter event coordinates with most recent pointer position
+            ev.pageX = cX; ev.pageY = cY;
+            // clear coordinate data from state object
+            delete s.pX; delete s.pY;
+            return cfg.over.apply($el[0],[ev]);
+        } else {
+            // set previous coordinates for next comparison
+            s.pX = cX; s.pY = cY;
+            // use self-calling timeout, guarantees intervals are spaced out properly (avoids JavaScript timer bugs)
+            s.timeoutId = setTimeout( function(){compare(ev, $el, s, cfg);} , cfg.interval );
+        }
+    };
+
+    // triggers given `out` function at configured `timeout` after a mouseleave and clears state
+    var delay = function(ev,$el,s,out) {
+        delete $el.data('hoverIntent')[s.id];
+        return out.apply($el[0],[ev]);
+    };
+
+    $.fn.hoverIntent = function(handlerIn,handlerOut,selector) {
+        // instance ID, used as a key to store and retrieve state information on an element
+        var instanceId = INSTANCE_COUNT++;
+
+        // extend the default configuration and parse parameters
+        var cfg = $.extend({}, _cfg);
+        if ( $.isPlainObject(handlerIn) ) {
+            cfg = $.extend(cfg, handlerIn);
+            if ( !$.isFunction(cfg.out) ) {
+                cfg.out = cfg.over;
+            }
+        } else if ( $.isFunction(handlerOut) ) {
+            cfg = $.extend(cfg, { over: handlerIn, out: handlerOut, selector: selector } );
+        } else {
+            cfg = $.extend(cfg, { over: handlerIn, out: handlerIn, selector: handlerOut } );
+        }
+
+        // A private function for handling mouse 'hovering'
+        var handleHover = function(e) {
+            // cloned event to pass to handlers (copy required for event object to be passed in IE)
+            var ev = $.extend({},e);
+
+            // the current target of the mouse event, wrapped in a jQuery object
+            var $el = $(this);
+
+            // read hoverIntent data from element (or initialize if not present)
+            var hoverIntentData = $el.data('hoverIntent');
+            if (!hoverIntentData) { $el.data('hoverIntent', (hoverIntentData = {})); }
+
+            // read per-instance state from element (or initialize if not present)
+            var state = hoverIntentData[instanceId];
+            if (!state) { hoverIntentData[instanceId] = state = { id: instanceId }; }
+
+            // state properties:
+            // id = instance ID, used to clean up data
+            // timeoutId = timeout ID, reused for tracking mouse position and delaying "out" handler
+            // isActive = plugin state, true after `over` is called just until `out` is called
+            // pX, pY = previously-measured pointer coordinates, updated at each polling interval
+            // event = string representing the namespaced event used for mouse tracking
+
+            // clear any existing timeout
+            if (state.timeoutId) { state.timeoutId = clearTimeout(state.timeoutId); }
+
+            // namespaced event used to register and unregister mousemove tracking
+            var mousemove = state.event = 'mousemove.hoverIntent.hoverIntent'+instanceId;
+
+            // handle the event, based on its type
+            if (e.type === 'mouseenter') {
+                // do nothing if already active
+                if (state.isActive) { return; }
+                // set "previous" X and Y position based on initial entry point
+                state.pX = ev.pageX; state.pY = ev.pageY;
+                // update "current" X and Y position based on mousemove
+                $el.off(mousemove,track).on(mousemove,track);
+                // start polling interval (self-calling timeout) to compare mouse coordinates over time
+                state.timeoutId = setTimeout( function(){compare(ev,$el,state,cfg);} , cfg.interval );
+            } else { // "mouseleave"
+                // do nothing if not already active
+                if (!state.isActive) { return; }
+                // unbind expensive mousemove event
+                $el.off(mousemove,track);
+                // if hoverIntent state is true, then call the mouseOut function after the specified delay
+                state.timeoutId = setTimeout( function(){delay(ev,$el,state,cfg.out);} , cfg.timeout );
+            }
+        };
+
+        // listen for mouseenter and mouseleave
+        return this.on({'mouseenter.hoverIntent':handleHover,'mouseleave.hoverIntent':handleHover}, cfg.selector);
+    };
+});
diff --git a/docs/lib/superfish/superfish.js b/docs/lib/superfish/superfish.js
new file mode 100644
index 0000000..8dc4120
--- /dev/null
+++ b/docs/lib/superfish/superfish.js
@@ -0,0 +1,276 @@
+/*
+ * jQuery Superfish Menu Plugin - v1.7.9
+ * Copyright (c) 2016 Joel Birch
+ *
+ * Dual licensed under the MIT and GPL licenses:
+ *	http://www.opensource.org/licenses/mit-license.php
+ *	http://www.gnu.org/licenses/gpl.html
+ */
+
+;(function ($, w) {
+	"use strict";
+
+	var methods = (function () {
+		// private properties and methods go here
+		var c = {
+				bcClass: 'sf-breadcrumb',
+				menuClass: 'sf-js-enabled',
+				anchorClass: 'sf-with-ul',
+				menuArrowClass: 'sf-arrows'
+			},
+			ios = (function () {
+				var ios = /^(?![\w\W]*Windows Phone)[\w\W]*(iPhone|iPad|iPod)/i.test(navigator.userAgent);
