test.js

var Module;

if (typeof Module === 'undefined') Module = {};

if (!Module.expectedDataFileDownloads) {
  Module.expectedDataFileDownloads = 0;
  Module.finishedDataFileDownloads = 0;
}
Module.expectedDataFileDownloads++;
(function() {
 var loadPackage = function(metadata) {

  function runWithFS() {

    function assert(check, msg) {
      if (!check) throw msg + new Error().stack;
    }
Module['FS_createPath']('/', 'data', true, true);
var fileData0 = [];
fileData0.push.apply(fileData0, [76, 79, 79, 80, 58, 32, 32, 32, 76, 79, 68, 68, 32, 80, 97, 115, 67, 110, 116, 58, 32, 32, 9, 9, 59, 32, 110, 117, 109, 32, 111, 102, 32, 102, 105, 98, 115, 32, 116, 111, 32, 100, 111, 32, 105, 110, 32, 80, 97, 115, 67, 110, 116, 10, 9, 74, 90, 69, 82, 32, 68, 79, 78, 69, 58, 9, 9, 59, 32, 110, 111, 32, 109, 111, 114, 101, 32, 112, 97, 115, 115, 101, 115, 44, 32, 103, 111, 32, 116, 111, 32, 100, 111, 110, 101, 10, 9, 83, 85, 66, 68, 32, 99, 49, 58, 10, 9, 83, 84, 79, 68, 32, 80, 97, 115, 67, 110, 116, 58, 9, 9, 59, 32, 45, 32, 45, 32, 112, 97, 115, 115, 101, 115, 32, 114, 101, 109, 97, 105, 110, 105, 110, 103, 10, 80, 49, 58, 9, 76, 79, 68, 68, 32, 100, 97, 100, 100, 114, 58, 9, 9, 59, 32, 108, 111, 97, 100, 32, 97, 32, 112, 111, 105, 110, 116, 101, 114, 32, 116, 111, 32, 102, 105, 98, 32, 97, 114, 103, 10, 9, 80, 83, 72, 73, 9, 9, 9, 59, 32, 112, 117, 115, 104, 32, 97, 114, 103, 32, 102, 111, 114, 32, 102, 105, 98, 32, 111, 110, 32, 115, 116, 97, 99, 107, 10, 9, 65, 68, 68, 68, 32, 99, 49, 58, 10, 9, 83, 84, 79, 68, 32, 100, 97, 100, 100, 114, 58, 9, 9, 59, 32, 105, 110, 99, 44, 32, 115, 116, 111, 114, 101, 32, 112, 111, 105, 110, 116, 101, 114, 32, 102, 111, 114, 32, 110, 101, 120, 116, 32, 100, 91, 110, 93, 32, 10, 9, 67, 65, 76, 76, 32, 70, 73, 66, 58, 9, 9, 59, 32, 99, 97, 108, 108, 32, 102, 105, 98, 32, 40, 97, 114, 103, 32, 111, 110, 32, 115, 116, 97, 99, 107, 41, 10, 9, 73, 78, 83, 80, 32, 49, 9, 9, 9, 59, 32, 99, 108, 101, 97, 114, 32, 115, 116, 97, 99, 107, 32, 111, 110, 32, 102, 105, 98, 32, 114, 101, 116, 117, 114, 110, 10, 80, 50, 58, 9, 80, 85, 83, 72, 9, 9, 9, 59, 32, 112, 117, 116, 32, 114, 101, 116, 117, 114, 110, 32, 65, 67, 32, 40, 102, 105, 98, 40, 110, 41, 41, 32, 111, 110, 32, 115, 116, 97, 99, 107, 10, 9, 76, 79, 68, 68, 32, 102, 97, 100, 100, 114, 58, 9, 9, 59, 32, 108, 111, 97, 100, 32, 97, 32, 112, 111, 105, 110, 116, 101, 114, 32, 116, 111, 32, 114, 101, 115, 117, 108, 116, 32, 102, 91, 110, 93, 10, 9, 80, 79, 80, 73, 9, 9, 9, 59, 32, 112, 111, 112, 32, 114, 101, 115, 117, 108, 116, 32, 111, 102, 102, 32, 115, 116, 97, 99, 107, 32, 105, 110, 116, 111, 32, 102, 91, 110, 93, 10, 9, 65, 68, 68, 68, 32, 99, 49, 58, 10, 9, 83, 84, 79, 68, 32, 102, 97, 100, 100, 114, 58, 9, 9, 59, 32, 105, 110, 99, 44, 32, 115, 116, 111, 114, 101, 32, 112, 111, 105, 110, 116, 101, 114, 32, 102, 111, 114, 32, 110, 101, 120, 116, 32, 102, 91, 110, 93, 10, 9, 74, 85, 77, 80, 32, 76, 79, 79, 80, 58, 9, 9, 59, 32, 103, 111, 32, 116, 111, 32, 116, 111, 112, 32, 102, 111, 114, 32, 110, 101, 120, 116, 32, 112, 97, 115, 115, 10, 70, 73, 66, 58, 9, 76, 79, 68, 76, 32, 49, 9, 9, 9, 59, 32, 102, 105, 98, 32, 102, 117, 110, 99, 32, 108, 111, 97, 100, 115, 32, 97, 114, 103, 32, 102, 114, 111, 109, 32, 115, 116, 97, 99, 107, 10, 9, 74, 90, 69, 82, 32, 70, 73, 66, 90, 69, 82, 58, 9, 9, 59, 32, 105, 102, 32, 102, 105, 98, 40, 48, 41, 32, 103, 111, 32, 116, 111, 32, 70, 73, 66, 90, 69, 82, 10, 9, 83, 85, 66, 68, 32, 99, 49, 58, 9, 9, 59, 32, 100, 101, 99, 32, 97, 114, 103, 32, 118, 97, 108, 117, 101, 32, 105, 110, 32, 65, 67, 32, 40, 97, 114, 103, 45, 49, 41, 10, 9, 74, 90, 69, 82, 32, 70, 73, 66, 79, 78, 69, 58, 9, 9, 59, 32, 105, 102, 32, 102, 105, 98, 40, 49, 41, 32, 103, 111, 32, 116, 111, 32, 70, 73, 66, 79, 78, 69, 10, 9, 83, 84, 79, 68, 32, 76, 112, 67, 110, 116, 58, 9, 9, 59, 32, 110, 117, 109, 98, 101, 114, 32, 111, 102, 32, 105, 116, 101, 114, 97, 116, 105, 111, 110, 115, 32, 105, 110, 32, 76, 112, 67, 110, 116, 10, 9, 76, 79, 68, 68, 32, 99, 48, 58, 9, 9, 59, 32, 108, 111, 97, 100, 32, 97, 32, 48, 32, 105, 110, 116, 111, 32, 116, 104, 101, 32, 65, 67, 10, 9, 83, 84, 79, 68, 32, 102, 109, 50, 58, 9, 9, 59, 32, 115, 116, 111, 114, 101, 32, 48, 32, 105, 110, 32, 102, 105, 98, 40, 110, 45, 50, 41, 10, 9, 76, 79, 68, 68, 32, 99, 49, 58, 9, 9, 59, 32, 108, 111, 97, 100, 32, 97, 32, 49, 32, 105, 110, 116, 111, 32, 116, 104, 101, 32, 65, 67, 10, 9, 83, 84, 79, 68, 32, 102, 109, 49, 58, 9, 9, 59, 32, 115, 116, 111, 114, 101, 32, 49, 32, 105, 110, 32, 102, 105, 98, 40, 110, 45, 49, 41, 10, 73, 84, 69, 82, 58, 9, 76, 79, 68, 68, 32, 76, 112, 67, 110, 116, 58, 9, 9, 59, 32, 76, 112, 67, 110, 116, 32, 97, 114, 103, 32, 45, 32, 49, 32, 105, 116, 101, 114, 97, 116, 105, 111, 110, 115, 32, 110, 101, 101, 100, 101, 100, 10, 9, 74, 90, 69, 82, 32, 82, 84, 78, 58, 9, 9, 59, 32, 119, 104, 101, 110, 32, 76, 112, 67, 110, 116, 32, 61, 61, 32, 48, 32, 103, 111, 116, 111, 32, 82, 84, 78, 58, 10, 9, 83, 85, 66, 68, 32, 99, 49, 58, 9, 9, 59, 32, 100, 101, 99, 32, 97, 114, 103, 32, 118, 97, 108, 117, 101, 32, 105, 110, 32, 65, 67, 32, 40, 76, 112, 67, 110, 116, 45, 49, 41, 10, 9, 83, 84, 79, 68, 32, 76, 112, 67, 110, 116, 58, 9, 9, 59, 32, 115, 116, 111, 114, 101, 32, 76, 112, 67, 110, 116, 32, 102, 111, 114, 32, 110, 101, 120, 116, 32, 105, 116, 101, 114, 97, 116, 105, 111, 110, 10, 9, 76, 79, 68, 68, 32, 102, 109, 50, 58, 9, 9, 59, 32, 97, 114, 103, 32, 109, 117, 115, 116, 32, 98, 101, 32, 62, 61, 32, 50, 44, 32, 102, 109, 50, 32, 105, 110, 105, 116, 105, 97, 108, 108, 121, 32, 102, 105, 98, 40, 48, 41, 10, 9, 65, 68, 68, 68, 32, 102, 109, 49, 58, 9, 9, 59, 32, 102, 109, 49, 32, 105, 110, 105, 116, 105, 97, 108, 108, 121, 32, 102, 105, 98, 40, 49, 41, 44, 32, 115, 111, 32, 65, 67, 32, 61, 32, 102, 109, 50, 43, 102, 109, 49, 10, 9, 83, 84, 79, 68, 32, 116, 109, 112, 58, 9, 9, 59, 32, 115, 116, 111, 114, 101, 32, 116, 104, 105, 115, 32, 65, 67, 32, 116, 111, 32, 116, 109, 112, 58, 10, 9, 76, 79, 68, 68, 32, 102, 109, 49, 58, 9, 9, 59, 32, 110, 111, 119, 32, 108, 111, 97, 100, 32, 65, 67, 32, 119, 105, 116, 104, 32, 102, 105, 98, 40, 110, 45, 49, 41, 10, 9, 83, 84, 79, 68, 32, 102, 109, 50, 58, 9, 9, 59, 32, 114, 101, 112, 108, 97, 99, 101, 32, 111, 108, 100, 32, 102, 105, 98, 40, 110, 45, 50, 41, 32, 119, 105, 116, 104, 32, 65, 67, 10, 9, 76, 79, 68, 68, 32, 116, 109, 112, 58, 9, 9, 59, 32, 108, 111, 97, 100, 32, 65, 67, 32, 119, 105, 116, 104, 32, 116, 109, 112, 58, 32, 98, 101, 99, 111, 109, 101, 115, 32, 102, 105, 98, 40, 110, 45, 49, 41, 10, 9, 83, 84, 79, 68, 32, 102, 109, 49, 58, 9, 9, 59, 32, 115, 116, 111, 114, 101, 32, 65, 67, 32, 97, 115, 32, 110, 101, 120, 116, 32, 102, 105, 98, 40, 110, 45, 49, 41, 32, 116, 111, 32, 102, 109, 49, 10, 9, 74, 85, 77, 80, 32, 73, 84, 69, 82, 58, 9, 9, 59, 32, 106, 117, 109, 112, 32, 116, 111, 32, 110, 101, 120, 116, 32, 105, 116, 101, 114, 97, 116, 105, 111, 110, 32, 10, 82, 84, 78, 58, 9, 76, 79, 68, 68, 32, 116, 109, 112, 58, 9, 9, 59, 32, 108, 111, 97, 100, 32, 65, 67, 32, 119, 105, 116, 104, 32, 116, 109, 112, 58, 32, 46, 46, 32, 102, 105, 110, 97, 108, 32, 114, 101, 115, 117, 108, 116, 10, 9, 82, 69, 84, 78, 10, 70, 73, 66, 90, 69, 82, 58, 9, 76, 79, 68, 68, 32, 99, 48, 58, 10, 9, 82, 69, 84, 78, 9, 9, 9, 59, 32, 65, 67, 32, 61, 32, 48, 32, 102, 111, 114, 32, 102, 105, 98, 40, 48, 41, 10, 70, 73, 66, 79, 78, 69, 58, 9, 76, 79, 68, 68, 32, 99, 49, 58, 10, 9, 82, 69, 84, 78, 9, 9, 9, 59, 32, 65, 67, 32, 61, 32, 49, 32, 102, 111, 114, 32, 102, 105, 98, 40, 49, 41, 10, 68, 79, 78, 69, 58, 9, 72, 65, 76, 84, 9, 32, 10, 46, 76, 79, 67, 32, 9, 49, 48, 48, 9, 9, 9, 59, 32, 108, 111, 99, 97, 116, 101, 32, 100, 97, 116, 97, 32, 98, 101, 103, 105, 110, 110, 105, 110, 103, 32, 97, 116, 32, 49, 48, 48, 10, 100, 48, 58, 32, 32, 9, 51, 9, 9, 9, 59, 32, 97, 114, 114, 97, 121, 32, 111, 102, 32, 97, 114, 103, 115, 32, 102, 111, 114, 32, 102, 105, 98, 32, 102, 117, 110, 99, 116, 105, 111, 110, 10, 32, 32, 32, 32, 32, 9, 57, 10, 32, 32, 32, 32, 32, 9, 49, 56, 10, 32, 32, 32, 32, 32, 9, 50, 51, 10, 32, 32, 32, 32, 32, 9, 50, 53, 10, 102, 48, 58, 32, 32, 9, 48, 9, 9, 9, 59, 32, 97, 114, 114, 97, 121, 32, 111, 102, 32, 114, 101, 115, 117, 108, 116, 32, 108, 111, 99, 115, 32, 102, 111, 114, 32, 102, 105, 98, 32, 114, 101, 116, 117, 114, 110, 115, 10, 32, 32, 32, 32, 32, 9, 48, 10, 32, 32, 32, 32, 32, 9, 48, 10, 32, 32, 32, 32, 32, 9, 48, 32, 10, 32, 32, 32, 32, 32, 9, 48, 10, 100, 97, 100, 100, 114, 58, 32, 32, 100, 48, 58, 9, 9, 9, 59, 32, 115, 116, 97, 114, 116, 32, 97, 100, 100, 114, 101, 115, 115, 32, 111, 102, 32, 102, 105, 98, 32, 97, 114, 103, 115, 32, 10, 102, 97, 100, 100, 114, 58, 32, 32, 102, 48, 58, 9, 9, 9, 59, 32, 115, 116, 97, 114, 116, 32, 97, 100, 100, 114, 101, 115, 115, 32, 111, 102, 32, 102, 105, 98, 32, 114, 101, 115, 117, 108, 116, 115, 10, 99, 48, 58, 32, 9, 48, 9, 9, 9, 59, 32, 99, 111, 110, 115, 116, 97, 110, 116, 115, 32, 10, 99, 49, 58, 32, 9, 49, 10, 80, 97, 115, 67, 110, 116, 58, 32, 53, 9, 9, 9, 59, 32, 110, 117, 109, 98, 101, 114, 32, 111, 102, 32, 100, 97, 116, 97, 32, 101, 108, 101, 109, 101, 110, 116, 115, 32, 116, 111, 32, 112, 114, 111, 99, 101, 115, 115, 10, 76, 112, 67, 110, 116, 58, 9, 48, 9, 9, 9, 59, 32, 110, 117, 109, 98, 101, 114, 32, 111, 102, 32, 102, 105, 98, 32, 105, 116, 101, 114, 97, 116, 105, 111, 110, 115, 10, 116, 109, 112, 58, 9, 48, 9, 9, 9, 59, 32, 105, 110, 105, 116, 105, 97, 108, 32, 118, 97, 108, 117, 101, 32, 102, 111, 114, 32, 102, 105, 98, 40, 50, 41, 10, 102, 109, 49, 58, 9, 48, 9, 9, 9, 59, 32, 97, 116, 32, 97, 110, 121, 32, 112, 111, 105, 110, 116, 32, 102, 105, 98, 40, 110, 45, 49, 41, 10, 102, 109, 50, 58, 9, 48, 9, 9, 9, 59, 32, 97, 116, 32, 97, 110, 121, 32, 112, 111, 105, 110, 116, 32, 102, 105, 98, 40, 110, 45, 50, 41, 10]);
Module['FS_createDataFile']('/data', 'ifib.asm', fileData0, true, true, false);
var fileData1 = [];
fileData1.push.apply(fileData1, [48, 48, 48, 49, 48, 48, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 49, 48, 48, 48, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 49, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 49, 49, 48, 48, 10, 48, 48, 49, 48, 48, 49, 48, 48, 48, 48, 48, 49, 48, 49, 48, 48, 48, 48, 49, 49, 48, 48, 49, 49, 48, 48, 48, 49, 48, 48, 49, 49, 10, 48, 48, 49, 49, 48, 49, 48, 48, 48, 48, 48, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 49, 48, 49, 49, 10, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 49, 48, 48, 49, 10, 48, 48, 48, 49, 48, 48, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 48, 49, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 49, 49, 49, 49, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 48, 49, 48, 48, 48, 49, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 49, 49, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 49, 49, 49, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 49, 49, 49, 49, 10, 48, 48, 48, 49, 48, 48, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 48, 49, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 49, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 49, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 48, 49, 48, 48, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 49, 48, 48, 48, 49, 48, 49, 49, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 10, 49, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 49, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 49, 49, 48, 49, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 49, 49, 48, 49, 48, 48, 48, 48, 48, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 49, 49, 48, 48, 49, 10, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 49, 48, 49, 49, 49, 10, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 49, 49, 48, 49, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 49, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 49, 48, 49, 49, 48, 10, 48, 49, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 49, 49, 48, 49, 49, 10, 48, 49, 49, 48, 49, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 49, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 49, 49, 48, 49, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 49, 48, 48, 49, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 49, 48, 48, 49, 48, 48, 48, 48, 48, 49, 48, 49, 48, 48, 48, 48, 49, 49, 48, 48, 49, 49, 48, 48, 49, 48, 49, 48, 48, 48, 10, 48, 48, 49, 49, 48, 49, 48, 48, 48, 48, 48, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 49, 48, 48, 48, 49, 49, 10, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 49, 48, 48, 48, 48, 49, 10, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 49, 48, 49, 48, 48, 48, 49, 48, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 49, 49, 49, 48, 48, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 49, 49, 10, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 49, 48, 49, 48, 48, 48, 49, 48, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 49, 49, 49, 48, 48, 48, 49, 49, 48, 49, 48, 48, 48, 48, 48, 49, 48, 49, 48, 48, 48, 48, 49, 48, 48, 48, 48, 49, 48, 49, 48, 10, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 49, 48, 48, 49, 49, 48, 10, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 49, 48, 49, 48, 48, 48, 49, 48, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 49, 49, 49, 48, 48, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 49, 48, 49, 10, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 49, 48, 49, 48, 48, 48, 49, 48, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 49, 49, 49, 48, 48, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 10, 48, 48, 49, 49, 48, 49, 48, 48, 48, 48, 48, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 49, 48, 49, 49, 49, 48, 10, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 49, 48, 49, 49, 48, 48, 10, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 49, 48, 49, 49, 48, 10, 48, 49, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 49, 49, 48, 49, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 49, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 49, 49, 48, 49, 48, 48, 48, 48, 48, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 49, 49, 48, 48, 49, 48, 10, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 49, 48, 48, 48, 49, 48, 48, 49, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 48, 49, 48, 48, 48, 49, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 49, 49, 48, 49, 48, 48, 48, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 49, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 49, 49, 48, 49, 48, 48, 48, 48, 48, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 49, 48, 48, 48, 48, 48, 49, 10, 48, 48, 49, 49, 48, 49, 48, 48, 48, 48, 48, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 49, 49, 49, 48, 49, 49, 10, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 49, 49, 49, 48, 48, 48, 10, 48, 48, 48, 49, 48, 48, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 49, 48, 48, 49, 48, 48, 48, 49, 48, 48, 49, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 49, 49, 49, 48, 48, 48, 48, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 49, 48, 10, 48, 48, 48, 48, 48, 48, 48, 48, 49, 49, 48, 49, 48, 48, 49, 48, 48, 48, 49, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 48, 49, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 49, 49, 49, 48, 48, 48, 48, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 49, 48, 10, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 49, 49, 49, 49, 49, 48, 10, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 49, 48, 48, 48, 49, 48, 48, 49, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 49, 49, 49, 48, 48, 48, 49, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 49, 48, 48, 48, 48, 49, 48, 49, 48, 10, 48, 48, 48, 48, 48, 48, 48, 48, 49, 49, 48, 49, 48, 48, 49, 48, 48, 48, 49, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 48, 49, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 49, 49, 49, 49, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 49, 49, 48, 49, 48, 48, 48, 48, 48, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 49, 48, 48, 49, 48, 48, 49, 10, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 49, 48, 48, 48, 49, 49, 48, 10, 48, 48, 48, 48, 48, 48, 48, 48, 49, 49, 48, 49, 48, 48, 49, 48, 48, 48, 49, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 48, 49, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 49, 49, 49, 49, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 49, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 49, 49, 49, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 49, 48, 48, 48, 48, 48, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 48, 49, 48, 48, 49, 49, 48, 48, 10, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 49, 49, 48, 49, 48, 48, 48, 49, 49, 49, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 48, 49, 48, 48, 48, 49, 48, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 49, 48, 49, 48, 48, 48, 49, 48, 48, 48, 49, 48, 48, 48, 49, 48, 49, 48, 48, 48, 48, 10, 48, 48, 48, 48, 49, 48, 48, 48, 48, 48, 48, 49, 49, 48, 49, 48, 48, 48, 49, 49, 49, 48, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 49, 49, 48, 49, 48, 48, 48, 48, 48, 49, 48, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 49, 49, 48, 49, 48, 49, 48, 49, 48, 48, 49, 49, 48, 48, 49, 48, 48, 49, 48, 49, 49, 10, 48, 48, 48, 48, 48, 48, 48, 48, 48, 49, 49, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 48, 10, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 10]);
Module['FS_createDataFile']('/data', 'prom.dat', fileData1, true, true, false);

  }
  if (Module['calledRun']) {
    runWithFS();
  } else {
    if (!Module['preRun']) Module['preRun'] = [];
    Module["preRun"].push(runWithFS); // FS is not initialized yet, wait for it
  }

 }
 loadPackage({"files": []});

})();

// Route URL GET parameters to argc+argv
if (typeof window === "object") {
  Module['arguments'] = window.location.search.substr(1).trim().split('&');
  // If no args were passed arguments = [''], in which case kill the single empty string.
  if (!Module['arguments'][0])
    Module['arguments'] = [];
}
// The Module object: Our interface to the outside world. We import
// and export values on it, and do the work to get that through
// closure compiler if necessary. There are various ways Module can be used:
// 1. Not defined. We create it here
// 2. A function parameter, function(Module) { ..generated code.. }
// 3. pre-run appended it, var Module = {}; ..generated code..
// 4. External script tag defines var Module.
// We need to do an eval in order to handle the closure compiler
// case, where this code here is minified but Module was defined
// elsewhere (e.g. case 4 above). We also need to check if Module
// already exists (e.g. case 3 above).
// Note that if you want to run closure, and also to use Module
// after the generated code, you will need to define   var Module = {};
// before the code. Then that object will be used in the code, and you
// can continue to use Module afterwards as well.
var Module;
if (!Module) Module = (typeof Module !== 'undefined' ? Module : null) || {};

// Sometimes an existing Module object exists with properties
// meant to overwrite the default module functionality. Here
// we collect those properties and reapply _after_ we configure
// the current environment's defaults to avoid having to be so
// defensive during initialization.
var moduleOverrides = {};
for (var key in Module) {
  if (Module.hasOwnProperty(key)) {
    moduleOverrides[key] = Module[key];
  }
}

// The environment setup code below is customized to use Module.
// *** Environment setup code ***
var ENVIRONMENT_IS_WEB = false;
var ENVIRONMENT_IS_WORKER = false;
var ENVIRONMENT_IS_NODE = false;
var ENVIRONMENT_IS_SHELL = false;

// Three configurations we can be running in:
// 1) We could be the application main() thread running in the main JS UI thread. (ENVIRONMENT_IS_WORKER == false and ENVIRONMENT_IS_PTHREAD == false)
// 2) We could be the application main() thread proxied to worker. (with Emscripten -s PROXY_TO_WORKER=1) (ENVIRONMENT_IS_WORKER == true, ENVIRONMENT_IS_PTHREAD == false)
// 3) We could be an application pthread running in a worker. (ENVIRONMENT_IS_WORKER == true and ENVIRONMENT_IS_PTHREAD == true)

if (Module['ENVIRONMENT']) {
  if (Module['ENVIRONMENT'] === 'WEB') {
    ENVIRONMENT_IS_WEB = true;
  } else if (Module['ENVIRONMENT'] === 'WORKER') {
    ENVIRONMENT_IS_WORKER = true;
  } else if (Module['ENVIRONMENT'] === 'NODE') {
    ENVIRONMENT_IS_NODE = true;
  } else if (Module['ENVIRONMENT'] === 'SHELL') {
    ENVIRONMENT_IS_SHELL = true;
  } else {
    throw new Error('The provided Module[\'ENVIRONMENT\'] value is not valid. It must be one of: WEB|WORKER|NODE|SHELL.');
  }
} else {
  ENVIRONMENT_IS_WEB = typeof window === 'object';
  ENVIRONMENT_IS_WORKER = typeof importScripts === 'function';
  ENVIRONMENT_IS_NODE = typeof process === 'object' && typeof require === 'function' && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER;
  ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER;
}


if (ENVIRONMENT_IS_NODE) {
  // Expose functionality in the same simple way that the shells work
  // Note that we pollute the global namespace here, otherwise we break in node
  if (!Module['print']) Module['print'] = console.log;
  if (!Module['printErr']) Module['printErr'] = console.warn;

  var nodeFS;
  var nodePath;

  Module['read'] = function shell_read(filename, binary) {
    if (!nodeFS) nodeFS = require('fs');
    if (!nodePath) nodePath = require('path');
    filename = nodePath['normalize'](filename);
    var ret = nodeFS['readFileSync'](filename);
    return binary ? ret : ret.toString();
  };

  Module['readBinary'] = function readBinary(filename) {
    var ret = Module['read'](filename, true);
    if (!ret.buffer) {
      ret = new Uint8Array(ret);
    }
    assert(ret.buffer);
    return ret;
  };

  Module['load'] = function load(f) {
    globalEval(read(f));
  };

  if (!Module['thisProgram']) {
    if (process['argv'].length > 1) {
      Module['thisProgram'] = process['argv'][1].replace(/\\/g, '/');
    } else {
      Module['thisProgram'] = 'unknown-program';
    }
  }

  Module['arguments'] = process['argv'].slice(2);

  if (typeof module !== 'undefined') {
    module['exports'] = Module;
  }

  process['on']('uncaughtException', function(ex) {
    // suppress ExitStatus exceptions from showing an error
    if (!(ex instanceof ExitStatus)) {
      throw ex;
    }
  });

  Module['inspect'] = function () { return '[Emscripten Module object]'; };
}
else if (ENVIRONMENT_IS_SHELL) {
  if (!Module['print']) Module['print'] = print;
  if (typeof printErr != 'undefined') Module['printErr'] = printErr; // not present in v8 or older sm

  if (typeof read != 'undefined') {
    Module['read'] = read;
  } else {
    Module['read'] = function shell_read() { throw 'no read() available' };
  }

  Module['readBinary'] = function readBinary(f) {
    if (typeof readbuffer === 'function') {
      return new Uint8Array(readbuffer(f));
    }
    var data = read(f, 'binary');
    assert(typeof data === 'object');
    return data;
  };

  if (typeof scriptArgs != 'undefined') {
    Module['arguments'] = scriptArgs;
  } else if (typeof arguments != 'undefined') {
    Module['arguments'] = arguments;
  }

  if (typeof quit === 'function') {
    Module['quit'] = function(status, toThrow) {
      quit(status);
    }
  }

}
else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) {
  Module['read'] = function shell_read(url) {
    var xhr = new XMLHttpRequest();
    xhr.open('GET', url, false);
    xhr.send(null);
    return xhr.responseText;
  };

  if (ENVIRONMENT_IS_WORKER) {
    Module['readBinary'] = function readBinary(url) {
      var xhr = new XMLHttpRequest();
      xhr.open('GET', url, false);
      xhr.responseType = 'arraybuffer';
      xhr.send(null);
      return new Uint8Array(xhr.response);
    };
  }

  Module['readAsync'] = function readAsync(url, onload, onerror) {
    var xhr = new XMLHttpRequest();
    xhr.open('GET', url, true);
    xhr.responseType = 'arraybuffer';
    xhr.onload = function xhr_onload() {
      if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0
        onload(xhr.response);
      } else {
        onerror();
      }
    };
    xhr.onerror = onerror;
    xhr.send(null);
  };

  if (typeof arguments != 'undefined') {
    Module['arguments'] = arguments;
  }

  if (typeof console !== 'undefined') {
    if (!Module['print']) Module['print'] = function shell_print(x) {
      console.log(x);
    };
    if (!Module['printErr']) Module['printErr'] = function shell_printErr(x) {
      console.warn(x);
    };
  } else {
    // Probably a worker, and without console.log. We can do very little here...
    var TRY_USE_DUMP = false;
    if (!Module['print']) Module['print'] = (TRY_USE_DUMP && (typeof(dump) !== "undefined") ? (function(x) {
      dump(x);
    }) : (function(x) {
      // self.postMessage(x); // enable this if you want stdout to be sent as messages
    }));
  }

  if (ENVIRONMENT_IS_WORKER) {
    Module['load'] = importScripts;
  }

  if (typeof Module['setWindowTitle'] === 'undefined') {
    Module['setWindowTitle'] = function(title) { document.title = title };
  }
}
else {
  // Unreachable because SHELL is dependant on the others
  throw 'Unknown runtime environment. Where are we?';
}

function globalEval(x) {
  eval.call(null, x);
}
if (!Module['load'] && Module['read']) {
  Module['load'] = function load(f) {
    globalEval(Module['read'](f));
  };
}
if (!Module['print']) {
  Module['print'] = function(){};
}
if (!Module['printErr']) {
  Module['printErr'] = Module['print'];
}
if (!Module['arguments']) {
  Module['arguments'] = [];
}
if (!Module['thisProgram']) {
  Module['thisProgram'] = './this.program';
}
if (!Module['quit']) {
  Module['quit'] = function(status, toThrow) {
    throw toThrow;
  }
}

// *** Environment setup code ***

// Closure helpers
Module.print = Module['print'];
Module.printErr = Module['printErr'];

// Callbacks
Module['preRun'] = [];
Module['postRun'] = [];

// Merge back in the overrides
for (var key in moduleOverrides) {
  if (moduleOverrides.hasOwnProperty(key)) {
    Module[key] = moduleOverrides[key];
  }
}
// Free the object hierarchy contained in the overrides, this lets the GC
// reclaim data used e.g. in memoryInitializerRequest, which is a large typed array.
moduleOverrides = undefined;



// {{PREAMBLE_ADDITIONS}}

// === Preamble library stuff ===

// Documentation for the public APIs defined in this file must be updated in:
//    site/source/docs/api_reference/preamble.js.rst
// A prebuilt local version of the documentation is available at:
//    site/build/text/docs/api_reference/preamble.js.txt
// You can also build docs locally as HTML or other formats in site/
// An online HTML version (which may be of a different version of Emscripten)
//    is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html

//========================================
// Runtime code shared with compiler
//========================================

var Runtime = {
  setTempRet0: function (value) {
    tempRet0 = value;
    return value;
  },
  getTempRet0: function () {
    return tempRet0;
  },
  stackSave: function () {
    return STACKTOP;
  },
  stackRestore: function (stackTop) {
    STACKTOP = stackTop;
  },
  getNativeTypeSize: function (type) {
    switch (type) {
      case 'i1': case 'i8': return 1;
      case 'i16': return 2;
      case 'i32': return 4;
      case 'i64': return 8;
      case 'float': return 4;
      case 'double': return 8;
      default: {
        if (type[type.length-1] === '*') {
          return Runtime.QUANTUM_SIZE; // A pointer
        } else if (type[0] === 'i') {
          var bits = parseInt(type.substr(1));
          assert(bits % 8 === 0);
          return bits/8;
        } else {
          return 0;
        }
      }
    }
  },
  getNativeFieldSize: function (type) {
    return Math.max(Runtime.getNativeTypeSize(type), Runtime.QUANTUM_SIZE);
  },
  STACK_ALIGN: 16,
  prepVararg: function (ptr, type) {
    if (type === 'double' || type === 'i64') {
      // move so the load is aligned
      if (ptr & 7) {
        assert((ptr & 7) === 4);
        ptr += 4;
      }
    } else {
      assert((ptr & 3) === 0);
    }
    return ptr;
  },
  getAlignSize: function (type, size, vararg) {
    // we align i64s and doubles on 64-bit boundaries, unlike x86
    if (!vararg && (type == 'i64' || type == 'double')) return 8;
    if (!type) return Math.min(size, 8); // align structures internally to 64 bits
    return Math.min(size || (type ? Runtime.getNativeFieldSize(type) : 0), Runtime.QUANTUM_SIZE);
  },
  dynCall: function (sig, ptr, args) {
    if (args && args.length) {
      assert(args.length == sig.length-1);
      assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\'');
      return Module['dynCall_' + sig].apply(null, [ptr].concat(args));
    } else {
      assert(sig.length == 1);
      assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\'');
      return Module['dynCall_' + sig].call(null, ptr);
    }
  },
  functionPointers: [],
  addFunction: function (func) {
    for (var i = 0; i < Runtime.functionPointers.length; i++) {
      if (!Runtime.functionPointers[i]) {
        Runtime.functionPointers[i] = func;
        return 2*(1 + i);
      }
    }
    throw 'Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS.';
  },
  removeFunction: function (index) {
    Runtime.functionPointers[(index-2)/2] = null;
  },
  warnOnce: function (text) {
    if (!Runtime.warnOnce.shown) Runtime.warnOnce.shown = {};
    if (!Runtime.warnOnce.shown[text]) {
      Runtime.warnOnce.shown[text] = 1;
      Module.printErr(text);
    }
  },
  funcWrappers: {},
  getFuncWrapper: function (func, sig) {
    if (!func) return; // on null pointer, return undefined
    assert(sig);
    if (!Runtime.funcWrappers[sig]) {
      Runtime.funcWrappers[sig] = {};
    }
    var sigCache = Runtime.funcWrappers[sig];
    if (!sigCache[func]) {
      // optimize away arguments usage in common cases
      if (sig.length === 1) {
        sigCache[func] = function dynCall_wrapper() {
          return Runtime.dynCall(sig, func);
        };
      } else if (sig.length === 2) {
        sigCache[func] = function dynCall_wrapper(arg) {
          return Runtime.dynCall(sig, func, [arg]);
        };
      } else {
        // general case
        sigCache[func] = function dynCall_wrapper() {
          return Runtime.dynCall(sig, func, Array.prototype.slice.call(arguments));
        };
      }
    }
    return sigCache[func];
  },
  getCompilerSetting: function (name) {
    throw 'You must build with -s RETAIN_COMPILER_SETTINGS=1 for Runtime.getCompilerSetting or emscripten_get_compiler_setting to work';
  },
  stackAlloc: function (size) { var ret = STACKTOP;STACKTOP = (STACKTOP + size)|0;STACKTOP = (((STACKTOP)+15)&-16);(assert((((STACKTOP|0) < (STACK_MAX|0))|0))|0); return ret; },
  staticAlloc: function (size) { var ret = STATICTOP;STATICTOP = (STATICTOP + (assert(!staticSealed),size))|0;STATICTOP = (((STATICTOP)+15)&-16); return ret; },
  dynamicAlloc: function (size) { assert(DYNAMICTOP_PTR);var ret = HEAP32[DYNAMICTOP_PTR>>2];var end = (((ret + size + 15)|0) & -16);HEAP32[DYNAMICTOP_PTR>>2] = end;if (end >= TOTAL_MEMORY) {var success = enlargeMemory();if (!success) {HEAP32[DYNAMICTOP_PTR>>2] = ret;return 0;}}return ret;},
  alignMemory: function (size,quantum) { var ret = size = Math.ceil((size)/(quantum ? quantum : 16))*(quantum ? quantum : 16); return ret; },
  makeBigInt: function (low,high,unsigned) { var ret = (unsigned ? ((+((low>>>0)))+((+((high>>>0)))*4294967296.0)) : ((+((low>>>0)))+((+((high|0)))*4294967296.0))); return ret; },
  GLOBAL_BASE: 8,
  QUANTUM_SIZE: 4,
  __dummy__: 0
}



Module["Runtime"] = Runtime;



//========================================
// Runtime essentials
//========================================

var ABORT = 0; // whether we are quitting the application. no code should run after this. set in exit() and abort()
var EXITSTATUS = 0;

/** @type {function(*, string=)} */
function assert(condition, text) {
  if (!condition) {
    abort('Assertion failed: ' + text);
  }
}

var globalScope = this;

// Returns the C function with a specified identifier (for C++, you need to do manual name mangling)
function getCFunc(ident) {
  var func = Module['_' + ident]; // closure exported function
  if (!func) {
    try { func = eval('_' + ident); } catch(e) {}
  }
  assert(func, 'Cannot call unknown function ' + ident + ' (perhaps LLVM optimizations or closure removed it?)');
  return func;
}

var cwrap, ccall;
(function(){
  var JSfuncs = {
    // Helpers for cwrap -- it can't refer to Runtime directly because it might
    // be renamed by closure, instead it calls JSfuncs['stackSave'].body to find
    // out what the minified function name is.
    'stackSave': function() {
      Runtime.stackSave()
    },
    'stackRestore': function() {
      Runtime.stackRestore()
    },
    // type conversion from js to c
    'arrayToC' : function(arr) {
      var ret = Runtime.stackAlloc(arr.length);
      writeArrayToMemory(arr, ret);
      return ret;
    },
    'stringToC' : function(str) {
      var ret = 0;
      if (str !== null && str !== undefined && str !== 0) { // null string
        // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0'
        var len = (str.length << 2) + 1;
        ret = Runtime.stackAlloc(len);
        stringToUTF8(str, ret, len);
      }
      return ret;
    }
  };
  // For fast lookup of conversion functions
  var toC = {'string' : JSfuncs['stringToC'], 'array' : JSfuncs['arrayToC']};

  // C calling interface.
  ccall = function ccallFunc(ident, returnType, argTypes, args, opts) {
    var func = getCFunc(ident);
    var cArgs = [];
    var stack = 0;
    assert(returnType !== 'array', 'Return type should not be "array".');
    if (args) {
      for (var i = 0; i < args.length; i++) {
        var converter = toC[argTypes[i]];
        if (converter) {
          if (stack === 0) stack = Runtime.stackSave();
          cArgs[i] = converter(args[i]);
        } else {
          cArgs[i] = args[i];
        }
      }
    }
    var ret = func.apply(null, cArgs);
    if ((!opts || !opts.async) && typeof EmterpreterAsync === 'object') {
      assert(!EmterpreterAsync.state, 'cannot start async op with normal JS calling ccall');
    }
    if (opts && opts.async) assert(!returnType, 'async ccalls cannot return values');
    if (returnType === 'string') ret = Pointer_stringify(ret);
    if (stack !== 0) {
      if (opts && opts.async) {
        EmterpreterAsync.asyncFinalizers.push(function() {
          Runtime.stackRestore(stack);
        });
        return;
      }
      Runtime.stackRestore(stack);
    }
    return ret;
  }

  var sourceRegex = /^function\s*[a-zA-Z$_0-9]*\s*\(([^)]*)\)\s*{\s*([^*]*?)[\s;]*(?:return\s*(.*?)[;\s]*)?}$/;
  function parseJSFunc(jsfunc) {
    // Match the body and the return value of a javascript function source
    var parsed = jsfunc.toString().match(sourceRegex).slice(1);
    return {arguments : parsed[0], body : parsed[1], returnValue: parsed[2]}
  }

  // sources of useful functions. we create this lazily as it can trigger a source decompression on this entire file
  var JSsource = null;
  function ensureJSsource() {
    if (!JSsource) {
      JSsource = {};
      for (var fun in JSfuncs) {
        if (JSfuncs.hasOwnProperty(fun)) {
          // Elements of toCsource are arrays of three items:
          // the code, and the return value
          JSsource[fun] = parseJSFunc(JSfuncs[fun]);
        }
      }
    }
  }

  cwrap = function cwrap(ident, returnType, argTypes) {
    argTypes = argTypes || [];
    var cfunc = getCFunc(ident);
    // When the function takes numbers and returns a number, we can just return
    // the original function
    var numericArgs = argTypes.every(function(type){ return type === 'number'});
    var numericRet = (returnType !== 'string');
    if ( numericRet && numericArgs) {
      return cfunc;
    }
    // Creation of the arguments list (["$1","$2",...,"$nargs"])
    var argNames = argTypes.map(function(x,i){return '$'+i});
    var funcstr = "(function(" + argNames.join(',') + ") {";
    var nargs = argTypes.length;
    if (!numericArgs) {
      // Generate the code needed to convert the arguments from javascript
      // values to pointers
      ensureJSsource();
      funcstr += 'var stack = ' + JSsource['stackSave'].body + ';';
      for (var i = 0; i < nargs; i++) {
        var arg = argNames[i], type = argTypes[i];
        if (type === 'number') continue;
        var convertCode = JSsource[type + 'ToC']; // [code, return]
        funcstr += 'var ' + convertCode.arguments + ' = ' + arg + ';';
        funcstr += convertCode.body + ';';
        funcstr += arg + '=(' + convertCode.returnValue + ');';
      }
    }

    // When the code is compressed, the name of cfunc is not literally 'cfunc' anymore
    var cfuncname = parseJSFunc(function(){return cfunc}).returnValue;
    // Call the function
    funcstr += 'var ret = ' + cfuncname + '(' + argNames.join(',') + ');';
    if (!numericRet) { // Return type can only by 'string' or 'number'
      // Convert the result to a string
      var strgfy = parseJSFunc(function(){return Pointer_stringify}).returnValue;
      funcstr += 'ret = ' + strgfy + '(ret);';
    }
    funcstr += "if (typeof EmterpreterAsync === 'object') { assert(!EmterpreterAsync.state, 'cannot start async op with normal JS calling cwrap') }";
    if (!numericArgs) {
      // If we had a stack, restore it
      ensureJSsource();
      funcstr += JSsource['stackRestore'].body.replace('()', '(stack)') + ';';
    }
    funcstr += 'return ret})';
    return eval(funcstr);
  };
})();
Module["ccall"] = ccall;
Module["cwrap"] = cwrap;

/** @type {function(number, number, string, boolean=)} */
function setValue(ptr, value, type, noSafe) {
  type = type || 'i8';
  if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
    switch(type) {
      case 'i1': HEAP8[((ptr)>>0)]=value; break;
      case 'i8': HEAP8[((ptr)>>0)]=value; break;
      case 'i16': HEAP16[((ptr)>>1)]=value; break;
      case 'i32': HEAP32[((ptr)>>2)]=value; break;
      case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)]=tempI64[0],HEAP32[(((ptr)+(4))>>2)]=tempI64[1]); break;
      case 'float': HEAPF32[((ptr)>>2)]=value; break;
      case 'double': HEAPF64[((ptr)>>3)]=value; break;
      default: abort('invalid type for setValue: ' + type);
    }
}
Module["setValue"] = setValue;

/** @type {function(number, string, boolean=)} */
function getValue(ptr, type, noSafe) {
  type = type || 'i8';
  if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
    switch(type) {
      case 'i1': return HEAP8[((ptr)>>0)];
      case 'i8': return HEAP8[((ptr)>>0)];
      case 'i16': return HEAP16[((ptr)>>1)];
      case 'i32': return HEAP32[((ptr)>>2)];
      case 'i64': return HEAP32[((ptr)>>2)];
      case 'float': return HEAPF32[((ptr)>>2)];
      case 'double': return HEAPF64[((ptr)>>3)];
      default: abort('invalid type for setValue: ' + type);
    }
  return null;
}
Module["getValue"] = getValue;

var ALLOC_NORMAL = 0; // Tries to use _malloc()
var ALLOC_STACK = 1; // Lives for the duration of the current function call
var ALLOC_STATIC = 2; // Cannot be freed
var ALLOC_DYNAMIC = 3; // Cannot be freed except through sbrk
var ALLOC_NONE = 4; // Do not allocate
Module["ALLOC_NORMAL"] = ALLOC_NORMAL;
Module["ALLOC_STACK"] = ALLOC_STACK;
Module["ALLOC_STATIC"] = ALLOC_STATIC;
Module["ALLOC_DYNAMIC"] = ALLOC_DYNAMIC;
Module["ALLOC_NONE"] = ALLOC_NONE;

// allocate(): This is for internal use. You can use it yourself as well, but the interface
//             is a little tricky (see docs right below). The reason is that it is optimized
//             for multiple syntaxes to save space in generated code. So you should
//             normally not use allocate(), and instead allocate memory using _malloc(),
//             initialize it with setValue(), and so forth.
// @slab: An array of data, or a number. If a number, then the size of the block to allocate,
//        in *bytes* (note that this is sometimes confusing: the next parameter does not
//        affect this!)
// @types: Either an array of types, one for each byte (or 0 if no type at that position),
//         or a single type which is used for the entire block. This only matters if there
//         is initial data - if @slab is a number, then this does not matter at all and is
//         ignored.
// @allocator: How to allocate memory, see ALLOC_*
/** @type {function((TypedArray|Array<number>|number), string, number, number=)} */
function allocate(slab, types, allocator, ptr) {
  var zeroinit, size;
  if (typeof slab === 'number') {
    zeroinit = true;
    size = slab;
  } else {
    zeroinit = false;
    size = slab.length;
  }

  var singleType = typeof types === 'string' ? types : null;

  var ret;
  if (allocator == ALLOC_NONE) {
    ret = ptr;
  } else {
    ret = [typeof _malloc === 'function' ? _malloc : Runtime.staticAlloc, Runtime.stackAlloc, Runtime.staticAlloc, Runtime.dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length));
  }

  if (zeroinit) {
    var ptr = ret, stop;
    assert((ret & 3) == 0);
    stop = ret + (size & ~3);
    for (; ptr < stop; ptr += 4) {
      HEAP32[((ptr)>>2)]=0;
    }
    stop = ret + size;
    while (ptr < stop) {
      HEAP8[((ptr++)>>0)]=0;
    }
    return ret;
  }

  if (singleType === 'i8') {
    if (slab.subarray || slab.slice) {
      HEAPU8.set(/** @type {!Uint8Array} */ (slab), ret);
    } else {
      HEAPU8.set(new Uint8Array(slab), ret);
    }
    return ret;
  }

  var i = 0, type, typeSize, previousType;
  while (i < size) {
    var curr = slab[i];

    if (typeof curr === 'function') {
      curr = Runtime.getFunctionIndex(curr);
    }

    type = singleType || types[i];
    if (type === 0) {
      i++;
      continue;
    }
    assert(type, 'Must know what type to store in allocate!');

    if (type == 'i64') type = 'i32'; // special case: we have one i32 here, and one i32 later

    setValue(ret+i, curr, type);

    // no need to look up size unless type changes, so cache it
    if (previousType !== type) {
      typeSize = Runtime.getNativeTypeSize(type);
      previousType = type;
    }
    i += typeSize;
  }

  return ret;
}
Module["allocate"] = allocate;

// Allocate memory during any stage of startup - static memory early on, dynamic memory later, malloc when ready
function getMemory(size) {
  if (!staticSealed) return Runtime.staticAlloc(size);
  if (!runtimeInitialized) return Runtime.dynamicAlloc(size);
  return _malloc(size);
}
Module["getMemory"] = getMemory;

/** @type {function(number, number=)} */
function Pointer_stringify(ptr, length) {
  if (length === 0 || !ptr) return '';
  // TODO: use TextDecoder
  // Find the length, and check for UTF while doing so
  var hasUtf = 0;
  var t;
  var i = 0;
  while (1) {
    assert(ptr + i < TOTAL_MEMORY);
    t = HEAPU8[(((ptr)+(i))>>0)];
    hasUtf |= t;
    if (t == 0 && !length) break;
    i++;
    if (length && i == length) break;
  }
  if (!length) length = i;

  var ret = '';

  if (hasUtf < 128) {
    var MAX_CHUNK = 1024; // split up into chunks, because .apply on a huge string can overflow the stack
    var curr;
    while (length > 0) {
      curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK)));
      ret = ret ? ret + curr : curr;
      ptr += MAX_CHUNK;
      length -= MAX_CHUNK;
    }
    return ret;
  }
  return Module['UTF8ToString'](ptr);
}
Module["Pointer_stringify"] = Pointer_stringify;

// Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns
// a copy of that string as a Javascript String object.

function AsciiToString(ptr) {
  var str = '';
  while (1) {
    var ch = HEAP8[((ptr++)>>0)];
    if (!ch) return str;
    str += String.fromCharCode(ch);
  }
}
Module["AsciiToString"] = AsciiToString;

// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
// null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP.

function stringToAscii(str, outPtr) {
  return writeAsciiToMemory(str, outPtr, false);
}
Module["stringToAscii"] = stringToAscii;

// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns
// a copy of that string as a Javascript String object.

var UTF8Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf8') : undefined;
function UTF8ArrayToString(u8Array, idx) {
  var endPtr = idx;
  // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself.
  // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage.
  while (u8Array[endPtr]) ++endPtr;

  if (endPtr - idx > 16 && u8Array.subarray && UTF8Decoder) {
    return UTF8Decoder.decode(u8Array.subarray(idx, endPtr));
  } else {
    var u0, u1, u2, u3, u4, u5;

    var str = '';
    while (1) {
      // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
      u0 = u8Array[idx++];
      if (!u0) return str;
      if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; }
      u1 = u8Array[idx++] & 63;
      if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; }
      u2 = u8Array[idx++] & 63;
      if ((u0 & 0xF0) == 0xE0) {
        u0 = ((u0 & 15) << 12) | (u1 << 6) | u2;
      } else {
        u3 = u8Array[idx++] & 63;
        if ((u0 & 0xF8) == 0xF0) {
          u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | u3;
        } else {
          u4 = u8Array[idx++] & 63;
          if ((u0 & 0xFC) == 0xF8) {
            u0 = ((u0 & 3) << 24) | (u1 << 18) | (u2 << 12) | (u3 << 6) | u4;
          } else {
            u5 = u8Array[idx++] & 63;
            u0 = ((u0 & 1) << 30) | (u1 << 24) | (u2 << 18) | (u3 << 12) | (u4 << 6) | u5;
          }
        }
      }
      if (u0 < 0x10000) {
        str += String.fromCharCode(u0);
      } else {
        var ch = u0 - 0x10000;
        str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
      }
    }
  }
}
Module["UTF8ArrayToString"] = UTF8ArrayToString;

// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns
// a copy of that string as a Javascript String object.

function UTF8ToString(ptr) {
  return UTF8ArrayToString(HEAPU8,ptr);
}
Module["UTF8ToString"] = UTF8ToString;

// Copies the given Javascript String object 'str' to the given byte array at address 'outIdx',
// encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP.
// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write.
// Parameters:
//   str: the Javascript string to copy.
//   outU8Array: the array to copy to. Each index in this array is assumed to be one 8-byte element.
//   outIdx: The starting offset in the array to begin the copying.
//   maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
//                    terminator, i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else.
//                    maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator.
// Returns the number of bytes written, EXCLUDING the null terminator.

function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) {
  if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes.
    return 0;

  var startIdx = outIdx;
  var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator.
  for (var i = 0; i < str.length; ++i) {
    // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
    // See http://unicode.org/faq/utf_bom.html#utf16-3
    // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
    var u = str.charCodeAt(i); // possibly a lead surrogate
    if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
    if (u <= 0x7F) {
      if (outIdx >= endIdx) break;
      outU8Array[outIdx++] = u;
    } else if (u <= 0x7FF) {
      if (outIdx + 1 >= endIdx) break;
      outU8Array[outIdx++] = 0xC0 | (u >> 6);
      outU8Array[outIdx++] = 0x80 | (u & 63);
    } else if (u <= 0xFFFF) {
      if (outIdx + 2 >= endIdx) break;
      outU8Array[outIdx++] = 0xE0 | (u >> 12);
      outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
      outU8Array[outIdx++] = 0x80 | (u & 63);
    } else if (u <= 0x1FFFFF) {
      if (outIdx + 3 >= endIdx) break;
      outU8Array[outIdx++] = 0xF0 | (u >> 18);
      outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
      outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
      outU8Array[outIdx++] = 0x80 | (u & 63);
    } else if (u <= 0x3FFFFFF) {
      if (outIdx + 4 >= endIdx) break;
      outU8Array[outIdx++] = 0xF8 | (u >> 24);
      outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
      outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
      outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
      outU8Array[outIdx++] = 0x80 | (u & 63);
    } else {
      if (outIdx + 5 >= endIdx) break;
      outU8Array[outIdx++] = 0xFC | (u >> 30);
      outU8Array[outIdx++] = 0x80 | ((u >> 24) & 63);
      outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
      outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
      outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
      outU8Array[outIdx++] = 0x80 | (u & 63);
    }
  }
  // Null-terminate the pointer to the buffer.
  outU8Array[outIdx] = 0;
  return outIdx - startIdx;
}
Module["stringToUTF8Array"] = stringToUTF8Array;

// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
// null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP.
// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write.
// Returns the number of bytes written, EXCLUDING the null terminator.

function stringToUTF8(str, outPtr, maxBytesToWrite) {
  assert(typeof maxBytesToWrite == 'number', 'stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
  return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite);
}
Module["stringToUTF8"] = stringToUTF8;

// Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte.

function lengthBytesUTF8(str) {
  var len = 0;
  for (var i = 0; i < str.length; ++i) {
    // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
    // See http://unicode.org/faq/utf_bom.html#utf16-3
    var u = str.charCodeAt(i); // possibly a lead surrogate
    if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
    if (u <= 0x7F) {
      ++len;
    } else if (u <= 0x7FF) {
      len += 2;
    } else if (u <= 0xFFFF) {
      len += 3;
    } else if (u <= 0x1FFFFF) {
      len += 4;
    } else if (u <= 0x3FFFFFF) {
      len += 5;
    } else {
      len += 6;
    }
  }
  return len;
}
Module["lengthBytesUTF8"] = lengthBytesUTF8;

// Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns
// a copy of that string as a Javascript String object.

var UTF16Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf-16le') : undefined;
function UTF16ToString(ptr) {
  assert(ptr % 2 == 0, 'Pointer passed to UTF16ToString must be aligned to two bytes!');
  var endPtr = ptr;
  // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself.
  // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage.
  var idx = endPtr >> 1;
  while (HEAP16[idx]) ++idx;
  endPtr = idx << 1;

  if (endPtr - ptr > 32 && UTF16Decoder) {
    return UTF16Decoder.decode(HEAPU8.subarray(ptr, endPtr));
  } else {
    var i = 0;

    var str = '';
    while (1) {
      var codeUnit = HEAP16[(((ptr)+(i*2))>>1)];
      if (codeUnit == 0) return str;
      ++i;
      // fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through.
      str += String.fromCharCode(codeUnit);
    }
  }
}


// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
// null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP.
// Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write.
// Parameters:
//   str: the Javascript string to copy.
//   outPtr: Byte address in Emscripten HEAP where to write the string to.
//   maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
//                    terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else.
//                    maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator.
// Returns the number of bytes written, EXCLUDING the null terminator.

function stringToUTF16(str, outPtr, maxBytesToWrite) {
  assert(outPtr % 2 == 0, 'Pointer passed to stringToUTF16 must be aligned to two bytes!');
  assert(typeof maxBytesToWrite == 'number', 'stringToUTF16(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
  // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
  if (maxBytesToWrite === undefined) {
    maxBytesToWrite = 0x7FFFFFFF;
  }
  if (maxBytesToWrite < 2) return 0;
  maxBytesToWrite -= 2; // Null terminator.
  var startPtr = outPtr;
  var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length;
  for (var i = 0; i < numCharsToWrite; ++i) {
    // charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP.
    var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
    HEAP16[((outPtr)>>1)]=codeUnit;
    outPtr += 2;
  }
  // Null-terminate the pointer to the HEAP.
  HEAP16[((outPtr)>>1)]=0;
  return outPtr - startPtr;
}


// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.

function lengthBytesUTF16(str) {
  return str.length*2;
}


function UTF32ToString(ptr) {
  assert(ptr % 4 == 0, 'Pointer passed to UTF32ToString must be aligned to four bytes!');
  var i = 0;

  var str = '';
  while (1) {
    var utf32 = HEAP32[(((ptr)+(i*4))>>2)];
    if (utf32 == 0)
      return str;
    ++i;
    // Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing.
    // See http://unicode.org/faq/utf_bom.html#utf16-3
    if (utf32 >= 0x10000) {
      var ch = utf32 - 0x10000;
      str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
    } else {
      str += String.fromCharCode(utf32);
    }
  }
}


// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
// null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP.
// Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write.
// Parameters:
//   str: the Javascript string to copy.
//   outPtr: Byte address in Emscripten HEAP where to write the string to.
//   maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
//                    terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else.
//                    maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator.
// Returns the number of bytes written, EXCLUDING the null terminator.

function stringToUTF32(str, outPtr, maxBytesToWrite) {
  assert(outPtr % 4 == 0, 'Pointer passed to stringToUTF32 must be aligned to four bytes!');
  assert(typeof maxBytesToWrite == 'number', 'stringToUTF32(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
  // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
  if (maxBytesToWrite === undefined) {
    maxBytesToWrite = 0x7FFFFFFF;
  }
  if (maxBytesToWrite < 4) return 0;
  var startPtr = outPtr;
  var endPtr = startPtr + maxBytesToWrite - 4;
  for (var i = 0; i < str.length; ++i) {
    // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
    // See http://unicode.org/faq/utf_bom.html#utf16-3
    var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
    if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) {
      var trailSurrogate = str.charCodeAt(++i);
      codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF);
    }
    HEAP32[((outPtr)>>2)]=codeUnit;
    outPtr += 4;
    if (outPtr + 4 > endPtr) break;
  }
  // Null-terminate the pointer to the HEAP.
  HEAP32[((outPtr)>>2)]=0;
  return outPtr - startPtr;
}


// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.

function lengthBytesUTF32(str) {
  var len = 0;
  for (var i = 0; i < str.length; ++i) {
    // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
    // See http://unicode.org/faq/utf_bom.html#utf16-3
    var codeUnit = str.charCodeAt(i);
    if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate.
    len += 4;
  }

  return len;
}


function demangle(func) {
  var __cxa_demangle_func = Module['___cxa_demangle'] || Module['__cxa_demangle'];
  if (__cxa_demangle_func) {
    try {
      var s =
        func.substr(1);
      var len = lengthBytesUTF8(s)+1;
      var buf = _malloc(len);
      stringToUTF8(s, buf, len);
      var status = _malloc(4);
      var ret = __cxa_demangle_func(buf, 0, 0, status);
      if (getValue(status, 'i32') === 0 && ret) {
        return Pointer_stringify(ret);
      }
      // otherwise, libcxxabi failed
    } catch(e) {
      // ignore problems here
    } finally {
      if (buf) _free(buf);
      if (status) _free(status);
      if (ret) _free(ret);
    }
    // failure when using libcxxabi, don't demangle
    return func;
  }
  Runtime.warnOnce('warning: build with  -s DEMANGLE_SUPPORT=1  to link in libcxxabi demangling');
  return func;
}

function demangleAll(text) {
  var regex =
    /__Z[\w\d_]+/g;
  return text.replace(regex,
    function(x) {
      var y = demangle(x);
      return x === y ? x : (x + ' [' + y + ']');
    });
}

function jsStackTrace() {
  var err = new Error();
  if (!err.stack) {
    // IE10+ special cases: It does have callstack info, but it is only populated if an Error object is thrown,
    // so try that as a special-case.
    try {
      throw new Error(0);
    } catch(e) {
      err = e;
    }
    if (!err.stack) {
      return '(no stack trace available)';
    }
  }
  return err.stack.toString();
}

function stackTrace() {
  var js = jsStackTrace();
  if (Module['extraStackTrace']) js += '\n' + Module['extraStackTrace']();
  return demangleAll(js);
}
Module["stackTrace"] = stackTrace;

// Memory management

var PAGE_SIZE = 16384;
var WASM_PAGE_SIZE = 65536;
var ASMJS_PAGE_SIZE = 16777216;
var MIN_TOTAL_MEMORY = 16777216;

function alignUp(x, multiple) {
  if (x % multiple > 0) {
    x += multiple - (x % multiple);
  }
  return x;
}

var HEAP,
/** @type {ArrayBuffer} */
  buffer,
/** @type {Int8Array} */
  HEAP8,
/** @type {Uint8Array} */
  HEAPU8,
/** @type {Int16Array} */
  HEAP16,
/** @type {Uint16Array} */
  HEAPU16,
/** @type {Int32Array} */
  HEAP32,
/** @type {Uint32Array} */
  HEAPU32,
/** @type {Float32Array} */
  HEAPF32,
/** @type {Float64Array} */
  HEAPF64;

function updateGlobalBuffer(buf) {
  Module['buffer'] = buffer = buf;
}

function updateGlobalBufferViews() {
  Module['HEAP8'] = HEAP8 = new Int8Array(buffer);
  Module['HEAP16'] = HEAP16 = new Int16Array(buffer);
  Module['HEAP32'] = HEAP32 = new Int32Array(buffer);
  Module['HEAPU8'] = HEAPU8 = new Uint8Array(buffer);
  Module['HEAPU16'] = HEAPU16 = new Uint16Array(buffer);
  Module['HEAPU32'] = HEAPU32 = new Uint32Array(buffer);
  Module['HEAPF32'] = HEAPF32 = new Float32Array(buffer);
  Module['HEAPF64'] = HEAPF64 = new Float64Array(buffer);
}

var STATIC_BASE, STATICTOP, staticSealed; // static area
var STACK_BASE, STACKTOP, STACK_MAX; // stack area
var DYNAMIC_BASE, DYNAMICTOP_PTR; // dynamic area handled by sbrk

  STATIC_BASE = STATICTOP = STACK_BASE = STACKTOP = STACK_MAX = DYNAMIC_BASE = DYNAMICTOP_PTR = 0;
  staticSealed = false;


// Initializes the stack cookie. Called at the startup of main and at the startup of each thread in pthreads mode.
function writeStackCookie() {
  assert((STACK_MAX & 3) == 0);
  HEAPU32[(STACK_MAX >> 2)-1] = 0x02135467;
  HEAPU32[(STACK_MAX >> 2)-2] = 0x89BACDFE;
}

function checkStackCookie() {
  if (HEAPU32[(STACK_MAX >> 2)-1] != 0x02135467 || HEAPU32[(STACK_MAX >> 2)-2] != 0x89BACDFE) {
    abort('Stack overflow! Stack cookie has been overwritten, expected hex dwords 0x89BACDFE and 0x02135467, but received 0x' + HEAPU32[(STACK_MAX >> 2)-2].toString(16) + ' ' + HEAPU32[(STACK_MAX >> 2)-1].toString(16));
  }
  // Also test the global address 0 for integrity. This check is not compatible with SAFE_SPLIT_MEMORY though, since that mode already tests all address 0 accesses on its own.
  if (HEAP32[0] !== 0x63736d65 /* 'emsc' */) throw 'Runtime error: The application has corrupted its heap memory area (address zero)!';
}

function abortStackOverflow(allocSize) {
  abort('Stack overflow! Attempted to allocate ' + allocSize + ' bytes on the stack, but stack has only ' + (STACK_MAX - Module['asm'].stackSave() + allocSize) + ' bytes available!');
}

function abortOnCannotGrowMemory() {
  abort('Cannot enlarge memory arrays. Either (1) compile with  -s TOTAL_MEMORY=X  with X higher than the current value ' + TOTAL_MEMORY + ', (2) compile with  -s ALLOW_MEMORY_GROWTH=1  which allows increasing the size at runtime but prevents some optimizations, (3) set Module.TOTAL_MEMORY to a higher value before the program runs, or (4) if you want malloc to return NULL (0) instead of this abort, compile with  -s ABORTING_MALLOC=0 ');
}


function enlargeMemory() {
  abortOnCannotGrowMemory();
}


var TOTAL_STACK = Module['TOTAL_STACK'] || 5242880;
var TOTAL_MEMORY = Module['TOTAL_MEMORY'] || 16777216;
if (TOTAL_MEMORY < TOTAL_STACK) Module.printErr('TOTAL_MEMORY should be larger than TOTAL_STACK, was ' + TOTAL_MEMORY + '! (TOTAL_STACK=' + TOTAL_STACK + ')');

// Initialize the runtime's memory
// check for full engine support (use string 'subarray' to avoid closure compiler confusion)
assert(typeof Int32Array !== 'undefined' && typeof Float64Array !== 'undefined' && Int32Array.prototype.subarray !== undefined && Int32Array.prototype.set !== undefined,
       'JS engine does not provide full typed array support');



// Use a provided buffer, if there is one, or else allocate a new one
if (Module['buffer']) {
  buffer = Module['buffer'];
  assert(buffer.byteLength === TOTAL_MEMORY, 'provided buffer should be ' + TOTAL_MEMORY + ' bytes, but it is ' + buffer.byteLength);
} else {
  // Use a WebAssembly memory where available
  {
    buffer = new ArrayBuffer(TOTAL_MEMORY);
  }
  assert(buffer.byteLength === TOTAL_MEMORY);
}
updateGlobalBufferViews();


function getTotalMemory() {
  return TOTAL_MEMORY;
}

// Endianness check (note: assumes compiler arch was little-endian)
  HEAP32[0] = 0x63736d65; /* 'emsc' */
HEAP16[1] = 0x6373;
if (HEAPU8[2] !== 0x73 || HEAPU8[3] !== 0x63) throw 'Runtime error: expected the system to be little-endian!';

Module['HEAP'] = HEAP;
Module['buffer'] = buffer;
Module['HEAP8'] = HEAP8;
Module['HEAP16'] = HEAP16;
Module['HEAP32'] = HEAP32;
Module['HEAPU8'] = HEAPU8;
Module['HEAPU16'] = HEAPU16;
Module['HEAPU32'] = HEAPU32;
Module['HEAPF32'] = HEAPF32;
Module['HEAPF64'] = HEAPF64;

function callRuntimeCallbacks(callbacks) {
  while(callbacks.length > 0) {
    var callback = callbacks.shift();
    if (typeof callback == 'function') {
      callback();
      continue;
    }
    var func = callback.func;
    if (typeof func === 'number') {
      if (callback.arg === undefined) {
        Module['dynCall_v'](func);
      } else {
        Module['dynCall_vi'](func, callback.arg);
      }
    } else {
      func(callback.arg === undefined ? null : callback.arg);
    }
  }
}

var __ATPRERUN__  = []; // functions called before the runtime is initialized
var __ATINIT__    = []; // functions called during startup
var __ATMAIN__    = []; // functions called when main() is to be run
var __ATEXIT__    = []; // functions called during shutdown
var __ATPOSTRUN__ = []; // functions called after the runtime has exited

var runtimeInitialized = false;
var runtimeExited = false;


function preRun() {
  // compatibility - merge in anything from Module['preRun'] at this time
  if (Module['preRun']) {
    if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']];
    while (Module['preRun'].length) {
      addOnPreRun(Module['preRun'].shift());
    }
  }
  callRuntimeCallbacks(__ATPRERUN__);
}

function ensureInitRuntime() {
  checkStackCookie();
  if (runtimeInitialized) return;
  runtimeInitialized = true;
  callRuntimeCallbacks(__ATINIT__);
}

function preMain() {
  checkStackCookie();
  callRuntimeCallbacks(__ATMAIN__);
}

function exitRuntime() {
  checkStackCookie();
  callRuntimeCallbacks(__ATEXIT__);
  runtimeExited = true;
}

function postRun() {
  checkStackCookie();
  // compatibility - merge in anything from Module['postRun'] at this time
  if (Module['postRun']) {
    if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']];
    while (Module['postRun'].length) {
      addOnPostRun(Module['postRun'].shift());
    }
  }
  callRuntimeCallbacks(__ATPOSTRUN__);
}

function addOnPreRun(cb) {
  __ATPRERUN__.unshift(cb);
}
Module["addOnPreRun"] = addOnPreRun;

function addOnInit(cb) {
  __ATINIT__.unshift(cb);
}
Module["addOnInit"] = addOnInit;

function addOnPreMain(cb) {
  __ATMAIN__.unshift(cb);
}
Module["addOnPreMain"] = addOnPreMain;

function addOnExit(cb) {
  __ATEXIT__.unshift(cb);
}
Module["addOnExit"] = addOnExit;

function addOnPostRun(cb) {
  __ATPOSTRUN__.unshift(cb);
}
Module["addOnPostRun"] = addOnPostRun;

// Tools

/** @type {function(string, boolean=, number=)} */
function intArrayFromString(stringy, dontAddNull, length) {
  var len = length > 0 ? length : lengthBytesUTF8(stringy)+1;
  var u8array = new Array(len);
  var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
  if (dontAddNull) u8array.length = numBytesWritten;
  return u8array;
}
Module["intArrayFromString"] = intArrayFromString;

function intArrayToString(array) {
  var ret = [];
  for (var i = 0; i < array.length; i++) {
    var chr = array[i];
    if (chr > 0xFF) {
      assert(false, 'Character code ' + chr + ' (' + String.fromCharCode(chr) + ')  at offset ' + i + ' not in 0x00-0xFF.');
      chr &= 0xFF;
    }
    ret.push(String.fromCharCode(chr));
  }
  return ret.join('');
}
Module["intArrayToString"] = intArrayToString;

// Deprecated: This function should not be called because it is unsafe and does not provide
// a maximum length limit of how many bytes it is allowed to write. Prefer calling the
// function stringToUTF8Array() instead, which takes in a maximum length that can be used
// to be secure from out of bounds writes.
/** @deprecated */
function writeStringToMemory(string, buffer, dontAddNull) {
  Runtime.warnOnce('writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!');

  var /** @type {number} */ lastChar, /** @type {number} */ end;
  if (dontAddNull) {
    // stringToUTF8Array always appends null. If we don't want to do that, remember the
    // character that existed at the location where the null will be placed, and restore
    // that after the write (below).
    end = buffer + lengthBytesUTF8(string);
    lastChar = HEAP8[end];
  }
  stringToUTF8(string, buffer, Infinity);
  if (dontAddNull) HEAP8[end] = lastChar; // Restore the value under the null character.
}
Module["writeStringToMemory"] = writeStringToMemory;

function writeArrayToMemory(array, buffer) {
  assert(array.length >= 0, 'writeArrayToMemory array must have a length (should be an array or typed array)')
  HEAP8.set(array, buffer);
}
Module["writeArrayToMemory"] = writeArrayToMemory;

function writeAsciiToMemory(str, buffer, dontAddNull) {
  for (var i = 0; i < str.length; ++i) {
    assert(str.charCodeAt(i) === str.charCodeAt(i)&0xff);
    HEAP8[((buffer++)>>0)]=str.charCodeAt(i);
  }
  // Null-terminate the pointer to the HEAP.
  if (!dontAddNull) HEAP8[((buffer)>>0)]=0;
}
Module["writeAsciiToMemory"] = writeAsciiToMemory;

function unSign(value, bits, ignore) {
  if (value >= 0) {
    return value;
  }
  return bits <= 32 ? 2*Math.abs(1 << (bits-1)) + value // Need some trickery, since if bits == 32, we are right at the limit of the bits JS uses in bitshifts
                    : Math.pow(2, bits)         + value;
}
function reSign(value, bits, ignore) {
  if (value <= 0) {
    return value;
  }
  var half = bits <= 32 ? Math.abs(1 << (bits-1)) // abs is needed if bits == 32
                        : Math.pow(2, bits-1);
  if (value >= half && (bits <= 32 || value > half)) { // for huge values, we can hit the precision limit and always get true here. so don't do that
                                                       // but, in general there is no perfect solution here. With 64-bit ints, we get rounding and errors
                                                       // TODO: In i64 mode 1, resign the two parts separately and safely
    value = -2*half + value; // Cannot bitshift half, as it may be at the limit of the bits JS uses in bitshifts
  }
  return value;
}

// check for imul support, and also for correctness ( https://bugs.webkit.org/show_bug.cgi?id=126345 )
if (!Math['imul'] || Math['imul'](0xffffffff, 5) !== -5) Math['imul'] = function imul(a, b) {
  var ah  = a >>> 16;
  var al = a & 0xffff;
  var bh  = b >>> 16;
  var bl = b & 0xffff;
  return (al*bl + ((ah*bl + al*bh) << 16))|0;
};
Math.imul = Math['imul'];


if (!Math['clz32']) Math['clz32'] = function(x) {
  x = x >>> 0;
  for (var i = 0; i < 32; i++) {
    if (x & (1 << (31 - i))) return i;
  }
  return 32;
};
Math.clz32 = Math['clz32']

if (!Math['trunc']) Math['trunc'] = function(x) {
  return x < 0 ? Math.ceil(x) : Math.floor(x);
};
Math.trunc = Math['trunc'];

var Math_abs = Math.abs;
var Math_cos = Math.cos;
var Math_sin = Math.sin;
var Math_tan = Math.tan;
var Math_acos = Math.acos;
var Math_asin = Math.asin;
var Math_atan = Math.atan;
var Math_atan2 = Math.atan2;
var Math_exp = Math.exp;
var Math_log = Math.log;
var Math_sqrt = Math.sqrt;
var Math_ceil = Math.ceil;
var Math_floor = Math.floor;
var Math_pow = Math.pow;
var Math_imul = Math.imul;
var Math_fround = Math.fround;
var Math_round = Math.round;
var Math_min = Math.min;
var Math_clz32 = Math.clz32;
var Math_trunc = Math.trunc;

// A counter of dependencies for calling run(). If we need to
// do asynchronous work before running, increment this and
// decrement it. Incrementing must happen in a place like
// PRE_RUN_ADDITIONS (used by emcc to add file preloading).
// Note that you can add dependencies in preRun, even though
// it happens right before run - run will be postponed until
// the dependencies are met.
var runDependencies = 0;
var runDependencyWatcher = null;
var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled
var runDependencyTracking = {};

function getUniqueRunDependency(id) {
  var orig = id;
  while (1) {
    if (!runDependencyTracking[id]) return id;
    id = orig + Math.random();
  }
  return id;
}

function addRunDependency(id) {
  runDependencies++;
  if (Module['monitorRunDependencies']) {
    Module['monitorRunDependencies'](runDependencies);
  }
  if (id) {
    assert(!runDependencyTracking[id]);
    runDependencyTracking[id] = 1;
    if (runDependencyWatcher === null && typeof setInterval !== 'undefined') {
      // Check for missing dependencies every few seconds
      runDependencyWatcher = setInterval(function() {
        if (ABORT) {
          clearInterval(runDependencyWatcher);
          runDependencyWatcher = null;
          return;
        }
        var shown = false;
        for (var dep in runDependencyTracking) {
          if (!shown) {
            shown = true;
            Module.printErr('still waiting on run dependencies:');
          }
          Module.printErr('dependency: ' + dep);
        }
        if (shown) {
          Module.printErr('(end of list)');
        }
      }, 10000);
    }
  } else {
    Module.printErr('warning: run dependency added without ID');
  }
}
Module["addRunDependency"] = addRunDependency;

function removeRunDependency(id) {
  runDependencies--;
  if (Module['monitorRunDependencies']) {
    Module['monitorRunDependencies'](runDependencies);
  }
  if (id) {
    assert(runDependencyTracking[id]);
    delete runDependencyTracking[id];
  } else {
    Module.printErr('warning: run dependency removed without ID');
  }
  if (runDependencies == 0) {
    if (runDependencyWatcher !== null) {
      clearInterval(runDependencyWatcher);
      runDependencyWatcher = null;
    }
    if (dependenciesFulfilled) {
      var callback = dependenciesFulfilled;
      dependenciesFulfilled = null;
      callback(); // can add another dependenciesFulfilled
    }
  }
}
Module["removeRunDependency"] = removeRunDependency;

Module["preloadedImages"] = {}; // maps url to image data
Module["preloadedAudios"] = {}; // maps url to audio data



var memoryInitializer = null;






// === Body ===

var ASM_CONSTS = [];




STATIC_BASE = Runtime.GLOBAL_BASE;

STATICTOP = STATIC_BASE + 94624;
/* global initializers */  __ATINIT__.push();