+				if (ios) {
+					// tap anywhere on iOS to unfocus a submenu
+					$('html').css('cursor', 'pointer').on('click', $.noop);
+				}
+				return ios;
+			})(),
+			wp7 = (function () {
+				var style = document.documentElement.style;
+				return ('behavior' in style && 'fill' in style && /iemobile/i.test(navigator.userAgent));
+			})(),
+			unprefixedPointerEvents = (function () {
+				return (!!w.PointerEvent);
+			})(),
+			toggleMenuClasses = function ($menu, o, add) {
+				var classes = c.menuClass,
+					method;
+				if (o.cssArrows) {
+					classes += ' ' + c.menuArrowClass;
+				}
+				method = (add) ? 'addClass' : 'removeClass';
+				$menu[method](classes);
+			},
+			setPathToCurrent = function ($menu, o) {
+				return $menu.find('li.' + o.pathClass).slice(0, o.pathLevels)
+					.addClass(o.hoverClass + ' ' + c.bcClass)
+						.filter(function () {
+							return ($(this).children(o.popUpSelector).hide().show().length);
+						}).removeClass(o.pathClass);
+			},
+			toggleAnchorClass = function ($li, add) {
+				var method = (add) ? 'addClass' : 'removeClass';
+				$li.children('a')[method](c.anchorClass);
+			},
+			toggleTouchAction = function ($menu) {
+				var msTouchAction = $menu.css('ms-touch-action');
+				var touchAction = $menu.css('touch-action');
+				touchAction = touchAction || msTouchAction;
+				touchAction = (touchAction === 'pan-y') ? 'auto' : 'pan-y';
+				$menu.css({
+					'ms-touch-action': touchAction,
+					'touch-action': touchAction
+				});
+			},
+			getMenu = function ($el) {
+				return $el.closest('.' + c.menuClass);
+			},
+			getOptions = function ($el) {
+				return getMenu($el).data('sfOptions');
+			},
+			over = function () {
+				var $this = $(this),
+					o = getOptions($this);
+				clearTimeout(o.sfTimer);
+				$this.siblings().superfish('hide').end().superfish('show');
+			},
+			close = function (o) {
+				o.retainPath = ($.inArray(this[0], o.$path) > -1);
+				this.superfish('hide');
+
+				if (!this.parents('.' + o.hoverClass).length) {
+					o.onIdle.call(getMenu(this));
+					if (o.$path.length) {
+						$.proxy(over, o.$path)();
+					}
+				}
+			},
+			out = function () {
+				var $this = $(this),
+					o = getOptions($this);
+				if (ios) {
+					$.proxy(close, $this, o)();
+				}
+				else {
+					clearTimeout(o.sfTimer);
+					o.sfTimer = setTimeout($.proxy(close, $this, o), o.delay);
+				}
+			},
+			touchHandler = function (e) {
+				var $this = $(this),
+					o = getOptions($this),
+					$ul = $this.siblings(e.data.popUpSelector);
+
+				if (o.onHandleTouch.call($ul) === false) {
+					return this;
+				}
+
+				if ($ul.length > 0 && $ul.is(':hidden')) {
+					$this.one('click.superfish', false);
+					if (e.type === 'MSPointerDown' || e.type === 'pointerdown') {
+						$this.trigger('focus');
+					} else {
+						$.proxy(over, $this.parent('li'))();
+					}
+				}
+			},
+			applyHandlers = function ($menu, o) {
+				var targets = 'li:has(' + o.popUpSelector + ')';
+				if ($.fn.hoverIntent && !o.disableHI) {
+					$menu.hoverIntent(over, out, targets);
+				}
+				else {
+					$menu
+						.on('mouseenter.superfish', targets, over)
+						.on('mouseleave.superfish', targets, out);
+				}
+				var touchevent = 'MSPointerDown.superfish';
+				if (unprefixedPointerEvents) {
+					touchevent = 'pointerdown.superfish';
+				}
+				if (!ios) {
+					touchevent += ' touchend.superfish';
+				}
+				if (wp7) {
+					touchevent += ' mousedown.superfish';
+				}
+				$menu
+					.on('focusin.superfish', 'li', over)
+					.on('focusout.superfish', 'li', out)
+					.on(touchevent, 'a', o, touchHandler);
+			};
+
+		return {
+			// public methods
+			hide: function (instant) {
+				if (this.length) {
+					var $this = this,
+						o = getOptions($this);
+					if (!o) {
+						return this;
+					}
+					var not = (o.retainPath === true) ? o.$path : '',
+						$ul = $this.find('li.' + o.hoverClass).add(this).not(not).removeClass(o.hoverClass).children(o.popUpSelector),
+						speed = o.speedOut;
+
+					if (instant) {
+						$ul.show();
+						speed = 0;
+					}
+					o.retainPath = false;
+
+					if (o.onBeforeHide.call($ul) === false) {
+						return this;
+					}
+
+					$ul.stop(true, true).animate(o.animationOut, speed, function () {
+						var $this = $(this);
+						o.onHide.call($this);
+					});
+				}
+				return this;
+			},
+			show: function () {
+				var o = getOptions(this);
+				if (!o) {
+					return this;
+				}
+				var $this = this.addClass(o.hoverClass),
+					$ul = $this.children(o.popUpSelector);
+
+				if (o.onBeforeShow.call($ul) === false) {
+					return this;
+				}
+
+				$ul.stop(true, true).animate(o.animation, o.speed, function () {
+					o.onShow.call($ul);
+				});
+				return this;
+			},
+			destroy: function () {
+				return this.each(function () {
+					var $this = $(this),
+						o = $this.data('sfOptions'),
+						$hasPopUp;
+					if (!o) {
+						return false;
+					}
+					$hasPopUp = $this.find(o.popUpSelector).parent('li');
+					clearTimeout(o.sfTimer);
+					toggleMenuClasses($this, o);
+					toggleAnchorClass($hasPopUp);
+					toggleTouchAction($this);
+					// remove event handlers
+					$this.off('.superfish').off('.hoverIntent');
+					// clear animation's inline display style
+					$hasPopUp.children(o.popUpSelector).attr('style', function (i, style) {
+						return style.replace(/display[^;]+;?/g, '');
+					});
+					// reset 'current' path classes
+					o.$path.removeClass(o.hoverClass + ' ' + c.bcClass).addClass(o.pathClass);
+					$this.find('.' + o.hoverClass).removeClass(o.hoverClass);
+					o.onDestroy.call($this);
+					$this.removeData('sfOptions');
+				});
+			},
+			init: function (op) {
+				return this.each(function () {
+					var $this = $(this);
+					if ($this.data('sfOptions')) {
+						return false;
+					}
+					var o = $.extend({}, $.fn.superfish.defaults, op),
+						$hasPopUp = $this.find(o.popUpSelector).parent('li');
+					o.$path = setPathToCurrent($this, o);
+
+					$this.data('sfOptions', o);
+
+					toggleMenuClasses($this, o, true);
+					toggleAnchorClass($hasPopUp, true);
+					toggleTouchAction($this);
+					applyHandlers($this, o);
+
+					$hasPopUp.not('.' + c.bcClass).superfish('hide', true);
+
+					o.onInit.call(this);
+				});
+			}
+		};
+	})();
+
+	$.fn.superfish = function (method, args) {
+		if (methods[method]) {
+			return methods[method].apply(this, Array.prototype.slice.call(arguments, 1));
+		}
+		else if (typeof method === 'object' || ! method) {
+			return methods.init.apply(this, arguments);
+		}
+		else {
+			return $.error('Method ' +  method + ' does not exist on jQuery.fn.superfish');
+		}
+	};
+
+	$.fn.superfish.defaults = {
+		popUpSelector: 'ul,.sf-mega', // within menu context
+		hoverClass: 'sfHover',
+		pathClass: 'overrideThisToUse',
+		pathLevels: 1,
+		delay: 800,
+		animation: {opacity: 'show'},
+		animationOut: {opacity: 'hide'},
+		speed: 'normal',
+		speedOut: 'fast',
+		cssArrows: true,
+		disableHI: false,
+		onInit: $.noop,
+		onBeforeShow: $.noop,
+		onShow: $.noop,
+		onBeforeHide: $.noop,
+		onHide: $.noop,
+		onIdle: $.noop,
+		onDestroy: $.noop,
+		onHandleTouch: $.noop
+	};
+
+})(jQuery, window);
diff --git a/docs/lib/superfish/superfish.min.js b/docs/lib/superfish/superfish.min.js
new file mode 100644
index 0000000..9ff2015
--- /dev/null
+++ b/docs/lib/superfish/superfish.min.js
@@ -0,0 +1,10 @@
+/*
+ * jQuery Superfish Menu Plugin - v1.7.9
+ * Copyright (c) 2016 Joel Birch
+ *
+ * Dual licensed under the MIT and GPL licenses:
+ *	http://www.opensource.org/licenses/mit-license.php
+ *	http://www.gnu.org/licenses/gpl.html
+ */
+
+;!function(a,b){"use strict";var c=function(){var c={bcClass:"sf-breadcrumb",menuClass:"sf-js-enabled",anchorClass:"sf-with-ul",menuArrowClass:"sf-arrows"},d=function(){var b=/^(?![\w\W]*Windows Phone)[\w\W]*(iPhone|iPad|iPod)/i.test(navigator.userAgent);return b&&a("html").css("cursor","pointer").on("click",a.noop),b}(),e=function(){var a=document.documentElement.style;return"behavior"in a&&"fill"in a&&/iemobile/i.test(navigator.userAgent)}(),f=function(){return!!b.PointerEvent}(),g=function(a,b,d){var e,f=c.menuClass;b.cssArrows&&(f+=" "+c.menuArrowClass),e=d?"addClass":"removeClass",a[e](f)},h=function(b,d){return b.find("li."+d.pathClass).slice(0,d.pathLevels).addClass(d.hoverClass+" "+c.bcClass).filter(function(){return a(this).children(d.popUpSelector).hide().show().length}).removeClass(d.pathClass)},i=function(a,b){var d=b?"addClass":"removeClass";a.children("a")[d](c.anchorClass)},j=function(a){var b=a.css("ms-touch-action"),c=a.css("touch-action");c=c||b,c="pan-y"===c?"auto":"pan-y",a.css({"ms-touch-action":c,"touch-action":c})},k=function(a){return a.closest("."+c.menuClass)},l=function(a){return k(a).data("sfOptions")},m=function(){var b=a(this),c=l(b);clearTimeout(c.sfTimer),b.siblings().superfish("hide").end().superfish("show")},n=function(b){b.retainPath=a.inArray(this[0],b.$path)>-1,this.superfish("hide"),this.parents("."+b.hoverClass).length||(b.onIdle.call(k(this)),b.$path.length&&a.proxy(m,b.$path)())},o=function(){var b=a(this),c=l(b);d?a.proxy(n,b,c)():(clearTimeout(c.sfTimer),c.sfTimer=setTimeout(a.proxy(n,b,c),c.delay))},p=function(b){var c=a(this),d=l(c),e=c.siblings(b.data.popUpSelector);return d.onHandleTouch.call(e)===!1?this:void(e.length>0&&e.is(":hidden")&&(c.one("click.superfish",!1),"MSPointerDown"===b.type||"pointerdown"===b.type?c.trigger("focus"):a.proxy(m,c.parent("li"))()))},q=function(b,c){var g="li:has("+c.popUpSelector+")";a.fn.hoverIntent&&!c.disableHI?b.hoverIntent(m,o,g):b.on("mouseenter.superfish",g,m).on("mouseleave.superfish",g,o);var h="MSPointerDown.superfish";f&&(h="pointerdown.superfish"),d||(h+=" touchend.superfish"),e&&(h+=" mousedown.superfish"),b.on("focusin.superfish","li",m).on("focusout.superfish","li",o).on(h,"a",c,p)};return{hide:function(b){if(this.length){var c=this,d=l(c);if(!d)return this;var e=d.retainPath===!0?d.$path:"",f=c.find("li."+d.hoverClass).add(this).not(e).removeClass(d.hoverClass).children(d.popUpSelector),g=d.speedOut;if(b&&(f.show(),g=0),d.retainPath=!1,d.onBeforeHide.call(f)===!1)return this;f.stop(!0,!0).animate(d.animationOut,g,function(){var b=a(this);d.onHide.call(b)})}return this},show:function(){var a=l(this);if(!a)return this;var b=this.addClass(a.hoverClass),c=b.children(a.popUpSelector);return a.onBeforeShow.call(c)===!1?this:(c.stop(!0,!0).animate(a.animation,a.speed,function(){a.onShow.call(c)}),this)},destroy:function(){return this.each(function(){var b,d=a(this),e=d.data("sfOptions");return e?