/* memory initializer */ allocate([1,0,0,0,2,0,0,0,4,0,0,0,8,0,0,0,16,0,0,0,32,0,0,0,64,0,0,0,128,0,0,0,0,1,0,0,0,2,0,0,0,4,0,0,0,8,0,0,0,16,0,0,0,32,0,0,0,64,0,0,0,128,0,0,76,0,0,0,5,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,3,0,0,0,140,105,1,0,0,4,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,10,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,24,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,76,0,0,0,196,1,0,0,9,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,0,0,0,3,0,0,0,148,109,1,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,68,2,0,0,5,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,5,0,0,0,3,0,0,0,156,113,1,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,192,3,0,0,192,4,0,0,192,5,0,0,192,6,0,0,192,7,0,0,192,8,0,0,192,9,0,0,192,10,0,0,192,11,0,0,192,12,0,0,192,13,0,0,192,14,0,0,192,15,0,0,192,16,0,0,192,17,0,0,192,18,0,0,192,19,0,0,192,20,0,0,192,21,0,0,192,22,0,0,192,23,0,0,192,24,0,0,192,25,0,0,192,26,0,0,192,27,0,0,192,28,0,0,192,29,0,0,192,30,0,0,192,31,0,0,192,0,0,0,179,1,0,0,195,2,0,0,195,3,0,0,195,4,0,0,195,5,0,0,195,6,0,0,195,7,0,0,195,8,0,0,195,9,0,0,195,10,0,0,195,11,0,0,195,12,0,0,195,13,0,0,211,14,0,0,195,15,0,0,195,0,0,12,187,1,0,12,195,2,0,12,195,3,0,12,195,4,0,12,211,10,0,0,0,100,0,0,0,232,3,0,0,16,39,0,0,160,134,1,0,64,66,15,0,128,150,152,0,0,225,245,5,95,112,137,0,255,9,47,15,102,110,99,116,108,32,102,97,105,108,101,100,58,32,0,84,111,111,32,109,97,110,121,32,99,111,109,109,97,110,100,32,108,105,110,101,32,97,114,103,117,109,101,110,116,115,44,32,97,98,111,114,116,105,110,103,10,0,48,48,48,48,48,48,48,48,48,48,48,48,0,10,84,111,116,97,108,32,99,121,99,108,101,115,32,32,32,58,32,37,100,10,10,0,84,121,112,101,32,100,101,99,105,109,97,108,32,97,100,100,114,101,115,115,32,116,111,32,118,105,101,119,32,109,101,109,111,114,121,44,32,32,113,32,32,116,111,32,113,117,105,116,32,111,114,32,32,99,32,32,116,111,32,99,111,110,116,105,110,117,101,58,32,0,10,84,104,101,32,110,101,119,32,80,67,32,105,115,32,32,58,32,37,115,10,10,0,77,73,67,45,49,32,101,109,117,108,97,116,111,114,32,102,105,110,105,115,104,105,110,103,44,32,103,111,111,100,98,121,101,10,10,0,66,65,68,32,76,79,67,65,84,73,79,78,32,86,65,76,85,69,44,32,77,85,83,84,32,66,69,32,66,69,84,87,69,69,78,32,48,32,97,110,100,32,52,48,57,53,10,0,32,32,32,32,32,116,104,101,32,108,111,99,97,116,105,111,110,32,37,52,100,32,104,97,115,32,118,97,108,117,101,32,37,49,54,115,32,44,32,111,114,32,37,53,100,32,32,111,114,32,115,105,103,110,101,100,32,37,54,100,10,0,84,121,112,101,32,32,60,69,110,116,101,114,62,32,32,116,111,32,99,111,110,116,105,110,117,101,32,100,101,98,117,103,103,105,110,103,10,84,121,112,101,32,32,32,32,32,32,32,32,113,32,32,116,111,32,113,117,105,116,10,84,121,112,101,32,32,32,32,32,32,32,32,102,32,102,111,114,32,102,111,114,119,97,114,100,32,114,97,110,103,101,10,84,121,112,101,32,32,32,32,32,32,32,32,98,32,102,111,114,32,98,97,99,107,119,97,114,100,32,114,97,110,103,101,58,32,0,84,121,112,101,32,116,104,101,32,110,117,109,98,101,114,32,111,102,32,102,111,114,119,97,114,100,32,108,111,99,97,116,105,111,110,115,32,116,111,32,100,117,109,112,58,32,0,66,65,68,32,79,70,70,83,69,84,32,86,65,76,85,69,44,32,71,79,69,83,32,66,69,89,79,78,68,32,52,48,57,49,10,0,84,121,112,101,32,116,104,101,32,110,117,109,98,101,114,32,111,102,32,114,101,118,101,114,115,101,32,108,111,99,97,116,105,111,110,115,32,116,111,32,100,117,109,112,58,32,0,66,65,68,32,79,70,70,83,69,84,32,86,65,76,85,69,44,32,71,79,69,83,32,66,69,76,79,87,32,48,10,0,114,101,115,101,116,32,102,99,110,116,108,32,101,114,114,111,114,58,32,0,115,101,116,32,98,108,111,99,107,105,110,103,32,102,99,110,116,108,32,101,114,114,111,114,58,32,0,100,97,116,97,47,112,114,111,109,46,100,97,116,0,112,114,111,109,102,105,108,101,46,100,97,116,0,67,97,110,39,116,32,111,112,101,110,32,80,114,111,109,102,105,108,101,44,32,97,98,111,114,116,105,110,103,32,10,0,10,82,101,97,100,32,105,110,32,37,100,32,109,105,99,114,111,32,105,110,115,116,114,117,99,116,105,111,110,115,10,0,49,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,0,48,49,48,48,48,48,48,48,48,48,48,48,48,48,48,48,0,48,48,49,48,48,48,48,48,48,48,48,48,48,48,48,48,0,48,48,48,49,48,48,48,48,48,48,48,48,48,48,48,48,0,48,48,48,48,49,48,48,48,48,48,48,48,48,48,48,48,0,48,48,48,48,48,49,48,48,48,48,48,48,48,48,48,48,0,48,48,48,48,48,48,49,48,48,48,48,48,48,48,48,48,0,48,48,48,48,48,48,48,49,48,48,48,48,48,48,48,48,0,48,48,48,48,48,48,48,48,49,48,48,48,48,48,48,48,0,48,48,48,48,48,48,48,48,48,49,48,48,48,48,48,48,0,48,48,48,48,48,48,48,48,48,48,49,48,48,48,48,48,0,48,48,48,48,48,48,48,48,48,48,48,49,48,48,48,48,0,48,48,48,48,48,48,48,48,48,48,48,48,49,48,48,48,0,48,48,48,48,48,48,48,48,48,48,48,48,48,49,48,48,0,48,48,48,48,48,48,48,48,48,48,48,48,48,48,49,48,0,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,0,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,0,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,0,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,0,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,0,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,0,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,0,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,0,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,0,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,0,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,0,10,80,114,111,103,114,97,109,67,111,117,110,116,101,114,32,58,32,37,115,32,32,98,97,115,101,32,49,48,58,32,32,37,54,100,10,0,65,99,99,117,109,117,108,97,116,111,114,32,32,32,32,58,32,37,115,32,32,98,97,115,101,32,49,48,58,32,32,37,54,100,10,0,73,110,115,116,114,117,99,116,105,111,110,82,101,103,32,58,32,37,115,32,32,98,97,115,101,32,49,48,58,32,32,37,54,100,10,0,84,101,109,112,73,110,115,116,114,32,32,32,32,32,32,58,32,37,115,32,32,98,97,115,101,32,49,48,58,32,32,37,54,100,10,0,83,116,97,99,107,80,111,105,110,116,101,114,32,32,32,58,32,37,115,32,32,98,97,115,101,32,49,48,58,32,32,37,54,100,10,0,65,82,101,103,105,115,116,101,114,32,32,32,32,32,32,58,32,37,115,32,32,98,97,115,101,32,49,48,58,32,32,37,54,100,10,0,66,82,101,103,105,115,116,101,114,32,32,32,32,32,32,58,32,37,115,32,32,98,97,115,101,32,49,48,58,32,32,37,54,100,10,0,67,82,101,103,105,115,116,101,114,32,32,32,32,32,32,58,32,37,115,32,32,98,97,115,101,32,49,48,58,32,32,37,54,100,10,0,68,82,101,103,105,115,116,101,114,32,32,32,32,32,32,58,32,37,115,32,32,98,97,115,101,32,49,48,58,32,32,37,54,100,10,0,69,82,101,103,105,115,116,101,114,32,32,32,32,32,32,58,32,37,115,32,32,98,97,115,101,32,49,48,58,32,32,37,54,100,10,0,70,82,101,103,105,115,116,101,114,32,32,32,32,32,32,58,32,37,115,32,32,98,97,115,101,32,49,48,58,32,32,37,54,100,10,0,48,48,48,48,49,49,49,49,49,48,48,48,48,48,48,48,0,83,116,97,114,116,105,110,103,32,80,67,32,105,115,32,58,32,37,115,32,32,98,97,115,101,32,49,48,58,32,32,37,54,100,10,83,116,97,114,116,105,110,103,32,83,80,32,105,115,32,58,32,37,115,32,32,98,97,115,101,32,49,48,58,32,32,37,54,100,10,10,0,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,49,0,48,48,48,48,49,49,49,49,49,49,49,49,49,49,49,49,0,48,48,48,48,48,48,48,48,49,49,49,49,49,49,49,49,0,37,115,0,49,49,49,49,49,49,49,49,49,49,49,49,49,49,49,49,0,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,48,0,100,97,116,97,47,105,102,105,98,46,97,115,109,0,114,0,105,110,110,101,114,46,100,97,116,0,67,97,110,39,116,32,111,112,101,110,32,80,114,111,103,114,97,109,32,70,105,108,101,44,32,97,98,111,114,116,105,110,103,32,10,0,10,83,117,99,99,101,115,115,102,117,108,108,121,32,108,111,97,100,101,100,32,97,115,109,0,10,82,101,97,100,32,105,110,32,37,100,32,109,97,99,104,105,110,101,32,105,110,115,116,114,117,99,116,105,111,110,115,10,0,10,37,100,0,17,0,10,0,17,17,17,0,0,0,0,5,0,0,0,0,0,0,9,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,15,10,17,17,17,3,10,7,0,1,19,9,11,11,0,0,9,6,11,0,0,11,0,6,17,0,0,0,17,17,17,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,10,10,17,17,17,0,10,0,0,2,0,9,11,0,0,0,9,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,14,0,0,0,0,0,0,0,0,0,0,0,13,0,0,0,4,13,0,0,0,0,9,14,0,0,0,0,0,14,0,0,14,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,16,0,0,0,0,0,0,0,0,0,0,0,15,0,0,0,0,15,0,0,0,0,9,16,0,0,0,0,0,16,0,0,16,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,9,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,0,0,0,10,0,0,0,0,10,0,0,0,0,9,11,0,0,0,0,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,45,43,32,32,32,48,88,48,120,0,40,110,117,108,108,41,0,45,48,88,43,48,88,32,48,88,45,48,120,43,48,120,32,48,120,0,105,110,102,0,73,78,70,0,78,65,78,0,48,49,50,51,52,53,54,55,56,57,65,66,67,68,69,70,46,0,84,33,34,25,13,1,2,3,17,75,28,12,16,4,11,29,18,30,39,104,110,111,112,113,98,32,5,6,15,19,20,21,26,8,22,7,40,36,23,24,9,10,14,27,31,37,35,131,130,125,38,42,43,60,61,62,63,67,71,74,77,88,89,90,91,92,93,94,95,96,97,99,100,101,102,103,105,106,107,108,114,115,116,121,122,123,124,0,73,108,108,101,103,97,108,32,98,121,116,101,32,115,101,113,117,101,110,99,101,0,68,111,109,97,105,110,32,101,114,114,111,114,0,82,101,115,117,108,116,32,110,111,116,32,114,101,112,114,101,115,101,110,116,97,98,108,101,0,78,111,116,32,97,32,116,116,121,0,80,101,114,109,105,115,115,105,111,110,32,100,101,110,105,101,100,0,79,112,101,114,97,116,105,111,110,32,110,111,116,32,112,101,114,109,105,116,116,101,100,0,78,111,32,115,117,99,104,32,102,105,108,101,32,111,114,32,100,105,114,101,99,116,111,114,121,0,78,111,32,115,117,99,104,32,112,114,111,99,101,115,115,0,70,105,108,101,32,101,120,105,115,116,115,0,86,97,108,117,101,32,116,111,111,32,108,97,114,103,101,32,102,111,114,32,100,97,116,97,32,116,121,112,101,0,78,111,32,115,112,97,99,101,32,108,101,102,116,32,111,110,32,100,101,118,105,99,101,0,79,117,116,32,111,102,32,109,101,109,111,114,121,0,82,101,115,111,117,114,99,101,32,98,117,115,121,0,73,110,116,101,114,114,117,112,116,101,100,32,115,121,115,116,101,109,32,99,97,108,108,0,82,101,115,111,117,114,99,101,32,116,101,109,112,111,114,97,114,105,108,121,32,117,110,97,118,97,105,108,97,98,108,101,0,73,110,118,97,108,105,100,32,115,101,101,107,0,67,114,111,115,115,45,100,101,118,105,99,101,32,108,105,110,107,0,82,101,97,100,45,111,110,108,121,32,102,105,108,101,32,115,121,115,116,101,109,0,68,105,114,101,99,116,111,114,121,32,110,111,116,32,101,109,112,116,121,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,112,101,101,114,0,79,112,101,114,97,116,105,111,110,32,116,105,109,101,100,32,111,117,116,0,67,111,110,110,101,99,116,105,111,110,32,114,101,102,117,115,101,100,0,72,111,115,116,32,105,115,32,100,111,119,110,0,72,111,115,116,32,105,115,32,117,110,114,101,97,99,104,97,98,108,101,0,65,100,100,114,101,115,115,32,105,110,32,117,115,101,0,66,114,111,107,101,110,32,112,105,112,101,0,73,47,79,32,101,114,114,111,114,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,32,111,114,32,97,100,100,114,101,115,115,0,66,108,111,99,107,32,100,101,118,105,99,101,32,114,101,113,117,105,114,101,100,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,0,78,111,116,32,97,32,100,105,114,101,99,116,111,114,121,0,73,115,32,97,32,100,105,114,101,99,116,111,114,121,0,84,101,120,116,32,102,105,108,101,32,98,117,115,121,0,69,120,101,99,32,102,111,114,109,97,116,32,101,114,114,111,114,0,73,110,118,97,108,105,100,32,97,114,103,117,109,101,110,116,0,65,114,103,117,109,101,110,116,32,108,105,115,116,32,116,111,111,32,108,111,110,103,0,83,121,109,98,111,108,105,99,32,108,105,110,107,32,108,111,111,112,0,70,105,108,101,110,97,109,101,32,116,111,111,32,108,111,110,103,0,84,111,111,32,109,97,110,121,32,111,112,101,110,32,102,105,108,101,115,32,105,110,32,115,121,115,116,101,109,0,78,111,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,115,32,97,118,97,105,108,97,98,108,101,0,66,97,100,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,0,78,111,32,99,104,105,108,100,32,112,114,111,99,101,115,115,0,66,97,100,32,97,100,100,114,101,115,115,0,70,105,108,101,32,116,111,111,32,108,97,114,103,101,0,84,111,111,32,109,97,110,121,32,108,105,110,107,115,0,78,111,32,108,111,99,107,115,32,97,118,97,105,108,97,98,108,101,0,82,101,115,111,117,114,99,101,32,100,101,97,100,108,111,99,107,32,119,111,117,108,100,32,111,99,99,117,114,0,83,116,97,116,101,32,110,111,116,32,114,101,99,111,118,101,114,97,98,108,101,0,80,114,101,118,105,111,117,115,32,111,119,110,101,114,32,100,105,101,100,0,79,112,101,114,97,116,105,111,110,32,99,97,110,99,101,108,101,100,0,70,117,110,99,116,105,111,110,32,110,111,116,32,105,109,112,108,101,109,101,110,116,101,100,0,78,111,32,109,101,115,115,97,103,101,32,111,102,32,100,101,115,105,114,101,100,32,116,121,112,101,0,73,100,101,110,116,105,102,105,101,114,32,114,101,109,111,118,101,100,0,68,101,118,105,99,101,32,110,111,116,32,97,32,115,116,114,101,97,109,0,78,111,32,100,97,116,97,32,97,118,97,105,108,97,98,108,101,0,68,101,118,105,99,101,32,116,105,109,101,111,117,116,0,79,117,116,32,111,102,32,115,116,114,101,97,109,115,32,114,101,115,111,117,114,99,101,115,0,76,105,110,107,32,104,97,115,32,98,101,101,110,32,115,101,118,101,114,101,100,0,80,114,111,116,111,99,111,108,32,101,114,114,111,114,0,66,97,100,32,109,101,115,115,97,103,101,0,70,105,108,101,32,100,101,115,99,114,105,112,116,111,114,32,105,110,32,98,97,100,32,115,116,97,116,101,0,78,111,116,32,97,32,115,111,99,107,101,116,0,68,101,115,116,105,110,97,116,105,111,110,32,97,100,100,114,101,115,115,32,114,101,113,117,105,114,101,100,0,77,101,115,115,97,103,101,32,116,111,111,32,108,97,114,103,101,0,80,114,111,116,111,99,111,108,32,119,114,111,110,103,32,116,121,112,101,32,102,111,114,32,115,111,99,107,101,116,0,80,114,111,116,111,99,111,108,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,80,114,111,116,111,99,111,108,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,83,111,99,107,101,116,32,116,121,112,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,78,111,116,32,115,117,112,112,111,114,116,101,100,0,80,114,111,116,111,99,111,108,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,65,100,100,114,101,115,115,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,98,121,32,112,114,111,116,111,99,111,108,0,65,100,100,114,101,115,115,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,78,101,116,119,111,114,107,32,105,115,32,100,111,119,110,0,78,101,116,119,111,114,107,32,117,110,114,101,97,99,104,97,98,108,101,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,110,101,116,119,111,114,107,0,67,111,110,110,101,99,116,105,111,110,32,97,98,111,114,116,101,100,0,78,111,32,98,117,102,102,101,114,32,115,112,97,99,101,32,97,118,97,105,108,97,98,108,101,0,83,111,99,107,101,116,32,105,115,32,99,111,110,110,101,99,116,101,100,0,83,111,99,107,101,116,32,110,111,116,32,99,111,110,110,101,99,116,101,100,0,67,97,110,110,111,116,32,115,101,110,100,32,97,102,116,101,114,32,115,111,99,107,101,116,32,115,104,117,116,100,111,119,110,0,79,112,101,114,97,116,105,111,110,32,97,108,114,101,97,100,121,32,105,110,32,112,114,111,103,114,101,115,115,0,79,112,101,114,97,116,105,111,110,32,105,110,32,112,114,111,103,114,101,115,115,0,83,116,97,108,101,32,102,105,108,101,32,104,97,110,100,108,101,0,82,101,109,111,116,101,32,73,47,79,32,101,114,114,111,114,0,81,117,111,116,97,32,101,120,99,101,101,100,101,100,0,78,111,32,109,101,100,105,117,109,32,102,111,117,110,100,0,87,114,111,110,103,32,109,101,100,105,117,109,32,116,121,112,101,0,78,111,32,101,114,114,111,114,32,105,110,102,111,114,109,97,116,105,111,110,0,0,105,110,102,105,110,105,116,121,0,110,97,110,0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,0,1,2,3,4,5,6,7,8,9,255,255,255,255,255,255,255,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,255,255,255,255,255,255,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,0,1,2,4,7,3,6,5,0,114,119,97,0], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE);





/* no memory initializer */
var tempDoublePtr = STATICTOP; STATICTOP += 16;

assert(tempDoublePtr % 8 == 0);

function copyTempFloat(ptr) { // functions, because inlining this code increases code size too much

  HEAP8[tempDoublePtr] = HEAP8[ptr];

  HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];

  HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];

  HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];

}

function copyTempDouble(ptr) {

  HEAP8[tempDoublePtr] = HEAP8[ptr];

  HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];

  HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];

  HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];

  HEAP8[tempDoublePtr+4] = HEAP8[ptr+4];

  HEAP8[tempDoublePtr+5] = HEAP8[ptr+5];

  HEAP8[tempDoublePtr+6] = HEAP8[ptr+6];

  HEAP8[tempDoublePtr+7] = HEAP8[ptr+7];

}

// {{PRE_LIBRARY}}


   

   

   

   

   

  
  
  
  var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86};
  
  var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can   access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"};
  
  function ___setErrNo(value) {
      if (Module['___errno_location']) HEAP32[((Module['___errno_location']())>>2)]=value;
      else Module.printErr('failed to set errno from JS');
      return value;
    }
  
  var PATH={splitPath:function (filename) {
        var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
        return splitPathRe.exec(filename).slice(1);
      },normalizeArray:function (parts, allowAboveRoot) {
        // if the path tries to go above the root, `up` ends up > 0
        var up = 0;
        for (var i = parts.length - 1; i >= 0; i--) {
          var last = parts[i];
          if (last === '.') {
            parts.splice(i, 1);
          } else if (last === '..') {
            parts.splice(i, 1);
            up++;
          } else if (up) {
            parts.splice(i, 1);
            up--;
          }
        }
        // if the path is allowed to go above the root, restore leading ..s
        if (allowAboveRoot) {
          for (; up; up--) {
            parts.unshift('..');
          }
        }
        return parts;
      },normalize:function (path) {
        var isAbsolute = path.charAt(0) === '/',
            trailingSlash = path.substr(-1) === '/';
        // Normalize the path
        path = PATH.normalizeArray(path.split('/').filter(function(p) {
          return !!p;
        }), !isAbsolute).join('/');
        if (!path && !isAbsolute) {
          path = '.';
        }
        if (path && trailingSlash) {
          path += '/';
        }
        return (isAbsolute ? '/' : '') + path;
      },dirname:function (path) {
        var result = PATH.splitPath(path),
            root = result[0],
            dir = result[1];
        if (!root && !dir) {
          // No dirname whatsoever
          return '.';
        }
        if (dir) {
          // It has a dirname, strip trailing slash
          dir = dir.substr(0, dir.length - 1);
        }
        return root + dir;
      },basename:function (path) {
        // EMSCRIPTEN return '/'' for '/', not an empty string
        if (path === '/') return '/';
        var lastSlash = path.lastIndexOf('/');
        if (lastSlash === -1) return path;
        return path.substr(lastSlash+1);
      },extname:function (path) {
        return PATH.splitPath(path)[3];
      },join:function () {
        var paths = Array.prototype.slice.call(arguments, 0);
        return PATH.normalize(paths.join('/'));
      },join2:function (l, r) {
        return PATH.normalize(l + '/' + r);
      },resolve:function () {
        var resolvedPath = '',
          resolvedAbsolute = false;
        for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
          var path = (i >= 0) ? arguments[i] : FS.cwd();
          // Skip empty and invalid entries
          if (typeof path !== 'string') {
            throw new TypeError('Arguments to path.resolve must be strings');
          } else if (!path) {
            return ''; // an invalid portion invalidates the whole thing
          }
          resolvedPath = path + '/' + resolvedPath;
          resolvedAbsolute = path.charAt(0) === '/';
        }
        // At this point the path should be resolved to a full absolute path, but
        // handle relative paths to be safe (might happen when process.cwd() fails)
        resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter(function(p) {
          return !!p;
        }), !resolvedAbsolute).join('/');
        return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.';
      },relative:function (from, to) {
        from = PATH.resolve(from).substr(1);
        to = PATH.resolve(to).substr(1);
        function trim(arr) {
          var start = 0;
          for (; start < arr.length; start++) {
            if (arr[start] !== '') break;
          }
          var end = arr.length - 1;
          for (; end >= 0; end--) {
            if (arr[end] !== '') break;
          }
          if (start > end) return [];
          return arr.slice(start, end - start + 1);
        }
        var fromParts = trim(from.split('/'));
        var toParts = trim(to.split('/'));
        var length = Math.min(fromParts.length, toParts.length);
        var samePartsLength = length;
        for (var i = 0; i < length; i++) {
          if (fromParts[i] !== toParts[i]) {
            samePartsLength = i;
            break;
          }
        }
        var outputParts = [];
        for (var i = samePartsLength; i < fromParts.length; i++) {
          outputParts.push('..');
        }
        outputParts = outputParts.concat(toParts.slice(samePartsLength));
        return outputParts.join('/');
      }};
  
  var TTY={ttys:[],init:function () {
        // https://github.com/kripken/emscripten/pull/1555
        // if (ENVIRONMENT_IS_NODE) {
        //   // currently, FS.init does not distinguish if process.stdin is a file or TTY
        //   // device, it always assumes it's a TTY device. because of this, we're forcing
        //   // process.stdin to UTF8 encoding to at least make stdin reading compatible
        //   // with text files until FS.init can be refactored.
        //   process['stdin']['setEncoding']('utf8');
        // }
      },shutdown:function () {
        // https://github.com/kripken/emscripten/pull/1555
        // if (ENVIRONMENT_IS_NODE) {
        //   // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)?
        //   // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation
        //   // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists?
        //   // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle
        //   // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call
        //   process['stdin']['pause']();
        // }
      },register:function (dev, ops) {
        TTY.ttys[dev] = { input: [], output: [], ops: ops };
        FS.registerDevice(dev, TTY.stream_ops);
      },stream_ops:{open:function (stream) {
          var tty = TTY.ttys[stream.node.rdev];
          if (!tty) {
            throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
          }
          stream.tty = tty;
          stream.seekable = false;
        },close:function (stream) {
          // flush any pending line data
          stream.tty.ops.flush(stream.tty);
        },flush:function (stream) {
          stream.tty.ops.flush(stream.tty);
        },read:function (stream, buffer, offset, length, pos /* ignored */) {
          if (!stream.tty || !stream.tty.ops.get_char) {
            throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
          }
          var bytesRead = 0;
          for (var i = 0; i < length; i++) {
            var result;
            try {
              result = stream.tty.ops.get_char(stream.tty);
            } catch (e) {
              throw new FS.ErrnoError(ERRNO_CODES.EIO);
            }
            if (result === undefined && bytesRead === 0) {
              throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
            }
            if (result === null || result === undefined) break;
            bytesRead++;
            buffer[offset+i] = result;
          }
          if (bytesRead) {
            stream.node.timestamp = Date.now();
          }
          return bytesRead;
        },write:function (stream, buffer, offset, length, pos) {
          if (!stream.tty || !stream.tty.ops.put_char) {
            throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
          }
          for (var i = 0; i < length; i++) {
            try {
              stream.tty.ops.put_char(stream.tty, buffer[offset+i]);
            } catch (e) {
              throw new FS.ErrnoError(ERRNO_CODES.EIO);
            }
          }
          if (length) {
            stream.node.timestamp = Date.now();
          }
          return i;
        }},default_tty_ops:{get_char:function (tty) {
          if (!tty.input.length) {
            var result = null;
            if (ENVIRONMENT_IS_NODE) {
              // we will read data by chunks of BUFSIZE
              var BUFSIZE = 256;
              var buf = new Buffer(BUFSIZE);
              var bytesRead = 0;
  
              var isPosixPlatform = (process.platform != 'win32'); // Node doesn't offer a direct check, so test by exclusion
  
              var fd = process.stdin.fd;
              if (isPosixPlatform) {
                // Linux and Mac cannot use process.stdin.fd (which isn't set up as sync)
                var usingDevice = false;
                try {
                  fd = fs.openSync('/dev/stdin', 'r');
                  usingDevice = true;
                } catch (e) {}
              }
  
              try {
                bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null);
              } catch(e) {
                // Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes,
                // reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0.
                if (e.toString().indexOf('EOF') != -1) bytesRead = 0;
                else throw e;
              }
  
              if (usingDevice) { fs.closeSync(fd); }
              if (bytesRead > 0) {
                result = buf.slice(0, bytesRead).toString('utf-8');
              } else {
                result = null;
              }
  
            } else if (typeof window != 'undefined' &&
              typeof window.prompt == 'function') {
              // Browser.
              result = window.prompt('Input: ');  // returns null on cancel
              if (result !== null) {
                result += '\n';
              }
            } else if (typeof readline == 'function') {
              // Command line.
              result = readline();
              if (result !== null) {
                result += '\n';
              }
            }
            if (!result) {
              return null;
            }
            tty.input = intArrayFromString(result, true);
          }
          return tty.input.shift();
        },put_char:function (tty, val) {
          if (val === null || val === 10) {
            Module['print'](UTF8ArrayToString(tty.output, 0));
            tty.output = [];
          } else {
            if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle.
          }
        },flush:function (tty) {
          if (tty.output && tty.output.length > 0) {
            Module['print'](UTF8ArrayToString(tty.output, 0));
            tty.output = [];
          }
        }},default_tty1_ops:{put_char:function (tty, val) {
          if (val === null || val === 10) {
            Module['printErr'](UTF8ArrayToString(tty.output, 0));
            tty.output = [];
          } else {
            if (val != 0) tty.output.push(val);
          }
        },flush:function (tty) {
          if (tty.output && tty.output.length > 0) {
            Module['printErr'](UTF8ArrayToString(tty.output, 0));
            tty.output = [];
          }
        }}};
  
  var MEMFS={ops_table:null,mount:function (mount) {
        return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
      },createNode:function (parent, name, mode, dev) {
        if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
          // no supported
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        if (!MEMFS.ops_table) {
          MEMFS.ops_table = {
            dir: {
              node: {
                getattr: MEMFS.node_ops.getattr,
                setattr: MEMFS.node_ops.setattr,
                lookup: MEMFS.node_ops.lookup,
                mknod: MEMFS.node_ops.mknod,
                rename: MEMFS.node_ops.rename,
                unlink: MEMFS.node_ops.unlink,
                rmdir: MEMFS.node_ops.rmdir,
                readdir: MEMFS.node_ops.readdir,
                symlink: MEMFS.node_ops.symlink
              },
              stream: {
                llseek: MEMFS.stream_ops.llseek
              }
            },
            file: {
              node: {
                getattr: MEMFS.node_ops.getattr,
                setattr: MEMFS.node_ops.setattr
              },
              stream: {
                llseek: MEMFS.stream_ops.llseek,
                read: MEMFS.stream_ops.read,
                write: MEMFS.stream_ops.write,
                allocate: MEMFS.stream_ops.allocate,
                mmap: MEMFS.stream_ops.mmap,
                msync: MEMFS.stream_ops.msync
              }
            },
            link: {
              node: {
                getattr: MEMFS.node_ops.getattr,
                setattr: MEMFS.node_ops.setattr,
                readlink: MEMFS.node_ops.readlink
              },
              stream: {}
            },
            chrdev: {
              node: {
                getattr: MEMFS.node_ops.getattr,
                setattr: MEMFS.node_ops.setattr
              },
              stream: FS.chrdev_stream_ops
            }
          };
        }
        var node = FS.createNode(parent, name, mode, dev);
        if (FS.isDir(node.mode)) {
          node.node_ops = MEMFS.ops_table.dir.node;
          node.stream_ops = MEMFS.ops_table.dir.stream;
          node.contents = {};
        } else if (FS.isFile(node.mode)) {
          node.node_ops = MEMFS.ops_table.file.node;
          node.stream_ops = MEMFS.ops_table.file.stream;
          node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity.
          // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred
          // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size
          // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme.
          node.contents = null; 
        } else if (FS.isLink(node.mode)) {
          node.node_ops = MEMFS.ops_table.link.node;
          node.stream_ops = MEMFS.ops_table.link.stream;
        } else if (FS.isChrdev(node.mode)) {
          node.node_ops = MEMFS.ops_table.chrdev.node;
          node.stream_ops = MEMFS.ops_table.chrdev.stream;
        }
        node.timestamp = Date.now();
        // add the new node to the parent
        if (parent) {
          parent.contents[name] = node;
        }
        return node;
      },getFileDataAsRegularArray:function (node) {
        if (node.contents && node.contents.subarray) {
          var arr = [];
          for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]);
          return arr; // Returns a copy of the original data.
        }
        return node.contents; // No-op, the file contents are already in a JS array. Return as-is.
      },getFileDataAsTypedArray:function (node) {
        if (!node.contents) return new Uint8Array;
        if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes.
        return new Uint8Array(node.contents);
      },expandFileStorage:function (node, newCapacity) {
        // If we are asked to expand the size of a file that already exists, revert to using a standard JS array to store the file
        // instead of a typed array. This makes resizing the array more flexible because we can just .push() elements at the back to
        // increase the size.
        if (node.contents && node.contents.subarray && newCapacity > node.contents.length) {
          node.contents = MEMFS.getFileDataAsRegularArray(node);
          node.usedBytes = node.contents.length; // We might be writing to a lazy-loaded file which had overridden this property, so force-reset it.
        }
  
        if (!node.contents || node.contents.subarray) { // Keep using a typed array if creating a new storage, or if old one was a typed array as well.
          var prevCapacity = node.contents ? node.contents.length : 0;
          if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough.
          // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity.
          // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to
          // avoid overshooting the allocation cap by a very large margin.
          var CAPACITY_DOUBLING_MAX = 1024 * 1024;
          newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) | 0);
          if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding.
          var oldContents = node.contents;
          node.contents = new Uint8Array(newCapacity); // Allocate new storage.
          if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage.
          return;
        }
        // Not using a typed array to back the file storage. Use a standard JS array instead.
        if (!node.contents && newCapacity > 0) node.contents = [];
        while (node.contents.length < newCapacity) node.contents.push(0);
      },resizeFileStorage:function (node, newSize) {
        if (node.usedBytes == newSize) return;
        if (newSize == 0) {
          node.contents = null; // Fully decommit when requesting a resize to zero.
          node.usedBytes = 0;
          return;
        }
        if (!node.contents || node.contents.subarray) { // Resize a typed array if that is being used as the backing store.
          var oldContents = node.contents;
          node.contents = new Uint8Array(new ArrayBuffer(newSize)); // Allocate new storage.
          if (oldContents) {
            node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage.
          }
          node.usedBytes = newSize;
          return;
        }
        // Backing with a JS array.
        if (!node.contents) node.contents = [];
        if (node.contents.length > newSize) node.contents.length = newSize;
        else while (node.contents.length < newSize) node.contents.push(0);
        node.usedBytes = newSize;
      },node_ops:{getattr:function (node) {
          var attr = {};
          // device numbers reuse inode numbers.
          attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
          attr.ino = node.id;
          attr.mode = node.mode;
          attr.nlink = 1;
          attr.uid = 0;
          attr.gid = 0;
          attr.rdev = node.rdev;
          if (FS.isDir(node.mode)) {
            attr.size = 4096;
          } else if (FS.isFile(node.mode)) {
            attr.size = node.usedBytes;
          } else if (FS.isLink(node.mode)) {
            attr.size = node.link.length;
          } else {
            attr.size = 0;
          }
          attr.atime = new Date(node.timestamp);
          attr.mtime = new Date(node.timestamp);
          attr.ctime = new Date(node.timestamp);
          // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize),
          //       but this is not required by the standard.
          attr.blksize = 4096;
          attr.blocks = Math.ceil(attr.size / attr.blksize);
          return attr;
        },setattr:function (node, attr) {
          if (attr.mode !== undefined) {
            node.mode = attr.mode;
          }
          if (attr.timestamp !== undefined) {
            node.timestamp = attr.timestamp;
          }
          if (attr.size !== undefined) {
            MEMFS.resizeFileStorage(node, attr.size);
          }
        },lookup:function (parent, name) {
          throw FS.genericErrors[ERRNO_CODES.ENOENT];
        },mknod:function (parent, name, mode, dev) {
          return MEMFS.createNode(parent, name, mode, dev);
        },rename:function (old_node, new_dir, new_name) {
          // if we're overwriting a directory at new_name, make sure it's empty.
          if (FS.isDir(old_node.mode)) {
            var new_node;
            try {
              new_node = FS.lookupNode(new_dir, new_name);
            } catch (e) {
            }
            if (new_node) {
              for (var i in new_node.contents) {
                throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
              }
            }
          }
          // do the internal rewiring
          delete old_node.parent.contents[old_node.name];
          old_node.name = new_name;
          new_dir.contents[new_name] = old_node;
          old_node.parent = new_dir;
        },unlink:function (parent, name) {
          delete parent.contents[name];
        },rmdir:function (parent, name) {
          var node = FS.lookupNode(parent, name);
          for (var i in node.contents) {
            throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
          }
          delete parent.contents[name];
        },readdir:function (node) {
          var entries = ['.', '..']
          for (var key in node.contents) {
            if (!node.contents.hasOwnProperty(key)) {
              continue;
            }
            entries.push(key);
          }
          return entries;
        },symlink:function (parent, newname, oldpath) {
          var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0);
          node.link = oldpath;
          return node;
        },readlink:function (node) {
          if (!FS.isLink(node.mode)) {
            throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
          }
          return node.link;
        }},stream_ops:{read:function (stream, buffer, offset, length, position) {
          var contents = stream.node.contents;
          if (position >= stream.node.usedBytes) return 0;
          var size = Math.min(stream.node.usedBytes - position, length);
          assert(size >= 0);
          if (size > 8 && contents.subarray) { // non-trivial, and typed array
            buffer.set(contents.subarray(position, position + size), offset);
          } else {
            for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i];
          }
          return size;
        },write:function (stream, buffer, offset, length, position, canOwn) {
          if (!length) return 0;
          var node = stream.node;
          node.timestamp = Date.now();
  
          if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array?
            if (canOwn) {
              assert(position === 0, 'canOwn must imply no weird position inside the file');
              node.contents = buffer.subarray(offset, offset + length);
              node.usedBytes = length;
              return length;
            } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data.
              node.contents = new Uint8Array(buffer.subarray(offset, offset + length));
              node.usedBytes = length;
              return length;
            } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file?
              node.contents.set(buffer.subarray(offset, offset + length), position);
              return length;
            }
          }
  
          // Appending to an existing file and we need to reallocate, or source data did not come as a typed array.
          MEMFS.expandFileStorage(node, position+length);
          if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position); // Use typed array write if available.
          else {
            for (var i = 0; i < length; i++) {
             node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not.
            }
          }
          node.usedBytes = Math.max(node.usedBytes, position+length);
          return length;
        },llseek:function (stream, offset, whence) {
          var position = offset;
          if (whence === 1) {  // SEEK_CUR.
            position += stream.position;
          } else if (whence === 2) {  // SEEK_END.
            if (FS.isFile(stream.node.mode)) {
              position += stream.node.usedBytes;
            }
          }
          if (position < 0) {
            throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
          }
          return position;
        },allocate:function (stream, offset, length) {
          MEMFS.expandFileStorage(stream.node, offset + length);
          stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length);
        },mmap:function (stream, buffer, offset, length, position, prot, flags) {
          if (!FS.isFile(stream.node.mode)) {
            throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
          }
          var ptr;
          var allocated;
          var contents = stream.node.contents;
          // Only make a new copy when MAP_PRIVATE is specified.
          if ( !(flags & 2) &&
                (contents.buffer === buffer || contents.buffer === buffer.buffer) ) {
            // We can't emulate MAP_SHARED when the file is not backed by the buffer
            // we're mapping to (e.g. the HEAP buffer).
            allocated = false;
            ptr = contents.byteOffset;
          } else {
            // Try to avoid unnecessary slices.
            if (position > 0 || position + length < stream.node.usedBytes) {
              if (contents.subarray) {
                contents = contents.subarray(position, position + length);
              } else {
                contents = Array.prototype.slice.call(contents, position, position + length);
              }
            }
            allocated = true;
            ptr = _malloc(length);
            if (!ptr) {
              throw new FS.ErrnoError(ERRNO_CODES.ENOMEM);
            }
            buffer.set(contents, ptr);
          }
          return { ptr: ptr, allocated: allocated };
        },msync:function (stream, buffer, offset, length, mmapFlags) {
          if (!FS.isFile(stream.node.mode)) {
            throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
          }
          if (mmapFlags & 2) {
            // MAP_PRIVATE calls need not to be synced back to underlying fs
            return 0;
          }
  
          var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
          // should we check if bytesWritten and length are the same?
          return 0;
        }}};
  
  var IDBFS={dbs:{},indexedDB:function () {
        if (typeof indexedDB !== 'undefined') return indexedDB;
        var ret = null;
        if (typeof window === 'object') ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
        assert(ret, 'IDBFS used, but indexedDB not supported');
        return ret;
      },DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function (mount) {
        // reuse all of the core MEMFS functionality
        return MEMFS.mount.apply(null, arguments);
      },syncfs:function (mount, populate, callback) {
        IDBFS.getLocalSet(mount, function(err, local) {
          if (err) return callback(err);
  
          IDBFS.getRemoteSet(mount, function(err, remote) {
            if (err) return callback(err);
  
            var src = populate ? remote : local;
            var dst = populate ? local : remote;
  
            IDBFS.reconcile(src, dst, callback);
          });
        });
      },getDB:function (name, callback) {
        // check the cache first
        var db = IDBFS.dbs[name];
        if (db) {
          return callback(null, db);
        }
  
        var req;
        try {
          req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION);
        } catch (e) {
          return callback(e);
        }
        if (!req) {
          return callback("Unable to connect to IndexedDB");
        }
        req.onupgradeneeded = function(e) {
          var db = e.target.result;
          var transaction = e.target.transaction;
  
          var fileStore;
  
          if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) {
            fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME);
          } else {
            fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME);
          }
  
          if (!fileStore.indexNames.contains('timestamp')) {
            fileStore.createIndex('timestamp', 'timestamp', { unique: false });
          }
        };
        req.onsuccess = function() {
          db = req.result;
  
          // add to the cache
          IDBFS.dbs[name] = db;
          callback(null, db);
        };
        req.onerror = function(e) {
          callback(this.error);
          e.preventDefault();
        };
      },getLocalSet:function (mount, callback) {
        var entries = {};
  
        function isRealDir(p) {
          return p !== '.' && p !== '..';
        };
        function toAbsolute(root) {
          return function(p) {
            return PATH.join2(root, p);
          }
        };
  
        var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));
  
        while (check.length) {
          var path = check.pop();
          var stat;
  
          try {
            stat = FS.stat(path);
          } catch (e) {
            return callback(e);
          }
  
          if (FS.isDir(stat.mode)) {
            check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path)));
          }
  
          entries[path] = { timestamp: stat.mtime };
        }
  
        return callback(null, { type: 'local', entries: entries });
      },getRemoteSet:function (mount, callback) {
        var entries = {};
  
        IDBFS.getDB(mount.mountpoint, function(err, db) {
          if (err) return callback(err);
  
          var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readonly');
          transaction.onerror = function(e) {
            callback(this.error);
            e.preventDefault();
          };
  
          var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
          var index = store.index('timestamp');
  
          index.openKeyCursor().onsuccess = function(event) {
            var cursor = event.target.result;
  
            if (!cursor) {
              return callback(null, { type: 'remote', db: db, entries: entries });
            }
  
            entries[cursor.primaryKey] = { timestamp: cursor.key };
  
            cursor.continue();
          };
        });
      },loadLocalEntry:function (path, callback) {
        var stat, node;
  
        try {
          var lookup = FS.lookupPath(path);
          node = lookup.node;
          stat = FS.stat(path);
        } catch (e) {
          return callback(e);
        }
  
        if (FS.isDir(stat.mode)) {
          return callback(null, { timestamp: stat.mtime, mode: stat.mode });
        } else if (FS.isFile(stat.mode)) {
          // Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array.
          // Therefore always convert the file contents to a typed array first before writing the data to IndexedDB.
          node.contents = MEMFS.getFileDataAsTypedArray(node);
          return callback(null, { timestamp: stat.mtime, mode: stat.mode, contents: node.contents });
        } else {
          return callback(new Error('node type not supported'));
        }
      },storeLocalEntry:function (path, entry, callback) {
        try {
          if (FS.isDir(entry.mode)) {
            FS.mkdir(path, entry.mode);
          } else if (FS.isFile(entry.mode)) {
            FS.writeFile(path, entry.contents, { encoding: 'binary', canOwn: true });
          } else {
            return callback(new Error('node type not supported'));
          }
  
          FS.chmod(path, entry.mode);
          FS.utime(path, entry.timestamp, entry.timestamp);
        } catch (e) {
          return callback(e);
        }
  
        callback(null);
      },removeLocalEntry:function (path, callback) {
        try {
          var lookup = FS.lookupPath(path);
          var stat = FS.stat(path);
  
          if (FS.isDir(stat.mode)) {
            FS.rmdir(path);
          } else if (FS.isFile(stat.mode)) {
            FS.unlink(path);
          }
        } catch (e) {
          return callback(e);
        }
  
        callback(null);
      },loadRemoteEntry:function (store, path, callback) {
        var req = store.get(path);
        req.onsuccess = function(event) { callback(null, event.target.result); };
        req.onerror = function(e) {
          callback(this.error);
          e.preventDefault();
        };
      },storeRemoteEntry:function (store, path, entry, callback) {
        var req = store.put(entry, path);
        req.onsuccess = function() { callback(null); };
        req.onerror = function(e) {
          callback(this.error);
          e.preventDefault();
        };
      },removeRemoteEntry:function (store, path, callback) {
        var req = store.delete(path);
        req.onsuccess = function() { callback(null); };
        req.onerror = function(e) {
          callback(this.error);
          e.preventDefault();
        };
      },reconcile:function (src, dst, callback) {
        var total = 0;
  
        var create = [];
        Object.keys(src.entries).forEach(function (key) {
          var e = src.entries[key];
          var e2 = dst.entries[key];
          if (!e2 || e.timestamp > e2.timestamp) {
            create.push(key);
            total++;
          }
        });
  
        var remove = [];
        Object.keys(dst.entries).forEach(function (key) {
          var e = dst.entries[key];
          var e2 = src.entries[key];
          if (!e2) {
            remove.push(key);
            total++;
          }
        });
  
        if (!total) {
          return callback(null);
        }
  
        var errored = false;
        var completed = 0;
        var db = src.type === 'remote' ? src.db : dst.db;
        var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readwrite');
        var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
  
        function done(err) {
          if (err) {
            if (!done.errored) {
              done.errored = true;
              return callback(err);
            }
            return;
          }
          if (++completed >= total) {
            return callback(null);
          }
        };
  
        transaction.onerror = function(e) {
          done(this.error);
          e.preventDefault();
        };
  
        // sort paths in ascending order so directory entries are created
        // before the files inside them
        create.sort().forEach(function (path) {
          if (dst.type === 'local') {
            IDBFS.loadRemoteEntry(store, path, function (err, entry) {
              if (err) return done(err);
              IDBFS.storeLocalEntry(path, entry, done);
            });
          } else {
            IDBFS.loadLocalEntry(path, function (err, entry) {
              if (err) return done(err);
              IDBFS.storeRemoteEntry(store, path, entry, done);
            });
          }
        });
  
        // sort paths in descending order so files are deleted before their
        // parent directories
        remove.sort().reverse().forEach(function(path) {
          if (dst.type === 'local') {
            IDBFS.removeLocalEntry(path, done);
          } else {
            IDBFS.removeRemoteEntry(store, path, done);
          }
        });
      }};
  
  var NODEFS={isWindows:false,staticInit:function () {
        NODEFS.isWindows = !!process.platform.match(/^win/);
      },mount:function (mount) {
        assert(ENVIRONMENT_IS_NODE);
        return NODEFS.createNode(null, '/', NODEFS.getMode(mount.opts.root), 0);
      },createNode:function (parent, name, mode, dev) {
        if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        var node = FS.createNode(parent, name, mode);
        node.node_ops = NODEFS.node_ops;
        node.stream_ops = NODEFS.stream_ops;
        return node;
      },getMode:function (path) {
        var stat;
        try {
          stat = fs.lstatSync(path);
          if (NODEFS.isWindows) {
            // On Windows, directories return permission bits 'rw-rw-rw-', even though they have 'rwxrwxrwx', so
            // propagate write bits to execute bits.
            stat.mode = stat.mode | ((stat.mode & 146) >> 1);
          }
        } catch (e) {
          if (!e.code) throw e;
          throw new FS.ErrnoError(ERRNO_CODES[e.code]);
        }
        return stat.mode;
      },realPath:function (node) {
        var parts = [];
        while (node.parent !== node) {
          parts.push(node.name);
          node = node.parent;
        }
        parts.push(node.mount.opts.root);
        parts.reverse();
        return PATH.join.apply(null, parts);
      },flagsToPermissionStringMap:{0:"r",1:"r+",2:"r+",64:"r",65:"r+",66:"r+",129:"rx+",193:"rx+",514:"w+",577:"w",578:"w+",705:"wx",706:"wx+",1024:"a",1025:"a",1026:"a+",1089:"a",1090:"a+",1153:"ax",1154:"ax+",1217:"ax",1218:"ax+",4096:"rs",4098:"rs+"},flagsToPermissionString:function (flags) {
        flags &= ~0x200000 /*O_PATH*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
        flags &= ~0x800 /*O_NONBLOCK*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
        flags &= ~0x8000 /*O_LARGEFILE*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
        flags &= ~0x80000 /*O_CLOEXEC*/; // Some applications may pass it; it makes no sense for a single process.
        if (flags in NODEFS.flagsToPermissionStringMap) {
          return NODEFS.flagsToPermissionStringMap[flags];
        } else {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
      },node_ops:{getattr:function (node) {
          var path = NODEFS.realPath(node);
          var stat;
          try {
            stat = fs.lstatSync(path);
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
          // node.js v0.10.20 doesn't report blksize and blocks on Windows. Fake them with default blksize of 4096.
          // See http://support.microsoft.com/kb/140365
          if (NODEFS.isWindows && !stat.blksize) {
            stat.blksize = 4096;
          }
          if (NODEFS.isWindows && !stat.blocks) {
            stat.blocks = (stat.size+stat.blksize-1)/stat.blksize|0;
          }
          return {
            dev: stat.dev,
            ino: stat.ino,
            mode: stat.mode,
            nlink: stat.nlink,
            uid: stat.uid,
            gid: stat.gid,
            rdev: stat.rdev,
            size: stat.size,
            atime: stat.atime,
            mtime: stat.mtime,
            ctime: stat.ctime,
            blksize: stat.blksize,
            blocks: stat.blocks
          };
        },setattr:function (node, attr) {
          var path = NODEFS.realPath(node);
          try {
            if (attr.mode !== undefined) {
              fs.chmodSync(path, attr.mode);
              // update the common node structure mode as well
              node.mode = attr.mode;
            }
            if (attr.timestamp !== undefined) {
              var date = new Date(attr.timestamp);
              fs.utimesSync(path, date, date);
            }
            if (attr.size !== undefined) {
              fs.truncateSync(path, attr.size);
            }
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },lookup:function (parent, name) {
          var path = PATH.join2(NODEFS.realPath(parent), name);
          var mode = NODEFS.getMode(path);
          return NODEFS.createNode(parent, name, mode);
        },mknod:function (parent, name, mode, dev) {
          var node = NODEFS.createNode(parent, name, mode, dev);
          // create the backing node for this in the fs root as well
          var path = NODEFS.realPath(node);
          try {
            if (FS.isDir(node.mode)) {
              fs.mkdirSync(path, node.mode);
            } else {
              fs.writeFileSync(path, '', { mode: node.mode });
            }
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
          return node;
        },rename:function (oldNode, newDir, newName) {
          var oldPath = NODEFS.realPath(oldNode);
          var newPath = PATH.join2(NODEFS.realPath(newDir), newName);
          try {
            fs.renameSync(oldPath, newPath);
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },unlink:function (parent, name) {
          var path = PATH.join2(NODEFS.realPath(parent), name);
          try {
            fs.unlinkSync(path);
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },rmdir:function (parent, name) {
          var path = PATH.join2(NODEFS.realPath(parent), name);
          try {
            fs.rmdirSync(path);
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },readdir:function (node) {
          var path = NODEFS.realPath(node);
          try {
            return fs.readdirSync(path);
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },symlink:function (parent, newName, oldPath) {
          var newPath = PATH.join2(NODEFS.realPath(parent), newName);
          try {
            fs.symlinkSync(oldPath, newPath);
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },readlink:function (node) {
          var path = NODEFS.realPath(node);
          try {
            path = fs.readlinkSync(path);
            path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path);
            return path;
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        }},stream_ops:{open:function (stream) {
          var path = NODEFS.realPath(stream.node);
          try {
            if (FS.isFile(stream.node.mode)) {
              stream.nfd = fs.openSync(path, NODEFS.flagsToPermissionString(stream.flags));
            }
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },close:function (stream) {
          try {
            if (FS.isFile(stream.node.mode) && stream.nfd) {
              fs.closeSync(stream.nfd);
            }
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },read:function (stream, buffer, offset, length, position) {
          if (length === 0) return 0; // node errors on 0 length reads
          // FIXME this is terrible.
          var nbuffer = new Buffer(length);
          var res;
          try {
            res = fs.readSync(stream.nfd, nbuffer, 0, length, position);
          } catch (e) {
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
          if (res > 0) {
            for (var i = 0; i < res; i++) {
              buffer[offset + i] = nbuffer[i];
            }
          }
          return res;
        },write:function (stream, buffer, offset, length, position) {
          // FIXME this is terrible.
          var nbuffer = new Buffer(buffer.subarray(offset, offset + length));
          var res;
          try {
            res = fs.writeSync(stream.nfd, nbuffer, 0, length, position);
          } catch (e) {
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
          return res;
        },llseek:function (stream, offset, whence) {
          var position = offset;
          if (whence === 1) {  // SEEK_CUR.
            position += stream.position;
          } else if (whence === 2) {  // SEEK_END.
            if (FS.isFile(stream.node.mode)) {
              try {
                var stat = fs.fstatSync(stream.nfd);
                position += stat.size;
              } catch (e) {
                throw new FS.ErrnoError(ERRNO_CODES[e.code]);
              }
            }
          }
  
          if (position < 0) {
            throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
          }
  
          return position;
        }}};
  
  var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function (mount) {
        assert(ENVIRONMENT_IS_WORKER);
        if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync();
        var root = WORKERFS.createNode(null, '/', WORKERFS.DIR_MODE, 0);
        var createdParents = {};
        function ensureParent(path) {
          // return the parent node, creating subdirs as necessary
          var parts = path.split('/');
          var parent = root;
          for (var i = 0; i < parts.length-1; i++) {
            var curr = parts.slice(0, i+1).join('/');
            // Issue 4254: Using curr as a node name will prevent the node
            // from being found in FS.nameTable when FS.open is called on
            // a path which holds a child of this node,
            // given that all FS functions assume node names
            // are just their corresponding parts within their given path,
            // rather than incremental aggregates which include their parent's
            // directories.
            if (!createdParents[curr]) {
              createdParents[curr] = WORKERFS.createNode(parent, parts[i], WORKERFS.DIR_MODE, 0);
            }
            parent = createdParents[curr];
          }
          return parent;
        }
        function base(path) {
          var parts = path.split('/');
          return parts[parts.length-1];
        }
        // We also accept FileList here, by using Array.prototype
        Array.prototype.forEach.call(mount.opts["files"] || [], function(file) {
          WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate);
        });
        (mount.opts["blobs"] || []).forEach(function(obj) {
          WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]);
        });
        (mount.opts["packages"] || []).forEach(function(pack) {
          pack['metadata'].files.forEach(function(file) {
            var name = file.filename.substr(1); // remove initial slash
            WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack['blob'].slice(file.start, file.end));
          });
        });
        return root;
      },createNode:function (parent, name, mode, dev, contents, mtime) {
        var node = FS.createNode(parent, name, mode);
        node.mode = mode;
        node.node_ops = WORKERFS.node_ops;
        node.stream_ops = WORKERFS.stream_ops;
        node.timestamp = (mtime || new Date).getTime();
        assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE);
        if (mode === WORKERFS.FILE_MODE) {
          node.size = contents.size;
          node.contents = contents;
        } else {
          node.size = 4096;
          node.contents = {};
        }
        if (parent) {
          parent.contents[name] = node;
        }
        return node;
      },node_ops:{getattr:function (node) {
          return {
            dev: 1,
            ino: undefined,
            mode: node.mode,
            nlink: 1,
            uid: 0,
            gid: 0,
            rdev: undefined,
            size: node.size,
            atime: new Date(node.timestamp),
            mtime: new Date(node.timestamp),
            ctime: new Date(node.timestamp),
            blksize: 4096,
            blocks: Math.ceil(node.size / 4096),
          };
        },setattr:function (node, attr) {
          if (attr.mode !== undefined) {
            node.mode = attr.mode;
          }
          if (attr.timestamp !== undefined) {
            node.timestamp = attr.timestamp;
          }
        },lookup:function (parent, name) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        },mknod:function (parent, name, mode, dev) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        },rename:function (oldNode, newDir, newName) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        },unlink:function (parent, name) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        },rmdir:function (parent, name) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        },readdir:function (node) {
          var entries = ['.', '..'];
          for (var key in node.contents) {
            if (!node.contents.hasOwnProperty(key)) {
              continue;
            }
            entries.push(key);
          }
          return entries;
        },symlink:function (parent, newName, oldPath) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        },readlink:function (node) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }},stream_ops:{read:function (stream, buffer, offset, length, position) {
          if (position >= stream.node.size) return 0;
          var chunk = stream.node.contents.slice(position, position + length);
          var ab = WORKERFS.reader.readAsArrayBuffer(chunk);
          buffer.set(new Uint8Array(ab), offset);
          return chunk.size;
        },write:function (stream, buffer, offset, length, position) {
          throw new FS.ErrnoError(ERRNO_CODES.EIO);
        },llseek:function (stream, offset, whence) {
          var position = offset;
          if (whence === 1) {  // SEEK_CUR.
            position += stream.position;
          } else if (whence === 2) {  // SEEK_END.
            if (FS.isFile(stream.node.mode)) {
              position += stream.node.size;
            }
          }
          if (position < 0) {
            throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
          }
          return position;
        }}};
  
  var _stdin=STATICTOP; STATICTOP += 16;;
  
  var _stdout=STATICTOP; STATICTOP += 16;;
  
  var _stderr=STATICTOP; STATICTOP += 16;;var FS={root:null,mounts:[],devices:[null],streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,handleFSError:function (e) {
        if (!(e instanceof FS.ErrnoError)) throw e + ' : ' + stackTrace();
        return ___setErrNo(e.errno);
      },lookupPath:function (path, opts) {
        path = PATH.resolve(FS.cwd(), path);
        opts = opts || {};
  
        if (!path) return { path: '', node: null };
  
        var defaults = {
          follow_mount: true,
          recurse_count: 0
        };
        for (var key in defaults) {
          if (opts[key] === undefined) {
            opts[key] = defaults[key];
          }
        }
  
        if (opts.recurse_count > 8) {  // max recursive lookup of 8
          throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
        }
  
        // split the path
        var parts = PATH.normalizeArray(path.split('/').filter(function(p) {
          return !!p;
        }), false);
  
        // start at the root
        var current = FS.root;
        var current_path = '/';
  
        for (var i = 0; i < parts.length; i++) {
          var islast = (i === parts.length-1);
          if (islast && opts.parent) {
            // stop resolving
            break;
          }
  
          current = FS.lookupNode(current, parts[i]);
          current_path = PATH.join2(current_path, parts[i]);
  
          // jump to the mount's root node if this is a mountpoint
          if (FS.isMountpoint(current)) {
            if (!islast || (islast && opts.follow_mount)) {
              current = current.mounted.root;
            }
          }
  
          // by default, lookupPath will not follow a symlink if it is the final path component.
          // setting opts.follow = true will override this behavior.
          if (!islast || opts.follow) {
            var count = 0;
            while (FS.isLink(current.mode)) {
              var link = FS.readlink(current_path);
              current_path = PATH.resolve(PATH.dirname(current_path), link);
  
              var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count });
              current = lookup.node;
  
              if (count++ > 40) {  // limit max consecutive symlinks to 40 (SYMLOOP_MAX).
                throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
              }
            }
          }
        }
  
        return { path: current_path, node: current };
      },getPath:function (node) {
        var path;
        while (true) {
          if (FS.isRoot(node)) {
            var mount = node.mount.mountpoint;
            if (!path) return mount;
            return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path;
          }
          path = path ? node.name + '/' + path : node.name;
          node = node.parent;
        }
      },hashName:function (parentid, name) {
        var hash = 0;
  
  
        for (var i = 0; i < name.length; i++) {
          hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0;
        }
        return ((parentid + hash) >>> 0) % FS.nameTable.length;
      },hashAddNode:function (node) {
        var hash = FS.hashName(node.parent.id, node.name);
        node.name_next = FS.nameTable[hash];
        FS.nameTable[hash] = node;
      },hashRemoveNode:function (node) {
        var hash = FS.hashName(node.parent.id, node.name);
        if (FS.nameTable[hash] === node) {
          FS.nameTable[hash] = node.name_next;
        } else {
          var current = FS.nameTable[hash];
          while (current) {
            if (current.name_next === node) {
              current.name_next = node.name_next;
              break;
            }
            current = current.name_next;
          }
        }
      },lookupNode:function (parent, name) {
        var err = FS.mayLookup(parent);
        if (err) {
          throw new FS.ErrnoError(err, parent);
        }
        var hash = FS.hashName(parent.id, name);
        for (var node = FS.nameTable[hash]; node; node = node.name_next) {
          var nodeName = node.name;
          if (node.parent.id === parent.id && nodeName === name) {
            return node;
          }
        }
        // if we failed to find it in the cache, call into the VFS
        return FS.lookup(parent, name);
      },createNode:function (parent, name, mode, rdev) {
        if (!FS.FSNode) {
          FS.FSNode = function(parent, name, mode, rdev) {
            if (!parent) {
              parent = this;  // root node sets parent to itself
            }
            this.parent = parent;
            this.mount = parent.mount;
            this.mounted = null;
            this.id = FS.nextInode++;
            this.name = name;
            this.mode = mode;
            this.node_ops = {};
            this.stream_ops = {};
            this.rdev = rdev;
          };
  
          FS.FSNode.prototype = {};
  
          // compatibility
          var readMode = 292 | 73;
          var writeMode = 146;
  
          // NOTE we must use Object.defineProperties instead of individual calls to
          // Object.defineProperty in order to make closure compiler happy
          Object.defineProperties(FS.FSNode.prototype, {
            read: {
              get: function() { return (this.mode & readMode) === readMode; },
              set: function(val) { val ? this.mode |= readMode : this.mode &= ~readMode; }
            },
            write: {
              get: function() { return (this.mode & writeMode) === writeMode; },
              set: function(val) { val ? this.mode |= writeMode : this.mode &= ~writeMode; }
            },
            isFolder: {
              get: function() { return FS.isDir(this.mode); }
            },
            isDevice: {
              get: function() { return FS.isChrdev(this.mode); }
            }
          });
        }
  
        var node = new FS.FSNode(parent, name, mode, rdev);
  
        FS.hashAddNode(node);
  
        return node;
      },destroyNode:function (node) {
        FS.hashRemoveNode(node);
      },isRoot:function (node) {
        return node === node.parent;
      },isMountpoint:function (node) {
        return !!node.mounted;
      },isFile:function (mode) {
        return (mode & 61440) === 32768;
      },isDir:function (mode) {
        return (mode & 61440) === 16384;
      },isLink:function (mode) {
        return (mode & 61440) === 40960;
      },isChrdev:function (mode) {
        return (mode & 61440) === 8192;
      },isBlkdev:function (mode) {
        return (mode & 61440) === 24576;
      },isFIFO:function (mode) {
        return (mode & 61440) === 4096;
      },isSocket:function (mode) {
        return (mode & 49152) === 49152;
      },flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function (str) {
        var flags = FS.flagModes[str];
        if (typeof flags === 'undefined') {
          throw new Error('Unknown file open mode: ' + str);
        }
        return flags;
      },flagsToPermissionString:function (flag) {
        var perms = ['r', 'w', 'rw'][flag & 3];
        if ((flag & 512)) {
          perms += 'w';
        }
        return perms;
      },nodePermissions:function (node, perms) {
        if (FS.ignorePermissions) {
          return 0;
        }
        // return 0 if any user, group or owner bits are set.
        if (perms.indexOf('r') !== -1 && !(node.mode & 292)) {
          return ERRNO_CODES.EACCES;
        } else if (perms.indexOf('w') !== -1 && !(node.mode & 146)) {
          return ERRNO_CODES.EACCES;
        } else if (perms.indexOf('x') !== -1 && !(node.mode & 73)) {
          return ERRNO_CODES.EACCES;
        }
        return 0;
      },mayLookup:function (dir) {
        var err = FS.nodePermissions(dir, 'x');
        if (err) return err;
        if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES;
        return 0;
      },mayCreate:function (dir, name) {
        try {
          var node = FS.lookupNode(dir, name);
          return ERRNO_CODES.EEXIST;
        } catch (e) {
        }
        return FS.nodePermissions(dir, 'wx');
      },mayDelete:function (dir, name, isdir) {
        var node;
        try {
          node = FS.lookupNode(dir, name);
        } catch (e) {
          return e.errno;
        }
        var err = FS.nodePermissions(dir, 'wx');
        if (err) {
          return err;
        }
        if (isdir) {
          if (!FS.isDir(node.mode)) {
            return ERRNO_CODES.ENOTDIR;
          }
          if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
            return ERRNO_CODES.EBUSY;
          }
        } else {
          if (FS.isDir(node.mode)) {
            return ERRNO_CODES.EISDIR;
          }
        }
        return 0;
      },mayOpen:function (node, flags) {
        if (!node) {
          return ERRNO_CODES.ENOENT;
        }
        if (FS.isLink(node.mode)) {
          return ERRNO_CODES.ELOOP;
        } else if (FS.isDir(node.mode)) {
          if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write
              (flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only)
            return ERRNO_CODES.EISDIR;
          }
        }
        return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
      },MAX_OPEN_FDS:4096,nextfd:function (fd_start, fd_end) {
        fd_start = fd_start || 0;
        fd_end = fd_end || FS.MAX_OPEN_FDS;
        for (var fd = fd_start; fd <= fd_end; fd++) {
          if (!FS.streams[fd]) {
            return fd;
          }
        }
        throw new FS.ErrnoError(ERRNO_CODES.EMFILE);
      },getStream:function (fd) {
        return FS.streams[fd];
      },createStream:function (stream, fd_start, fd_end) {
        if (!FS.FSStream) {
          FS.FSStream = function(){};
          FS.FSStream.prototype = {};
          // compatibility
          Object.defineProperties(FS.FSStream.prototype, {
            object: {
              get: function() { return this.node; },
              set: function(val) { this.node = val; }
            },
            isRead: {
              get: function() { return (this.flags & 2097155) !== 1; }
            },
            isWrite: {
              get: function() { return (this.flags & 2097155) !== 0; }
            },
            isAppend: {
              get: function() { return (this.flags & 1024); }
            }
          });
        }
        // clone it, so we can return an instance of FSStream
        var newStream = new FS.FSStream();
        for (var p in stream) {
          newStream[p] = stream[p];
        }
        stream = newStream;
        var fd = FS.nextfd(fd_start, fd_end);
        stream.fd = fd;
        FS.streams[fd] = stream;
        return stream;
      },closeStream:function (fd) {
        FS.streams[fd] = null;
      },chrdev_stream_ops:{open:function (stream) {
          var device = FS.getDevice(stream.node.rdev);
          // override node's stream ops with the device's
          stream.stream_ops = device.stream_ops;
          // forward the open call
          if (stream.stream_ops.open) {
            stream.stream_ops.open(stream);
          }
        },llseek:function () {
          throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
        }},major:function (dev) {
        return ((dev) >> 8);
      },minor:function (dev) {
        return ((dev) & 0xff);
      },makedev:function (ma, mi) {
        return ((ma) << 8 | (mi));
      },registerDevice:function (dev, ops) {
        FS.devices[dev] = { stream_ops: ops };
      },getDevice:function (dev) {
        return FS.devices[dev];
      },getMounts:function (mount) {
        var mounts = [];
        var check = [mount];
  
        while (check.length) {
          var m = check.pop();
  
          mounts.push(m);
  
          check.push.apply(check, m.mounts);
        }
  
        return mounts;
      },syncfs:function (populate, callback) {
        if (typeof(populate) === 'function') {
          callback = populate;
          populate = false;
        }
  
        FS.syncFSRequests++;
  
        if (FS.syncFSRequests > 1) {
          console.log('warning: ' + FS.syncFSRequests + ' FS.syncfs operations in flight at once, probably just doing extra work');
        }
  
        var mounts = FS.getMounts(FS.root.mount);
        var completed = 0;
  
        function doCallback(err) {
          assert(FS.syncFSRequests > 0);
          FS.syncFSRequests--;
          return callback(err);
        }
  
        function done(err) {
          if (err) {
            if (!done.errored) {
              done.errored = true;
              return doCallback(err);
            }
            return;
          }
          if (++completed >= mounts.length) {
            doCallback(null);
          }
        };
  
        // sync all mounts
        mounts.forEach(function (mount) {
          if (!mount.type.syncfs) {
            return done(null);
          }
          mount.type.syncfs(mount, populate, done);
        });
      },mount:function (type, opts, mountpoint) {
        var root = mountpoint === '/';
        var pseudo = !mountpoint;
        var node;
  
        if (root && FS.root) {
          throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
        } else if (!root && !pseudo) {
          var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
  
          mountpoint = lookup.path;  // use the absolute path
          node = lookup.node;
  
          if (FS.isMountpoint(node)) {
            throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
          }
  
          if (!FS.isDir(node.mode)) {
            throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
          }
        }
  
        var mount = {
          type: type,
          opts: opts,
          mountpoint: mountpoint,
          mounts: []
        };
  
        // create a root node for the fs
        var mountRoot = type.mount(mount);
        mountRoot.mount = mount;
        mount.root = mountRoot;
  
        if (root) {
          FS.root = mountRoot;
        } else if (node) {
          // set as a mountpoint
          node.mounted = mount;
  
          // add the new mount to the current mount's children
          if (node.mount) {
            node.mount.mounts.push(mount);
          }
        }
  
        return mountRoot;
      },unmount:function (mountpoint) {
        var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
  
        if (!FS.isMountpoint(lookup.node)) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
  
        // destroy the nodes for this mount, and all its child mounts
        var node = lookup.node;
        var mount = node.mounted;
        var mounts = FS.getMounts(mount);
  
        Object.keys(FS.nameTable).forEach(function (hash) {
          var current = FS.nameTable[hash];
  
          while (current) {
            var next = current.name_next;
  
            if (mounts.indexOf(current.mount) !== -1) {
              FS.destroyNode(current);
            }
  
            current = next;
          }
        });
  
        // no longer a mountpoint
        node.mounted = null;
  
        // remove this mount from the child mounts
        var idx = node.mount.mounts.indexOf(mount);
        assert(idx !== -1);
        node.mount.mounts.splice(idx, 1);
      },lookup:function (parent, name) {
        return parent.node_ops.lookup(parent, name);
      },mknod:function (path, mode, dev) {
        var lookup = FS.lookupPath(path, { parent: true });
        var parent = lookup.node;
        var name = PATH.basename(path);
        if (!name || name === '.' || name === '..') {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        var err = FS.mayCreate(parent, name);
        if (err) {
          throw new FS.ErrnoError(err);
        }
        if (!parent.node_ops.mknod) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        return parent.node_ops.mknod(parent, name, mode, dev);
      },create:function (path, mode) {
        mode = mode !== undefined ? mode : 438 /* 0666 */;
        mode &= 4095;
        mode |= 32768;
        return FS.mknod(path, mode, 0);
      },mkdir:function (path, mode) {
        mode = mode !== undefined ? mode : 511 /* 0777 */;
        mode &= 511 | 512;
        mode |= 16384;
        return FS.mknod(path, mode, 0);
      },mkdirTree:function (path, mode) {
        var dirs = path.split('/');
        var d = '';
        for (var i = 0; i < dirs.length; ++i) {
          if (!dirs[i]) continue;
          d += '/' + dirs[i];
          try {
            FS.mkdir(d, mode);
          } catch(e) {
            if (e.errno != ERRNO_CODES.EEXIST) throw e;
          }
        }
      },mkdev:function (path, mode, dev) {
        if (typeof(dev) === 'undefined') {
          dev = mode;
          mode = 438 /* 0666 */;
        }
        mode |= 8192;
        return FS.mknod(path, mode, dev);
      },symlink:function (oldpath, newpath) {
        if (!PATH.resolve(oldpath)) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        }
        var lookup = FS.lookupPath(newpath, { parent: true });
        var parent = lookup.node;
        if (!parent) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        }
        var newname = PATH.basename(newpath);
        var err = FS.mayCreate(parent, newname);
        if (err) {
          throw new FS.ErrnoError(err);
        }
        if (!parent.node_ops.symlink) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        return parent.node_ops.symlink(parent, newname, oldpath);
      },rename:function (old_path, new_path) {
        var old_dirname = PATH.dirname(old_path);
        var new_dirname = PATH.dirname(new_path);
        var old_name = PATH.basename(old_path);
        var new_name = PATH.basename(new_path);
        // parents must exist
        var lookup, old_dir, new_dir;
        try {
          lookup = FS.lookupPath(old_path, { parent: true });
          old_dir = lookup.node;
          lookup = FS.lookupPath(new_path, { parent: true });
          new_dir = lookup.node;
        } catch (e) {
          throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
        }
        if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        // need to be part of the same mount
        if (old_dir.mount !== new_dir.mount) {
          throw new FS.ErrnoError(ERRNO_CODES.EXDEV);
        }
        // source must exist
        var old_node = FS.lookupNode(old_dir, old_name);
        // old path should not be an ancestor of the new path
        var relative = PATH.relative(old_path, new_dirname);
        if (relative.charAt(0) !== '.') {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        // new path should not be an ancestor of the old path
        relative = PATH.relative(new_path, old_dirname);
        if (relative.charAt(0) !== '.') {
          throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
        }
        // see if the new path already exists
        var new_node;
        try {
          new_node = FS.lookupNode(new_dir, new_name);
        } catch (e) {
          // not fatal
        }
        // early out if nothing needs to change
        if (old_node === new_node) {
          return;
        }
        // we'll need to delete the old entry
        var isdir = FS.isDir(old_node.mode);
        var err = FS.mayDelete(old_dir, old_name, isdir);
        if (err) {
          throw new FS.ErrnoError(err);
        }
        // need delete permissions if we'll be overwriting.
        // need create permissions if new doesn't already exist.
        err = new_node ?
          FS.mayDelete(new_dir, new_name, isdir) :
          FS.mayCreate(new_dir, new_name);
        if (err) {
          throw new FS.ErrnoError(err);
        }
        if (!old_dir.node_ops.rename) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) {
          throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
        }
        // if we are going to change the parent, check write permissions
        if (new_dir !== old_dir) {
          err = FS.nodePermissions(old_dir, 'w');
          if (err) {
            throw new FS.ErrnoError(err);
          }
        }
        try {
          if (FS.trackingDelegate['willMovePath']) {
            FS.trackingDelegate['willMovePath'](old_path, new_path);
          }
        } catch(e) {
          console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
        }
        // remove the node from the lookup hash
        FS.hashRemoveNode(old_node);
        // do the underlying fs rename
        try {
          old_dir.node_ops.rename(old_node, new_dir, new_name);
        } catch (e) {
          throw e;
        } finally {
          // add the node back to the hash (in case node_ops.rename
          // changed its name)
          FS.hashAddNode(old_node);
        }
        try {
          if (FS.trackingDelegate['onMovePath']) FS.trackingDelegate['onMovePath'](old_path, new_path);
        } catch(e) {
          console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
        }
      },rmdir:function (path) {
        var lookup = FS.lookupPath(path, { parent: true });
        var parent = lookup.node;
        var name = PATH.basename(path);
        var node = FS.lookupNode(parent, name);
        var err = FS.mayDelete(parent, name, true);
        if (err) {
          throw new FS.ErrnoError(err);
        }
        if (!parent.node_ops.rmdir) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        if (FS.isMountpoint(node)) {
          throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
        }
        try {
          if (FS.trackingDelegate['willDeletePath']) {
            FS.trackingDelegate['willDeletePath'](path);
          }
        } catch(e) {
          console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
        }
        parent.node_ops.rmdir(parent, name);
        FS.destroyNode(node);
        try {
          if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
        } catch(e) {
          console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
        }
      },readdir:function (path) {
        var lookup = FS.lookupPath(path, { follow: true });
        var node = lookup.node;
        if (!node.node_ops.readdir) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
        }
        return node.node_ops.readdir(node);
      },unlink:function (path) {
        var lookup = FS.lookupPath(path, { parent: true });
        var parent = lookup.node;
        var name = PATH.basename(path);
        var node = FS.lookupNode(parent, name);
        var err = FS.mayDelete(parent, name, false);
        if (err) {
          // According to POSIX, we should map EISDIR to EPERM, but
          // we instead do what Linux does (and we must, as we use
          // the musl linux libc).
          throw new FS.ErrnoError(err);
        }
        if (!parent.node_ops.unlink) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        if (FS.isMountpoint(node)) {
          throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
        }
        try {
          if (FS.trackingDelegate['willDeletePath']) {
            FS.trackingDelegate['willDeletePath'](path);
          }
        } catch(e) {
          console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
        }
        parent.node_ops.unlink(parent, name);
        FS.destroyNode(node);
        try {
          if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
        } catch(e) {
          console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
        }
      },readlink:function (path) {
        var lookup = FS.lookupPath(path);
        var link = lookup.node;
        if (!link) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        }
        if (!link.node_ops.readlink) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link));
      },stat:function (path, dontFollow) {
        var lookup = FS.lookupPath(path, { follow: !dontFollow });
        var node = lookup.node;
        if (!node) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        }
        if (!node.node_ops.getattr) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        return node.node_ops.getattr(node);
      },lstat:function (path) {
        return FS.stat(path, true);
      },chmod:function (path, mode, dontFollow) {
        var node;
        if (typeof path === 'string') {
          var lookup = FS.lookupPath(path, { follow: !dontFollow });
          node = lookup.node;
        } else {
          node = path;
        }
        if (!node.node_ops.setattr) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        node.node_ops.setattr(node, {
          mode: (mode & 4095) | (node.mode & ~4095),
          timestamp: Date.now()
        });
      },lchmod:function (path, mode) {
        FS.chmod(path, mode, true);
      },fchmod:function (fd, mode) {
        var stream = FS.getStream(fd);
        if (!stream) {
          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        }
        FS.chmod(stream.node, mode);
      },chown:function (path, uid, gid, dontFollow) {
        var node;
        if (typeof path === 'string') {
          var lookup = FS.lookupPath(path, { follow: !dontFollow });
          node = lookup.node;
        } else {
          node = path;
        }
        if (!node.node_ops.setattr) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        node.node_ops.setattr(node, {
          timestamp: Date.now()
          // we ignore the uid / gid for now
        });
      },lchown:function (path, uid, gid) {
        FS.chown(path, uid, gid, true);
      },fchown:function (fd, uid, gid) {
        var stream = FS.getStream(fd);
        if (!stream) {
          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        }
        FS.chown(stream.node, uid, gid);
      },truncate:function (path, len) {
        if (len < 0) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        var node;
        if (typeof path === 'string') {
          var lookup = FS.lookupPath(path, { follow: true });
          node = lookup.node;
        } else {
          node = path;
        }
        if (!node.node_ops.setattr) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        if (FS.isDir(node.mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
        }
        if (!FS.isFile(node.mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        var err = FS.nodePermissions(node, 'w');
        if (err) {
          throw new FS.ErrnoError(err);
        }
        node.node_ops.setattr(node, {
          size: len,
          timestamp: Date.now()
        });
      },ftruncate:function (fd, len) {
        var stream = FS.getStream(fd);
        if (!stream) {
          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        }
        if ((stream.flags & 2097155) === 0) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        FS.truncate(stream.node, len);
      },utime:function (path, atime, mtime) {
        var lookup = FS.lookupPath(path, { follow: true });
        var node = lookup.node;
        node.node_ops.setattr(node, {
          timestamp: Math.max(atime, mtime)
        });
      },open:function (path, flags, mode, fd_start, fd_end) {
        if (path === "") {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        }
        flags = typeof flags === 'string' ? FS.modeStringToFlags(flags) : flags;
        mode = typeof mode === 'undefined' ? 438 /* 0666 */ : mode;
        if ((flags & 64)) {
          mode = (mode & 4095) | 32768;
        } else {
          mode = 0;
        }
        var node;
        if (typeof path === 'object') {
          node = path;
        } else {
          path = PATH.normalize(path);
          try {
            var lookup = FS.lookupPath(path, {
              follow: !(flags & 131072)
            });
            node = lookup.node;
          } catch (e) {
            // ignore
          }
        }
        // perhaps we need to create the node
        var created = false;
        if ((flags & 64)) {
          if (node) {
            // if O_CREAT and O_EXCL are set, error out if the node already exists
            if ((flags & 128)) {
              throw new FS.ErrnoError(ERRNO_CODES.EEXIST);
            }
          } else {
            // node doesn't exist, try to create it
            node = FS.mknod(path, mode, 0);
            created = true;
          }
        }
        if (!node) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        }
        // can't truncate a device
        if (FS.isChrdev(node.mode)) {
          flags &= ~512;
        }
        // if asked only for a directory, then this must be one
        if ((flags & 65536) && !FS.isDir(node.mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
        }
        // check permissions, if this is not a file we just created now (it is ok to
        // create and write to a file with read-only permissions; it is read-only
        // for later use)
        if (!created) {
          var err = FS.mayOpen(node, flags);
          if (err) {
            throw new FS.ErrnoError(err);
          }
        }
        // do truncation if necessary
        if ((flags & 512)) {
          FS.truncate(node, 0);
        }
        // we've already handled these, don't pass down to the underlying vfs
        flags &= ~(128 | 512);
  
        // register the stream with the filesystem
        var stream = FS.createStream({
          node: node,
          path: FS.getPath(node),  // we want the absolute path to the node
          flags: flags,
          seekable: true,
          position: 0,
          stream_ops: node.stream_ops,
          // used by the file family libc calls (fopen, fwrite, ferror, etc.)
          ungotten: [],
          error: false
        }, fd_start, fd_end);
        // call the new stream's open function
        if (stream.stream_ops.open) {
          stream.stream_ops.open(stream);
        }
        if (Module['logReadFiles'] && !(flags & 1)) {
          if (!FS.readFiles) FS.readFiles = {};
          if (!(path in FS.readFiles)) {
            FS.readFiles[path] = 1;
            Module['printErr']('read file: ' + path);
          }
        }
        try {
          if (FS.trackingDelegate['onOpenFile']) {
            var trackingFlags = 0;
            if ((flags & 2097155) !== 1) {
              trackingFlags |= FS.tracking.openFlags.READ;
            }
            if ((flags & 2097155) !== 0) {
              trackingFlags |= FS.tracking.openFlags.WRITE;
            }
            FS.trackingDelegate['onOpenFile'](path, trackingFlags);
          }
        } catch(e) {
          console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: " + e.message);
        }
        return stream;
      },close:function (stream) {
        if (stream.getdents) stream.getdents = null; // free readdir state
        try {
          if (stream.stream_ops.close) {
            stream.stream_ops.close(stream);
          }
        } catch (e) {
          throw e;
        } finally {
          FS.closeStream(stream.fd);
        }
      },llseek:function (stream, offset, whence) {
        if (!stream.seekable || !stream.stream_ops.llseek) {
          throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
        }
        stream.position = stream.stream_ops.llseek(stream, offset, whence);
        stream.ungotten = [];
        return stream.position;
      },read:function (stream, buffer, offset, length, position) {
        if (length < 0 || position < 0) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        if ((stream.flags & 2097155) === 1) {
          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        }
        if (FS.isDir(stream.node.mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
        }
        if (!stream.stream_ops.read) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        var seeking = true;
        if (typeof position === 'undefined') {
          position = stream.position;
          seeking = false;
        } else if (!stream.seekable) {
          throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
        }
        var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
        if (!seeking) stream.position += bytesRead;
        return bytesRead;
      },write:function (stream, buffer, offset, length, position, canOwn) {
        if (length < 0 || position < 0) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        if ((stream.flags & 2097155) === 0) {
          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        }
        if (FS.isDir(stream.node.mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
        }
        if (!stream.stream_ops.write) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        if (stream.flags & 1024) {
          // seek to the end before writing in append mode
          FS.llseek(stream, 0, 2);
        }
        var seeking = true;
        if (typeof position === 'undefined') {
          position = stream.position;
          seeking = false;
        } else if (!stream.seekable) {
          throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
        }
        var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
        if (!seeking) stream.position += bytesWritten;
        try {
          if (stream.path && FS.trackingDelegate['onWriteToFile']) FS.trackingDelegate['onWriteToFile'](stream.path);
        } catch(e) {
          console.log("FS.trackingDelegate['onWriteToFile']('"+path+"') threw an exception: " + e.message);
        }
        return bytesWritten;
      },allocate:function (stream, offset, length) {
        if (offset < 0 || length <= 0) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        if ((stream.flags & 2097155) === 0) {
          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        }
        if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
        }
        if (!stream.stream_ops.allocate) {
          throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP);
        }
        stream.stream_ops.allocate(stream, offset, length);
      },mmap:function (stream, buffer, offset, length, position, prot, flags) {
        // TODO if PROT is PROT_WRITE, make sure we have write access
        if ((stream.flags & 2097155) === 1) {
          throw new FS.ErrnoError(ERRNO_CODES.EACCES);
        }
        if (!stream.stream_ops.mmap) {
          throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
        }
        return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags);
      },msync:function (stream, buffer, offset, length, mmapFlags) {
        if (!stream || !stream.stream_ops.msync) {
          return 0;
        }
        return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags);
      },munmap:function (stream) {
        return 0;
      },ioctl:function (stream, cmd, arg) {
        if (!stream.stream_ops.ioctl) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOTTY);
        }
        return stream.stream_ops.ioctl(stream, cmd, arg);
      },readFile:function (path, opts) {
        opts = opts || {};
        opts.flags = opts.flags || 'r';
        opts.encoding = opts.encoding || 'binary';
        if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
          throw new Error('Invalid encoding type "' + opts.encoding + '"');
        }
        var ret;
        var stream = FS.open(path, opts.flags);
        var stat = FS.stat(path);
        var length = stat.size;
        var buf = new Uint8Array(length);
        FS.read(stream, buf, 0, length, 0);
        if (opts.encoding === 'utf8') {
          ret = UTF8ArrayToString(buf, 0);
        } else if (opts.encoding === 'binary') {
          ret = buf;
        }
        FS.close(stream);
        return ret;
      },writeFile:function (path, data, opts) {
        opts = opts || {};
        opts.flags = opts.flags || 'w';
        opts.encoding = opts.encoding || 'utf8';
        if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
          throw new Error('Invalid encoding type "' + opts.encoding + '"');
        }
        var stream = FS.open(path, opts.flags, opts.mode);
        if (opts.encoding === 'utf8') {
          var buf = new Uint8Array(lengthBytesUTF8(data)+1);
          var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
          FS.write(stream, buf, 0, actualNumBytes, 0, opts.canOwn);
        } else if (opts.encoding === 'binary') {
          FS.write(stream, data, 0, data.length, 0, opts.canOwn);
        }
        FS.close(stream);
      },cwd:function () {
        return FS.currentPath;
      },chdir:function (path) {
        var lookup = FS.lookupPath(path, { follow: true });
        if (lookup.node === null) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        }
        if (!FS.isDir(lookup.node.mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
        }
        var err = FS.nodePermissions(lookup.node, 'x');
        if (err) {
          throw new FS.ErrnoError(err);
        }
        FS.currentPath = lookup.path;
      },createDefaultDirectories:function () {
        FS.mkdir('/tmp');
        FS.mkdir('/home');
        FS.mkdir('/home/web_user');
      },createDefaultDevices:function () {
        // create /dev
        FS.mkdir('/dev');
        // setup /dev/null
        FS.registerDevice(FS.makedev(1, 3), {
          read: function() { return 0; },
          write: function(stream, buffer, offset, length, pos) { return length; }
        });
        FS.mkdev('/dev/null', FS.makedev(1, 3));
        // setup /dev/tty and /dev/tty1
        // stderr needs to print output using Module['printErr']
        // so we register a second tty just for it.
        TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
        TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
        FS.mkdev('/dev/tty', FS.makedev(5, 0));
        FS.mkdev('/dev/tty1', FS.makedev(6, 0));
        // setup /dev/[u]random
        var random_device;
        if (typeof crypto !== 'undefined') {
          // for modern web browsers
          var randomBuffer = new Uint8Array(1);
          random_device = function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; };
        } else if (ENVIRONMENT_IS_NODE) {
          // for nodejs
          random_device = function() { return require('crypto').randomBytes(1)[0]; };
        } else {
          // default for ES5 platforms
          random_device = function() { return (Math.random()*256)|0; };
        }
        FS.createDevice('/dev', 'random', random_device);
        FS.createDevice('/dev', 'urandom', random_device);
        // we're not going to emulate the actual shm device,
        // just create the tmp dirs that reside in it commonly
        FS.mkdir('/dev/shm');
        FS.mkdir('/dev/shm/tmp');
      },createSpecialDirectories:function () {
        // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the name of the stream for fd 6 (see test_unistd_ttyname)
        FS.mkdir('/proc');
        FS.mkdir('/proc/self');
        FS.mkdir('/proc/self/fd');
        FS.mount({
          mount: function() {
            var node = FS.createNode('/proc/self', 'fd', 16384 | 511 /* 0777 */, 73);
            node.node_ops = {
              lookup: function(parent, name) {
                var fd = +name;
                var stream = FS.getStream(fd);
                if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
                var ret = {
                  parent: null,
                  mount: { mountpoint: 'fake' },
                  node_ops: { readlink: function() { return stream.path } }
                };
                ret.parent = ret; // make it look like a simple root node
                return ret;
              }
            };
            return node;
          }
        }, {}, '/proc/self/fd');
      },createStandardStreams:function () {
        // TODO deprecate the old functionality of a single
        // input / output callback and that utilizes FS.createDevice
        // and instead require a unique set of stream ops
  