(b=d.find(e.popUpSelector).parent("li"),clearTimeout(e.sfTimer),g(d,e),i(b),j(d),d.off(".superfish").off(".hoverIntent"),b.children(e.popUpSelector).attr("style",function(a,b){return b.replace(/display[^;]+;?/g,"")}),e.$path.removeClass(e.hoverClass+" "+c.bcClass).addClass(e.pathClass),d.find("."+e.hoverClass).removeClass(e.hoverClass),e.onDestroy.call(d),void d.removeData("sfOptions")):!1})},init:function(b){return this.each(function(){var d=a(this);if(d.data("sfOptions"))return!1;var e=a.extend({},a.fn.superfish.defaults,b),f=d.find(e.popUpSelector).parent("li");e.$path=h(d,e),d.data("sfOptions",e),g(d,e,!0),i(f,!0),j(d),q(d,e),f.not("."+c.bcClass).superfish("hide",!0),e.onInit.call(this)})}}}();a.fn.superfish=function(b,d){return c[b]?c[b].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof b&&b?a.error("Method "+b+" does not exist on jQuery.fn.superfish"):c.init.apply(this,arguments)},a.fn.superfish.defaults={popUpSelector:"ul,.sf-mega",hoverClass:"sfHover",pathClass:"overrideThisToUse",pathLevels:1,delay:800,animation:{opacity:"show"},animationOut:{opacity:"hide"},speed:"normal",speedOut:"fast",cssArrows:!0,disableHI:!1,onInit:a.noop,onBeforeShow:a.noop,onShow:a.noop,onBeforeHide:a.noop,onHide:a.noop,onIdle:a.noop,onDestroy:a.noop,onHandleTouch:a.noop}}(jQuery,window);
\ No newline at end of file
diff --git a/docs/lib/wow/wow.js b/docs/lib/wow/wow.js
new file mode 100644
index 0000000..42dabed
--- /dev/null
+++ b/docs/lib/wow/wow.js
@@ -0,0 +1,542 @@
+/*
+* WOW wow.js - v1.3.0 - 2016-10-04
+* https://wowjs.uk
+* Copyright (c) 2016 Thomas Grainger; Licensed MIT
+*/
+
+(function (global, factory) {
+  if (typeof define === "function" && define.amd) {
+    define(['module', 'exports'], factory);
+  } else if (typeof exports !== "undefined") {
+    factory(module, exports);
+  } else {
+    var mod = {
+      exports: {}
+    };
+    factory(mod, mod.exports);
+    global.WOW = mod.exports;
+  }
+})(this, function (module, exports) {
+  'use strict';
+
+  Object.defineProperty(exports, "__esModule", {
+    value: true
+  });
+
+  var _class, _temp;
+
+  function _classCallCheck(instance, Constructor) {
+    if (!(instance instanceof Constructor)) {
+      throw new TypeError("Cannot call a class as a function");
+    }
+  }
+
+  var _createClass = function () {
+    function defineProperties(target, props) {
+      for (var i = 0; i < props.length; i++) {
+        var descriptor = props[i];
+        descriptor.enumerable = descriptor.enumerable || false;
+        descriptor.configurable = true;
+        if ("value" in descriptor) descriptor.writable = true;
+        Object.defineProperty(target, descriptor.key, descriptor);
+      }
+    }
+
+    return function (Constructor, protoProps, staticProps) {
+      if (protoProps) defineProperties(Constructor.prototype, protoProps);
+      if (staticProps) defineProperties(Constructor, staticProps);
+      return Constructor;
+    };
+  }();
+
+  function isIn(needle, haystack) {
+    return haystack.indexOf(needle) >= 0;
+  }
+
+  function extend(custom, defaults) {
+    for (var key in defaults) {
+      if (custom[key] == null) {
+        var value = defaults[key];
+        custom[key] = value;
+      }
+    }
+    return custom;
+  }
+
+  function isMobile(agent) {
+    return (/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(agent)
+    );
+  }
+
+  function createEvent(event) {
+    var bubble = arguments.length <= 1 || arguments[1] === undefined ? false : arguments[1];
+    var cancel = arguments.length <= 2 || arguments[2] === undefined ? false : arguments[2];
+    var detail = arguments.length <= 3 || arguments[3] === undefined ? null : arguments[3];
+
+    var customEvent = void 0;
+    if (document.createEvent != null) {
+      // W3C DOM
+      customEvent = document.createEvent('CustomEvent');
+      customEvent.initCustomEvent(event, bubble, cancel, detail);
+    } else if (document.createEventObject != null) {
+      // IE DOM < 9
+      customEvent = document.createEventObject();
+      customEvent.eventType = event;
+    } else {
+      customEvent.eventName = event;
+    }
+
+    return customEvent;
+  }
+
+  function emitEvent(elem, event) {
+    if (elem.dispatchEvent != null) {
+      // W3C DOM
+      elem.dispatchEvent(event);
+    } else if (event in (elem != null)) {
+      elem[event]();
+    } else if ('on' + event in (elem != null)) {
+      elem['on' + event]();
+    }
+  }
+
+  function addEvent(elem, event, fn) {
+    if (elem.addEventListener != null) {
+      // W3C DOM
+      elem.addEventListener(event, fn, false);
+    } else if (elem.attachEvent != null) {
+      // IE DOM
+      elem.attachEvent('on' + event, fn);
+    } else {
+      // fallback
+      elem[event] = fn;
+    }
+  }
+
+  function removeEvent(elem, event, fn) {
+    if (elem.removeEventListener != null) {
+      // W3C DOM
+      elem.removeEventListener(event, fn, false);
+    } else if (elem.detachEvent != null) {
+      // IE DOM
+      elem.detachEvent('on' + event, fn);
+    } else {
+      // fallback
+      delete elem[event];
+    }
+  }
+
+  function getInnerHeight() {
+    if ('innerHeight' in window) {
+      return window.innerHeight;
+    }
+
+    return document.documentElement.clientHeight;
+  }
+
+  // Minimalistic WeakMap shim, just in case.