        // by default, we symlink the standard streams to the
        // default tty devices. however, if the standard streams
        // have been overwritten we create a unique device for
        // them instead.
        if (Module['stdin']) {
          FS.createDevice('/dev', 'stdin', Module['stdin']);
        } else {
          FS.symlink('/dev/tty', '/dev/stdin');
        }
        if (Module['stdout']) {
          FS.createDevice('/dev', 'stdout', null, Module['stdout']);
        } else {
          FS.symlink('/dev/tty', '/dev/stdout');
        }
        if (Module['stderr']) {
          FS.createDevice('/dev', 'stderr', null, Module['stderr']);
        } else {
          FS.symlink('/dev/tty1', '/dev/stderr');
        }
  
        // open default streams for the stdin, stdout and stderr devices
        var stdin = FS.open('/dev/stdin', 'r');
        assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')');
  
        var stdout = FS.open('/dev/stdout', 'w');
        assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')');
  
        var stderr = FS.open('/dev/stderr', 'w');
        assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')');
      },ensureErrnoError:function () {
        if (FS.ErrnoError) return;
        FS.ErrnoError = function ErrnoError(errno, node) {
          //Module.printErr(stackTrace()); // useful for debugging
          this.node = node;
          this.setErrno = function(errno) {
            this.errno = errno;
            for (var key in ERRNO_CODES) {
              if (ERRNO_CODES[key] === errno) {
                this.code = key;
                break;
              }
            }
          };
          this.setErrno(errno);
          this.message = ERRNO_MESSAGES[errno];
          if (this.stack) this.stack = demangleAll(this.stack);
        };
        FS.ErrnoError.prototype = new Error();
        FS.ErrnoError.prototype.constructor = FS.ErrnoError;
        // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info)
        [ERRNO_CODES.ENOENT].forEach(function(code) {
          FS.genericErrors[code] = new FS.ErrnoError(code);
          FS.genericErrors[code].stack = '<generic error, no stack>';
        });
      },staticInit:function () {
        FS.ensureErrnoError();
  
        FS.nameTable = new Array(4096);
  
        FS.mount(MEMFS, {}, '/');
  
        FS.createDefaultDirectories();
        FS.createDefaultDevices();
        FS.createSpecialDirectories();
  
        FS.filesystems = {
          'MEMFS': MEMFS,
          'IDBFS': IDBFS,
          'NODEFS': NODEFS,
          'WORKERFS': WORKERFS,
        };
      },init:function (input, output, error) {
        assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)');
        FS.init.initialized = true;
  
        FS.ensureErrnoError();
  
        // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here
        Module['stdin'] = input || Module['stdin'];
        Module['stdout'] = output || Module['stdout'];
        Module['stderr'] = error || Module['stderr'];
  
        FS.createStandardStreams();
      },quit:function () {
        FS.init.initialized = false;
        // force-flush all streams, so we get musl std streams printed out
        var fflush = Module['_fflush'];
        if (fflush) fflush(0);
        // close all of our streams
        for (var i = 0; i < FS.streams.length; i++) {
          var stream = FS.streams[i];
          if (!stream) {
            continue;
          }
          FS.close(stream);
        }
      },getMode:function (canRead, canWrite) {
        var mode = 0;
        if (canRead) mode |= 292 | 73;
        if (canWrite) mode |= 146;
        return mode;
      },joinPath:function (parts, forceRelative) {
        var path = PATH.join.apply(null, parts);
        if (forceRelative && path[0] == '/') path = path.substr(1);
        return path;
      },absolutePath:function (relative, base) {
        return PATH.resolve(base, relative);
      },standardizePath:function (path) {
        return PATH.normalize(path);
      },findObject:function (path, dontResolveLastLink) {
        var ret = FS.analyzePath(path, dontResolveLastLink);
        if (ret.exists) {
          return ret.object;
        } else {
          ___setErrNo(ret.error);
          return null;
        }
      },analyzePath:function (path, dontResolveLastLink) {
        // operate from within the context of the symlink's target
        try {
          var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
          path = lookup.path;
        } catch (e) {
        }
        var ret = {
          isRoot: false, exists: false, error: 0, name: null, path: null, object: null,
          parentExists: false, parentPath: null, parentObject: null
        };
        try {
          var lookup = FS.lookupPath(path, { parent: true });
          ret.parentExists = true;
          ret.parentPath = lookup.path;
          ret.parentObject = lookup.node;
          ret.name = PATH.basename(path);
          lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
          ret.exists = true;
          ret.path = lookup.path;
          ret.object = lookup.node;
          ret.name = lookup.node.name;
          ret.isRoot = lookup.path === '/';
        } catch (e) {
          ret.error = e.errno;
        };
        return ret;
      },createFolder:function (parent, name, canRead, canWrite) {
        var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
        var mode = FS.getMode(canRead, canWrite);
        return FS.mkdir(path, mode);
      },createPath:function (parent, path, canRead, canWrite) {
        parent = typeof parent === 'string' ? parent : FS.getPath(parent);
        var parts = path.split('/').reverse();
        while (parts.length) {
          var part = parts.pop();
          if (!part) continue;
          var current = PATH.join2(parent, part);
          try {
            FS.mkdir(current);
          } catch (e) {
            // ignore EEXIST
          }
          parent = current;
        }
        return current;
      },createFile:function (parent, name, properties, canRead, canWrite) {
        var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
        var mode = FS.getMode(canRead, canWrite);
        return FS.create(path, mode);
      },createDataFile:function (parent, name, data, canRead, canWrite, canOwn) {
        var path = name ? PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name) : parent;
        var mode = FS.getMode(canRead, canWrite);
        var node = FS.create(path, mode);
        if (data) {
          if (typeof data === 'string') {
            var arr = new Array(data.length);
            for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
            data = arr;
          }
          // make sure we can write to the file
          FS.chmod(node, mode | 146);
          var stream = FS.open(node, 'w');
          FS.write(stream, data, 0, data.length, 0, canOwn);
          FS.close(stream);
          FS.chmod(node, mode);
        }
        return node;
      },createDevice:function (parent, name, input, output) {
        var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
        var mode = FS.getMode(!!input, !!output);
        if (!FS.createDevice.major) FS.createDevice.major = 64;
        var dev = FS.makedev(FS.createDevice.major++, 0);
        // Create a fake device that a set of stream ops to emulate
        // the old behavior.
        FS.registerDevice(dev, {
          open: function(stream) {
            stream.seekable = false;
          },
          close: function(stream) {
            // flush any pending line data
            if (output && output.buffer && output.buffer.length) {
              output(10);
            }
          },
          read: function(stream, buffer, offset, length, pos /* ignored */) {
            var bytesRead = 0;
            for (var i = 0; i < length; i++) {
              var result;
              try {
                result = input();
              } catch (e) {
                throw new FS.ErrnoError(ERRNO_CODES.EIO);
              }
              if (result === undefined && bytesRead === 0) {
                throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
              }
              if (result === null || result === undefined) break;
              bytesRead++;
              buffer[offset+i] = result;
            }
            if (bytesRead) {
              stream.node.timestamp = Date.now();
            }
            return bytesRead;
          },
          write: function(stream, buffer, offset, length, pos) {
            for (var i = 0; i < length; i++) {
              try {
                output(buffer[offset+i]);
              } catch (e) {
                throw new FS.ErrnoError(ERRNO_CODES.EIO);
              }
            }
            if (length) {
              stream.node.timestamp = Date.now();
            }
            return i;
          }
        });
        return FS.mkdev(path, mode, dev);
      },createLink:function (parent, name, target, canRead, canWrite) {
        var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
        return FS.symlink(target, path);
      },forceLoadFile:function (obj) {
        if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
        var success = true;
        if (typeof XMLHttpRequest !== 'undefined') {
          throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.");
        } else if (Module['read']) {
          // Command-line.
          try {
            // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as
            //          read() will try to parse UTF8.
            obj.contents = intArrayFromString(Module['read'](obj.url), true);
            obj.usedBytes = obj.contents.length;
          } catch (e) {
            success = false;
          }
        } else {
          throw new Error('Cannot load without read() or XMLHttpRequest.');
        }
        if (!success) ___setErrNo(ERRNO_CODES.EIO);
        return success;
      },createLazyFile:function (parent, name, url, canRead, canWrite) {
        // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse.
        function LazyUint8Array() {
          this.lengthKnown = false;
          this.chunks = []; // Loaded chunks. Index is the chunk number
        }
        LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) {
          if (idx > this.length-1 || idx < 0) {
            return undefined;
          }
          var chunkOffset = idx % this.chunkSize;
          var chunkNum = (idx / this.chunkSize)|0;
          return this.getter(chunkNum)[chunkOffset];
        }
        LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) {
          this.getter = getter;
        }
        LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() {
          // Find length
          var xhr = new XMLHttpRequest();
          xhr.open('HEAD', url, false);
          xhr.send(null);
          if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
          var datalength = Number(xhr.getResponseHeader("Content-length"));
          var header;
          var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
          var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip";
  
          var chunkSize = 1024*1024; // Chunk size in bytes
  
          if (!hasByteServing) chunkSize = datalength;
  
          // Function to get a range from the remote URL.
          var doXHR = (function(from, to) {
            if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
            if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!");
  
            // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available.
            var xhr = new XMLHttpRequest();
            xhr.open('GET', url, false);
            if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
  
            // Some hints to the browser that we want binary data.
            if (typeof Uint8Array != 'undefined') xhr.responseType = 'arraybuffer';
            if (xhr.overrideMimeType) {
              xhr.overrideMimeType('text/plain; charset=x-user-defined');
            }
  
            xhr.send(null);
            if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
            if (xhr.response !== undefined) {
              return new Uint8Array(xhr.response || []);
            } else {
              return intArrayFromString(xhr.responseText || '', true);
            }
          });
          var lazyArray = this;
          lazyArray.setDataGetter(function(chunkNum) {
            var start = chunkNum * chunkSize;
            var end = (chunkNum+1) * chunkSize - 1; // including this byte
            end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block
            if (typeof(lazyArray.chunks[chunkNum]) === "undefined") {
              lazyArray.chunks[chunkNum] = doXHR(start, end);
            }
            if (typeof(lazyArray.chunks[chunkNum]) === "undefined") throw new Error("doXHR failed!");
            return lazyArray.chunks[chunkNum];
          });
  
          if (usesGzip || !datalength) {
            // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length
            chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file
            datalength = this.getter(0).length;
            chunkSize = datalength;
            console.log("LazyFiles on gzip forces download of the whole file when length is accessed");
          }
  
          this._length = datalength;
          this._chunkSize = chunkSize;
          this.lengthKnown = true;
        }
        if (typeof XMLHttpRequest !== 'undefined') {
          if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc';
          var lazyArray = new LazyUint8Array();
          Object.defineProperties(lazyArray, {
            length: {
              get: function() {
                if(!this.lengthKnown) {
                  this.cacheLength();
                }
                return this._length;
              }
            },
            chunkSize: {
              get: function() {
                if(!this.lengthKnown) {
                  this.cacheLength();
                }
                return this._chunkSize;
              }
            }
          });
  
          var properties = { isDevice: false, contents: lazyArray };
        } else {
          var properties = { isDevice: false, url: url };
        }
  
        var node = FS.createFile(parent, name, properties, canRead, canWrite);
        // This is a total hack, but I want to get this lazy file code out of the
        // core of MEMFS. If we want to keep this lazy file concept I feel it should
        // be its own thin LAZYFS proxying calls to MEMFS.
        if (properties.contents) {
          node.contents = properties.contents;
        } else if (properties.url) {
          node.contents = null;
          node.url = properties.url;
        }
        // Add a function that defers querying the file size until it is asked the first time.
        Object.defineProperties(node, {
          usedBytes: {
            get: function() { return this.contents.length; }
          }
        });
        // override each stream op with one that tries to force load the lazy file first
        var stream_ops = {};
        var keys = Object.keys(node.stream_ops);
        keys.forEach(function(key) {
          var fn = node.stream_ops[key];
          stream_ops[key] = function forceLoadLazyFile() {
            if (!FS.forceLoadFile(node)) {
              throw new FS.ErrnoError(ERRNO_CODES.EIO);
            }
            return fn.apply(null, arguments);
          };
        });
        // use a custom read function
        stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) {
          if (!FS.forceLoadFile(node)) {
            throw new FS.ErrnoError(ERRNO_CODES.EIO);
          }
          var contents = stream.node.contents;
          if (position >= contents.length)
            return 0;
          var size = Math.min(contents.length - position, length);
          assert(size >= 0);
          if (contents.slice) { // normal array
            for (var i = 0; i < size; i++) {
              buffer[offset + i] = contents[position + i];
            }
          } else {
            for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR
              buffer[offset + i] = contents.get(position + i);
            }
          }
          return size;
        };
        node.stream_ops = stream_ops;
        return node;
      },createPreloadedFile:function (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) {
        Browser.init(); // XXX perhaps this method should move onto Browser?
        // TODO we should allow people to just pass in a complete filename instead
        // of parent and name being that we just join them anyways
        var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent;
        var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname
        function processData(byteArray) {
          function finish(byteArray) {
            if (preFinish) preFinish();
            if (!dontCreateFile) {
              FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn);
            }
            if (onload) onload();
            removeRunDependency(dep);
          }
          var handled = false;
          Module['preloadPlugins'].forEach(function(plugin) {
            if (handled) return;
            if (plugin['canHandle'](fullname)) {
              plugin['handle'](byteArray, fullname, finish, function() {
                if (onerror) onerror();
                removeRunDependency(dep);
              });
              handled = true;
            }
          });
          if (!handled) finish(byteArray);
        }
        addRunDependency(dep);
        if (typeof url == 'string') {
          Browser.asyncLoad(url, function(byteArray) {
            processData(byteArray);
          }, onerror);
        } else {
          processData(url);
        }
      },indexedDB:function () {
        return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
      },DB_NAME:function () {
        return 'EM_FS_' + window.location.pathname;
      },DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function (paths, onload, onerror) {
        onload = onload || function(){};
        onerror = onerror || function(){};
        var indexedDB = FS.indexedDB();
        try {
          var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
        } catch (e) {
          return onerror(e);
        }
        openRequest.onupgradeneeded = function openRequest_onupgradeneeded() {
          console.log('creating db');
          var db = openRequest.result;
          db.createObjectStore(FS.DB_STORE_NAME);
        };
        openRequest.onsuccess = function openRequest_onsuccess() {
          var db = openRequest.result;
          var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite');
          var files = transaction.objectStore(FS.DB_STORE_NAME);
          var ok = 0, fail = 0, total = paths.length;
          function finish() {
            if (fail == 0) onload(); else onerror();
          }
          paths.forEach(function(path) {
            var putRequest = files.put(FS.analyzePath(path).object.contents, path);
            putRequest.onsuccess = function putRequest_onsuccess() { ok++; if (ok + fail == total) finish() };
            putRequest.onerror = function putRequest_onerror() { fail++; if (ok + fail == total) finish() };
          });
          transaction.onerror = onerror;
        };
        openRequest.onerror = onerror;
      },loadFilesFromDB:function (paths, onload, onerror) {
        onload = onload || function(){};
        onerror = onerror || function(){};
        var indexedDB = FS.indexedDB();
        try {
          var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
        } catch (e) {
          return onerror(e);
        }
        openRequest.onupgradeneeded = onerror; // no database to load from
        openRequest.onsuccess = function openRequest_onsuccess() {
          var db = openRequest.result;
          try {
            var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly');
          } catch(e) {
            onerror(e);
            return;
          }
          var files = transaction.objectStore(FS.DB_STORE_NAME);
          var ok = 0, fail = 0, total = paths.length;
          function finish() {
            if (fail == 0) onload(); else onerror();
          }
          paths.forEach(function(path) {
            var getRequest = files.get(path);
            getRequest.onsuccess = function getRequest_onsuccess() {
              if (FS.analyzePath(path).exists) {
                FS.unlink(path);
              }
              FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true);
              ok++;
              if (ok + fail == total) finish();
            };
            getRequest.onerror = function getRequest_onerror() { fail++; if (ok + fail == total) finish() };
          });
          transaction.onerror = onerror;
        };
        openRequest.onerror = onerror;
      }};var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function (dirfd, path) {
        if (path[0] !== '/') {
          // relative path
          var dir;
          if (dirfd === -100) {
            dir = FS.cwd();
          } else {
            var dirstream = FS.getStream(dirfd);
            if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
            dir = dirstream.path;
          }
          path = PATH.join2(dir, path);
        }
        return path;
      },doStat:function (func, path, buf) {
        try {
          var stat = func(path);
        } catch (e) {
          if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) {
            // an error occurred while trying to look up the path; we should just report ENOTDIR
            return -ERRNO_CODES.ENOTDIR;
          }
          throw e;
        }
        HEAP32[((buf)>>2)]=stat.dev;
        HEAP32[(((buf)+(4))>>2)]=0;
        HEAP32[(((buf)+(8))>>2)]=stat.ino;
        HEAP32[(((buf)+(12))>>2)]=stat.mode;
        HEAP32[(((buf)+(16))>>2)]=stat.nlink;
        HEAP32[(((buf)+(20))>>2)]=stat.uid;
        HEAP32[(((buf)+(24))>>2)]=stat.gid;
        HEAP32[(((buf)+(28))>>2)]=stat.rdev;
        HEAP32[(((buf)+(32))>>2)]=0;
        HEAP32[(((buf)+(36))>>2)]=stat.size;
        HEAP32[(((buf)+(40))>>2)]=4096;
        HEAP32[(((buf)+(44))>>2)]=stat.blocks;
        HEAP32[(((buf)+(48))>>2)]=(stat.atime.getTime() / 1000)|0;
        HEAP32[(((buf)+(52))>>2)]=0;
        HEAP32[(((buf)+(56))>>2)]=(stat.mtime.getTime() / 1000)|0;
        HEAP32[(((buf)+(60))>>2)]=0;
        HEAP32[(((buf)+(64))>>2)]=(stat.ctime.getTime() / 1000)|0;
        HEAP32[(((buf)+(68))>>2)]=0;
        HEAP32[(((buf)+(72))>>2)]=stat.ino;
        return 0;
      },doMsync:function (addr, stream, len, flags) {
        var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len));
        FS.msync(stream, buffer, 0, len, flags);
      },doMkdir:function (path, mode) {
        // remove a trailing slash, if one - /a/b/ has basename of '', but
        // we want to create b in the context of this function
        path = PATH.normalize(path);
        if (path[path.length-1] === '/') path = path.substr(0, path.length-1);
        FS.mkdir(path, mode, 0);
        return 0;
      },doMknod:function (path, mode, dev) {
        // we don't want this in the JS API as it uses mknod to create all nodes.
        switch (mode & 61440) {
          case 32768:
          case 8192:
          case 24576:
          case 4096:
          case 49152:
            break;
          default: return -ERRNO_CODES.EINVAL;
        }
        FS.mknod(path, mode, dev);
        return 0;
      },doReadlink:function (path, buf, bufsize) {
        if (bufsize <= 0) return -ERRNO_CODES.EINVAL;
        var ret = FS.readlink(path);
  
        var len = Math.min(bufsize, lengthBytesUTF8(ret));
        var endChar = HEAP8[buf+len];
        stringToUTF8(ret, buf, bufsize+1);
        // readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!)
        // stringToUTF8() always appends a null byte, so restore the character under the null byte after the write.
        HEAP8[buf+len] = endChar;
  
        return len;
      },doAccess:function (path, amode) {
        if (amode & ~7) {
          // need a valid mode
          return -ERRNO_CODES.EINVAL;
        }
        var node;
        var lookup = FS.lookupPath(path, { follow: true });
        node = lookup.node;
        var perms = '';
        if (amode & 4) perms += 'r';
        if (amode & 2) perms += 'w';
        if (amode & 1) perms += 'x';
        if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) {
          return -ERRNO_CODES.EACCES;
        }
        return 0;
      },doDup:function (path, flags, suggestFD) {
        var suggest = FS.getStream(suggestFD);
        if (suggest) FS.close(suggest);
        return FS.open(path, flags, 0, suggestFD, suggestFD).fd;
      },doReadv:function (stream, iov, iovcnt, offset) {
        var ret = 0;
        for (var i = 0; i < iovcnt; i++) {
          var ptr = HEAP32[(((iov)+(i*8))>>2)];
          var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
          var curr = FS.read(stream, HEAP8,ptr, len, offset);
          if (curr < 0) return -1;
          ret += curr;
          if (curr < len) break; // nothing more to read
        }
        return ret;
      },doWritev:function (stream, iov, iovcnt, offset) {
        var ret = 0;
        for (var i = 0; i < iovcnt; i++) {
          var ptr = HEAP32[(((iov)+(i*8))>>2)];
          var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
          var curr = FS.write(stream, HEAP8,ptr, len, offset);
          if (curr < 0) return -1;
          ret += curr;
        }
        return ret;
      },varargs:0,get:function (varargs) {
        SYSCALLS.varargs += 4;
        var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)];
        return ret;
      },getStr:function () {
        var ret = Pointer_stringify(SYSCALLS.get());
        return ret;
      },getStreamFromFD:function () {
        var stream = FS.getStream(SYSCALLS.get());
        if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        return stream;
      },getSocketFromFD:function () {
        var socket = SOCKFS.getSocket(SYSCALLS.get());
        if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        return socket;
      },getSocketAddress:function (allowNull) {
        var addrp = SYSCALLS.get(), addrlen = SYSCALLS.get();
        if (allowNull && addrp === 0) return null;
        var info = __read_sockaddr(addrp, addrlen);
        if (info.errno) throw new FS.ErrnoError(info.errno);
        info.addr = DNS.lookup_addr(info.addr) || info.addr;
        return info;
      },get64:function () {
        var low = SYSCALLS.get(), high = SYSCALLS.get();
        if (low >= 0) assert(high === 0);
        else assert(high === -1);
        return low;
      },getZero:function () {
        assert(SYSCALLS.get() === 0);
      }};function ___syscall5(which, varargs) {SYSCALLS.varargs = varargs;
  try {
   // open
      var pathname = SYSCALLS.getStr(), flags = SYSCALLS.get(), mode = SYSCALLS.get() // optional TODO
      var stream = FS.open(pathname, flags, mode);
      return stream.fd;
    } catch (e) {
    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
    return -e.errno;
  }
  }

  function ___lock() {}

  function ___unlock() {}

  function ___syscall6(which, varargs) {SYSCALLS.varargs = varargs;
  try {
   // close
      var stream = SYSCALLS.getStreamFromFD();
      FS.close(stream);
      return 0;
    } catch (e) {
    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
    return -e.errno;
  }
  }

  function _usleep(useconds) {
      // int usleep(useconds_t useconds);
      // http://pubs.opengroup.org/onlinepubs/000095399/functions/usleep.html
      // We're single-threaded, so use a busy loop. Super-ugly.
      var msec = useconds / 1000;
      if ((ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && self['performance'] && self['performance']['now']) {
        var start = self['performance']['now']();
        while (self['performance']['now']() - start < msec) {
          // Do nothing.
        }
      } else {
        var start = Date.now();
        while (Date.now() - start < msec) {
          // Do nothing.
        }
      }
      return 0;
    }

  
  
  var cttz_i8 = allocate([8,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,7,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0], "i8", ALLOC_STATIC);   

  
    

   

   

  
  function _emscripten_memcpy_big(dest, src, num) {
      HEAPU8.set(HEAPU8.subarray(src, src+num), dest);
      return dest;
    } 

  function ___syscall4(which, varargs) {SYSCALLS.varargs = varargs;
  try {
   // write
      var stream = SYSCALLS.getStreamFromFD(), buf = SYSCALLS.get(), count = SYSCALLS.get();
      return FS.write(stream, HEAP8,buf, count);
    } catch (e) {
    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
    return -e.errno;
  }
  }

  
  function __exit(status) {
      // void _exit(int status);
      // http://pubs.opengroup.org/onlinepubs/000095399/functions/exit.html
      Module['exit'](status);
    }function _exit(status) {
      __exit(status);
    }

   

  function ___syscall140(which, varargs) {SYSCALLS.varargs = varargs;
  try {
   // llseek
      var stream = SYSCALLS.getStreamFromFD(), offset_high = SYSCALLS.get(), offset_low = SYSCALLS.get(), result = SYSCALLS.get(), whence = SYSCALLS.get();
      // NOTE: offset_high is unused - Emscripten's off_t is 32-bit
      var offset = offset_low;
      FS.llseek(stream, offset, whence);
      HEAP32[((result)>>2)]=stream.position;
      if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state
      return 0;
    } catch (e) {
    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
    return -e.errno;
  }
  }

  function ___syscall146(which, varargs) {SYSCALLS.varargs = varargs;
  try {
   // writev
      var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
      return SYSCALLS.doWritev(stream, iov, iovcnt);
    } catch (e) {
    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
    return -e.errno;
  }
  }

  function ___syscall54(which, varargs) {SYSCALLS.varargs = varargs;
  try {
   // ioctl
      var stream = SYSCALLS.getStreamFromFD(), op = SYSCALLS.get();
      switch (op) {
        case 21505: {
          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
          return 0;
        }
        case 21506: {
          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
          return 0; // no-op, not actually adjusting terminal settings
        }
        case 21519: {
          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
          var argp = SYSCALLS.get();
          HEAP32[((argp)>>2)]=0;
          return 0;
        }
        case 21520: {
          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
          return -ERRNO_CODES.EINVAL; // not supported
        }
        case 21531: {
          var argp = SYSCALLS.get();
          return FS.ioctl(stream, op, argp);
        }
        case 21523: {
          // TODO: in theory we should write to the winsize struct that gets
          // passed in, but for now musl doesn't read anything on it
          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
          return 0;
        }
        default: abort('bad ioctl syscall ' + op);
      }
    } catch (e) {
    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
    return -e.errno;
  }
  }

  function ___syscall221(which, varargs) {SYSCALLS.varargs = varargs;
  try {
   // fcntl64
      var stream = SYSCALLS.getStreamFromFD(), cmd = SYSCALLS.get();
      switch (cmd) {
        case 0: {
          var arg = SYSCALLS.get();
          if (arg < 0) {
            return -ERRNO_CODES.EINVAL;
          }
          var newStream;
          newStream = FS.open(stream.path, stream.flags, 0, arg);
          return newStream.fd;
        }
        case 1:
        case 2:
          return 0;  // FD_CLOEXEC makes no sense for a single process.
        case 3:
          return stream.flags;
        case 4: {
          var arg = SYSCALLS.get();
          stream.flags |= arg;
          return 0;
        }
        case 12:
        case 12: {
          var arg = SYSCALLS.get();
          var offset = 0;
          // We're always unlocked.
          HEAP16[(((arg)+(offset))>>1)]=2;
          return 0;
        }
        case 13:
        case 14:
        case 13:
        case 14:
          return 0; // Pretend that the locking is successful.
        case 16:
        case 8:
          return -ERRNO_CODES.EINVAL; // These are for sockets. We don't have them fully implemented yet.
        case 9:
          // musl trusts getown return values, due to a bug where they must be, as they overlap with errors. just return -1 here, so fnctl() returns that, and we set errno ourselves.
          ___setErrNo(ERRNO_CODES.EINVAL);
          return -1;
        default: {
          return -ERRNO_CODES.EINVAL;
        }
      }
    } catch (e) {
    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
    return -e.errno;
  }
  }

  function ___syscall145(which, varargs) {SYSCALLS.varargs = varargs;
  try {
   // readv
      var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
      return SYSCALLS.doReadv(stream, iov, iovcnt);
    } catch (e) {
    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
    return -e.errno;
  }
  }
FS.staticInit();__ATINIT__.unshift(function() { if (!Module["noFSInit"] && !FS.init.initialized) FS.init() });__ATMAIN__.push(function() { FS.ignorePermissions = false });__ATEXIT__.push(function() { FS.quit() });Module["FS_createFolder"] = FS.createFolder;Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;Module["FS_createPreloadedFile"] = FS.createPreloadedFile;Module["FS_createLazyFile"] = FS.createLazyFile;Module["FS_createLink"] = FS.createLink;Module["FS_createDevice"] = FS.createDevice;Module["FS_unlink"] = FS.unlink;;
__ATINIT__.unshift(function() { TTY.init() });__ATEXIT__.push(function() { TTY.shutdown() });;
if (ENVIRONMENT_IS_NODE) { var fs = require("fs"); var NODEJS_PATH = require("path"); NODEFS.staticInit(); };
DYNAMICTOP_PTR = allocate(1, "i32", ALLOC_STATIC);

STACK_BASE = STACKTOP = Runtime.alignMemory(STATICTOP);

STACK_MAX = STACK_BASE + TOTAL_STACK;

DYNAMIC_BASE = Runtime.alignMemory(STACK_MAX);

HEAP32[DYNAMICTOP_PTR>>2] = DYNAMIC_BASE;

staticSealed = true; // seal the static portion of memory

assert(DYNAMIC_BASE < TOTAL_MEMORY, "TOTAL_MEMORY not big enough for stack");


function nullFunc_ii(x) { Module["printErr"]("Invalid function pointer called with signature 'ii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function nullFunc_iiii(x) { Module["printErr"]("Invalid function pointer called with signature 'iiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }

function invoke_ii(index,a1) {
  try {
    return Module["dynCall_ii"](index,a1);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_iiii(index,a1,a2,a3) {
  try {
    return Module["dynCall_iiii"](index,a1,a2,a3);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

Module.asmGlobalArg = { "Math": Math, "Int8Array": Int8Array, "Int16Array": Int16Array, "Int32Array": Int32Array, "Uint8Array": Uint8Array, "Uint16Array": Uint16Array, "Uint32Array": Uint32Array, "Float32Array": Float32Array, "Float64Array": Float64Array, "NaN": NaN, "Infinity": Infinity };

Module.asmLibraryArg = { "abort": abort, "assert": assert, "enlargeMemory": enlargeMemory, "getTotalMemory": getTotalMemory, "abortOnCannotGrowMemory": abortOnCannotGrowMemory, "abortStackOverflow": abortStackOverflow, "nullFunc_ii": nullFunc_ii, "nullFunc_iiii": nullFunc_iiii, "invoke_ii": invoke_ii, "invoke_iiii": invoke_iiii, "___syscall221": ___syscall221, "___lock": ___lock, "___syscall6": ___syscall6, "___setErrNo": ___setErrNo, "___syscall4": ___syscall4, "___syscall140": ___syscall140, "___syscall146": ___syscall146, "___syscall5": ___syscall5, "_emscripten_memcpy_big": _emscripten_memcpy_big, "___syscall54": ___syscall54, "___unlock": ___unlock, "_exit": _exit, "__exit": __exit, "___syscall145": ___syscall145, "_usleep": _usleep, "DYNAMICTOP_PTR": DYNAMICTOP_PTR, "tempDoublePtr": tempDoublePtr, "ABORT": ABORT, "STACKTOP": STACKTOP, "STACK_MAX": STACK_MAX, "cttz_i8": cttz_i8 };
// EMSCRIPTEN_START_ASM
var asm = (function(global, env, buffer) {
'almost asm';


  var HEAP8 = new global.Int8Array(buffer);
  var HEAP16 = new global.Int16Array(buffer);
  var HEAP32 = new global.Int32Array(buffer);
  var HEAPU8 = new global.Uint8Array(buffer);
  var HEAPU16 = new global.Uint16Array(buffer);
  var HEAPU32 = new global.Uint32Array(buffer);
  var HEAPF32 = new global.Float32Array(buffer);
  var HEAPF64 = new global.Float64Array(buffer);

  var DYNAMICTOP_PTR=env.DYNAMICTOP_PTR|0;
  var tempDoublePtr=env.tempDoublePtr|0;
  var ABORT=env.ABORT|0;
  var STACKTOP=env.STACKTOP|0;
  var STACK_MAX=env.STACK_MAX|0;
  var cttz_i8=env.cttz_i8|0;

  var __THREW__ = 0;
  var threwValue = 0;
  var setjmpId = 0;
  var undef = 0;
  var nan = global.NaN, inf = global.Infinity;
  var tempInt = 0, tempBigInt = 0, tempBigIntS = 0, tempValue = 0, tempDouble = 0.0;
  var tempRet0 = 0;

  var Math_floor=global.Math.floor;
  var Math_abs=global.Math.abs;
  var Math_sqrt=global.Math.sqrt;
  var Math_pow=global.Math.pow;
  var Math_cos=global.Math.cos;
  var Math_sin=global.Math.sin;
  var Math_tan=global.Math.tan;
  var Math_acos=global.Math.acos;
  var Math_asin=global.Math.asin;
  var Math_atan=global.Math.atan;
  var Math_atan2=global.Math.atan2;
  var Math_exp=global.Math.exp;
  var Math_log=global.Math.log;
  var Math_ceil=global.Math.ceil;
  var Math_imul=global.Math.imul;
  var Math_min=global.Math.min;
  var Math_max=global.Math.max;
  var Math_clz32=global.Math.clz32;
  var abort=env.abort;
  var assert=env.assert;
  var enlargeMemory=env.enlargeMemory;
  var getTotalMemory=env.getTotalMemory;
  var abortOnCannotGrowMemory=env.abortOnCannotGrowMemory;
  var abortStackOverflow=env.abortStackOverflow;
  var nullFunc_ii=env.nullFunc_ii;
  var nullFunc_iiii=env.nullFunc_iiii;
  var invoke_ii=env.invoke_ii;
  var invoke_iiii=env.invoke_iiii;
  var ___syscall221=env.___syscall221;
  var ___lock=env.___lock;
  var ___syscall6=env.___syscall6;
  var ___setErrNo=env.___setErrNo;
  var ___syscall4=env.___syscall4;
  var ___syscall140=env.___syscall140;
  var ___syscall146=env.___syscall146;
  var ___syscall5=env.___syscall5;
  var _emscripten_memcpy_big=env._emscripten_memcpy_big;
  var ___syscall54=env.___syscall54;
  var ___unlock=env.___unlock;
  var _exit=env._exit;
  var __exit=env.__exit;
  var ___syscall145=env.___syscall145;
  var _usleep=env._usleep;
  var tempFloat = 0.0;

// EMSCRIPTEN_START_FUNCS

function stackAlloc(size) {
  size = size|0;
  var ret = 0;
  ret = STACKTOP;
  STACKTOP = (STACKTOP + size)|0;
  STACKTOP = (STACKTOP + 15)&-16;
  if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(size|0);

  return ret|0;
}
function stackSave() {
  return STACKTOP|0;
}
function stackRestore(top) {
  top = top|0;
  STACKTOP = top;
}
function establishStackSpace(stackBase, stackMax) {
  stackBase = stackBase|0;
  stackMax = stackMax|0;
  STACKTOP = stackBase;
  STACK_MAX = stackMax;
}

function setThrew(threw, value) {
  threw = threw|0;
  value = value|0;
  if ((__THREW__|0) == 0) {
    __THREW__ = threw;
    threwValue = value;
  }
}

function setTempRet0(value) {
  value = value|0;
  tempRet0 = value;
}
function getTempRet0() {
  return tempRet0|0;
}

function _main($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0;
 var $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0;
 var $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0;
 var $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0;
 var $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0;
 var $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0;
 var $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0;
 var $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0;
 var $244 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
 var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
 var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0;
 var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0;
 var $97 = 0, $98 = 0, $99 = 0, $or$cond = 0, $vararg_buffer = 0, $vararg_buffer12 = 0, $vararg_buffer14 = 0, $vararg_buffer16 = 0, $vararg_buffer2 = 0, $vararg_buffer22 = 0, $vararg_buffer24 = 0, $vararg_buffer26 = 0, $vararg_buffer28 = 0, $vararg_buffer30 = 0, $vararg_buffer36 = 0, $vararg_buffer38 = 0, $vararg_buffer4 = 0, $vararg_buffer40 = 0, $vararg_buffer7 = 0, $vararg_buffer9 = 0;
 var $vararg_ptr19 = 0, $vararg_ptr20 = 0, $vararg_ptr21 = 0, $vararg_ptr33 = 0, $vararg_ptr34 = 0, $vararg_ptr35 = 0, $vararg_ptr43 = 0, $vararg_ptr44 = 0, $vararg_ptr45 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 512|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(512|0);
 $vararg_buffer40 = sp + 136|0;
 $vararg_buffer38 = sp + 128|0;
 $vararg_buffer36 = sp + 120|0;
 $vararg_buffer30 = sp + 104|0;
 $vararg_buffer28 = sp + 96|0;
 $vararg_buffer26 = sp + 88|0;
 $vararg_buffer24 = sp + 80|0;
 $vararg_buffer22 = sp + 72|0;
 $vararg_buffer16 = sp + 56|0;
 $vararg_buffer14 = sp + 48|0;
 $vararg_buffer12 = sp + 40|0;
 $vararg_buffer9 = sp + 32|0;
 $vararg_buffer7 = sp + 24|0;
 $vararg_buffer4 = sp + 16|0;
 $vararg_buffer2 = sp + 8|0;
 $vararg_buffer = sp;
 $5 = sp + 495|0;
 $6 = sp + 482|0;
 $7 = sp + 481|0;
 $8 = sp + 480|0;
 $17 = sp + 400|0;
 $18 = sp + 376|0;
 $19 = sp + 296|0;
 $20 = sp + 216|0;
 $2 = 0;
 $3 = $0;
 $4 = $1;
 HEAP32[$vararg_buffer>>2] = 0;
 $25 = (_fcntl(0,3,$vararg_buffer)|0);
 HEAP32[1393] = $25;
 $26 = ($25|0)==(-1);
 if ($26) {
  _perror(948);
  _exit(1);
  // unreachable;
 }
 $27 = (_fopen(1617,2738)|0);
 $23 = $27;
 $28 = (_fopen(2724,2738)|0);
 $24 = $28;
 $29 = HEAP32[1393]|0;
 $30 = $29 | 2048;
 HEAP32[1394] = $30;
 $31 = $3;
 switch ($31|0) {
 case 0:  {
  $32 = $23;
  (_strcpy($19,$32)|0);
  $33 = $24;
  (_strcpy($20,$33)|0);
  $21 = -1;
  $22 = -1;
  label = 5;
  break;
 }
 case 1:  {
  label = 5;
  break;
 }
 case 2:  {
  $34 = $23;
  (_strcpy($19,$34)|0);
  HEAP8[$20>>0] = 0;
  $21 = -1;
  $22 = -1;
  break;
 }
 case 3:  {
  $35 = $23;
  (_strcpy($19,$35)|0);
  $36 = $24;
  (_strcpy($20,$36)|0);
  $21 = -1;
  $22 = -1;
  break;
 }
 case 4:  {
  $37 = $23;
  (_strcpy($19,$37)|0);
  $38 = $24;
  (_strcpy($20,$38)|0);
  $39 = $4;
  $40 = ((($39)) + 12|0);
  $41 = HEAP32[$40>>2]|0;
  $42 = (_atoi($41)|0);
  $21 = $42;
  $22 = -1;
  break;
 }
 case 5:  {
  $43 = $23;
  (_strcpy($19,$43)|0);
  $44 = $24;
  (_strcpy($20,$44)|0);
  $45 = $4;
  $46 = ((($45)) + 12|0);
  $47 = HEAP32[$46>>2]|0;
  $48 = (_atoi($47)|0);
  $21 = $48;
  $49 = $4;
  $50 = ((($49)) + 16|0);
  $51 = HEAP32[$50>>2]|0;
  $52 = (_atoi($51)|0);
  $22 = $52;
  break;
 }
 default: {
  $53 = HEAP32[144]|0;
  (_fprintf($53,963,$vararg_buffer2)|0);
  _exit(2);
  // unreachable;
 }
 }
 if ((label|0) == 5) {
  HEAP8[$19>>0] = 0;
  HEAP8[$20>>0] = 0;
  $21 = -1;
  $22 = -1;
 }
 $12 = 0;
 while(1) {
  $54 = $12;
  $55 = ($54|0)<(100);
  if (!($55)) {
   break;
  }
  $13 = 0;
  while(1) {
   $56 = $13;
   $57 = ($56|0)<(80);
   $58 = $12;
   if (!($57)) {
    break;
   }
   $59 = (6192 + (($58*80)|0)|0);
   $60 = $13;
   $61 = (($59) + ($60)|0);
   HEAP8[$61>>0] = 0;
   $62 = $13;
   $63 = (($62) + 1)|0;
   $13 = $63;
  }
  $64 = (($58) + 1)|0;
  $12 = $64;
 }
 _BurnInProm($19);
 _InitializeMemory($20);
 $65 = $21;
 $66 = $22;
 _InitializePCandStackPointer($65,$66);
 (_strcpy($6,1006)|0);
 (_strcpy($5,2707)|0);
 HEAP8[$7>>0] = 48;
 HEAP8[$8>>0] = 48;
 L22: while(1) {
  while(1) {
   $67 = HEAP32[1389]|0;
   $68 = ($67|0)!=(0);
   if ($68) {
    _Set_nonblocking_io();
    $69 = HEAP32[1392]|0;
    $70 = (6192 + (($69*80)|0)|0);
    $71 = HEAP32[112]|0;
    $72 = (_fgets($70,99,$71)|0);
    HEAP32[1395] = $72;
    $73 = ($72|0)!=(0|0);
    if ($73) {
     $74 = HEAP32[1392]|0;
     $75 = (6192 + (($74*80)|0)|0);
     $76 = HEAP32[1395]|0;
     $77 = (_strlen($76)|0);
     $15 = $77;
     $78 = (($75) + ($77)|0);
     HEAP8[$78>>0] = 10;
     $79 = HEAP32[1392]|0;
     $80 = (6192 + (($79*80)|0)|0);
     $81 = $15;
     $82 = (($81) + 1)|0;
     $83 = (($80) + ($82)|0);
     HEAP8[$83>>0] = 0;
     $84 = HEAP32[1392]|0;
     $85 = (($84) + 1)|0;
     $86 = (($85|0) % 100)&-1;
     HEAP32[1392] = $86;
     HEAP32[1389] = 0;
     HEAP8[(92511)>>0] = 49;
     HEAP8[(92512)>>0] = 48;
     _Set_blocking_io();
    }
   }
   _GeneratePulse();
   _ActivateCpu($6,$5,$7,$8);
   $87 = HEAP8[$7>>0]|0;
   $88 = $87 << 24 >> 24;
   $89 = HEAP8[$8>>0]|0;
   $90 = $89 << 24 >> 24;
   _ActivateMemory($6,$5,$88,$90);
   $91 = HEAP8[$7>>0]|0;
   $92 = $91 << 24 >> 24;
   $93 = ($92|0)==(49);
   if (!($93)) {
    continue;
   }
   $94 = HEAP8[$8>>0]|0;
   $95 = $94 << 24 >> 24;
   $96 = ($95|0)==(49);
   if ($96) {
    break;
   }
  }
  (_usleep(1)|0);
  _Set_blocking_io();
  (_DumpRegisters()|0);
  $97 = (_Cycle()|0);
  $9 = $97;
  $98 = $9;
  HEAP32[$vararg_buffer4>>2] = $98;
  (_printf(1019,$vararg_buffer4)|0);
  L32: while(1) {
   (_printf(1042,$vararg_buffer7)|0);
   $99 = HEAP32[112]|0;
   (_fgets($17,79,$99)|0);
   $100 = HEAP8[$17>>0]|0;
   $101 = $100 << 24 >> 24;
   $102 = ($101|0)==(99);
   if ($102) {
    break;
   }
   $103 = HEAP8[$17>>0]|0;
   $104 = $103 << 24 >> 24;
   $105 = ($104|0)==(113);
   if ($105) {
    label = 29;
    break L22;
   }
   $106 = HEAP8[$17>>0]|0;
   $107 = $106 << 24 >> 24;
   $108 = ($107|0)==(81);
   if ($108) {
    label = 29;
    break L22;
   }
   $109 = (_atoi($17)|0);
   $10 = $109;
   $11 = $109;
   $110 = $10;
   $111 = ($110|0)<(0);
   $112 = $10;
   $113 = ($112|0)>(4095);
   $or$cond = $111 | $113;
   if ($or$cond) {
    (_printf(1171,$vararg_buffer14)|0);
    continue;
   }
   $12 = 11;
   while(1) {
    $114 = $12;
    $115 = ($114|0)>=(0);
    if (!($115)) {
     break;
    }
    $116 = $10;
    $117 = $12;
    $118 = (8 + ($117<<2)|0);
    $119 = HEAP32[$118>>2]|0;
    $120 = ($116|0)>=($119|0);
    $121 = $12;
    $122 = (11 - ($121))|0;
    $123 = (($6) + ($122)|0);
    if ($120) {
     HEAP8[$123>>0] = 49;
     $124 = $12;
     $125 = (8 + ($124<<2)|0);
     $126 = HEAP32[$125>>2]|0;
     $127 = $10;
     $128 = (($127) - ($126))|0;
     $10 = $128;
    } else {
     HEAP8[$123>>0] = 48;
    }
    $129 = $12;
    $130 = (($129) + -1)|0;
    $12 = $130;
   }
   $131 = ((($6)) + 12|0);
   HEAP8[$131>>0] = 0;
   _ActivateMemory($6,$18,49,48);
   $132 = ((($18)) + 16|0);
   HEAP8[$132>>0] = 0;
   $133 = $11;
   $134 = (_btoi($18)|0);
   $135 = (_btoi($18)|0);
   $136 = $135&65535;
   $137 = $136 << 16 >> 16;
   HEAP32[$vararg_buffer16>>2] = $133;
   $vararg_ptr19 = ((($vararg_buffer16)) + 4|0);
   HEAP32[$vararg_ptr19>>2] = $18;
   $vararg_ptr20 = ((($vararg_buffer16)) + 8|0);
   HEAP32[$vararg_ptr20>>2] = $134;
   $vararg_ptr21 = ((($vararg_buffer16)) + 12|0);
   HEAP32[$vararg_ptr21>>2] = $137;
   (_printf(1219,$vararg_buffer16)|0);
   (_printf(1281,$vararg_buffer22)|0);
   $138 = HEAP32[112]|0;
   (_fgets($17,79,$138)|0);
   $139 = HEAP8[$17>>0]|0;
   $140 = $139 << 24 >> 24;
   $141 = ($140|0)==(113);
   $142 = $141&1;
   $143 = HEAP8[$17>>0]|0;
   $144 = $143 << 24 >> 24;
   $145 = ($144|0)==(81);
   $146 = $145&1;
   $147 = $142 | $146;
   $148 = ($147|0)!=(0);
   if ($148) {
    label = 39;
    break L22;
   }
   $149 = HEAP8[$17>>0]|0;
   $150 = $149 << 24 >> 24;
   $151 = ($150|0)==(102);
   if (!($151)) {
    $152 = HEAP8[$17>>0]|0;
    $153 = $152 << 24 >> 24;
    $154 = ($153|0)==(70);
    if (!($154)) {
     $197 = HEAP8[$17>>0]|0;
     $198 = $197 << 24 >> 24;
     $199 = ($198|0)==(98);
     if (!($199)) {
      $200 = HEAP8[$17>>0]|0;
      $201 = $200 << 24 >> 24;
      $202 = ($201|0)==(66);
      if (!($202)) {
       continue;
      }
     }
     (_printf(1491,$vararg_buffer36)|0);
     $203 = HEAP32[112]|0;
     (_fgets($17,79,$203)|0);
     $204 = (_atoi($17)|0);
     $16 = $204;
     $205 = $11;
     $206 = $16;
     $207 = (($205) - ($206))|0;
     $208 = ($207|0)<(0);
     if ($208) {
      (_printf(1538,$vararg_buffer38)|0);
      continue;
     }
     $14 = 0;
     while(1) {
      $209 = $14;
      $210 = $16;
      $211 = ($209|0)<($210|0);
      if (!($211)) {
       continue L32;
      }
      $212 = $11;
      $213 = $14;
      $214 = (($213) + 1)|0;
      $215 = (($212) - ($214))|0;
      $10 = $215;
      $12 = 11;
      while(1) {
       $216 = $12;
       $217 = ($216|0)>=(0);
       if (!($217)) {
        break;
       }
       $218 = $10;
       $219 = $12;
       $220 = (8 + ($219<<2)|0);
       $221 = HEAP32[$220>>2]|0;
       $222 = ($218|0)>=($221|0);
       $223 = $12;
       $224 = (11 - ($223))|0;
       $225 = (($6) + ($224)|0);
       if ($222) {
        HEAP8[$225>>0] = 49;
        $226 = $12;
        $227 = (8 + ($226<<2)|0);
        $228 = HEAP32[$227>>2]|0;
        $229 = $10;
        $230 = (($229) - ($228))|0;
        $10 = $230;
       } else {
        HEAP8[$225>>0] = 48;
       }
       $231 = $12;
       $232 = (($231) + -1)|0;
       $12 = $232;
      }
      $233 = ((($6)) + 12|0);
      HEAP8[$233>>0] = 0;
      _ActivateMemory($6,$18,49,48);
      $234 = ((($18)) + 16|0);
      HEAP8[$234>>0] = 0;
      $235 = $11;
      $236 = $14;
      $237 = (($236) + 1)|0;
      $238 = (($235) - ($237))|0;
      $239 = (_btoi($18)|0);
      $240 = (_btoi($18)|0);
      $241 = $240&65535;
      $242 = $241 << 16 >> 16;
      HEAP32[$vararg_buffer40>>2] = $238;
      $vararg_ptr43 = ((($vararg_buffer40)) + 4|0);
      HEAP32[$vararg_ptr43>>2] = $18;
      $vararg_ptr44 = ((($vararg_buffer40)) + 8|0);
      HEAP32[$vararg_ptr44>>2] = $239;
      $vararg_ptr45 = ((($vararg_buffer40)) + 12|0);
      HEAP32[$vararg_ptr45>>2] = $242;
      (_printf(1219,$vararg_buffer40)|0);
      $243 = $14;
      $244 = (($243) + 1)|0;
      $14 = $244;
     }
    }
   }
   (_printf(1408,$vararg_buffer26)|0);
   $155 = HEAP32[112]|0;
   (_fgets($17,79,$155)|0);
   $156 = (_atoi($17)|0);
   $16 = $156;
   $157 = $11;
   $158 = $16;
   $159 = (($157) + ($158))|0;
   $160 = ($159|0)>(4091);
   if ($160) {
    (_printf(1455,$vararg_buffer28)|0);
    continue;
   }
   $14 = 0;
   while(1) {
    $161 = $14;
    $162 = $16;
    $163 = ($161|0)<($162|0);
    if (!($163)) {
     continue L32;
    }
    $164 = $11;
    $165 = $14;
    $166 = (($164) + ($165))|0;
    $167 = (($166) + 1)|0;
    $10 = $167;
    $12 = 11;
    while(1) {
     $168 = $12;
     $169 = ($168|0)>=(0);
     if (!($169)) {
      break;
     }
     $170 = $10;
     $171 = $12;
     $172 = (8 + ($171<<2)|0);
     $173 = HEAP32[$172>>2]|0;
     $174 = ($170|0)>=($173|0);
     $175 = $12;
     $176 = (11 - ($175))|0;
     $177 = (($6) + ($176)|0);
     if ($174) {
      HEAP8[$177>>0] = 49;
      $178 = $12;
      $179 = (8 + ($178<<2)|0);
      $180 = HEAP32[$179>>2]|0;
      $181 = $10;
      $182 = (($181) - ($180))|0;
      $10 = $182;
     } else {
      HEAP8[$177>>0] = 48;
     }
     $183 = $12;
     $184 = (($183) + -1)|0;
     $12 = $184;
    }
    $185 = ((($6)) + 12|0);
    HEAP8[$185>>0] = 0;
    _ActivateMemory($6,$18,49,48);
    $186 = ((($18)) + 16|0);
    HEAP8[$186>>0] = 0;
    $187 = $11;
    $188 = $14;
    $189 = (($187) + ($188))|0;
    $190 = (($189) + 1)|0;
    $191 = (_btoi($18)|0);
    $192 = (_btoi($18)|0);
    $193 = $192&65535;
    $194 = $193 << 16 >> 16;
    HEAP32[$vararg_buffer30>>2] = $190;
    $vararg_ptr33 = ((($vararg_buffer30)) + 4|0);
    HEAP32[$vararg_ptr33>>2] = $18;
    $vararg_ptr34 = ((($vararg_buffer30)) + 8|0);
    HEAP32[$vararg_ptr34>>2] = $191;
    $vararg_ptr35 = ((($vararg_buffer30)) + 12|0);
    HEAP32[$vararg_ptr35>>2] = $194;
    (_printf(1219,$vararg_buffer30)|0);
    $195 = $14;
    $196 = (($195) + 1)|0;
    $14 = $196;
   }
  }
  HEAP32[$vararg_buffer9>>2] = 1963;
  (_printf(1112,$vararg_buffer9)|0);
  HEAP32[1396] = 0;
  HEAP32[1547] = 0;
 }
 if ((label|0) == 29) {
  (_printf(1135,$vararg_buffer12)|0);
  _exit(1);
  // unreachable;
 }
 else if ((label|0) == 39) {
  (_printf(1135,$vararg_buffer24)|0);
  _exit(1);
  // unreachable;
 }
 return (0)|0;
}
function _btoi($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $1 = $0;
 $3 = 0;
 $2 = 0;
 while(1) {
  $4 = $2;
  $5 = ($4|0)<(16);
  if (!($5)) {
   break;
  }
  $6 = $1;
  $7 = $2;
  $8 = (($6) + ($7)|0);
  $9 = HEAP8[$8>>0]|0;
  $10 = $9 << 24 >> 24;
  $11 = ($10|0)==(49);
  if ($11) {
   $12 = $2;
   $13 = (15 - ($12))|0;
   $14 = (8 + ($13<<2)|0);
   $15 = HEAP32[$14>>2]|0;
   $16 = $3;
   $17 = (($16) + ($15))|0;
   $3 = $17;
  }
  $18 = $2;
  $19 = (($18) + 1)|0;
  $2 = $19;
 }
 $20 = $3;
 STACKTOP = sp;return ($20|0);
}
function _btoc($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
 var $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $1 = $0;
 $3 = 0;
 $2 = 8;
 while(1) {
  $4 = $2;
  $5 = ($4|0)<(16);
  if (!($5)) {
   break;
  }
  $6 = $1;
  $7 = $2;
  $8 = (($6) + ($7)|0);
  $9 = HEAP8[$8>>0]|0;
  $10 = $9 << 24 >> 24;
  $11 = ($10|0)==(49);
  if ($11) {
   $12 = $2;
   $13 = (15 - ($12))|0;
   $14 = (8 + ($13<<2)|0);
   $15 = HEAP32[$14>>2]|0;
   $16 = $3;
   $17 = (($16) + ($15))|0;
   $3 = $17;
  }
  $18 = $2;
  $19 = (($18) + 1)|0;
  $2 = $19;
 }
 $20 = $3;
 $21 = $20&255;
 STACKTOP = sp;return ($21|0);
}
function _True_ascii_to_mem_ascii($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0;
 var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $2 = $0;
 $3 = $1;
 $4 = 0;
 while(1) {
  $5 = $4;
  $6 = ($5|0)<(16);
  $7 = $2;
  if (!($6)) {
   break;
  }
  $8 = $4;
  $9 = (($7) + ($8)|0);
  HEAP8[$9>>0] = 48;
  $10 = $4;
  $11 = (($10) + 1)|0;
  $4 = $11;
 }
 $12 = ((($7)) + 16|0);
 HEAP8[$12>>0] = 0;
 $4 = 8;
 while(1) {
  $13 = $4;
  $14 = ($13|0)<(16);
  if (!($14)) {
   break;
  }
  $15 = $4;
  $16 = (15 - ($15))|0;
  $17 = (8 + ($16<<2)|0);
  $18 = HEAP32[$17>>2]|0;
  $19 = $3;
  $20 = HEAP8[$19>>0]|0;
  $21 = $20 << 24 >> 24;
  $22 = $18 & $21;
  $23 = ($22|0)!=(0);
  if ($23) {
   $24 = $2;
   $25 = $4;
   $26 = (($24) + ($25)|0);
   HEAP8[$26>>0] = 49;
  }
  $27 = $4;
  $28 = (($27) + 1)|0;
  $4 = $28;
 }
 STACKTOP = sp;return 1;
}
function _Set_blocking_io() {
 var $0 = 0, $1 = 0, $2 = 0, $vararg_buffer = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $vararg_buffer = sp;
 $0 = HEAP32[1393]|0;
 HEAP32[$vararg_buffer>>2] = $0;
 $1 = (_fcntl(0,4,$vararg_buffer)|0);
 $2 = ($1|0)==(-1);
 if ($2) {
  _perror(1570);
  _exit(2);
  // unreachable;
 } else {
  STACKTOP = sp;return;
 }
}
function _Set_nonblocking_io() {
 var $0 = 0, $1 = 0, $2 = 0, $vararg_buffer = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $vararg_buffer = sp;
 $0 = HEAP32[1394]|0;
 HEAP32[$vararg_buffer>>2] = $0;
 $1 = (_fcntl(0,4,$vararg_buffer)|0);
 $2 = ($1|0)==(-1);
 if ($2) {
  _perror(1590);
  _exit(2);
  // unreachable;
 } else {
  STACKTOP = sp;return;
 }
}
function _Add($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0;
 var $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0;
 var $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0;
 var $154 = 0, $155 = 0, $156 = 0, $157 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0;
 var $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0;
 var $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0;
 var $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0;
 var $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $4 = $0;
 $5 = $1;
 $6 = $2;
 $7 = 48;
 $8 = 16;
 while(1) {
  $9 = $8;
  $10 = ($9|0)>=(0);
  if (!($10)) {
   break;
  }
  $11 = $7;
  $12 = $11 << 24 >> 24;
  $13 = ($12|0)==(48);
  if ($13) {
   $14 = $4;
   $15 = $8;
   $16 = (($14) + ($15)|0);
   $17 = HEAP8[$16>>0]|0;
   $18 = $17 << 24 >> 24;
   $19 = ($18|0)==(48);
   if ($19) {
    $20 = $5;
    $21 = $8;
    $22 = (($20) + ($21)|0);
    $23 = HEAP8[$22>>0]|0;
    $24 = $23 << 24 >> 24;
    $25 = ($24|0)==(48);
    if ($25) {
     $26 = $6;
     $27 = $8;
     $28 = (($26) + ($27)|0);
     HEAP8[$28>>0] = 48;
     $7 = 48;
    } else {
     label = 7;
    }
   } else {
    label = 7;
   }
  } else {
   label = 7;
  }
  do {
   if ((label|0) == 7) {
    label = 0;
    $29 = $7;
    $30 = $29 << 24 >> 24;
    $31 = ($30|0)==(48);
    if ($31) {
     $32 = $4;
     $33 = $8;
     $34 = (($32) + ($33)|0);
     $35 = HEAP8[$34>>0]|0;
     $36 = $35 << 24 >> 24;
     $37 = ($36|0)==(48);
     if ($37) {
      $38 = $5;
      $39 = $8;
      $40 = (($38) + ($39)|0);
      $41 = HEAP8[$40>>0]|0;
      $42 = $41 << 24 >> 24;
      $43 = ($42|0)==(49);
      if ($43) {
       $44 = $6;
       $45 = $8;
       $46 = (($44) + ($45)|0);
       HEAP8[$46>>0] = 49;
       $7 = 48;
       break;
      }
     }
    }
    $47 = $7;
    $48 = $47 << 24 >> 24;
    $49 = ($48|0)==(48);
    if ($49) {
     $50 = $4;
     $51 = $8;
     $52 = (($50) + ($51)|0);
     $53 = HEAP8[$52>>0]|0;
     $54 = $53 << 24 >> 24;
     $55 = ($54|0)==(49);
     if ($55) {
      $56 = $5;
      $57 = $8;
      $58 = (($56) + ($57)|0);
      $59 = HEAP8[$58>>0]|0;
      $60 = $59 << 24 >> 24;
      $61 = ($60|0)==(48);
      if ($61) {
       $62 = $6;
       $63 = $8;
       $64 = (($62) + ($63)|0);
       HEAP8[$64>>0] = 49;
       $7 = 48;
       break;
      }
     }
    }
    $65 = $7;
    $66 = $65 << 24 >> 24;
    $67 = ($66|0)==(48);
    if ($67) {
     $68 = $4;
     $69 = $8;
     $70 = (($68) + ($69)|0);
     $71 = HEAP8[$70>>0]|0;
     $72 = $71 << 24 >> 24;
     $73 = ($72|0)==(49);
     if ($73) {
      $74 = $5;
      $75 = $8;
      $76 = (($74) + ($75)|0);
      $77 = HEAP8[$76>>0]|0;
      $78 = $77 << 24 >> 24;
      $79 = ($78|0)==(49);
      if ($79) {
       $80 = $6;
       $81 = $8;
       $82 = (($80) + ($81)|0);
       HEAP8[$82>>0] = 48;
       $7 = 49;
       break;
      }
     }
    }
    $83 = $7;
    $84 = $83 << 24 >> 24;
    $85 = ($84|0)==(49);
    if ($85) {
     $86 = $4;
     $87 = $8;
     $88 = (($86) + ($87)|0);
     $89 = HEAP8[$88>>0]|0;
     $90 = $89 << 24 >> 24;
     $91 = ($90|0)==(48);
     if ($91) {
      $92 = $5;
      $93 = $8;
      $94 = (($92) + ($93)|0);
      $95 = HEAP8[$94>>0]|0;
      $96 = $95 << 24 >> 24;
      $97 = ($96|0)==(48);
      if ($97) {
       $98 = $6;
       $99 = $8;
       $100 = (($98) + ($99)|0);
       HEAP8[$100>>0] = 49;
       $7 = 48;
       break;
      }
     }
    }
    $101 = $7;
    $102 = $101 << 24 >> 24;
    $103 = ($102|0)==(49);
    if ($103) {
     $104 = $4;
     $105 = $8;
     $106 = (($104) + ($105)|0);
     $107 = HEAP8[$106>>0]|0;
     $108 = $107 << 24 >> 24;
     $109 = ($108|0)==(48);
     if ($109) {
      $110 = $5;
      $111 = $8;
      $112 = (($110) + ($111)|0);
      $113 = HEAP8[$112>>0]|0;
      $114 = $113 << 24 >> 24;
      $115 = ($114|0)==(49);
      if ($115) {
       $116 = $6;
       $117 = $8;
       $118 = (($116) + ($117)|0);
       HEAP8[$118>>0] = 48;
       $7 = 49;
       break;
      }
     }
    }
    $119 = $7;
    $120 = $119 << 24 >> 24;
    $121 = ($120|0)==(49);
    if ($121) {
     $122 = $4;
     $123 = $8;
     $124 = (($122) + ($123)|0);
     $125 = HEAP8[$124>>0]|0;
     $126 = $125 << 24 >> 24;
     $127 = ($126|0)==(49);
     if ($127) {
      $128 = $5;
      $129 = $8;
      $130 = (($128) + ($129)|0);
      $131 = HEAP8[$130>>0]|0;
      $132 = $131 << 24 >> 24;
      $133 = ($132|0)==(48);
      if ($133) {
       $134 = $6;
       $135 = $8;
       $136 = (($134) + ($135)|0);
       HEAP8[$136>>0] = 48;
       $7 = 49;
       break;
      }
     }
    }
    $137 = $7;
    $138 = $137 << 24 >> 24;
    $139 = ($138|0)==(49);
    if ($139) {
     $140 = $4;
     $141 = $8;
     $142 = (($140) + ($141)|0);
     $143 = HEAP8[$142>>0]|0;
     $144 = $143 << 24 >> 24;
     $145 = ($144|0)==(49);
     if ($145) {
      $146 = $5;
      $147 = $8;
      $148 = (($146) + ($147)|0);
      $149 = HEAP8[$148>>0]|0;
      $150 = $149 << 24 >> 24;
      $151 = ($150|0)==(49);
      if ($151) {
       $152 = $6;
       $153 = $8;
       $154 = (($152) + ($153)|0);
       HEAP8[$154>>0] = 49;
       $7 = 49;
      }
     }
    }
   }
  } while(0);
  $155 = $8;
  $156 = (($155) + -1)|0;
  $8 = $156;
 }
 $157 = $3;
 STACKTOP = sp;return ($157|0);
}
function _And($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$sink = 0, $$sink1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
 var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $4 = $0;
 $5 = $1;
 $6 = $2;
 $7 = 0;
 while(1) {
  $8 = $7;
  $9 = ($8|0)<(16);
  if (!($9)) {
   break;
  }
  $10 = $4;
  $11 = $7;
  $12 = (($10) + ($11)|0);
  $13 = HEAP8[$12>>0]|0;
  $14 = $13 << 24 >> 24;
  $15 = ($14|0)==(49);
  if ($15) {
   $16 = $5;
   $17 = $7;
   $18 = (($16) + ($17)|0);
   $19 = HEAP8[$18>>0]|0;
   $20 = $19 << 24 >> 24;
   $21 = ($20|0)==(49);
   if ($21) {
    $22 = $6;
    $23 = $7;
    $24 = (($22) + ($23)|0);
    $$sink = 49;$$sink1 = $24;
   } else {
    label = 6;
   }
  } else {
   label = 6;
  }
  if ((label|0) == 6) {
   label = 0;
   $25 = $6;
   $26 = $7;
   $27 = (($25) + ($26)|0);
   $$sink = 48;$$sink1 = $27;
  }
  HEAP8[$$sink1>>0] = $$sink;
  $28 = $7;
  $29 = (($28) + 1)|0;
  $7 = $29;
 }
 $30 = $3;
 STACKTOP = sp;return ($30|0);
}
function _NotA($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$sink = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $3 = $0;
 $4 = $1;
 $5 = 0;
 while(1) {
  $6 = $5;
  $7 = ($6|0)<(16);
  if (!($7)) {
   break;
  }
  $8 = $3;
  $9 = $5;
  $10 = (($8) + ($9)|0);
  $11 = HEAP8[$10>>0]|0;
  $12 = $11 << 24 >> 24;
  $13 = ($12|0)==(49);
  $14 = $4;
  $15 = $5;
  $16 = (($14) + ($15)|0);
  $$sink = $13 ? 48 : 49;
  HEAP8[$16>>0] = $$sink;
  $17 = $5;
  $18 = (($17) + 1)|0;
  $5 = $18;
 }
 $19 = $2;
 STACKTOP = sp;return ($19|0);
}
function _ActivateAlu($0,$1,$2,$3,$4,$5) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 var $$sink = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0;
 var $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
 var $49 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0;
 var $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(48|0);
 $7 = $0;
 $8 = $1;
 $9 = $2;
 $10 = $3;
 $11 = $4;
 $12 = $5;
 $16 = $9;
 $17 = HEAP8[$16>>0]|0;
 $14 = $17;
 $18 = $9;
 $19 = ((($18)) + 1|0);
 $20 = HEAP8[$19>>0]|0;
 $15 = $20;
 $21 = $14;
 $22 = $21 << 24 >> 24;
 $23 = ($22|0)==(48);
 if ($23) {
  $24 = $15;
  $25 = $24 << 24 >> 24;
  $26 = ($25|0)==(48);
  if ($26) {
   $27 = $7;
   $28 = $8;
   $29 = $10;
   (_Add($27,$28,$29)|0);
  } else {
   label = 4;
  }
 } else {
  label = 4;
 }
 do {
  if ((label|0) == 4) {
   $30 = $14;
   $31 = $30 << 24 >> 24;
   $32 = ($31|0)==(48);
   if ($32) {
    $33 = $15;
    $34 = $33 << 24 >> 24;
    $35 = ($34|0)==(49);
    if ($35) {
     $36 = $7;
     $37 = $8;
     $38 = $10;
     (_And($36,$37,$38)|0);
     break;
    }
   }
   $39 = $14;
   $40 = $39 << 24 >> 24;
   $41 = ($40|0)==(49);
   if ($41) {
    $42 = $15;
    $43 = $42 << 24 >> 24;
    $44 = ($43|0)==(48);
    if ($44) {
     $45 = $10;
     $46 = $7;
     (_strcpy($45,$46)|0);
     break;
    }
   }
   $47 = $14;
   $48 = $47 << 24 >> 24;
   $49 = ($48|0)==(49);
   if ($49) {
    $50 = $15;
    $51 = $50 << 24 >> 24;
    $52 = ($51|0)==(49);
    if ($52) {
     $53 = $7;
     $54 = $10;
     (_NotA($53,$54)|0);
    }
   }
  }
 } while(0);
 $55 = $10;
 $56 = HEAP8[$55>>0]|0;
 $57 = $56 << 24 >> 24;
 $58 = ($57|0)==(49);
 $59 = $11;
 $$sink = $58 ? 49 : 48;
 HEAP8[$59>>0] = $$sink;
 $60 = $12;
 HEAP8[$60>>0] = 49;
 $13 = 0;
 while(1) {
  $61 = $13;
  $62 = ($61|0)<(16);
  if (!($62)) {
   break;
  }
  $63 = $10;
  $64 = $13;
  $65 = (($63) + ($64)|0);
  $66 = HEAP8[$65>>0]|0;
  $67 = $66 << 24 >> 24;
  $68 = ($67|0)==(49);
  if ($68) {
   $69 = $12;
   HEAP8[$69>>0] = 48;
  }
  $70 = $13;
  $71 = (($70) + 1)|0;
  $13 = $71;
 }
 $72 = $6;
 STACKTOP = sp;return ($72|0);
}
function _BurnInProm($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
 var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
 var $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(80|0);
 $vararg_buffer3 = sp + 16|0;
 $vararg_buffer1 = sp + 8|0;
 $vararg_buffer = sp;
 $4 = sp + 36|0;
 $1 = $0;
 $2 = 0;
 while(1) {
  $6 = $2;
  $7 = ($6|0)<(256);
  if (!($7)) {
   break;
  }
  $3 = 0;
  while(1) {
   $8 = $3;
   $9 = ($8|0)<(32);
   $10 = $2;
   if (!($9)) {
    break;
   }
   $11 = (14192 + (($10*33)|0)|0);
   $12 = $3;
   $13 = (($11) + ($12)|0);
   HEAP8[$13>>0] = 48;
   $14 = $3;
   $15 = (($14) + 1)|0;
   $3 = $15;
  }
  $16 = (($10) + 1)|0;
  $2 = $16;
 }
 $2 = 0;
 $17 = (_fopen(1617,2738)|0);
 $5 = $17;
 $18 = ($17|0)==(0|0);
 if ($18) {
  $19 = (_fopen(1631,2738)|0);
  $5 = $19;
  $20 = ($19|0)==(0|0);
  if ($20) {
   $21 = HEAP32[144]|0;
   (_fprintf($21,1644,$vararg_buffer)|0);
   _exit(2);
   // unreachable;
  }
 }
 while(1) {
  $22 = $5;
  HEAP32[$vararg_buffer1>>2] = $4;
  $23 = (_fscanf($22,2687,$vararg_buffer1)|0);
  $24 = ($23|0)!=(-1);
  if (!($24)) {
   break;
  }
  $3 = 0;
  while(1) {
   $25 = $3;
   $26 = ($25|0)<(32);
   if (!($26)) {
    break;
   }
   $27 = $3;
   $28 = (($4) + ($27)|0);
   $29 = HEAP8[$28>>0]|0;
   $30 = $2;
   $31 = (14192 + (($30*33)|0)|0);
   $32 = $3;
   $33 = (($31) + ($32)|0);
   HEAP8[$33>>0] = $29;
   $34 = $3;
   $35 = (($34) + 1)|0;
   $3 = $35;
  }
  $36 = $2;
  $37 = (($36) + 1)|0;
  $2 = $37;
  $38 = HEAP32[1397]|0;
  $39 = (($38) + 1)|0;
  HEAP32[1397] = $39;
 }
 $40 = HEAP32[1397]|0;
 HEAP32[$vararg_buffer3>>2] = $40;
 (_printf(1676,$vararg_buffer3)|0);
 $41 = $5;
 (_fclose($41)|0);
 STACKTOP = sp;return;
}
function _BusRegister($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
 var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $1 = $0;
 $2 = 0;
 $3 = $1;
 $4 = ((($3)) + 3|0);
 $5 = HEAP8[$4>>0]|0;
 $6 = $5 << 24 >> 24;
 $7 = ($6|0)==(49);
 if ($7) {
  $8 = $2;
  $9 = (($8) + 1)|0;
  $2 = $9;
 }
 $10 = $1;
 $11 = ((($10)) + 2|0);
 $12 = HEAP8[$11>>0]|0;
 $13 = $12 << 24 >> 24;
 $14 = ($13|0)==(49);
 if ($14) {
  $15 = $2;
  $16 = (($15) + 2)|0;
  $2 = $16;
 }
 $17 = $1;
 $18 = ((($17)) + 1|0);
 $19 = HEAP8[$18>>0]|0;
 $20 = $19 << 24 >> 24;
 $21 = ($20|0)==(49);
 if ($21) {
  $22 = $2;
  $23 = (($22) + 4)|0;
  $2 = $23;
 }
 $24 = $1;
 $25 = HEAP8[$24>>0]|0;
 $26 = $25 << 24 >> 24;
 $27 = ($26|0)==(49);
 if (!($27)) {
  $30 = $2;
  STACKTOP = sp;return ($30|0);
 }
 $28 = $2;
 $29 = (($28) + 8)|0;
 $2 = $29;
 $30 = $2;
 STACKTOP = sp;return ($30|0);
}
function _DecodeRegField($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $3 = 0, $4 = 0, $5 = 0;
 var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $3 = $0;
 $4 = $1;
 $6 = $3;
 $7 = (_BusRegister($6)|0);
 $5 = $7;
 $8 = $5;
 do {
  switch ($8|0) {
  case 0:  {
   $9 = $4;
   (_strcpy($9,1708)|0);
   break;
  }
  case 1:  {
   $10 = $4;
   (_strcpy($10,1725)|0);
   break;
  }
  case 2:  {
   $11 = $4;
   (_strcpy($11,1742)|0);
   break;
  }
  case 3:  {
   $12 = $4;
   (_strcpy($12,1759)|0);
   break;
  }
  case 4:  {
   $13 = $4;
   (_strcpy($13,1776)|0);
   break;
  }
  case 5:  {
   $14 = $4;
   (_strcpy($14,1793)|0);
   break;
  }
  case 6:  {
   $15 = $4;
   (_strcpy($15,1810)|0);
   break;
  }
  case 7:  {
   $16 = $4;
   (_strcpy($16,1827)|0);
   break;
  }
  case 8:  {
   $17 = $4;
   (_strcpy($17,1844)|0);
   break;
  }
  case 9:  {
   $18 = $4;
   (_strcpy($18,1861)|0);
   break;
  }
  case 10:  {
   $19 = $4;
   (_strcpy($19,1878)|0);
   break;
  }
  case 11:  {
   $20 = $4;
   (_strcpy($20,1895)|0);
   break;
  }
  case 12:  {
   $21 = $4;
   (_strcpy($21,1912)|0);
   break;
  }
  case 13:  {
   $22 = $4;
   (_strcpy($22,1929)|0);
   break;
  }
  case 14:  {
   $23 = $4;
   (_strcpy($23,1946)|0);
   break;
  }
  case 15:  {
   $24 = $4;
   (_strcpy($24,2636)|0);
   break;
  }
  default: {
  }
  }
 } while(0);
 $25 = $2;
 STACKTOP = sp;return ($25|0);
}
function _DecodeAField($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $3 = sp + 8|0;
 $2 = $0;
 $4 = HEAP8[(22660)>>0]|0;
 HEAP8[$3>>0] = $4;
 $5 = HEAP8[(22661)>>0]|0;
 $6 = ((($3)) + 1|0);
 HEAP8[$6>>0] = $5;
 $7 = HEAP8[(22662)>>0]|0;
 $8 = ((($3)) + 2|0);
 HEAP8[$8>>0] = $7;
 $9 = HEAP8[(22663)>>0]|0;
 $10 = ((($3)) + 3|0);
 HEAP8[$10>>0] = $9;
 $11 = $2;
 (_DecodeRegField($3,$11)|0);
 $12 = $1;
 STACKTOP = sp;return ($12|0);
}
function _DecodeBField($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $3 = sp + 8|0;
 $2 = $0;
 $4 = HEAP8[(22656)>>0]|0;
 HEAP8[$3>>0] = $4;
 $5 = HEAP8[(22657)>>0]|0;
 $6 = ((($3)) + 1|0);
 HEAP8[$6>>0] = $5;
 $7 = HEAP8[(22658)>>0]|0;
 $8 = ((($3)) + 2|0);
 HEAP8[$8>>0] = $7;
 $9 = HEAP8[(22659)>>0]|0;
 $10 = ((($3)) + 3|0);
 HEAP8[$10>>0] = $9;
 $11 = $2;
 (_DecodeRegField($3,$11)|0);
 $12 = $1;
 STACKTOP = sp;return ($12|0);
}
function _DecodeCField($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $3 = sp + 8|0;
 $2 = $0;
 $4 = HEAP8[(22651)>>0]|0;
 $5 = $4 << 24 >> 24;
 $6 = ($5|0)==(49);
 if ($6) {
  $7 = HEAP8[(22652)>>0]|0;
  HEAP8[$3>>0] = $7;
  $8 = HEAP8[(22653)>>0]|0;
  $9 = ((($3)) + 1|0);
  HEAP8[$9>>0] = $8;
  $10 = HEAP8[(22654)>>0]|0;
  $11 = ((($3)) + 2|0);
  HEAP8[$11>>0] = $10;
  $12 = HEAP8[(22655)>>0]|0;
  $13 = ((($3)) + 3|0);
  HEAP8[$13>>0] = $12;
  $14 = $2;
  (_DecodeRegField($3,$14)|0);
  $16 = $1;
  STACKTOP = sp;return ($16|0);
 } else {
  $15 = $2;
  (_strcpy($15,2707)|0);
  $16 = $1;
  STACKTOP = sp;return ($16|0);
 }
 return (0)|0;
}
function _LoadMirFromControlStore() {
 var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $1 = 0;
 while(1) {
  $2 = $1;
  $3 = ($2|0)<(32);
  if (!($3)) {
   break;
  }
  $4 = HEAP32[1396]|0;
  $5 = (14192 + (($4*33)|0)|0);
  $6 = $1;
  $7 = (($5) + ($6)|0);
  $8 = HEAP8[$7>>0]|0;
  $9 = $1;
  $10 = (22640 + ($9)|0);
  HEAP8[$10>>0] = $8;
  $11 = $1;
  $12 = (($11) + 1)|0;
  $1 = $12;
 }
 $13 = $0;
 STACKTOP = sp;return ($13|0);
}
function _DetermineMmux($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $$sink = 0, $$sink1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
 var $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0;
 var $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $11 = $0&255;
 $12 = $1&255;
 $5 = $11;
 $6 = $12;
 $7 = $2;
 $8 = $3;
 $13 = $7;
 $14 = HEAP8[$13>>0]|0;
 $9 = $14;
 $15 = $7;
 $16 = ((($15)) + 1|0);
 $17 = HEAP8[$16>>0]|0;
 $10 = $17;
 $18 = $9;
 $19 = $18 << 24 >> 24;
 $20 = ($19|0)==(48);
 if ($20) {
  $21 = $10;
  $22 = $21 << 24 >> 24;
  $23 = ($22|0)==(48);
  if ($23) {
   $24 = $8;
   HEAP8[$24>>0] = 48;
  }
 }
 $25 = $9;
 $26 = $25 << 24 >> 24;
 $27 = ($26|0)==(49);
 if ($27) {
  $28 = $10;
  $29 = $28 << 24 >> 24;
  $30 = ($29|0)==(49);
  if ($30) {
   $31 = $8;
   HEAP8[$31>>0] = 49;
  }
 }
 $32 = $9;
 $33 = $32 << 24 >> 24;
 $34 = ($33|0)==(49);
 if ($34) {
  $35 = $10;
  $36 = $35 << 24 >> 24;
  $37 = ($36|0)==(48);
  if ($37) {
   $38 = $6;
   $39 = $38 << 24 >> 24;
   $40 = ($39|0)==(49);
   $41 = $8;
   $$sink = $40 ? 49 : 48;
   HEAP8[$41>>0] = $$sink;
  }
 }
 $42 = $9;
 $43 = $42 << 24 >> 24;
 $44 = ($43|0)==(48);
 if (!($44)) {
  $52 = $4;
  STACKTOP = sp;return ($52|0);
 }
 $45 = $10;
 $46 = $45 << 24 >> 24;
 $47 = ($46|0)==(49);
 if (!($47)) {
  $52 = $4;
  STACKTOP = sp;return ($52|0);
 }
 $48 = $5;
 $49 = $48 << 24 >> 24;
 $50 = ($49|0)==(49);
 $51 = $8;
 $$sink1 = $50 ? 49 : 48;
 HEAP8[$51>>0] = $$sink1;
 $52 = $4;
 STACKTOP = sp;return ($52|0);
}
function _ConvertToCardinal($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $1 = $0;
 $4 = 0;
 $2 = 0;
 while(1) {
  $5 = $2;
  $6 = ($5|0)<=(7);
  if (!($6)) {
   break;
  }
  $7 = $1;
  $8 = $2;
  $9 = (($7) + ($8)|0);
  $10 = HEAP8[$9>>0]|0;
  $11 = $10 << 24 >> 24;
  $12 = ($11|0)==(49);
  if ($12) {
   $3 = 1;
  } else {
   $3 = 0;
  }
  $13 = $4;
  $14 = $13<<1;
  $15 = $3;
  $16 = (($14) + ($15))|0;
  $4 = $16;
  $17 = $2;
  $18 = (($17) + 1)|0;
  $2 = $18;
 }
 $19 = $4;
 STACKTOP = sp;return ($19|0);
}
function _LoadMicroProgramCounter($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $$sink = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0;
 var $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $9 = sp + 12|0;
 $10 = $0&255;
 $11 = $1&255;
 $5 = $10;
 $6 = $11;
 $7 = $2;
 $8 = $3;
 $12 = $5;
 $13 = $12 << 24 >> 24;
 $14 = $6;
 $15 = $14 << 24 >> 24;
 $16 = $7;
 (_DetermineMmux($13,$15,$16,$9)|0);
 $17 = HEAP8[$9>>0]|0;
 $18 = $17 << 24 >> 24;
 $19 = ($18|0)==(48);
 if ($19) {
  $20 = HEAP32[1396]|0;
  $21 = (($20) + 1)|0;
  $$sink = $21;
  HEAP32[1396] = $$sink;
  $24 = $4;
  STACKTOP = sp;return ($24|0);
 } else {
  $22 = $8;
  $23 = (_ConvertToCardinal($22)|0);
  $$sink = $23;
  HEAP32[1396] = $$sink;
  $24 = $4;
  STACKTOP = sp;return ($24|0);
 }
 return (0)|0;
}
function _ActivateControlStore($0,$1,$2,$3,$4,$5,$6,$7,$8,$9,$10,$11) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 $6 = $6|0;
 $7 = $7|0;
 $8 = $8|0;
 $9 = $9|0;
 $10 = $10|0;
 $11 = $11|0;
 var $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0;
 var $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0;
 var $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0;
 var $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
 var $49 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0;
 var $69 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0;
 var $89 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
 $25 = sp + 54|0;
 $26 = sp + 44|0;
 $27 = $0&255;
 $28 = $1&255;
 $13 = $27;
 $14 = $28;
 $15 = $2;
 $16 = $3;
 $17 = $4;
 $18 = $5;
 $19 = $6;
 $20 = $7;
 $21 = $8;
 $22 = $9;
 $23 = $10;
 $24 = $11;
 $29 = (_FirstSubcycle()|0);
 $30 = ($29|0)!=(0);
 if ($30) {
  (_LoadMirFromControlStore()|0);
  $31 = HEAP8[22640]|0;
  $32 = $18;
  HEAP8[$32>>0] = $31;
  $33 = HEAP8[(22643)>>0]|0;
  $34 = $19;
  HEAP8[$34>>0] = $33;
  $35 = HEAP8[(22644)>>0]|0;
  $36 = $19;
  $37 = ((($36)) + 1|0);
  HEAP8[$37>>0] = $35;
  $38 = HEAP8[(22645)>>0]|0;
  $39 = $20;
  HEAP8[$39>>0] = $38;
  $40 = HEAP8[(22646)>>0]|0;
  $41 = $20;
  $42 = ((($41)) + 1|0);
  HEAP8[$42>>0] = $40;
  $43 = HEAP8[(22647)>>0]|0;
  $44 = $21;
  HEAP8[$44>>0] = $43;
  $45 = HEAP8[(22648)>>0]|0;
  $46 = $22;
  HEAP8[$46>>0] = $45;
  $47 = HEAP8[(22649)>>0]|0;
  $48 = $23;
  HEAP8[$48>>0] = $47;
  $49 = HEAP8[(22650)>>0]|0;
  $50 = $24;
  HEAP8[$50>>0] = $49;
 }
 $51 = (_SecondSubcycle()|0);
 $52 = ($51|0)!=(0);
 if ($52) {
  $53 = $15;
  (_DecodeAField($53)|0);
  $54 = $16;
  (_DecodeBField($54)|0);
  $55 = HEAP8[22640]|0;
  $56 = $18;
  HEAP8[$56>>0] = $55;
  $57 = HEAP8[(22643)>>0]|0;
  $58 = $19;
  HEAP8[$58>>0] = $57;
  $59 = HEAP8[(22644)>>0]|0;
  $60 = $19;
  $61 = ((($60)) + 1|0);
  HEAP8[$61>>0] = $59;
  $62 = HEAP8[(22645)>>0]|0;
  $63 = $20;
  HEAP8[$63>>0] = $62;
  $64 = HEAP8[(22646)>>0]|0;
  $65 = $20;
  $66 = ((($65)) + 1|0);
  HEAP8[$66>>0] = $64;
  $67 = HEAP8[(22647)>>0]|0;
  $68 = $21;
  HEAP8[$68>>0] = $67;
  $69 = HEAP8[(22648)>>0]|0;
  $70 = $22;
  HEAP8[$70>>0] = $69;
  $71 = HEAP8[(22649)>>0]|0;
  $72 = $23;
  HEAP8[$72>>0] = $71;
  $73 = HEAP8[(22650)>>0]|0;
  $74 = $24;
  HEAP8[$74>>0] = $73;
 }
 $75 = (_ThirdSubcycle()|0);
 $76 = ($75|0)!=(0);
 if ($76) {
  $77 = HEAP8[22640]|0;
  $78 = $18;
  HEAP8[$78>>0] = $77;
  $79 = HEAP8[(22643)>>0]|0;
  $80 = $19;
  HEAP8[$80>>0] = $79;
  $81 = HEAP8[(22644)>>0]|0;
  $82 = $19;
  $83 = ((($82)) + 1|0);
  HEAP8[$83>>0] = $81;
  $84 = HEAP8[(22645)>>0]|0;
  $85 = $20;
  HEAP8[$85>>0] = $84;
  $86 = HEAP8[(22646)>>0]|0;
  $87 = $20;
  $88 = ((($87)) + 1|0);
  HEAP8[$88>>0] = $86;
  $89 = HEAP8[(22647)>>0]|0;
  $90 = $21;
  HEAP8[$90>>0] = $89;
  $91 = HEAP8[(22648)>>0]|0;
  $92 = $22;
  HEAP8[$92>>0] = $91;
  $93 = HEAP8[(22649)>>0]|0;
  $94 = $23;
  HEAP8[$94>>0] = $93;
  $95 = HEAP8[(22650)>>0]|0;
  $96 = $24;
  HEAP8[$96>>0] = $95;
 }
 $97 = (_FourthSubcycle()|0);
 $98 = ($97|0)!=(0);
 if (!($98)) {
  $142 = $12;
  STACKTOP = sp;return ($142|0);
 }
 $99 = $17;
 (_DecodeCField($99)|0);
 $100 = HEAP8[(22641)>>0]|0;
 HEAP8[$25>>0] = $100;
 $101 = HEAP8[(22642)>>0]|0;
 $102 = ((($25)) + 1|0);
 HEAP8[$102>>0] = $101;
 $103 = HEAP8[(22664)>>0]|0;
 HEAP8[$26>>0] = $103;
 $104 = HEAP8[(22665)>>0]|0;
 $105 = ((($26)) + 1|0);
 HEAP8[$105>>0] = $104;
 $106 = HEAP8[(22666)>>0]|0;
 $107 = ((($26)) + 2|0);
 HEAP8[$107>>0] = $106;
 $108 = HEAP8[(22667)>>0]|0;
 $109 = ((($26)) + 3|0);
 HEAP8[$109>>0] = $108;
 $110 = HEAP8[(22668)>>0]|0;
 $111 = ((($26)) + 4|0);
 HEAP8[$111>>0] = $110;
 $112 = HEAP8[(22669)>>0]|0;
 $113 = ((($26)) + 5|0);
 HEAP8[$113>>0] = $112;
 $114 = HEAP8[(22670)>>0]|0;
 $115 = ((($26)) + 6|0);
 HEAP8[$115>>0] = $114;
 $116 = HEAP8[(22671)>>0]|0;
 $117 = ((($26)) + 7|0);
 HEAP8[$117>>0] = $116;
 $118 = $13;
 $119 = $118 << 24 >> 24;
 $120 = $14;
 $121 = $120 << 24 >> 24;
 (_LoadMicroProgramCounter($119,$121,$25,$26)|0);
 $122 = HEAP8[22640]|0;
 $123 = $18;
 HEAP8[$123>>0] = $122;
 $124 = HEAP8[(22643)>>0]|0;
 $125 = $19;
 HEAP8[$125>>0] = $124;
 $126 = HEAP8[(22644)>>0]|0;
 $127 = $19;
 $128 = ((($127)) + 1|0);
 HEAP8[$128>>0] = $126;
 $129 = HEAP8[(22645)>>0]|0;
 $130 = $20;
 HEAP8[$130>>0] = $129;
 $131 = HEAP8[(22646)>>0]|0;
 $132 = $20;
 $133 = ((($132)) + 1|0);
 HEAP8[$133>>0] = $131;
 $134 = HEAP8[(22647)>>0]|0;
 $135 = $21;
 HEAP8[$135>>0] = $134;
 $136 = HEAP8[(22648)>>0]|0;
 $137 = $22;
 HEAP8[$137>>0] = $136;
 $138 = HEAP8[(22649)>>0]|0;
 $139 = $23;
 HEAP8[$139>>0] = $138;
 $140 = HEAP8[(22650)>>0]|0;
 $141 = $24;
 HEAP8[$141>>0] = $140;
 $142 = $12;
 STACKTOP = sp;return ($142|0);
}
function _FirstSubcycle() {
 var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $1 = HEAP32[1547]|0;
 $2 = ($1|0)==(1);
 if ($2) {
  $0 = 1;
 } else {
  $0 = 0;
 }
 $3 = $0;
 STACKTOP = sp;return ($3|0);
}
function _SecondSubcycle() {
 var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $1 = HEAP32[1547]|0;
 $2 = ($1|0)==(2);
 if ($2) {
  $0 = 1;
 } else {
  $0 = 0;
 }
 $3 = $0;
 STACKTOP = sp;return ($3|0);
}
function _ThirdSubcycle() {
 var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $1 = HEAP32[1547]|0;
 $2 = ($1|0)==(3);
 if ($2) {
  $0 = 1;
 } else {
  $0 = 0;
 }
 $3 = $0;
 STACKTOP = sp;return ($3|0);
}
function _FourthSubcycle() {
 var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $1 = HEAP32[1547]|0;
 $2 = ($1|0)==(4);
 if ($2) {
  $0 = 1;
 } else {
  $0 = 0;
 }
 $3 = $0;
 STACKTOP = sp;return ($3|0);
}
function _Cycle() {
 var $0 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = HEAP32[1546]|0;
 return ($0|0);
}
function _GeneratePulse() {
 var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = HEAP32[1547]|0;
 $1 = (($0|0) % 4)&-1;
 $2 = (($1) + 1)|0;
 HEAP32[1547] = $2;
 $3 = HEAP32[1547]|0;
 $4 = ($3|0)==(1);
 if (!($4)) {
  return;
 }
 $5 = HEAP32[1546]|0;
 $6 = (($5) + 1)|0;
 HEAP32[1546] = $6;
 return;
}
function _ActivateCpu($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $4 = $0;
 $5 = $1;
 $6 = $2;
 $7 = $3;
 $8 = HEAP8[22673]|0;
 $9 = $8 << 24 >> 24;
 $10 = HEAP8[22674]|0;
 $11 = $10 << 24 >> 24;
 $12 = $6;
 $13 = $7;
 (_ActivateControlStore($9,$11,22675,22692,22709,22726,22727,22729,22731,22732,$12,$13)|0);
 $14 = $4;
 $15 = $5;
 $16 = HEAP8[22726]|0;
 $17 = $16 << 24 >> 24;
 $18 = HEAP8[22731]|0;
 $19 = $18 << 24 >> 24;
 $20 = HEAP8[22732]|0;
 $21 = $20 << 24 >> 24;
 (_ActivateDataPath($14,$15,22675,22692,22709,$17,22727,22729,$19,$21,22673,22674)|0);
 STACKTOP = sp;return;
}
function _DumpRegisters() {
 var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer10 = 0, $vararg_buffer14 = 0, $vararg_buffer18 = 0, $vararg_buffer2 = 0, $vararg_buffer22 = 0, $vararg_buffer26 = 0;
 var $vararg_buffer30 = 0, $vararg_buffer34 = 0, $vararg_buffer38 = 0, $vararg_buffer6 = 0, $vararg_ptr1 = 0, $vararg_ptr13 = 0, $vararg_ptr17 = 0, $vararg_ptr21 = 0, $vararg_ptr25 = 0, $vararg_ptr29 = 0, $vararg_ptr33 = 0, $vararg_ptr37 = 0, $vararg_ptr41 = 0, $vararg_ptr5 = 0, $vararg_ptr9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(96|0);
 $vararg_buffer38 = sp + 80|0;
 $vararg_buffer34 = sp + 72|0;
 $vararg_buffer30 = sp + 64|0;
 $vararg_buffer26 = sp + 56|0;
 $vararg_buffer22 = sp + 48|0;
 $vararg_buffer18 = sp + 40|0;
 $vararg_buffer14 = sp + 32|0;
 $vararg_buffer10 = sp + 24|0;
 $vararg_buffer6 = sp + 16|0;
 $vararg_buffer2 = sp + 8|0;
 $vararg_buffer = sp;
 $1 = (_btoi(1963)|0);
 HEAP32[$vararg_buffer>>2] = 1963;
 $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
 HEAP32[$vararg_ptr1>>2] = $1;
 (_printf(2150,$vararg_buffer)|0);
 $2 = (_btoi(1980)|0);
 HEAP32[$vararg_buffer2>>2] = 1980;
 $vararg_ptr5 = ((($vararg_buffer2)) + 4|0);
 HEAP32[$vararg_ptr5>>2] = $2;
 (_printf(2187,$vararg_buffer2)|0);
 $3 = (_btoi(2014)|0);
 HEAP32[$vararg_buffer6>>2] = 2014;
 $vararg_ptr9 = ((($vararg_buffer6)) + 4|0);
 HEAP32[$vararg_ptr9>>2] = $3;
 (_printf(2223,$vararg_buffer6)|0);
 $4 = (_btoi(2031)|0);
 HEAP32[$vararg_buffer10>>2] = 2031;
 $vararg_ptr13 = ((($vararg_buffer10)) + 4|0);
 HEAP32[$vararg_ptr13>>2] = $4;
 (_printf(2259,$vararg_buffer10)|0);
 $5 = (_btoi(1997)|0);
 HEAP32[$vararg_buffer14>>2] = 1997;
 $vararg_ptr17 = ((($vararg_buffer14)) + 4|0);
 HEAP32[$vararg_ptr17>>2] = $5;
 (_printf(2295,$vararg_buffer14)|0);
 $6 = (_btoi(2048)|0);
 HEAP32[$vararg_buffer18>>2] = 2048;
 $vararg_ptr21 = ((($vararg_buffer18)) + 4|0);
 HEAP32[$vararg_ptr21>>2] = $6;
 (_printf(2331,$vararg_buffer18)|0);
 $7 = (_btoi(2065)|0);
 HEAP32[$vararg_buffer22>>2] = 2065;
 $vararg_ptr25 = ((($vararg_buffer22)) + 4|0);
 HEAP32[$vararg_ptr25>>2] = $7;
 (_printf(2367,$vararg_buffer22)|0);
 $8 = (_btoi(2082)|0);
 HEAP32[$vararg_buffer26>>2] = 2082;
 $vararg_ptr29 = ((($vararg_buffer26)) + 4|0);
 HEAP32[$vararg_ptr29>>2] = $8;
 (_printf(2403,$vararg_buffer26)|0);
 $9 = (_btoi(2099)|0);
 HEAP32[$vararg_buffer30>>2] = 2099;
 $vararg_ptr33 = ((($vararg_buffer30)) + 4|0);
 HEAP32[$vararg_ptr33>>2] = $9;
 (_printf(2439,$vararg_buffer30)|0);
 $10 = (_btoi(2116)|0);
 HEAP32[$vararg_buffer34>>2] = 2116;
 $vararg_ptr37 = ((($vararg_buffer34)) + 4|0);
 HEAP32[$vararg_ptr37>>2] = $10;
 (_printf(2475,$vararg_buffer34)|0);
 $11 = (_btoi(2133)|0);
 HEAP32[$vararg_buffer38>>2] = 2133;
 $vararg_ptr41 = ((($vararg_buffer38)) + 4|0);
 HEAP32[$vararg_ptr41>>2] = $11;
 (_printf(2511,$vararg_buffer38)|0);
 $12 = $0;
 STACKTOP = sp;return ($12|0);
}
function _LoadMar($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $2 = $0;
 $3 = 0;
 while(1) {
  $4 = $3;
  $5 = ($4|0)<=(11);
  if (!($5)) {
   break;
  }
  $6 = $2;
  $7 = $3;
  $8 = (($7) + 4)|0;
  $9 = (($6) + ($8)|0);
  $10 = HEAP8[$9>>0]|0;
  $11 = $3;
  $12 = (22733 + ($11)|0);
  HEAP8[$12>>0] = $10;
  $13 = $3;
  $14 = (($13) + 1)|0;
  $3 = $14;
 }
 $15 = $1;
 STACKTOP = sp;return ($15|0);
}
function _SelectRegister($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $1 = $0;
 $3 = 16;
 $2 = 0;
 while(1) {
  $4 = $2;
  $5 = ($4|0)<(17);
  if (!($5)) {
   break;
  }
  $6 = $1;
  $7 = $2;
  $8 = (($6) + ($7)|0);
  $9 = HEAP8[$8>>0]|0;
  $10 = $9 << 24 >> 24;
  $11 = ($10|0)==(49);
  if ($11) {
   $12 = $2;
   $3 = $12;
  }
  $13 = $2;
  $14 = (($13) + 1)|0;
  $2 = $14;
 }
 $15 = $3;
 STACKTOP = sp;return ($15|0);
}
function _LoadALatch($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $2 = $0;
 $4 = $2;
 $5 = (_SelectRegister($4)|0);
 $3 = $5;
 $6 = $3;
 do {
  switch ($6|0) {
  case 0:  {
   (_strcpy(22746,1963)|0);
   break;
  }
  case 1:  {
   (_strcpy(22746,1980)|0);
   break;
  }
  case 2:  {
   (_strcpy(22746,1997)|0);
   break;
  }
  case 3:  {
   (_strcpy(22746,2014)|0);
   break;
  }
  case 4:  {
   (_strcpy(22746,2031)|0);
   break;
  }
  case 5:  {
   (_strcpy(22746,22763)|0);
   break;
  }
  case 6:  {
   (_strcpy(22746,22780)|0);
   break;
  }
  case 7:  {
   (_strcpy(22746,22797)|0);
   break;
  }
  case 8:  {
   (_strcpy(22746,22814)|0);
   break;
  }
  case 9:  {
   (_strcpy(22746,22831)|0);
   break;
  }
  case 10:  {
   (_strcpy(22746,2048)|0);
   break;
  }
  case 11:  {
   (_strcpy(22746,2065)|0);
   break;
  }
  case 12:  {
   (_strcpy(22746,2082)|0);
   break;
  }
  case 13:  {
   (_strcpy(22746,2099)|0);
   break;
  }
  case 14:  {
   (_strcpy(22746,2116)|0);
   break;
  }
  case 15:  {
   (_strcpy(22746,2133)|0);
   break;
  }
  default: {
  }
  }
 } while(0);
 $7 = $1;
 STACKTOP = sp;return ($7|0);
}
function _LoadBLatch($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $2 = $0;
 $4 = $2;
 $5 = (_SelectRegister($4)|0);
 $3 = $5;
 $6 = $3;
 do {
  switch ($6|0) {
  case 0:  {
   (_strcpy(22848,1963)|0);
   break;
  }
  case 1:  {
   (_strcpy(22848,1980)|0);
   break;
  }
  case 2:  {
   (_strcpy(22848,1997)|0);
   break;
  }
  case 3:  {
   (_strcpy(22848,2014)|0);
   break;
  }
  case 4:  {
   (_strcpy(22848,2031)|0);
   break;
  }
  case 5:  {
   (_strcpy(22848,22763)|0);
   break;
  }
  case 6:  {
   (_strcpy(22848,22780)|0);
   break;
  }
  case 7:  {
   (_strcpy(22848,22797)|0);
   break;
  }
  case 8:  {
   (_strcpy(22848,22814)|0);
   break;
  }
  case 9:  {
   (_strcpy(22848,22831)|0);
   break;
  }
  case 10:  {
   (_strcpy(22848,2048)|0);
   break;
  }
  case 11:  {
   (_strcpy(22848,2065)|0);
   break;
  }
  case 12:  {
   (_strcpy(22848,2082)|0);
   break;
  }
  case 13:  {
   (_strcpy(22848,2099)|0);
   break;
  }
  case 14:  {
   (_strcpy(22848,2116)|0);
   break;
  }
  case 15:  {
   (_strcpy(22848,2133)|0);
   break;
  }
  default: {
  }
  }
 } while(0);
 $7 = $1;
 STACKTOP = sp;return ($7|0);
}
function _LoadRegisterBank($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
 var $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $3 = $0;
 $4 = $1;
 $6 = $3;
 $7 = (_SelectRegister($6)|0);
 $5 = $7;
 $8 = $5;
 do {
  switch ($8|0) {
  case 0:  {
   $9 = $4;
   (_strcpy(1963,$9)|0);
   break;
  }
  case 1:  {
   $10 = $4;
   (_strcpy(1980,$10)|0);
   break;
  }
  case 2:  {
   $11 = $4;
   (_strcpy(1997,$11)|0);
   break;
  }
  case 3:  {
   $12 = $4;
   (_strcpy(2014,$12)|0);
   break;
  }
  case 4:  {
   $13 = $4;
   (_strcpy(2031,$13)|0);
   break;
  }
  case 10:  {
   $14 = $4;
   (_strcpy(2048,$14)|0);
   break;
  }
  case 11:  {
   $15 = $4;
   (_strcpy(2065,$15)|0);
   break;
  }
  case 12:  {
   $16 = $4;
   (_strcpy(2082,$16)|0);
   break;
  }
  case 13:  {
   $17 = $4;
   (_strcpy(2099,$17)|0);
   break;
  }
  case 14:  {
   $18 = $4;
   (_strcpy(2116,$18)|0);
   break;
  }
  case 15:  {
   $19 = $4;
   (_strcpy(2133,$19)|0);
   break;
  }
  case 16:  {
   $20 = $4;
   $21 = $4;
   (_strcpy($20,$21)|0);
   break;
  }
  default: {
  }
  }
 } while(0);
 $22 = $2;
 STACKTOP = sp;return ($22|0);
}
function _ActivateDataPath($0,$1,$2,$3,$4,$5,$6,$7,$8,$9,$10,$11) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 $6 = $6|0;
 $7 = $7|0;
 $8 = $8|0;
 $9 = $9|0;
 $10 = $10|0;
 $11 = $11|0;
 var $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0;
 var $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $50 = 0, $51 = 0;
 var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(80|0);
 $25 = sp + 57|0;
 $26 = sp + 40|0;
 $27 = $5&255;
 $28 = $8&255;
 $29 = $9&255;
 $13 = $0;
 $14 = $1;
 $15 = $2;
 $16 = $3;
 $17 = $4;
 $18 = $27;
 $19 = $6;
 $20 = $7;
 $21 = $28;
 $22 = $29;
 $23 = $10;
 $24 = $11;
 $30 = $13;
 (_strcpy(22733,$30)|0);
 $31 = $14;
 (_strcpy(22865,$31)|0);
 $32 = (_SecondSubcycle()|0);
 $33 = ($32|0)!=(0);
 if ($33) {
  $34 = $15;
  (_LoadALatch($34)|0);
  $35 = $16;
  (_LoadBLatch($35)|0);
 }
 $36 = (_ThirdSubcycle()|0);
 $37 = ($36|0)!=(0);
 if ($37) {
  $38 = $18;
  $39 = $38 << 24 >> 24;
  $40 = ($39|0)==(49);
  if ($40) {
   (_strcpy($25,22865)|0);
  } else {
   (_strcpy($25,22746)|0);
  }
  $41 = $22;
  $42 = $41 << 24 >> 24;
  $43 = ($42|0)==(49);
  if ($43) {
   (_LoadMar(22848)|0);
   $44 = $13;
   (_strcpy($44,22733)|0);
  }
  (_strcpy($26,22848)|0);
  $45 = $19;
  $46 = $23;
  $47 = $24;
  (_ActivateAlu($25,$26,$45,22882,$46,$47)|0);
  $48 = $20;
  (_ActivateShifter(22882,$48,22899)|0);
 }
 $49 = (_FourthSubcycle()|0);
 $50 = ($49|0)!=(0);
 if (!($50)) {
  $56 = $12;
  STACKTOP = sp;return ($56|0);
 }
 $51 = $17;
 (_LoadRegisterBank($51,22899)|0);
 $52 = $21;
 $53 = $52 << 24 >> 24;
 $54 = ($53|0)==(49);
 if (!($54)) {
  $56 = $12;
  STACKTOP = sp;return ($56|0);
 }
 (_strcpy(22865,22899)|0);
 $55 = $14;
 (_strcpy($55,22899)|0);
 $56 = $12;
 STACKTOP = sp;return ($56|0);
}
function _InitializePCandStackPointer($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$sink = 0, $$sink6 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
 var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
 var $9 = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $vararg_buffer = 0, $vararg_ptr7 = 0, $vararg_ptr8 = 0, $vararg_ptr9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(80|0);
 $vararg_buffer = sp;
 $4 = sp + 49|0;
 $5 = sp + 32|0;
 $2 = $0;
 $3 = $1;
 $7 = 32768;
 $8 = $2;
 $9 = ($8|0)<(0);
 $10 = $3;
 $11 = ($10|0)<(0);
 $or$cond = $9 | $11;
 $12 = $2;
 $13 = ($12|0)>(2047);
 $or$cond3 = $or$cond | $13;
 $14 = $3;
 $15 = ($14|0)>(4095);
 $or$cond5 = $or$cond3 | $15;
 if ($or$cond5) {
  (_strcpy(1963,2707)|0);
  (_strcpy(1997,2547)|0);
  (_strcpy(22763,2707)|0);
  (_strcpy(22780,2636)|0);
  (_strcpy(22797,2690)|0);
  (_strcpy(22814,2653)|0);
  (_strcpy(22831,2670)|0);
  STACKTOP = sp;return;
 }
 $6 = 0;
 while(1) {
  $16 = $6;
  $17 = ($16|0)<(16);
  if (!($17)) {
   break;
  }
  $18 = $2;
  $19 = $7;
  $20 = $6;
  $21 = $19 >> $20;
  $22 = $18 & $21;
  $23 = ($22|0)!=(0);
  $24 = $6;
  $25 = (($4) + ($24)|0);
  $$sink = $23 ? 49 : 48;
  HEAP8[$25>>0] = $$sink;
  $26 = $3;
  $27 = $7;
  $28 = $6;
  $29 = $27 >> $28;
  $30 = $26 & $29;
  $31 = ($30|0)!=(0);
  $32 = $6;
  $33 = (($5) + ($32)|0);
  $$sink6 = $31 ? 49 : 48;
  HEAP8[$33>>0] = $$sink6;
  $34 = $6;
  $35 = (($34) + 1)|0;
  $6 = $35;
 }
 $36 = ((($4)) + 16|0);
 HEAP8[$36>>0] = 0;
 $37 = ((($5)) + 16|0);
 HEAP8[$37>>0] = 0;
 (_strcpy(1963,$4)|0);
 (_strcpy(1997,$5)|0);
 $38 = HEAP32[144]|0;
 $39 = (_btoi($4)|0);
 $40 = (_btoi($5)|0);
 HEAP32[$vararg_buffer>>2] = $4;
 $vararg_ptr7 = ((($vararg_buffer)) + 4|0);
 HEAP32[$vararg_ptr7>>2] = $39;
 $vararg_ptr8 = ((($vararg_buffer)) + 8|0);
 HEAP32[$vararg_ptr8>>2] = $5;
 $vararg_ptr9 = ((($vararg_buffer)) + 12|0);
 HEAP32[$vararg_ptr9>>2] = $40;
 (_fprintf($38,2564,$vararg_buffer)|0);
 (_strcpy(22763,2707)|0);
 (_strcpy(22780,2636)|0);
 (_strcpy(22797,2690)|0);
 (_strcpy(22814,2653)|0);
 (_strcpy(22831,2670)|0);
 STACKTOP = sp;return;
}
function _ActivateMemoryChip0($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
 var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $10 = $2&255;
 $11 = $3&255;
 $5 = $0;
 $6 = $1;
 $7 = $10;
 $8 = $11;
 $12 = $7;
 $13 = $12 << 24 >> 24;
 $14 = ($13|0)==(49);
 if ($14) {
  $9 = 0;
  while(1) {
   $15 = $9;
   $16 = ($15|0)<(16);
   if (!($16)) {
    break;
   }
   $17 = $5;
   $18 = (22916 + (($17*17)|0)|0);
   $19 = $9;
   $20 = (($18) + ($19)|0);
   $21 = HEAP8[$20>>0]|0;
   $22 = $6;
   $23 = $9;
   $24 = (($22) + ($23)|0);
   HEAP8[$24>>0] = $21;
   $25 = $9;
   $26 = (($25) + 1)|0;
   $9 = $26;
  }
  $42 = $4;
  STACKTOP = sp;return ($42|0);
 }
 $27 = $8;
 $28 = $27 << 24 >> 24;
 $29 = ($28|0)==(49);
 if (!($29)) {
  $42 = $4;
  STACKTOP = sp;return ($42|0);
 }
 $9 = 0;
 while(1) {
  $30 = $9;
  $31 = ($30|0)<(16);
  if (!($31)) {
   break;
  }
  $32 = $6;
  $33 = $9;
  $34 = (($32) + ($33)|0);
  $35 = HEAP8[$34>>0]|0;
  $36 = $5;
  $37 = (22916 + (($36*17)|0)|0);
  $38 = $9;
  $39 = (($37) + ($38)|0);
  HEAP8[$39>>0] = $35;
  $40 = $9;
  $41 = (($40) + 1)|0;
  $9 = $41;
 }
 $42 = $4;
 STACKTOP = sp;return ($42|0);
}
function _ActivateMemoryChip1($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
 var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $10 = $2&255;
 $11 = $3&255;
 $5 = $0;
 $6 = $1;
 $7 = $10;
 $8 = $11;
 $12 = $7;
 $13 = $12 << 24 >> 24;
 $14 = ($13|0)==(49);
 if ($14) {
  $9 = 0;
  while(1) {
   $15 = $9;
   $16 = ($15|0)<(16);
   if (!($16)) {
    break;
   }
   $17 = $5;
   $18 = (40324 + (($17*17)|0)|0);
   $19 = $9;
   $20 = (($18) + ($19)|0);
   $21 = HEAP8[$20>>0]|0;
   $22 = $6;
   $23 = $9;
   $24 = (($22) + ($23)|0);
   HEAP8[$24>>0] = $21;
   $25 = $9;
   $26 = (($25) + 1)|0;
   $9 = $26;
  }
  $42 = $4;
  STACKTOP = sp;return ($42|0);
 }
 $27 = $8;
 $28 = $27 << 24 >> 24;
 $29 = ($28|0)==(49);
 if (!($29)) {
  $42 = $4;
  STACKTOP = sp;return ($42|0);
 }
 $9 = 0;
 while(1) {
  $30 = $9;
  $31 = ($30|0)<(16);
  if (!($31)) {
   break;
  }
  $32 = $6;
  $33 = $9;
  $34 = (($32) + ($33)|0);
  $35 = HEAP8[$34>>0]|0;
  $36 = $5;
  $37 = (40324 + (($36*17)|0)|0);
  $38 = $9;
  $39 = (($37) + ($38)|0);
  HEAP8[$39>>0] = $35;
  $40 = $9;
  $41 = (($40) + 1)|0;
  $9 = $41;
 }
 $42 = $4;
 STACKTOP = sp;return ($42|0);
}
function _ActivateMemoryChip2($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
 var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $10 = $2&255;
 $11 = $3&255;
 $5 = $0;
 $6 = $1;
 $7 = $10;
 $8 = $11;
 $12 = $7;
 $13 = $12 << 24 >> 24;
 $14 = ($13|0)==(49);
 if ($14) {
  $9 = 0;
  while(1) {
   $15 = $9;
   $16 = ($15|0)<(16);
   if (!($16)) {
    break;
   }
   $17 = $5;
   $18 = (57732 + (($17*17)|0)|0);
   $19 = $9;
   $20 = (($18) + ($19)|0);
   $21 = HEAP8[$20>>0]|0;
   $22 = $6;
   $23 = $9;
   $24 = (($22) + ($23)|0);
   HEAP8[$24>>0] = $21;
   $25 = $9;
   $26 = (($25) + 1)|0;
   $9 = $26;
  }
  $42 = $4;
  STACKTOP = sp;return ($42|0);
 }
 $27 = $8;
 $28 = $27 << 24 >> 24;
 $29 = ($28|0)==(49);
 if (!($29)) {
  $42 = $4;
  STACKTOP = sp;return ($42|0);
 }
 $9 = 0;
 while(1) {
  $30 = $9;
  $31 = ($30|0)<(16);
  if (!($31)) {
   break;
  }
  $32 = $6;
  $33 = $9;
  $34 = (($32) + ($33)|0);
  $35 = HEAP8[$34>>0]|0;
  $36 = $5;
  $37 = (57732 + (($36*17)|0)|0);
  $38 = $9;
  $39 = (($37) + ($38)|0);
  HEAP8[$39>>0] = $35;
  $40 = $9;
  $41 = (($40) + 1)|0;
  $9 = $41;
 }
 $42 = $4;
 STACKTOP = sp;return ($42|0);
}
function _ActivateMemoryChip3($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $$sink = 0, $$sink1 = 0, $$sink2 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0;
 var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0;
 var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0;
 var $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0;
 var $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0;
 var $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
 var $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0;
 var $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0;
 var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0;
 var $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $10 = sp + 16|0;
 $11 = $2&255;
 $12 = $3&255;
 $5 = $0;
 $6 = $1;
 $7 = $11;
 $8 = $12;
 $13 = HEAP32[1400]|0;
 $14 = (($13) + 1)|0;
 HEAP32[1400] = $14;
 $15 = $7;
 $16 = $15 << 24 >> 24;
 $17 = ($16|0)==(49);
 if ($17) {
  $18 = $5;
  switch ($18|0) {
  case 1022:  {
   $9 = 0;
   while(1) {
    $31 = $9;
    $32 = ($31|0)<(16);
    if (!($32)) {
     break;
    }
    $33 = $5;
    $34 = (75140 + (($33*17)|0)|0);
    $35 = $9;
    $36 = (($34) + ($35)|0);
    $37 = HEAP8[$36>>0]|0;
    $38 = $6;
    $39 = $9;
    $40 = (($38) + ($39)|0);
    HEAP8[$40>>0] = $37;
    $41 = $9;
    $42 = (($41) + 1)|0;
    $9 = $42;
   }
   $199 = $4;
   STACKTOP = sp;return ($199|0);
   break;
  }
  case 1021:  {
   $9 = 0;
   while(1) {
    $43 = $9;
    $44 = ($43|0)<(16);
    if (!($44)) {
     break;
    }
    $45 = $5;
    $46 = (75140 + (($45*17)|0)|0);
    $47 = $9;
    $48 = (($46) + ($47)|0);
    $49 = HEAP8[$48>>0]|0;
    $50 = $6;
    $51 = $9;
    $52 = (($50) + ($51)|0);
    HEAP8[$52>>0] = $49;
    $53 = $9;
    $54 = (($53) + 1)|0;
    $9 = $54;
   }
   $199 = $4;
   STACKTOP = sp;return ($199|0);
   break;
  }
  case 1020:  {
   $55 = HEAP32[1401]|0;
   $56 = (($55) + 1)|0;
   HEAP32[1401] = $56;
   $57 = (($55|0) % 8)&-1;
   $58 = ($57|0)==(0);
   if ($58) {
    $59 = HEAP8[(92511)>>0]|0;
    $60 = $59 << 24 >> 24;
    $61 = ($60|0)==(49);
    if ($61) {
     $62 = HEAP8[(92509)>>0]|0;
     $63 = $62 << 24 >> 24;
     $64 = ($63|0)==(49);
     if ($64) {
      $65 = HEAP32[1390]|0;
      $66 = (6192 + (($65*80)|0)|0);
      $67 = HEAP32[1391]|0;
      $68 = (($66) + ($67)|0);
      (_True_ascii_to_mem_ascii((92480),$68)|0);
      $69 = HEAP32[1390]|0;
      $70 = (6192 + (($69*80)|0)|0);
      $71 = HEAP32[1391]|0;
      $72 = (($71) + 1)|0;
      HEAP32[1391] = $72;
      $73 = (($70) + ($72)|0);
      $74 = HEAP8[$73>>0]|0;
      $75 = $74 << 24 >> 24;
      $76 = ($75|0)==(0);
      if ($76) {
       HEAP32[1391] = 0;
       $77 = HEAP32[1390]|0;
       $78 = (6192 + (($77*80)|0)|0);
       $79 = HEAP32[1391]|0;
       $80 = (($78) + ($79)|0);
       HEAP8[$80>>0] = 0;
       $81 = HEAP32[1390]|0;
       $82 = (($81) + 1)|0;
       $83 = (($82|0) % 100)&-1;
       HEAP32[1390] = $83;
       $84 = HEAP32[1390]|0;
       $85 = (6192 + (($84*80)|0)|0);
       $86 = HEAP32[1391]|0;
       $87 = (($85) + ($86)|0);
       $88 = HEAP8[$87>>0]|0;
       $89 = $88 << 24 >> 24;
       $90 = ($89|0)==(0);
       $$sink2 = $90 ? 49 : 48;
       $$sink1 = $90 ? 48 : 49;
       $$sink = $90 ? 1 : 0;
       HEAP8[(92512)>>0] = $$sink2;
       HEAP8[(92511)>>0] = $$sink1;
       HEAP32[1389] = $$sink;
      }
     }
    }
   }
   $9 = 0;
   while(1) {
    $91 = $9;
    $92 = ($91|0)<(16);
    if (!($92)) {
     break;
    }
    $93 = $5;
    $94 = (75140 + (($93*17)|0)|0);
    $95 = $9;
    $96 = (($94) + ($95)|0);
    $97 = HEAP8[$96>>0]|0;
    $98 = $6;
    $99 = $9;
    $100 = (($98) + ($99)|0);
    HEAP8[$100>>0] = $97;
    $101 = $9;
    $102 = (($101) + 1)|0;
    $9 = $102;
   }
   $199 = $4;
   STACKTOP = sp;return ($199|0);
   break;
  }
  default: {
   $9 = 0;
   while(1) {
    $19 = $9;
    $20 = ($19|0)<(16);
    if (!($20)) {
     break;
    }
    $21 = $5;
    $22 = (75140 + (($21*17)|0)|0);
    $23 = $9;
    $24 = (($22) + ($23)|0);
    $25 = HEAP8[$24>>0]|0;
    $26 = $6;
    $27 = $9;
    $28 = (($26) + ($27)|0);
    HEAP8[$28>>0] = $25;
    $29 = $9;
    $30 = (($29) + 1)|0;
    $9 = $30;
   }
   $199 = $4;
   STACKTOP = sp;return ($199|0);
  }
  }
 }
 $103 = $8;
 $104 = $103 << 24 >> 24;
 $105 = ($104|0)==(49);
 if (!($105)) {
  $199 = $4;
  STACKTOP = sp;return ($199|0);
 }
 $106 = $5;
 switch ($106|0) {
 case 1022:  {
  $119 = HEAP32[1400]|0;
  $120 = (($119|0) % 4)&-1;
  $121 = ($120|0)==(0);
  if (!($121)) {
   $199 = $4;
   STACKTOP = sp;return ($199|0);
  }
  $122 = HEAP8[(92543)>>0]|0;
  $123 = $122 << 24 >> 24;
  $124 = ($123|0)==(49);
  if (!($124)) {
   $199 = $4;
   STACKTOP = sp;return ($199|0);
  }
  $125 = HEAP8[(92545)>>0]|0;
  $126 = $125 << 24 >> 24;
  $127 = ($126|0)==(49);
  if (!($127)) {
   $199 = $4;
   STACKTOP = sp;return ($199|0);
  }
  $9 = 0;
  while(1) {
   $128 = $9;
   $129 = ($128|0)<(16);
   $130 = $6;
   if (!($129)) {
    break;
   }
   $131 = $9;
   $132 = (($130) + ($131)|0);
   $133 = HEAP8[$132>>0]|0;
   $134 = $5;
   $135 = (75140 + (($134*17)|0)|0);
   $136 = $9;
   $137 = (($135) + ($136)|0);
   HEAP8[$137>>0] = $133;
   $138 = $9;
   $139 = (($138) + 1)|0;
   $9 = $139;
  }
  $140 = (_btoc($130)|0);
  HEAP8[$10>>0] = $140;
  (_write(1,$10,1)|0);
  HEAP8[(92545)>>0] = 49;
  HEAP8[(92546)>>0] = 48;
  $199 = $4;
  STACKTOP = sp;return ($199|0);
  break;
 }
 case 1021:  {
  $141 = $6;
  $142 = ((($141)) + 12|0);
  $143 = HEAP8[$142>>0]|0;
  $144 = $143 << 24 >> 24;
  $145 = ($144|0)==(49);
  $9 = 0;
  if ($145) {
   while(1) {
    $146 = $9;
    $147 = ($146|0)<(16);
    if (!($147)) {
     break;
    }
    $148 = $5;
    $149 = (75140 + (($148*17)|0)|0);
    $150 = $9;
    $151 = (($149) + ($150)|0);
    HEAP8[$151>>0] = 48;
    $152 = $9;
    $153 = (($152) + 1)|0;
    $9 = $153;
   }
   HEAP32[1389] = 1;
   $154 = $5;
   $155 = (75140 + (($154*17)|0)|0);
   $156 = ((($155)) + 14|0);
   HEAP8[$156>>0] = 48;
   $157 = $5;
   $158 = (75140 + (($157*17)|0)|0);
   $159 = ((($158)) + 15|0);
   HEAP8[$159>>0] = 49;
   $160 = $5;
   $161 = (75140 + (($160*17)|0)|0);
   $162 = ((($161)) + 12|0);
   HEAP8[$162>>0] = 49;
   $199 = $4;
   STACKTOP = sp;return ($199|0);
  } else {
   while(1) {
    $163 = $9;
    $164 = ($163|0)<(16);
    if (!($164)) {
     break;
    }
    $165 = $5;
    $166 = (75140 + (($165*17)|0)|0);
    $167 = $9;
    $168 = (($166) + ($167)|0);
    HEAP8[$168>>0] = 48;
    $169 = $9;
    $170 = (($169) + 1)|0;
    $9 = $170;
   }
   HEAP32[1389] = 0;
   $199 = $4;
   STACKTOP = sp;return ($199|0);
  }
  break;
 }
 case 1023:  {
  $171 = $6;
  $172 = ((($171)) + 12|0);
  $173 = HEAP8[$172>>0]|0;
  $174 = $173 << 24 >> 24;
  $175 = ($174|0)==(49);
  $9 = 0;
  if ($175) {
   while(1) {
    $176 = $9;
    $177 = ($176|0)<(16);
    $178 = $5;
    $179 = (75140 + (($178*17)|0)|0);
    if (!($177)) {
     break;
    }
    $180 = $9;
    $181 = (($179) + ($180)|0);
    HEAP8[$181>>0] = 48;
    $182 = $9;
    $183 = (($182) + 1)|0;
    $9 = $183;
   }
   $184 = ((($179)) + 14|0);
   HEAP8[$184>>0] = 49;
   $185 = $5;
   $186 = (75140 + (($185*17)|0)|0);
   $187 = ((($186)) + 15|0);
   HEAP8[$187>>0] = 48;
   $188 = $5;
   $189 = (75140 + (($188*17)|0)|0);
   $190 = ((($189)) + 12|0);
   HEAP8[$190>>0] = 49;
   $199 = $4;
   STACKTOP = sp;return ($199|0);
  } else {
   while(1) {
    $191 = $9;
    $192 = ($191|0)<(16);
    if (!($192)) {
     break;
    }
    $193 = $5;
    $194 = (75140 + (($193*17)|0)|0);
    $195 = $9;
    $196 = (($194) + ($195)|0);
    HEAP8[$196>>0] = 48;
    $197 = $9;
    $198 = (($197) + 1)|0;
    $9 = $198;
   }
   HEAP32[1389] = 0;
   $199 = $4;
   STACKTOP = sp;return ($199|0);
  }
  break;
 }
 case 1020:  {
  $199 = $4;
  STACKTOP = sp;return ($199|0);
  break;
 }
 default: {
  $9 = 0;
  while(1) {
   $107 = $9;
   $108 = ($107|0)<(16);
   if (!($108)) {
    break;
   }
   $109 = $6;
   $110 = $9;
   $111 = (($109) + ($110)|0);
   $112 = HEAP8[$111>>0]|0;
   $113 = $5;
   $114 = (75140 + (($113*17)|0)|0);
   $115 = $9;
   $116 = (($114) + ($115)|0);
   HEAP8[$116>>0] = $112;
   $117 = $9;
   $118 = (($117) + 1)|0;
   $9 = $118;
  }
  $199 = $4;
  STACKTOP = sp;return ($199|0);
 }
 }
 return (0)|0;
}
function _ComputeOffset($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $1 = $0;
 $4 = 0;
 $2 = 2;
 while(1) {
  $5 = $2;
  $6 = ($5|0)<(12);
  if (!($6)) {
   break;
  }
  $7 = $1;
  $8 = $2;
  $9 = (($7) + ($8)|0);
  $10 = HEAP8[$9>>0]|0;
  $11 = $10 << 24 >> 24;
  $12 = ($11|0)==(49);
  if ($12) {
   $3 = 1;
  } else {
   $3 = 0;
  }
  $13 = $4;
  $14 = $13<<1;
  $15 = $3;
  $16 = (($14) + ($15))|0;
  $4 = $16;
  $17 = $2;
  $18 = (($17) + 1)|0;
  $2 = $18;
 }
 $19 = $4;
 STACKTOP = sp;return ($19|0);
}
function _ComputeChipSelect($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $3 = 0, $4 = 0, $5 = 0;
 var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $5 = $0&255;
 $6 = $1&255;
 $3 = $5;
 $4 = $6;
 $7 = $3;
 $8 = $7 << 24 >> 24;
 $9 = ($8|0)==(48);
 if ($9) {
  $10 = $4;
  $11 = $10 << 24 >> 24;
  $12 = ($11|0)==(48);
  if ($12) {
   $2 = 0;
  } else {
   label = 4;
  }
 } else {
  label = 4;
 }
 do {
  if ((label|0) == 4) {
   $13 = $3;
   $14 = $13 << 24 >> 24;
   $15 = ($14|0)==(48);
   if ($15) {
    $16 = $4;
    $17 = $16 << 24 >> 24;
    $18 = ($17|0)==(49);
    if ($18) {
     $2 = 1;
     break;
    }
   }
   $19 = $3;
   $20 = $19 << 24 >> 24;
   $21 = ($20|0)==(49);
   if ($21) {
    $22 = $4;
    $23 = $22 << 24 >> 24;
    $24 = ($23|0)==(48);
    if ($24) {
     $2 = 2;
     break;
    }
   }
   $2 = 3;
  }
 } while(0);
 $25 = $2;
 STACKTOP = sp;return ($25|0);
}
function _ActivateMemory($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
 var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $5 = 0, $6 = 0, $7 = 0;
 var $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $9 = $2&255;
 $10 = $3&255;
 $4 = $0;
 $5 = $1;
 $6 = $9;
 $7 = $10;
 $11 = $4;
 $12 = (_ComputeOffset($11)|0);
 HEAP32[1398] = $12;
 $13 = $4;
 $14 = HEAP8[$13>>0]|0;
 $15 = $14 << 24 >> 24;
 $16 = $4;
 $17 = ((($16)) + 1|0);
 $18 = HEAP8[$17>>0]|0;
 $19 = $18 << 24 >> 24;
 $20 = (_ComputeChipSelect($15,$19)|0);
 $8 = $20;
 $21 = $8;
 switch ($21|0) {
 case 0:  {
  $22 = HEAP32[1398]|0;
  $23 = $5;
  $24 = $6;
  $25 = $24 << 24 >> 24;
  $26 = $7;
  $27 = $26 << 24 >> 24;
  (_ActivateMemoryChip0($22,$23,$25,$27)|0);
  STACKTOP = sp;return;
  break;
 }
 case 1:  {
  $28 = HEAP32[1398]|0;
  $29 = $5;
  $30 = $6;
  $31 = $30 << 24 >> 24;
  $32 = $7;
  $33 = $32 << 24 >> 24;
  (_ActivateMemoryChip1($28,$29,$31,$33)|0);
  STACKTOP = sp;return;
  break;
 }
 case 2:  {
  $34 = HEAP32[1398]|0;
  $35 = $5;
  $36 = $6;
  $37 = $36 << 24 >> 24;
  $38 = $7;
  $39 = $38 << 24 >> 24;
  (_ActivateMemoryChip2($34,$35,$37,$39)|0);
  STACKTOP = sp;return;
  break;
 }
 case 3:  {
  $40 = HEAP32[1398]|0;
  $41 = $5;
  $42 = $6;
  $43 = $42 << 24 >> 24;
  $44 = $7;
  $45 = $44 << 24 >> 24;
  (_ActivateMemoryChip3($40,$41,$43,$45)|0);
  STACKTOP = sp;return;
  break;
 }
 default: {
  STACKTOP = sp;return;
 }
 }
}
function _InitializeMemory($0) {
 $0 = $0|0;
 var $$sink = 0, $$sink1 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
 var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
 var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
 var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer12 = 0, $vararg_buffer15 = 0, $vararg_buffer18 = 0, $vararg_buffer2 = 0, $vararg_buffer4 = 0, $vararg_buffer6 = 0, $vararg_buffer9 = 0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(80|0);
 $vararg_buffer18 = sp + 56|0;
 $vararg_buffer15 = sp + 48|0;
 $vararg_buffer12 = sp + 40|0;
 $vararg_buffer9 = sp + 32|0;
 $vararg_buffer6 = sp + 24|0;
 $vararg_buffer4 = sp + 16|0;
 $vararg_buffer2 = sp + 8|0;
 $vararg_buffer = sp;
 $1 = $0;
 $$sink = 0;
 while(1) {
  HEAP32[1399] = $$sink;
  $4 = HEAP32[1399]|0;
  $5 = ($4|0)<=(4095);
  if (!($5)) {
   break;
  }
  $6 = HEAP32[1399]|0;
  $7 = (($6|0) / 1024)&-1;
  $3 = $7;
  $8 = HEAP32[1399]|0;
  $9 = (($8|0) % 1024)&-1;
  HEAP32[1398] = $9;
  $10 = $3;
  $11 = ($10|0)==(0);
  do {
   if ($11) {
    $12 = HEAP32[1398]|0;
    $13 = (22916 + (($12*17)|0)|0);
    (_strcpy($13,2690)|0);
   } else {
    $14 = $3;
    $15 = ($14|0)==(1);
    if ($15) {
     $16 = HEAP32[1398]|0;
     $17 = (40324 + (($16*17)|0)|0);
     (_strcpy($17,2690)|0);
     break;
    }
    $18 = $3;
    $19 = ($18|0)==(2);
    if ($19) {
     $20 = HEAP32[1398]|0;
     $21 = (57732 + (($20*17)|0)|0);
     (_strcpy($21,2690)|0);
     break;
    }
    $22 = $3;
    $23 = ($22|0)==(3);
    if ($23) {
     $24 = HEAP32[1398]|0;
     $25 = (75140 + (($24*17)|0)|0);
     (_strcpy($25,2690)|0);
    }
   }
  } while(0);
  $26 = HEAP32[1399]|0;
  $27 = (($26) + 1)|0;
  $$sink = $27;
 }
 (_strcpy((92480),2707)|0);
 (_strcpy((92497),2707)|0);
 (_strcpy((92514),2707)|0);
 (_strcpy((92531),2707)|0);
 $28 = (_fopen(2724,2738)|0);
 $2 = $28;
 $29 = ($28|0)==(0|0);
 if ($29) {
  $30 = (_fopen(2740,2738)|0);
  $2 = $30;
  $31 = ($30|0)==(0|0);
  if ($31) {
   $32 = HEAP32[144]|0;
   (_fprintf($32,2750,$vararg_buffer)|0);
   _exit(2);
   // unreachable;
  }
 }
 (_printf(2786,$vararg_buffer2)|0);
 $$sink1 = 0;
 while(1) {
  HEAP32[1399] = $$sink1;
  $33 = HEAP32[1399]|0;
  $34 = ($33|0)<(4096);
  if (!($34)) {
   break;
  }
  $35 = HEAP32[1399]|0;
  $36 = (($35|0) / 1024)&-1;
  $3 = $36;
  $37 = HEAP32[1399]|0;
  $38 = (($37|0) % 1024)&-1;
  HEAP32[1398] = $38;
  $39 = $3;
  $40 = ($39|0)==(0);
  if ($40) {
   $41 = $2;
   $42 = HEAP32[1398]|0;
   $43 = (22916 + (($42*17)|0)|0);
   HEAP32[$vararg_buffer4>>2] = $43;
   $44 = (_fscanf($41,2687,$vararg_buffer4)|0);
   $45 = ($44|0)==(-1);
   if ($45) {
    break;
   }
  }
  $46 = $3;
  $47 = ($46|0)==(1);
  if ($47) {
   $48 = $2;
   $49 = HEAP32[1398]|0;
   $50 = (40324 + (($49*17)|0)|0);
   HEAP32[$vararg_buffer6>>2] = $50;
   $51 = (_fscanf($48,2687,$vararg_buffer6)|0);
   $52 = ($51|0)==(-1);
   if ($52) {
    break;
   }
  }
  $53 = $3;
  $54 = ($53|0)==(2);
  if ($54) {
   $55 = $2;
   $56 = HEAP32[1398]|0;