+  var WeakMap = window.WeakMap || window.MozWeakMap || function () {
+    function WeakMap() {
+      _classCallCheck(this, WeakMap);
+
+      this.keys = [];
+      this.values = [];
+    }
+
+    _createClass(WeakMap, [{
+      key: 'get',
+      value: function get(key) {
+        for (var i = 0; i < this.keys.length; i++) {
+          var item = this.keys[i];
+          if (item === key) {
+            return this.values[i];
+          }
+        }
+        return undefined;
+      }
+    }, {
+      key: 'set',
+      value: function set(key, value) {
+        for (var i = 0; i < this.keys.length; i++) {
+          var item = this.keys[i];
+          if (item === key) {
+            this.values[i] = value;
+            return this;
+          }
+        }
+        this.keys.push(key);
+        this.values.push(value);
+        return this;
+      }
+    }]);
+
+    return WeakMap;
+  }();
+
+  // Dummy MutationObserver, to avoid raising exceptions.
+  var MutationObserver = window.MutationObserver || window.WebkitMutationObserver || window.MozMutationObserver || (_temp = _class = function () {
+    function MutationObserver() {
+      _classCallCheck(this, MutationObserver);
+
+      if (typeof console !== 'undefined' && console !== null) {
+        console.warn('MutationObserver is not supported by your browser.');
+        console.warn('WOW.js cannot detect dom mutations, please call .sync() after loading new content.');
+      }
+    }
+
+    _createClass(MutationObserver, [{
+      key: 'observe',
+      value: function observe() {}
+    }]);
+
+    return MutationObserver;
+  }(), _class.notSupported = true, _temp);
+
+  // getComputedStyle shim, from http://stackoverflow.com/a/21797294
+  var getComputedStyle = window.getComputedStyle || function getComputedStyle(el) {
+    var getComputedStyleRX = /(\-([a-z]){1})/g;
+    return {
+      getPropertyValue: function getPropertyValue(prop) {
+        if (prop === 'float') {
+          prop = 'styleFloat';
+        }
+        if (getComputedStyleRX.test(prop)) {
+          prop.replace(getComputedStyleRX, function (_, _char) {
+            return _char.toUpperCase();
+          });
+        }
+        var currentStyle = el.currentStyle;
+
+        return (currentStyle != null ? currentStyle[prop] : void 0) || null;
+      }
+    };
+  };
+
+  var WOW = function () {
+    function WOW() {
+      var options = arguments.length <= 0 || arguments[0] === undefined ? {} : arguments[0];
+
+      _classCallCheck(this, WOW);
+
+      this.defaults = {
+        boxClass: 'wow',
+        animateClass: 'animated',
+        offset: 0,
+        mobile: true,
+        live: true,
+        callback: null,
+        scrollContainer: null,
+        resetAnimation: true
+      };
+
+      this.animate = function animateFactory() {
+        if ('requestAnimationFrame' in window) {
+          return function (callback) {
+            return window.requestAnimationFrame(callback);
+          };
+        }
+        return function (callback) {
+          return callback();
+        };
+      }();
+
+      this.vendors = ['moz', 'webkit'];
+
+      this.start = this.start.bind(this);
+      this.resetAnimation = this.resetAnimation.bind(this);
+      this.scrollHandler = this.scrollHandler.bind(this);
+      this.scrollCallback = this.scrollCallback.bind(this);
+      this.scrolled = true;
+      this.config = extend(options, this.defaults);
+      if (options.scrollContainer != null) {
+        this.config.scrollContainer = document.querySelector(options.scrollContainer);
+      }
+      // Map of elements to animation names:
+      this.animationNameCache = new WeakMap();
+      this.wowEvent = createEvent(this.config.boxClass);
+    }
+
+    _createClass(WOW, [{
+      key: 'init',
+      value: function init() {
+        this.element = window.document.documentElement;
+        if (isIn(document.readyState, ['interactive', 'complete'])) {
+          this.start();
+        } else {
+          addEvent(document, 'DOMContentLoaded', this.start);
+        }
+        this.finished = [];
+      }
+    }, {
+      key: 'start',
+      value: function start() {
+        var _this = this;
+
+        this.stopped = false;
+        this.boxes = [].slice.call(this.element.querySelectorAll('.' + this.config.boxClass));
+        this.all = this.boxes.slice(0);
+        if (this.boxes.length) {
+          if (this.disabled()) {
+            this.resetStyle();
+          } else {
+            for (var i = 0; i < this.boxes.length; i++) {
+              var box = this.boxes[i];
+              this.applyStyle(box, true);
+            }
+          }
+        }
+        if (!this.disabled()) {
+          addEvent(this.config.scrollContainer || window, 'scroll', this.scrollHandler);
+          addEvent(window, 'resize', this.scrollHandler);
+          this.interval = setInterval(this.scrollCallback, 50);
+        }
+        if (this.config.live) {
+          var mut = new MutationObserver(function (records) {
+            for (var j = 0; j < records.length; j++) {
+              var record = records[j];
+              for (var k = 0; k < record.addedNodes.length; k++) {
+                var node = record.addedNodes[k];
+                _this.doSync(node);
+              }
+            }
+            return undefined;
+          });
+          mut.observe(document.body, {
+            childList: true,
+            subtree: true
+          });
+        }
+      }
+    }, {
+      key: 'stop',
+      value: function stop() {
+        this.stopped = true;
+        removeEvent(this.config.scrollContainer || window, 'scroll', this.scrollHandler);
+        removeEvent(window, 'resize', this.scrollHandler);
+        if (this.interval != null) {
+          clearInterval(this.interval);
+        }
+      }
+    }, {
+      key: 'sync',
+      value: function sync() {
+        if (MutationObserver.notSupported) {
+          this.doSync(this.element);
+        }
+      }