   $57 = (57732 + (($56*17)|0)|0);
   HEAP32[$vararg_buffer9>>2] = $57;
   $58 = (_fscanf($55,2687,$vararg_buffer9)|0);
   $59 = ($58|0)==(-1);
   if ($59) {
    break;
   }
  }
  $60 = $3;
  $61 = ($60|0)==(3);
  if ($61) {
   $62 = $2;
   $63 = HEAP32[1398]|0;
   $64 = (75140 + (($63*17)|0)|0);
   HEAP32[$vararg_buffer12>>2] = $64;
   $65 = (_fscanf($62,2687,$vararg_buffer12)|0);
   $66 = ($65|0)==(-1);
   if ($66) {
    break;
   }
  }
  $67 = HEAP32[1399]|0;
  $68 = (($67) + 1)|0;
  $$sink1 = $68;
 }
 $69 = HEAP32[1399]|0;
 HEAP32[$vararg_buffer15>>2] = $69;
 (_printf(2811,$vararg_buffer15)|0);
 $70 = HEAP32[1399]|0;
 HEAP32[$vararg_buffer18>>2] = $70;
 (_printf(2845,$vararg_buffer18)|0);
 STACKTOP = sp;return;
}
function _ShiftLeft($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $3 = $0;
 $4 = $1;
 $5 = 0;
 while(1) {
  $6 = $5;
  $7 = ($6|0)<(16);
  if (!($7)) {
   break;
  }
  $8 = $3;
  $9 = $5;
  $10 = (($9) + 1)|0;
  $11 = (($8) + ($10)|0);
  $12 = HEAP8[$11>>0]|0;
  $13 = $4;
  $14 = $5;
  $15 = (($13) + ($14)|0);
  HEAP8[$15>>0] = $12;
  $16 = $5;
  $17 = (($16) + 1)|0;
  $5 = $17;
 }
 $18 = $4;
 $19 = ((($18)) + 15|0);
 HEAP8[$19>>0] = 48;
 $20 = $2;
 STACKTOP = sp;return ($20|0);
}
function _ShiftRight($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $3 = $0;
 $4 = $1;
 $6 = $4;
 HEAP8[$6>>0] = 48;
 $5 = 1;
 while(1) {
  $7 = $5;
  $8 = ($7|0)<(16);
  if (!($8)) {
   break;
  }
  $9 = $3;
  $10 = $5;
  $11 = (($10) - 1)|0;
  $12 = (($9) + ($11)|0);
  $13 = HEAP8[$12>>0]|0;
  $14 = $4;
  $15 = $5;
  $16 = (($14) + ($15)|0);
  HEAP8[$16>>0] = $13;
  $17 = $5;
  $18 = (($17) + 1)|0;
  $5 = $18;
 }
 $19 = $2;
 STACKTOP = sp;return ($19|0);
}
function _ActivateShifter($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
 var $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $4 = $0;
 $5 = $1;
 $6 = $2;
 $9 = $5;
 $10 = HEAP8[$9>>0]|0;
 $7 = $10;
 $11 = $5;
 $12 = ((($11)) + 1|0);
 $13 = HEAP8[$12>>0]|0;
 $8 = $13;
 $14 = $6;
 $15 = $4;
 (_strcpy($14,$15)|0);
 $16 = $7;
 $17 = $16 << 24 >> 24;
 $18 = ($17|0)==(48);
 if ($18) {
  $19 = $8;
  $20 = $19 << 24 >> 24;
  $21 = ($20|0)==(49);
  if ($21) {
   $22 = $4;
   $23 = $6;
   (_ShiftRight($22,$23)|0);
  } else {
   label = 4;
  }
 } else {
  label = 4;
 }
 if ((label|0) == 4) {
  $24 = $7;
  $25 = $24 << 24 >> 24;
  $26 = ($25|0)==(49);
  if ($26) {
   $27 = $8;
   $28 = $27 << 24 >> 24;
   $29 = ($28|0)==(48);
   if ($29) {
    $30 = $4;
    $31 = $6;
    (_ShiftLeft($30,$31)|0);
   }
  }
 }
 $32 = $3;
 STACKTOP = sp;return ($32|0);
}
function _malloc($0) {
 $0 = $0|0;
 var $$$0172$i = 0, $$$0173$i = 0, $$$4236$i = 0, $$$4329$i = 0, $$$i = 0, $$0 = 0, $$0$i = 0, $$0$i$i = 0, $$0$i$i$i = 0, $$0$i20$i = 0, $$01$i$i = 0, $$0172$lcssa$i = 0, $$01726$i = 0, $$0173$lcssa$i = 0, $$01735$i = 0, $$0192 = 0, $$0194 = 0, $$0201$i$i = 0, $$0202$i$i = 0, $$0206$i$i = 0;
 var $$0207$i$i = 0, $$024370$i = 0, $$0260$i$i = 0, $$0261$i$i = 0, $$0262$i$i = 0, $$0268$i$i = 0, $$0269$i$i = 0, $$0320$i = 0, $$0322$i = 0, $$0323$i = 0, $$0325$i = 0, $$0331$i = 0, $$0336$i = 0, $$0337$$i = 0, $$0337$i = 0, $$0339$i = 0, $$0340$i = 0, $$0345$i = 0, $$1176$i = 0, $$1178$i = 0;
 var $$124469$i = 0, $$1264$i$i = 0, $$1266$i$i = 0, $$1321$i = 0, $$1326$i = 0, $$1341$i = 0, $$1347$i = 0, $$1351$i = 0, $$2234243136$i = 0, $$2247$ph$i = 0, $$2253$ph$i = 0, $$2333$i = 0, $$3$i = 0, $$3$i$i = 0, $$3$i200 = 0, $$3328$i = 0, $$3349$i = 0, $$4$lcssa$i = 0, $$4$ph$i = 0, $$411$i = 0;
 var $$4236$i = 0, $$4329$lcssa$i = 0, $$432910$i = 0, $$4335$$4$i = 0, $$4335$ph$i = 0, $$43359$i = 0, $$723947$i = 0, $$748$i = 0, $$pre = 0, $$pre$i = 0, $$pre$i$i = 0, $$pre$i17$i = 0, $$pre$i195 = 0, $$pre$i210 = 0, $$pre$phi$i$iZ2D = 0, $$pre$phi$i18$iZ2D = 0, $$pre$phi$i211Z2D = 0, $$pre$phi$iZ2D = 0, $$pre$phiZ2D = 0, $$sink1$i = 0;
 var $$sink1$i$i = 0, $$sink14$i = 0, $$sink2$i = 0, $$sink2$i204 = 0, $$sink3$i = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0;
 var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0;
 var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0;
 var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0;
 var $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0;
 var $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0;
 var $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0;
 var $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0;
 var $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0;
 var $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0;
 var $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0;
 var $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0;
 var $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0;
 var $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0;
 var $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0;
 var $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0;
 var $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0;
 var $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0;
 var $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0;
 var $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0;
 var $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0;
 var $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0;
 var $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0;
 var $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0;
 var $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0;
 var $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0;
 var $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0;
 var $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0;
 var $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0;
 var $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0, $634 = 0;
 var $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0, $642 = 0, $643 = 0, $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0, $652 = 0;
 var $653 = 0, $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0, $660 = 0, $661 = 0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0, $670 = 0;
 var $671 = 0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0, $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0, $684 = 0, $685 = 0, $686 = 0, $687 = 0, $688 = 0, $689 = 0;
 var $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0, $706 = 0;
 var $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0, $724 = 0;
 var $725 = 0, $726 = 0, $727 = 0, $728 = 0, $729 = 0, $73 = 0, $730 = 0, $731 = 0, $732 = 0, $733 = 0, $734 = 0, $735 = 0, $736 = 0, $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0, $742 = 0;
 var $743 = 0, $744 = 0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0, $750 = 0, $751 = 0, $752 = 0, $753 = 0, $754 = 0, $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0, $760 = 0;
 var $761 = 0, $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0, $769 = 0, $77 = 0, $770 = 0, $771 = 0, $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0, $779 = 0;
 var $78 = 0, $780 = 0, $781 = 0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0, $787 = 0, $788 = 0, $789 = 0, $79 = 0, $790 = 0, $791 = 0, $792 = 0, $793 = 0, $794 = 0, $795 = 0, $796 = 0, $797 = 0;
 var $798 = 0, $799 = 0, $8 = 0, $80 = 0, $800 = 0, $801 = 0, $802 = 0, $803 = 0, $804 = 0, $805 = 0, $806 = 0, $807 = 0, $808 = 0, $809 = 0, $81 = 0, $810 = 0, $811 = 0, $812 = 0, $813 = 0, $814 = 0;
 var $815 = 0, $816 = 0, $817 = 0, $818 = 0, $819 = 0, $82 = 0, $820 = 0, $821 = 0, $822 = 0, $823 = 0, $824 = 0, $825 = 0, $826 = 0, $827 = 0, $828 = 0, $829 = 0, $83 = 0, $830 = 0, $831 = 0, $832 = 0;
 var $833 = 0, $834 = 0, $835 = 0, $836 = 0, $837 = 0, $838 = 0, $839 = 0, $84 = 0, $840 = 0, $841 = 0, $842 = 0, $843 = 0, $844 = 0, $845 = 0, $846 = 0, $847 = 0, $848 = 0, $849 = 0, $85 = 0, $850 = 0;
 var $851 = 0, $852 = 0, $853 = 0, $854 = 0, $855 = 0, $856 = 0, $857 = 0, $858 = 0, $859 = 0, $86 = 0, $860 = 0, $861 = 0, $862 = 0, $863 = 0, $864 = 0, $865 = 0, $866 = 0, $867 = 0, $868 = 0, $869 = 0;
 var $87 = 0, $870 = 0, $871 = 0, $872 = 0, $873 = 0, $874 = 0, $875 = 0, $876 = 0, $877 = 0, $878 = 0, $879 = 0, $88 = 0, $880 = 0, $881 = 0, $882 = 0, $883 = 0, $884 = 0, $885 = 0, $886 = 0, $887 = 0;
 var $888 = 0, $889 = 0, $89 = 0, $890 = 0, $891 = 0, $892 = 0, $893 = 0, $894 = 0, $895 = 0, $896 = 0, $897 = 0, $898 = 0, $899 = 0, $9 = 0, $90 = 0, $900 = 0, $901 = 0, $902 = 0, $903 = 0, $904 = 0;
 var $905 = 0, $906 = 0, $907 = 0, $908 = 0, $909 = 0, $91 = 0, $910 = 0, $911 = 0, $912 = 0, $913 = 0, $914 = 0, $915 = 0, $916 = 0, $917 = 0, $918 = 0, $919 = 0, $92 = 0, $920 = 0, $921 = 0, $922 = 0;
 var $923 = 0, $924 = 0, $925 = 0, $926 = 0, $927 = 0, $928 = 0, $929 = 0, $93 = 0, $930 = 0, $931 = 0, $932 = 0, $933 = 0, $934 = 0, $935 = 0, $936 = 0, $937 = 0, $938 = 0, $939 = 0, $94 = 0, $940 = 0;
 var $941 = 0, $942 = 0, $943 = 0, $944 = 0, $945 = 0, $946 = 0, $947 = 0, $948 = 0, $949 = 0, $95 = 0, $950 = 0, $951 = 0, $952 = 0, $953 = 0, $954 = 0, $955 = 0, $956 = 0, $957 = 0, $958 = 0, $959 = 0;
 var $96 = 0, $960 = 0, $961 = 0, $962 = 0, $963 = 0, $964 = 0, $965 = 0, $966 = 0, $967 = 0, $968 = 0, $969 = 0, $97 = 0, $970 = 0, $98 = 0, $99 = 0, $cond$i = 0, $cond$i$i = 0, $cond$i208 = 0, $exitcond$i$i = 0, $not$$i = 0;
 var $not$$i$i = 0, $not$$i197 = 0, $not$$i209 = 0, $not$1$i = 0, $not$1$i203 = 0, $not$3$i = 0, $not$5$i = 0, $or$cond$i = 0, $or$cond$i201 = 0, $or$cond1$i = 0, $or$cond10$i = 0, $or$cond11$i = 0, $or$cond11$not$i = 0, $or$cond12$i = 0, $or$cond2$i = 0, $or$cond2$i199 = 0, $or$cond49$i = 0, $or$cond5$i = 0, $or$cond50$i = 0, $or$cond7$i = 0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $1 = sp;
 $2 = ($0>>>0)<(245);
 do {
  if ($2) {
   $3 = ($0>>>0)<(11);
   $4 = (($0) + 11)|0;
   $5 = $4 & -8;
   $6 = $3 ? 16 : $5;
   $7 = $6 >>> 3;
   $8 = HEAP32[1402]|0;
   $9 = $8 >>> $7;
   $10 = $9 & 3;
   $11 = ($10|0)==(0);
   if (!($11)) {
    $12 = $9 & 1;
    $13 = $12 ^ 1;
    $14 = (($13) + ($7))|0;
    $15 = $14 << 1;
    $16 = (5648 + ($15<<2)|0);
    $17 = ((($16)) + 8|0);
    $18 = HEAP32[$17>>2]|0;
    $19 = ((($18)) + 8|0);
    $20 = HEAP32[$19>>2]|0;
    $21 = ($16|0)==($20|0);
    if ($21) {
     $22 = 1 << $14;
     $23 = $22 ^ -1;
     $24 = $8 & $23;
     HEAP32[1402] = $24;
    } else {
     $25 = ((($20)) + 12|0);
     HEAP32[$25>>2] = $16;
     HEAP32[$17>>2] = $20;
    }
    $26 = $14 << 3;
    $27 = $26 | 3;
    $28 = ((($18)) + 4|0);
    HEAP32[$28>>2] = $27;
    $29 = (($18) + ($26)|0);
    $30 = ((($29)) + 4|0);
    $31 = HEAP32[$30>>2]|0;
    $32 = $31 | 1;
    HEAP32[$30>>2] = $32;
    $$0 = $19;
    STACKTOP = sp;return ($$0|0);
   }
   $33 = HEAP32[(5616)>>2]|0;
   $34 = ($6>>>0)>($33>>>0);
   if ($34) {
    $35 = ($9|0)==(0);
    if (!($35)) {
     $36 = $9 << $7;
     $37 = 2 << $7;
     $38 = (0 - ($37))|0;
     $39 = $37 | $38;
     $40 = $36 & $39;
     $41 = (0 - ($40))|0;
     $42 = $40 & $41;
     $43 = (($42) + -1)|0;
     $44 = $43 >>> 12;
     $45 = $44 & 16;
     $46 = $43 >>> $45;
     $47 = $46 >>> 5;
     $48 = $47 & 8;
     $49 = $48 | $45;
     $50 = $46 >>> $48;
     $51 = $50 >>> 2;
     $52 = $51 & 4;
     $53 = $49 | $52;
     $54 = $50 >>> $52;
     $55 = $54 >>> 1;
     $56 = $55 & 2;
     $57 = $53 | $56;
     $58 = $54 >>> $56;
     $59 = $58 >>> 1;
     $60 = $59 & 1;
     $61 = $57 | $60;
     $62 = $58 >>> $60;
     $63 = (($61) + ($62))|0;
     $64 = $63 << 1;
     $65 = (5648 + ($64<<2)|0);
     $66 = ((($65)) + 8|0);
     $67 = HEAP32[$66>>2]|0;
     $68 = ((($67)) + 8|0);
     $69 = HEAP32[$68>>2]|0;
     $70 = ($65|0)==($69|0);
     if ($70) {
      $71 = 1 << $63;
      $72 = $71 ^ -1;
      $73 = $8 & $72;
      HEAP32[1402] = $73;
      $90 = $73;
     } else {
      $74 = ((($69)) + 12|0);
      HEAP32[$74>>2] = $65;
      HEAP32[$66>>2] = $69;
      $90 = $8;
     }
     $75 = $63 << 3;
     $76 = (($75) - ($6))|0;
     $77 = $6 | 3;
     $78 = ((($67)) + 4|0);
     HEAP32[$78>>2] = $77;
     $79 = (($67) + ($6)|0);
     $80 = $76 | 1;
     $81 = ((($79)) + 4|0);
     HEAP32[$81>>2] = $80;
     $82 = (($79) + ($76)|0);
     HEAP32[$82>>2] = $76;
     $83 = ($33|0)==(0);
     if (!($83)) {
      $84 = HEAP32[(5628)>>2]|0;
      $85 = $33 >>> 3;
      $86 = $85 << 1;
      $87 = (5648 + ($86<<2)|0);
      $88 = 1 << $85;
      $89 = $90 & $88;
      $91 = ($89|0)==(0);
      if ($91) {
       $92 = $90 | $88;
       HEAP32[1402] = $92;
       $$pre = ((($87)) + 8|0);
       $$0194 = $87;$$pre$phiZ2D = $$pre;
      } else {
       $93 = ((($87)) + 8|0);
       $94 = HEAP32[$93>>2]|0;
       $$0194 = $94;$$pre$phiZ2D = $93;
      }
      HEAP32[$$pre$phiZ2D>>2] = $84;
      $95 = ((($$0194)) + 12|0);
      HEAP32[$95>>2] = $84;
      $96 = ((($84)) + 8|0);
      HEAP32[$96>>2] = $$0194;
      $97 = ((($84)) + 12|0);
      HEAP32[$97>>2] = $87;
     }
     HEAP32[(5616)>>2] = $76;
     HEAP32[(5628)>>2] = $79;
     $$0 = $68;
     STACKTOP = sp;return ($$0|0);
    }
    $98 = HEAP32[(5612)>>2]|0;
    $99 = ($98|0)==(0);
    if ($99) {
     $$0192 = $6;
    } else {
     $100 = (0 - ($98))|0;
     $101 = $98 & $100;
     $102 = (($101) + -1)|0;
     $103 = $102 >>> 12;
     $104 = $103 & 16;
     $105 = $102 >>> $104;
     $106 = $105 >>> 5;
     $107 = $106 & 8;
     $108 = $107 | $104;
     $109 = $105 >>> $107;
     $110 = $109 >>> 2;
     $111 = $110 & 4;
     $112 = $108 | $111;
     $113 = $109 >>> $111;
     $114 = $113 >>> 1;
     $115 = $114 & 2;
     $116 = $112 | $115;
     $117 = $113 >>> $115;
     $118 = $117 >>> 1;
     $119 = $118 & 1;
     $120 = $116 | $119;
     $121 = $117 >>> $119;
     $122 = (($120) + ($121))|0;
     $123 = (5912 + ($122<<2)|0);
     $124 = HEAP32[$123>>2]|0;
     $125 = ((($124)) + 4|0);
     $126 = HEAP32[$125>>2]|0;
     $127 = $126 & -8;
     $128 = (($127) - ($6))|0;
     $129 = ((($124)) + 16|0);
     $130 = HEAP32[$129>>2]|0;
     $not$3$i = ($130|0)==(0|0);
     $$sink14$i = $not$3$i&1;
     $131 = (((($124)) + 16|0) + ($$sink14$i<<2)|0);
     $132 = HEAP32[$131>>2]|0;
     $133 = ($132|0)==(0|0);
     if ($133) {
      $$0172$lcssa$i = $124;$$0173$lcssa$i = $128;
     } else {
      $$01726$i = $124;$$01735$i = $128;$135 = $132;
      while(1) {
       $134 = ((($135)) + 4|0);
       $136 = HEAP32[$134>>2]|0;
       $137 = $136 & -8;
       $138 = (($137) - ($6))|0;
       $139 = ($138>>>0)<($$01735$i>>>0);
       $$$0173$i = $139 ? $138 : $$01735$i;
       $$$0172$i = $139 ? $135 : $$01726$i;
       $140 = ((($135)) + 16|0);
       $141 = HEAP32[$140>>2]|0;
       $not$$i = ($141|0)==(0|0);
       $$sink1$i = $not$$i&1;
       $142 = (((($135)) + 16|0) + ($$sink1$i<<2)|0);
       $143 = HEAP32[$142>>2]|0;
       $144 = ($143|0)==(0|0);
       if ($144) {
        $$0172$lcssa$i = $$$0172$i;$$0173$lcssa$i = $$$0173$i;
        break;
       } else {
        $$01726$i = $$$0172$i;$$01735$i = $$$0173$i;$135 = $143;
       }
      }
     }
     $145 = (($$0172$lcssa$i) + ($6)|0);
     $146 = ($$0172$lcssa$i>>>0)<($145>>>0);
     if ($146) {
      $147 = ((($$0172$lcssa$i)) + 24|0);
      $148 = HEAP32[$147>>2]|0;
      $149 = ((($$0172$lcssa$i)) + 12|0);
      $150 = HEAP32[$149>>2]|0;
      $151 = ($150|0)==($$0172$lcssa$i|0);
      do {
       if ($151) {
        $156 = ((($$0172$lcssa$i)) + 20|0);
        $157 = HEAP32[$156>>2]|0;
        $158 = ($157|0)==(0|0);
        if ($158) {
         $159 = ((($$0172$lcssa$i)) + 16|0);
         $160 = HEAP32[$159>>2]|0;
         $161 = ($160|0)==(0|0);
         if ($161) {
          $$3$i = 0;
          break;
         } else {
          $$1176$i = $160;$$1178$i = $159;
         }
        } else {
         $$1176$i = $157;$$1178$i = $156;
        }
        while(1) {
         $162 = ((($$1176$i)) + 20|0);
         $163 = HEAP32[$162>>2]|0;
         $164 = ($163|0)==(0|0);
         if (!($164)) {
          $$1176$i = $163;$$1178$i = $162;
          continue;
         }
         $165 = ((($$1176$i)) + 16|0);
         $166 = HEAP32[$165>>2]|0;
         $167 = ($166|0)==(0|0);
         if ($167) {
          break;
         } else {
          $$1176$i = $166;$$1178$i = $165;
         }
        }
        HEAP32[$$1178$i>>2] = 0;
        $$3$i = $$1176$i;
       } else {
        $152 = ((($$0172$lcssa$i)) + 8|0);
        $153 = HEAP32[$152>>2]|0;
        $154 = ((($153)) + 12|0);
        HEAP32[$154>>2] = $150;
        $155 = ((($150)) + 8|0);
        HEAP32[$155>>2] = $153;
        $$3$i = $150;
       }
      } while(0);
      $168 = ($148|0)==(0|0);
      do {
       if (!($168)) {
        $169 = ((($$0172$lcssa$i)) + 28|0);
        $170 = HEAP32[$169>>2]|0;
        $171 = (5912 + ($170<<2)|0);
        $172 = HEAP32[$171>>2]|0;
        $173 = ($$0172$lcssa$i|0)==($172|0);
        if ($173) {
         HEAP32[$171>>2] = $$3$i;
         $cond$i = ($$3$i|0)==(0|0);
         if ($cond$i) {
          $174 = 1 << $170;
          $175 = $174 ^ -1;
          $176 = $98 & $175;
          HEAP32[(5612)>>2] = $176;
          break;
         }
        } else {
         $177 = ((($148)) + 16|0);
         $178 = HEAP32[$177>>2]|0;
         $not$1$i = ($178|0)!=($$0172$lcssa$i|0);
         $$sink2$i = $not$1$i&1;
         $179 = (((($148)) + 16|0) + ($$sink2$i<<2)|0);
         HEAP32[$179>>2] = $$3$i;
         $180 = ($$3$i|0)==(0|0);
         if ($180) {
          break;
         }
        }
        $181 = ((($$3$i)) + 24|0);
        HEAP32[$181>>2] = $148;
        $182 = ((($$0172$lcssa$i)) + 16|0);
        $183 = HEAP32[$182>>2]|0;
        $184 = ($183|0)==(0|0);
        if (!($184)) {
         $185 = ((($$3$i)) + 16|0);
         HEAP32[$185>>2] = $183;
         $186 = ((($183)) + 24|0);
         HEAP32[$186>>2] = $$3$i;
        }
        $187 = ((($$0172$lcssa$i)) + 20|0);
        $188 = HEAP32[$187>>2]|0;
        $189 = ($188|0)==(0|0);
        if (!($189)) {
         $190 = ((($$3$i)) + 20|0);
         HEAP32[$190>>2] = $188;
         $191 = ((($188)) + 24|0);
         HEAP32[$191>>2] = $$3$i;
        }
       }
      } while(0);
      $192 = ($$0173$lcssa$i>>>0)<(16);
      if ($192) {
       $193 = (($$0173$lcssa$i) + ($6))|0;
       $194 = $193 | 3;
       $195 = ((($$0172$lcssa$i)) + 4|0);
       HEAP32[$195>>2] = $194;
       $196 = (($$0172$lcssa$i) + ($193)|0);
       $197 = ((($196)) + 4|0);
       $198 = HEAP32[$197>>2]|0;
       $199 = $198 | 1;
       HEAP32[$197>>2] = $199;
      } else {
       $200 = $6 | 3;
       $201 = ((($$0172$lcssa$i)) + 4|0);
       HEAP32[$201>>2] = $200;
       $202 = $$0173$lcssa$i | 1;
       $203 = ((($145)) + 4|0);
       HEAP32[$203>>2] = $202;
       $204 = (($145) + ($$0173$lcssa$i)|0);
       HEAP32[$204>>2] = $$0173$lcssa$i;
       $205 = ($33|0)==(0);
       if (!($205)) {
        $206 = HEAP32[(5628)>>2]|0;
        $207 = $33 >>> 3;
        $208 = $207 << 1;
        $209 = (5648 + ($208<<2)|0);
        $210 = 1 << $207;
        $211 = $8 & $210;
        $212 = ($211|0)==(0);
        if ($212) {
         $213 = $8 | $210;
         HEAP32[1402] = $213;
         $$pre$i = ((($209)) + 8|0);
         $$0$i = $209;$$pre$phi$iZ2D = $$pre$i;
        } else {
         $214 = ((($209)) + 8|0);
         $215 = HEAP32[$214>>2]|0;
         $$0$i = $215;$$pre$phi$iZ2D = $214;
        }
        HEAP32[$$pre$phi$iZ2D>>2] = $206;
        $216 = ((($$0$i)) + 12|0);
        HEAP32[$216>>2] = $206;
        $217 = ((($206)) + 8|0);
        HEAP32[$217>>2] = $$0$i;
        $218 = ((($206)) + 12|0);
        HEAP32[$218>>2] = $209;
       }
       HEAP32[(5616)>>2] = $$0173$lcssa$i;
       HEAP32[(5628)>>2] = $145;
      }
      $219 = ((($$0172$lcssa$i)) + 8|0);
      $$0 = $219;
      STACKTOP = sp;return ($$0|0);
     } else {
      $$0192 = $6;
     }
    }
   } else {
    $$0192 = $6;
   }
  } else {
   $220 = ($0>>>0)>(4294967231);
   if ($220) {
    $$0192 = -1;
   } else {
    $221 = (($0) + 11)|0;
    $222 = $221 & -8;
    $223 = HEAP32[(5612)>>2]|0;
    $224 = ($223|0)==(0);
    if ($224) {
     $$0192 = $222;
    } else {
     $225 = (0 - ($222))|0;
     $226 = $221 >>> 8;
     $227 = ($226|0)==(0);
     if ($227) {
      $$0336$i = 0;
     } else {
      $228 = ($222>>>0)>(16777215);
      if ($228) {
       $$0336$i = 31;
      } else {
       $229 = (($226) + 1048320)|0;
       $230 = $229 >>> 16;
       $231 = $230 & 8;
       $232 = $226 << $231;
       $233 = (($232) + 520192)|0;
       $234 = $233 >>> 16;
       $235 = $234 & 4;
       $236 = $235 | $231;
       $237 = $232 << $235;
       $238 = (($237) + 245760)|0;
       $239 = $238 >>> 16;
       $240 = $239 & 2;
       $241 = $236 | $240;
       $242 = (14 - ($241))|0;
       $243 = $237 << $240;
       $244 = $243 >>> 15;
       $245 = (($242) + ($244))|0;
       $246 = $245 << 1;
       $247 = (($245) + 7)|0;
       $248 = $222 >>> $247;
       $249 = $248 & 1;
       $250 = $249 | $246;
       $$0336$i = $250;
      }
     }
     $251 = (5912 + ($$0336$i<<2)|0);
     $252 = HEAP32[$251>>2]|0;
     $253 = ($252|0)==(0|0);
     L74: do {
      if ($253) {
       $$2333$i = 0;$$3$i200 = 0;$$3328$i = $225;
       label = 57;
      } else {
       $254 = ($$0336$i|0)==(31);
       $255 = $$0336$i >>> 1;
       $256 = (25 - ($255))|0;
       $257 = $254 ? 0 : $256;
       $258 = $222 << $257;
       $$0320$i = 0;$$0325$i = $225;$$0331$i = $252;$$0337$i = $258;$$0340$i = 0;
       while(1) {
        $259 = ((($$0331$i)) + 4|0);
        $260 = HEAP32[$259>>2]|0;
        $261 = $260 & -8;
        $262 = (($261) - ($222))|0;
        $263 = ($262>>>0)<($$0325$i>>>0);
        if ($263) {
         $264 = ($262|0)==(0);
         if ($264) {
          $$411$i = $$0331$i;$$432910$i = 0;$$43359$i = $$0331$i;
          label = 61;
          break L74;
         } else {
          $$1321$i = $$0331$i;$$1326$i = $262;
         }
        } else {
         $$1321$i = $$0320$i;$$1326$i = $$0325$i;
        }
        $265 = ((($$0331$i)) + 20|0);
        $266 = HEAP32[$265>>2]|0;
        $267 = $$0337$i >>> 31;
        $268 = (((($$0331$i)) + 16|0) + ($267<<2)|0);
        $269 = HEAP32[$268>>2]|0;
        $270 = ($266|0)==(0|0);
        $271 = ($266|0)==($269|0);
        $or$cond2$i199 = $270 | $271;
        $$1341$i = $or$cond2$i199 ? $$0340$i : $266;
        $272 = ($269|0)==(0|0);
        $not$5$i = $272 ^ 1;
        $273 = $not$5$i&1;
        $$0337$$i = $$0337$i << $273;
        if ($272) {
         $$2333$i = $$1341$i;$$3$i200 = $$1321$i;$$3328$i = $$1326$i;
         label = 57;
         break;
        } else {
         $$0320$i = $$1321$i;$$0325$i = $$1326$i;$$0331$i = $269;$$0337$i = $$0337$$i;$$0340$i = $$1341$i;
        }
       }
      }
     } while(0);
     if ((label|0) == 57) {
      $274 = ($$2333$i|0)==(0|0);
      $275 = ($$3$i200|0)==(0|0);
      $or$cond$i201 = $274 & $275;
      if ($or$cond$i201) {
       $276 = 2 << $$0336$i;
       $277 = (0 - ($276))|0;
       $278 = $276 | $277;
       $279 = $223 & $278;
       $280 = ($279|0)==(0);
       if ($280) {
        $$0192 = $222;
        break;
       }
       $281 = (0 - ($279))|0;
       $282 = $279 & $281;
       $283 = (($282) + -1)|0;
       $284 = $283 >>> 12;
       $285 = $284 & 16;
       $286 = $283 >>> $285;
       $287 = $286 >>> 5;
       $288 = $287 & 8;
       $289 = $288 | $285;
       $290 = $286 >>> $288;
       $291 = $290 >>> 2;
       $292 = $291 & 4;
       $293 = $289 | $292;
       $294 = $290 >>> $292;
       $295 = $294 >>> 1;
       $296 = $295 & 2;
       $297 = $293 | $296;
       $298 = $294 >>> $296;
       $299 = $298 >>> 1;
       $300 = $299 & 1;
       $301 = $297 | $300;
       $302 = $298 >>> $300;
       $303 = (($301) + ($302))|0;
       $304 = (5912 + ($303<<2)|0);
       $305 = HEAP32[$304>>2]|0;
       $$4$ph$i = 0;$$4335$ph$i = $305;
      } else {
       $$4$ph$i = $$3$i200;$$4335$ph$i = $$2333$i;
      }
      $306 = ($$4335$ph$i|0)==(0|0);
      if ($306) {
       $$4$lcssa$i = $$4$ph$i;$$4329$lcssa$i = $$3328$i;
      } else {
       $$411$i = $$4$ph$i;$$432910$i = $$3328$i;$$43359$i = $$4335$ph$i;
       label = 61;
      }
     }
     if ((label|0) == 61) {
      while(1) {
       label = 0;
       $307 = ((($$43359$i)) + 4|0);
       $308 = HEAP32[$307>>2]|0;
       $309 = $308 & -8;
       $310 = (($309) - ($222))|0;
       $311 = ($310>>>0)<($$432910$i>>>0);
       $$$4329$i = $311 ? $310 : $$432910$i;
       $$4335$$4$i = $311 ? $$43359$i : $$411$i;
       $312 = ((($$43359$i)) + 16|0);
       $313 = HEAP32[$312>>2]|0;
       $not$1$i203 = ($313|0)==(0|0);
       $$sink2$i204 = $not$1$i203&1;
       $314 = (((($$43359$i)) + 16|0) + ($$sink2$i204<<2)|0);
       $315 = HEAP32[$314>>2]|0;
       $316 = ($315|0)==(0|0);
       if ($316) {
        $$4$lcssa$i = $$4335$$4$i;$$4329$lcssa$i = $$$4329$i;
        break;
       } else {
        $$411$i = $$4335$$4$i;$$432910$i = $$$4329$i;$$43359$i = $315;
        label = 61;
       }
      }
     }
     $317 = ($$4$lcssa$i|0)==(0|0);
     if ($317) {
      $$0192 = $222;
     } else {
      $318 = HEAP32[(5616)>>2]|0;
      $319 = (($318) - ($222))|0;
      $320 = ($$4329$lcssa$i>>>0)<($319>>>0);
      if ($320) {
       $321 = (($$4$lcssa$i) + ($222)|0);
       $322 = ($$4$lcssa$i>>>0)<($321>>>0);
       if (!($322)) {
        $$0 = 0;
        STACKTOP = sp;return ($$0|0);
       }
       $323 = ((($$4$lcssa$i)) + 24|0);
       $324 = HEAP32[$323>>2]|0;
       $325 = ((($$4$lcssa$i)) + 12|0);
       $326 = HEAP32[$325>>2]|0;
       $327 = ($326|0)==($$4$lcssa$i|0);
       do {
        if ($327) {
         $332 = ((($$4$lcssa$i)) + 20|0);
         $333 = HEAP32[$332>>2]|0;
         $334 = ($333|0)==(0|0);
         if ($334) {
          $335 = ((($$4$lcssa$i)) + 16|0);
          $336 = HEAP32[$335>>2]|0;
          $337 = ($336|0)==(0|0);
          if ($337) {
           $$3349$i = 0;
           break;
          } else {
           $$1347$i = $336;$$1351$i = $335;
          }
         } else {
          $$1347$i = $333;$$1351$i = $332;
         }
         while(1) {
          $338 = ((($$1347$i)) + 20|0);
          $339 = HEAP32[$338>>2]|0;
          $340 = ($339|0)==(0|0);
          if (!($340)) {
           $$1347$i = $339;$$1351$i = $338;
           continue;
          }
          $341 = ((($$1347$i)) + 16|0);
          $342 = HEAP32[$341>>2]|0;
          $343 = ($342|0)==(0|0);
          if ($343) {
           break;
          } else {
           $$1347$i = $342;$$1351$i = $341;
          }
         }
         HEAP32[$$1351$i>>2] = 0;
         $$3349$i = $$1347$i;
        } else {
         $328 = ((($$4$lcssa$i)) + 8|0);
         $329 = HEAP32[$328>>2]|0;
         $330 = ((($329)) + 12|0);
         HEAP32[$330>>2] = $326;
         $331 = ((($326)) + 8|0);
         HEAP32[$331>>2] = $329;
         $$3349$i = $326;
        }
       } while(0);
       $344 = ($324|0)==(0|0);
       do {
        if ($344) {
         $426 = $223;
        } else {
         $345 = ((($$4$lcssa$i)) + 28|0);
         $346 = HEAP32[$345>>2]|0;
         $347 = (5912 + ($346<<2)|0);
         $348 = HEAP32[$347>>2]|0;
         $349 = ($$4$lcssa$i|0)==($348|0);
         if ($349) {
          HEAP32[$347>>2] = $$3349$i;
          $cond$i208 = ($$3349$i|0)==(0|0);
          if ($cond$i208) {
           $350 = 1 << $346;
           $351 = $350 ^ -1;
           $352 = $223 & $351;
           HEAP32[(5612)>>2] = $352;
           $426 = $352;
           break;
          }
         } else {
          $353 = ((($324)) + 16|0);
          $354 = HEAP32[$353>>2]|0;
          $not$$i209 = ($354|0)!=($$4$lcssa$i|0);
          $$sink3$i = $not$$i209&1;
          $355 = (((($324)) + 16|0) + ($$sink3$i<<2)|0);
          HEAP32[$355>>2] = $$3349$i;
          $356 = ($$3349$i|0)==(0|0);
          if ($356) {
           $426 = $223;
           break;
          }
         }
         $357 = ((($$3349$i)) + 24|0);
         HEAP32[$357>>2] = $324;
         $358 = ((($$4$lcssa$i)) + 16|0);
         $359 = HEAP32[$358>>2]|0;
         $360 = ($359|0)==(0|0);
         if (!($360)) {
          $361 = ((($$3349$i)) + 16|0);
          HEAP32[$361>>2] = $359;
          $362 = ((($359)) + 24|0);
          HEAP32[$362>>2] = $$3349$i;
         }
         $363 = ((($$4$lcssa$i)) + 20|0);
         $364 = HEAP32[$363>>2]|0;
         $365 = ($364|0)==(0|0);
         if ($365) {
          $426 = $223;
         } else {
          $366 = ((($$3349$i)) + 20|0);
          HEAP32[$366>>2] = $364;
          $367 = ((($364)) + 24|0);
          HEAP32[$367>>2] = $$3349$i;
          $426 = $223;
         }
        }
       } while(0);
       $368 = ($$4329$lcssa$i>>>0)<(16);
       do {
        if ($368) {
         $369 = (($$4329$lcssa$i) + ($222))|0;
         $370 = $369 | 3;
         $371 = ((($$4$lcssa$i)) + 4|0);
         HEAP32[$371>>2] = $370;
         $372 = (($$4$lcssa$i) + ($369)|0);
         $373 = ((($372)) + 4|0);
         $374 = HEAP32[$373>>2]|0;
         $375 = $374 | 1;
         HEAP32[$373>>2] = $375;
        } else {
         $376 = $222 | 3;
         $377 = ((($$4$lcssa$i)) + 4|0);
         HEAP32[$377>>2] = $376;
         $378 = $$4329$lcssa$i | 1;
         $379 = ((($321)) + 4|0);
         HEAP32[$379>>2] = $378;
         $380 = (($321) + ($$4329$lcssa$i)|0);
         HEAP32[$380>>2] = $$4329$lcssa$i;
         $381 = $$4329$lcssa$i >>> 3;
         $382 = ($$4329$lcssa$i>>>0)<(256);
         if ($382) {
          $383 = $381 << 1;
          $384 = (5648 + ($383<<2)|0);
          $385 = HEAP32[1402]|0;
          $386 = 1 << $381;
          $387 = $385 & $386;
          $388 = ($387|0)==(0);
          if ($388) {
           $389 = $385 | $386;
           HEAP32[1402] = $389;
           $$pre$i210 = ((($384)) + 8|0);
           $$0345$i = $384;$$pre$phi$i211Z2D = $$pre$i210;
          } else {
           $390 = ((($384)) + 8|0);
           $391 = HEAP32[$390>>2]|0;
           $$0345$i = $391;$$pre$phi$i211Z2D = $390;
          }
          HEAP32[$$pre$phi$i211Z2D>>2] = $321;
          $392 = ((($$0345$i)) + 12|0);
          HEAP32[$392>>2] = $321;
          $393 = ((($321)) + 8|0);
          HEAP32[$393>>2] = $$0345$i;
          $394 = ((($321)) + 12|0);
          HEAP32[$394>>2] = $384;
          break;
         }
         $395 = $$4329$lcssa$i >>> 8;
         $396 = ($395|0)==(0);
         if ($396) {
          $$0339$i = 0;
         } else {
          $397 = ($$4329$lcssa$i>>>0)>(16777215);
          if ($397) {
           $$0339$i = 31;
          } else {
           $398 = (($395) + 1048320)|0;
           $399 = $398 >>> 16;
           $400 = $399 & 8;
           $401 = $395 << $400;
           $402 = (($401) + 520192)|0;
           $403 = $402 >>> 16;
           $404 = $403 & 4;
           $405 = $404 | $400;
           $406 = $401 << $404;
           $407 = (($406) + 245760)|0;
           $408 = $407 >>> 16;
           $409 = $408 & 2;
           $410 = $405 | $409;
           $411 = (14 - ($410))|0;
           $412 = $406 << $409;
           $413 = $412 >>> 15;
           $414 = (($411) + ($413))|0;
           $415 = $414 << 1;
           $416 = (($414) + 7)|0;
           $417 = $$4329$lcssa$i >>> $416;
           $418 = $417 & 1;
           $419 = $418 | $415;
           $$0339$i = $419;
          }
         }
         $420 = (5912 + ($$0339$i<<2)|0);
         $421 = ((($321)) + 28|0);
         HEAP32[$421>>2] = $$0339$i;
         $422 = ((($321)) + 16|0);
         $423 = ((($422)) + 4|0);
         HEAP32[$423>>2] = 0;
         HEAP32[$422>>2] = 0;
         $424 = 1 << $$0339$i;
         $425 = $426 & $424;
         $427 = ($425|0)==(0);
         if ($427) {
          $428 = $426 | $424;
          HEAP32[(5612)>>2] = $428;
          HEAP32[$420>>2] = $321;
          $429 = ((($321)) + 24|0);
          HEAP32[$429>>2] = $420;
          $430 = ((($321)) + 12|0);
          HEAP32[$430>>2] = $321;
          $431 = ((($321)) + 8|0);
          HEAP32[$431>>2] = $321;
          break;
         }
         $432 = HEAP32[$420>>2]|0;
         $433 = ($$0339$i|0)==(31);
         $434 = $$0339$i >>> 1;
         $435 = (25 - ($434))|0;
         $436 = $433 ? 0 : $435;
         $437 = $$4329$lcssa$i << $436;
         $$0322$i = $437;$$0323$i = $432;
         while(1) {
          $438 = ((($$0323$i)) + 4|0);
          $439 = HEAP32[$438>>2]|0;
          $440 = $439 & -8;
          $441 = ($440|0)==($$4329$lcssa$i|0);
          if ($441) {
           label = 97;
           break;
          }
          $442 = $$0322$i >>> 31;
          $443 = (((($$0323$i)) + 16|0) + ($442<<2)|0);
          $444 = $$0322$i << 1;
          $445 = HEAP32[$443>>2]|0;
          $446 = ($445|0)==(0|0);
          if ($446) {
           label = 96;
           break;
          } else {
           $$0322$i = $444;$$0323$i = $445;
          }
         }
         if ((label|0) == 96) {
          HEAP32[$443>>2] = $321;
          $447 = ((($321)) + 24|0);
          HEAP32[$447>>2] = $$0323$i;
          $448 = ((($321)) + 12|0);
          HEAP32[$448>>2] = $321;
          $449 = ((($321)) + 8|0);
          HEAP32[$449>>2] = $321;
          break;
         }
         else if ((label|0) == 97) {
          $450 = ((($$0323$i)) + 8|0);
          $451 = HEAP32[$450>>2]|0;
          $452 = ((($451)) + 12|0);
          HEAP32[$452>>2] = $321;
          HEAP32[$450>>2] = $321;
          $453 = ((($321)) + 8|0);
          HEAP32[$453>>2] = $451;
          $454 = ((($321)) + 12|0);
          HEAP32[$454>>2] = $$0323$i;
          $455 = ((($321)) + 24|0);
          HEAP32[$455>>2] = 0;
          break;
         }
        }
       } while(0);
       $456 = ((($$4$lcssa$i)) + 8|0);
       $$0 = $456;
       STACKTOP = sp;return ($$0|0);
      } else {
       $$0192 = $222;
      }
     }
    }
   }
  }
 } while(0);
 $457 = HEAP32[(5616)>>2]|0;
 $458 = ($457>>>0)<($$0192>>>0);
 if (!($458)) {
  $459 = (($457) - ($$0192))|0;
  $460 = HEAP32[(5628)>>2]|0;
  $461 = ($459>>>0)>(15);
  if ($461) {
   $462 = (($460) + ($$0192)|0);
   HEAP32[(5628)>>2] = $462;
   HEAP32[(5616)>>2] = $459;
   $463 = $459 | 1;
   $464 = ((($462)) + 4|0);
   HEAP32[$464>>2] = $463;
   $465 = (($462) + ($459)|0);
   HEAP32[$465>>2] = $459;
   $466 = $$0192 | 3;
   $467 = ((($460)) + 4|0);
   HEAP32[$467>>2] = $466;
  } else {
   HEAP32[(5616)>>2] = 0;
   HEAP32[(5628)>>2] = 0;
   $468 = $457 | 3;
   $469 = ((($460)) + 4|0);
   HEAP32[$469>>2] = $468;
   $470 = (($460) + ($457)|0);
   $471 = ((($470)) + 4|0);
   $472 = HEAP32[$471>>2]|0;
   $473 = $472 | 1;
   HEAP32[$471>>2] = $473;
  }
  $474 = ((($460)) + 8|0);
  $$0 = $474;
  STACKTOP = sp;return ($$0|0);
 }
 $475 = HEAP32[(5620)>>2]|0;
 $476 = ($475>>>0)>($$0192>>>0);
 if ($476) {
  $477 = (($475) - ($$0192))|0;
  HEAP32[(5620)>>2] = $477;
  $478 = HEAP32[(5632)>>2]|0;
  $479 = (($478) + ($$0192)|0);
  HEAP32[(5632)>>2] = $479;
  $480 = $477 | 1;
  $481 = ((($479)) + 4|0);
  HEAP32[$481>>2] = $480;
  $482 = $$0192 | 3;
  $483 = ((($478)) + 4|0);
  HEAP32[$483>>2] = $482;
  $484 = ((($478)) + 8|0);
  $$0 = $484;
  STACKTOP = sp;return ($$0|0);
 }
 $485 = HEAP32[1520]|0;
 $486 = ($485|0)==(0);
 if ($486) {
  HEAP32[(6088)>>2] = 4096;
  HEAP32[(6084)>>2] = 4096;
  HEAP32[(6092)>>2] = -1;
  HEAP32[(6096)>>2] = -1;
  HEAP32[(6100)>>2] = 0;
  HEAP32[(6052)>>2] = 0;
  $487 = $1;
  $488 = $487 & -16;
  $489 = $488 ^ 1431655768;
  HEAP32[$1>>2] = $489;
  HEAP32[1520] = $489;
  $493 = 4096;
 } else {
  $$pre$i195 = HEAP32[(6088)>>2]|0;
  $493 = $$pre$i195;
 }
 $490 = (($$0192) + 48)|0;
 $491 = (($$0192) + 47)|0;
 $492 = (($493) + ($491))|0;
 $494 = (0 - ($493))|0;
 $495 = $492 & $494;
 $496 = ($495>>>0)>($$0192>>>0);
 if (!($496)) {
  $$0 = 0;
  STACKTOP = sp;return ($$0|0);
 }
 $497 = HEAP32[(6048)>>2]|0;
 $498 = ($497|0)==(0);
 if (!($498)) {
  $499 = HEAP32[(6040)>>2]|0;
  $500 = (($499) + ($495))|0;
  $501 = ($500>>>0)<=($499>>>0);
  $502 = ($500>>>0)>($497>>>0);
  $or$cond1$i = $501 | $502;
  if ($or$cond1$i) {
   $$0 = 0;
   STACKTOP = sp;return ($$0|0);
  }
 }
 $503 = HEAP32[(6052)>>2]|0;
 $504 = $503 & 4;
 $505 = ($504|0)==(0);
 L167: do {
  if ($505) {
   $506 = HEAP32[(5632)>>2]|0;
   $507 = ($506|0)==(0|0);
   L169: do {
    if ($507) {
     label = 118;
    } else {
     $$0$i20$i = (6056);
     while(1) {
      $508 = HEAP32[$$0$i20$i>>2]|0;
      $509 = ($508>>>0)>($506>>>0);
      if (!($509)) {
       $510 = ((($$0$i20$i)) + 4|0);
       $511 = HEAP32[$510>>2]|0;
       $512 = (($508) + ($511)|0);
       $513 = ($512>>>0)>($506>>>0);
       if ($513) {
        break;
       }
      }
      $514 = ((($$0$i20$i)) + 8|0);
      $515 = HEAP32[$514>>2]|0;
      $516 = ($515|0)==(0|0);
      if ($516) {
       label = 118;
       break L169;
      } else {
       $$0$i20$i = $515;
      }
     }
     $539 = (($492) - ($475))|0;
     $540 = $539 & $494;
     $541 = ($540>>>0)<(2147483647);
     if ($541) {
      $542 = (_sbrk(($540|0))|0);
      $543 = HEAP32[$$0$i20$i>>2]|0;
      $544 = HEAP32[$510>>2]|0;
      $545 = (($543) + ($544)|0);
      $546 = ($542|0)==($545|0);
      if ($546) {
       $547 = ($542|0)==((-1)|0);
       if ($547) {
        $$2234243136$i = $540;
       } else {
        $$723947$i = $540;$$748$i = $542;
        label = 135;
        break L167;
       }
      } else {
       $$2247$ph$i = $542;$$2253$ph$i = $540;
       label = 126;
      }
     } else {
      $$2234243136$i = 0;
     }
    }
   } while(0);
   do {
    if ((label|0) == 118) {
     $517 = (_sbrk(0)|0);
     $518 = ($517|0)==((-1)|0);
     if ($518) {
      $$2234243136$i = 0;
     } else {
      $519 = $517;
      $520 = HEAP32[(6084)>>2]|0;
      $521 = (($520) + -1)|0;
      $522 = $521 & $519;
      $523 = ($522|0)==(0);
      $524 = (($521) + ($519))|0;
      $525 = (0 - ($520))|0;
      $526 = $524 & $525;
      $527 = (($526) - ($519))|0;
      $528 = $523 ? 0 : $527;
      $$$i = (($528) + ($495))|0;
      $529 = HEAP32[(6040)>>2]|0;
      $530 = (($$$i) + ($529))|0;
      $531 = ($$$i>>>0)>($$0192>>>0);
      $532 = ($$$i>>>0)<(2147483647);
      $or$cond$i = $531 & $532;
      if ($or$cond$i) {
       $533 = HEAP32[(6048)>>2]|0;
       $534 = ($533|0)==(0);
       if (!($534)) {
        $535 = ($530>>>0)<=($529>>>0);
        $536 = ($530>>>0)>($533>>>0);
        $or$cond2$i = $535 | $536;
        if ($or$cond2$i) {
         $$2234243136$i = 0;
         break;
        }
       }
       $537 = (_sbrk(($$$i|0))|0);
       $538 = ($537|0)==($517|0);
       if ($538) {
        $$723947$i = $$$i;$$748$i = $517;
        label = 135;
        break L167;
       } else {
        $$2247$ph$i = $537;$$2253$ph$i = $$$i;
        label = 126;
       }
      } else {
       $$2234243136$i = 0;
      }
     }
    }
   } while(0);
   do {
    if ((label|0) == 126) {
     $548 = (0 - ($$2253$ph$i))|0;
     $549 = ($$2247$ph$i|0)!=((-1)|0);
     $550 = ($$2253$ph$i>>>0)<(2147483647);
     $or$cond7$i = $550 & $549;
     $551 = ($490>>>0)>($$2253$ph$i>>>0);
     $or$cond10$i = $551 & $or$cond7$i;
     if (!($or$cond10$i)) {
      $561 = ($$2247$ph$i|0)==((-1)|0);
      if ($561) {
       $$2234243136$i = 0;
       break;
      } else {
       $$723947$i = $$2253$ph$i;$$748$i = $$2247$ph$i;
       label = 135;
       break L167;
      }
     }
     $552 = HEAP32[(6088)>>2]|0;
     $553 = (($491) - ($$2253$ph$i))|0;
     $554 = (($553) + ($552))|0;
     $555 = (0 - ($552))|0;
     $556 = $554 & $555;
     $557 = ($556>>>0)<(2147483647);
     if (!($557)) {
      $$723947$i = $$2253$ph$i;$$748$i = $$2247$ph$i;
      label = 135;
      break L167;
     }
     $558 = (_sbrk(($556|0))|0);
     $559 = ($558|0)==((-1)|0);
     if ($559) {
      (_sbrk(($548|0))|0);
      $$2234243136$i = 0;
      break;
     } else {
      $560 = (($556) + ($$2253$ph$i))|0;
      $$723947$i = $560;$$748$i = $$2247$ph$i;
      label = 135;
      break L167;
     }
    }
   } while(0);
   $562 = HEAP32[(6052)>>2]|0;
   $563 = $562 | 4;
   HEAP32[(6052)>>2] = $563;
   $$4236$i = $$2234243136$i;
   label = 133;
  } else {
   $$4236$i = 0;
   label = 133;
  }
 } while(0);
 if ((label|0) == 133) {
  $564 = ($495>>>0)<(2147483647);
  if ($564) {
   $565 = (_sbrk(($495|0))|0);
   $566 = (_sbrk(0)|0);
   $567 = ($565|0)!=((-1)|0);
   $568 = ($566|0)!=((-1)|0);
   $or$cond5$i = $567 & $568;
   $569 = ($565>>>0)<($566>>>0);
   $or$cond11$i = $569 & $or$cond5$i;
   $570 = $566;
   $571 = $565;
   $572 = (($570) - ($571))|0;
   $573 = (($$0192) + 40)|0;
   $574 = ($572>>>0)>($573>>>0);
   $$$4236$i = $574 ? $572 : $$4236$i;
   $or$cond11$not$i = $or$cond11$i ^ 1;
   $575 = ($565|0)==((-1)|0);
   $not$$i197 = $574 ^ 1;
   $576 = $575 | $not$$i197;
   $or$cond49$i = $576 | $or$cond11$not$i;
   if (!($or$cond49$i)) {
    $$723947$i = $$$4236$i;$$748$i = $565;
    label = 135;
   }
  }
 }
 if ((label|0) == 135) {
  $577 = HEAP32[(6040)>>2]|0;
  $578 = (($577) + ($$723947$i))|0;
  HEAP32[(6040)>>2] = $578;
  $579 = HEAP32[(6044)>>2]|0;
  $580 = ($578>>>0)>($579>>>0);
  if ($580) {
   HEAP32[(6044)>>2] = $578;
  }
  $581 = HEAP32[(5632)>>2]|0;
  $582 = ($581|0)==(0|0);
  do {
   if ($582) {
    $583 = HEAP32[(5624)>>2]|0;
    $584 = ($583|0)==(0|0);
    $585 = ($$748$i>>>0)<($583>>>0);
    $or$cond12$i = $584 | $585;
    if ($or$cond12$i) {
     HEAP32[(5624)>>2] = $$748$i;
    }
    HEAP32[(6056)>>2] = $$748$i;
    HEAP32[(6060)>>2] = $$723947$i;
    HEAP32[(6068)>>2] = 0;
    $586 = HEAP32[1520]|0;
    HEAP32[(5644)>>2] = $586;
    HEAP32[(5640)>>2] = -1;
    $$01$i$i = 0;
    while(1) {
     $587 = $$01$i$i << 1;
     $588 = (5648 + ($587<<2)|0);
     $589 = ((($588)) + 12|0);
     HEAP32[$589>>2] = $588;
     $590 = ((($588)) + 8|0);
     HEAP32[$590>>2] = $588;
     $591 = (($$01$i$i) + 1)|0;
     $exitcond$i$i = ($591|0)==(32);
     if ($exitcond$i$i) {
      break;
     } else {
      $$01$i$i = $591;
     }
    }
    $592 = (($$723947$i) + -40)|0;
    $593 = ((($$748$i)) + 8|0);
    $594 = $593;
    $595 = $594 & 7;
    $596 = ($595|0)==(0);
    $597 = (0 - ($594))|0;
    $598 = $597 & 7;
    $599 = $596 ? 0 : $598;
    $600 = (($$748$i) + ($599)|0);
    $601 = (($592) - ($599))|0;
    HEAP32[(5632)>>2] = $600;
    HEAP32[(5620)>>2] = $601;
    $602 = $601 | 1;
    $603 = ((($600)) + 4|0);
    HEAP32[$603>>2] = $602;
    $604 = (($600) + ($601)|0);
    $605 = ((($604)) + 4|0);
    HEAP32[$605>>2] = 40;
    $606 = HEAP32[(6096)>>2]|0;
    HEAP32[(5636)>>2] = $606;
   } else {
    $$024370$i = (6056);
    while(1) {
     $607 = HEAP32[$$024370$i>>2]|0;
     $608 = ((($$024370$i)) + 4|0);
     $609 = HEAP32[$608>>2]|0;
     $610 = (($607) + ($609)|0);
     $611 = ($$748$i|0)==($610|0);
     if ($611) {
      label = 145;
      break;
     }
     $612 = ((($$024370$i)) + 8|0);
     $613 = HEAP32[$612>>2]|0;
     $614 = ($613|0)==(0|0);
     if ($614) {
      break;
     } else {
      $$024370$i = $613;
     }
    }
    if ((label|0) == 145) {
     $615 = ((($$024370$i)) + 12|0);
     $616 = HEAP32[$615>>2]|0;
     $617 = $616 & 8;
     $618 = ($617|0)==(0);
     if ($618) {
      $619 = ($581>>>0)>=($607>>>0);
      $620 = ($581>>>0)<($$748$i>>>0);
      $or$cond50$i = $620 & $619;
      if ($or$cond50$i) {
       $621 = (($609) + ($$723947$i))|0;
       HEAP32[$608>>2] = $621;
       $622 = HEAP32[(5620)>>2]|0;
       $623 = ((($581)) + 8|0);
       $624 = $623;
       $625 = $624 & 7;
       $626 = ($625|0)==(0);
       $627 = (0 - ($624))|0;
       $628 = $627 & 7;
       $629 = $626 ? 0 : $628;
       $630 = (($581) + ($629)|0);
       $631 = (($$723947$i) - ($629))|0;
       $632 = (($622) + ($631))|0;
       HEAP32[(5632)>>2] = $630;
       HEAP32[(5620)>>2] = $632;
       $633 = $632 | 1;
       $634 = ((($630)) + 4|0);
       HEAP32[$634>>2] = $633;
       $635 = (($630) + ($632)|0);
       $636 = ((($635)) + 4|0);
       HEAP32[$636>>2] = 40;
       $637 = HEAP32[(6096)>>2]|0;
       HEAP32[(5636)>>2] = $637;
       break;
      }
     }
    }
    $638 = HEAP32[(5624)>>2]|0;
    $639 = ($$748$i>>>0)<($638>>>0);
    if ($639) {
     HEAP32[(5624)>>2] = $$748$i;
    }
    $640 = (($$748$i) + ($$723947$i)|0);
    $$124469$i = (6056);
    while(1) {
     $641 = HEAP32[$$124469$i>>2]|0;
     $642 = ($641|0)==($640|0);
     if ($642) {
      label = 153;
      break;
     }
     $643 = ((($$124469$i)) + 8|0);
     $644 = HEAP32[$643>>2]|0;
     $645 = ($644|0)==(0|0);
     if ($645) {
      break;
     } else {
      $$124469$i = $644;
     }
    }
    if ((label|0) == 153) {
     $646 = ((($$124469$i)) + 12|0);
     $647 = HEAP32[$646>>2]|0;
     $648 = $647 & 8;
     $649 = ($648|0)==(0);
     if ($649) {
      HEAP32[$$124469$i>>2] = $$748$i;
      $650 = ((($$124469$i)) + 4|0);
      $651 = HEAP32[$650>>2]|0;
      $652 = (($651) + ($$723947$i))|0;
      HEAP32[$650>>2] = $652;
      $653 = ((($$748$i)) + 8|0);
      $654 = $653;
      $655 = $654 & 7;
      $656 = ($655|0)==(0);
      $657 = (0 - ($654))|0;
      $658 = $657 & 7;
      $659 = $656 ? 0 : $658;
      $660 = (($$748$i) + ($659)|0);
      $661 = ((($640)) + 8|0);
      $662 = $661;
      $663 = $662 & 7;
      $664 = ($663|0)==(0);
      $665 = (0 - ($662))|0;
      $666 = $665 & 7;
      $667 = $664 ? 0 : $666;
      $668 = (($640) + ($667)|0);
      $669 = $668;
      $670 = $660;
      $671 = (($669) - ($670))|0;
      $672 = (($660) + ($$0192)|0);
      $673 = (($671) - ($$0192))|0;
      $674 = $$0192 | 3;
      $675 = ((($660)) + 4|0);
      HEAP32[$675>>2] = $674;
      $676 = ($668|0)==($581|0);
      do {
       if ($676) {
        $677 = HEAP32[(5620)>>2]|0;
        $678 = (($677) + ($673))|0;
        HEAP32[(5620)>>2] = $678;
        HEAP32[(5632)>>2] = $672;
        $679 = $678 | 1;
        $680 = ((($672)) + 4|0);
        HEAP32[$680>>2] = $679;
       } else {
        $681 = HEAP32[(5628)>>2]|0;
        $682 = ($668|0)==($681|0);
        if ($682) {
         $683 = HEAP32[(5616)>>2]|0;
         $684 = (($683) + ($673))|0;
         HEAP32[(5616)>>2] = $684;
         HEAP32[(5628)>>2] = $672;
         $685 = $684 | 1;
         $686 = ((($672)) + 4|0);
         HEAP32[$686>>2] = $685;
         $687 = (($672) + ($684)|0);
         HEAP32[$687>>2] = $684;
         break;
        }
        $688 = ((($668)) + 4|0);
        $689 = HEAP32[$688>>2]|0;
        $690 = $689 & 3;
        $691 = ($690|0)==(1);
        if ($691) {
         $692 = $689 & -8;
         $693 = $689 >>> 3;
         $694 = ($689>>>0)<(256);
         L237: do {
          if ($694) {
           $695 = ((($668)) + 8|0);
           $696 = HEAP32[$695>>2]|0;
           $697 = ((($668)) + 12|0);
           $698 = HEAP32[$697>>2]|0;
           $699 = ($698|0)==($696|0);
           if ($699) {
            $700 = 1 << $693;
            $701 = $700 ^ -1;
            $702 = HEAP32[1402]|0;
            $703 = $702 & $701;
            HEAP32[1402] = $703;
            break;
           } else {
            $704 = ((($696)) + 12|0);
            HEAP32[$704>>2] = $698;
            $705 = ((($698)) + 8|0);
            HEAP32[$705>>2] = $696;
            break;
           }
          } else {
           $706 = ((($668)) + 24|0);
           $707 = HEAP32[$706>>2]|0;
           $708 = ((($668)) + 12|0);
           $709 = HEAP32[$708>>2]|0;
           $710 = ($709|0)==($668|0);
           do {
            if ($710) {
             $715 = ((($668)) + 16|0);
             $716 = ((($715)) + 4|0);
             $717 = HEAP32[$716>>2]|0;
             $718 = ($717|0)==(0|0);
             if ($718) {
              $719 = HEAP32[$715>>2]|0;
              $720 = ($719|0)==(0|0);
              if ($720) {
               $$3$i$i = 0;
               break;
              } else {
               $$1264$i$i = $719;$$1266$i$i = $715;
              }
             } else {
              $$1264$i$i = $717;$$1266$i$i = $716;
             }
             while(1) {
              $721 = ((($$1264$i$i)) + 20|0);
              $722 = HEAP32[$721>>2]|0;
              $723 = ($722|0)==(0|0);
              if (!($723)) {
               $$1264$i$i = $722;$$1266$i$i = $721;
               continue;
              }
              $724 = ((($$1264$i$i)) + 16|0);
              $725 = HEAP32[$724>>2]|0;
              $726 = ($725|0)==(0|0);
              if ($726) {
               break;
              } else {
               $$1264$i$i = $725;$$1266$i$i = $724;
              }
             }
             HEAP32[$$1266$i$i>>2] = 0;
             $$3$i$i = $$1264$i$i;
            } else {
             $711 = ((($668)) + 8|0);
             $712 = HEAP32[$711>>2]|0;
             $713 = ((($712)) + 12|0);
             HEAP32[$713>>2] = $709;
             $714 = ((($709)) + 8|0);
             HEAP32[$714>>2] = $712;
             $$3$i$i = $709;
            }
           } while(0);
           $727 = ($707|0)==(0|0);
           if ($727) {
            break;
           }
           $728 = ((($668)) + 28|0);
           $729 = HEAP32[$728>>2]|0;
           $730 = (5912 + ($729<<2)|0);
           $731 = HEAP32[$730>>2]|0;
           $732 = ($668|0)==($731|0);
           do {
            if ($732) {
             HEAP32[$730>>2] = $$3$i$i;
             $cond$i$i = ($$3$i$i|0)==(0|0);
             if (!($cond$i$i)) {
              break;
             }
             $733 = 1 << $729;
             $734 = $733 ^ -1;
             $735 = HEAP32[(5612)>>2]|0;
             $736 = $735 & $734;
             HEAP32[(5612)>>2] = $736;
             break L237;
            } else {
             $737 = ((($707)) + 16|0);
             $738 = HEAP32[$737>>2]|0;
             $not$$i$i = ($738|0)!=($668|0);
             $$sink1$i$i = $not$$i$i&1;
             $739 = (((($707)) + 16|0) + ($$sink1$i$i<<2)|0);
             HEAP32[$739>>2] = $$3$i$i;
             $740 = ($$3$i$i|0)==(0|0);
             if ($740) {
              break L237;
             }
            }
           } while(0);
           $741 = ((($$3$i$i)) + 24|0);
           HEAP32[$741>>2] = $707;
           $742 = ((($668)) + 16|0);
           $743 = HEAP32[$742>>2]|0;
           $744 = ($743|0)==(0|0);
           if (!($744)) {
            $745 = ((($$3$i$i)) + 16|0);
            HEAP32[$745>>2] = $743;
            $746 = ((($743)) + 24|0);
            HEAP32[$746>>2] = $$3$i$i;
           }
           $747 = ((($742)) + 4|0);
           $748 = HEAP32[$747>>2]|0;
           $749 = ($748|0)==(0|0);
           if ($749) {
            break;
           }
           $750 = ((($$3$i$i)) + 20|0);
           HEAP32[$750>>2] = $748;
           $751 = ((($748)) + 24|0);
           HEAP32[$751>>2] = $$3$i$i;
          }
         } while(0);
         $752 = (($668) + ($692)|0);
         $753 = (($692) + ($673))|0;
         $$0$i$i = $752;$$0260$i$i = $753;
        } else {
         $$0$i$i = $668;$$0260$i$i = $673;
        }
        $754 = ((($$0$i$i)) + 4|0);
        $755 = HEAP32[$754>>2]|0;
        $756 = $755 & -2;
        HEAP32[$754>>2] = $756;
        $757 = $$0260$i$i | 1;
        $758 = ((($672)) + 4|0);
        HEAP32[$758>>2] = $757;
        $759 = (($672) + ($$0260$i$i)|0);
        HEAP32[$759>>2] = $$0260$i$i;
        $760 = $$0260$i$i >>> 3;
        $761 = ($$0260$i$i>>>0)<(256);
        if ($761) {
         $762 = $760 << 1;
         $763 = (5648 + ($762<<2)|0);
         $764 = HEAP32[1402]|0;
         $765 = 1 << $760;
         $766 = $764 & $765;
         $767 = ($766|0)==(0);
         if ($767) {
          $768 = $764 | $765;
          HEAP32[1402] = $768;
          $$pre$i17$i = ((($763)) + 8|0);
          $$0268$i$i = $763;$$pre$phi$i18$iZ2D = $$pre$i17$i;
         } else {
          $769 = ((($763)) + 8|0);
          $770 = HEAP32[$769>>2]|0;
          $$0268$i$i = $770;$$pre$phi$i18$iZ2D = $769;
         }
         HEAP32[$$pre$phi$i18$iZ2D>>2] = $672;
         $771 = ((($$0268$i$i)) + 12|0);
         HEAP32[$771>>2] = $672;
         $772 = ((($672)) + 8|0);
         HEAP32[$772>>2] = $$0268$i$i;
         $773 = ((($672)) + 12|0);
         HEAP32[$773>>2] = $763;
         break;
        }
        $774 = $$0260$i$i >>> 8;
        $775 = ($774|0)==(0);
        do {
         if ($775) {
          $$0269$i$i = 0;
         } else {
          $776 = ($$0260$i$i>>>0)>(16777215);
          if ($776) {
           $$0269$i$i = 31;
           break;
          }
          $777 = (($774) + 1048320)|0;
          $778 = $777 >>> 16;
          $779 = $778 & 8;
          $780 = $774 << $779;
          $781 = (($780) + 520192)|0;
          $782 = $781 >>> 16;
          $783 = $782 & 4;
          $784 = $783 | $779;
          $785 = $780 << $783;
          $786 = (($785) + 245760)|0;
          $787 = $786 >>> 16;
          $788 = $787 & 2;
          $789 = $784 | $788;
          $790 = (14 - ($789))|0;
          $791 = $785 << $788;
          $792 = $791 >>> 15;
          $793 = (($790) + ($792))|0;
          $794 = $793 << 1;
          $795 = (($793) + 7)|0;
          $796 = $$0260$i$i >>> $795;
          $797 = $796 & 1;
          $798 = $797 | $794;
          $$0269$i$i = $798;
         }
        } while(0);
        $799 = (5912 + ($$0269$i$i<<2)|0);
        $800 = ((($672)) + 28|0);
        HEAP32[$800>>2] = $$0269$i$i;
        $801 = ((($672)) + 16|0);
        $802 = ((($801)) + 4|0);
        HEAP32[$802>>2] = 0;
        HEAP32[$801>>2] = 0;
        $803 = HEAP32[(5612)>>2]|0;
        $804 = 1 << $$0269$i$i;
        $805 = $803 & $804;
        $806 = ($805|0)==(0);
        if ($806) {
         $807 = $803 | $804;
         HEAP32[(5612)>>2] = $807;
         HEAP32[$799>>2] = $672;
         $808 = ((($672)) + 24|0);
         HEAP32[$808>>2] = $799;
         $809 = ((($672)) + 12|0);
         HEAP32[$809>>2] = $672;
         $810 = ((($672)) + 8|0);
         HEAP32[$810>>2] = $672;
         break;
        }
        $811 = HEAP32[$799>>2]|0;
        $812 = ($$0269$i$i|0)==(31);
        $813 = $$0269$i$i >>> 1;
        $814 = (25 - ($813))|0;
        $815 = $812 ? 0 : $814;
        $816 = $$0260$i$i << $815;
        $$0261$i$i = $816;$$0262$i$i = $811;
        while(1) {
         $817 = ((($$0262$i$i)) + 4|0);
         $818 = HEAP32[$817>>2]|0;
         $819 = $818 & -8;
         $820 = ($819|0)==($$0260$i$i|0);
         if ($820) {
          label = 194;
          break;
         }
         $821 = $$0261$i$i >>> 31;
         $822 = (((($$0262$i$i)) + 16|0) + ($821<<2)|0);
         $823 = $$0261$i$i << 1;
         $824 = HEAP32[$822>>2]|0;
         $825 = ($824|0)==(0|0);
         if ($825) {
          label = 193;
          break;
         } else {
          $$0261$i$i = $823;$$0262$i$i = $824;
         }
        }
        if ((label|0) == 193) {
         HEAP32[$822>>2] = $672;
         $826 = ((($672)) + 24|0);
         HEAP32[$826>>2] = $$0262$i$i;
         $827 = ((($672)) + 12|0);
         HEAP32[$827>>2] = $672;
         $828 = ((($672)) + 8|0);
         HEAP32[$828>>2] = $672;
         break;
        }
        else if ((label|0) == 194) {
         $829 = ((($$0262$i$i)) + 8|0);
         $830 = HEAP32[$829>>2]|0;
         $831 = ((($830)) + 12|0);
         HEAP32[$831>>2] = $672;
         HEAP32[$829>>2] = $672;
         $832 = ((($672)) + 8|0);
         HEAP32[$832>>2] = $830;
         $833 = ((($672)) + 12|0);
         HEAP32[$833>>2] = $$0262$i$i;
         $834 = ((($672)) + 24|0);
         HEAP32[$834>>2] = 0;
         break;
        }
       }
      } while(0);
      $959 = ((($660)) + 8|0);
      $$0 = $959;
      STACKTOP = sp;return ($$0|0);
     }
    }
    $$0$i$i$i = (6056);
    while(1) {
     $835 = HEAP32[$$0$i$i$i>>2]|0;
     $836 = ($835>>>0)>($581>>>0);
     if (!($836)) {
      $837 = ((($$0$i$i$i)) + 4|0);
      $838 = HEAP32[$837>>2]|0;
      $839 = (($835) + ($838)|0);
      $840 = ($839>>>0)>($581>>>0);
      if ($840) {
       break;
      }
     }
     $841 = ((($$0$i$i$i)) + 8|0);
     $842 = HEAP32[$841>>2]|0;
     $$0$i$i$i = $842;
    }
    $843 = ((($839)) + -47|0);
    $844 = ((($843)) + 8|0);
    $845 = $844;
    $846 = $845 & 7;
    $847 = ($846|0)==(0);
    $848 = (0 - ($845))|0;
    $849 = $848 & 7;
    $850 = $847 ? 0 : $849;
    $851 = (($843) + ($850)|0);
    $852 = ((($581)) + 16|0);
    $853 = ($851>>>0)<($852>>>0);
    $854 = $853 ? $581 : $851;
    $855 = ((($854)) + 8|0);
    $856 = ((($854)) + 24|0);
    $857 = (($$723947$i) + -40)|0;
    $858 = ((($$748$i)) + 8|0);
    $859 = $858;
    $860 = $859 & 7;
    $861 = ($860|0)==(0);
    $862 = (0 - ($859))|0;
    $863 = $862 & 7;
    $864 = $861 ? 0 : $863;
    $865 = (($$748$i) + ($864)|0);
    $866 = (($857) - ($864))|0;
    HEAP32[(5632)>>2] = $865;
    HEAP32[(5620)>>2] = $866;
    $867 = $866 | 1;
    $868 = ((($865)) + 4|0);
    HEAP32[$868>>2] = $867;
    $869 = (($865) + ($866)|0);
    $870 = ((($869)) + 4|0);
    HEAP32[$870>>2] = 40;
    $871 = HEAP32[(6096)>>2]|0;
    HEAP32[(5636)>>2] = $871;
    $872 = ((($854)) + 4|0);
    HEAP32[$872>>2] = 27;
    ;HEAP32[$855>>2]=HEAP32[(6056)>>2]|0;HEAP32[$855+4>>2]=HEAP32[(6056)+4>>2]|0;HEAP32[$855+8>>2]=HEAP32[(6056)+8>>2]|0;HEAP32[$855+12>>2]=HEAP32[(6056)+12>>2]|0;
    HEAP32[(6056)>>2] = $$748$i;
    HEAP32[(6060)>>2] = $$723947$i;
    HEAP32[(6068)>>2] = 0;
    HEAP32[(6064)>>2] = $855;
    $874 = $856;
    while(1) {
     $873 = ((($874)) + 4|0);
     HEAP32[$873>>2] = 7;
     $875 = ((($874)) + 8|0);
     $876 = ($875>>>0)<($839>>>0);
     if ($876) {
      $874 = $873;
     } else {
      break;
     }
    }
    $877 = ($854|0)==($581|0);
    if (!($877)) {
     $878 = $854;
     $879 = $581;
     $880 = (($878) - ($879))|0;
     $881 = HEAP32[$872>>2]|0;
     $882 = $881 & -2;
     HEAP32[$872>>2] = $882;
     $883 = $880 | 1;
     $884 = ((($581)) + 4|0);
     HEAP32[$884>>2] = $883;
     HEAP32[$854>>2] = $880;
     $885 = $880 >>> 3;
     $886 = ($880>>>0)<(256);
     if ($886) {
      $887 = $885 << 1;
      $888 = (5648 + ($887<<2)|0);
      $889 = HEAP32[1402]|0;
      $890 = 1 << $885;
      $891 = $889 & $890;
      $892 = ($891|0)==(0);
      if ($892) {
       $893 = $889 | $890;
       HEAP32[1402] = $893;
       $$pre$i$i = ((($888)) + 8|0);
       $$0206$i$i = $888;$$pre$phi$i$iZ2D = $$pre$i$i;
      } else {
       $894 = ((($888)) + 8|0);
       $895 = HEAP32[$894>>2]|0;
       $$0206$i$i = $895;$$pre$phi$i$iZ2D = $894;
      }
      HEAP32[$$pre$phi$i$iZ2D>>2] = $581;
      $896 = ((($$0206$i$i)) + 12|0);
      HEAP32[$896>>2] = $581;
      $897 = ((($581)) + 8|0);
      HEAP32[$897>>2] = $$0206$i$i;
      $898 = ((($581)) + 12|0);
      HEAP32[$898>>2] = $888;
      break;
     }
     $899 = $880 >>> 8;
     $900 = ($899|0)==(0);
     if ($900) {
      $$0207$i$i = 0;
     } else {
      $901 = ($880>>>0)>(16777215);
      if ($901) {
       $$0207$i$i = 31;
      } else {
       $902 = (($899) + 1048320)|0;
       $903 = $902 >>> 16;
       $904 = $903 & 8;
       $905 = $899 << $904;
       $906 = (($905) + 520192)|0;
       $907 = $906 >>> 16;
       $908 = $907 & 4;
       $909 = $908 | $904;
       $910 = $905 << $908;
       $911 = (($910) + 245760)|0;
       $912 = $911 >>> 16;
       $913 = $912 & 2;
       $914 = $909 | $913;
       $915 = (14 - ($914))|0;
       $916 = $910 << $913;
       $917 = $916 >>> 15;
       $918 = (($915) + ($917))|0;
       $919 = $918 << 1;
       $920 = (($918) + 7)|0;
       $921 = $880 >>> $920;
       $922 = $921 & 1;
       $923 = $922 | $919;
       $$0207$i$i = $923;
      }
     }
     $924 = (5912 + ($$0207$i$i<<2)|0);
     $925 = ((($581)) + 28|0);
     HEAP32[$925>>2] = $$0207$i$i;
     $926 = ((($581)) + 20|0);
     HEAP32[$926>>2] = 0;
     HEAP32[$852>>2] = 0;
     $927 = HEAP32[(5612)>>2]|0;
     $928 = 1 << $$0207$i$i;
     $929 = $927 & $928;
     $930 = ($929|0)==(0);
     if ($930) {
      $931 = $927 | $928;
      HEAP32[(5612)>>2] = $931;
      HEAP32[$924>>2] = $581;
      $932 = ((($581)) + 24|0);
      HEAP32[$932>>2] = $924;
      $933 = ((($581)) + 12|0);
      HEAP32[$933>>2] = $581;
      $934 = ((($581)) + 8|0);
      HEAP32[$934>>2] = $581;
      break;
     }
     $935 = HEAP32[$924>>2]|0;
     $936 = ($$0207$i$i|0)==(31);
     $937 = $$0207$i$i >>> 1;
     $938 = (25 - ($937))|0;
     $939 = $936 ? 0 : $938;
     $940 = $880 << $939;
     $$0201$i$i = $940;$$0202$i$i = $935;
     while(1) {
      $941 = ((($$0202$i$i)) + 4|0);
      $942 = HEAP32[$941>>2]|0;
      $943 = $942 & -8;
      $944 = ($943|0)==($880|0);
      if ($944) {
       label = 216;
       break;
      }
      $945 = $$0201$i$i >>> 31;
      $946 = (((($$0202$i$i)) + 16|0) + ($945<<2)|0);
      $947 = $$0201$i$i << 1;
      $948 = HEAP32[$946>>2]|0;
      $949 = ($948|0)==(0|0);
      if ($949) {
       label = 215;
       break;
      } else {
       $$0201$i$i = $947;$$0202$i$i = $948;
      }
     }
     if ((label|0) == 215) {
      HEAP32[$946>>2] = $581;
      $950 = ((($581)) + 24|0);
      HEAP32[$950>>2] = $$0202$i$i;
      $951 = ((($581)) + 12|0);
      HEAP32[$951>>2] = $581;
      $952 = ((($581)) + 8|0);
      HEAP32[$952>>2] = $581;
      break;
     }
     else if ((label|0) == 216) {
      $953 = ((($$0202$i$i)) + 8|0);
      $954 = HEAP32[$953>>2]|0;
      $955 = ((($954)) + 12|0);
      HEAP32[$955>>2] = $581;
      HEAP32[$953>>2] = $581;
      $956 = ((($581)) + 8|0);
      HEAP32[$956>>2] = $954;
      $957 = ((($581)) + 12|0);
      HEAP32[$957>>2] = $$0202$i$i;
      $958 = ((($581)) + 24|0);
      HEAP32[$958>>2] = 0;
      break;
     }
    }
   }
  } while(0);
  $960 = HEAP32[(5620)>>2]|0;
  $961 = ($960>>>0)>($$0192>>>0);
  if ($961) {
   $962 = (($960) - ($$0192))|0;
   HEAP32[(5620)>>2] = $962;
   $963 = HEAP32[(5632)>>2]|0;
   $964 = (($963) + ($$0192)|0);
   HEAP32[(5632)>>2] = $964;
   $965 = $962 | 1;
   $966 = ((($964)) + 4|0);
   HEAP32[$966>>2] = $965;
   $967 = $$0192 | 3;
   $968 = ((($963)) + 4|0);
   HEAP32[$968>>2] = $967;
   $969 = ((($963)) + 8|0);
   $$0 = $969;
   STACKTOP = sp;return ($$0|0);
  }
 }
 $970 = (___errno_location()|0);
 HEAP32[$970>>2] = 12;
 $$0 = 0;
 STACKTOP = sp;return ($$0|0);
}
function _free($0) {
 $0 = $0|0;
 var $$0195$i = 0, $$0195$in$i = 0, $$0348 = 0, $$0349 = 0, $$0361 = 0, $$0368 = 0, $$1 = 0, $$1347 = 0, $$1352 = 0, $$1355 = 0, $$1363 = 0, $$1367 = 0, $$2 = 0, $$3 = 0, $$3365 = 0, $$pre = 0, $$pre$phiZ2D = 0, $$sink3 = 0, $$sink5 = 0, $1 = 0;
 var $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0;
 var $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0;
 var $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0;
 var $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0;
 var $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0;
 var $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0;
 var $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0;
 var $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0;
 var $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0;
 var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
 var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0;
 var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0;
 var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $cond374 = 0, $cond375 = 0, $not$ = 0, $not$370 = 0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ($0|0)==(0|0);
 if ($1) {
  return;
 }
 $2 = ((($0)) + -8|0);
 $3 = HEAP32[(5624)>>2]|0;
 $4 = ((($0)) + -4|0);
 $5 = HEAP32[$4>>2]|0;
 $6 = $5 & -8;
 $7 = (($2) + ($6)|0);
 $8 = $5 & 1;
 $9 = ($8|0)==(0);
 do {
  if ($9) {
   $10 = HEAP32[$2>>2]|0;
   $11 = $5 & 3;
   $12 = ($11|0)==(0);
   if ($12) {
    return;
   }
   $13 = (0 - ($10))|0;
   $14 = (($2) + ($13)|0);
   $15 = (($10) + ($6))|0;
   $16 = ($14>>>0)<($3>>>0);
   if ($16) {
    return;
   }
   $17 = HEAP32[(5628)>>2]|0;
   $18 = ($14|0)==($17|0);
   if ($18) {
    $78 = ((($7)) + 4|0);
    $79 = HEAP32[$78>>2]|0;
    $80 = $79 & 3;
    $81 = ($80|0)==(3);
    if (!($81)) {
     $$1 = $14;$$1347 = $15;$86 = $14;
     break;
    }
    $82 = (($14) + ($15)|0);
    $83 = ((($14)) + 4|0);
    $84 = $15 | 1;
    $85 = $79 & -2;
    HEAP32[(5616)>>2] = $15;
    HEAP32[$78>>2] = $85;
    HEAP32[$83>>2] = $84;
    HEAP32[$82>>2] = $15;
    return;
   }
   $19 = $10 >>> 3;
   $20 = ($10>>>0)<(256);
   if ($20) {
    $21 = ((($14)) + 8|0);
    $22 = HEAP32[$21>>2]|0;
    $23 = ((($14)) + 12|0);
    $24 = HEAP32[$23>>2]|0;
    $25 = ($24|0)==($22|0);
    if ($25) {
     $26 = 1 << $19;
     $27 = $26 ^ -1;
     $28 = HEAP32[1402]|0;
     $29 = $28 & $27;
     HEAP32[1402] = $29;
     $$1 = $14;$$1347 = $15;$86 = $14;
     break;
    } else {
     $30 = ((($22)) + 12|0);
     HEAP32[$30>>2] = $24;
     $31 = ((($24)) + 8|0);
     HEAP32[$31>>2] = $22;
     $$1 = $14;$$1347 = $15;$86 = $14;
     break;
    }
   }
   $32 = ((($14)) + 24|0);
   $33 = HEAP32[$32>>2]|0;
   $34 = ((($14)) + 12|0);
   $35 = HEAP32[$34>>2]|0;
   $36 = ($35|0)==($14|0);
   do {
    if ($36) {
     $41 = ((($14)) + 16|0);
     $42 = ((($41)) + 4|0);
     $43 = HEAP32[$42>>2]|0;
     $44 = ($43|0)==(0|0);
     if ($44) {
      $45 = HEAP32[$41>>2]|0;
      $46 = ($45|0)==(0|0);
      if ($46) {
       $$3 = 0;
       break;
      } else {
       $$1352 = $45;$$1355 = $41;
      }
     } else {
      $$1352 = $43;$$1355 = $42;
     }
     while(1) {
      $47 = ((($$1352)) + 20|0);
      $48 = HEAP32[$47>>2]|0;
      $49 = ($48|0)==(0|0);
      if (!($49)) {
       $$1352 = $48;$$1355 = $47;
       continue;
      }
      $50 = ((($$1352)) + 16|0);
      $51 = HEAP32[$50>>2]|0;
      $52 = ($51|0)==(0|0);
      if ($52) {
       break;
      } else {
       $$1352 = $51;$$1355 = $50;
      }
     }
     HEAP32[$$1355>>2] = 0;
     $$3 = $$1352;
    } else {
     $37 = ((($14)) + 8|0);
     $38 = HEAP32[$37>>2]|0;
     $39 = ((($38)) + 12|0);
     HEAP32[$39>>2] = $35;
     $40 = ((($35)) + 8|0);
     HEAP32[$40>>2] = $38;
     $$3 = $35;
    }
   } while(0);
   $53 = ($33|0)==(0|0);
   if ($53) {
    $$1 = $14;$$1347 = $15;$86 = $14;
   } else {
    $54 = ((($14)) + 28|0);
    $55 = HEAP32[$54>>2]|0;
    $56 = (5912 + ($55<<2)|0);
    $57 = HEAP32[$56>>2]|0;
    $58 = ($14|0)==($57|0);
    if ($58) {
     HEAP32[$56>>2] = $$3;
     $cond374 = ($$3|0)==(0|0);
     if ($cond374) {
      $59 = 1 << $55;
      $60 = $59 ^ -1;
      $61 = HEAP32[(5612)>>2]|0;
      $62 = $61 & $60;
      HEAP32[(5612)>>2] = $62;
      $$1 = $14;$$1347 = $15;$86 = $14;
      break;
     }
    } else {
     $63 = ((($33)) + 16|0);
     $64 = HEAP32[$63>>2]|0;
     $not$370 = ($64|0)!=($14|0);
     $$sink3 = $not$370&1;
     $65 = (((($33)) + 16|0) + ($$sink3<<2)|0);
     HEAP32[$65>>2] = $$3;
     $66 = ($$3|0)==(0|0);
     if ($66) {
      $$1 = $14;$$1347 = $15;$86 = $14;
      break;
     }
    }
    $67 = ((($$3)) + 24|0);
    HEAP32[$67>>2] = $33;
    $68 = ((($14)) + 16|0);
    $69 = HEAP32[$68>>2]|0;
    $70 = ($69|0)==(0|0);
    if (!($70)) {
     $71 = ((($$3)) + 16|0);
     HEAP32[$71>>2] = $69;
     $72 = ((($69)) + 24|0);
     HEAP32[$72>>2] = $$3;
    }
    $73 = ((($68)) + 4|0);
    $74 = HEAP32[$73>>2]|0;
    $75 = ($74|0)==(0|0);
    if ($75) {
     $$1 = $14;$$1347 = $15;$86 = $14;
    } else {
     $76 = ((($$3)) + 20|0);
     HEAP32[$76>>2] = $74;
     $77 = ((($74)) + 24|0);
     HEAP32[$77>>2] = $$3;
     $$1 = $14;$$1347 = $15;$86 = $14;
    }
   }
  } else {
   $$1 = $2;$$1347 = $6;$86 = $2;
  }
 } while(0);
 $87 = ($86>>>0)<($7>>>0);
 if (!($87)) {
  return;
 }
 $88 = ((($7)) + 4|0);
 $89 = HEAP32[$88>>2]|0;
 $90 = $89 & 1;
 $91 = ($90|0)==(0);
 if ($91) {
  return;
 }
 $92 = $89 & 2;
 $93 = ($92|0)==(0);
 if ($93) {
  $94 = HEAP32[(5632)>>2]|0;
  $95 = ($7|0)==($94|0);
  $96 = HEAP32[(5628)>>2]|0;
  if ($95) {
   $97 = HEAP32[(5620)>>2]|0;
   $98 = (($97) + ($$1347))|0;
   HEAP32[(5620)>>2] = $98;
   HEAP32[(5632)>>2] = $$1;
   $99 = $98 | 1;
   $100 = ((($$1)) + 4|0);
   HEAP32[$100>>2] = $99;
   $101 = ($$1|0)==($96|0);
   if (!($101)) {
    return;
   }
   HEAP32[(5628)>>2] = 0;
   HEAP32[(5616)>>2] = 0;
   return;
  }
  $102 = ($7|0)==($96|0);
  if ($102) {
   $103 = HEAP32[(5616)>>2]|0;
   $104 = (($103) + ($$1347))|0;
   HEAP32[(5616)>>2] = $104;
   HEAP32[(5628)>>2] = $86;
   $105 = $104 | 1;
   $106 = ((($$1)) + 4|0);
   HEAP32[$106>>2] = $105;
   $107 = (($86) + ($104)|0);
   HEAP32[$107>>2] = $104;
   return;
  }
  $108 = $89 & -8;
  $109 = (($108) + ($$1347))|0;
  $110 = $89 >>> 3;
  $111 = ($89>>>0)<(256);
  do {
   if ($111) {
    $112 = ((($7)) + 8|0);
    $113 = HEAP32[$112>>2]|0;
    $114 = ((($7)) + 12|0);
    $115 = HEAP32[$114>>2]|0;
    $116 = ($115|0)==($113|0);
    if ($116) {
     $117 = 1 << $110;
     $118 = $117 ^ -1;
     $119 = HEAP32[1402]|0;
     $120 = $119 & $118;
     HEAP32[1402] = $120;
     break;
    } else {
     $121 = ((($113)) + 12|0);
     HEAP32[$121>>2] = $115;
     $122 = ((($115)) + 8|0);
     HEAP32[$122>>2] = $113;
     break;
    }
   } else {
    $123 = ((($7)) + 24|0);
    $124 = HEAP32[$123>>2]|0;
    $125 = ((($7)) + 12|0);
    $126 = HEAP32[$125>>2]|0;
    $127 = ($126|0)==($7|0);
    do {
     if ($127) {
      $132 = ((($7)) + 16|0);
      $133 = ((($132)) + 4|0);
      $134 = HEAP32[$133>>2]|0;
      $135 = ($134|0)==(0|0);
      if ($135) {
       $136 = HEAP32[$132>>2]|0;
       $137 = ($136|0)==(0|0);
       if ($137) {
        $$3365 = 0;
        break;
       } else {
        $$1363 = $136;$$1367 = $132;
       }
      } else {
       $$1363 = $134;$$1367 = $133;
      }
      while(1) {
       $138 = ((($$1363)) + 20|0);
       $139 = HEAP32[$138>>2]|0;
       $140 = ($139|0)==(0|0);
       if (!($140)) {
        $$1363 = $139;$$1367 = $138;
        continue;
       }
       $141 = ((($$1363)) + 16|0);
       $142 = HEAP32[$141>>2]|0;
       $143 = ($142|0)==(0|0);
       if ($143) {
        break;
       } else {
        $$1363 = $142;$$1367 = $141;
       }
      }
      HEAP32[$$1367>>2] = 0;
      $$3365 = $$1363;
     } else {
      $128 = ((($7)) + 8|0);
      $129 = HEAP32[$128>>2]|0;
      $130 = ((($129)) + 12|0);
      HEAP32[$130>>2] = $126;
      $131 = ((($126)) + 8|0);
      HEAP32[$131>>2] = $129;
      $$3365 = $126;
     }
    } while(0);
    $144 = ($124|0)==(0|0);
    if (!($144)) {
     $145 = ((($7)) + 28|0);
     $146 = HEAP32[$145>>2]|0;
     $147 = (5912 + ($146<<2)|0);
     $148 = HEAP32[$147>>2]|0;
     $149 = ($7|0)==($148|0);
     if ($149) {
      HEAP32[$147>>2] = $$3365;
      $cond375 = ($$3365|0)==(0|0);
      if ($cond375) {
       $150 = 1 << $146;
       $151 = $150 ^ -1;
       $152 = HEAP32[(5612)>>2]|0;
       $153 = $152 & $151;
       HEAP32[(5612)>>2] = $153;
       break;
      }
     } else {
      $154 = ((($124)) + 16|0);
      $155 = HEAP32[$154>>2]|0;
      $not$ = ($155|0)!=($7|0);
      $$sink5 = $not$&1;
      $156 = (((($124)) + 16|0) + ($$sink5<<2)|0);
      HEAP32[$156>>2] = $$3365;
      $157 = ($$3365|0)==(0|0);
      if ($157) {
       break;
      }
     }
     $158 = ((($$3365)) + 24|0);
     HEAP32[$158>>2] = $124;
     $159 = ((($7)) + 16|0);
     $160 = HEAP32[$159>>2]|0;
     $161 = ($160|0)==(0|0);
     if (!($161)) {
      $162 = ((($$3365)) + 16|0);
      HEAP32[$162>>2] = $160;
      $163 = ((($160)) + 24|0);
      HEAP32[$163>>2] = $$3365;
     }
     $164 = ((($159)) + 4|0);
     $165 = HEAP32[$164>>2]|0;
     $166 = ($165|0)==(0|0);
     if (!($166)) {
      $167 = ((($$3365)) + 20|0);
      HEAP32[$167>>2] = $165;
      $168 = ((($165)) + 24|0);
      HEAP32[$168>>2] = $$3365;
     }
    }
   }
  } while(0);
  $169 = $109 | 1;
  $170 = ((($$1)) + 4|0);
  HEAP32[$170>>2] = $169;
  $171 = (($86) + ($109)|0);
  HEAP32[$171>>2] = $109;
  $172 = HEAP32[(5628)>>2]|0;
  $173 = ($$1|0)==($172|0);
  if ($173) {
   HEAP32[(5616)>>2] = $109;
   return;
  } else {
   $$2 = $109;
  }
 } else {
  $174 = $89 & -2;
  HEAP32[$88>>2] = $174;
  $175 = $$1347 | 1;
  $176 = ((($$1)) + 4|0);
  HEAP32[$176>>2] = $175;
  $177 = (($86) + ($$1347)|0);
  HEAP32[$177>>2] = $$1347;
  $$2 = $$1347;
 }
 $178 = $$2 >>> 3;
 $179 = ($$2>>>0)<(256);
 if ($179) {
  $180 = $178 << 1;
  $181 = (5648 + ($180<<2)|0);
  $182 = HEAP32[1402]|0;
  $183 = 1 << $178;
  $184 = $182 & $183;
  $185 = ($184|0)==(0);
  if ($185) {
   $186 = $182 | $183;
   HEAP32[1402] = $186;
   $$pre = ((($181)) + 8|0);
   $$0368 = $181;$$pre$phiZ2D = $$pre;
  } else {
   $187 = ((($181)) + 8|0);
   $188 = HEAP32[$187>>2]|0;
   $$0368 = $188;$$pre$phiZ2D = $187;
  }
  HEAP32[$$pre$phiZ2D>>2] = $$1;
  $189 = ((($$0368)) + 12|0);
  HEAP32[$189>>2] = $$1;
  $190 = ((($$1)) + 8|0);
  HEAP32[$190>>2] = $$0368;
  $191 = ((($$1)) + 12|0);
  HEAP32[$191>>2] = $181;
  return;
 }
 $192 = $$2 >>> 8;
 $193 = ($192|0)==(0);
 if ($193) {
  $$0361 = 0;
 } else {
  $194 = ($$2>>>0)>(16777215);
  if ($194) {
   $$0361 = 31;
  } else {
   $195 = (($192) + 1048320)|0;
   $196 = $195 >>> 16;
   $197 = $196 & 8;
   $198 = $192 << $197;
   $199 = (($198) + 520192)|0;
   $200 = $199 >>> 16;
   $201 = $200 & 4;
   $202 = $201 | $197;
   $203 = $198 << $201;
   $204 = (($203) + 245760)|0;
   $205 = $204 >>> 16;
   $206 = $205 & 2;
   $207 = $202 | $206;
   $208 = (14 - ($207))|0;
   $209 = $203 << $206;
   $210 = $209 >>> 15;
   $211 = (($208) + ($210))|0;
   $212 = $211 << 1;
   $213 = (($211) + 7)|0;
   $214 = $$2 >>> $213;
   $215 = $214 & 1;
   $216 = $215 | $212;
   $$0361 = $216;
  }
 }
 $217 = (5912 + ($$0361<<2)|0);
 $218 = ((($$1)) + 28|0);
 HEAP32[$218>>2] = $$0361;
 $219 = ((($$1)) + 16|0);
 $220 = ((($$1)) + 20|0);
 HEAP32[$220>>2] = 0;
 HEAP32[$219>>2] = 0;
 $221 = HEAP32[(5612)>>2]|0;
 $222 = 1 << $$0361;
 $223 = $221 & $222;
 $224 = ($223|0)==(0);
 do {
  if ($224) {
   $225 = $221 | $222;
   HEAP32[(5612)>>2] = $225;
   HEAP32[$217>>2] = $$1;
   $226 = ((($$1)) + 24|0);
   HEAP32[$226>>2] = $217;
   $227 = ((($$1)) + 12|0);
   HEAP32[$227>>2] = $$1;
   $228 = ((($$1)) + 8|0);
   HEAP32[$228>>2] = $$1;
  } else {
   $229 = HEAP32[$217>>2]|0;
   $230 = ($$0361|0)==(31);
   $231 = $$0361 >>> 1;
   $232 = (25 - ($231))|0;
   $233 = $230 ? 0 : $232;
   $234 = $$2 << $233;
   $$0348 = $234;$$0349 = $229;
   while(1) {
    $235 = ((($$0349)) + 4|0);
    $236 = HEAP32[$235>>2]|0;
    $237 = $236 & -8;
    $238 = ($237|0)==($$2|0);
    if ($238) {
     label = 73;
     break;
    }
    $239 = $$0348 >>> 31;
    $240 = (((($$0349)) + 16|0) + ($239<<2)|0);
    $241 = $$0348 << 1;
    $242 = HEAP32[$240>>2]|0;
    $243 = ($242|0)==(0|0);
    if ($243) {
     label = 72;
     break;
    } else {
     $$0348 = $241;$$0349 = $242;
    }
   }
   if ((label|0) == 72) {
    HEAP32[$240>>2] = $$1;
    $244 = ((($$1)) + 24|0);
    HEAP32[$244>>2] = $$0349;
    $245 = ((($$1)) + 12|0);
    HEAP32[$245>>2] = $$1;
    $246 = ((($$1)) + 8|0);
    HEAP32[$246>>2] = $$1;
    break;
   }
   else if ((label|0) == 73) {
    $247 = ((($$0349)) + 8|0);
    $248 = HEAP32[$247>>2]|0;
    $249 = ((($248)) + 12|0);
    HEAP32[$249>>2] = $$1;
    HEAP32[$247>>2] = $$1;
    $250 = ((($$1)) + 8|0);
    HEAP32[$250>>2] = $248;
    $251 = ((($$1)) + 12|0);
    HEAP32[$251>>2] = $$0349;
    $252 = ((($$1)) + 24|0);
    HEAP32[$252>>2] = 0;
    break;
   }
  }
 } while(0);
 $253 = HEAP32[(5640)>>2]|0;
 $254 = (($253) + -1)|0;
 HEAP32[(5640)>>2] = $254;
 $255 = ($254|0)==(0);
 if ($255) {
  $$0195$in$i = (6064);
 } else {
  return;
 }
 while(1) {
  $$0195$i = HEAP32[$$0195$in$i>>2]|0;
  $256 = ($$0195$i|0)==(0|0);
  $257 = ((($$0195$i)) + 8|0);
  if ($256) {
   break;
  } else {
   $$0195$in$i = $257;
  }
 }
 HEAP32[(5640)>>2] = -1;
 return;
}
function _realloc($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $3 = 0, $4 = 0, $5 = 0;
 var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ($0|0)==(0|0);
 if ($2) {
  $3 = (_malloc($1)|0);
  $$1 = $3;
  return ($$1|0);
 }
 $4 = ($1>>>0)>(4294967231);
 if ($4) {
  $5 = (___errno_location()|0);
  HEAP32[$5>>2] = 12;
  $$1 = 0;
  return ($$1|0);
 }
 $6 = ($1>>>0)<(11);
 $7 = (($1) + 11)|0;
 $8 = $7 & -8;
 $9 = $6 ? 16 : $8;
 $10 = ((($0)) + -8|0);
 $11 = (_try_realloc_chunk($10,$9)|0);
 $12 = ($11|0)==(0|0);
 if (!($12)) {
  $13 = ((($11)) + 8|0);
  $$1 = $13;
  return ($$1|0);
 }
 $14 = (_malloc($1)|0);
 $15 = ($14|0)==(0|0);
 if ($15) {
  $$1 = 0;
  return ($$1|0);
 }
 $16 = ((($0)) + -4|0);
 $17 = HEAP32[$16>>2]|0;
 $18 = $17 & -8;
 $19 = $17 & 3;
 $20 = ($19|0)==(0);
 $21 = $20 ? 8 : 4;
 $22 = (($18) - ($21))|0;
 $23 = ($22>>>0)<($1>>>0);
 $24 = $23 ? $22 : $1;
 _memcpy(($14|0),($0|0),($24|0))|0;
 _free($0);
 $$1 = $14;
 return ($$1|0);
}
function _try_realloc_chunk($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$1246 = 0, $$1249 = 0, $$2 = 0, $$3 = 0, $$sink1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0;
 var $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0;
 var $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $15 = 0, $16 = 0, $17 = 0;
 var $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0;
 var $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0;
 var $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0;
 var $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0;
 var $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $cond = 0, $not$ = 0, $storemerge = 0, $storemerge1 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ((($0)) + 4|0);
 $3 = HEAP32[$2>>2]|0;
 $4 = $3 & -8;
 $5 = (($0) + ($4)|0);
 $6 = $3 & 3;
 $7 = ($6|0)==(0);
 if ($7) {
  $8 = ($1>>>0)<(256);
  if ($8) {
   $$2 = 0;
   return ($$2|0);
  }
  $9 = (($1) + 4)|0;
  $10 = ($4>>>0)<($9>>>0);
  if (!($10)) {
   $11 = (($4) - ($1))|0;
   $12 = HEAP32[(6088)>>2]|0;
   $13 = $12 << 1;
   $14 = ($11>>>0)>($13>>>0);
   if (!($14)) {
    $$2 = $0;
    return ($$2|0);
   }
  }
  $$2 = 0;
  return ($$2|0);
 }
 $15 = ($4>>>0)<($1>>>0);
 if (!($15)) {
  $16 = (($4) - ($1))|0;
  $17 = ($16>>>0)>(15);
  if (!($17)) {
   $$2 = $0;
   return ($$2|0);
  }
  $18 = (($0) + ($1)|0);
  $19 = $3 & 1;
  $20 = $19 | $1;
  $21 = $20 | 2;
  HEAP32[$2>>2] = $21;
  $22 = ((($18)) + 4|0);
  $23 = $16 | 3;
  HEAP32[$22>>2] = $23;
  $24 = (($18) + ($16)|0);
  $25 = ((($24)) + 4|0);
  $26 = HEAP32[$25>>2]|0;
  $27 = $26 | 1;
  HEAP32[$25>>2] = $27;
  _dispose_chunk($18,$16);
  $$2 = $0;
  return ($$2|0);
 }
 $28 = HEAP32[(5632)>>2]|0;
 $29 = ($5|0)==($28|0);
 if ($29) {
  $30 = HEAP32[(5620)>>2]|0;
  $31 = (($30) + ($4))|0;
  $32 = ($31>>>0)>($1>>>0);
  $33 = (($31) - ($1))|0;
  $34 = (($0) + ($1)|0);
  if (!($32)) {
   $$2 = 0;
   return ($$2|0);
  }
  $35 = $33 | 1;
  $36 = ((($34)) + 4|0);
  $37 = $3 & 1;
  $38 = $37 | $1;
  $39 = $38 | 2;
  HEAP32[$2>>2] = $39;
  HEAP32[$36>>2] = $35;
  HEAP32[(5632)>>2] = $34;
  HEAP32[(5620)>>2] = $33;
  $$2 = $0;
  return ($$2|0);
 }
 $40 = HEAP32[(5628)>>2]|0;
 $41 = ($5|0)==($40|0);
 if ($41) {
  $42 = HEAP32[(5616)>>2]|0;
  $43 = (($42) + ($4))|0;
  $44 = ($43>>>0)<($1>>>0);
  if ($44) {
   $$2 = 0;
   return ($$2|0);
  }
  $45 = (($43) - ($1))|0;
  $46 = ($45>>>0)>(15);
  $47 = $3 & 1;
  if ($46) {
   $48 = (($0) + ($1)|0);
   $49 = (($48) + ($45)|0);
   $50 = $47 | $1;
   $51 = $50 | 2;
   HEAP32[$2>>2] = $51;
   $52 = ((($48)) + 4|0);
   $53 = $45 | 1;
   HEAP32[$52>>2] = $53;
   HEAP32[$49>>2] = $45;
   $54 = ((($49)) + 4|0);
   $55 = HEAP32[$54>>2]|0;
   $56 = $55 & -2;
   HEAP32[$54>>2] = $56;
   $storemerge = $48;$storemerge1 = $45;
  } else {
   $57 = $47 | $43;
   $58 = $57 | 2;
   HEAP32[$2>>2] = $58;
   $59 = (($0) + ($43)|0);
   $60 = ((($59)) + 4|0);
   $61 = HEAP32[$60>>2]|0;
   $62 = $61 | 1;
   HEAP32[$60>>2] = $62;
   $storemerge = 0;$storemerge1 = 0;
  }
  HEAP32[(5616)>>2] = $storemerge1;
  HEAP32[(5628)>>2] = $storemerge;
  $$2 = $0;
  return ($$2|0);
 }
 $63 = ((($5)) + 4|0);
 $64 = HEAP32[$63>>2]|0;
 $65 = $64 & 2;
 $66 = ($65|0)==(0);
 if (!($66)) {
  $$2 = 0;
  return ($$2|0);
 }
 $67 = $64 & -8;
 $68 = (($67) + ($4))|0;
 $69 = ($68>>>0)<($1>>>0);
 if ($69) {
  $$2 = 0;
  return ($$2|0);
 }
 $70 = (($68) - ($1))|0;
 $71 = $64 >>> 3;
 $72 = ($64>>>0)<(256);
 do {
  if ($72) {
   $73 = ((($5)) + 8|0);
   $74 = HEAP32[$73>>2]|0;
   $75 = ((($5)) + 12|0);
   $76 = HEAP32[$75>>2]|0;
   $77 = ($76|0)==($74|0);
   if ($77) {
    $78 = 1 << $71;
    $79 = $78 ^ -1;
    $80 = HEAP32[1402]|0;
    $81 = $80 & $79;
    HEAP32[1402] = $81;
    break;
   } else {
    $82 = ((($74)) + 12|0);
    HEAP32[$82>>2] = $76;
    $83 = ((($76)) + 8|0);
    HEAP32[$83>>2] = $74;
    break;
   }
  } else {
   $84 = ((($5)) + 24|0);
   $85 = HEAP32[$84>>2]|0;
   $86 = ((($5)) + 12|0);
   $87 = HEAP32[$86>>2]|0;
   $88 = ($87|0)==($5|0);
   do {
    if ($88) {
     $93 = ((($5)) + 16|0);
     $94 = ((($93)) + 4|0);
     $95 = HEAP32[$94>>2]|0;
     $96 = ($95|0)==(0|0);
     if ($96) {
      $97 = HEAP32[$93>>2]|0;
      $98 = ($97|0)==(0|0);
      if ($98) {
       $$3 = 0;
       break;
      } else {
       $$1246 = $97;$$1249 = $93;
      }
     } else {
      $$1246 = $95;$$1249 = $94;
     }
     while(1) {
      $99 = ((($$1246)) + 20|0);
      $100 = HEAP32[$99>>2]|0;
      $101 = ($100|0)==(0|0);
      if (!($101)) {
       $$1246 = $100;$$1249 = $99;
       continue;
      }
      $102 = ((($$1246)) + 16|0);
      $103 = HEAP32[$102>>2]|0;
      $104 = ($103|0)==(0|0);
      if ($104) {
       break;
      } else {
       $$1246 = $103;$$1249 = $102;
      }
     }
     HEAP32[$$1249>>2] = 0;
     $$3 = $$1246;
    } else {
     $89 = ((($5)) + 8|0);
     $90 = HEAP32[$89>>2]|0;
     $91 = ((($90)) + 12|0);
     HEAP32[$91>>2] = $87;
     $92 = ((($87)) + 8|0);
     HEAP32[$92>>2] = $90;
     $$3 = $87;
    }
   } while(0);
   $105 = ($85|0)==(0|0);
   if (!($105)) {
    $106 = ((($5)) + 28|0);
    $107 = HEAP32[$106>>2]|0;
    $108 = (5912 + ($107<<2)|0);
    $109 = HEAP32[$108>>2]|0;
    $110 = ($5|0)==($109|0);
    if ($110) {
     HEAP32[$108>>2] = $$3;
     $cond = ($$3|0)==(0|0);
     if ($cond) {
      $111 = 1 << $107;
      $112 = $111 ^ -1;
      $113 = HEAP32[(5612)>>2]|0;
      $114 = $113 & $112;
      HEAP32[(5612)>>2] = $114;
      break;
     }
    } else {
     $115 = ((($85)) + 16|0);
     $116 = HEAP32[$115>>2]|0;
     $not$ = ($116|0)!=($5|0);
     $$sink1 = $not$&1;
     $117 = (((($85)) + 16|0) + ($$sink1<<2)|0);
     HEAP32[$117>>2] = $$3;
     $118 = ($$3|0)==(0|0);
     if ($118) {
      break;
     }
    }
    $119 = ((($$3)) + 24|0);
    HEAP32[$119>>2] = $85;
    $120 = ((($5)) + 16|0);
    $121 = HEAP32[$120>>2]|0;
    $122 = ($121|0)==(0|0);
    if (!($122)) {
     $123 = ((($$3)) + 16|0);
     HEAP32[$123>>2] = $121;
     $124 = ((($121)) + 24|0);
     HEAP32[$124>>2] = $$3;
    }
    $125 = ((($120)) + 4|0);
    $126 = HEAP32[$125>>2]|0;
    $127 = ($126|0)==(0|0);
    if (!($127)) {
     $128 = ((($$3)) + 20|0);
     HEAP32[$128>>2] = $126;
     $129 = ((($126)) + 24|0);
     HEAP32[$129>>2] = $$3;
    }
   }
  }
 } while(0);
 $130 = ($70>>>0)<(16);
 $131 = $3 & 1;
 if ($130) {
  $132 = $68 | $131;
  $133 = $132 | 2;
  HEAP32[$2>>2] = $133;
  $134 = (($0) + ($68)|0);
  $135 = ((($134)) + 4|0);
  $136 = HEAP32[$135>>2]|0;
  $137 = $136 | 1;
  HEAP32[$135>>2] = $137;
  $$2 = $0;
  return ($$2|0);
 } else {
  $138 = (($0) + ($1)|0);
  $139 = $131 | $1;
  $140 = $139 | 2;
  HEAP32[$2>>2] = $140;
  $141 = ((($138)) + 4|0);
  $142 = $70 | 3;
  HEAP32[$141>>2] = $142;
  $143 = (($138) + ($70)|0);
  $144 = ((($143)) + 4|0);
  $145 = HEAP32[$144>>2]|0;
  $146 = $145 | 1;
  HEAP32[$144>>2] = $146;
  _dispose_chunk($138,$70);
  $$2 = $0;
  return ($$2|0);
 }
 return (0)|0;
}
function _dispose_chunk($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0366 = 0, $$0367 = 0, $$0378 = 0, $$0385 = 0, $$1 = 0, $$1365 = 0, $$1373 = 0, $$1376 = 0, $$1380 = 0, $$1384 = 0, $$2 = 0, $$3 = 0, $$3382 = 0, $$pre = 0, $$pre$phiZ2D = 0, $$sink2 = 0, $$sink4 = 0, $10 = 0, $100 = 0, $101 = 0;
 var $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0;
 var $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0;
 var $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0;
 var $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0;
 var $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0;
 var $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0;
 var $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0;
 var $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $25 = 0, $26 = 0;
 var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
 var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
 var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
 var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0;
 var $cond = 0, $cond5 = 0, $not$ = 0, $not$1 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = (($0) + ($1)|0);
 $3 = ((($0)) + 4|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = $4 & 1;
 $6 = ($5|0)==(0);
 do {
  if ($6) {
   $7 = HEAP32[$0>>2]|0;
   $8 = $4 & 3;
   $9 = ($8|0)==(0);
   if ($9) {
    return;
   }
   $10 = (0 - ($7))|0;
   $11 = (($0) + ($10)|0);
   $12 = (($7) + ($1))|0;
   $13 = HEAP32[(5628)>>2]|0;
   $14 = ($11|0)==($13|0);
   if ($14) {
    $74 = ((($2)) + 4|0);
    $75 = HEAP32[$74>>2]|0;
    $76 = $75 & 3;
    $77 = ($76|0)==(3);
    if (!($77)) {
     $$1 = $11;$$1365 = $12;
     break;
    }
    $78 = (($11) + ($12)|0);
    $79 = ((($11)) + 4|0);
    $80 = $12 | 1;
    $81 = $75 & -2;
    HEAP32[(5616)>>2] = $12;
    HEAP32[$74>>2] = $81;
    HEAP32[$79>>2] = $80;
    HEAP32[$78>>2] = $12;
    return;
   }
   $15 = $7 >>> 3;
   $16 = ($7>>>0)<(256);
   if ($16) {
    $17 = ((($11)) + 8|0);
    $18 = HEAP32[$17>>2]|0;
    $19 = ((($11)) + 12|0);
    $20 = HEAP32[$19>>2]|0;
    $21 = ($20|0)==($18|0);
    if ($21) {
     $22 = 1 << $15;
     $23 = $22 ^ -1;
     $24 = HEAP32[1402]|0;
     $25 = $24 & $23;
     HEAP32[1402] = $25;
     $$1 = $11;$$1365 = $12;
     break;
    } else {
     $26 = ((($18)) + 12|0);
     HEAP32[$26>>2] = $20;
     $27 = ((($20)) + 8|0);
     HEAP32[$27>>2] = $18;
     $$1 = $11;$$1365 = $12;
     break;
    }
   }
   $28 = ((($11)) + 24|0);
   $29 = HEAP32[$28>>2]|0;
   $30 = ((($11)) + 12|0);
   $31 = HEAP32[$30>>2]|0;
   $32 = ($31|0)==($11|0);
   do {
    if ($32) {
     $37 = ((($11)) + 16|0);
     $38 = ((($37)) + 4|0);
     $39 = HEAP32[$38>>2]|0;
     $40 = ($39|0)==(0|0);
     if ($40) {
      $41 = HEAP32[$37>>2]|0;
      $42 = ($41|0)==(0|0);
      if ($42) {
       $$3 = 0;
       break;
      } else {
       $$1373 = $41;$$1376 = $37;
      }
     } else {
      $$1373 = $39;$$1376 = $38;
     }
     while(1) {
      $43 = ((($$1373)) + 20|0);
      $44 = HEAP32[$43>>2]|0;
      $45 = ($44|0)==(0|0);
      if (!($45)) {
       $$1373 = $44;$$1376 = $43;
       continue;
      }
      $46 = ((($$1373)) + 16|0);
      $47 = HEAP32[$46>>2]|0;
      $48 = ($47|0)==(0|0);
      if ($48) {
       break;
      } else {
       $$1373 = $47;$$1376 = $46;
      }
     }
     HEAP32[$$1376>>2] = 0;
     $$3 = $$1373;
    } else {
     $33 = ((($11)) + 8|0);
     $34 = HEAP32[$33>>2]|0;
     $35 = ((($34)) + 12|0);
     HEAP32[$35>>2] = $31;
     $36 = ((($31)) + 8|0);
     HEAP32[$36>>2] = $34;
     $$3 = $31;
    }
   } while(0);
   $49 = ($29|0)==(0|0);
   if ($49) {
    $$1 = $11;$$1365 = $12;
   } else {
    $50 = ((($11)) + 28|0);
    $51 = HEAP32[$50>>2]|0;
    $52 = (5912 + ($51<<2)|0);
    $53 = HEAP32[$52>>2]|0;
    $54 = ($11|0)==($53|0);
    if ($54) {
     HEAP32[$52>>2] = $$3;
     $cond = ($$3|0)==(0|0);
     if ($cond) {
      $55 = 1 << $51;
      $56 = $55 ^ -1;
      $57 = HEAP32[(5612)>>2]|0;
      $58 = $57 & $56;
      HEAP32[(5612)>>2] = $58;
      $$1 = $11;$$1365 = $12;
      break;
     }
    } else {
     $59 = ((($29)) + 16|0);
     $60 = HEAP32[$59>>2]|0;
     $not$1 = ($60|0)!=($11|0);
     $$sink2 = $not$1&1;
     $61 = (((($29)) + 16|0) + ($$sink2<<2)|0);
     HEAP32[$61>>2] = $$3;
     $62 = ($$3|0)==(0|0);
     if ($62) {
      $$1 = $11;$$1365 = $12;
      break;
     }
    }
    $63 = ((($$3)) + 24|0);
    HEAP32[$63>>2] = $29;
    $64 = ((($11)) + 16|0);
    $65 = HEAP32[$64>>2]|0;
    $66 = ($65|0)==(0|0);
    if (!($66)) {
     $67 = ((($$3)) + 16|0);
     HEAP32[$67>>2] = $65;
     $68 = ((($65)) + 24|0);
     HEAP32[$68>>2] = $$3;
    }
    $69 = ((($64)) + 4|0);
    $70 = HEAP32[$69>>2]|0;
    $71 = ($70|0)==(0|0);
    if ($71) {
     $$1 = $11;$$1365 = $12;
    } else {
     $72 = ((($$3)) + 20|0);
     HEAP32[$72>>2] = $70;
     $73 = ((($70)) + 24|0);
     HEAP32[$73>>2] = $$3;
     $$1 = $11;$$1365 = $12;
    }
   }
  } else {
   $$1 = $0;$$1365 = $1;
  }
 } while(0);
 $82 = ((($2)) + 4|0);
 $83 = HEAP32[$82>>2]|0;
 $84 = $83 & 2;
 $85 = ($84|0)==(0);
 if ($85) {
  $86 = HEAP32[(5632)>>2]|0;
  $87 = ($2|0)==($86|0);
  $88 = HEAP32[(5628)>>2]|0;
  if ($87) {
   $89 = HEAP32[(5620)>>2]|0;
   $90 = (($89) + ($$1365))|0;
   HEAP32[(5620)>>2] = $90;
   HEAP32[(5632)>>2] = $$1;
   $91 = $90 | 1;
   $92 = ((($$1)) + 4|0);
   HEAP32[$92>>2] = $91;
   $93 = ($$1|0)==($88|0);
   if (!($93)) {
    return;
   }
   HEAP32[(5628)>>2] = 0;
   HEAP32[(5616)>>2] = 0;
   return;
  }
  $94 = ($2|0)==($88|0);
  if ($94) {
   $95 = HEAP32[(5616)>>2]|0;
   $96 = (($95) + ($$1365))|0;
   HEAP32[(5616)>>2] = $96;
   HEAP32[(5628)>>2] = $$1;
   $97 = $96 | 1;
   $98 = ((($$1)) + 4|0);
   HEAP32[$98>>2] = $97;
   $99 = (($$1) + ($96)|0);
   HEAP32[$99>>2] = $96;
   return;
  }
  $100 = $83 & -8;
  $101 = (($100) + ($$1365))|0;
  $102 = $83 >>> 3;
  $103 = ($83>>>0)<(256);
  do {
   if ($103) {
    $104 = ((($2)) + 8|0);
    $105 = HEAP32[$104>>2]|0;
    $106 = ((($2)) + 12|0);
    $107 = HEAP32[$106>>2]|0;
    $108 = ($107|0)==($105|0);
    if ($108) {
     $109 = 1 << $102;
     $110 = $109 ^ -1;
     $111 = HEAP32[1402]|0;
     $112 = $111 & $110;
     HEAP32[1402] = $112;
     break;
    } else {
     $113 = ((($105)) + 12|0);
     HEAP32[$113>>2] = $107;
     $114 = ((($107)) + 8|0);
     HEAP32[$114>>2] = $105;
     break;
    }
   } else {
    $115 = ((($2)) + 24|0);
    $116 = HEAP32[$115>>2]|0;
    $117 = ((($2)) + 12|0);
    $118 = HEAP32[$117>>2]|0;
    $119 = ($118|0)==($2|0);
    do {
     if ($119) {
      $124 = ((($2)) + 16|0);
      $125 = ((($124)) + 4|0);
      $126 = HEAP32[$125>>2]|0;
      $127 = ($126|0)==(0|0);
      if ($127) {
       $128 = HEAP32[$124>>2]|0;
       $129 = ($128|0)==(0|0);
       if ($129) {
        $$3382 = 0;
        break;
       } else {
        $$1380 = $128;$$1384 = $124;
       }
      } else {
       $$1380 = $126;$$1384 = $125;
      }
      while(1) {
       $130 = ((($$1380)) + 20|0);
       $131 = HEAP32[$130>>2]|0;
       $132 = ($131|0)==(0|0);
       if (!($132)) {
        $$1380 = $131;$$1384 = $130;
        continue;
       }
       $133 = ((($$1380)) + 16|0);
       $134 = HEAP32[$133>>2]|0;
       $135 = ($134|0)==(0|0);
       if ($135) {
        break;
       } else {
        $$1380 = $134;$$1384 = $133;
       }
      }
      HEAP32[$$1384>>2] = 0;
      $$3382 = $$1380;
     } else {
      $120 = ((($2)) + 8|0);
      $121 = HEAP32[$120>>2]|0;
      $122 = ((($121)) + 12|0);
      HEAP32[$122>>2] = $118;
      $123 = ((($118)) + 8|0);
      HEAP32[$123>>2] = $121;
      $$3382 = $118;
     }
    } while(0);
    $136 = ($116|0)==(0|0);
    if (!($136)) {
     $137 = ((($2)) + 28|0);
     $138 = HEAP32[$137>>2]|0;
     $139 = (5912 + ($138<<2)|0);
     $140 = HEAP32[$139>>2]|0;
     $141 = ($2|0)==($140|0);
     if ($141) {
      HEAP32[$139>>2] = $$3382;
      $cond5 = ($$3382|0)==(0|0);
      if ($cond5) {
       $142 = 1 << $138;
       $143 = $142 ^ -1;
       $144 = HEAP32[(5612)>>2]|0;
       $145 = $144 & $143;
       HEAP32[(5612)>>2] = $145;
       break;
      }
     } else {
      $146 = ((($116)) + 16|0);
      $147 = HEAP32[$146>>2]|0;
      $not$ = ($147|0)!=($2|0);
      $$sink4 = $not$&1;
      $148 = (((($116)) + 16|0) + ($$sink4<<2)|0);
      HEAP32[$148>>2] = $$3382;
      $149 = ($$3382|0)==(0|0);
      if ($149) {
       break;
      }
     }
     $150 = ((($$3382)) + 24|0);
     HEAP32[$150>>2] = $116;
     $151 = ((($2)) + 16|0);
     $152 = HEAP32[$151>>2]|0;
     $153 = ($152|0)==(0|0);
     if (!($153)) {
      $154 = ((($$3382)) + 16|0);
      HEAP32[$154>>2] = $152;
      $155 = ((($152)) + 24|0);
      HEAP32[$155>>2] = $$3382;
     }
     $156 = ((($151)) + 4|0);
     $157 = HEAP32[$156>>2]|0;
     $158 = ($157|0)==(0|0);
     if (!($158)) {
      $159 = ((($$3382)) + 20|0);
      HEAP32[$159>>2] = $157;
      $160 = ((($157)) + 24|0);
      HEAP32[$160>>2] = $$3382;
     }
    }
   }
  } while(0);
  $161 = $101 | 1;
  $162 = ((($$1)) + 4|0);
  HEAP32[$162>>2] = $161;
  $163 = (($$1) + ($101)|0);
  HEAP32[$163>>2] = $101;
  $164 = HEAP32[(5628)>>2]|0;
  $165 = ($$1|0)==($164|0);
  if ($165) {
   HEAP32[(5616)>>2] = $101;
   return;
  } else {
   $$2 = $101;
  }
 } else {
  $166 = $83 & -2;
  HEAP32[$82>>2] = $166;
  $167 = $$1365 | 1;
  $168 = ((($$1)) + 4|0);
  HEAP32[$168>>2] = $167;
  $169 = (($$1) + ($$1365)|0);
  HEAP32[$169>>2] = $$1365;
  $$2 = $$1365;
 }
 $170 = $$2 >>> 3;
 $171 = ($$2>>>0)<(256);
 if ($171) {
  $172 = $170 << 1;
  $173 = (5648 + ($172<<2)|0);
  $174 = HEAP32[1402]|0;
  $175 = 1 << $170;
  $176 = $174 & $175;
  $177 = ($176|0)==(0);
  if ($177) {
   $178 = $174 | $175;
   HEAP32[1402] = $178;
   $$pre = ((($173)) + 8|0);
   $$0385 = $173;$$pre$phiZ2D = $$pre;
  } else {
   $179 = ((($173)) + 8|0);
   $180 = HEAP32[$179>>2]|0;
   $$0385 = $180;$$pre$phiZ2D = $179;
  }
  HEAP32[$$pre$phiZ2D>>2] = $$1;
  $181 = ((($$0385)) + 12|0);
  HEAP32[$181>>2] = $$1;
  $182 = ((($$1)) + 8|0);
  HEAP32[$182>>2] = $$0385;
  $183 = ((($$1)) + 12|0);
  HEAP32[$183>>2] = $173;
  return;
 }
 $184 = $$2 >>> 8;
 $185 = ($184|0)==(0);
 if ($185) {
  $$0378 = 0;
 } else {
  $186 = ($$2>>>0)>(16777215);
  if ($186) {
   $$0378 = 31;
  } else {
   $187 = (($184) + 1048320)|0;
   $188 = $187 >>> 16;
   $189 = $188 & 8;
   $190 = $184 << $189;
   $191 = (($190) + 520192)|0;
   $192 = $191 >>> 16;
   $193 = $192 & 4;
   $194 = $193 | $189;
   $195 = $190 << $193;
   $196 = (($195) + 245760)|0;
   $197 = $196 >>> 16;
   $198 = $197 & 2;
   $199 = $194 | $198;
   $200 = (14 - ($199))|0;
   $201 = $195 << $198;
   $202 = $201 >>> 15;
   $203 = (($200) + ($202))|0;
   $204 = $203 << 1;
   $205 = (($203) + 7)|0;
   $206 = $$2 >>> $205;
   $207 = $206 & 1;
   $208 = $207 | $204;
   $$0378 = $208;
  }
 }
 $209 = (5912 + ($$0378<<2)|0);
 $210 = ((($$1)) + 28|0);
 HEAP32[$210>>2] = $$0378;
 $211 = ((($$1)) + 16|0);
 $212 = ((($$1)) + 20|0);
 HEAP32[$212>>2] = 0;
 HEAP32[$211>>2] = 0;
 $213 = HEAP32[(5612)>>2]|0;
 $214 = 1 << $$0378;
 $215 = $213 & $214;
 $216 = ($215|0)==(0);
 if ($216) {
  $217 = $213 | $214;
  HEAP32[(5612)>>2] = $217;
  HEAP32[$209>>2] = $$1;
  $218 = ((($$1)) + 24|0);
  HEAP32[$218>>2] = $209;
  $219 = ((($$1)) + 12|0);
  HEAP32[$219>>2] = $$1;
  $220 = ((($$1)) + 8|0);
  HEAP32[$220>>2] = $$1;
  return;
 }
 $221 = HEAP32[$209>>2]|0;
 $222 = ($$0378|0)==(31);
 $223 = $$0378 >>> 1;
 $224 = (25 - ($223))|0;
 $225 = $222 ? 0 : $224;
 $226 = $$2 << $225;
 $$0366 = $226;$$0367 = $221;
 while(1) {
  $227 = ((($$0367)) + 4|0);
  $228 = HEAP32[$227>>2]|0;
  $229 = $228 & -8;
  $230 = ($229|0)==($$2|0);
  if ($230) {
   label = 69;
   break;
  }
  $231 = $$0366 >>> 31;
  $232 = (((($$0367)) + 16|0) + ($231<<2)|0);
  $233 = $$0366 << 1;
  $234 = HEAP32[$232>>2]|0;
  $235 = ($234|0)==(0|0);
  if ($235) {
   label = 68;
   break;
  } else {
   $$0366 = $233;$$0367 = $234;
  }
 }
 if ((label|0) == 68) {
  HEAP32[$232>>2] = $$1;
  $236 = ((($$1)) + 24|0);
  HEAP32[$236>>2] = $$0367;
  $237 = ((($$1)) + 12|0);
  HEAP32[$237>>2] = $$1;
  $238 = ((($$1)) + 8|0);
  HEAP32[$238>>2] = $$1;
  return;
 }
 else if ((label|0) == 69) {
  $239 = ((($$0367)) + 8|0);
  $240 = HEAP32[$239>>2]|0;
  $241 = ((($240)) + 12|0);
  HEAP32[$241>>2] = $$1;
  HEAP32[$239>>2] = $$1;
  $242 = ((($$1)) + 8|0);
  HEAP32[$242>>2] = $240;
  $243 = ((($$1)) + 12|0);
  HEAP32[$243>>2] = $$0367;
  $244 = ((($$1)) + 24|0);
  HEAP32[$244>>2] = 0;
  return;
 }
}
function ___stdio_close($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $vararg_buffer = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $vararg_buffer = sp;
 $1 = ((($0)) + 60|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = (_dummy_82($2)|0);
 HEAP32[$vararg_buffer>>2] = $3;
 $4 = (___syscall6(6,($vararg_buffer|0))|0);
 $5 = (___syscall_ret($4)|0);
 STACKTOP = sp;return ($5|0);
}
function ___stdout_write($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $vararg_buffer = sp;
 $3 = sp + 16|0;
 $4 = ((($0)) + 36|0);
 HEAP32[$4>>2] = 5;
 $5 = HEAP32[$0>>2]|0;
 $6 = $5 & 64;
 $7 = ($6|0)==(0);
 if ($7) {
  $8 = ((($0)) + 60|0);
  $9 = HEAP32[$8>>2]|0;
  $10 = $3;
  HEAP32[$vararg_buffer>>2] = $9;
  $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
  HEAP32[$vararg_ptr1>>2] = 21523;
  $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
  HEAP32[$vararg_ptr2>>2] = $10;
  $11 = (___syscall54(54,($vararg_buffer|0))|0);
  $12 = ($11|0)==(0);
  if (!($12)) {
   $13 = ((($0)) + 75|0);
   HEAP8[$13>>0] = -1;
  }
 }
 $14 = (___stdio_write($0,$1,$2)|0);
 STACKTOP = sp;return ($14|0);
}
function ___stdio_seek($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$pre = 0, $10 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr4 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $vararg_buffer = sp;
 $3 = sp + 20|0;
 $4 = ((($0)) + 60|0);
 $5 = HEAP32[$4>>2]|0;
 $6 = $3;
 HEAP32[$vararg_buffer>>2] = $5;
 $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
 HEAP32[$vararg_ptr1>>2] = 0;
 $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
 HEAP32[$vararg_ptr2>>2] = $1;
 $vararg_ptr3 = ((($vararg_buffer)) + 12|0);
 HEAP32[$vararg_ptr3>>2] = $6;
 $vararg_ptr4 = ((($vararg_buffer)) + 16|0);
 HEAP32[$vararg_ptr4>>2] = $2;
 $7 = (___syscall140(140,($vararg_buffer|0))|0);
 $8 = (___syscall_ret($7)|0);
 $9 = ($8|0)<(0);
 if ($9) {
  HEAP32[$3>>2] = -1;
  $10 = -1;
 } else {
  $$pre = HEAP32[$3>>2]|0;
  $10 = $$pre;
 }
 STACKTOP = sp;return ($10|0);
}
function ___syscall_ret($0) {
 $0 = $0|0;
 var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ($0>>>0)>(4294963200);
 if ($1) {
  $2 = (0 - ($0))|0;
  $3 = (___errno_location()|0);
  HEAP32[$3>>2] = $2;
  $$0 = -1;
 } else {
  $$0 = $0;
 }
 return ($$0|0);
}
function ___errno_location() {
 var $0 = 0, $1 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = (___pthread_self_916()|0);
 $1 = ((($0)) + 64|0);
 return ($1|0);
}
function ___pthread_self_916() {
 var $0 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = (_pthread_self()|0);
 return ($0|0);
}
function _pthread_self() {
 var label = 0, sp = 0;
 sp = STACKTOP;
 return (200|0);
}
function ___stdio_write($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0 = 0, $$04756 = 0, $$04855 = 0, $$04954 = 0, $$051 = 0, $$1 = 0, $$150 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0;
 var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0;
 var $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0;
 var $vararg_ptr7 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(48|0);
 $vararg_buffer3 = sp + 16|0;
 $vararg_buffer = sp;
 $3 = sp + 32|0;
 $4 = ((($0)) + 28|0);
 $5 = HEAP32[$4>>2]|0;
 HEAP32[$3>>2] = $5;
 $6 = ((($3)) + 4|0);
 $7 = ((($0)) + 20|0);
 $8 = HEAP32[$7>>2]|0;
 $9 = (($8) - ($5))|0;
 HEAP32[$6>>2] = $9;
 $10 = ((($3)) + 8|0);
 HEAP32[$10>>2] = $1;
 $11 = ((($3)) + 12|0);
 HEAP32[$11>>2] = $2;
 $12 = (($9) + ($2))|0;
 $13 = ((($0)) + 60|0);
 $14 = HEAP32[$13>>2]|0;
 $15 = $3;
 HEAP32[$vararg_buffer>>2] = $14;
 $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
 HEAP32[$vararg_ptr1>>2] = $15;
 $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
 HEAP32[$vararg_ptr2>>2] = 2;
 $16 = (___syscall146(146,($vararg_buffer|0))|0);
 $17 = (___syscall_ret($16)|0);
 $18 = ($12|0)==($17|0);
 L1: do {
  if ($18) {
   label = 3;
  } else {
   $$04756 = 2;$$04855 = $12;$$04954 = $3;$25 = $17;
   while(1) {
    $26 = ($25|0)<(0);
    if ($26) {
     break;
    }
    $34 = (($$04855) - ($25))|0;
    $35 = ((($$04954)) + 4|0);
    $36 = HEAP32[$35>>2]|0;
    $37 = ($25>>>0)>($36>>>0);
    $38 = ((($$04954)) + 8|0);
    $$150 = $37 ? $38 : $$04954;
    $39 = $37 << 31 >> 31;
    $$1 = (($39) + ($$04756))|0;
    $40 = $37 ? $36 : 0;
    $$0 = (($25) - ($40))|0;
    $41 = HEAP32[$$150>>2]|0;
    $42 = (($41) + ($$0)|0);
    HEAP32[$$150>>2] = $42;
    $43 = ((($$150)) + 4|0);
    $44 = HEAP32[$43>>2]|0;
    $45 = (($44) - ($$0))|0;
    HEAP32[$43>>2] = $45;
    $46 = HEAP32[$13>>2]|0;
    $47 = $$150;
    HEAP32[$vararg_buffer3>>2] = $46;
    $vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
    HEAP32[$vararg_ptr6>>2] = $47;
    $vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
    HEAP32[$vararg_ptr7>>2] = $$1;
    $48 = (___syscall146(146,($vararg_buffer3|0))|0);
    $49 = (___syscall_ret($48)|0);
    $50 = ($34|0)==($49|0);
    if ($50) {
     label = 3;
     break L1;
    } else {
     $$04756 = $$1;$$04855 = $34;$$04954 = $$150;$25 = $49;
    }
   }
   $27 = ((($0)) + 16|0);
   HEAP32[$27>>2] = 0;
   HEAP32[$4>>2] = 0;
   HEAP32[$7>>2] = 0;
   $28 = HEAP32[$0>>2]|0;
   $29 = $28 | 32;
   HEAP32[$0>>2] = $29;
   $30 = ($$04756|0)==(2);
   if ($30) {
    $$051 = 0;
   } else {
    $31 = ((($$04954)) + 4|0);
    $32 = HEAP32[$31>>2]|0;
    $33 = (($2) - ($32))|0;
    $$051 = $33;
   }
  }
 } while(0);
 if ((label|0) == 3) {
  $19 = ((($0)) + 44|0);
  $20 = HEAP32[$19>>2]|0;
  $21 = ((($0)) + 48|0);
  $22 = HEAP32[$21>>2]|0;
  $23 = (($20) + ($22)|0);
  $24 = ((($0)) + 16|0);
  HEAP32[$24>>2] = $23;
  HEAP32[$4>>2] = $20;
  HEAP32[$7>>2] = $20;
  $$051 = $2;
 }
 STACKTOP = sp;return ($$051|0);
}
function _dummy_82($0) {
 $0 = $0|0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 return ($0|0);
}
function ___stdio_read($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0;
 var $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
 $vararg_buffer = sp;
 $3 = sp + 16|0;
 HEAP32[$3>>2] = $1;
 $4 = ((($3)) + 4|0);
 $5 = ((($0)) + 48|0);
 $6 = HEAP32[$5>>2]|0;
 $7 = ($6|0)!=(0);
 $8 = $7&1;
 $9 = (($2) - ($8))|0;
 HEAP32[$4>>2] = $9;
 $10 = ((($3)) + 8|0);
 $11 = ((($0)) + 44|0);
 $12 = HEAP32[$11>>2]|0;
 HEAP32[$10>>2] = $12;
 $13 = ((($3)) + 12|0);
 HEAP32[$13>>2] = $6;
 $14 = ((($0)) + 60|0);
 $15 = HEAP32[$14>>2]|0;
 $16 = $3;
 HEAP32[$vararg_buffer>>2] = $15;
 $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
 HEAP32[$vararg_ptr1>>2] = $16;
 $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
 HEAP32[$vararg_ptr2>>2] = 2;
 $17 = (___syscall145(145,($vararg_buffer|0))|0);
 $18 = (___syscall_ret($17)|0);
 $19 = ($18|0)<(1);
 if ($19) {
  $20 = $18 & 48;
  $21 = $20 ^ 16;
  $22 = HEAP32[$0>>2]|0;
  $23 = $22 | $21;
  HEAP32[$0>>2] = $23;
  $$0 = $18;
 } else {
  $24 = HEAP32[$4>>2]|0;
  $25 = ($18>>>0)>($24>>>0);
  if ($25) {
   $26 = (($18) - ($24))|0;
   $27 = HEAP32[$11>>2]|0;
   $28 = ((($0)) + 4|0);
   HEAP32[$28>>2] = $27;
   $29 = (($27) + ($26)|0);
   $30 = ((($0)) + 8|0);
   HEAP32[$30>>2] = $29;
   $31 = HEAP32[$5>>2]|0;
   $32 = ($31|0)==(0);
   if ($32) {
    $$0 = $2;
   } else {
    $33 = ((($27)) + 1|0);
    HEAP32[$28>>2] = $33;
    $34 = HEAP8[$27>>0]|0;
    $35 = (($2) + -1)|0;
    $36 = (($1) + ($35)|0);
    HEAP8[$36>>0] = $34;
    $$0 = $2;
   }
  } else {
   $$0 = $18;
  }
 }
 STACKTOP = sp;return ($$0|0);
}
function _emscripten_get_global_libc() {
 var label = 0, sp = 0;
 sp = STACKTOP;
 return (6104|0);
}
function _fcntl($0,$1,$varargs) {
 $0 = $0|0;
 $1 = $1|0;
 $varargs = $varargs|0;
 var $$ = 0, $$0 = 0, $$2 = 0, $$sink = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
 var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
 var $arglist_current = 0, $arglist_next = 0, $expanded = 0, $expanded2 = 0, $expanded4 = 0, $expanded5 = 0, $expanded6 = 0, $vararg_buffer = 0, $vararg_buffer13 = 0, $vararg_buffer18 = 0, $vararg_buffer23 = 0, $vararg_buffer28 = 0, $vararg_buffer3 = 0, $vararg_buffer31 = 0, $vararg_buffer36 = 0, $vararg_buffer41 = 0, $vararg_buffer46 = 0, $vararg_buffer8 = 0, $vararg_ptr1 = 0, $vararg_ptr11 = 0;
 var $vararg_ptr12 = 0, $vararg_ptr16 = 0, $vararg_ptr17 = 0, $vararg_ptr2 = 0, $vararg_ptr21 = 0, $vararg_ptr22 = 0, $vararg_ptr26 = 0, $vararg_ptr27 = 0, $vararg_ptr34 = 0, $vararg_ptr35 = 0, $vararg_ptr39 = 0, $vararg_ptr40 = 0, $vararg_ptr44 = 0, $vararg_ptr45 = 0, $vararg_ptr49 = 0, $vararg_ptr50 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 192|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(192|0);
 $vararg_buffer46 = sp + 152|0;
 $vararg_buffer41 = sp + 136|0;
 $vararg_buffer36 = sp + 120|0;
 $vararg_buffer31 = sp + 104|0;
 $vararg_buffer28 = sp + 96|0;
 $vararg_buffer23 = sp + 80|0;
 $vararg_buffer18 = sp + 64|0;
 $vararg_buffer13 = sp + 48|0;
 $vararg_buffer8 = sp + 32|0;
 $vararg_buffer3 = sp + 16|0;
 $vararg_buffer = sp;
 $2 = sp + 176|0;
 $3 = sp + 168|0;
 HEAP32[$2>>2] = $varargs;
 $arglist_current = HEAP32[$2>>2]|0;
 $4 = $arglist_current;
 $5 = ((0) + 4|0);
 $expanded2 = $5;
 $expanded = (($expanded2) - 1)|0;
 $6 = (($4) + ($expanded))|0;
 $7 = ((0) + 4|0);
 $expanded6 = $7;
 $expanded5 = (($expanded6) - 1)|0;
 $expanded4 = $expanded5 ^ -1;
 $8 = $6 & $expanded4;
 $9 = $8;
 $10 = HEAP32[$9>>2]|0;
 $arglist_next = ((($9)) + 4|0);
 HEAP32[$2>>2] = $arglist_next;
 $11 = ($1|0)==(4);
 $12 = $10 | 32768;
 $$ = $11 ? $12 : $10;
 switch ($1|0) {
 case 14:  {
  HEAP32[$vararg_buffer>>2] = $0;
  $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
  HEAP32[$vararg_ptr1>>2] = 14;
  $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
  HEAP32[$vararg_ptr2>>2] = $$;
  $13 = (___syscall221(221,($vararg_buffer|0))|0);
  $14 = (___syscall_ret($13)|0);
  $$2 = $14;
  break;
 }
 case 9:  {
  $15 = $3;
  HEAP32[$vararg_buffer3>>2] = $0;
  $vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
  HEAP32[$vararg_ptr6>>2] = 16;
  $vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
  HEAP32[$vararg_ptr7>>2] = $15;
  $16 = (___syscall221(221,($vararg_buffer3|0))|0);
  switch ($16|0) {
  case -22:  {
   HEAP32[$vararg_buffer8>>2] = $0;
   $vararg_ptr11 = ((($vararg_buffer8)) + 4|0);
   HEAP32[$vararg_ptr11>>2] = 9;
   $vararg_ptr12 = ((($vararg_buffer8)) + 8|0);
   HEAP32[$vararg_ptr12>>2] = $$;
   $17 = (___syscall221(221,($vararg_buffer8|0))|0);
   $$0 = $17;
   break;
  }
  case 0:  {
   $19 = HEAP32[$3>>2]|0;
   $20 = ($19|0)==(2);
   $21 = ((($3)) + 4|0);
   $22 = HEAP32[$21>>2]|0;
   $23 = (0 - ($22))|0;
   $24 = $20 ? $23 : $22;
   $$0 = $24;
   break;
  }
  default: {
   $18 = (___syscall_ret($16)|0);
   $$0 = $18;
  }
  }
  $$2 = $$0;
  break;
 }
 case 1030:  {
  HEAP32[$vararg_buffer13>>2] = $0;
  $vararg_ptr16 = ((($vararg_buffer13)) + 4|0);
  HEAP32[$vararg_ptr16>>2] = 1030;
  $vararg_ptr17 = ((($vararg_buffer13)) + 8|0);
  HEAP32[$vararg_ptr17>>2] = $$;
  $25 = (___syscall221(221,($vararg_buffer13|0))|0);
  $26 = ($25|0)==(-22);
  do {
   if ($26) {
    HEAP32[$vararg_buffer23>>2] = $0;
    $vararg_ptr26 = ((($vararg_buffer23)) + 4|0);
    HEAP32[$vararg_ptr26>>2] = 1030;
    $vararg_ptr27 = ((($vararg_buffer23)) + 8|0);
    HEAP32[$vararg_ptr27>>2] = 0;
    $28 = (___syscall221(221,($vararg_buffer23|0))|0);
    $29 = ($28|0)==(-22);
    if ($29) {
     HEAP32[$vararg_buffer31>>2] = $0;
     $vararg_ptr34 = ((($vararg_buffer31)) + 4|0);
     HEAP32[$vararg_ptr34>>2] = 0;
     $vararg_ptr35 = ((($vararg_buffer31)) + 8|0);
     HEAP32[$vararg_ptr35>>2] = $$;
     $31 = (___syscall221(221,($vararg_buffer31|0))|0);
     $32 = ($31|0)>(-1);
     if (!($32)) {
      $$sink = $31;
      break;
     }
     HEAP32[$vararg_buffer36>>2] = $31;
     $vararg_ptr39 = ((($vararg_buffer36)) + 4|0);
     HEAP32[$vararg_ptr39>>2] = 2;
     $vararg_ptr40 = ((($vararg_buffer36)) + 8|0);
     HEAP32[$vararg_ptr40>>2] = 1;
     (___syscall221(221,($vararg_buffer36|0))|0);
     $$sink = $31;
     break;
    } else {
     $30 = ($28|0)>(-1);
     if (!($30)) {
      $$sink = -22;
      break;
     }
     HEAP32[$vararg_buffer28>>2] = $28;
     (___syscall6(6,($vararg_buffer28|0))|0);
     $$sink = -22;
     break;
    }
   } else {
    $27 = ($25|0)>(-1);
    if ($27) {
     HEAP32[$vararg_buffer18>>2] = $25;
     $vararg_ptr21 = ((($vararg_buffer18)) + 4|0);
     HEAP32[$vararg_ptr21>>2] = 2;
     $vararg_ptr22 = ((($vararg_buffer18)) + 8|0);
     HEAP32[$vararg_ptr22>>2] = 1;
     (___syscall221(221,($vararg_buffer18|0))|0);
     $$sink = $25;
    } else {
     $$sink = $25;
    }
   }
  } while(0);
  $33 = (___syscall_ret($$sink)|0);
  $$2 = $33;
  break;
 }
 case 15: case 16: case 12: case 13:  {
  HEAP32[$vararg_buffer41>>2] = $0;
  $vararg_ptr44 = ((($vararg_buffer41)) + 4|0);
  HEAP32[$vararg_ptr44>>2] = $1;
  $vararg_ptr45 = ((($vararg_buffer41)) + 8|0);
  HEAP32[$vararg_ptr45>>2] = $$;
  $34 = (___syscall221(221,($vararg_buffer41|0))|0);
  $35 = (___syscall_ret($34)|0);
  $$2 = $35;
  break;
 }
 default: {
  HEAP32[$vararg_buffer46>>2] = $0;
  $vararg_ptr49 = ((($vararg_buffer46)) + 4|0);
  HEAP32[$vararg_ptr49>>2] = $1;
  $vararg_ptr50 = ((($vararg_buffer46)) + 8|0);
  HEAP32[$vararg_ptr50>>2] = $$;
  $36 = (___syscall221(221,($vararg_buffer46|0))|0);
  $37 = (___syscall_ret($36)|0);
  $$2 = $37;
 }
 }
 STACKTOP = sp;return ($$2|0);
}
function _strcmp($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$011 = 0, $$0710 = 0, $$lcssa = 0, $$lcssa8 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond9 = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 $2 = HEAP8[$0>>0]|0;
 $3 = HEAP8[$1>>0]|0;
 $4 = ($2<<24>>24)!=($3<<24>>24);
 $5 = ($2<<24>>24)==(0);
 $or$cond9 = $5 | $4;
 if ($or$cond9) {
  $$lcssa = $3;$$lcssa8 = $2;
 } else {
  $$011 = $1;$$0710 = $0;
  while(1) {
   $6 = ((($$0710)) + 1|0);
   $7 = ((($$011)) + 1|0);
   $8 = HEAP8[$6>>0]|0;
   $9 = HEAP8[$7>>0]|0;
   $10 = ($8<<24>>24)!=($9<<24>>24);
   $11 = ($8<<24>>24)==(0);
   $or$cond = $11 | $10;
   if ($or$cond) {
    $$lcssa = $9;$$lcssa8 = $8;
    break;
   } else {
    $$011 = $7;$$0710 = $6;
   }
  }
 }
 $12 = $$lcssa8&255;
 $13 = $$lcssa&255;
 $14 = (($12) - ($13))|0;
 return ($14|0);
}
function _memchr($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0$lcssa = 0, $$035$lcssa = 0, $$035$lcssa65 = 0, $$03555 = 0, $$036$lcssa = 0, $$036$lcssa64 = 0, $$03654 = 0, $$046 = 0, $$137$lcssa = 0, $$13745 = 0, $$140 = 0, $$2 = 0, $$23839 = 0, $$3 = 0, $$lcssa = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0;
 var $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
 var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond53 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = $1 & 255;
 $4 = $0;
 $5 = $4 & 3;
 $6 = ($5|0)!=(0);
 $7 = ($2|0)!=(0);
 $or$cond53 = $7 & $6;
 L1: do {
  if ($or$cond53) {
   $8 = $1&255;
   $$03555 = $0;$$03654 = $2;
   while(1) {
    $9 = HEAP8[$$03555>>0]|0;
    $10 = ($9<<24>>24)==($8<<24>>24);
    if ($10) {
     $$035$lcssa65 = $$03555;$$036$lcssa64 = $$03654;
     label = 6;
     break L1;
    }
    $11 = ((($$03555)) + 1|0);
    $12 = (($$03654) + -1)|0;
    $13 = $11;
    $14 = $13 & 3;
    $15 = ($14|0)!=(0);
    $16 = ($12|0)!=(0);
    $or$cond = $16 & $15;
    if ($or$cond) {
     $$03555 = $11;$$03654 = $12;
    } else {
     $$035$lcssa = $11;$$036$lcssa = $12;$$lcssa = $16;
     label = 5;
     break;
    }
   }
  } else {
   $$035$lcssa = $0;$$036$lcssa = $2;$$lcssa = $7;
   label = 5;
  }
 } while(0);
 if ((label|0) == 5) {
  if ($$lcssa) {
   $$035$lcssa65 = $$035$lcssa;$$036$lcssa64 = $$036$lcssa;
   label = 6;
  } else {
   $$2 = $$035$lcssa;$$3 = 0;
  }
 }
 L8: do {
  if ((label|0) == 6) {
   $17 = HEAP8[$$035$lcssa65>>0]|0;
   $18 = $1&255;
   $19 = ($17<<24>>24)==($18<<24>>24);
   if ($19) {
    $$2 = $$035$lcssa65;$$3 = $$036$lcssa64;
   } else {
    $20 = Math_imul($3, 16843009)|0;
    $21 = ($$036$lcssa64>>>0)>(3);
    L11: do {
     if ($21) {
      $$046 = $$035$lcssa65;$$13745 = $$036$lcssa64;
      while(1) {
       $22 = HEAP32[$$046>>2]|0;
       $23 = $22 ^ $20;
       $24 = (($23) + -16843009)|0;
       $25 = $23 & -2139062144;
       $26 = $25 ^ -2139062144;
       $27 = $26 & $24;
       $28 = ($27|0)==(0);
       if (!($28)) {
        break;
       }
       $29 = ((($$046)) + 4|0);
       $30 = (($$13745) + -4)|0;
       $31 = ($30>>>0)>(3);
       if ($31) {
        $$046 = $29;$$13745 = $30;
       } else {
        $$0$lcssa = $29;$$137$lcssa = $30;
        label = 11;
        break L11;
       }
      }
      $$140 = $$046;$$23839 = $$13745;
     } else {
      $$0$lcssa = $$035$lcssa65;$$137$lcssa = $$036$lcssa64;
      label = 11;
     }
    } while(0);
    if ((label|0) == 11) {
     $32 = ($$137$lcssa|0)==(0);
     if ($32) {
      $$2 = $$0$lcssa;$$3 = 0;
      break;
     } else {
      $$140 = $$0$lcssa;$$23839 = $$137$lcssa;
     }
    }
    while(1) {
     $33 = HEAP8[$$140>>0]|0;
     $34 = ($33<<24>>24)==($18<<24>>24);
     if ($34) {
      $$2 = $$140;$$3 = $$23839;
      break L8;
     }
     $35 = ((($$140)) + 1|0);
     $36 = (($$23839) + -1)|0;
     $37 = ($36|0)==(0);
     if ($37) {
      $$2 = $35;$$3 = 0;
      break;
     } else {
      $$140 = $35;$$23839 = $36;
     }
    }
   }
  }
 } while(0);
 $38 = ($$3|0)!=(0);
 $39 = $38 ? $$2 : 0;
 return ($39|0);
}
function _strlen($0) {
 $0 = $0|0;
 var $$0 = 0, $$015$lcssa = 0, $$01519 = 0, $$1$lcssa = 0, $$pn = 0, $$pre = 0, $$sink = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
 var $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = $0;
 $2 = $1 & 3;
 $3 = ($2|0)==(0);
 L1: do {
  if ($3) {
   $$015$lcssa = $0;
   label = 4;
  } else {
   $$01519 = $0;$23 = $1;
   while(1) {
    $4 = HEAP8[$$01519>>0]|0;
    $5 = ($4<<24>>24)==(0);
    if ($5) {
     $$sink = $23;
     break L1;
    }
    $6 = ((($$01519)) + 1|0);
    $7 = $6;
    $8 = $7 & 3;
    $9 = ($8|0)==(0);
    if ($9) {
     $$015$lcssa = $6;
     label = 4;
     break;
    } else {
     $$01519 = $6;$23 = $7;
    }
   }
  }
 } while(0);
 if ((label|0) == 4) {
  $$0 = $$015$lcssa;
  while(1) {
   $10 = HEAP32[$$0>>2]|0;
   $11 = (($10) + -16843009)|0;
   $12 = $10 & -2139062144;
   $13 = $12 ^ -2139062144;
   $14 = $13 & $11;
   $15 = ($14|0)==(0);
   $16 = ((($$0)) + 4|0);
   if ($15) {
    $$0 = $16;
   } else {
    break;
   }
  }
  $17 = $10&255;
  $18 = ($17<<24>>24)==(0);
  if ($18) {
   $$1$lcssa = $$0;
  } else {
   $$pn = $$0;
   while(1) {
    $19 = ((($$pn)) + 1|0);
    $$pre = HEAP8[$19>>0]|0;
    $20 = ($$pre<<24>>24)==(0);
    if ($20) {
     $$1$lcssa = $19;
     break;
    } else {
     $$pn = $19;
    }
   }
  }
  $21 = $$1$lcssa;
  $$sink = $21;
 }
 $22 = (($$sink) - ($1))|0;
 return ($22|0);
}
function _strcpy($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 (___stpcpy($0,$1)|0);
 return ($0|0);
}
function ___stpcpy($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0$lcssa = 0, $$025$lcssa = 0, $$02536 = 0, $$026$lcssa = 0, $$02642 = 0, $$027$lcssa = 0, $$02741 = 0, $$029 = 0, $$037 = 0, $$1$ph = 0, $$128$ph = 0, $$12834 = 0, $$135 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0;
 var $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0;
 var $35 = 0, $36 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = $1;
 $3 = $0;
 $4 = $2 ^ $3;
 $5 = $4 & 3;
 $6 = ($5|0)==(0);
 L1: do {
  if ($6) {
   $7 = $2 & 3;
   $8 = ($7|0)==(0);
   if ($8) {
    $$026$lcssa = $1;$$027$lcssa = $0;
   } else {
    $$02642 = $1;$$02741 = $0;
    while(1) {
     $9 = HEAP8[$$02642>>0]|0;
     HEAP8[$$02741>>0] = $9;
     $10 = ($9<<24>>24)==(0);
     if ($10) {
      $$029 = $$02741;
      break L1;
     }
     $11 = ((($$02642)) + 1|0);
     $12 = ((($$02741)) + 1|0);
     $13 = $11;
     $14 = $13 & 3;
     $15 = ($14|0)==(0);
     if ($15) {
      $$026$lcssa = $11;$$027$lcssa = $12;
      break;
     } else {
      $$02642 = $11;$$02741 = $12;
     }
    }
   }
   $16 = HEAP32[$$026$lcssa>>2]|0;
   $17 = (($16) + -16843009)|0;
   $18 = $16 & -2139062144;
   $19 = $18 ^ -2139062144;
   $20 = $19 & $17;
   $21 = ($20|0)==(0);
   if ($21) {
    $$02536 = $$027$lcssa;$$037 = $$026$lcssa;$24 = $16;
    while(1) {
     $22 = ((($$037)) + 4|0);
     $23 = ((($$02536)) + 4|0);
     HEAP32[$$02536>>2] = $24;
     $25 = HEAP32[$22>>2]|0;
     $26 = (($25) + -16843009)|0;
     $27 = $25 & -2139062144;
     $28 = $27 ^ -2139062144;
     $29 = $28 & $26;
     $30 = ($29|0)==(0);
     if ($30) {
      $$02536 = $23;$$037 = $22;$24 = $25;
     } else {
      $$0$lcssa = $22;$$025$lcssa = $23;
      break;
     }
    }
   } else {
    $$0$lcssa = $$026$lcssa;$$025$lcssa = $$027$lcssa;
   }
   $$1$ph = $$0$lcssa;$$128$ph = $$025$lcssa;
   label = 8;
  } else {
   $$1$ph = $1;$$128$ph = $0;
   label = 8;
  }
 } while(0);
 if ((label|0) == 8) {
  $31 = HEAP8[$$1$ph>>0]|0;
  HEAP8[$$128$ph>>0] = $31;
  $32 = ($31<<24>>24)==(0);
  if ($32) {
   $$029 = $$128$ph;
  } else {
   $$12834 = $$128$ph;$$135 = $$1$ph;
   while(1) {
    $33 = ((($$135)) + 1|0);
    $34 = ((($$12834)) + 1|0);
    $35 = HEAP8[$33>>0]|0;
    HEAP8[$34>>0] = $35;
    $36 = ($35<<24>>24)==(0);
    if ($36) {
     $$029 = $34;
     break;
    } else {
     $$12834 = $34;$$135 = $33;
    }
   }
  }
 }
 return ($$029|0);
}
function _strchr($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = (___strchrnul($0,$1)|0);
 $3 = HEAP8[$2>>0]|0;
 $4 = $1&255;
 $5 = ($3<<24>>24)==($4<<24>>24);
 $6 = $5 ? $2 : 0;
 return ($6|0);
}
function ___strchrnul($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $$029$lcssa = 0, $$02936 = 0, $$030$lcssa = 0, $$03039 = 0, $$1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
 var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0;
 var $41 = 0, $42 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond33 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = $1 & 255;
 $3 = ($2|0)==(0);
 L1: do {
  if ($3) {
   $8 = (_strlen($0)|0);
   $9 = (($0) + ($8)|0);
   $$0 = $9;
  } else {
   $4 = $0;
   $5 = $4 & 3;
   $6 = ($5|0)==(0);
   if ($6) {
    $$030$lcssa = $0;
   } else {
    $7 = $1&255;
    $$03039 = $0;
    while(1) {
     $10 = HEAP8[$$03039>>0]|0;
     $11 = ($10<<24>>24)==(0);
     $12 = ($10<<24>>24)==($7<<24>>24);
     $or$cond = $11 | $12;
     if ($or$cond) {
      $$0 = $$03039;
      break L1;
     }
     $13 = ((($$03039)) + 1|0);
     $14 = $13;
     $15 = $14 & 3;
     $16 = ($15|0)==(0);
     if ($16) {
      $$030$lcssa = $13;
      break;
     } else {
      $$03039 = $13;
     }
    }
   }
   $17 = Math_imul($2, 16843009)|0;
   $18 = HEAP32[$$030$lcssa>>2]|0;
   $19 = (($18) + -16843009)|0;
   $20 = $18 & -2139062144;
   $21 = $20 ^ -2139062144;
   $22 = $21 & $19;
   $23 = ($22|0)==(0);
   L10: do {
    if ($23) {
     $$02936 = $$030$lcssa;$25 = $18;
     while(1) {
      $24 = $25 ^ $17;
      $26 = (($24) + -16843009)|0;
      $27 = $24 & -2139062144;
      $28 = $27 ^ -2139062144;
      $29 = $28 & $26;
      $30 = ($29|0)==(0);
      if (!($30)) {
       $$029$lcssa = $$02936;
       break L10;
      }
      $31 = ((($$02936)) + 4|0);
      $32 = HEAP32[$31>>2]|0;
      $33 = (($32) + -16843009)|0;
      $34 = $32 & -2139062144;
      $35 = $34 ^ -2139062144;
      $36 = $35 & $33;
      $37 = ($36|0)==(0);
      if ($37) {
       $$02936 = $31;$25 = $32;
      } else {
       $$029$lcssa = $31;
       break;
      }
     }
    } else {
     $$029$lcssa = $$030$lcssa;
    }
   } while(0);
   $38 = $1&255;
   $$1 = $$029$lcssa;
   while(1) {
    $39 = HEAP8[$$1>>0]|0;
    $40 = ($39<<24>>24)==(0);
    $41 = ($39<<24>>24)==($38<<24>>24);
    $or$cond33 = $40 | $41;
    $42 = ((($$1)) + 1|0);
    if ($or$cond33) {
     $$0 = $$1;
     break;
    } else {
     $$1 = $42;
    }
   }
  }
 } while(0);
 return ($$0|0);
}
function _vfprintf($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$ = 0, $$0 = 0, $$1 = 0, $$1$ = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
 var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $5 = 0, $6 = 0, $7 = 0;
 var $8 = 0, $9 = 0, $vacopy_currentptr = 0, dest = 0, label = 0, sp = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 224|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(224|0);
 $3 = sp + 120|0;
 $4 = sp + 80|0;
 $5 = sp;
 $6 = sp + 136|0;
 dest=$4; stop=dest+40|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
 $vacopy_currentptr = HEAP32[$2>>2]|0;
 HEAP32[$3>>2] = $vacopy_currentptr;
 $7 = (_printf_core(0,$1,$3,$5,$4)|0);
 $8 = ($7|0)<(0);
 if ($8) {
  $$0 = -1;
 } else {
  $9 = ((($0)) + 76|0);
  $10 = HEAP32[$9>>2]|0;
  $11 = ($10|0)>(-1);
  if ($11) {
   $12 = (___lockfile($0)|0);
   $39 = $12;
  } else {
   $39 = 0;
  }
  $13 = HEAP32[$0>>2]|0;
  $14 = $13 & 32;
  $15 = ((($0)) + 74|0);
  $16 = HEAP8[$15>>0]|0;
  $17 = ($16<<24>>24)<(1);
  if ($17) {
   $18 = $13 & -33;
   HEAP32[$0>>2] = $18;
  }
  $19 = ((($0)) + 48|0);
  $20 = HEAP32[$19>>2]|0;
  $21 = ($20|0)==(0);
  if ($21) {
   $23 = ((($0)) + 44|0);
   $24 = HEAP32[$23>>2]|0;
   HEAP32[$23>>2] = $6;
   $25 = ((($0)) + 28|0);
   HEAP32[$25>>2] = $6;
   $26 = ((($0)) + 20|0);
   HEAP32[$26>>2] = $6;
   HEAP32[$19>>2] = 80;
   $27 = ((($6)) + 80|0);
   $28 = ((($0)) + 16|0);
   HEAP32[$28>>2] = $27;
   $29 = (_printf_core($0,$1,$3,$5,$4)|0);
   $30 = ($24|0)==(0|0);
   if ($30) {
    $$1 = $29;
   } else {
    $31 = ((($0)) + 36|0);
    $32 = HEAP32[$31>>2]|0;
    (FUNCTION_TABLE_iiii[$32 & 7]($0,0,0)|0);
    $33 = HEAP32[$26>>2]|0;
    $34 = ($33|0)==(0|0);
    $$ = $34 ? -1 : $29;
    HEAP32[$23>>2] = $24;
    HEAP32[$19>>2] = 0;
    HEAP32[$28>>2] = 0;
    HEAP32[$25>>2] = 0;
    HEAP32[$26>>2] = 0;
    $$1 = $$;
   }
  } else {
   $22 = (_printf_core($0,$1,$3,$5,$4)|0);
   $$1 = $22;
  }
  $35 = HEAP32[$0>>2]|0;
  $36 = $35 & 32;
  $37 = ($36|0)==(0);
  $$1$ = $37 ? $$1 : -1;
  $38 = $35 | $14;
  HEAP32[$0>>2] = $38;
  $40 = ($39|0)==(0);
  if (!($40)) {
   ___unlockfile($0);
  }
  $$0 = $$1$;
 }
 STACKTOP = sp;return ($$0|0);
}
function _printf_core($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $$ = 0, $$$ = 0, $$$0259 = 0, $$$0262 = 0, $$$0269 = 0, $$$4266 = 0, $$$5 = 0, $$0 = 0, $$0228 = 0, $$0228$ = 0, $$0229322 = 0, $$0232 = 0, $$0235 = 0, $$0237 = 0, $$0240$lcssa = 0, $$0240$lcssa357 = 0, $$0240321 = 0, $$0243 = 0, $$0247 = 0, $$0249$lcssa = 0;
 var $$0249306 = 0, $$0252 = 0, $$0253 = 0, $$0254 = 0, $$0254$$0254$ = 0, $$0259 = 0, $$0262$lcssa = 0, $$0262311 = 0, $$0269 = 0, $$0269$phi = 0, $$1 = 0, $$1230333 = 0, $$1233 = 0, $$1236 = 0, $$1238 = 0, $$1241332 = 0, $$1244320 = 0, $$1248 = 0, $$1250 = 0, $$1255 = 0;
 var $$1260 = 0, $$1263 = 0, $$1263$ = 0, $$1270 = 0, $$2 = 0, $$2234 = 0, $$2239 = 0, $$2242305 = 0, $$2245 = 0, $$2251 = 0, $$2256 = 0, $$2256$ = 0, $$2256$$$2256 = 0, $$2261 = 0, $$2271 = 0, $$284$ = 0, $$289 = 0, $$290 = 0, $$3257 = 0, $$3265 = 0;
 var $$3272 = 0, $$3303 = 0, $$377 = 0, $$4258355 = 0, $$4266 = 0, $$5 = 0, $$6268 = 0, $$lcssa295 = 0, $$pre = 0, $$pre346 = 0, $$pre347 = 0, $$pre347$pre = 0, $$pre349 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0;
 var $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0;
 var $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0;
 var $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0;
 var $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0;
 var $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0;
 var $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0;
 var $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0;
 var $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0;
 var $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0;
 var $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0;
 var $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0;
 var $306 = 0.0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0;
 var $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
 var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
 var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
 var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0;
 var $arglist_current = 0, $arglist_current2 = 0, $arglist_next = 0, $arglist_next3 = 0, $expanded = 0, $expanded10 = 0, $expanded11 = 0, $expanded13 = 0, $expanded14 = 0, $expanded15 = 0, $expanded4 = 0, $expanded6 = 0, $expanded7 = 0, $expanded8 = 0, $isdigit = 0, $isdigit275 = 0, $isdigit277 = 0, $isdigittmp = 0, $isdigittmp$ = 0, $isdigittmp274 = 0;
 var $isdigittmp276 = 0, $narrow = 0, $or$cond = 0, $or$cond281 = 0, $or$cond283 = 0, $or$cond286 = 0, $storemerge = 0, $storemerge273310 = 0, $storemerge278 = 0, $trunc = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
 $5 = sp + 16|0;
 $6 = sp;
 $7 = sp + 24|0;
 $8 = sp + 8|0;
 $9 = sp + 20|0;
 HEAP32[$5>>2] = $1;
 $10 = ($0|0)!=(0|0);
 $11 = ((($7)) + 40|0);
 $12 = $11;
 $13 = ((($7)) + 39|0);
 $14 = ((($8)) + 4|0);
 $$0243 = 0;$$0247 = 0;$$0269 = 0;$21 = $1;
 L1: while(1) {
  $15 = ($$0247|0)>(-1);
  do {
   if ($15) {
    $16 = (2147483647 - ($$0247))|0;
    $17 = ($$0243|0)>($16|0);
    if ($17) {
     $18 = (___errno_location()|0);
     HEAP32[$18>>2] = 75;
     $$1248 = -1;
     break;
    } else {
     $19 = (($$0243) + ($$0247))|0;
     $$1248 = $19;
     break;
    }
   } else {
    $$1248 = $$0247;
   }
  } while(0);
  $20 = HEAP8[$21>>0]|0;
  $22 = ($20<<24>>24)==(0);
  if ($22) {
   label = 87;
   break;
  } else {
   $23 = $20;$25 = $21;
  }
  L9: while(1) {
   switch ($23<<24>>24) {
   case 37:  {
    $$0249306 = $25;$27 = $25;
    label = 9;
    break L9;
    break;
   }
   case 0:  {
    $$0249$lcssa = $25;$39 = $25;
    break L9;
    break;
   }
   default: {
   }
   }
   $24 = ((($25)) + 1|0);
   HEAP32[$5>>2] = $24;
   $$pre = HEAP8[$24>>0]|0;
   $23 = $$pre;$25 = $24;
  }
  L12: do {
   if ((label|0) == 9) {
    while(1) {
     label = 0;
     $26 = ((($27)) + 1|0);
     $28 = HEAP8[$26>>0]|0;
     $29 = ($28<<24>>24)==(37);
     if (!($29)) {
      $$0249$lcssa = $$0249306;$39 = $27;
      break L12;
     }
     $30 = ((($$0249306)) + 1|0);
     $31 = ((($27)) + 2|0);
     HEAP32[$5>>2] = $31;
     $32 = HEAP8[$31>>0]|0;
     $33 = ($32<<24>>24)==(37);
     if ($33) {
      $$0249306 = $30;$27 = $31;
      label = 9;
     } else {
      $$0249$lcssa = $30;$39 = $31;
      break;
     }
    }
   }
  } while(0);
  $34 = $$0249$lcssa;
  $35 = $21;
  $36 = (($34) - ($35))|0;
  if ($10) {
   _out_94($0,$21,$36);
  }
  $37 = ($36|0)==(0);
  if (!($37)) {
   $$0269$phi = $$0269;$$0243 = $36;$$0247 = $$1248;$21 = $39;$$0269 = $$0269$phi;
   continue;
  }
  $38 = ((($39)) + 1|0);
  $40 = HEAP8[$38>>0]|0;
  $41 = $40 << 24 >> 24;
  $isdigittmp = (($41) + -48)|0;
  $isdigit = ($isdigittmp>>>0)<(10);
  if ($isdigit) {
   $42 = ((($39)) + 2|0);
   $43 = HEAP8[$42>>0]|0;
   $44 = ($43<<24>>24)==(36);
   $45 = ((($39)) + 3|0);
   $$377 = $44 ? $45 : $38;
   $$$0269 = $44 ? 1 : $$0269;
   $isdigittmp$ = $44 ? $isdigittmp : -1;
   $$0253 = $isdigittmp$;$$1270 = $$$0269;$storemerge = $$377;
  } else {
   $$0253 = -1;$$1270 = $$0269;$storemerge = $38;
  }
  HEAP32[$5>>2] = $storemerge;
  $46 = HEAP8[$storemerge>>0]|0;
  $47 = $46 << 24 >> 24;
  $48 = (($47) + -32)|0;
  $49 = ($48>>>0)<(32);
  L24: do {
   if ($49) {
    $$0262311 = 0;$329 = $46;$51 = $48;$storemerge273310 = $storemerge;
    while(1) {
     $50 = 1 << $51;
     $52 = $50 & 75913;
     $53 = ($52|0)==(0);
     if ($53) {
      $$0262$lcssa = $$0262311;$$lcssa295 = $329;$62 = $storemerge273310;
      break L24;
     }
     $54 = $50 | $$0262311;
     $55 = ((($storemerge273310)) + 1|0);
     HEAP32[$5>>2] = $55;
     $56 = HEAP8[$55>>0]|0;
     $57 = $56 << 24 >> 24;
     $58 = (($57) + -32)|0;
     $59 = ($58>>>0)<(32);
     if ($59) {
      $$0262311 = $54;$329 = $56;$51 = $58;$storemerge273310 = $55;
     } else {
      $$0262$lcssa = $54;$$lcssa295 = $56;$62 = $55;
      break;
     }
    }
   } else {
    $$0262$lcssa = 0;$$lcssa295 = $46;$62 = $storemerge;
   }
  } while(0);
  $60 = ($$lcssa295<<24>>24)==(42);
  if ($60) {
   $61 = ((($62)) + 1|0);
   $63 = HEAP8[$61>>0]|0;
   $64 = $63 << 24 >> 24;
   $isdigittmp276 = (($64) + -48)|0;
   $isdigit277 = ($isdigittmp276>>>0)<(10);
   if ($isdigit277) {
    $65 = ((($62)) + 2|0);
    $66 = HEAP8[$65>>0]|0;
    $67 = ($66<<24>>24)==(36);
    if ($67) {
     $68 = (($4) + ($isdigittmp276<<2)|0);
     HEAP32[$68>>2] = 10;
     $69 = HEAP8[$61>>0]|0;
     $70 = $69 << 24 >> 24;
     $71 = (($70) + -48)|0;
     $72 = (($3) + ($71<<3)|0);
     $73 = $72;
     $74 = $73;
     $75 = HEAP32[$74>>2]|0;
     $76 = (($73) + 4)|0;
     $77 = $76;
     $78 = HEAP32[$77>>2]|0;
     $79 = ((($62)) + 3|0);
     $$0259 = $75;$$2271 = 1;$storemerge278 = $79;
    } else {
     label = 23;
    }
   } else {
    label = 23;
   }
   if ((label|0) == 23) {
    label = 0;
    $80 = ($$1270|0)==(0);
    if (!($80)) {
     $$0 = -1;
     break;
    }
    if ($10) {
     $arglist_current = HEAP32[$2>>2]|0;
     $81 = $arglist_current;
     $82 = ((0) + 4|0);
     $expanded4 = $82;
     $expanded = (($expanded4) - 1)|0;
     $83 = (($81) + ($expanded))|0;
     $84 = ((0) + 4|0);
     $expanded8 = $84;
     $expanded7 = (($expanded8) - 1)|0;
     $expanded6 = $expanded7 ^ -1;
     $85 = $83 & $expanded6;
     $86 = $85;
     $87 = HEAP32[$86>>2]|0;
     $arglist_next = ((($86)) + 4|0);
     HEAP32[$2>>2] = $arglist_next;
     $$0259 = $87;$$2271 = 0;$storemerge278 = $61;
    } else {
     $$0259 = 0;$$2271 = 0;$storemerge278 = $61;
    }
   }
   HEAP32[$5>>2] = $storemerge278;
   $88 = ($$0259|0)<(0);
   $89 = $$0262$lcssa | 8192;
   $90 = (0 - ($$0259))|0;
   $$$0262 = $88 ? $89 : $$0262$lcssa;
   $$$0259 = $88 ? $90 : $$0259;
   $$1260 = $$$0259;$$1263 = $$$0262;$$3272 = $$2271;$94 = $storemerge278;
  } else {
   $91 = (_getint_95($5)|0);
   $92 = ($91|0)<(0);
   if ($92) {
    $$0 = -1;
    break;
   }
   $$pre346 = HEAP32[$5>>2]|0;
   $$1260 = $91;$$1263 = $$0262$lcssa;$$3272 = $$1270;$94 = $$pre346;
  }
  $93 = HEAP8[$94>>0]|0;
  $95 = ($93<<24>>24)==(46);
  do {
   if ($95) {
    $96 = ((($94)) + 1|0);
    $97 = HEAP8[$96>>0]|0;
    $98 = ($97<<24>>24)==(42);
    if (!($98)) {
     $125 = ((($94)) + 1|0);
     HEAP32[$5>>2] = $125;
     $126 = (_getint_95($5)|0);
     $$pre347$pre = HEAP32[$5>>2]|0;
     $$0254 = $126;$$pre347 = $$pre347$pre;
     break;
    }
    $99 = ((($94)) + 2|0);
    $100 = HEAP8[$99>>0]|0;
    $101 = $100 << 24 >> 24;
    $isdigittmp274 = (($101) + -48)|0;
    $isdigit275 = ($isdigittmp274>>>0)<(10);
    if ($isdigit275) {
     $102 = ((($94)) + 3|0);
     $103 = HEAP8[$102>>0]|0;
     $104 = ($103<<24>>24)==(36);
     if ($104) {
      $105 = (($4) + ($isdigittmp274<<2)|0);
      HEAP32[$105>>2] = 10;
      $106 = HEAP8[$99>>0]|0;
      $107 = $106 << 24 >> 24;
      $108 = (($107) + -48)|0;
      $109 = (($3) + ($108<<3)|0);
      $110 = $109;
      $111 = $110;
      $112 = HEAP32[$111>>2]|0;
      $113 = (($110) + 4)|0;
      $114 = $113;
      $115 = HEAP32[$114>>2]|0;
      $116 = ((($94)) + 4|0);
      HEAP32[$5>>2] = $116;
      $$0254 = $112;$$pre347 = $116;
      break;
     }
    }
    $117 = ($$3272|0)==(0);
    if (!($117)) {
     $$0 = -1;
     break L1;
    }
    if ($10) {
     $arglist_current2 = HEAP32[$2>>2]|0;
     $118 = $arglist_current2;
     $119 = ((0) + 4|0);
     $expanded11 = $119;
     $expanded10 = (($expanded11) - 1)|0;
     $120 = (($118) + ($expanded10))|0;
     $121 = ((0) + 4|0);
     $expanded15 = $121;
     $expanded14 = (($expanded15) - 1)|0;
     $expanded13 = $expanded14 ^ -1;
     $122 = $120 & $expanded13;
     $123 = $122;
     $124 = HEAP32[$123>>2]|0;
     $arglist_next3 = ((($123)) + 4|0);
     HEAP32[$2>>2] = $arglist_next3;
     $330 = $124;
    } else {
     $330 = 0;
    }
    HEAP32[$5>>2] = $99;
    $$0254 = $330;$$pre347 = $99;
   } else {
    $$0254 = -1;$$pre347 = $94;
   }
  } while(0);
  $$0252 = 0;$128 = $$pre347;
  while(1) {
   $127 = HEAP8[$128>>0]|0;
   $129 = $127 << 24 >> 24;
   $130 = (($129) + -65)|0;
   $131 = ($130>>>0)>(57);
   if ($131) {
    $$0 = -1;
    break L1;
   }
   $132 = ((($128)) + 1|0);
   HEAP32[$5>>2] = $132;
   $133 = HEAP8[$128>>0]|0;
   $134 = $133 << 24 >> 24;
   $135 = (($134) + -65)|0;
   $136 = ((2849 + (($$0252*58)|0)|0) + ($135)|0);
   $137 = HEAP8[$136>>0]|0;
   $138 = $137&255;
   $139 = (($138) + -1)|0;
   $140 = ($139>>>0)<(8);
   if ($140) {
    $$0252 = $138;$128 = $132;
   } else {
    break;
   }
  }
  $141 = ($137<<24>>24)==(0);
  if ($141) {
   $$0 = -1;
   break;
  }
  $142 = ($137<<24>>24)==(19);
  $143 = ($$0253|0)>(-1);
  do {
   if ($142) {
    if ($143) {
     $$0 = -1;
     break L1;
    } else {
     label = 49;
    }
   } else {
    if ($143) {
     $144 = (($4) + ($$0253<<2)|0);
     HEAP32[$144>>2] = $138;
     $145 = (($3) + ($$0253<<3)|0);
     $146 = $145;
     $147 = $146;
     $148 = HEAP32[$147>>2]|0;
     $149 = (($146) + 4)|0;
     $150 = $149;
     $151 = HEAP32[$150>>2]|0;
     $152 = $6;
     $153 = $152;
     HEAP32[$153>>2] = $148;
     $154 = (($152) + 4)|0;
     $155 = $154;
     HEAP32[$155>>2] = $151;
     label = 49;
     break;
    }
    if (!($10)) {
     $$0 = 0;
     break L1;
    }
    _pop_arg_97($6,$138,$2);
   }
  } while(0);
  if ((label|0) == 49) {
   label = 0;
   if (!($10)) {
    $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
    continue;
   }
  }
  $156 = HEAP8[$128>>0]|0;
  $157 = $156 << 24 >> 24;
  $158 = ($$0252|0)!=(0);
  $159 = $157 & 15;
  $160 = ($159|0)==(3);
  $or$cond281 = $158 & $160;
  $161 = $157 & -33;
  $$0235 = $or$cond281 ? $161 : $157;
  $162 = $$1263 & 8192;
  $163 = ($162|0)==(0);
  $164 = $$1263 & -65537;
  $$1263$ = $163 ? $$1263 : $164;
  L71: do {
   switch ($$0235|0) {
   case 110:  {
    $trunc = $$0252&255;
    switch ($trunc<<24>>24) {
    case 0:  {
     $171 = HEAP32[$6>>2]|0;
     HEAP32[$171>>2] = $$1248;
     $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
     continue L1;
     break;
    }
    case 1:  {
     $172 = HEAP32[$6>>2]|0;
     HEAP32[$172>>2] = $$1248;
     $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
     continue L1;
     break;
    }
    case 2:  {
     $173 = ($$1248|0)<(0);
     $174 = $173 << 31 >> 31;
     $175 = HEAP32[$6>>2]|0;
     $176 = $175;
     $177 = $176;
     HEAP32[$177>>2] = $$1248;
     $178 = (($176) + 4)|0;
     $179 = $178;
     HEAP32[$179>>2] = $174;
     $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
     continue L1;
     break;
    }
    case 3:  {
     $180 = $$1248&65535;
     $181 = HEAP32[$6>>2]|0;
     HEAP16[$181>>1] = $180;
     $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
     continue L1;
     break;
    }
    case 4:  {
     $182 = $$1248&255;
     $183 = HEAP32[$6>>2]|0;
     HEAP8[$183>>0] = $182;
     $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
     continue L1;
     break;
    }
    case 6:  {
     $184 = HEAP32[$6>>2]|0;
     HEAP32[$184>>2] = $$1248;
     $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
     continue L1;
     break;
    }
    case 7:  {
     $185 = ($$1248|0)<(0);
     $186 = $185 << 31 >> 31;
     $187 = HEAP32[$6>>2]|0;
     $188 = $187;
     $189 = $188;
     HEAP32[$189>>2] = $$1248;
     $190 = (($188) + 4)|0;
     $191 = $190;
     HEAP32[$191>>2] = $186;
     $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
     continue L1;
     break;
    }
    default: {
     $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
     continue L1;
    }
    }
    break;
   }
   case 112:  {
    $192 = ($$0254>>>0)>(8);
    $193 = $192 ? $$0254 : 8;
    $194 = $$1263$ | 8;
    $$1236 = 120;$$1255 = $193;$$3265 = $194;
    label = 61;
    break;
   }
   case 88: case 120:  {
    $$1236 = $$0235;$$1255 = $$0254;$$3265 = $$1263$;
    label = 61;
    break;
   }
   case 111:  {
    $210 = $6;
    $211 = $210;
    $212 = HEAP32[$211>>2]|0;
    $213 = (($210) + 4)|0;
    $214 = $213;
    $215 = HEAP32[$214>>2]|0;
    $216 = (_fmt_o($212,$215,$11)|0);
    $217 = $$1263$ & 8;
    $218 = ($217|0)==(0);
    $219 = $216;
    $220 = (($12) - ($219))|0;
    $221 = ($$0254|0)>($220|0);
    $222 = (($220) + 1)|0;
    $223 = $218 | $221;
    $$0254$$0254$ = $223 ? $$0254 : $222;
    $$0228 = $216;$$1233 = 0;$$1238 = 3313;$$2256 = $$0254$$0254$;$$4266 = $$1263$;$247 = $212;$249 = $215;
    label = 67;
    break;
   }
   case 105: case 100:  {
    $224 = $6;
    $225 = $224;
    $226 = HEAP32[$225>>2]|0;
    $227 = (($224) + 4)|0;
    $228 = $227;
    $229 = HEAP32[$228>>2]|0;
    $230 = ($229|0)<(0);
    if ($230) {
     $231 = (_i64Subtract(0,0,($226|0),($229|0))|0);
     $232 = tempRet0;
     $233 = $6;
     $234 = $233;
     HEAP32[$234>>2] = $231;
     $235 = (($233) + 4)|0;
     $236 = $235;
     HEAP32[$236>>2] = $232;
     $$0232 = 1;$$0237 = 3313;$242 = $231;$243 = $232;
     label = 66;
     break L71;
    } else {
     $237 = $$1263$ & 2048;
     $238 = ($237|0)==(0);
     $239 = $$1263$ & 1;
     $240 = ($239|0)==(0);
     $$ = $240 ? 3313 : (3315);
     $$$ = $238 ? $$ : (3314);
     $241 = $$1263$ & 2049;
     $narrow = ($241|0)!=(0);
     $$284$ = $narrow&1;
     $$0232 = $$284$;$$0237 = $$$;$242 = $226;$243 = $229;
     label = 66;
     break L71;
    }
    break;
   }
   case 117:  {
    $165 = $6;
    $166 = $165;
    $167 = HEAP32[$166>>2]|0;
    $168 = (($165) + 4)|0;
    $169 = $168;
    $170 = HEAP32[$169>>2]|0;