+    }, {
+      key: 'doSync',
+      value: function doSync(element) {
+        if (typeof element === 'undefined' || element === null) {
+          element = this.element;
+        }
+        if (element.nodeType !== 1) {
+          return;
+        }
+        element = element.parentNode || element;
+        var iterable = element.querySelectorAll('.' + this.config.boxClass);
+        for (var i = 0; i < iterable.length; i++) {
+          var box = iterable[i];
+          if (!isIn(box, this.all)) {
+            this.boxes.push(box);
+            this.all.push(box);
+            if (this.stopped || this.disabled()) {
+              this.resetStyle();
+            } else {
+              this.applyStyle(box, true);
+            }
+            this.scrolled = true;
+          }
+        }
+      }
+    }, {
+      key: 'show',
+      value: function show(box) {
+        this.applyStyle(box);
+        box.className = box.className + ' ' + this.config.animateClass;
+        if (this.config.callback != null) {
+          this.config.callback(box);
+        }
+        emitEvent(box, this.wowEvent);
+
+        if (this.config.resetAnimation) {
+          addEvent(box, 'animationend', this.resetAnimation);
+          addEvent(box, 'oanimationend', this.resetAnimation);
+          addEvent(box, 'webkitAnimationEnd', this.resetAnimation);
+          addEvent(box, 'MSAnimationEnd', this.resetAnimation);
+        }
+
+        return box;
+      }
+    }, {
+      key: 'applyStyle',
+      value: function applyStyle(box, hidden) {
+        var _this2 = this;
+
+        var duration = box.getAttribute('data-wow-duration');
+        var delay = box.getAttribute('data-wow-delay');
+        var iteration = box.getAttribute('data-wow-iteration');
+
+        return this.animate(function () {
+          return _this2.customStyle(box, hidden, duration, delay, iteration);
+        });
+      }
+    }, {
+      key: 'resetStyle',
+      value: function resetStyle() {
+        for (var i = 0; i < this.boxes.length; i++) {
+          var box = this.boxes[i];
+          box.style.visibility = 'visible';
+        }
+        return undefined;
+      }
+    }, {
+      key: 'resetAnimation',
+      value: function resetAnimation(event) {
+        if (event.type.toLowerCase().indexOf('animationend') >= 0) {
+          var target = event.target || event.srcElement;
+          target.className = target.className.replace(this.config.animateClass, '').trim();
+        }
+      }
+    }, {
+      key: 'customStyle',
+      value: function customStyle(box, hidden, duration, delay, iteration) {
+        if (hidden) {
+          this.cacheAnimationName(box);
+        }
+        box.style.visibility = hidden ? 'hidden' : 'visible';
+
+        if (duration) {
+          this.vendorSet(box.style, { animationDuration: duration });
+        }
+        if (delay) {
+          this.vendorSet(box.style, { animationDelay: delay });
+        }
+        if (iteration) {
+          this.vendorSet(box.style, { animationIterationCount: iteration });
+        }
+        this.vendorSet(box.style, { animationName: hidden ? 'none' : this.cachedAnimationName(box) });
+
+        return box;
+      }
+    }, {
+      key: 'vendorSet',
+      value: function vendorSet(elem, properties) {
+        for (var name in properties) {
+          if (properties.hasOwnProperty(name)) {
+            var value = properties[name];
+            elem['' + name] = value;
+            for (var i = 0; i < this.vendors.length; i++) {
+              var vendor = this.vendors[i];
+              elem['' + vendor + name.charAt(0).toUpperCase() + name.substr(1)] = value;
+            }
+          }
+        }
+      }
+    }, {
+      key: 'vendorCSS',
+      value: function vendorCSS(elem, property) {
+        var style = getComputedStyle(elem);
+        var result = style.getPropertyCSSValue(property);
+        for (var i = 0; i < this.vendors.length; i++) {
+          var vendor = this.vendors[i];
+          result = result || style.getPropertyCSSValue('-' + vendor + '-' + property);
+        }
+        return result;
+      }
+    }, {
+      key: 'animationName',
+      value: function animationName(box) {
+        var aName = void 0;
+        try {
+          aName = this.vendorCSS(box, 'animation-name').cssText;
+        } catch (error) {
+          // Opera, fall back to plain property value
+          aName = getComputedStyle(box).getPropertyValue('animation-name');
+        }
+
+        if (aName === 'none') {
+          return ''; // SVG/Firefox, unable to get animation name?
+        }
+
+        return aName;
+      }
+    }, {
+      key: 'cacheAnimationName',
+      value: function cacheAnimationName(box) {
+        // https://bugzilla.mozilla.org/show_bug.cgi?id=921834
+        // box.dataset is not supported for SVG elements in Firefox
+        return this.animationNameCache.set(box, this.animationName(box));
+      }
+    }, {
+      key: 'cachedAnimationName',
+      value: function cachedAnimationName(box) {
+        return this.animationNameCache.get(box);
+      }
+    }, {
+      key: 'scrollHandler',
+      value: function scrollHandler() {
+        this.scrolled = true;
+      }
+    }, {
+      key: 'scrollCallback',
+      value: function scrollCallback() {
+        if (this.scrolled) {
+          this.scrolled = false;
+          var results = [];
+          for (var i = 0; i < this.boxes.length; i++) {
+            var box = this.boxes[i];
+            if (box) {
+              if (this.isVisible(box)) {
+                this.show(box);
+                continue;
+              }
+              results.push(box);
+            }
+          }
+          this.boxes = results;
+          if (!this.boxes.length && !this.config.live) {
+            this.stop();
+          }
+        }
+      }
+    }, {
+      key: 'offsetTop',
+      value: function offsetTop(element) {
+        // SVG elements don't have an offsetTop in Firefox.