    $$0232 = 0;$$0237 = 3313;$242 = $167;$243 = $170;
    label = 66;
    break;
   }
   case 99:  {
    $259 = $6;
    $260 = $259;
    $261 = HEAP32[$260>>2]|0;
    $262 = (($259) + 4)|0;
    $263 = $262;
    $264 = HEAP32[$263>>2]|0;
    $265 = $261&255;
    HEAP8[$13>>0] = $265;
    $$2 = $13;$$2234 = 0;$$2239 = 3313;$$2251 = $11;$$5 = 1;$$6268 = $164;
    break;
   }
   case 109:  {
    $266 = (___errno_location()|0);
    $267 = HEAP32[$266>>2]|0;
    $268 = (_strerror($267)|0);
    $$1 = $268;
    label = 71;
    break;
   }
   case 115:  {
    $269 = HEAP32[$6>>2]|0;
    $270 = ($269|0)!=(0|0);
    $271 = $270 ? $269 : 3323;
    $$1 = $271;
    label = 71;
    break;
   }
   case 67:  {
    $278 = $6;
    $279 = $278;
    $280 = HEAP32[$279>>2]|0;
    $281 = (($278) + 4)|0;
    $282 = $281;
    $283 = HEAP32[$282>>2]|0;
    HEAP32[$8>>2] = $280;
    HEAP32[$14>>2] = 0;
    HEAP32[$6>>2] = $8;
    $$4258355 = -1;$331 = $8;
    label = 75;
    break;
   }
   case 83:  {
    $$pre349 = HEAP32[$6>>2]|0;
    $284 = ($$0254|0)==(0);
    if ($284) {
     _pad($0,32,$$1260,0,$$1263$);
     $$0240$lcssa357 = 0;
     label = 84;
    } else {
     $$4258355 = $$0254;$331 = $$pre349;
     label = 75;
    }
    break;
   }
   case 65: case 71: case 70: case 69: case 97: case 103: case 102: case 101:  {
    $306 = +HEAPF64[$6>>3];
    $307 = (_fmt_fp($0,$306,$$1260,$$0254,$$1263$,$$0235)|0);
    $$0243 = $307;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
    continue L1;
    break;
   }
   default: {
    $$2 = $21;$$2234 = 0;$$2239 = 3313;$$2251 = $11;$$5 = $$0254;$$6268 = $$1263$;
   }
   }
  } while(0);
  L95: do {
   if ((label|0) == 61) {
    label = 0;
    $195 = $6;
    $196 = $195;
    $197 = HEAP32[$196>>2]|0;
    $198 = (($195) + 4)|0;
    $199 = $198;
    $200 = HEAP32[$199>>2]|0;
    $201 = $$1236 & 32;
    $202 = (_fmt_x($197,$200,$11,$201)|0);
    $203 = ($197|0)==(0);
    $204 = ($200|0)==(0);
    $205 = $203 & $204;
    $206 = $$3265 & 8;
    $207 = ($206|0)==(0);
    $or$cond283 = $207 | $205;
    $208 = $$1236 >> 4;
    $209 = (3313 + ($208)|0);
    $$289 = $or$cond283 ? 3313 : $209;
    $$290 = $or$cond283 ? 0 : 2;
    $$0228 = $202;$$1233 = $$290;$$1238 = $$289;$$2256 = $$1255;$$4266 = $$3265;$247 = $197;$249 = $200;
    label = 67;
   }
   else if ((label|0) == 66) {
    label = 0;
    $244 = (_fmt_u($242,$243,$11)|0);
    $$0228 = $244;$$1233 = $$0232;$$1238 = $$0237;$$2256 = $$0254;$$4266 = $$1263$;$247 = $242;$249 = $243;
    label = 67;
   }
   else if ((label|0) == 71) {
    label = 0;
    $272 = (_memchr($$1,0,$$0254)|0);
    $273 = ($272|0)==(0|0);
    $274 = $272;
    $275 = $$1;
    $276 = (($274) - ($275))|0;
    $277 = (($$1) + ($$0254)|0);
    $$3257 = $273 ? $$0254 : $276;
    $$1250 = $273 ? $277 : $272;
    $$2 = $$1;$$2234 = 0;$$2239 = 3313;$$2251 = $$1250;$$5 = $$3257;$$6268 = $164;
   }
   else if ((label|0) == 75) {
    label = 0;
    $$0229322 = $331;$$0240321 = 0;$$1244320 = 0;
    while(1) {
     $285 = HEAP32[$$0229322>>2]|0;
     $286 = ($285|0)==(0);
     if ($286) {
      $$0240$lcssa = $$0240321;$$2245 = $$1244320;
      break;
     }
     $287 = (_wctomb($9,$285)|0);
     $288 = ($287|0)<(0);
     $289 = (($$4258355) - ($$0240321))|0;
     $290 = ($287>>>0)>($289>>>0);
     $or$cond286 = $288 | $290;
     if ($or$cond286) {
      $$0240$lcssa = $$0240321;$$2245 = $287;
      break;
     }
     $291 = ((($$0229322)) + 4|0);
     $292 = (($287) + ($$0240321))|0;
     $293 = ($$4258355>>>0)>($292>>>0);
     if ($293) {
      $$0229322 = $291;$$0240321 = $292;$$1244320 = $287;
     } else {
      $$0240$lcssa = $292;$$2245 = $287;
      break;
     }
    }
    $294 = ($$2245|0)<(0);
    if ($294) {
     $$0 = -1;
     break L1;
    }
    _pad($0,32,$$1260,$$0240$lcssa,$$1263$);
    $295 = ($$0240$lcssa|0)==(0);
    if ($295) {
     $$0240$lcssa357 = 0;
     label = 84;
    } else {
     $$1230333 = $331;$$1241332 = 0;
     while(1) {
      $296 = HEAP32[$$1230333>>2]|0;
      $297 = ($296|0)==(0);
      if ($297) {
       $$0240$lcssa357 = $$0240$lcssa;
       label = 84;
       break L95;
      }
      $298 = (_wctomb($9,$296)|0);
      $299 = (($298) + ($$1241332))|0;
      $300 = ($299|0)>($$0240$lcssa|0);
      if ($300) {
       $$0240$lcssa357 = $$0240$lcssa;
       label = 84;
       break L95;
      }
      $301 = ((($$1230333)) + 4|0);
      _out_94($0,$9,$298);
      $302 = ($299>>>0)<($$0240$lcssa>>>0);
      if ($302) {
       $$1230333 = $301;$$1241332 = $299;
      } else {
       $$0240$lcssa357 = $$0240$lcssa;
       label = 84;
       break;
      }
     }
    }
   }
  } while(0);
  if ((label|0) == 67) {
   label = 0;
   $245 = ($$2256|0)>(-1);
   $246 = $$4266 & -65537;
   $$$4266 = $245 ? $246 : $$4266;
   $248 = ($247|0)!=(0);
   $250 = ($249|0)!=(0);
   $251 = $248 | $250;
   $252 = ($$2256|0)!=(0);
   $or$cond = $252 | $251;
   $253 = $$0228;
   $254 = (($12) - ($253))|0;
   $255 = $251 ^ 1;
   $256 = $255&1;
   $257 = (($256) + ($254))|0;
   $258 = ($$2256|0)>($257|0);
   $$2256$ = $258 ? $$2256 : $257;
   $$2256$$$2256 = $or$cond ? $$2256$ : $$2256;
   $$0228$ = $or$cond ? $$0228 : $11;
   $$2 = $$0228$;$$2234 = $$1233;$$2239 = $$1238;$$2251 = $11;$$5 = $$2256$$$2256;$$6268 = $$$4266;
  }
  else if ((label|0) == 84) {
   label = 0;
   $303 = $$1263$ ^ 8192;
   _pad($0,32,$$1260,$$0240$lcssa357,$303);
   $304 = ($$1260|0)>($$0240$lcssa357|0);
   $305 = $304 ? $$1260 : $$0240$lcssa357;
   $$0243 = $305;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
   continue;
  }
  $308 = $$2251;
  $309 = $$2;
  $310 = (($308) - ($309))|0;
  $311 = ($$5|0)<($310|0);
  $$$5 = $311 ? $310 : $$5;
  $312 = (($$$5) + ($$2234))|0;
  $313 = ($$1260|0)<($312|0);
  $$2261 = $313 ? $312 : $$1260;
  _pad($0,32,$$2261,$312,$$6268);
  _out_94($0,$$2239,$$2234);
  $314 = $$6268 ^ 65536;
  _pad($0,48,$$2261,$312,$314);
  _pad($0,48,$$$5,$310,0);
  _out_94($0,$$2,$310);
  $315 = $$6268 ^ 8192;
  _pad($0,32,$$2261,$312,$315);
  $$0243 = $$2261;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
 }
 L114: do {
  if ((label|0) == 87) {
   $316 = ($0|0)==(0|0);
   if ($316) {
    $317 = ($$0269|0)==(0);
    if ($317) {
     $$0 = 0;
    } else {
     $$2242305 = 1;
     while(1) {
      $318 = (($4) + ($$2242305<<2)|0);
      $319 = HEAP32[$318>>2]|0;
      $320 = ($319|0)==(0);
      if ($320) {
       $$3303 = $$2242305;
       break;
      }
      $321 = (($3) + ($$2242305<<3)|0);
      _pop_arg_97($321,$319,$2);
      $322 = (($$2242305) + 1)|0;
      $323 = ($322|0)<(10);
      if ($323) {
       $$2242305 = $322;
      } else {
       $$0 = 1;
       break L114;
      }
     }
     while(1) {
      $326 = (($4) + ($$3303<<2)|0);
      $327 = HEAP32[$326>>2]|0;
      $328 = ($327|0)==(0);
      $324 = (($$3303) + 1)|0;
      if (!($328)) {
       $$0 = -1;
       break L114;
      }
      $325 = ($324|0)<(10);
      if ($325) {
       $$3303 = $324;
      } else {
       $$0 = 1;
       break;
      }
     }
    }
   } else {
    $$0 = $$1248;
   }
  }
 } while(0);
 STACKTOP = sp;return ($$0|0);
}
function ___lockfile($0) {
 $0 = $0|0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 return 0;
}
function ___unlockfile($0) {
 $0 = $0|0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 return;
}
function _out_94($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = HEAP32[$0>>2]|0;
 $4 = $3 & 32;
 $5 = ($4|0)==(0);
 if ($5) {
  (___fwritex($1,$2,$0)|0);
 }
 return;
}
function _getint_95($0) {
 $0 = $0|0;
 var $$0$lcssa = 0, $$06 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $isdigit = 0, $isdigit5 = 0, $isdigittmp = 0, $isdigittmp4 = 0, $isdigittmp7 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = HEAP32[$0>>2]|0;
 $2 = HEAP8[$1>>0]|0;
 $3 = $2 << 24 >> 24;
 $isdigittmp4 = (($3) + -48)|0;
 $isdigit5 = ($isdigittmp4>>>0)<(10);
 if ($isdigit5) {
  $$06 = 0;$7 = $1;$isdigittmp7 = $isdigittmp4;
  while(1) {
   $4 = ($$06*10)|0;
   $5 = (($isdigittmp7) + ($4))|0;
   $6 = ((($7)) + 1|0);
   HEAP32[$0>>2] = $6;
   $8 = HEAP8[$6>>0]|0;
   $9 = $8 << 24 >> 24;
   $isdigittmp = (($9) + -48)|0;
   $isdigit = ($isdigittmp>>>0)<(10);
   if ($isdigit) {
    $$06 = $5;$7 = $6;$isdigittmp7 = $isdigittmp;
   } else {
    $$0$lcssa = $5;
    break;
   }
  }
 } else {
  $$0$lcssa = 0;
 }
 return ($$0$lcssa|0);
}
function _pop_arg_97($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$mask = 0, $$mask31 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0.0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
 var $116 = 0.0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0;
 var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
 var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0;
 var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0;
 var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $arglist_current = 0, $arglist_current11 = 0, $arglist_current14 = 0, $arglist_current17 = 0;
 var $arglist_current2 = 0, $arglist_current20 = 0, $arglist_current23 = 0, $arglist_current26 = 0, $arglist_current5 = 0, $arglist_current8 = 0, $arglist_next = 0, $arglist_next12 = 0, $arglist_next15 = 0, $arglist_next18 = 0, $arglist_next21 = 0, $arglist_next24 = 0, $arglist_next27 = 0, $arglist_next3 = 0, $arglist_next6 = 0, $arglist_next9 = 0, $expanded = 0, $expanded28 = 0, $expanded30 = 0, $expanded31 = 0;
 var $expanded32 = 0, $expanded34 = 0, $expanded35 = 0, $expanded37 = 0, $expanded38 = 0, $expanded39 = 0, $expanded41 = 0, $expanded42 = 0, $expanded44 = 0, $expanded45 = 0, $expanded46 = 0, $expanded48 = 0, $expanded49 = 0, $expanded51 = 0, $expanded52 = 0, $expanded53 = 0, $expanded55 = 0, $expanded56 = 0, $expanded58 = 0, $expanded59 = 0;
 var $expanded60 = 0, $expanded62 = 0, $expanded63 = 0, $expanded65 = 0, $expanded66 = 0, $expanded67 = 0, $expanded69 = 0, $expanded70 = 0, $expanded72 = 0, $expanded73 = 0, $expanded74 = 0, $expanded76 = 0, $expanded77 = 0, $expanded79 = 0, $expanded80 = 0, $expanded81 = 0, $expanded83 = 0, $expanded84 = 0, $expanded86 = 0, $expanded87 = 0;
 var $expanded88 = 0, $expanded90 = 0, $expanded91 = 0, $expanded93 = 0, $expanded94 = 0, $expanded95 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ($1>>>0)>(20);
 L1: do {
  if (!($3)) {
   do {
    switch ($1|0) {
    case 9:  {
     $arglist_current = HEAP32[$2>>2]|0;
     $4 = $arglist_current;
     $5 = ((0) + 4|0);
     $expanded28 = $5;
     $expanded = (($expanded28) - 1)|0;
     $6 = (($4) + ($expanded))|0;
     $7 = ((0) + 4|0);
     $expanded32 = $7;
     $expanded31 = (($expanded32) - 1)|0;
     $expanded30 = $expanded31 ^ -1;
     $8 = $6 & $expanded30;
     $9 = $8;
     $10 = HEAP32[$9>>2]|0;
     $arglist_next = ((($9)) + 4|0);
     HEAP32[$2>>2] = $arglist_next;
     HEAP32[$0>>2] = $10;
     break L1;
     break;
    }
    case 10:  {
     $arglist_current2 = HEAP32[$2>>2]|0;
     $11 = $arglist_current2;
     $12 = ((0) + 4|0);
     $expanded35 = $12;
     $expanded34 = (($expanded35) - 1)|0;
     $13 = (($11) + ($expanded34))|0;
     $14 = ((0) + 4|0);
     $expanded39 = $14;
     $expanded38 = (($expanded39) - 1)|0;
     $expanded37 = $expanded38 ^ -1;
     $15 = $13 & $expanded37;
     $16 = $15;
     $17 = HEAP32[$16>>2]|0;
     $arglist_next3 = ((($16)) + 4|0);
     HEAP32[$2>>2] = $arglist_next3;
     $18 = ($17|0)<(0);
     $19 = $18 << 31 >> 31;
     $20 = $0;
     $21 = $20;
     HEAP32[$21>>2] = $17;
     $22 = (($20) + 4)|0;
     $23 = $22;
     HEAP32[$23>>2] = $19;
     break L1;
     break;
    }
    case 11:  {
     $arglist_current5 = HEAP32[$2>>2]|0;
     $24 = $arglist_current5;
     $25 = ((0) + 4|0);
     $expanded42 = $25;
     $expanded41 = (($expanded42) - 1)|0;
     $26 = (($24) + ($expanded41))|0;
     $27 = ((0) + 4|0);
     $expanded46 = $27;
     $expanded45 = (($expanded46) - 1)|0;
     $expanded44 = $expanded45 ^ -1;
     $28 = $26 & $expanded44;
     $29 = $28;
     $30 = HEAP32[$29>>2]|0;
     $arglist_next6 = ((($29)) + 4|0);
     HEAP32[$2>>2] = $arglist_next6;
     $31 = $0;
     $32 = $31;
     HEAP32[$32>>2] = $30;
     $33 = (($31) + 4)|0;
     $34 = $33;
     HEAP32[$34>>2] = 0;
     break L1;
     break;
    }
    case 12:  {
     $arglist_current8 = HEAP32[$2>>2]|0;
     $35 = $arglist_current8;
     $36 = ((0) + 8|0);
     $expanded49 = $36;
     $expanded48 = (($expanded49) - 1)|0;
     $37 = (($35) + ($expanded48))|0;
     $38 = ((0) + 8|0);
     $expanded53 = $38;
     $expanded52 = (($expanded53) - 1)|0;
     $expanded51 = $expanded52 ^ -1;
     $39 = $37 & $expanded51;
     $40 = $39;
     $41 = $40;
     $42 = $41;
     $43 = HEAP32[$42>>2]|0;
     $44 = (($41) + 4)|0;
     $45 = $44;
     $46 = HEAP32[$45>>2]|0;
     $arglist_next9 = ((($40)) + 8|0);
     HEAP32[$2>>2] = $arglist_next9;
     $47 = $0;
     $48 = $47;
     HEAP32[$48>>2] = $43;
     $49 = (($47) + 4)|0;
     $50 = $49;
     HEAP32[$50>>2] = $46;
     break L1;
     break;
    }
    case 13:  {
     $arglist_current11 = HEAP32[$2>>2]|0;
     $51 = $arglist_current11;
     $52 = ((0) + 4|0);
     $expanded56 = $52;
     $expanded55 = (($expanded56) - 1)|0;
     $53 = (($51) + ($expanded55))|0;
     $54 = ((0) + 4|0);
     $expanded60 = $54;
     $expanded59 = (($expanded60) - 1)|0;
     $expanded58 = $expanded59 ^ -1;
     $55 = $53 & $expanded58;
     $56 = $55;
     $57 = HEAP32[$56>>2]|0;
     $arglist_next12 = ((($56)) + 4|0);
     HEAP32[$2>>2] = $arglist_next12;
     $58 = $57&65535;
     $59 = $58 << 16 >> 16;
     $60 = ($59|0)<(0);
     $61 = $60 << 31 >> 31;
     $62 = $0;
     $63 = $62;
     HEAP32[$63>>2] = $59;
     $64 = (($62) + 4)|0;
     $65 = $64;
     HEAP32[$65>>2] = $61;
     break L1;
     break;
    }
    case 14:  {
     $arglist_current14 = HEAP32[$2>>2]|0;
     $66 = $arglist_current14;
     $67 = ((0) + 4|0);
     $expanded63 = $67;
     $expanded62 = (($expanded63) - 1)|0;
     $68 = (($66) + ($expanded62))|0;
     $69 = ((0) + 4|0);
     $expanded67 = $69;
     $expanded66 = (($expanded67) - 1)|0;
     $expanded65 = $expanded66 ^ -1;
     $70 = $68 & $expanded65;
     $71 = $70;
     $72 = HEAP32[$71>>2]|0;
     $arglist_next15 = ((($71)) + 4|0);
     HEAP32[$2>>2] = $arglist_next15;
     $$mask31 = $72 & 65535;
     $73 = $0;
     $74 = $73;
     HEAP32[$74>>2] = $$mask31;
     $75 = (($73) + 4)|0;
     $76 = $75;
     HEAP32[$76>>2] = 0;
     break L1;
     break;
    }
    case 15:  {
     $arglist_current17 = HEAP32[$2>>2]|0;
     $77 = $arglist_current17;
     $78 = ((0) + 4|0);
     $expanded70 = $78;
     $expanded69 = (($expanded70) - 1)|0;
     $79 = (($77) + ($expanded69))|0;
     $80 = ((0) + 4|0);
     $expanded74 = $80;
     $expanded73 = (($expanded74) - 1)|0;
     $expanded72 = $expanded73 ^ -1;
     $81 = $79 & $expanded72;
     $82 = $81;
     $83 = HEAP32[$82>>2]|0;
     $arglist_next18 = ((($82)) + 4|0);
     HEAP32[$2>>2] = $arglist_next18;
     $84 = $83&255;
     $85 = $84 << 24 >> 24;
     $86 = ($85|0)<(0);
     $87 = $86 << 31 >> 31;
     $88 = $0;
     $89 = $88;
     HEAP32[$89>>2] = $85;
     $90 = (($88) + 4)|0;
     $91 = $90;
     HEAP32[$91>>2] = $87;
     break L1;
     break;
    }
    case 16:  {
     $arglist_current20 = HEAP32[$2>>2]|0;
     $92 = $arglist_current20;
     $93 = ((0) + 4|0);
     $expanded77 = $93;
     $expanded76 = (($expanded77) - 1)|0;
     $94 = (($92) + ($expanded76))|0;
     $95 = ((0) + 4|0);
     $expanded81 = $95;
     $expanded80 = (($expanded81) - 1)|0;
     $expanded79 = $expanded80 ^ -1;
     $96 = $94 & $expanded79;
     $97 = $96;
     $98 = HEAP32[$97>>2]|0;
     $arglist_next21 = ((($97)) + 4|0);
     HEAP32[$2>>2] = $arglist_next21;
     $$mask = $98 & 255;
     $99 = $0;
     $100 = $99;
     HEAP32[$100>>2] = $$mask;
     $101 = (($99) + 4)|0;
     $102 = $101;
     HEAP32[$102>>2] = 0;
     break L1;
     break;
    }
    case 17:  {
     $arglist_current23 = HEAP32[$2>>2]|0;
     $103 = $arglist_current23;
     $104 = ((0) + 8|0);
     $expanded84 = $104;
     $expanded83 = (($expanded84) - 1)|0;
     $105 = (($103) + ($expanded83))|0;
     $106 = ((0) + 8|0);
     $expanded88 = $106;
     $expanded87 = (($expanded88) - 1)|0;
     $expanded86 = $expanded87 ^ -1;
     $107 = $105 & $expanded86;
     $108 = $107;
     $109 = +HEAPF64[$108>>3];
     $arglist_next24 = ((($108)) + 8|0);
     HEAP32[$2>>2] = $arglist_next24;
     HEAPF64[$0>>3] = $109;
     break L1;
     break;
    }
    case 18:  {
     $arglist_current26 = HEAP32[$2>>2]|0;
     $110 = $arglist_current26;
     $111 = ((0) + 8|0);
     $expanded91 = $111;
     $expanded90 = (($expanded91) - 1)|0;
     $112 = (($110) + ($expanded90))|0;
     $113 = ((0) + 8|0);
     $expanded95 = $113;
     $expanded94 = (($expanded95) - 1)|0;
     $expanded93 = $expanded94 ^ -1;
     $114 = $112 & $expanded93;
     $115 = $114;
     $116 = +HEAPF64[$115>>3];
     $arglist_next27 = ((($115)) + 8|0);
     HEAP32[$2>>2] = $arglist_next27;
     HEAPF64[$0>>3] = $116;
     break L1;
     break;
    }
    default: {
     break L1;
    }
    }
   } while(0);
  }
 } while(0);
 return;
}
function _fmt_x($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $$05$lcssa = 0, $$056 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 $4 = ($0|0)==(0);
 $5 = ($1|0)==(0);
 $6 = $4 & $5;
 if ($6) {
  $$05$lcssa = $2;
 } else {
  $$056 = $2;$15 = $1;$8 = $0;
  while(1) {
   $7 = $8 & 15;
   $9 = (3361 + ($7)|0);
   $10 = HEAP8[$9>>0]|0;
   $11 = $10&255;
   $12 = $11 | $3;
   $13 = $12&255;
   $14 = ((($$056)) + -1|0);
   HEAP8[$14>>0] = $13;
   $16 = (_bitshift64Lshr(($8|0),($15|0),4)|0);
   $17 = tempRet0;
   $18 = ($16|0)==(0);
   $19 = ($17|0)==(0);
   $20 = $18 & $19;
   if ($20) {
    $$05$lcssa = $14;
    break;
   } else {
    $$056 = $14;$15 = $17;$8 = $16;
   }
  }
 }
 return ($$05$lcssa|0);
}
function _fmt_o($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0$lcssa = 0, $$06 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ($0|0)==(0);
 $4 = ($1|0)==(0);
 $5 = $3 & $4;
 if ($5) {
  $$0$lcssa = $2;
 } else {
  $$06 = $2;$11 = $1;$7 = $0;
  while(1) {
   $6 = $7&255;
   $8 = $6 & 7;
   $9 = $8 | 48;
   $10 = ((($$06)) + -1|0);
   HEAP8[$10>>0] = $9;
   $12 = (_bitshift64Lshr(($7|0),($11|0),3)|0);
   $13 = tempRet0;
   $14 = ($12|0)==(0);
   $15 = ($13|0)==(0);
   $16 = $14 & $15;
   if ($16) {
    $$0$lcssa = $10;
    break;
   } else {
    $$06 = $10;$11 = $13;$7 = $12;
   }
  }
 }
 return ($$0$lcssa|0);
}
function _fmt_u($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$010$lcssa$off0 = 0, $$012 = 0, $$09$lcssa = 0, $$0914 = 0, $$1$lcssa = 0, $$111 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
 var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ($1>>>0)>(0);
 $4 = ($0>>>0)>(4294967295);
 $5 = ($1|0)==(0);
 $6 = $5 & $4;
 $7 = $3 | $6;
 if ($7) {
  $$0914 = $2;$8 = $0;$9 = $1;
  while(1) {
   $10 = (___uremdi3(($8|0),($9|0),10,0)|0);
   $11 = tempRet0;
   $12 = $10&255;
   $13 = $12 | 48;
   $14 = ((($$0914)) + -1|0);
   HEAP8[$14>>0] = $13;
   $15 = (___udivdi3(($8|0),($9|0),10,0)|0);
   $16 = tempRet0;
   $17 = ($9>>>0)>(9);
   $18 = ($8>>>0)>(4294967295);
   $19 = ($9|0)==(9);
   $20 = $19 & $18;
   $21 = $17 | $20;
   if ($21) {
    $$0914 = $14;$8 = $15;$9 = $16;
   } else {
    break;
   }
  }
  $$010$lcssa$off0 = $15;$$09$lcssa = $14;
 } else {
  $$010$lcssa$off0 = $0;$$09$lcssa = $2;
 }
 $22 = ($$010$lcssa$off0|0)==(0);
 if ($22) {
  $$1$lcssa = $$09$lcssa;
 } else {
  $$012 = $$010$lcssa$off0;$$111 = $$09$lcssa;
  while(1) {
   $23 = (($$012>>>0) % 10)&-1;
   $24 = $23 | 48;
   $25 = $24&255;
   $26 = ((($$111)) + -1|0);
   HEAP8[$26>>0] = $25;
   $27 = (($$012>>>0) / 10)&-1;
   $28 = ($$012>>>0)<(10);
   if ($28) {
    $$1$lcssa = $26;
    break;
   } else {
    $$012 = $27;$$111 = $26;
   }
  }
 }
 return ($$1$lcssa|0);
}
function _strerror($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = (___pthread_self_919()|0);
 $2 = ((($1)) + 188|0);
 $3 = HEAP32[$2>>2]|0;
 $4 = (___strerror_l($0,$3)|0);
 return ($4|0);
}
function _pad($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $$0$lcssa = 0, $$011 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
 $5 = sp;
 $6 = $4 & 73728;
 $7 = ($6|0)==(0);
 $8 = ($2|0)>($3|0);
 $or$cond = $8 & $7;
 if ($or$cond) {
  $9 = (($2) - ($3))|0;
  $10 = ($9>>>0)<(256);
  $11 = $10 ? $9 : 256;
  _memset(($5|0),($1|0),($11|0))|0;
  $12 = ($9>>>0)>(255);
  if ($12) {
   $13 = (($2) - ($3))|0;
   $$011 = $9;
   while(1) {
    _out_94($0,$5,256);
    $14 = (($$011) + -256)|0;
    $15 = ($14>>>0)>(255);
    if ($15) {
     $$011 = $14;
    } else {
     break;
    }
   }
   $16 = $13 & 255;
   $$0$lcssa = $16;
  } else {
   $$0$lcssa = $9;
  }
  _out_94($0,$5,$$0$lcssa);
 }
 STACKTOP = sp;return;
}
function _wctomb($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ($0|0)==(0|0);
 if ($2) {
  $$0 = 0;
 } else {
  $3 = (_wcrtomb($0,$1,0)|0);
  $$0 = $3;
 }
 return ($$0|0);
}
function _fmt_fp($0,$1,$2,$3,$4,$5) {
 $0 = $0|0;
 $1 = +$1;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 var $$ = 0, $$$ = 0, $$$$559 = 0.0, $$$3484 = 0, $$$3484691 = 0, $$$3484692 = 0, $$$3501 = 0, $$$4502 = 0, $$$542 = 0.0, $$$559 = 0.0, $$0 = 0, $$0463$lcssa = 0, $$0463584 = 0, $$0464594 = 0, $$0471 = 0.0, $$0479 = 0, $$0487642 = 0, $$0488 = 0, $$0488653 = 0, $$0488655 = 0;
 var $$0496$$9 = 0, $$0497654 = 0, $$0498 = 0, $$0509582 = 0.0, $$0510 = 0, $$0511 = 0, $$0514637 = 0, $$0520 = 0, $$0521 = 0, $$0521$ = 0, $$0523 = 0, $$0525 = 0, $$0527 = 0, $$0527629 = 0, $$0527631 = 0, $$0530636 = 0, $$1465 = 0, $$1467 = 0.0, $$1469 = 0.0, $$1472 = 0.0;
 var $$1480 = 0, $$1482$lcssa = 0, $$1482661 = 0, $$1489641 = 0, $$1499$lcssa = 0, $$1499660 = 0, $$1508583 = 0, $$1512$lcssa = 0, $$1512607 = 0, $$1515 = 0, $$1524 = 0, $$1526 = 0, $$1528614 = 0, $$1531$lcssa = 0, $$1531630 = 0, $$1598 = 0, $$2 = 0, $$2473 = 0.0, $$2476 = 0, $$2476$$547 = 0;
 var $$2476$$549 = 0, $$2483$ph = 0, $$2500 = 0, $$2513 = 0, $$2516618 = 0, $$2529 = 0, $$2532617 = 0, $$3 = 0.0, $$3477 = 0, $$3484$lcssa = 0, $$3484648 = 0, $$3501$lcssa = 0, $$3501647 = 0, $$3533613 = 0, $$4 = 0.0, $$4478$lcssa = 0, $$4478590 = 0, $$4492 = 0, $$4502 = 0, $$4518 = 0;
 var $$5$lcssa = 0, $$534$ = 0, $$539 = 0, $$539$ = 0, $$542 = 0.0, $$546 = 0, $$548 = 0, $$5486$lcssa = 0, $$5486623 = 0, $$5493597 = 0, $$5519$ph = 0, $$555 = 0, $$556 = 0, $$559 = 0.0, $$5602 = 0, $$6 = 0, $$6494589 = 0, $$7495601 = 0, $$7505 = 0, $$7505$ = 0;
 var $$7505$ph = 0, $$8 = 0, $$9$ph = 0, $$lcssa673 = 0, $$neg = 0, $$neg567 = 0, $$pn = 0, $$pn566 = 0, $$pr = 0, $$pr564 = 0, $$pre = 0, $$pre$phi690Z2D = 0, $$pre689 = 0, $$sink545$lcssa = 0, $$sink545622 = 0, $$sink562 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0;
 var $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0.0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0.0, $117 = 0.0, $118 = 0.0, $119 = 0, $12 = 0, $120 = 0;
 var $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0;
 var $14 = 0.0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0;
 var $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0;
 var $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0;
 var $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0;
 var $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0.0, $229 = 0.0, $23 = 0;
 var $230 = 0, $231 = 0.0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0;
 var $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0;
 var $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0;
 var $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0;
 var $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0;
 var $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0;
 var $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0.0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0;
 var $358 = 0, $359 = 0, $36 = 0.0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0;
 var $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
 var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $50 = 0, $51 = 0.0, $52 = 0, $53 = 0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0, $62 = 0, $63 = 0;
 var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0;
 var $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0;
 var $narrow = 0, $not$ = 0, $notlhs = 0, $notrhs = 0, $or$cond = 0, $or$cond3$not = 0, $or$cond537 = 0, $or$cond541 = 0, $or$cond544 = 0, $or$cond554 = 0, $or$cond6 = 0, $scevgep684 = 0, $scevgep684685 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 560|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(560|0);
 $6 = sp + 8|0;
 $7 = sp;
 $8 = sp + 524|0;
 $9 = $8;
 $10 = sp + 512|0;
 HEAP32[$7>>2] = 0;
 $11 = ((($10)) + 12|0);
 (___DOUBLE_BITS($1)|0);
 $12 = tempRet0;
 $13 = ($12|0)<(0);
 if ($13) {
  $14 = -$1;
  $$0471 = $14;$$0520 = 1;$$0521 = 3330;
 } else {
  $15 = $4 & 2048;
  $16 = ($15|0)==(0);
  $17 = $4 & 1;
  $18 = ($17|0)==(0);
  $$ = $18 ? (3331) : (3336);
  $$$ = $16 ? $$ : (3333);
  $19 = $4 & 2049;
  $narrow = ($19|0)!=(0);
  $$534$ = $narrow&1;
  $$0471 = $1;$$0520 = $$534$;$$0521 = $$$;
 }
 (___DOUBLE_BITS($$0471)|0);
 $20 = tempRet0;
 $21 = $20 & 2146435072;
 $22 = ($21>>>0)<(2146435072);
 $23 = (0)<(0);
 $24 = ($21|0)==(2146435072);
 $25 = $24 & $23;
 $26 = $22 | $25;
 do {
  if ($26) {
   $35 = (+_frexpl($$0471,$7));
   $36 = $35 * 2.0;
   $37 = $36 != 0.0;
   if ($37) {
    $38 = HEAP32[$7>>2]|0;
    $39 = (($38) + -1)|0;
    HEAP32[$7>>2] = $39;
   }
   $40 = $5 | 32;
   $41 = ($40|0)==(97);
   if ($41) {
    $42 = $5 & 32;
    $43 = ($42|0)==(0);
    $44 = ((($$0521)) + 9|0);
    $$0521$ = $43 ? $$0521 : $44;
    $45 = $$0520 | 2;
    $46 = ($3>>>0)>(11);
    $47 = (12 - ($3))|0;
    $48 = ($47|0)==(0);
    $49 = $46 | $48;
    do {
     if ($49) {
      $$1472 = $36;
     } else {
      $$0509582 = 8.0;$$1508583 = $47;
      while(1) {
       $50 = (($$1508583) + -1)|0;
       $51 = $$0509582 * 16.0;
       $52 = ($50|0)==(0);
       if ($52) {
        break;
       } else {
        $$0509582 = $51;$$1508583 = $50;
       }
      }
      $53 = HEAP8[$$0521$>>0]|0;
      $54 = ($53<<24>>24)==(45);
      if ($54) {
       $55 = -$36;
       $56 = $55 - $51;
       $57 = $51 + $56;
       $58 = -$57;
       $$1472 = $58;
       break;
      } else {
       $59 = $36 + $51;
       $60 = $59 - $51;
       $$1472 = $60;
       break;
      }
     }
    } while(0);
    $61 = HEAP32[$7>>2]|0;
    $62 = ($61|0)<(0);
    $63 = (0 - ($61))|0;
    $64 = $62 ? $63 : $61;
    $65 = ($64|0)<(0);
    $66 = $65 << 31 >> 31;
    $67 = (_fmt_u($64,$66,$11)|0);
    $68 = ($67|0)==($11|0);
    if ($68) {
     $69 = ((($10)) + 11|0);
     HEAP8[$69>>0] = 48;
     $$0511 = $69;
    } else {
     $$0511 = $67;
    }
    $70 = $61 >> 31;
    $71 = $70 & 2;
    $72 = (($71) + 43)|0;
    $73 = $72&255;
    $74 = ((($$0511)) + -1|0);
    HEAP8[$74>>0] = $73;
    $75 = (($5) + 15)|0;
    $76 = $75&255;
    $77 = ((($$0511)) + -2|0);
    HEAP8[$77>>0] = $76;
    $notrhs = ($3|0)<(1);
    $78 = $4 & 8;
    $79 = ($78|0)==(0);
    $$0523 = $8;$$2473 = $$1472;
    while(1) {
     $80 = (~~(($$2473)));
     $81 = (3361 + ($80)|0);
     $82 = HEAP8[$81>>0]|0;
     $83 = $82&255;
     $84 = $83 | $42;
     $85 = $84&255;
     $86 = ((($$0523)) + 1|0);
     HEAP8[$$0523>>0] = $85;
     $87 = (+($80|0));
     $88 = $$2473 - $87;
     $89 = $88 * 16.0;
     $90 = $86;
     $91 = (($90) - ($9))|0;
     $92 = ($91|0)==(1);
     if ($92) {
      $notlhs = $89 == 0.0;
      $or$cond3$not = $notrhs & $notlhs;
      $or$cond = $79 & $or$cond3$not;
      if ($or$cond) {
       $$1524 = $86;
      } else {
       $93 = ((($$0523)) + 2|0);
       HEAP8[$86>>0] = 46;
       $$1524 = $93;
      }
     } else {
      $$1524 = $86;
     }
     $94 = $89 != 0.0;
     if ($94) {
      $$0523 = $$1524;$$2473 = $89;
     } else {
      break;
     }
    }
    $95 = ($3|0)!=(0);
    $96 = $77;
    $97 = $11;
    $98 = $$1524;
    $99 = (($98) - ($9))|0;
    $100 = (($97) - ($96))|0;
    $101 = (($99) + -2)|0;
    $102 = ($101|0)<($3|0);
    $or$cond537 = $95 & $102;
    $103 = (($3) + 2)|0;
    $$pn = $or$cond537 ? $103 : $99;
    $$0525 = (($100) + ($45))|0;
    $104 = (($$0525) + ($$pn))|0;
    _pad($0,32,$2,$104,$4);
    _out_94($0,$$0521$,$45);
    $105 = $4 ^ 65536;
    _pad($0,48,$2,$104,$105);
    _out_94($0,$8,$99);
    $106 = (($$pn) - ($99))|0;
    _pad($0,48,$106,0,0);
    _out_94($0,$77,$100);
    $107 = $4 ^ 8192;
    _pad($0,32,$2,$104,$107);
    $$sink562 = $104;
    break;
   }
   $108 = ($3|0)<(0);
   $$539 = $108 ? 6 : $3;
   if ($37) {
    $109 = $36 * 268435456.0;
    $110 = HEAP32[$7>>2]|0;
    $111 = (($110) + -28)|0;
    HEAP32[$7>>2] = $111;
    $$3 = $109;$$pr = $111;
   } else {
    $$pre = HEAP32[$7>>2]|0;
    $$3 = $36;$$pr = $$pre;
   }
   $112 = ($$pr|0)<(0);
   $113 = ((($6)) + 288|0);
   $$556 = $112 ? $6 : $113;
   $$0498 = $$556;$$4 = $$3;
   while(1) {
    $114 = (~~(($$4))>>>0);
    HEAP32[$$0498>>2] = $114;
    $115 = ((($$0498)) + 4|0);
    $116 = (+($114>>>0));
    $117 = $$4 - $116;
    $118 = $117 * 1.0E+9;
    $119 = $118 != 0.0;
    if ($119) {
     $$0498 = $115;$$4 = $118;
    } else {
     break;
    }
   }
   $120 = ($$pr|0)>(0);
   if ($120) {
    $$1482661 = $$556;$$1499660 = $115;$121 = $$pr;
    while(1) {
     $122 = ($121|0)<(29);
     $123 = $122 ? $121 : 29;
     $$0488653 = ((($$1499660)) + -4|0);
     $124 = ($$0488653>>>0)<($$1482661>>>0);
     if ($124) {
      $$2483$ph = $$1482661;
     } else {
      $$0488655 = $$0488653;$$0497654 = 0;
      while(1) {
       $125 = HEAP32[$$0488655>>2]|0;
       $126 = (_bitshift64Shl(($125|0),0,($123|0))|0);
       $127 = tempRet0;
       $128 = (_i64Add(($126|0),($127|0),($$0497654|0),0)|0);
       $129 = tempRet0;
       $130 = (___uremdi3(($128|0),($129|0),1000000000,0)|0);
       $131 = tempRet0;
       HEAP32[$$0488655>>2] = $130;
       $132 = (___udivdi3(($128|0),($129|0),1000000000,0)|0);
       $133 = tempRet0;
       $$0488 = ((($$0488655)) + -4|0);
       $134 = ($$0488>>>0)<($$1482661>>>0);
       if ($134) {
        break;
       } else {
        $$0488655 = $$0488;$$0497654 = $132;
       }
      }
      $135 = ($132|0)==(0);
      if ($135) {
       $$2483$ph = $$1482661;
      } else {
       $136 = ((($$1482661)) + -4|0);
       HEAP32[$136>>2] = $132;
       $$2483$ph = $136;
      }
     }
     $$2500 = $$1499660;
     while(1) {
      $137 = ($$2500>>>0)>($$2483$ph>>>0);
      if (!($137)) {
       break;
      }
      $138 = ((($$2500)) + -4|0);
      $139 = HEAP32[$138>>2]|0;
      $140 = ($139|0)==(0);
      if ($140) {
       $$2500 = $138;
      } else {
       break;
      }
     }
     $141 = HEAP32[$7>>2]|0;
     $142 = (($141) - ($123))|0;
     HEAP32[$7>>2] = $142;
     $143 = ($142|0)>(0);
     if ($143) {
      $$1482661 = $$2483$ph;$$1499660 = $$2500;$121 = $142;
     } else {
      $$1482$lcssa = $$2483$ph;$$1499$lcssa = $$2500;$$pr564 = $142;
      break;
     }
    }
   } else {
    $$1482$lcssa = $$556;$$1499$lcssa = $115;$$pr564 = $$pr;
   }
   $144 = ($$pr564|0)<(0);
   if ($144) {
    $145 = (($$539) + 25)|0;
    $146 = (($145|0) / 9)&-1;
    $147 = (($146) + 1)|0;
    $148 = ($40|0)==(102);
    $$3484648 = $$1482$lcssa;$$3501647 = $$1499$lcssa;$150 = $$pr564;
    while(1) {
     $149 = (0 - ($150))|0;
     $151 = ($149|0)<(9);
     $152 = $151 ? $149 : 9;
     $153 = ($$3484648>>>0)<($$3501647>>>0);
     if ($153) {
      $157 = 1 << $152;
      $158 = (($157) + -1)|0;
      $159 = 1000000000 >>> $152;
      $$0487642 = 0;$$1489641 = $$3484648;
      while(1) {
       $160 = HEAP32[$$1489641>>2]|0;
       $161 = $160 & $158;
       $162 = $160 >>> $152;
       $163 = (($162) + ($$0487642))|0;
       HEAP32[$$1489641>>2] = $163;
       $164 = Math_imul($161, $159)|0;
       $165 = ((($$1489641)) + 4|0);
       $166 = ($165>>>0)<($$3501647>>>0);
       if ($166) {
        $$0487642 = $164;$$1489641 = $165;
       } else {
        break;
       }
      }
      $167 = HEAP32[$$3484648>>2]|0;
      $168 = ($167|0)==(0);
      $169 = ((($$3484648)) + 4|0);
      $$$3484 = $168 ? $169 : $$3484648;
      $170 = ($164|0)==(0);
      if ($170) {
       $$$3484692 = $$$3484;$$4502 = $$3501647;
      } else {
       $171 = ((($$3501647)) + 4|0);
       HEAP32[$$3501647>>2] = $164;
       $$$3484692 = $$$3484;$$4502 = $171;
      }
     } else {
      $154 = HEAP32[$$3484648>>2]|0;
      $155 = ($154|0)==(0);
      $156 = ((($$3484648)) + 4|0);
      $$$3484691 = $155 ? $156 : $$3484648;
      $$$3484692 = $$$3484691;$$4502 = $$3501647;
     }
     $172 = $148 ? $$556 : $$$3484692;
     $173 = $$4502;
     $174 = $172;
     $175 = (($173) - ($174))|0;
     $176 = $175 >> 2;
     $177 = ($176|0)>($147|0);
     $178 = (($172) + ($147<<2)|0);
     $$$4502 = $177 ? $178 : $$4502;
     $179 = HEAP32[$7>>2]|0;
     $180 = (($179) + ($152))|0;
     HEAP32[$7>>2] = $180;
     $181 = ($180|0)<(0);
     if ($181) {
      $$3484648 = $$$3484692;$$3501647 = $$$4502;$150 = $180;
     } else {
      $$3484$lcssa = $$$3484692;$$3501$lcssa = $$$4502;
      break;
     }
    }
   } else {
    $$3484$lcssa = $$1482$lcssa;$$3501$lcssa = $$1499$lcssa;
   }
   $182 = ($$3484$lcssa>>>0)<($$3501$lcssa>>>0);
   $183 = $$556;
   if ($182) {
    $184 = $$3484$lcssa;
    $185 = (($183) - ($184))|0;
    $186 = $185 >> 2;
    $187 = ($186*9)|0;
    $188 = HEAP32[$$3484$lcssa>>2]|0;
    $189 = ($188>>>0)<(10);
    if ($189) {
     $$1515 = $187;
    } else {
     $$0514637 = $187;$$0530636 = 10;
     while(1) {
      $190 = ($$0530636*10)|0;
      $191 = (($$0514637) + 1)|0;
      $192 = ($188>>>0)<($190>>>0);
      if ($192) {
       $$1515 = $191;
       break;
      } else {
       $$0514637 = $191;$$0530636 = $190;
      }
     }
    }
   } else {
    $$1515 = 0;
   }
   $193 = ($40|0)!=(102);
   $194 = $193 ? $$1515 : 0;
   $195 = (($$539) - ($194))|0;
   $196 = ($40|0)==(103);
   $197 = ($$539|0)!=(0);
   $198 = $197 & $196;
   $$neg = $198 << 31 >> 31;
   $199 = (($195) + ($$neg))|0;
   $200 = $$3501$lcssa;
   $201 = (($200) - ($183))|0;
   $202 = $201 >> 2;
   $203 = ($202*9)|0;
   $204 = (($203) + -9)|0;
   $205 = ($199|0)<($204|0);
   if ($205) {
    $206 = ((($$556)) + 4|0);
    $207 = (($199) + 9216)|0;
    $208 = (($207|0) / 9)&-1;
    $209 = (($208) + -1024)|0;
    $210 = (($206) + ($209<<2)|0);
    $211 = (($207|0) % 9)&-1;
    $$0527629 = (($211) + 1)|0;
    $212 = ($$0527629|0)<(9);
    if ($212) {
     $$0527631 = $$0527629;$$1531630 = 10;
     while(1) {
      $213 = ($$1531630*10)|0;
      $$0527 = (($$0527631) + 1)|0;
      $exitcond = ($$0527|0)==(9);
      if ($exitcond) {
       $$1531$lcssa = $213;
       break;
      } else {
       $$0527631 = $$0527;$$1531630 = $213;
      }
     }
    } else {
     $$1531$lcssa = 10;
    }
    $214 = HEAP32[$210>>2]|0;
    $215 = (($214>>>0) % ($$1531$lcssa>>>0))&-1;
    $216 = ($215|0)==(0);
    $217 = ((($210)) + 4|0);
    $218 = ($217|0)==($$3501$lcssa|0);
    $or$cond541 = $218 & $216;
    if ($or$cond541) {
     $$4492 = $210;$$4518 = $$1515;$$8 = $$3484$lcssa;
    } else {
     $219 = (($214>>>0) / ($$1531$lcssa>>>0))&-1;
     $220 = $219 & 1;
     $221 = ($220|0)==(0);
     $$542 = $221 ? 9007199254740992.0 : 9007199254740994.0;
     $222 = (($$1531$lcssa|0) / 2)&-1;
     $223 = ($215>>>0)<($222>>>0);
     $224 = ($215|0)==($222|0);
     $or$cond544 = $218 & $224;
     $$559 = $or$cond544 ? 1.0 : 1.5;
     $$$559 = $223 ? 0.5 : $$559;
     $225 = ($$0520|0)==(0);
     if ($225) {
      $$1467 = $$$559;$$1469 = $$542;
     } else {
      $226 = HEAP8[$$0521>>0]|0;
      $227 = ($226<<24>>24)==(45);
      $228 = -$$542;
      $229 = -$$$559;
      $$$542 = $227 ? $228 : $$542;
      $$$$559 = $227 ? $229 : $$$559;
      $$1467 = $$$$559;$$1469 = $$$542;
     }
     $230 = (($214) - ($215))|0;
     HEAP32[$210>>2] = $230;
     $231 = $$1469 + $$1467;
     $232 = $231 != $$1469;
     if ($232) {
      $233 = (($230) + ($$1531$lcssa))|0;
      HEAP32[$210>>2] = $233;
      $234 = ($233>>>0)>(999999999);
      if ($234) {
       $$5486623 = $$3484$lcssa;$$sink545622 = $210;
       while(1) {
        $235 = ((($$sink545622)) + -4|0);
        HEAP32[$$sink545622>>2] = 0;
        $236 = ($235>>>0)<($$5486623>>>0);
        if ($236) {
         $237 = ((($$5486623)) + -4|0);
         HEAP32[$237>>2] = 0;
         $$6 = $237;
        } else {
         $$6 = $$5486623;
        }
        $238 = HEAP32[$235>>2]|0;
        $239 = (($238) + 1)|0;
        HEAP32[$235>>2] = $239;
        $240 = ($239>>>0)>(999999999);
        if ($240) {
         $$5486623 = $$6;$$sink545622 = $235;
        } else {
         $$5486$lcssa = $$6;$$sink545$lcssa = $235;
         break;
        }
       }
      } else {
       $$5486$lcssa = $$3484$lcssa;$$sink545$lcssa = $210;
      }
      $241 = $$5486$lcssa;
      $242 = (($183) - ($241))|0;
      $243 = $242 >> 2;
      $244 = ($243*9)|0;
      $245 = HEAP32[$$5486$lcssa>>2]|0;
      $246 = ($245>>>0)<(10);
      if ($246) {
       $$4492 = $$sink545$lcssa;$$4518 = $244;$$8 = $$5486$lcssa;
      } else {
       $$2516618 = $244;$$2532617 = 10;
       while(1) {
        $247 = ($$2532617*10)|0;
        $248 = (($$2516618) + 1)|0;
        $249 = ($245>>>0)<($247>>>0);
        if ($249) {
         $$4492 = $$sink545$lcssa;$$4518 = $248;$$8 = $$5486$lcssa;
         break;
        } else {
         $$2516618 = $248;$$2532617 = $247;
        }
       }
      }
     } else {
      $$4492 = $210;$$4518 = $$1515;$$8 = $$3484$lcssa;
     }
    }
    $250 = ((($$4492)) + 4|0);
    $251 = ($$3501$lcssa>>>0)>($250>>>0);
    $$$3501 = $251 ? $250 : $$3501$lcssa;
    $$5519$ph = $$4518;$$7505$ph = $$$3501;$$9$ph = $$8;
   } else {
    $$5519$ph = $$1515;$$7505$ph = $$3501$lcssa;$$9$ph = $$3484$lcssa;
   }
   $$7505 = $$7505$ph;
   while(1) {
    $252 = ($$7505>>>0)>($$9$ph>>>0);
    if (!($252)) {
     $$lcssa673 = 0;
     break;
    }
    $253 = ((($$7505)) + -4|0);
    $254 = HEAP32[$253>>2]|0;
    $255 = ($254|0)==(0);
    if ($255) {
     $$7505 = $253;
    } else {
     $$lcssa673 = 1;
     break;
    }
   }
   $256 = (0 - ($$5519$ph))|0;
   do {
    if ($196) {
     $not$ = $197 ^ 1;
     $257 = $not$&1;
     $$539$ = (($257) + ($$539))|0;
     $258 = ($$539$|0)>($$5519$ph|0);
     $259 = ($$5519$ph|0)>(-5);
     $or$cond6 = $258 & $259;
     if ($or$cond6) {
      $260 = (($5) + -1)|0;
      $$neg567 = (($$539$) + -1)|0;
      $261 = (($$neg567) - ($$5519$ph))|0;
      $$0479 = $260;$$2476 = $261;
     } else {
      $262 = (($5) + -2)|0;
      $263 = (($$539$) + -1)|0;
      $$0479 = $262;$$2476 = $263;
     }
     $264 = $4 & 8;
     $265 = ($264|0)==(0);
     if ($265) {
      if ($$lcssa673) {
       $266 = ((($$7505)) + -4|0);
       $267 = HEAP32[$266>>2]|0;
       $268 = ($267|0)==(0);
       if ($268) {
        $$2529 = 9;
       } else {
        $269 = (($267>>>0) % 10)&-1;
        $270 = ($269|0)==(0);
        if ($270) {
         $$1528614 = 0;$$3533613 = 10;
         while(1) {
          $271 = ($$3533613*10)|0;
          $272 = (($$1528614) + 1)|0;
          $273 = (($267>>>0) % ($271>>>0))&-1;
          $274 = ($273|0)==(0);
          if ($274) {
           $$1528614 = $272;$$3533613 = $271;
          } else {
           $$2529 = $272;
           break;
          }
         }
        } else {
         $$2529 = 0;
        }
       }
      } else {
       $$2529 = 9;
      }
      $275 = $$0479 | 32;
      $276 = ($275|0)==(102);
      $277 = $$7505;
      $278 = (($277) - ($183))|0;
      $279 = $278 >> 2;
      $280 = ($279*9)|0;
      $281 = (($280) + -9)|0;
      if ($276) {
       $282 = (($281) - ($$2529))|0;
       $283 = ($282|0)>(0);
       $$546 = $283 ? $282 : 0;
       $284 = ($$2476|0)<($$546|0);
       $$2476$$547 = $284 ? $$2476 : $$546;
       $$1480 = $$0479;$$3477 = $$2476$$547;$$pre$phi690Z2D = 0;
       break;
      } else {
       $285 = (($281) + ($$5519$ph))|0;
       $286 = (($285) - ($$2529))|0;
       $287 = ($286|0)>(0);
       $$548 = $287 ? $286 : 0;
       $288 = ($$2476|0)<($$548|0);
       $$2476$$549 = $288 ? $$2476 : $$548;
       $$1480 = $$0479;$$3477 = $$2476$$549;$$pre$phi690Z2D = 0;
       break;
      }
     } else {
      $$1480 = $$0479;$$3477 = $$2476;$$pre$phi690Z2D = $264;
     }
    } else {
     $$pre689 = $4 & 8;
     $$1480 = $5;$$3477 = $$539;$$pre$phi690Z2D = $$pre689;
    }
   } while(0);
   $289 = $$3477 | $$pre$phi690Z2D;
   $290 = ($289|0)!=(0);
   $291 = $290&1;
   $292 = $$1480 | 32;
   $293 = ($292|0)==(102);
   if ($293) {
    $294 = ($$5519$ph|0)>(0);
    $295 = $294 ? $$5519$ph : 0;
    $$2513 = 0;$$pn566 = $295;
   } else {
    $296 = ($$5519$ph|0)<(0);
    $297 = $296 ? $256 : $$5519$ph;
    $298 = ($297|0)<(0);
    $299 = $298 << 31 >> 31;
    $300 = (_fmt_u($297,$299,$11)|0);
    $301 = $11;
    $302 = $300;
    $303 = (($301) - ($302))|0;
    $304 = ($303|0)<(2);
    if ($304) {
     $$1512607 = $300;
     while(1) {
      $305 = ((($$1512607)) + -1|0);
      HEAP8[$305>>0] = 48;
      $306 = $305;
      $307 = (($301) - ($306))|0;
      $308 = ($307|0)<(2);
      if ($308) {
       $$1512607 = $305;
      } else {
       $$1512$lcssa = $305;
       break;
      }
     }
    } else {
     $$1512$lcssa = $300;
    }
    $309 = $$5519$ph >> 31;
    $310 = $309 & 2;
    $311 = (($310) + 43)|0;
    $312 = $311&255;
    $313 = ((($$1512$lcssa)) + -1|0);
    HEAP8[$313>>0] = $312;
    $314 = $$1480&255;
    $315 = ((($$1512$lcssa)) + -2|0);
    HEAP8[$315>>0] = $314;
    $316 = $315;
    $317 = (($301) - ($316))|0;
    $$2513 = $315;$$pn566 = $317;
   }
   $318 = (($$0520) + 1)|0;
   $319 = (($318) + ($$3477))|0;
   $$1526 = (($319) + ($291))|0;
   $320 = (($$1526) + ($$pn566))|0;
   _pad($0,32,$2,$320,$4);
   _out_94($0,$$0521,$$0520);
   $321 = $4 ^ 65536;
   _pad($0,48,$2,$320,$321);
   if ($293) {
    $322 = ($$9$ph>>>0)>($$556>>>0);
    $$0496$$9 = $322 ? $$556 : $$9$ph;
    $323 = ((($8)) + 9|0);
    $324 = $323;
    $325 = ((($8)) + 8|0);
    $$5493597 = $$0496$$9;
    while(1) {
     $326 = HEAP32[$$5493597>>2]|0;
     $327 = (_fmt_u($326,0,$323)|0);
     $328 = ($$5493597|0)==($$0496$$9|0);
     if ($328) {
      $334 = ($327|0)==($323|0);
      if ($334) {
       HEAP8[$325>>0] = 48;
       $$1465 = $325;
      } else {
       $$1465 = $327;
      }
     } else {
      $329 = ($327>>>0)>($8>>>0);
      if ($329) {
       $330 = $327;
       $331 = (($330) - ($9))|0;
       _memset(($8|0),48,($331|0))|0;
       $$0464594 = $327;
       while(1) {
        $332 = ((($$0464594)) + -1|0);
        $333 = ($332>>>0)>($8>>>0);
        if ($333) {
         $$0464594 = $332;
        } else {
         $$1465 = $332;
         break;
        }
       }
      } else {
       $$1465 = $327;
      }
     }
     $335 = $$1465;
     $336 = (($324) - ($335))|0;
     _out_94($0,$$1465,$336);
     $337 = ((($$5493597)) + 4|0);
     $338 = ($337>>>0)>($$556>>>0);
     if ($338) {
      break;
     } else {
      $$5493597 = $337;
     }
    }
    $339 = ($289|0)==(0);
    if (!($339)) {
     _out_94($0,3377,1);
    }
    $340 = ($337>>>0)<($$7505>>>0);
    $341 = ($$3477|0)>(0);
    $342 = $340 & $341;
    if ($342) {
     $$4478590 = $$3477;$$6494589 = $337;
     while(1) {
      $343 = HEAP32[$$6494589>>2]|0;
      $344 = (_fmt_u($343,0,$323)|0);
      $345 = ($344>>>0)>($8>>>0);
      if ($345) {
       $346 = $344;
       $347 = (($346) - ($9))|0;
       _memset(($8|0),48,($347|0))|0;
       $$0463584 = $344;
       while(1) {
        $348 = ((($$0463584)) + -1|0);
        $349 = ($348>>>0)>($8>>>0);
        if ($349) {
         $$0463584 = $348;
        } else {
         $$0463$lcssa = $348;
         break;
        }
       }
      } else {
       $$0463$lcssa = $344;
      }
      $350 = ($$4478590|0)<(9);
      $351 = $350 ? $$4478590 : 9;
      _out_94($0,$$0463$lcssa,$351);
      $352 = ((($$6494589)) + 4|0);
      $353 = (($$4478590) + -9)|0;
      $354 = ($352>>>0)<($$7505>>>0);
      $355 = ($$4478590|0)>(9);
      $356 = $354 & $355;
      if ($356) {
       $$4478590 = $353;$$6494589 = $352;
      } else {
       $$4478$lcssa = $353;
       break;
      }
     }
    } else {
     $$4478$lcssa = $$3477;
    }
    $357 = (($$4478$lcssa) + 9)|0;
    _pad($0,48,$357,9,0);
   } else {
    $358 = ((($$9$ph)) + 4|0);
    $$7505$ = $$lcssa673 ? $$7505 : $358;
    $359 = ($$3477|0)>(-1);
    if ($359) {
     $360 = ((($8)) + 9|0);
     $361 = ($$pre$phi690Z2D|0)==(0);
     $362 = $360;
     $363 = (0 - ($9))|0;
     $364 = ((($8)) + 8|0);
     $$5602 = $$3477;$$7495601 = $$9$ph;
     while(1) {
      $365 = HEAP32[$$7495601>>2]|0;
      $366 = (_fmt_u($365,0,$360)|0);
      $367 = ($366|0)==($360|0);
      if ($367) {
       HEAP8[$364>>0] = 48;
       $$0 = $364;
      } else {
       $$0 = $366;
      }
      $368 = ($$7495601|0)==($$9$ph|0);
      do {
       if ($368) {
        $372 = ((($$0)) + 1|0);
        _out_94($0,$$0,1);
        $373 = ($$5602|0)<(1);
        $or$cond554 = $361 & $373;
        if ($or$cond554) {
         $$2 = $372;
         break;
        }
        _out_94($0,3377,1);
        $$2 = $372;
       } else {
        $369 = ($$0>>>0)>($8>>>0);
        if (!($369)) {
         $$2 = $$0;
         break;
        }
        $scevgep684 = (($$0) + ($363)|0);
        $scevgep684685 = $scevgep684;
        _memset(($8|0),48,($scevgep684685|0))|0;
        $$1598 = $$0;
        while(1) {
         $370 = ((($$1598)) + -1|0);
         $371 = ($370>>>0)>($8>>>0);
         if ($371) {
          $$1598 = $370;
         } else {
          $$2 = $370;
          break;
         }
        }
       }
      } while(0);
      $374 = $$2;
      $375 = (($362) - ($374))|0;
      $376 = ($$5602|0)>($375|0);
      $377 = $376 ? $375 : $$5602;
      _out_94($0,$$2,$377);
      $378 = (($$5602) - ($375))|0;
      $379 = ((($$7495601)) + 4|0);
      $380 = ($379>>>0)<($$7505$>>>0);
      $381 = ($378|0)>(-1);
      $382 = $380 & $381;
      if ($382) {
       $$5602 = $378;$$7495601 = $379;
      } else {
       $$5$lcssa = $378;
       break;
      }
     }
    } else {
     $$5$lcssa = $$3477;
    }
    $383 = (($$5$lcssa) + 18)|0;
    _pad($0,48,$383,18,0);
    $384 = $11;
    $385 = $$2513;
    $386 = (($384) - ($385))|0;
    _out_94($0,$$2513,$386);
   }
   $387 = $4 ^ 8192;
   _pad($0,32,$2,$320,$387);
   $$sink562 = $320;
  } else {
   $27 = $5 & 32;
   $28 = ($27|0)!=(0);
   $29 = $28 ? 3349 : 3353;
   $30 = ($$0471 != $$0471) | (0.0 != 0.0);
   $31 = $28 ? 5280 : 3357;
   $$0510 = $30 ? $31 : $29;
   $32 = (($$0520) + 3)|0;
   $33 = $4 & -65537;
   _pad($0,32,$2,$32,$33);
   _out_94($0,$$0521,$$0520);
   _out_94($0,$$0510,3);
   $34 = $4 ^ 8192;
   _pad($0,32,$2,$32,$34);
   $$sink562 = $32;
  }
 } while(0);
 $388 = ($$sink562|0)<($2|0);
 $$555 = $388 ? $2 : $$sink562;
 STACKTOP = sp;return ($$555|0);
}
function ___DOUBLE_BITS($0) {
 $0 = +$0;
 var $1 = 0, $2 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 HEAPF64[tempDoublePtr>>3] = $0;$1 = HEAP32[tempDoublePtr>>2]|0;
 $2 = HEAP32[tempDoublePtr+4>>2]|0;
 tempRet0 = ($2);
 return ($1|0);
}
function _frexpl($0,$1) {
 $0 = +$0;
 $1 = $1|0;
 var $2 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = (+_frexp($0,$1));
 return (+$2);
}
function _frexp($0,$1) {
 $0 = +$0;
 $1 = $1|0;
 var $$0 = 0.0, $$016 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0.0, $storemerge = 0, $trunc$clear = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 HEAPF64[tempDoublePtr>>3] = $0;$2 = HEAP32[tempDoublePtr>>2]|0;
 $3 = HEAP32[tempDoublePtr+4>>2]|0;
 $4 = (_bitshift64Lshr(($2|0),($3|0),52)|0);
 $5 = tempRet0;
 $6 = $4&65535;
 $trunc$clear = $6 & 2047;
 switch ($trunc$clear<<16>>16) {
 case 0:  {
  $7 = $0 != 0.0;
  if ($7) {
   $8 = $0 * 1.8446744073709552E+19;
   $9 = (+_frexp($8,$1));
   $10 = HEAP32[$1>>2]|0;
   $11 = (($10) + -64)|0;
   $$016 = $9;$storemerge = $11;
  } else {
   $$016 = $0;$storemerge = 0;
  }
  HEAP32[$1>>2] = $storemerge;
  $$0 = $$016;
  break;
 }
 case 2047:  {
  $$0 = $0;
  break;
 }
 default: {
  $12 = $4 & 2047;
  $13 = (($12) + -1022)|0;
  HEAP32[$1>>2] = $13;
  $14 = $3 & -2146435073;
  $15 = $14 | 1071644672;
  HEAP32[tempDoublePtr>>2] = $2;HEAP32[tempDoublePtr+4>>2] = $15;$16 = +HEAPF64[tempDoublePtr>>3];
  $$0 = $16;
 }
 }
 return (+$$0);
}
function _wcrtomb($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0;
 var $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0;
 var $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $not$ = 0, $or$cond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ($0|0)==(0|0);
 do {
  if ($3) {
   $$0 = 1;
  } else {
   $4 = ($1>>>0)<(128);
   if ($4) {
    $5 = $1&255;
    HEAP8[$0>>0] = $5;
    $$0 = 1;
    break;
   }
   $6 = (___pthread_self_582()|0);
   $7 = ((($6)) + 188|0);
   $8 = HEAP32[$7>>2]|0;
   $9 = HEAP32[$8>>2]|0;
   $not$ = ($9|0)==(0|0);
   if ($not$) {
    $10 = $1 & -128;
    $11 = ($10|0)==(57216);
    if ($11) {
     $13 = $1&255;
     HEAP8[$0>>0] = $13;
     $$0 = 1;
     break;
    } else {
     $12 = (___errno_location()|0);
     HEAP32[$12>>2] = 84;
     $$0 = -1;
     break;
    }
   }
   $14 = ($1>>>0)<(2048);
   if ($14) {
    $15 = $1 >>> 6;
    $16 = $15 | 192;
    $17 = $16&255;
    $18 = ((($0)) + 1|0);
    HEAP8[$0>>0] = $17;
    $19 = $1 & 63;
    $20 = $19 | 128;
    $21 = $20&255;
    HEAP8[$18>>0] = $21;
    $$0 = 2;
    break;
   }
   $22 = ($1>>>0)<(55296);
   $23 = $1 & -8192;
   $24 = ($23|0)==(57344);
   $or$cond = $22 | $24;
   if ($or$cond) {
    $25 = $1 >>> 12;
    $26 = $25 | 224;
    $27 = $26&255;
    $28 = ((($0)) + 1|0);
    HEAP8[$0>>0] = $27;
    $29 = $1 >>> 6;
    $30 = $29 & 63;
    $31 = $30 | 128;
    $32 = $31&255;
    $33 = ((($0)) + 2|0);
    HEAP8[$28>>0] = $32;
    $34 = $1 & 63;
    $35 = $34 | 128;
    $36 = $35&255;
    HEAP8[$33>>0] = $36;
    $$0 = 3;
    break;
   }
   $37 = (($1) + -65536)|0;
   $38 = ($37>>>0)<(1048576);
   if ($38) {
    $39 = $1 >>> 18;
    $40 = $39 | 240;
    $41 = $40&255;
    $42 = ((($0)) + 1|0);
    HEAP8[$0>>0] = $41;
    $43 = $1 >>> 12;
    $44 = $43 & 63;
    $45 = $44 | 128;
    $46 = $45&255;
    $47 = ((($0)) + 2|0);
    HEAP8[$42>>0] = $46;
    $48 = $1 >>> 6;
    $49 = $48 & 63;
    $50 = $49 | 128;
    $51 = $50&255;
    $52 = ((($0)) + 3|0);
    HEAP8[$47>>0] = $51;
    $53 = $1 & 63;
    $54 = $53 | 128;
    $55 = $54&255;
    HEAP8[$52>>0] = $55;
    $$0 = 4;
    break;
   } else {
    $56 = (___errno_location()|0);
    HEAP32[$56>>2] = 84;
    $$0 = -1;
    break;
   }
  }
 } while(0);
 return ($$0|0);
}
function ___pthread_self_582() {
 var $0 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = (_pthread_self()|0);
 return ($0|0);
}
function ___pthread_self_919() {
 var $0 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = (_pthread_self()|0);
 return ($0|0);
}
function ___strerror_l($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$012$lcssa = 0, $$01214 = 0, $$016 = 0, $$113 = 0, $$115 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 $$016 = 0;
 while(1) {
  $3 = (3379 + ($$016)|0);
  $4 = HEAP8[$3>>0]|0;
  $5 = $4&255;
  $6 = ($5|0)==($0|0);
  if ($6) {
   label = 2;
   break;
  }
  $7 = (($$016) + 1)|0;
  $8 = ($7|0)==(87);
  if ($8) {
   $$01214 = 3467;$$115 = 87;
   label = 5;
   break;
  } else {
   $$016 = $7;
  }
 }
 if ((label|0) == 2) {
  $2 = ($$016|0)==(0);
  if ($2) {
   $$012$lcssa = 3467;
  } else {
   $$01214 = 3467;$$115 = $$016;
   label = 5;
  }
 }
 if ((label|0) == 5) {
  while(1) {
   label = 0;
   $$113 = $$01214;
   while(1) {
    $9 = HEAP8[$$113>>0]|0;
    $10 = ($9<<24>>24)==(0);
    $11 = ((($$113)) + 1|0);
    if ($10) {
     break;
    } else {
     $$113 = $11;
    }
   }
   $12 = (($$115) + -1)|0;
   $13 = ($12|0)==(0);
   if ($13) {
    $$012$lcssa = $11;
    break;
   } else {
    $$01214 = $11;$$115 = $12;
    label = 5;
   }
  }
 }
 $14 = ((($1)) + 20|0);
 $15 = HEAP32[$14>>2]|0;
 $16 = (___lctrans($$012$lcssa,$15)|0);
 return ($16|0);
}
function ___lctrans($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $2 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = (___lctrans_impl($0,$1)|0);
 return ($2|0);
}
function ___lctrans_impl($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ($1|0)==(0|0);
 if ($2) {
  $$0 = 0;
 } else {
  $3 = HEAP32[$1>>2]|0;
  $4 = ((($1)) + 4|0);
  $5 = HEAP32[$4>>2]|0;
  $6 = (___mo_lookup($3,$5,$0)|0);
  $$0 = $6;
 }
 $7 = ($$0|0)!=(0|0);
 $8 = $7 ? $$0 : $0;
 return ($8|0);
}
function ___mo_lookup($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$ = 0, $$090 = 0, $$094 = 0, $$191 = 0, $$195 = 0, $$4 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
 var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
 var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
 var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond102 = 0, $or$cond104 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = HEAP32[$0>>2]|0;
 $4 = (($3) + 1794895138)|0;
 $5 = ((($0)) + 8|0);
 $6 = HEAP32[$5>>2]|0;
 $7 = (_swapc($6,$4)|0);
 $8 = ((($0)) + 12|0);
 $9 = HEAP32[$8>>2]|0;
 $10 = (_swapc($9,$4)|0);
 $11 = ((($0)) + 16|0);
 $12 = HEAP32[$11>>2]|0;
 $13 = (_swapc($12,$4)|0);
 $14 = $1 >>> 2;
 $15 = ($7>>>0)<($14>>>0);
 L1: do {
  if ($15) {
   $16 = $7 << 2;
   $17 = (($1) - ($16))|0;
   $18 = ($10>>>0)<($17>>>0);
   $19 = ($13>>>0)<($17>>>0);
   $or$cond = $18 & $19;
   if ($or$cond) {
    $20 = $13 | $10;
    $21 = $20 & 3;
    $22 = ($21|0)==(0);
    if ($22) {
     $23 = $10 >>> 2;
     $24 = $13 >>> 2;
     $$090 = 0;$$094 = $7;
     while(1) {
      $25 = $$094 >>> 1;
      $26 = (($$090) + ($25))|0;
      $27 = $26 << 1;
      $28 = (($27) + ($23))|0;
      $29 = (($0) + ($28<<2)|0);
      $30 = HEAP32[$29>>2]|0;
      $31 = (_swapc($30,$4)|0);
      $32 = (($28) + 1)|0;
      $33 = (($0) + ($32<<2)|0);
      $34 = HEAP32[$33>>2]|0;
      $35 = (_swapc($34,$4)|0);
      $36 = ($35>>>0)<($1>>>0);
      $37 = (($1) - ($35))|0;
      $38 = ($31>>>0)<($37>>>0);
      $or$cond102 = $36 & $38;
      if (!($or$cond102)) {
       $$4 = 0;
       break L1;
      }
      $39 = (($35) + ($31))|0;
      $40 = (($0) + ($39)|0);
      $41 = HEAP8[$40>>0]|0;
      $42 = ($41<<24>>24)==(0);
      if (!($42)) {
       $$4 = 0;
       break L1;
      }
      $43 = (($0) + ($35)|0);
      $44 = (_strcmp($2,$43)|0);
      $45 = ($44|0)==(0);
      if ($45) {
       break;
      }
      $62 = ($$094|0)==(1);
      $63 = ($44|0)<(0);
      $64 = (($$094) - ($25))|0;
      $$195 = $63 ? $25 : $64;
      $$191 = $63 ? $$090 : $26;
      if ($62) {
       $$4 = 0;
       break L1;
      } else {
       $$090 = $$191;$$094 = $$195;
      }
     }
     $46 = (($27) + ($24))|0;
     $47 = (($0) + ($46<<2)|0);
     $48 = HEAP32[$47>>2]|0;
     $49 = (_swapc($48,$4)|0);
     $50 = (($46) + 1)|0;
     $51 = (($0) + ($50<<2)|0);
     $52 = HEAP32[$51>>2]|0;
     $53 = (_swapc($52,$4)|0);
     $54 = ($53>>>0)<($1>>>0);
     $55 = (($1) - ($53))|0;
     $56 = ($49>>>0)<($55>>>0);
     $or$cond104 = $54 & $56;
     if ($or$cond104) {
      $57 = (($0) + ($53)|0);
      $58 = (($53) + ($49))|0;
      $59 = (($0) + ($58)|0);
      $60 = HEAP8[$59>>0]|0;
      $61 = ($60<<24>>24)==(0);
      $$ = $61 ? $57 : 0;
      $$4 = $$;
     } else {
      $$4 = 0;
     }
    } else {
     $$4 = 0;
    }
   } else {
    $$4 = 0;
   }
  } else {
   $$4 = 0;
  }
 } while(0);
 return ($$4|0);
}
function _swapc($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$ = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ($1|0)==(0);
 $3 = (_llvm_bswap_i32(($0|0))|0);
 $$ = $2 ? $0 : $3;
 return ($$|0);
}
function ___fwritex($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$038 = 0, $$042 = 0, $$1 = 0, $$139 = 0, $$141 = 0, $$143 = 0, $$pre = 0, $$pre47 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0;
 var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ((($2)) + 16|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = ($4|0)==(0|0);
 if ($5) {
  $7 = (___towrite($2)|0);
  $8 = ($7|0)==(0);
  if ($8) {
   $$pre = HEAP32[$3>>2]|0;
   $12 = $$pre;
   label = 5;
  } else {
   $$1 = 0;
  }
 } else {
  $6 = $4;
  $12 = $6;
  label = 5;
 }
 L5: do {
  if ((label|0) == 5) {
   $9 = ((($2)) + 20|0);
   $10 = HEAP32[$9>>2]|0;
   $11 = (($12) - ($10))|0;
   $13 = ($11>>>0)<($1>>>0);
   $14 = $10;
   if ($13) {
    $15 = ((($2)) + 36|0);
    $16 = HEAP32[$15>>2]|0;
    $17 = (FUNCTION_TABLE_iiii[$16 & 7]($2,$0,$1)|0);
    $$1 = $17;
    break;
   }
   $18 = ((($2)) + 75|0);
   $19 = HEAP8[$18>>0]|0;
   $20 = ($19<<24>>24)>(-1);
   L10: do {
    if ($20) {
     $$038 = $1;
     while(1) {
      $21 = ($$038|0)==(0);
      if ($21) {
       $$139 = 0;$$141 = $0;$$143 = $1;$31 = $14;
       break L10;
      }
      $22 = (($$038) + -1)|0;
      $23 = (($0) + ($22)|0);
      $24 = HEAP8[$23>>0]|0;
      $25 = ($24<<24>>24)==(10);
      if ($25) {
       break;
      } else {
       $$038 = $22;
      }
     }
     $26 = ((($2)) + 36|0);
     $27 = HEAP32[$26>>2]|0;
     $28 = (FUNCTION_TABLE_iiii[$27 & 7]($2,$0,$$038)|0);
     $29 = ($28>>>0)<($$038>>>0);
     if ($29) {
      $$1 = $28;
      break L5;
     }
     $30 = (($0) + ($$038)|0);
     $$042 = (($1) - ($$038))|0;
     $$pre47 = HEAP32[$9>>2]|0;
     $$139 = $$038;$$141 = $30;$$143 = $$042;$31 = $$pre47;
    } else {
     $$139 = 0;$$141 = $0;$$143 = $1;$31 = $14;
    }
   } while(0);
   _memcpy(($31|0),($$141|0),($$143|0))|0;
   $32 = HEAP32[$9>>2]|0;
   $33 = (($32) + ($$143)|0);
   HEAP32[$9>>2] = $33;
   $34 = (($$139) + ($$143))|0;
   $$1 = $34;
  }
 } while(0);
 return ($$1|0);
}
function ___towrite($0) {
 $0 = $0|0;
 var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
 var $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 74|0);
 $2 = HEAP8[$1>>0]|0;
 $3 = $2 << 24 >> 24;
 $4 = (($3) + 255)|0;
 $5 = $4 | $3;
 $6 = $5&255;
 HEAP8[$1>>0] = $6;
 $7 = HEAP32[$0>>2]|0;
 $8 = $7 & 8;
 $9 = ($8|0)==(0);
 if ($9) {
  $11 = ((($0)) + 8|0);
  HEAP32[$11>>2] = 0;
  $12 = ((($0)) + 4|0);
  HEAP32[$12>>2] = 0;
  $13 = ((($0)) + 44|0);
  $14 = HEAP32[$13>>2]|0;
  $15 = ((($0)) + 28|0);
  HEAP32[$15>>2] = $14;
  $16 = ((($0)) + 20|0);
  HEAP32[$16>>2] = $14;
  $17 = ((($0)) + 48|0);
  $18 = HEAP32[$17>>2]|0;
  $19 = (($14) + ($18)|0);
  $20 = ((($0)) + 16|0);
  HEAP32[$20>>2] = $19;
  $$0 = 0;
 } else {
  $10 = $7 | 32;
  HEAP32[$0>>2] = $10;
  $$0 = -1;
 }
 return ($$0|0);
}
function ___uflow($0) {
 $0 = $0|0;
 var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $1 = sp;
 $2 = (___toread($0)|0);
 $3 = ($2|0)==(0);
 if ($3) {
  $4 = ((($0)) + 32|0);
  $5 = HEAP32[$4>>2]|0;
  $6 = (FUNCTION_TABLE_iiii[$5 & 7]($0,$1,1)|0);
  $7 = ($6|0)==(1);
  if ($7) {
   $8 = HEAP8[$1>>0]|0;
   $9 = $8&255;
   $$0 = $9;
  } else {
   $$0 = -1;
  }
 } else {
  $$0 = -1;
 }
 STACKTOP = sp;return ($$0|0);
}
function ___toread($0) {
 $0 = $0|0;
 var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
 var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $sext = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 74|0);
 $2 = HEAP8[$1>>0]|0;
 $3 = $2 << 24 >> 24;
 $4 = (($3) + 255)|0;
 $5 = $4 | $3;
 $6 = $5&255;
 HEAP8[$1>>0] = $6;
 $7 = ((($0)) + 20|0);
 $8 = HEAP32[$7>>2]|0;
 $9 = ((($0)) + 28|0);
 $10 = HEAP32[$9>>2]|0;
 $11 = ($8>>>0)>($10>>>0);
 if ($11) {
  $12 = ((($0)) + 36|0);
  $13 = HEAP32[$12>>2]|0;
  (FUNCTION_TABLE_iiii[$13 & 7]($0,0,0)|0);
 }
 $14 = ((($0)) + 16|0);
 HEAP32[$14>>2] = 0;
 HEAP32[$9>>2] = 0;
 HEAP32[$7>>2] = 0;
 $15 = HEAP32[$0>>2]|0;
 $16 = $15 & 4;
 $17 = ($16|0)==(0);
 if ($17) {
  $19 = ((($0)) + 44|0);
  $20 = HEAP32[$19>>2]|0;
  $21 = ((($0)) + 48|0);
  $22 = HEAP32[$21>>2]|0;
  $23 = (($20) + ($22)|0);
  $24 = ((($0)) + 8|0);
  HEAP32[$24>>2] = $23;
  $25 = ((($0)) + 4|0);
  HEAP32[$25>>2] = $23;
  $26 = $15 << 27;
  $sext = $26 >> 31;
  $$0 = $sext;
 } else {
  $18 = $15 | 32;
  HEAP32[$0>>2] = $18;
  $$0 = -1;
 }
 return ($$0|0);
}
function ___overflow($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $$pre = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $3 = 0, $4 = 0;
 var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $2 = sp;
 $3 = $1&255;
 HEAP8[$2>>0] = $3;
 $4 = ((($0)) + 16|0);
 $5 = HEAP32[$4>>2]|0;
 $6 = ($5|0)==(0|0);
 if ($6) {
  $7 = (___towrite($0)|0);
  $8 = ($7|0)==(0);
  if ($8) {
   $$pre = HEAP32[$4>>2]|0;
   $12 = $$pre;
   label = 4;
  } else {
   $$0 = -1;
  }
 } else {
  $12 = $5;
  label = 4;
 }
 do {
  if ((label|0) == 4) {
   $9 = ((($0)) + 20|0);
   $10 = HEAP32[$9>>2]|0;
   $11 = ($10>>>0)<($12>>>0);
   if ($11) {
    $13 = $1 & 255;
    $14 = ((($0)) + 75|0);
    $15 = HEAP8[$14>>0]|0;
    $16 = $15 << 24 >> 24;
    $17 = ($13|0)==($16|0);
    if (!($17)) {
     $18 = ((($10)) + 1|0);
     HEAP32[$9>>2] = $18;
     HEAP8[$10>>0] = $3;
     $$0 = $13;
     break;
    }
   }
   $19 = ((($0)) + 36|0);
   $20 = HEAP32[$19>>2]|0;
   $21 = (FUNCTION_TABLE_iiii[$20 & 7]($0,$2,1)|0);
   $22 = ($21|0)==(1);
   if ($22) {
    $23 = HEAP8[$2>>0]|0;
    $24 = $23&255;
    $$0 = $24;
   } else {
    $$0 = -1;
   }
  }
 } while(0);
 STACKTOP = sp;return ($$0|0);
}
function _fscanf($0,$1,$varargs) {
 $0 = $0|0;
 $1 = $1|0;
 $varargs = $varargs|0;
 var $2 = 0, $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $2 = sp;
 HEAP32[$2>>2] = $varargs;
 $3 = (_vfscanf($0,$1,$2)|0);
 STACKTOP = sp;return ($3|0);
}
function _vfscanf($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$ = 0, $$$0266 = 0, $$$0268 = 0, $$$0305 = 0, $$$3 = 0, $$0266$lcssa = 0, $$0266417 = 0, $$0268 = 0, $$0272 = 0, $$0273429 = 0, $$0276$ph = 0, $$0278$ph = 0, $$0278$ph$phi = 0, $$0278$ph336 = 0, $$0283428 = 0, $$0286420 = 0, $$0288$ = 0, $$0288425 = 0, $$0292 = 0, $$0293 = 0;
 var $$0305423 = 0, $$10 = 0, $$11 = 0, $$1267 = 0, $$1271 = 0, $$1274 = 0, $$1277$ph = 0, $$1279 = 0, $$1284 = 0, $$1289 = 0, $$2 = 0, $$2275 = 0, $$2280 = 0, $$2280$ph = 0, $$2280$ph$phi = 0, $$2285 = 0, $$2290 = 0, $$2307$ph = 0, $$3$lcssa = 0, $$319 = 0;
 var $$320 = 0, $$321 = 0, $$322 = 0, $$327 = 0, $$328$le439 = 0, $$328$le441 = 0, $$3281 = 0, $$3291 = 0, $$3416 = 0, $$4282 = 0, $$4309 = 0, $$5 = 0, $$5299 = 0, $$5310 = 0, $$6 = 0, $$6311 = 0, $$7 = 0, $$7$ph = 0, $$7312 = 0, $$8 = 0;
 var $$8313 = 0, $$9 = 0, $$9314 = 0, $$9314$ph = 0, $$lcssa355 = 0, $$not = 0, $$old4 = 0, $$ph = 0, $$ph353 = 0, $$pre = 0, $$pre$phi516Z2D = 0, $$pre507 = 0, $$pre509 = 0, $$pre511 = 0, $$pre512 = 0, $$pre513 = 0, $$pre514 = 0, $$pre515 = 0, $$sink443 = 0, $$sroa$2$0$$sroa_idx13 = 0;
 var $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0;
 var $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0;
 var $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0;
 var $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0;
 var $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0;
 var $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0;
 var $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0;
 var $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0;
 var $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0;
 var $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0;
 var $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0.0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0.0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0;
 var $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0;
 var $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0;
 var $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0;
 var $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0;
 var $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $arglist_current = 0, $arglist_next = 0, $expanded = 0, $expanded1 = 0, $expanded3 = 0, $expanded4 = 0, $expanded5 = 0, $factor = 0, $factor331 = 0, $isdigit = 0;
 var $isdigit316 = 0, $isdigit316415 = 0, $isdigittmp = 0, $isdigittmp315 = 0, $isdigittmp315414 = 0, $narrow = 0, $narrow469 = 0, $or$cond = 0, $or$cond3 = 0, $or$cond318 = 0, $or$cond5 = 0, $trunc = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 288|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(288|0);
 $3 = sp + 8|0;
 $4 = sp + 17|0;
 $5 = sp;
 $6 = sp + 16|0;
 $7 = ((($0)) + 76|0);
 $8 = HEAP32[$7>>2]|0;
 $9 = ($8|0)>(-1);
 if ($9) {
  $10 = (___lockfile($0)|0);
  $305 = $10;
 } else {
  $305 = 0;
 }
 $11 = HEAP8[$1>>0]|0;
 $12 = ($11<<24>>24)==(0);
 L4: do {
  if ($12) {
   $$3291 = 0;
  } else {
   $13 = ((($0)) + 4|0);
   $14 = ((($0)) + 100|0);
   $15 = ((($0)) + 108|0);
   $16 = ((($0)) + 8|0);
   $17 = ((($4)) + 10|0);
   $18 = ((($4)) + 33|0);
   $$sroa$2$0$$sroa_idx13 = ((($3)) + 4|0);
   $19 = ((($4)) + 46|0);
   $20 = ((($4)) + 94|0);
   $21 = ((($4)) + 1|0);
   $22 = ((($4)) + 1|0);
   $$0273429 = $1;$$0283428 = 0;$$0288425 = 0;$$0305423 = 0;$102 = 0;$24 = $11;
   L6: while(1) {
    $23 = $24&255;
    $25 = (_isspace($23)|0);
    $26 = ($25|0)==(0);
    L8: do {
     if ($26) {
      $53 = ($24<<24>>24)==(37);
      L10: do {
       if ($53) {
        $54 = ((($$0273429)) + 1|0);
        $55 = HEAP8[$54>>0]|0;
        L12: do {
         switch ($55<<24>>24) {
         case 37:  {
          break L10;
          break;
         }
         case 42:  {
          $76 = ((($$0273429)) + 2|0);
          $$0293 = 0;$$2275 = $76;
          break;
         }
         default: {
          $77 = $55&255;
          $isdigittmp = (($77) + -48)|0;
          $isdigit = ($isdigittmp>>>0)<(10);
          if ($isdigit) {
           $78 = ((($$0273429)) + 2|0);
           $79 = HEAP8[$78>>0]|0;
           $80 = ($79<<24>>24)==(36);
           if ($80) {
            $81 = (_arg_n($2,$isdigittmp)|0);
            $82 = ((($$0273429)) + 3|0);
            $$0293 = $81;$$2275 = $82;
            break L12;
           }
          }
          $arglist_current = HEAP32[$2>>2]|0;
          $83 = $arglist_current;
          $84 = ((0) + 4|0);
          $expanded1 = $84;
          $expanded = (($expanded1) - 1)|0;
          $85 = (($83) + ($expanded))|0;
          $86 = ((0) + 4|0);
          $expanded5 = $86;
          $expanded4 = (($expanded5) - 1)|0;
          $expanded3 = $expanded4 ^ -1;
          $87 = $85 & $expanded3;
          $88 = $87;
          $89 = HEAP32[$88>>2]|0;
          $arglist_next = ((($88)) + 4|0);
          HEAP32[$2>>2] = $arglist_next;
          $$0293 = $89;$$2275 = $54;
         }
         }
        } while(0);
        $90 = HEAP8[$$2275>>0]|0;
        $91 = $90&255;
        $isdigittmp315414 = (($91) + -48)|0;
        $isdigit316415 = ($isdigittmp315414>>>0)<(10);
        if ($isdigit316415) {
         $$0266417 = 0;$$3416 = $$2275;$95 = $91;
         while(1) {
          $92 = ($$0266417*10)|0;
          $93 = (($92) + -48)|0;
          $94 = (($93) + ($95))|0;
          $96 = ((($$3416)) + 1|0);
          $97 = HEAP8[$96>>0]|0;
          $98 = $97&255;
          $isdigittmp315 = (($98) + -48)|0;
          $isdigit316 = ($isdigittmp315>>>0)<(10);
          if ($isdigit316) {
           $$0266417 = $94;$$3416 = $96;$95 = $98;
          } else {
           $$0266$lcssa = $94;$$3$lcssa = $96;$$lcssa355 = $97;
           break;
          }
         }
        } else {
         $$0266$lcssa = 0;$$3$lcssa = $$2275;$$lcssa355 = $90;
        }
        $99 = ($$lcssa355<<24>>24)==(109);
        $100 = ($$0293|0)!=(0|0);
        $101 = ((($$3$lcssa)) + 1|0);
        $$$0305 = $99 ? 0 : $$0305423;
        $$327 = $99 ? 0 : $102;
        $$$3 = $99 ? $101 : $$3$lcssa;
        $narrow = $100 & $99;
        $103 = ((($$$3)) + 1|0);
        $104 = HEAP8[$$$3>>0]|0;
        switch ($104<<24>>24) {
        case 104:  {
         $105 = HEAP8[$103>>0]|0;
         $106 = ($105<<24>>24)==(104);
         $107 = ((($$$3)) + 2|0);
         $$319 = $106 ? $107 : $103;
         $$320 = $106 ? -2 : -1;
         $$0268 = $$320;$$5 = $$319;
         break;
        }
        case 108:  {
         $108 = HEAP8[$103>>0]|0;
         $109 = ($108<<24>>24)==(108);
         $110 = ((($$$3)) + 2|0);
         $$321 = $109 ? $110 : $103;
         $$322 = $109 ? 3 : 1;
         $$0268 = $$322;$$5 = $$321;
         break;
        }
        case 106:  {
         $$0268 = 3;$$5 = $103;
         break;
        }
        case 116: case 122:  {
         $$0268 = 1;$$5 = $103;
         break;
        }
        case 76:  {
         $$0268 = 2;$$5 = $103;
         break;
        }
        case 110: case 112: case 67: case 83: case 91: case 99: case 115: case 88: case 71: case 70: case 69: case 65: case 103: case 102: case 101: case 97: case 120: case 117: case 111: case 105: case 100:  {