+        // This will use their nearest parent that has an offsetTop.
+        // Also, using ('offsetTop' of element) causes an exception in Firefox.
+        while (element.offsetTop === undefined) {
+          element = element.parentNode;
+        }
+        var top = element.offsetTop;
+        while (element.offsetParent) {
+          element = element.offsetParent;
+          top += element.offsetTop;
+        }
+        return top;
+      }
+    }, {
+      key: 'isVisible',
+      value: function isVisible(box) {
+        var offset = box.getAttribute('data-wow-offset') || this.config.offset;
+        var viewTop = this.config.scrollContainer && this.config.scrollContainer.scrollTop || window.pageYOffset;
+        var viewBottom = viewTop + Math.min(this.element.clientHeight, getInnerHeight()) - offset;
+        var top = this.offsetTop(box);
+        var bottom = top + box.clientHeight;
+
+        return top <= viewBottom && bottom >= viewTop;
+      }
+    }, {
+      key: 'disabled',
+      value: function disabled() {
+        return !this.config.mobile && isMobile(navigator.userAgent);
+      }
+    }]);
+
+    return WOW;
+  }();
+
+  exports.default = WOW;
+  module.exports = exports['default'];
+});
diff --git a/docs/lib/wow/wow.min.js b/docs/lib/wow/wow.min.js
new file mode 100644
index 0000000..2a9cc46
--- /dev/null
+++ b/docs/lib/wow/wow.min.js
@@ -0,0 +1,3 @@
+/*! WOW wow.js - v1.3.0 - 2016-10-04
+* https://wowjs.uk
+* Copyright (c) 2016 Thomas Grainger; Licensed MIT */!function(a,b){if("function"==typeof define&&define.amd)define(["module","exports"],b);else if("undefined"!=typeof exports)b(module,exports);else{var c={exports:{}};b(c,c.exports),a.WOW=c.exports}}(this,function(a,b){"use strict";function c(a,b){if(!(a instanceof b))throw new TypeError("Cannot call a class as a function")}function d(a,b){return b.indexOf(a)>=0}function e(a,b){for(var c in b)if(null==a[c]){var d=b[c];a[c]=d}return a}function f(a){return/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(a)}function g(a){var b=arguments.length<=1||void 0===arguments[1]?!1:arguments[1],c=arguments.length<=2||void 0===arguments[2]?!1:arguments[2],d=arguments.length<=3||void 0===arguments[3]?null:arguments[3],e=void 0;return null!=document.createEvent?(e=document.createEvent("CustomEvent"),e.initCustomEvent(a,b,c,d)):null!=document.createEventObject?(e=document.createEventObject(),e.eventType=a):e.eventName=a,e}function h(a,b){null!=a.dispatchEvent?a.dispatchEvent(b):b in(null!=a)?a[b]():"on"+b in(null!=a)&&a["on"+b]()}function i(a,b,c){null!=a.addEventListener?a.addEventListener(b,c,!1):null!=a.attachEvent?a.attachEvent("on"+b,c):a[b]=c}function j(a,b,c){null!=a.removeEventListener?a.removeEventListener(b,c,!1):null!=a.detachEvent?a.detachEvent("on"+b,c):delete a[b]}function k(){return"innerHeight"in window?window.innerHeight:document.documentElement.clientHeight}Object.defineProperty(b,"__esModule",{value:!0});var l,m,n=function(){function a(a,b){for(var c=0;c<b.length;c++){var d=b[c];d.enumerable=d.enumerable||!1,d.configurable=!0,"value"in d&&(d.writable=!0),Object.defineProperty(a,d.key,d)}}return function(b,c,d){return c&&a(b.prototype,c),d&&a(b,d),b}}(),o=window.WeakMap||window.MozWeakMap||function(){function a(){c(this,a),this.keys=[],this.values=[]}return n(a,[{key:"get",value:function(a){for(var b=0;b<this.keys.length;b++){var c=this.keys[b];if(c===a)return this.values[b]}}},{key:"set",value:function(a,b){for(var c=0;c<this.keys.length;c++){var d=this.keys[c];if(d===a)return this.values[c]=b,this}return this.keys.push(a),this.values.push(b),this}}]),a}(),p=window.MutationObserver||window.WebkitMutationObserver||window.MozMutationObserver||(m=l=function(){function a(){c(this,a),"undefined"!=typeof console&&null!==console&&(console.warn("MutationObserver is not supported by your browser."),console.warn("WOW.js cannot detect dom mutations, please call .sync() after loading new content."))}return n(a,[{key:"observe",value:function(){}}]),a}(),l.notSupported=!0,m),q=window.getComputedStyle||function(a){var b=/(\-([a-z]){1})/g;return{getPropertyValue:function(c){"float"===c&&(c="styleFloat"),b.test(c)&&c.replace(b,function(a,b){return b.toUpperCase()});var d=a.currentStyle;return(null!=d?d[c]:void 0)||null}}},r=function(){function a(){var b=arguments.length<=0||void 0===arguments[0]?{}:arguments[0];c(this,a),this.defaults={boxClass:"wow",animateClass:"animated",offset:0,mobile:!0,live:!0,callback:null,scrollContainer:null,resetAnimation:!0},this.animate=function(){return"requestAnimationFrame"in window?function(a){return window.requestAnimationFrame(a)}:function(a){return a()}}(),this.vendors=["moz","webkit"],this.start=this.start.bind(this),this.resetAnimation=this.resetAnimation.bind(this),this.scrollHandler=this.scrollHandler.bind(this),this.scrollCallback=this.scrollCallback.bind(this),this.scrolled=!0,this.config=e(b,this.defaults),null!=b.scrollContainer&&(this.config.scrollContainer=document.querySelector(b.scrollContainer)),this.animationNameCache=new o,this.wowEvent=g(this.config.boxClass)}return n(a,[{key:"init",value:function(){this.element=window.document.documentElement,d(document.readyState,["interactive","complete"])?this.start():i(document,"DOMContentLoaded",this.start),this.finished=[]}},{key:"start",value:function(){var a=this;if(this.stopped=!1,this.boxes=[].slice.call(this.element.querySelectorAll("."+this.config.boxClass)),this.all=this.boxes.slice(0),this.boxes.length)if(this.disabled())this.resetStyle();else for(var b=0;b<this.boxes.length;b++){var c=this.boxes[b];this.applyStyle(c,!0)}if(this.disabled()||(i(this.config.scrollContainer||window,"scroll",this.scrollHandler),i(window,"resize",this.scrollHandler),this.interval=setInterval(this.scrollCallback,50)),this.config.live){var d=new p(function(b){for(var c=0;c<b.length;c++)for(var d=b[c],e=0;e<d.addedNodes.length;e++){var f=d.addedNodes[e];a.doSync(f)}});d.observe(document.body,{childList:!0,subtree:!0})}}},{key:"stop",value:function(){this.stopped=!0,j(this.config.scrollContainer||window,"scroll",this.scrollHandler),j(window,"resize",this.scrollHandler),null!=this.interval&&clearInterval(this.interval)}},{key:"sync",value:function(){p.notSupported&&this.doSync(this.element)}},{key:"doSync",value:function(a){if("undefined"!=typeof a&&null!==a||(a=this.element),1===a.nodeType){a=a.parentNode||a;for(var b=a.querySelectorAll("."+this.config.boxClass),c=0;c<b.length;c++){var e=b[c];d(e,this.all)||(this.boxes.push(e),this.all.push(e),this.stopped||this.disabled()?this.resetStyle():this.applyStyle(e,!0),this.scrolled=!0)}}}},{key:"show",value:function(a){return this.applyStyle(a),a.className=a.className+" "+this.config.animateClass,null!=this.config.callback&&this.config.callback(a),h(a,this.wowEvent),this.config.resetAnimation&&(i(a,"animationend",this.resetAnimation),i(a,"oanimationend",this.resetAnimation),i(a,"webkitAnimationEnd",this.resetAnimation),i(a,"MSAnimationEnd",this.resetAnimation)),a}},{key:"applyStyle",value:function(a,b){var c=this,d=a.getAttribute("data-wow-duration"),e=a.getAttribute("data-wow-delay"),f=a.getAttribute("data-wow-iteration");return this.animate(function(){return c.customStyle(a,b,d,e,f)})}},{key:"resetStyle",value:function(){for(var a=0;a<this.boxes.length;a++){var b=this.boxes[a];b.style.visibility="visible"}}},{key:"resetAnimation",value:function(a){if(a.type.toLowerCase().indexOf("animationend")>=0){var b=a.target||a.srcElement;b.className=b.className.replace(this.config.animateClass,"").trim()}}},{key:"customStyle",value:function(a,b,c,d,e){return b&&this.cacheAnimationName(a),a.style.visibility=b?"hidden":"visible",c&&this.vendorSet(a.style,{animationDuration:c}),d&&this.vendorSet(a.style,{animationDelay:d}),e&&this.vendorSet(a.style,{animationIterationCount:e}),this.vendorSet(a.style,{animationName:b?"none":this.cachedAnimationName(a)}),a}},{key:"vendorSet",value:function(a,b){for(var c in b)if(b.hasOwnProperty(c)){var d=b[c];a[""+c]=d;for(var e=0;e<this.vendors.length;e++){var f=this.vendors[e];a[""+f+c.charAt(0).toUpperCase()+c.substr(1)]=d}}}},{key:"vendorCSS",value:function(a,b){for(var c=q(a),d=c.getPropertyCSSValue(b),e=0;e<this.vendors.length;e++){var f=this.vendors[e];d=d||c.getPropertyCSSValue("-"+f+"-"+b)}return d}},{key:"animationName",value:function(a){var b=void 0;try{b=this.vendorCSS(a,"animation-name").cssText}catch(c){b=q(a).getPropertyValue("animation-name")}return"none"===b?"":b}},{key:"cacheAnimationName",value:function(a){return this.animationNameCache.set(a,this.animationName(a))}},{key:"cachedAnimationName",value:function(a){return this.animationNameCache.get(a)}},{key:"scrollHandler",value:function(){this.scrolled=!0}},{key:"scrollCallback",value:function(){if(this.scrolled){this.scrolled=!1;for(var a=[],b=0;b<this.boxes.length;b++){var c=this.boxes[b];if(c){if(this.isVisible(c)){this.show(c);continue}a.push(c)}}this.boxes=a,this.boxes.length||this.config.live||this.stop()}}},{key:"offsetTop",value:function(a){for(;void 0===a.offsetTop;)a=a.parentNode;for(var b=a.offsetTop;a.offsetParent;)a=a.offsetParent,b+=a.offsetTop;return b}},{key:"isVisible",value:function(a){var b=a.getAttribute("data-wow-offset")||this.config.offset,c=this.config.scrollContainer&&this.config.scrollContainer.scrollTop||window.pageYOffset,d=c+Math.min(this.element.clientHeight,k())-b,e=this.offsetTop(a),f=e+a.clientHeight;return d>=e&&f>=c}},{key:"disabled",value:function(){return!this.config.mobile&&f(navigator.userAgent)}}]),a}();b["default"]=r,a.exports=b["default"]});