         $$0268 = 0;$$5 = $$$3;
         break;
        }
        default: {
         $$7312 = $$$0305;$309 = $$327;$narrow469 = $narrow;
         label = 137;
         break L6;
        }
        }
        $111 = HEAP8[$$5>>0]|0;
        $112 = $111&255;
        $113 = $112 & 47;
        $114 = ($113|0)==(3);
        $115 = $112 | 32;
        $$ = $114 ? $115 : $112;
        $$$0268 = $114 ? 1 : $$0268;
        $trunc = $$&255;
        switch ($trunc<<24>>24) {
        case 99:  {
         $116 = ($$0266$lcssa|0)>(1);
         $$$0266 = $116 ? $$0266$lcssa : 1;
         $$1267 = $$$0266;$$1284 = $$0283428;
         break;
        }
        case 91:  {
         $$1267 = $$0266$lcssa;$$1284 = $$0283428;
         break;
        }
        case 110:  {
         $117 = ($$0283428|0)<(0);
         $118 = $117 << 31 >> 31;
         _store_int($$0293,$$$0268,$$0283428,$118);
         $$11 = $$5;$$1289 = $$0288425;$$2285 = $$0283428;$$6311 = $$$0305;$307 = $$327;
         break L8;
         break;
        }
        default: {
         ___shlim($0,0);
         while(1) {
          $119 = HEAP32[$13>>2]|0;
          $120 = HEAP32[$14>>2]|0;
          $121 = ($119>>>0)<($120>>>0);
          if ($121) {
           $122 = ((($119)) + 1|0);
           HEAP32[$13>>2] = $122;
           $123 = HEAP8[$119>>0]|0;
           $124 = $123&255;
           $126 = $124;
          } else {
           $125 = (___shgetc($0)|0);
           $126 = $125;
          }
          $127 = (_isspace($126)|0);
          $128 = ($127|0)==(0);
          if ($128) {
           break;
          }
         }
         $129 = HEAP32[$14>>2]|0;
         $130 = ($129|0)==(0|0);
         if ($130) {
          $$pre507 = HEAP32[$13>>2]|0;
          $138 = $$pre507;
         } else {
          $131 = HEAP32[$13>>2]|0;
          $132 = ((($131)) + -1|0);
          HEAP32[$13>>2] = $132;
          $133 = $132;
          $138 = $133;
         }
         $134 = HEAP32[$15>>2]|0;
         $135 = HEAP32[$16>>2]|0;
         $136 = (($134) + ($$0283428))|0;
         $137 = (($136) + ($138))|0;
         $139 = (($137) - ($135))|0;
         $$1267 = $$0266$lcssa;$$1284 = $139;
        }
        }
        ___shlim($0,$$1267);
        $140 = HEAP32[$13>>2]|0;
        $141 = HEAP32[$14>>2]|0;
        $142 = ($140>>>0)<($141>>>0);
        if ($142) {
         $143 = ((($140)) + 1|0);
         HEAP32[$13>>2] = $143;
         $146 = $141;
        } else {
         $144 = (___shgetc($0)|0);
         $145 = ($144|0)<(0);
         if ($145) {
          $$7312 = $$$0305;$309 = $$327;$narrow469 = $narrow;
          label = 137;
          break L6;
         }
         $$pre509 = HEAP32[$14>>2]|0;
         $146 = $$pre509;
        }
        $147 = ($146|0)==(0|0);
        if (!($147)) {
         $148 = HEAP32[$13>>2]|0;
         $149 = ((($148)) + -1|0);
         HEAP32[$13>>2] = $149;
        }
        L55: do {
         switch ($trunc<<24>>24) {
         case 91: case 99: case 115:  {
          $150 = ($$|0)==(99);
          $151 = $$ | 16;
          $152 = ($151|0)==(115);
          L57: do {
           if ($152) {
            $153 = ($$|0)==(115);
            _memset(($21|0),-1,256)|0;
            HEAP8[$4>>0] = 0;
            if ($153) {
             HEAP8[$18>>0] = 0;
             ;HEAP8[$17>>0]=0|0;HEAP8[$17+1>>0]=0|0;HEAP8[$17+2>>0]=0|0;HEAP8[$17+3>>0]=0|0;HEAP8[$17+4>>0]=0|0;
             $$9 = $$5;
            } else {
             $$9 = $$5;
            }
           } else {
            $154 = ((($$5)) + 1|0);
            $155 = HEAP8[$154>>0]|0;
            $156 = ($155<<24>>24)==(94);
            $157 = ((($$5)) + 2|0);
            $$0292 = $156&1;
            $$6 = $156 ? $157 : $154;
            $158 = $156&1;
            _memset(($22|0),($158|0),256)|0;
            HEAP8[$4>>0] = 0;
            $159 = HEAP8[$$6>>0]|0;
            switch ($159<<24>>24) {
            case 45:  {
             $$sink443 = $19;
             label = 64;
             break;
            }
            case 93:  {
             $$sink443 = $20;
             label = 64;
             break;
            }
            default: {
             $$pre514 = $$0292 ^ 1;
             $$pre515 = $$pre514&255;
             $$7$ph = $$6;$$pre$phi516Z2D = $$pre515;
            }
            }
            if ((label|0) == 64) {
             label = 0;
             $160 = ((($$6)) + 1|0);
             $161 = $$0292 ^ 1;
             $162 = $161&255;
             HEAP8[$$sink443>>0] = $162;
             $$7$ph = $160;$$pre$phi516Z2D = $162;
            }
            $$7 = $$7$ph;
            while(1) {
             $163 = HEAP8[$$7>>0]|0;
             L69: do {
              switch ($163<<24>>24) {
              case 0:  {
               $$7312 = $$$0305;$309 = $$327;$narrow469 = $narrow;
               label = 137;
               break L6;
               break;
              }
              case 93:  {
               $$9 = $$7;
               break L57;
               break;
              }
              case 45:  {
               $164 = ((($$7)) + 1|0);
               $165 = HEAP8[$164>>0]|0;
               switch ($165<<24>>24) {
               case 93: case 0:  {
                $$8 = $$7;$176 = 45;
                break L69;
                break;
               }
               default: {
               }
               }
               $166 = ((($$7)) + -1|0);
               $167 = HEAP8[$166>>0]|0;
               $168 = ($167&255)<($165&255);
               if ($168) {
                $169 = $167&255;
                $$0286420 = $169;
                while(1) {
                 $170 = (($$0286420) + 1)|0;
                 $171 = (($4) + ($170)|0);
                 HEAP8[$171>>0] = $$pre$phi516Z2D;
                 $172 = HEAP8[$164>>0]|0;
                 $173 = $172&255;
                 $174 = ($170|0)<($173|0);
                 if ($174) {
                  $$0286420 = $170;
                 } else {
                  $$8 = $164;$176 = $172;
                  break;
                 }
                }
               } else {
                $$8 = $164;$176 = $165;
               }
               break;
              }
              default: {
               $$8 = $$7;$176 = $163;
              }
              }
             } while(0);
             $175 = $176&255;
             $177 = (($175) + 1)|0;
             $178 = (($4) + ($177)|0);
             HEAP8[$178>>0] = $$pre$phi516Z2D;
             $179 = ((($$8)) + 1|0);
             $$7 = $179;
            }
           }
          } while(0);
          $180 = (($$1267) + 1)|0;
          $181 = $150 ? $180 : 31;
          $182 = ($$$0268|0)==(1);
          L77: do {
           if ($182) {
            if ($narrow) {
             $183 = $181 << 2;
             $184 = (_malloc($183)|0);
             $185 = ($184|0)==(0|0);
             if ($185) {
              $$7312 = 0;$309 = 0;$narrow469 = 1;
              label = 137;
              break L6;
             } else {
              $311 = $184;
             }
            } else {
             $311 = $$0293;
            }
            HEAP32[$3>>2] = 0;
            HEAP32[$$sroa$2$0$$sroa_idx13>>2] = 0;
            $$0276$ph = $181;$$0278$ph = 0;$$ph = $311;
            L82: while(1) {
             $186 = ($$ph|0)==(0|0);
             $$0278$ph336 = $$0278$ph;
             while(1) {
              L86: while(1) {
               $187 = HEAP32[$13>>2]|0;
               $188 = HEAP32[$14>>2]|0;
               $189 = ($187>>>0)<($188>>>0);
               if ($189) {
                $190 = ((($187)) + 1|0);
                HEAP32[$13>>2] = $190;
                $191 = HEAP8[$187>>0]|0;
                $192 = $191&255;
                $195 = $192;
               } else {
                $193 = (___shgetc($0)|0);
                $195 = $193;
               }
               $194 = (($195) + 1)|0;
               $196 = (($4) + ($194)|0);
               $197 = HEAP8[$196>>0]|0;
               $198 = ($197<<24>>24)==(0);
               if ($198) {
                break L82;
               }
               $199 = $195&255;
               HEAP8[$6>>0] = $199;
               $200 = (_mbrtowc($5,$6,1,$3)|0);
               switch ($200|0) {
               case -1:  {
                $$7312 = 0;$309 = $$ph;$narrow469 = $narrow;
                label = 137;
                break L6;
                break;
               }
               case -2:  {
                break;
               }
               default: {
                break L86;
               }
               }
              }
              if ($186) {
               $$1279 = $$0278$ph336;
              } else {
               $201 = (($$ph) + ($$0278$ph336<<2)|0);
               $202 = (($$0278$ph336) + 1)|0;
               $203 = HEAP32[$5>>2]|0;
               HEAP32[$201>>2] = $203;
               $$1279 = $202;
              }
              $204 = ($$1279|0)==($$0276$ph|0);
              $or$cond = $narrow & $204;
              if ($or$cond) {
               break;
              } else {
               $$0278$ph336 = $$1279;
              }
             }
             $factor331 = $$0276$ph << 1;
             $205 = $factor331 | 1;
             $206 = $205 << 2;
             $207 = (_realloc($$ph,$206)|0);
             $208 = ($207|0)==(0|0);
             if ($208) {
              $$7312 = 0;$309 = $$ph;$narrow469 = 1;
              label = 137;
              break L6;
             } else {
              $$0278$ph$phi = $$0276$ph;$$0276$ph = $205;$$ph = $207;$$0278$ph = $$0278$ph$phi;
             }
            }
            $209 = (_mbsinit($3)|0);
            $210 = ($209|0)==(0);
            if ($210) {
             $$7312 = 0;$309 = $$ph;$narrow469 = $narrow;
             label = 137;
             break L6;
            } else {
             $$4282 = $$0278$ph336;$$4309 = 0;$$5299 = $$ph;$312 = $$ph;
            }
           } else {
            if ($narrow) {
             $211 = (_malloc($181)|0);
             $212 = ($211|0)==(0|0);
             if ($212) {
              $$7312 = 0;$309 = 0;$narrow469 = 1;
              label = 137;
              break L6;
             } else {
              $$1277$ph = $181;$$2280$ph = 0;$$2307$ph = $211;
             }
             while(1) {
              $$2280 = $$2280$ph;
              while(1) {
               $213 = HEAP32[$13>>2]|0;
               $214 = HEAP32[$14>>2]|0;
               $215 = ($213>>>0)<($214>>>0);
               if ($215) {
                $216 = ((($213)) + 1|0);
                HEAP32[$13>>2] = $216;
                $217 = HEAP8[$213>>0]|0;
                $218 = $217&255;
                $221 = $218;
               } else {
                $219 = (___shgetc($0)|0);
                $221 = $219;
               }
               $220 = (($221) + 1)|0;
               $222 = (($4) + ($220)|0);
               $223 = HEAP8[$222>>0]|0;
               $224 = ($223<<24>>24)==(0);
               if ($224) {
                $$4282 = $$2280;$$4309 = $$2307$ph;$$5299 = 0;$312 = 0;
                break L77;
               }
               $225 = $221&255;
               $226 = (($$2280) + 1)|0;
               $227 = (($$2307$ph) + ($$2280)|0);
               HEAP8[$227>>0] = $225;
               $228 = ($226|0)==($$1277$ph|0);
               if ($228) {
                break;
               } else {
                $$2280 = $226;
               }
              }
              $factor = $$1277$ph << 1;
              $229 = $factor | 1;
              $230 = (_realloc($$2307$ph,$229)|0);
              $231 = ($230|0)==(0|0);
              if ($231) {
               $$7312 = $$2307$ph;$309 = 0;$narrow469 = 1;
               label = 137;
               break L6;
              } else {
               $$2280$ph$phi = $$1277$ph;$$1277$ph = $229;$$2307$ph = $230;$$2280$ph = $$2280$ph$phi;
              }
             }
            }
            $232 = ($$0293|0)==(0|0);
            if ($232) {
             $250 = $146;
             while(1) {
              $248 = HEAP32[$13>>2]|0;
              $249 = ($248>>>0)<($250>>>0);
              if ($249) {
               $251 = ((($248)) + 1|0);
               HEAP32[$13>>2] = $251;
               $252 = HEAP8[$248>>0]|0;
               $253 = $252&255;
               $256 = $253;
              } else {
               $254 = (___shgetc($0)|0);
               $256 = $254;
              }
              $255 = (($256) + 1)|0;
              $257 = (($4) + ($255)|0);
              $258 = HEAP8[$257>>0]|0;
              $259 = ($258<<24>>24)==(0);
              if ($259) {
               $$4282 = 0;$$4309 = 0;$$5299 = 0;$312 = 0;
               break L77;
              }
              $$pre512 = HEAP32[$14>>2]|0;
              $250 = $$pre512;
             }
            } else {
             $$3281 = 0;$235 = $146;
             while(1) {
              $233 = HEAP32[$13>>2]|0;
              $234 = ($233>>>0)<($235>>>0);
              if ($234) {
               $236 = ((($233)) + 1|0);
               HEAP32[$13>>2] = $236;
               $237 = HEAP8[$233>>0]|0;
               $238 = $237&255;
               $241 = $238;
              } else {
               $239 = (___shgetc($0)|0);
               $241 = $239;
              }
              $240 = (($241) + 1)|0;
              $242 = (($4) + ($240)|0);
              $243 = HEAP8[$242>>0]|0;
              $244 = ($243<<24>>24)==(0);
              if ($244) {
               $$4282 = $$3281;$$4309 = $$0293;$$5299 = 0;$312 = 0;
               break L77;
              }
              $245 = $241&255;
              $246 = (($$3281) + 1)|0;
              $247 = (($$0293) + ($$3281)|0);
              HEAP8[$247>>0] = $245;
              $$pre511 = HEAP32[$14>>2]|0;
              $$3281 = $246;$235 = $$pre511;
             }
            }
           }
          } while(0);
          $260 = HEAP32[$14>>2]|0;
          $261 = ($260|0)==(0|0);
          if ($261) {
           $$pre513 = HEAP32[$13>>2]|0;
           $268 = $$pre513;
          } else {
           $262 = HEAP32[$13>>2]|0;
           $263 = ((($262)) + -1|0);
           HEAP32[$13>>2] = $263;
           $264 = $263;
           $268 = $264;
          }
          $265 = HEAP32[$15>>2]|0;
          $266 = HEAP32[$16>>2]|0;
          $267 = (($268) - ($266))|0;
          $269 = (($267) + ($265))|0;
          $270 = ($269|0)==(0);
          if ($270) {
           $$9314$ph = $$4309;$$ph353 = $312;
           label = 139;
           break L6;
          }
          $$not = $150 ^ 1;
          $271 = ($269|0)==($$1267|0);
          $or$cond318 = $271 | $$not;
          if (!($or$cond318)) {
           $$9314$ph = $$4309;$$ph353 = $312;
           label = 139;
           break L6;
          }
          do {
           if ($narrow) {
            if ($182) {
             HEAP32[$$0293>>2] = $$5299;
             break;
            } else {
             HEAP32[$$0293>>2] = $$4309;
             break;
            }
           }
          } while(0);
          if ($150) {
           $$10 = $$9;$$5310 = $$4309;$310 = $312;
          } else {
           $272 = ($$5299|0)==(0|0);
           if (!($272)) {
            $273 = (($$5299) + ($$4282<<2)|0);
            HEAP32[$273>>2] = 0;
           }
           $274 = ($$4309|0)==(0|0);
           if ($274) {
            $$10 = $$9;$$5310 = 0;$310 = $312;
            break L55;
           }
           $275 = (($$4309) + ($$4282)|0);
           HEAP8[$275>>0] = 0;
           $$10 = $$9;$$5310 = $$4309;$310 = $312;
          }
          break;
         }
         case 120: case 88: case 112:  {
          $$0272 = 16;
          label = 125;
          break;
         }
         case 111:  {
          $$0272 = 8;
          label = 125;
          break;
         }
         case 117: case 100:  {
          $$0272 = 10;
          label = 125;
          break;
         }
         case 105:  {
          $$0272 = 0;
          label = 125;
          break;
         }
         case 71: case 103: case 70: case 102: case 69: case 101: case 65: case 97:  {
          $285 = (+___floatscan($0,$$$0268,0));
          $286 = HEAP32[$15>>2]|0;
          $287 = HEAP32[$13>>2]|0;
          $288 = HEAP32[$16>>2]|0;
          $289 = (($288) - ($287))|0;
          $290 = ($286|0)==($289|0);
          if ($290) {
           $$9314$ph = $$$0305;$$ph353 = $$327;
           label = 139;
           break L6;
          }
          $291 = ($$0293|0)==(0|0);
          if ($291) {
           $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
          } else {
           switch ($$$0268|0) {
           case 0:  {
            $292 = $285;
            HEAPF32[$$0293>>2] = $292;
            $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
            break L55;
            break;
           }
           case 1:  {
            HEAPF64[$$0293>>3] = $285;
            $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
            break L55;
            break;
           }
           case 2:  {
            HEAPF64[$$0293>>3] = $285;
            $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
            break L55;
            break;
           }
           default: {
            $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
            break L55;
           }
           }
          }
          break;
         }
         default: {
          $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
         }
         }
        } while(0);
        do {
         if ((label|0) == 125) {
          label = 0;
          $276 = (___intscan($0,$$0272,0,-1,-1)|0);
          $277 = tempRet0;
          $278 = HEAP32[$15>>2]|0;
          $279 = HEAP32[$13>>2]|0;
          $280 = HEAP32[$16>>2]|0;
          $281 = (($280) - ($279))|0;
          $282 = ($278|0)==($281|0);
          if ($282) {
           $$9314$ph = $$$0305;$$ph353 = $$327;
           label = 139;
           break L6;
          }
          $283 = ($$|0)==(112);
          $or$cond3 = $100 & $283;
          if ($or$cond3) {
           $284 = $276;
           HEAP32[$$0293>>2] = $284;
           $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
           break;
          } else {
           _store_int($$0293,$$$0268,$276,$277);
           $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
           break;
          }
         }
        } while(0);
        $293 = HEAP32[$15>>2]|0;
        $294 = HEAP32[$13>>2]|0;
        $295 = HEAP32[$16>>2]|0;
        $296 = (($293) + ($$1284))|0;
        $297 = (($296) + ($294))|0;
        $298 = (($297) - ($295))|0;
        $299 = $100&1;
        $$0288$ = (($299) + ($$0288425))|0;
        $$11 = $$10;$$1289 = $$0288$;$$2285 = $298;$$6311 = $$5310;$307 = $310;
        break L8;
       }
      } while(0);
      $56 = $53&1;
      $57 = (($$0273429) + ($56)|0);
      ___shlim($0,0);
      $58 = HEAP32[$13>>2]|0;
      $59 = HEAP32[$14>>2]|0;
      $60 = ($58>>>0)<($59>>>0);
      if ($60) {
       $61 = ((($58)) + 1|0);
       HEAP32[$13>>2] = $61;
       $62 = HEAP8[$58>>0]|0;
       $63 = $62&255;
       $67 = $63;
      } else {
       $64 = (___shgetc($0)|0);
       $67 = $64;
      }
      $65 = HEAP8[$57>>0]|0;
      $66 = $65&255;
      $68 = ($67|0)==($66|0);
      if (!($68)) {
       label = 22;
       break L6;
      }
      $75 = (($$0283428) + 1)|0;
      $$11 = $57;$$1289 = $$0288425;$$2285 = $75;$$6311 = $$0305423;$307 = $102;
     } else {
      $$1274 = $$0273429;
      while(1) {
       $27 = ((($$1274)) + 1|0);
       $28 = HEAP8[$27>>0]|0;
       $29 = $28&255;
       $30 = (_isspace($29)|0);
       $31 = ($30|0)==(0);
       if ($31) {
        break;
       } else {
        $$1274 = $27;
       }
      }
      ___shlim($0,0);
      while(1) {
       $32 = HEAP32[$13>>2]|0;
       $33 = HEAP32[$14>>2]|0;
       $34 = ($32>>>0)<($33>>>0);
       if ($34) {
        $35 = ((($32)) + 1|0);
        HEAP32[$13>>2] = $35;
        $36 = HEAP8[$32>>0]|0;
        $37 = $36&255;
        $39 = $37;
       } else {
        $38 = (___shgetc($0)|0);
        $39 = $38;
       }
       $40 = (_isspace($39)|0);
       $41 = ($40|0)==(0);
       if ($41) {
        break;
       }
      }
      $42 = HEAP32[$14>>2]|0;
      $43 = ($42|0)==(0|0);
      if ($43) {
       $$pre = HEAP32[$13>>2]|0;
       $51 = $$pre;
      } else {
       $44 = HEAP32[$13>>2]|0;
       $45 = ((($44)) + -1|0);
       HEAP32[$13>>2] = $45;
       $46 = $45;
       $51 = $46;
      }
      $47 = HEAP32[$15>>2]|0;
      $48 = HEAP32[$16>>2]|0;
      $49 = (($47) + ($$0283428))|0;
      $50 = (($49) + ($51))|0;
      $52 = (($50) - ($48))|0;
      $$11 = $$1274;$$1289 = $$0288425;$$2285 = $52;$$6311 = $$0305423;$307 = $102;
     }
    } while(0);
    $300 = ((($$11)) + 1|0);
    $301 = HEAP8[$300>>0]|0;
    $302 = ($301<<24>>24)==(0);
    if ($302) {
     $$3291 = $$1289;
     break L4;
    } else {
     $$0273429 = $300;$$0283428 = $$2285;$$0288425 = $$1289;$$0305423 = $$6311;$102 = $307;$24 = $301;
    }
   }
   if ((label|0) == 22) {
    $69 = HEAP32[$14>>2]|0;
    $70 = ($69|0)==(0|0);
    if (!($70)) {
     $71 = HEAP32[$13>>2]|0;
     $72 = ((($71)) + -1|0);
     HEAP32[$13>>2] = $72;
    }
    $73 = ($67|0)>(-1);
    $74 = ($$0288425|0)!=(0);
    $or$cond5 = $74 | $73;
    if ($or$cond5) {
     $$3291 = $$0288425;
     break;
    } else {
     $$1271 = 0;$$8313 = $$0305423;$308 = $102;
     label = 138;
    }
   }
   else if ((label|0) == 137) {
    $$328$le441 = $narrow469&1;
    $$old4 = ($$0288425|0)==(0);
    if ($$old4) {
     $$1271 = $$328$le441;$$8313 = $$7312;$308 = $309;
     label = 138;
    } else {
     $$2 = $$328$le441;$$2290 = $$0288425;$$9314 = $$7312;$304 = $309;
    }
   }
   else if ((label|0) == 139) {
    $$328$le439 = $narrow&1;
    $$2 = $$328$le439;$$2290 = $$0288425;$$9314 = $$9314$ph;$304 = $$ph353;
   }
   if ((label|0) == 138) {
    $$2 = $$1271;$$2290 = -1;$$9314 = $$8313;$304 = $308;
   }
   $303 = ($$2|0)==(0);
   if ($303) {
    $$3291 = $$2290;
   } else {
    _free($$9314);
    _free($304);
    $$3291 = $$2290;
   }
  }
 } while(0);
 $306 = ($305|0)==(0);
 if (!($306)) {
  ___unlockfile($0);
 }
 STACKTOP = sp;return ($$3291|0);
}
function _isspace($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ($0|0)==(32);
 $2 = (($0) + -9)|0;
 $3 = ($2>>>0)<(5);
 $4 = $1 | $3;
 $5 = $4&1;
 return ($5|0);
}
function ___shlim($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$sink = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ((($0)) + 104|0);
 HEAP32[$2>>2] = $1;
 $3 = ((($0)) + 8|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = ((($0)) + 4|0);
 $6 = HEAP32[$5>>2]|0;
 $7 = $4;
 $8 = $6;
 $9 = (($7) - ($8))|0;
 $10 = ((($0)) + 108|0);
 HEAP32[$10>>2] = $9;
 $11 = ($1|0)!=(0);
 $12 = ($9|0)>($1|0);
 $or$cond = $11 & $12;
 $13 = (($6) + ($1)|0);
 $$sink = $or$cond ? $13 : $4;
 $14 = ((($0)) + 100|0);
 HEAP32[$14>>2] = $$sink;
 return;
}
function ___shgetc($0) {
 $0 = $0|0;
 var $$0 = 0, $$phi$trans$insert = 0, $$phi$trans$insert28$phi$trans$insert = 0, $$pre = 0, $$pre$phi34Z2D = 0, $$pre29$pre = 0, $$pre35 = 0, $$sink = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0;
 var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0;
 var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 104|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = ($2|0)==(0);
 if ($3) {
  label = 3;
 } else {
  $4 = ((($0)) + 108|0);
  $5 = HEAP32[$4>>2]|0;
  $6 = ($5|0)<($2|0);
  if ($6) {
   label = 3;
  } else {
   label = 4;
  }
 }
 if ((label|0) == 3) {
  $7 = (___uflow($0)|0);
  $8 = ($7|0)<(0);
  if ($8) {
   label = 4;
  } else {
   $10 = HEAP32[$1>>2]|0;
   $11 = ($10|0)==(0);
   $$phi$trans$insert = ((($0)) + 8|0);
   if ($11) {
    $$pre = HEAP32[$$phi$trans$insert>>2]|0;
    $$phi$trans$insert28$phi$trans$insert = ((($0)) + 4|0);
    $$pre29$pre = HEAP32[$$phi$trans$insert28$phi$trans$insert>>2]|0;
    $$pre35 = ((($0)) + 108|0);
    $$pre$phi34Z2D = $$pre35;$$sink = $$pre;$25 = $$pre;$28 = $$pre29$pre;
   } else {
    $12 = HEAP32[$$phi$trans$insert>>2]|0;
    $13 = ((($0)) + 4|0);
    $14 = HEAP32[$13>>2]|0;
    $15 = $14;
    $16 = (($12) - ($15))|0;
    $17 = ((($0)) + 108|0);
    $18 = HEAP32[$17>>2]|0;
    $19 = (($10) - ($18))|0;
    $20 = ($16|0)<($19|0);
    $21 = $12;
    if ($20) {
     $$pre$phi34Z2D = $17;$$sink = $21;$25 = $21;$28 = $14;
    } else {
     $22 = (($19) + -1)|0;
     $23 = (($14) + ($22)|0);
     $$pre$phi34Z2D = $17;$$sink = $23;$25 = $21;$28 = $14;
    }
   }
   $24 = ((($0)) + 100|0);
   HEAP32[$24>>2] = $$sink;
   $26 = ($25|0)==(0|0);
   if (!($26)) {
    $27 = $25;
    $29 = $28;
    $30 = HEAP32[$$pre$phi34Z2D>>2]|0;
    $31 = (($27) + 1)|0;
    $32 = (($31) - ($29))|0;
    $33 = (($32) + ($30))|0;
    HEAP32[$$pre$phi34Z2D>>2] = $33;
   }
   $34 = ((($28)) + -1|0);
   $35 = HEAP8[$34>>0]|0;
   $36 = $35&255;
   $37 = ($36|0)==($7|0);
   if ($37) {
    $$0 = $7;
   } else {
    $38 = $7&255;
    HEAP8[$34>>0] = $38;
    $$0 = $7;
   }
  }
 }
 if ((label|0) == 4) {
  $9 = ((($0)) + 100|0);
  HEAP32[$9>>2] = 0;
  $$0 = -1;
 }
 return ($$0|0);
}
function _arg_n($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $arglist_current = 0, $arglist_next = 0, $expanded = 0, $expanded1 = 0, $expanded3 = 0, $expanded4 = 0, $expanded5 = 0, $vacopy_currentptr = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $2 = sp;
 $vacopy_currentptr = HEAP32[$0>>2]|0;
 HEAP32[$2>>2] = $vacopy_currentptr;
 $$0 = $1;
 while(1) {
  $3 = ($$0>>>0)>(1);
  $arglist_current = HEAP32[$2>>2]|0;
  $4 = $arglist_current;
  $5 = ((0) + 4|0);
  $expanded1 = $5;
  $expanded = (($expanded1) - 1)|0;
  $6 = (($4) + ($expanded))|0;
  $7 = ((0) + 4|0);
  $expanded5 = $7;
  $expanded4 = (($expanded5) - 1)|0;
  $expanded3 = $expanded4 ^ -1;
  $8 = $6 & $expanded3;
  $9 = $8;
  $10 = HEAP32[$9>>2]|0;
  $arglist_next = ((($9)) + 4|0);
  HEAP32[$2>>2] = $arglist_next;
  $11 = (($$0) + -1)|0;
  if ($3) {
   $$0 = $11;
  } else {
   break;
  }
 }
 STACKTOP = sp;return ($10|0);
}
function _store_int($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $10 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $4 = ($0|0)==(0|0);
 L1: do {
  if (!($4)) {
   switch ($1|0) {
   case -2:  {
    $5 = $2&255;
    HEAP8[$0>>0] = $5;
    break L1;
    break;
   }
   case -1:  {
    $6 = $2&65535;
    HEAP16[$0>>1] = $6;
    break L1;
    break;
   }
   case 0:  {
    HEAP32[$0>>2] = $2;
    break L1;
    break;
   }
   case 1:  {
    HEAP32[$0>>2] = $2;
    break L1;
    break;
   }
   case 3:  {
    $7 = $0;
    $8 = $7;
    HEAP32[$8>>2] = $2;
    $9 = (($7) + 4)|0;
    $10 = $9;
    HEAP32[$10>>2] = $3;
    break L1;
    break;
   }
   default: {
    break L1;
   }
   }
  }
 } while(0);
 return;
}
function _mbrtowc($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $$ = 0, $$0 = 0, $$03952 = 0, $$04051 = 0, $$04350 = 0, $$1 = 0, $$141 = 0, $$144 = 0, $$2 = 0, $$47 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
 var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0;
 var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
 var $not$ = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $4 = sp;
 $5 = ($3|0)==(0|0);
 $$ = $5 ? 6168 : $3;
 $6 = HEAP32[$$>>2]|0;
 $7 = ($1|0)==(0|0);
 L1: do {
  if ($7) {
   $8 = ($6|0)==(0);
   if ($8) {
    $$0 = 0;
   } else {
    label = 17;
   }
  } else {
   $9 = ($0|0)==(0|0);
   $$47 = $9 ? $4 : $0;
   $10 = ($2|0)==(0);
   if ($10) {
    $$0 = -2;
   } else {
    $11 = ($6|0)==(0);
    if ($11) {
     $12 = HEAP8[$1>>0]|0;
     $13 = ($12<<24>>24)>(-1);
     if ($13) {
      $14 = $12&255;
      HEAP32[$$47>>2] = $14;
      $15 = ($12<<24>>24)!=(0);
      $16 = $15&1;
      $$0 = $16;
      break;
     }
     $17 = (___pthread_self_566()|0);
     $18 = ((($17)) + 188|0);
     $19 = HEAP32[$18>>2]|0;
     $20 = HEAP32[$19>>2]|0;
     $not$ = ($20|0)==(0|0);
     $21 = HEAP8[$1>>0]|0;
     if ($not$) {
      $22 = $21 << 24 >> 24;
      $23 = $22 & 57343;
      HEAP32[$$47>>2] = $23;
      $$0 = 1;
      break;
     }
     $24 = $21&255;
     $25 = (($24) + -194)|0;
     $26 = ($25>>>0)>(50);
     if ($26) {
      label = 17;
      break;
     }
     $27 = ((($1)) + 1|0);
     $28 = (704 + ($25<<2)|0);
     $29 = HEAP32[$28>>2]|0;
     $30 = (($2) + -1)|0;
     $31 = ($30|0)==(0);
     if ($31) {
      $$2 = $29;
     } else {
      $$03952 = $27;$$04051 = $29;$$04350 = $30;
      label = 11;
     }
    } else {
     $$03952 = $1;$$04051 = $6;$$04350 = $2;
     label = 11;
    }
    L14: do {
     if ((label|0) == 11) {
      $32 = HEAP8[$$03952>>0]|0;
      $33 = $32&255;
      $34 = $33 >>> 3;
      $35 = (($34) + -16)|0;
      $36 = $$04051 >> 26;
      $37 = (($34) + ($36))|0;
      $38 = $35 | $37;
      $39 = ($38>>>0)>(7);
      if ($39) {
       label = 17;
       break L1;
      } else {
       $$1 = $$03952;$$141 = $$04051;$$144 = $$04350;$43 = $32;
      }
      while(1) {
       $40 = $$141 << 6;
       $41 = ((($$1)) + 1|0);
       $42 = $43&255;
       $44 = (($42) + -128)|0;
       $45 = $44 | $40;
       $46 = (($$144) + -1)|0;
       $47 = ($45|0)<(0);
       if (!($47)) {
        break;
       }
       $49 = ($46|0)==(0);
       if ($49) {
        $$2 = $45;
        break L14;
       }
       $50 = HEAP8[$41>>0]|0;
       $51 = $50 & -64;
       $52 = ($51<<24>>24)==(-128);
       if ($52) {
        $$1 = $41;$$141 = $45;$$144 = $46;$43 = $50;
       } else {
        label = 17;
        break L1;
       }
      }
      HEAP32[$$>>2] = 0;
      HEAP32[$$47>>2] = $45;
      $48 = (($2) - ($46))|0;
      $$0 = $48;
      break L1;
     }
    } while(0);
    HEAP32[$$>>2] = $$2;
    $$0 = -2;
   }
  }
 } while(0);
 if ((label|0) == 17) {
  HEAP32[$$>>2] = 0;
  $53 = (___errno_location()|0);
  HEAP32[$53>>2] = 84;
  $$0 = -1;
 }
 STACKTOP = sp;return ($$0|0);
}
function _mbsinit($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ($0|0)==(0|0);
 if ($1) {
  $5 = 1;
 } else {
  $2 = HEAP32[$0>>2]|0;
  $3 = ($2|0)==(0);
  $5 = $3;
 }
 $4 = $5&1;
 return ($4|0);
}
function ___intscan($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $$0154222 = 0, $$0157 = 0, $$0157$ = 0, $$0159 = 0, $$1155192 = 0, $$1158 = 0, $$1160 = 0, $$1160169 = 0, $$1165 = 0, $$1165167 = 0, $$1165168 = 0, $$166 = 0, $$2156210 = 0, $$2161$be = 0, $$2161$lcssa = 0, $$3162$be = 0, $$3162215 = 0, $$4163$be = 0, $$4163$lcssa = 0, $$5$be = 0;
 var $$6$be = 0, $$6$lcssa = 0, $$7$be = 0, $$7198 = 0, $$8 = 0, $$9$be = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0;
 var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0;
 var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0;
 var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0;
 var $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0;
 var $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0;
 var $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0;
 var $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0;
 var $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0;
 var $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0;
 var $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0;
 var $294 = 0, $295 = 0, $296 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0;
 var $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0;
 var $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0;
 var $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $or$cond = 0, $or$cond12 = 0;
 var $or$cond187 = 0, $or$cond5 = 0, $or$cond7 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $5 = ($1>>>0)>(36);
 L1: do {
  if ($5) {
   $8 = (___errno_location()|0);
   HEAP32[$8>>2] = 22;
   $289 = 0;$290 = 0;
  } else {
   $6 = ((($0)) + 4|0);
   $7 = ((($0)) + 100|0);
   while(1) {
    $9 = HEAP32[$6>>2]|0;
    $10 = HEAP32[$7>>2]|0;
    $11 = ($9>>>0)<($10>>>0);
    if ($11) {
     $12 = ((($9)) + 1|0);
     HEAP32[$6>>2] = $12;
     $13 = HEAP8[$9>>0]|0;
     $14 = $13&255;
     $16 = $14;
    } else {
     $15 = (___shgetc($0)|0);
     $16 = $15;
    }
    $17 = (_isspace($16)|0);
    $18 = ($17|0)==(0);
    if ($18) {
     break;
    }
   }
   L11: do {
    switch ($16|0) {
    case 43: case 45:  {
     $19 = ($16|0)==(45);
     $20 = $19 << 31 >> 31;
     $21 = HEAP32[$6>>2]|0;
     $22 = HEAP32[$7>>2]|0;
     $23 = ($21>>>0)<($22>>>0);
     if ($23) {
      $24 = ((($21)) + 1|0);
      HEAP32[$6>>2] = $24;
      $25 = HEAP8[$21>>0]|0;
      $26 = $25&255;
      $$0157 = $20;$$0159 = $26;
      break L11;
     } else {
      $27 = (___shgetc($0)|0);
      $$0157 = $20;$$0159 = $27;
      break L11;
     }
     break;
    }
    default: {
     $$0157 = 0;$$0159 = $16;
    }
    }
   } while(0);
   $28 = ($1|0)==(0);
   $29 = $1 | 16;
   $30 = ($29|0)==(16);
   $31 = ($$0159|0)==(48);
   $or$cond5 = $30 & $31;
   do {
    if ($or$cond5) {
     $32 = HEAP32[$6>>2]|0;
     $33 = HEAP32[$7>>2]|0;
     $34 = ($32>>>0)<($33>>>0);
     if ($34) {
      $35 = ((($32)) + 1|0);
      HEAP32[$6>>2] = $35;
      $36 = HEAP8[$32>>0]|0;
      $37 = $36&255;
      $40 = $37;
     } else {
      $38 = (___shgetc($0)|0);
      $40 = $38;
     }
     $39 = $40 | 32;
     $41 = ($39|0)==(120);
     if (!($41)) {
      if ($28) {
       $$1160169 = $40;$$1165168 = 8;
       label = 46;
       break;
      } else {
       $$1160 = $40;$$1165 = $1;
       label = 32;
       break;
      }
     }
     $42 = HEAP32[$6>>2]|0;
     $43 = HEAP32[$7>>2]|0;
     $44 = ($42>>>0)<($43>>>0);
     if ($44) {
      $45 = ((($42)) + 1|0);
      HEAP32[$6>>2] = $45;
      $46 = HEAP8[$42>>0]|0;
      $47 = $46&255;
      $50 = $47;
     } else {
      $48 = (___shgetc($0)|0);
      $50 = $48;
     }
     $49 = ((5285) + ($50)|0);
     $51 = HEAP8[$49>>0]|0;
     $52 = ($51&255)>(15);
     if ($52) {
      $53 = HEAP32[$7>>2]|0;
      $54 = ($53|0)!=(0|0);
      if ($54) {
       $55 = HEAP32[$6>>2]|0;
       $56 = ((($55)) + -1|0);
       HEAP32[$6>>2] = $56;
      }
      $57 = ($2|0)==(0);
      if ($57) {
       ___shlim($0,0);
       $289 = 0;$290 = 0;
       break L1;
      }
      if (!($54)) {
       $289 = 0;$290 = 0;
       break L1;
      }
      $58 = HEAP32[$6>>2]|0;
      $59 = ((($58)) + -1|0);
      HEAP32[$6>>2] = $59;
      $289 = 0;$290 = 0;
      break L1;
     } else {
      $$1160169 = $50;$$1165168 = 16;
      label = 46;
     }
    } else {
     $$166 = $28 ? 10 : $1;
     $60 = ((5285) + ($$0159)|0);
     $61 = HEAP8[$60>>0]|0;
     $62 = $61&255;
     $63 = ($62>>>0)<($$166>>>0);
     if ($63) {
      $$1160 = $$0159;$$1165 = $$166;
      label = 32;
     } else {
      $64 = HEAP32[$7>>2]|0;
      $65 = ($64|0)==(0|0);
      if (!($65)) {
       $66 = HEAP32[$6>>2]|0;
       $67 = ((($66)) + -1|0);
       HEAP32[$6>>2] = $67;
      }
      ___shlim($0,0);
      $68 = (___errno_location()|0);
      HEAP32[$68>>2] = 22;
      $289 = 0;$290 = 0;
      break L1;
     }
    }
   } while(0);
   L43: do {
    if ((label|0) == 32) {
     $69 = ($$1165|0)==(10);
     if ($69) {
      $70 = (($$1160) + -48)|0;
      $71 = ($70>>>0)<(10);
      if ($71) {
       $$0154222 = 0;$74 = $70;
       while(1) {
        $72 = ($$0154222*10)|0;
        $73 = (($72) + ($74))|0;
        $75 = HEAP32[$6>>2]|0;
        $76 = HEAP32[$7>>2]|0;
        $77 = ($75>>>0)<($76>>>0);
        if ($77) {
         $78 = ((($75)) + 1|0);
         HEAP32[$6>>2] = $78;
         $79 = HEAP8[$75>>0]|0;
         $80 = $79&255;
         $$2161$be = $80;
        } else {
         $81 = (___shgetc($0)|0);
         $$2161$be = $81;
        }
        $82 = (($$2161$be) + -48)|0;
        $83 = ($82>>>0)<(10);
        $84 = ($73>>>0)<(429496729);
        $85 = $83 & $84;
        if ($85) {
         $$0154222 = $73;$74 = $82;
        } else {
         break;
        }
       }
       $$2161$lcssa = $$2161$be;$291 = $73;$292 = 0;
      } else {
       $$2161$lcssa = $$1160;$291 = 0;$292 = 0;
      }
      $86 = (($$2161$lcssa) + -48)|0;
      $87 = ($86>>>0)<(10);
      if ($87) {
       $$3162215 = $$2161$lcssa;$88 = $291;$89 = $292;$92 = $86;
       while(1) {
        $90 = (___muldi3(($88|0),($89|0),10,0)|0);
        $91 = tempRet0;
        $93 = ($92|0)<(0);
        $94 = $93 << 31 >> 31;
        $95 = $92 ^ -1;
        $96 = $94 ^ -1;
        $97 = ($91>>>0)>($96>>>0);
        $98 = ($90>>>0)>($95>>>0);
        $99 = ($91|0)==($96|0);
        $100 = $99 & $98;
        $101 = $97 | $100;
        if ($101) {
         $$1165167 = 10;$$8 = $$3162215;$293 = $88;$294 = $89;
         label = 72;
         break L43;
        }
        $102 = (_i64Add(($90|0),($91|0),($92|0),($94|0))|0);
        $103 = tempRet0;
        $104 = HEAP32[$6>>2]|0;
        $105 = HEAP32[$7>>2]|0;
        $106 = ($104>>>0)<($105>>>0);
        if ($106) {
         $107 = ((($104)) + 1|0);
         HEAP32[$6>>2] = $107;
         $108 = HEAP8[$104>>0]|0;
         $109 = $108&255;
         $$3162$be = $109;
        } else {
         $110 = (___shgetc($0)|0);
         $$3162$be = $110;
        }
        $111 = (($$3162$be) + -48)|0;
        $112 = ($111>>>0)<(10);
        $113 = ($103>>>0)<(429496729);
        $114 = ($102>>>0)<(2576980378);
        $115 = ($103|0)==(429496729);
        $116 = $115 & $114;
        $117 = $113 | $116;
        $or$cond7 = $112 & $117;
        if ($or$cond7) {
         $$3162215 = $$3162$be;$88 = $102;$89 = $103;$92 = $111;
        } else {
         break;
        }
       }
       $118 = ($111>>>0)>(9);
       if ($118) {
        $$1158 = $$0157;$262 = $103;$264 = $102;
       } else {
        $$1165167 = 10;$$8 = $$3162$be;$293 = $102;$294 = $103;
        label = 72;
       }
      } else {
       $$1158 = $$0157;$262 = $292;$264 = $291;
      }
     } else {
      $$1160169 = $$1160;$$1165168 = $$1165;
      label = 46;
     }
    }
   } while(0);
   L63: do {
    if ((label|0) == 46) {
     $119 = (($$1165168) + -1)|0;
     $120 = $119 & $$1165168;
     $121 = ($120|0)==(0);
     if ($121) {
      $126 = ($$1165168*23)|0;
      $127 = $126 >>> 5;
      $128 = $127 & 7;
      $129 = (5541 + ($128)|0);
      $130 = HEAP8[$129>>0]|0;
      $131 = $130 << 24 >> 24;
      $132 = ((5285) + ($$1160169)|0);
      $133 = HEAP8[$132>>0]|0;
      $134 = $133&255;
      $135 = ($134>>>0)<($$1165168>>>0);
      if ($135) {
       $$1155192 = 0;$138 = $134;
       while(1) {
        $136 = $$1155192 << $131;
        $137 = $138 | $136;
        $139 = HEAP32[$6>>2]|0;
        $140 = HEAP32[$7>>2]|0;
        $141 = ($139>>>0)<($140>>>0);
        if ($141) {
         $142 = ((($139)) + 1|0);
         HEAP32[$6>>2] = $142;
         $143 = HEAP8[$139>>0]|0;
         $144 = $143&255;
         $$4163$be = $144;
        } else {
         $145 = (___shgetc($0)|0);
         $$4163$be = $145;
        }
        $146 = ((5285) + ($$4163$be)|0);
        $147 = HEAP8[$146>>0]|0;
        $148 = $147&255;
        $149 = ($148>>>0)<($$1165168>>>0);
        $150 = ($137>>>0)<(134217728);
        $151 = $150 & $149;
        if ($151) {
         $$1155192 = $137;$138 = $148;
        } else {
         break;
        }
       }
       $$4163$lcssa = $$4163$be;$155 = $147;$157 = 0;$159 = $137;
      } else {
       $$4163$lcssa = $$1160169;$155 = $133;$157 = 0;$159 = 0;
      }
      $152 = (_bitshift64Lshr(-1,-1,($131|0))|0);
      $153 = tempRet0;
      $154 = $155&255;
      $156 = ($154>>>0)>=($$1165168>>>0);
      $158 = ($157>>>0)>($153>>>0);
      $160 = ($159>>>0)>($152>>>0);
      $161 = ($157|0)==($153|0);
      $162 = $161 & $160;
      $163 = $158 | $162;
      $or$cond187 = $156 | $163;
      if ($or$cond187) {
       $$1165167 = $$1165168;$$8 = $$4163$lcssa;$293 = $159;$294 = $157;
       label = 72;
       break;
      } else {
       $164 = $159;$165 = $157;$169 = $155;
      }
      while(1) {
       $166 = (_bitshift64Shl(($164|0),($165|0),($131|0))|0);
       $167 = tempRet0;
       $168 = $169&255;
       $170 = $168 | $166;
       $171 = HEAP32[$6>>2]|0;
       $172 = HEAP32[$7>>2]|0;
       $173 = ($171>>>0)<($172>>>0);
       if ($173) {
        $174 = ((($171)) + 1|0);
        HEAP32[$6>>2] = $174;
        $175 = HEAP8[$171>>0]|0;
        $176 = $175&255;
        $$5$be = $176;
       } else {
        $177 = (___shgetc($0)|0);
        $$5$be = $177;
       }
       $178 = ((5285) + ($$5$be)|0);
       $179 = HEAP8[$178>>0]|0;
       $180 = $179&255;
       $181 = ($180>>>0)>=($$1165168>>>0);
       $182 = ($167>>>0)>($153>>>0);
       $183 = ($170>>>0)>($152>>>0);
       $184 = ($167|0)==($153|0);
       $185 = $184 & $183;
       $186 = $182 | $185;
       $or$cond = $181 | $186;
       if ($or$cond) {
        $$1165167 = $$1165168;$$8 = $$5$be;$293 = $170;$294 = $167;
        label = 72;
        break L63;
       } else {
        $164 = $170;$165 = $167;$169 = $179;
       }
      }
     }
     $122 = ((5285) + ($$1160169)|0);
     $123 = HEAP8[$122>>0]|0;
     $124 = $123&255;
     $125 = ($124>>>0)<($$1165168>>>0);
     if ($125) {
      $$2156210 = 0;$189 = $124;
      while(1) {
       $187 = Math_imul($$2156210, $$1165168)|0;
       $188 = (($189) + ($187))|0;
       $190 = HEAP32[$6>>2]|0;
       $191 = HEAP32[$7>>2]|0;
       $192 = ($190>>>0)<($191>>>0);
       if ($192) {
        $193 = ((($190)) + 1|0);
        HEAP32[$6>>2] = $193;
        $194 = HEAP8[$190>>0]|0;
        $195 = $194&255;
        $$6$be = $195;
       } else {
        $196 = (___shgetc($0)|0);
        $$6$be = $196;
       }
       $197 = ((5285) + ($$6$be)|0);
       $198 = HEAP8[$197>>0]|0;
       $199 = $198&255;
       $200 = ($199>>>0)<($$1165168>>>0);
       $201 = ($188>>>0)<(119304647);
       $202 = $201 & $200;
       if ($202) {
        $$2156210 = $188;$189 = $199;
       } else {
        break;
       }
      }
      $$6$lcssa = $$6$be;$204 = $198;$295 = $188;$296 = 0;
     } else {
      $$6$lcssa = $$1160169;$204 = $123;$295 = 0;$296 = 0;
     }
     $203 = $204&255;
     $205 = ($203>>>0)<($$1165168>>>0);
     if ($205) {
      $206 = (___udivdi3(-1,-1,($$1165168|0),0)|0);
      $207 = tempRet0;
      $$7198 = $$6$lcssa;$208 = $296;$210 = $295;$218 = $204;
      while(1) {
       $209 = ($208>>>0)>($207>>>0);
       $211 = ($210>>>0)>($206>>>0);
       $212 = ($208|0)==($207|0);
       $213 = $212 & $211;
       $214 = $209 | $213;
       if ($214) {
        $$1165167 = $$1165168;$$8 = $$7198;$293 = $210;$294 = $208;
        label = 72;
        break L63;
       }
       $215 = (___muldi3(($210|0),($208|0),($$1165168|0),0)|0);
       $216 = tempRet0;
       $217 = $218&255;
       $219 = $217 ^ -1;
       $220 = ($216>>>0)>(4294967295);
       $221 = ($215>>>0)>($219>>>0);
       $222 = ($216|0)==(-1);
       $223 = $222 & $221;
       $224 = $220 | $223;
       if ($224) {
        $$1165167 = $$1165168;$$8 = $$7198;$293 = $210;$294 = $208;
        label = 72;
        break L63;
       }
       $225 = (_i64Add(($217|0),0,($215|0),($216|0))|0);
       $226 = tempRet0;
       $227 = HEAP32[$6>>2]|0;
       $228 = HEAP32[$7>>2]|0;
       $229 = ($227>>>0)<($228>>>0);
       if ($229) {
        $230 = ((($227)) + 1|0);
        HEAP32[$6>>2] = $230;
        $231 = HEAP8[$227>>0]|0;
        $232 = $231&255;
        $$7$be = $232;
       } else {
        $233 = (___shgetc($0)|0);
        $$7$be = $233;
       }
       $234 = ((5285) + ($$7$be)|0);
       $235 = HEAP8[$234>>0]|0;
       $236 = $235&255;
       $237 = ($236>>>0)<($$1165168>>>0);
       if ($237) {
        $$7198 = $$7$be;$208 = $226;$210 = $225;$218 = $235;
       } else {
        $$1165167 = $$1165168;$$8 = $$7$be;$293 = $225;$294 = $226;
        label = 72;
        break;
       }
      }
     } else {
      $$1165167 = $$1165168;$$8 = $$6$lcssa;$293 = $295;$294 = $296;
      label = 72;
     }
    }
   } while(0);
   if ((label|0) == 72) {
    $238 = ((5285) + ($$8)|0);
    $239 = HEAP8[$238>>0]|0;
    $240 = $239&255;
    $241 = ($240>>>0)<($$1165167>>>0);
    if ($241) {
     while(1) {
      $242 = HEAP32[$6>>2]|0;
      $243 = HEAP32[$7>>2]|0;
      $244 = ($242>>>0)<($243>>>0);
      if ($244) {
       $245 = ((($242)) + 1|0);
       HEAP32[$6>>2] = $245;
       $246 = HEAP8[$242>>0]|0;
       $247 = $246&255;
       $$9$be = $247;
      } else {
       $248 = (___shgetc($0)|0);
       $$9$be = $248;
      }
      $249 = ((5285) + ($$9$be)|0);
      $250 = HEAP8[$249>>0]|0;
      $251 = $250&255;
      $252 = ($251>>>0)<($$1165167>>>0);
      if (!($252)) {
       break;
      }
     }
     $253 = (___errno_location()|0);
     HEAP32[$253>>2] = 34;
     $254 = $3 & 1;
     $255 = ($254|0)==(0);
     $256 = (0)==(0);
     $257 = $255 & $256;
     $$0157$ = $257 ? $$0157 : 0;
     $$1158 = $$0157$;$262 = $4;$264 = $3;
    } else {
     $$1158 = $$0157;$262 = $294;$264 = $293;
    }
   }
   $258 = HEAP32[$7>>2]|0;
   $259 = ($258|0)==(0|0);
   if (!($259)) {
    $260 = HEAP32[$6>>2]|0;
    $261 = ((($260)) + -1|0);
    HEAP32[$6>>2] = $261;
   }
   $263 = ($262>>>0)<($4>>>0);
   $265 = ($264>>>0)<($3>>>0);
   $266 = ($262|0)==($4|0);
   $267 = $266 & $265;
   $268 = $263 | $267;
   if (!($268)) {
    $269 = $3 & 1;
    $270 = ($269|0)!=(0);
    $271 = (0)!=(0);
    $272 = $270 | $271;
    $273 = ($$1158|0)!=(0);
    $or$cond12 = $272 | $273;
    if (!($or$cond12)) {
     $274 = (___errno_location()|0);
     HEAP32[$274>>2] = 34;
     $275 = (_i64Add(($3|0),($4|0),-1,-1)|0);
     $276 = tempRet0;
     $289 = $276;$290 = $275;
     break;
    }
    $277 = ($262>>>0)>($4>>>0);
    $278 = ($264>>>0)>($3>>>0);
    $279 = ($262|0)==($4|0);
    $280 = $279 & $278;
    $281 = $277 | $280;
    if ($281) {
     $282 = (___errno_location()|0);
     HEAP32[$282>>2] = 34;
     $289 = $4;$290 = $3;
     break;
    }
   }
   $283 = ($$1158|0)<(0);
   $284 = $283 << 31 >> 31;
   $285 = $264 ^ $$1158;
   $286 = $262 ^ $284;
   $287 = (_i64Subtract(($285|0),($286|0),($$1158|0),($284|0))|0);
   $288 = tempRet0;
   $289 = $288;$290 = $287;
  }
 } while(0);
 tempRet0 = ($289);
 return ($290|0);
}
function ___floatscan($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0 = 0, $$0105$ph = 0, $$0106$ph = 0, $$0107$lcssa = 0, $$0107127 = 0, $$0113 = 0, $$0114 = 0.0, $$1$lcssa = 0, $$1108 = 0, $$1128 = 0, $$2 = 0, $$2109125 = 0, $$3110 = 0, $$3126 = 0, $$4 = 0, $$4111 = 0, $$5 = 0, $$6 = 0, $$in = 0, $$old8 = 0;
 var $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0;
 var $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0.0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0.0, $14 = 0, $15 = 0;
 var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0;
 var $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0;
 var $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0;
 var $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0;
 var $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $or$cond = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 switch ($1|0) {
 case 0:  {
  $$0105$ph = -149;$$0106$ph = 24;
  label = 4;
  break;
 }
 case 1:  {
  $$0105$ph = -1074;$$0106$ph = 53;
  label = 4;
  break;
 }
 case 2:  {
  $$0105$ph = -1074;$$0106$ph = 53;
  label = 4;
  break;
 }
 default: {
  $$0114 = 0.0;
 }
 }
 L4: do {
  if ((label|0) == 4) {
   $3 = ((($0)) + 4|0);
   $4 = ((($0)) + 100|0);
   while(1) {
    $5 = HEAP32[$3>>2]|0;
    $6 = HEAP32[$4>>2]|0;
    $7 = ($5>>>0)<($6>>>0);
    if ($7) {
     $8 = ((($5)) + 1|0);
     HEAP32[$3>>2] = $8;
     $9 = HEAP8[$5>>0]|0;
     $10 = $9&255;
     $12 = $10;
    } else {
     $11 = (___shgetc($0)|0);
     $12 = $11;
    }
    $13 = (_isspace($12)|0);
    $14 = ($13|0)==(0);
    if ($14) {
     break;
    }
   }
   L13: do {
    switch ($12|0) {
    case 43: case 45:  {
     $15 = ($12|0)==(45);
     $16 = $15&1;
     $17 = $16 << 1;
     $18 = (1 - ($17))|0;
     $19 = HEAP32[$3>>2]|0;
     $20 = HEAP32[$4>>2]|0;
     $21 = ($19>>>0)<($20>>>0);
     if ($21) {
      $22 = ((($19)) + 1|0);
      HEAP32[$3>>2] = $22;
      $23 = HEAP8[$19>>0]|0;
      $24 = $23&255;
      $$0 = $24;$$0113 = $18;
      break L13;
     } else {
      $25 = (___shgetc($0)|0);
      $$0 = $25;$$0113 = $18;
      break L13;
     }
     break;
    }
    default: {
     $$0 = $12;$$0113 = 1;
    }
    }
   } while(0);
   $$0107127 = 0;$$1128 = $$0;
   while(1) {
    $26 = $$1128 | 32;
    $27 = (5271 + ($$0107127)|0);
    $28 = HEAP8[$27>>0]|0;
    $29 = $28 << 24 >> 24;
    $30 = ($26|0)==($29|0);
    if (!($30)) {
     $$0107$lcssa = $$0107127;$$1$lcssa = $$1128;
     break;
    }
    $31 = ($$0107127>>>0)<(7);
    do {
     if ($31) {
      $32 = HEAP32[$3>>2]|0;
      $33 = HEAP32[$4>>2]|0;
      $34 = ($32>>>0)<($33>>>0);
      if ($34) {
       $35 = ((($32)) + 1|0);
       HEAP32[$3>>2] = $35;
       $36 = HEAP8[$32>>0]|0;
       $37 = $36&255;
       $$2 = $37;
       break;
      } else {
       $38 = (___shgetc($0)|0);
       $$2 = $38;
       break;
      }
     } else {
      $$2 = $$1128;
     }
    } while(0);
    $39 = (($$0107127) + 1)|0;
    $40 = ($39>>>0)<(8);
    if ($40) {
     $$0107127 = $39;$$1128 = $$2;
    } else {
     $$0107$lcssa = $39;$$1$lcssa = $$2;
     break;
    }
   }
   L29: do {
    switch ($$0107$lcssa|0) {
    case 8:  {
     break;
    }
    case 3:  {
     label = 23;
     break;
    }
    default: {
     $41 = ($$0107$lcssa>>>0)>(3);
     $42 = ($2|0)!=(0);
     $or$cond5 = $42 & $41;
     if ($or$cond5) {
      $43 = ($$0107$lcssa|0)==(8);
      if ($43) {
       break L29;
      } else {
       label = 23;
       break L29;
      }
     }
     $56 = ($$0107$lcssa|0)==(0);
     L34: do {
      if ($56) {
       $$2109125 = 0;$$3126 = $$1$lcssa;
       while(1) {
        $57 = $$3126 | 32;
        $58 = (5280 + ($$2109125)|0);
        $59 = HEAP8[$58>>0]|0;
        $60 = $59 << 24 >> 24;
        $61 = ($57|0)==($60|0);
        if (!($61)) {
         $$3110 = $$2109125;$$5 = $$3126;
         break L34;
        }
        $62 = ($$2109125>>>0)<(2);
        do {
         if ($62) {
          $63 = HEAP32[$3>>2]|0;
          $64 = HEAP32[$4>>2]|0;
          $65 = ($63>>>0)<($64>>>0);
          if ($65) {
           $66 = ((($63)) + 1|0);
           HEAP32[$3>>2] = $66;
           $67 = HEAP8[$63>>0]|0;
           $68 = $67&255;
           $$4 = $68;
           break;
          } else {
           $69 = (___shgetc($0)|0);
           $$4 = $69;
           break;
          }
         } else {
          $$4 = $$3126;
         }
        } while(0);
        $70 = (($$2109125) + 1)|0;
        $71 = ($70>>>0)<(3);
        if ($71) {
         $$2109125 = $70;$$3126 = $$4;
        } else {
         $$3110 = $70;$$5 = $$4;
         break;
        }
       }
      } else {
       $$3110 = $$0107$lcssa;$$5 = $$1$lcssa;
      }
     } while(0);
     switch ($$3110|0) {
     case 3:  {
      $72 = HEAP32[$3>>2]|0;
      $73 = HEAP32[$4>>2]|0;
      $74 = ($72>>>0)<($73>>>0);
      if ($74) {
       $75 = ((($72)) + 1|0);
       HEAP32[$3>>2] = $75;
       $76 = HEAP8[$72>>0]|0;
       $77 = $76&255;
       $79 = $77;
      } else {
       $78 = (___shgetc($0)|0);
       $79 = $78;
      }
      $80 = ($79|0)==(40);
      if ($80) {
       $$4111 = 1;
      } else {
       $81 = HEAP32[$4>>2]|0;
       $82 = ($81|0)==(0|0);
       if ($82) {
        $$0114 = nan;
        break L4;
       }
       $83 = HEAP32[$3>>2]|0;
       $84 = ((($83)) + -1|0);
       HEAP32[$3>>2] = $84;
       $$0114 = nan;
       break L4;
      }
      while(1) {
       $85 = HEAP32[$3>>2]|0;
       $86 = HEAP32[$4>>2]|0;
       $87 = ($85>>>0)<($86>>>0);
       if ($87) {
        $88 = ((($85)) + 1|0);
        HEAP32[$3>>2] = $88;
        $89 = HEAP8[$85>>0]|0;
        $90 = $89&255;
        $93 = $90;
       } else {
        $91 = (___shgetc($0)|0);
        $93 = $91;
       }
       $92 = (($93) + -48)|0;
       $94 = ($92>>>0)<(10);
       $95 = (($93) + -65)|0;
       $96 = ($95>>>0)<(26);
       $or$cond = $94 | $96;
       if (!($or$cond)) {
        $97 = (($93) + -97)|0;
        $98 = ($97>>>0)<(26);
        $99 = ($93|0)==(95);
        $or$cond7 = $99 | $98;
        if (!($or$cond7)) {
         break;
        }
       }
       $111 = (($$4111) + 1)|0;
       $$4111 = $111;
      }
      $100 = ($93|0)==(41);
      if ($100) {
       $$0114 = nan;
       break L4;
      }
      $101 = HEAP32[$4>>2]|0;
      $102 = ($101|0)==(0|0);
      if (!($102)) {
       $103 = HEAP32[$3>>2]|0;
       $104 = ((($103)) + -1|0);
       HEAP32[$3>>2] = $104;
      }
      if (!($42)) {
       $106 = (___errno_location()|0);
       HEAP32[$106>>2] = 22;
       ___shlim($0,0);
       $$0114 = 0.0;
       break L4;
      }
      $105 = ($$4111|0)==(0);
      if ($105) {
       $$0114 = nan;
       break L4;
      } else {
       $$in = $$4111;
      }
      while(1) {
       $107 = (($$in) + -1)|0;
       if (!($102)) {
        $108 = HEAP32[$3>>2]|0;
        $109 = ((($108)) + -1|0);
        HEAP32[$3>>2] = $109;
       }
       $110 = ($107|0)==(0);
       if ($110) {
        $$0114 = nan;
        break L4;
       } else {
        $$in = $107;
       }
      }
      break;
     }
     case 0:  {
      $117 = ($$5|0)==(48);
      if ($117) {
       $118 = HEAP32[$3>>2]|0;
       $119 = HEAP32[$4>>2]|0;
       $120 = ($118>>>0)<($119>>>0);
       if ($120) {
        $121 = ((($118)) + 1|0);
        HEAP32[$3>>2] = $121;
        $122 = HEAP8[$118>>0]|0;
        $123 = $122&255;
        $126 = $123;
       } else {
        $124 = (___shgetc($0)|0);
        $126 = $124;
       }
       $125 = $126 | 32;
       $127 = ($125|0)==(120);
       if ($127) {
        $128 = (+_hexfloat($0,$$0106$ph,$$0105$ph,$$0113,$2));
        $$0114 = $128;
        break L4;
       }
       $129 = HEAP32[$4>>2]|0;
       $130 = ($129|0)==(0|0);
       if ($130) {
        $$6 = 48;
       } else {
        $131 = HEAP32[$3>>2]|0;
        $132 = ((($131)) + -1|0);
        HEAP32[$3>>2] = $132;
        $$6 = 48;
       }
      } else {
       $$6 = $$5;
      }
      $133 = (+_decfloat($0,$$6,$$0106$ph,$$0105$ph,$$0113,$2));
      $$0114 = $133;
      break L4;
      break;
     }
     default: {
      $112 = HEAP32[$4>>2]|0;
      $113 = ($112|0)==(0|0);
      if (!($113)) {
       $114 = HEAP32[$3>>2]|0;
       $115 = ((($114)) + -1|0);
       HEAP32[$3>>2] = $115;
      }
      $116 = (___errno_location()|0);
      HEAP32[$116>>2] = 22;
      ___shlim($0,0);
      $$0114 = 0.0;
      break L4;
     }
     }
    }
    }
   } while(0);
   if ((label|0) == 23) {
    $44 = HEAP32[$4>>2]|0;
    $45 = ($44|0)==(0|0);
    if (!($45)) {
     $46 = HEAP32[$3>>2]|0;
     $47 = ((($46)) + -1|0);
     HEAP32[$3>>2] = $47;
    }
    $48 = ($2|0)!=(0);
    $49 = ($$0107$lcssa>>>0)>(3);
    $or$cond9 = $48 & $49;
    if ($or$cond9) {
     $$1108 = $$0107$lcssa;
     while(1) {
      if (!($45)) {
       $50 = HEAP32[$3>>2]|0;
       $51 = ((($50)) + -1|0);
       HEAP32[$3>>2] = $51;
      }
      $52 = (($$1108) + -1)|0;
      $$old8 = ($52>>>0)>(3);
      if ($$old8) {
       $$1108 = $52;
      } else {
       break;
      }
     }
    }
   }
   $53 = (+($$0113|0));
   $54 = $53 * inf;
   $55 = $54;
   $$0114 = $55;
  }
 } while(0);
 return (+$$0114);
}
function _hexfloat($0,$1,$2,$3,$4) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 var $$0 = 0, $$0133 = 0, $$0142 = 0, $$0146 = 0, $$0148 = 0, $$0148$ = 0, $$0151 = 0.0, $$0152 = 0.0, $$0155 = 0.0, $$0155$ = 0.0, $$0159 = 0, $$0165 = 0.0, $$0166 = 0, $$0166169 = 0, $$0166170 = 0, $$1$ph = 0, $$1147 = 0, $$1149 = 0, $$1153 = 0.0, $$1156 = 0.0;
 var $$1160 = 0, $$2 = 0, $$2$lcssa = 0, $$2144 = 0, $$2150 = 0, $$2154 = 0.0, $$2157 = 0.0, $$2161 = 0, $$3145 = 0, $$3158$lcssa = 0.0, $$3158179 = 0.0, $$3162$lcssa = 0, $$3162183 = 0, $$4 = 0.0, $$4163$lcssa = 0, $$4163178 = 0, $$5 = 0.0, $$5164 = 0, $$6 = 0, $$pn = 0.0;
 var $$pre = 0.0, $$pre$phiZ2D = 0.0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
 var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0;
 var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0.0, $143 = 0.0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0;
 var $152 = 0, $153 = 0.0, $154 = 0.0, $155 = 0.0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0.0, $167 = 0.0, $168 = 0.0, $169 = 0, $17 = 0;
 var $170 = 0, $171 = 0.0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0;
 var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0.0, $197 = 0, $198 = 0.0, $199 = 0.0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0.0, $206 = 0.0;
 var $207 = 0.0, $208 = 0.0, $209 = 0.0, $21 = 0, $210 = 0.0, $211 = 0, $212 = 0, $213 = 0.0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
 var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0;
 var $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0.0, $67 = 0.0;
 var $68 = 0.0, $69 = 0.0, $7 = 0, $70 = 0, $71 = 0, $72 = 0.0, $73 = 0.0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0;
 var $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0.0, $96 = 0.0, $97 = 0, $98 = 0, $99 = 0, $not$ = 0, $or$cond = 0, $or$cond168 = 0, $or$cond206 = 0, $or$cond4 = 0;
 var $or$cond6 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $5 = ((($0)) + 4|0);
 $6 = HEAP32[$5>>2]|0;
 $7 = ((($0)) + 100|0);
 $8 = HEAP32[$7>>2]|0;
 $9 = ($6>>>0)<($8>>>0);
 if ($9) {
  $10 = ((($6)) + 1|0);
  HEAP32[$5>>2] = $10;
  $11 = HEAP8[$6>>0]|0;
  $12 = $11&255;
  $$0 = $12;$$0142 = 0;
 } else {
  $13 = (___shgetc($0)|0);
  $$0 = $13;$$0142 = 0;
 }
 L4: while(1) {
  switch ($$0|0) {
  case 46:  {
   label = 8;
   break L4;
   break;
  }
  case 48:  {
   break;
  }
  default: {
   $$0146 = 0;$$0148 = 0;$$0152 = 1.0;$$0155 = 0.0;$$0159 = 0;$$2 = $$0;$$2144 = $$0142;$100 = 0;$52 = 0;$54 = 0;$98 = 0;
   break L4;
  }
  }
  $14 = HEAP32[$5>>2]|0;
  $15 = HEAP32[$7>>2]|0;
  $16 = ($14>>>0)<($15>>>0);
  if ($16) {
   $17 = ((($14)) + 1|0);
   HEAP32[$5>>2] = $17;
   $18 = HEAP8[$14>>0]|0;
   $19 = $18&255;
   $$0 = $19;$$0142 = 1;
   continue;
  } else {
   $20 = (___shgetc($0)|0);
   $$0 = $20;$$0142 = 1;
   continue;
  }
 }
 if ((label|0) == 8) {
  $21 = HEAP32[$5>>2]|0;
  $22 = HEAP32[$7>>2]|0;
  $23 = ($21>>>0)<($22>>>0);
  if ($23) {
   $24 = ((($21)) + 1|0);
   HEAP32[$5>>2] = $24;
   $25 = HEAP8[$21>>0]|0;
   $26 = $25&255;
   $$1$ph = $26;
  } else {
   $27 = (___shgetc($0)|0);
   $$1$ph = $27;
  }
  $28 = ($$1$ph|0)==(48);
  if ($28) {
   $36 = 0;$37 = 0;
   while(1) {
    $29 = HEAP32[$5>>2]|0;
    $30 = HEAP32[$7>>2]|0;
    $31 = ($29>>>0)<($30>>>0);
    if ($31) {
     $32 = ((($29)) + 1|0);
     HEAP32[$5>>2] = $32;
     $33 = HEAP8[$29>>0]|0;
     $34 = $33&255;
     $40 = $34;
    } else {
     $35 = (___shgetc($0)|0);
     $40 = $35;
    }
    $38 = (_i64Add(($36|0),($37|0),-1,-1)|0);
    $39 = tempRet0;
    $41 = ($40|0)==(48);
    if ($41) {
     $36 = $38;$37 = $39;
    } else {
     $$0146 = 1;$$0148 = 0;$$0152 = 1.0;$$0155 = 0.0;$$0159 = 0;$$2 = $40;$$2144 = 1;$100 = $39;$52 = 0;$54 = 0;$98 = $38;
     break;
    }
   }
  } else {
   $$0146 = 1;$$0148 = 0;$$0152 = 1.0;$$0155 = 0.0;$$0159 = 0;$$2 = $$1$ph;$$2144 = $$0142;$100 = 0;$52 = 0;$54 = 0;$98 = 0;
  }
 }
 while(1) {
  $42 = (($$2) + -48)|0;
  $43 = ($42>>>0)<(10);
  $44 = ($$2|0)==(46);
  if (!($43)) {
   $45 = $$2 | 32;
   $46 = (($45) + -97)|0;
   $47 = ($46>>>0)<(6);
   $or$cond6 = $44 | $47;
   if (!($or$cond6)) {
    $$2$lcssa = $$2;
    break;
   }
  }
  if ($44) {
   $48 = ($$0146|0)==(0);
   if ($48) {
    $$1147 = 1;$$2150 = $$0148;$$2154 = $$0152;$$2157 = $$0155;$$2161 = $$0159;$$3145 = $$2144;$214 = $54;$215 = $52;$216 = $54;$217 = $52;
   } else {
    $$2$lcssa = 46;
    break;
   }
  } else {
   $49 = ($$2|0)>(57);
   $50 = $$2 | 32;
   $51 = (($50) + -87)|0;
   $$0133 = $49 ? $51 : $42;
   $53 = ($52|0)<(0);
   $55 = ($54>>>0)<(8);
   $56 = ($52|0)==(0);
   $57 = $56 & $55;
   $58 = $53 | $57;
   do {
    if ($58) {
     $59 = $$0159 << 4;
     $60 = (($$0133) + ($59))|0;
     $$1149 = $$0148;$$1153 = $$0152;$$1156 = $$0155;$$1160 = $60;
    } else {
     $61 = ($52|0)<(0);
     $62 = ($54>>>0)<(14);
     $63 = ($52|0)==(0);
     $64 = $63 & $62;
     $65 = $61 | $64;
     if ($65) {
      $66 = (+($$0133|0));
      $67 = $$0152 * 0.0625;
      $68 = $67 * $66;
      $69 = $$0155 + $68;
      $$1149 = $$0148;$$1153 = $67;$$1156 = $69;$$1160 = $$0159;
      break;
     } else {
      $70 = ($$0133|0)==(0);
      $71 = ($$0148|0)!=(0);
      $or$cond = $71 | $70;
      $72 = $$0152 * 0.5;
      $73 = $$0155 + $72;
      $$0155$ = $or$cond ? $$0155 : $73;
      $$0148$ = $or$cond ? $$0148 : 1;
      $$1149 = $$0148$;$$1153 = $$0152;$$1156 = $$0155$;$$1160 = $$0159;
      break;
     }
    }
   } while(0);
   $74 = (_i64Add(($54|0),($52|0),1,0)|0);
   $75 = tempRet0;
   $$1147 = $$0146;$$2150 = $$1149;$$2154 = $$1153;$$2157 = $$1156;$$2161 = $$1160;$$3145 = 1;$214 = $98;$215 = $100;$216 = $74;$217 = $75;
  }
  $76 = HEAP32[$5>>2]|0;
  $77 = HEAP32[$7>>2]|0;
  $78 = ($76>>>0)<($77>>>0);
  if ($78) {
   $79 = ((($76)) + 1|0);
   HEAP32[$5>>2] = $79;
   $80 = HEAP8[$76>>0]|0;
   $81 = $80&255;
   $$0146 = $$1147;$$0148 = $$2150;$$0152 = $$2154;$$0155 = $$2157;$$0159 = $$2161;$$2 = $81;$$2144 = $$3145;$100 = $215;$52 = $217;$54 = $216;$98 = $214;
   continue;
  } else {
   $82 = (___shgetc($0)|0);
   $$0146 = $$1147;$$0148 = $$2150;$$0152 = $$2154;$$0155 = $$2157;$$0159 = $$2161;$$2 = $82;$$2144 = $$3145;$100 = $215;$52 = $217;$54 = $216;$98 = $214;
   continue;
  }
 }
 $83 = ($$2144|0)==(0);
 do {
  if ($83) {
   $84 = HEAP32[$7>>2]|0;
   $85 = ($84|0)!=(0|0);
   if ($85) {
    $86 = HEAP32[$5>>2]|0;
    $87 = ((($86)) + -1|0);
    HEAP32[$5>>2] = $87;
   }
   $88 = ($4|0)==(0);
   if ($88) {
    ___shlim($0,0);
   } else {
    if ($85) {
     $89 = HEAP32[$5>>2]|0;
     $90 = ((($89)) + -1|0);
     HEAP32[$5>>2] = $90;
    }
    $91 = ($$0146|0)==(0);
    $92 = ($84|0)==(0|0);
    $or$cond206 = $91 | $92;
    if (!($or$cond206)) {
     $93 = HEAP32[$5>>2]|0;
     $94 = ((($93)) + -1|0);
     HEAP32[$5>>2] = $94;
    }
   }
   $95 = (+($3|0));
   $96 = $95 * 0.0;
   $$0165 = $96;
  } else {
   $97 = ($$0146|0)==(0);
   $99 = $97 ? $54 : $98;
   $101 = $97 ? $52 : $100;
   $102 = ($52|0)<(0);
   $103 = ($54>>>0)<(8);
   $104 = ($52|0)==(0);
   $105 = $104 & $103;
   $106 = $102 | $105;
   if ($106) {
    $$3162183 = $$0159;$108 = $54;$109 = $52;
    while(1) {
     $107 = $$3162183 << 4;
     $110 = (_i64Add(($108|0),($109|0),1,0)|0);
     $111 = tempRet0;
     $112 = ($111|0)<(0);
     $113 = ($110>>>0)<(8);
     $114 = ($111|0)==(0);
     $115 = $114 & $113;
     $116 = $112 | $115;
     if ($116) {
      $$3162183 = $107;$108 = $110;$109 = $111;
     } else {
      $$3162$lcssa = $107;
      break;
     }
    }
   } else {
    $$3162$lcssa = $$0159;
   }
   $117 = $$2$lcssa | 32;
   $118 = ($117|0)==(112);
   if ($118) {
    $119 = (_scanexp($0,$4)|0);
    $120 = tempRet0;
    $121 = ($119|0)==(0);
    $122 = ($120|0)==(-2147483648);
    $123 = $121 & $122;
    if ($123) {
     $124 = ($4|0)==(0);
     if ($124) {
      ___shlim($0,0);
      $$0165 = 0.0;
      break;
     }
     $125 = HEAP32[$7>>2]|0;
     $126 = ($125|0)==(0|0);
     if ($126) {
      $137 = 0;$138 = 0;
     } else {
      $127 = HEAP32[$5>>2]|0;
      $128 = ((($127)) + -1|0);
      HEAP32[$5>>2] = $128;
      $137 = 0;$138 = 0;
     }
    } else {
     $137 = $119;$138 = $120;
    }
   } else {
    $129 = HEAP32[$7>>2]|0;
    $130 = ($129|0)==(0|0);
    if ($130) {
     $137 = 0;$138 = 0;
    } else {
     $131 = HEAP32[$5>>2]|0;
     $132 = ((($131)) + -1|0);
     HEAP32[$5>>2] = $132;
     $137 = 0;$138 = 0;
    }
   }
   $133 = (_bitshift64Shl(($99|0),($101|0),2)|0);
   $134 = tempRet0;
   $135 = (_i64Add(($133|0),($134|0),-32,-1)|0);
   $136 = tempRet0;
   $139 = (_i64Add(($135|0),($136|0),($137|0),($138|0))|0);
   $140 = tempRet0;
   $141 = ($$3162$lcssa|0)==(0);
   if ($141) {
    $142 = (+($3|0));
    $143 = $142 * 0.0;
    $$0165 = $143;
    break;
   }
   $144 = (0 - ($2))|0;
   $145 = ($144|0)<(0);
   $146 = $145 << 31 >> 31;
   $147 = ($140|0)>($146|0);
   $148 = ($139>>>0)>($144>>>0);
   $149 = ($140|0)==($146|0);
   $150 = $149 & $148;
   $151 = $147 | $150;
   if ($151) {
    $152 = (___errno_location()|0);
    HEAP32[$152>>2] = 34;
    $153 = (+($3|0));
    $154 = $153 * 1.7976931348623157E+308;
    $155 = $154 * 1.7976931348623157E+308;
    $$0165 = $155;
    break;
   }
   $156 = (($2) + -106)|0;
   $157 = ($156|0)<(0);
   $158 = $157 << 31 >> 31;
   $159 = ($140|0)<($158|0);
   $160 = ($139>>>0)<($156>>>0);
   $161 = ($140|0)==($158|0);
   $162 = $161 & $160;
   $163 = $159 | $162;
   if ($163) {
    $165 = (___errno_location()|0);
    HEAP32[$165>>2] = 34;
    $166 = (+($3|0));
    $167 = $166 * 2.2250738585072014E-308;
    $168 = $167 * 2.2250738585072014E-308;
    $$0165 = $168;
    break;
   }
   $164 = ($$3162$lcssa|0)>(-1);
   if ($164) {
    $$3158179 = $$0155;$$4163178 = $$3162$lcssa;$173 = $139;$174 = $140;
    while(1) {
     $169 = !($$3158179 >= 0.5);
     $170 = $$4163178 << 1;
     $171 = $$3158179 + -1.0;
     $not$ = $169 ^ 1;
     $172 = $not$&1;
     $$5164 = $170 | $172;
     $$pn = $169 ? $$3158179 : $171;
     $$4 = $$3158179 + $$pn;
     $175 = (_i64Add(($173|0),($174|0),-1,-1)|0);
     $176 = tempRet0;
     $177 = ($$5164|0)>(-1);
     if ($177) {
      $$3158179 = $$4;$$4163178 = $$5164;$173 = $175;$174 = $176;
     } else {
      $$3158$lcssa = $$4;$$4163$lcssa = $$5164;$184 = $175;$185 = $176;
      break;
     }
    }
   } else {
    $$3158$lcssa = $$0155;$$4163$lcssa = $$3162$lcssa;$184 = $139;$185 = $140;
   }
   $178 = ($1|0)<(0);
   $179 = $178 << 31 >> 31;
   $180 = ($2|0)<(0);
   $181 = $180 << 31 >> 31;
   $182 = (_i64Subtract(32,0,($2|0),($181|0))|0);
   $183 = tempRet0;
   $186 = (_i64Add(($182|0),($183|0),($184|0),($185|0))|0);
   $187 = tempRet0;
   $188 = ($179|0)>($187|0);
   $189 = ($1>>>0)>($186>>>0);
   $190 = ($179|0)==($187|0);
   $191 = $190 & $189;
   $192 = $188 | $191;
   if ($192) {
    $193 = ($186|0)>(0);
    if ($193) {
     $$0166 = $186;
     label = 59;
    } else {
     $$0166170 = 0;$197 = 84;
     label = 61;
    }
   } else {
    $$0166 = $1;
    label = 59;
   }
   if ((label|0) == 59) {
    $194 = ($$0166|0)<(53);
    $195 = (84 - ($$0166))|0;
    if ($194) {
     $$0166170 = $$0166;$197 = $195;
     label = 61;
    } else {
     $$pre = (+($3|0));
     $$0151 = 0.0;$$0166169 = $$0166;$$pre$phiZ2D = $$pre;
    }
   }
   if ((label|0) == 61) {
    $196 = (+($3|0));
    $198 = (+_scalbn(1.0,$197));
    $199 = (+_copysignl($198,$196));
    $$0151 = $199;$$0166169 = $$0166170;$$pre$phiZ2D = $196;
   }
   $200 = ($$0166169|0)<(32);
   $201 = $$3158$lcssa != 0.0;
   $or$cond4 = $201 & $200;
   $202 = $$4163$lcssa & 1;
   $203 = ($202|0)==(0);
   $or$cond168 = $203 & $or$cond4;
   $204 = $or$cond168&1;
   $$6 = (($204) + ($$4163$lcssa))|0;
   $$5 = $or$cond168 ? 0.0 : $$3158$lcssa;
   $205 = (+($$6>>>0));
   $206 = $$pre$phiZ2D * $205;
   $207 = $$0151 + $206;
   $208 = $$pre$phiZ2D * $$5;
   $209 = $208 + $207;
   $210 = $209 - $$0151;
   $211 = $210 != 0.0;
   if (!($211)) {
    $212 = (___errno_location()|0);
    HEAP32[$212>>2] = 34;
   }
   $213 = (+_scalbnl($210,$184));
   $$0165 = $213;
  }
 } while(0);
 return (+$$0165);
}
function _decfloat($0,$1,$2,$3,$4,$5) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 var $$ = 0, $$$0345 = 0, $$$0350 = 0, $$$0385 = 0, $$$0401 = 0, $$$5355 = 0, $$$5390 = 0, $$0329 = 0, $$0332490 = 0, $$0333 = 0, $$0334 = 0, $$0336486 = 0, $$0340496 = 0, $$0341$lcssa = 0, $$0341463 = 0, $$0341464 = 0, $$0341465 = 0, $$0341513 = 0, $$0345$lcssa = 0, $$0345467 = 0;
 var $$0345468 = 0, $$0345469 = 0, $$0345512 = 0, $$0350$lcssa554 = 0, $$0350494 = 0, $$0360 = 0.0, $$0361 = 0.0, $$0365484 = 0.0, $$0372 = 0, $$0380 = 0, $$0380$ph = 0, $$0385$lcssa553 = 0, $$0385493 = 0, $$0393 = 0, $$0396 = 0, $$0401$lcssa = 0, $$0401473 = 0, $$0401474 = 0, $$0401475 = 0, $$0401509 = 0;
 var $$1 = 0.0, $$10 = 0, $$1330$be = 0, $$1330$ph = 0, $$1335 = 0, $$1337 = 0, $$1362 = 0.0, $$1366 = 0.0, $$1373 = 0, $$1373$ph448 = 0, $$1381 = 0, $$1381$ph = 0, $$1381$ph558 = 0, $$1394$lcssa = 0, $$1394511 = 0, $$2 = 0, $$2343 = 0, $$2347 = 0, $$2352$ph449 = 0, $$2367 = 0.0;
 var $$2371$v = 0, $$2374 = 0, $$2387$ph447 = 0, $$2395 = 0, $$2398 = 0, $$2403 = 0, $$3$be = 0, $$3$lcssa = 0, $$3344503 = 0, $$3348 = 0, $$3364 = 0.0, $$3368 = 0.0, $$3375 = 0, $$3383 = 0, $$3399$lcssa = 0, $$3399510 = 0, $$3514 = 0, $$413 = 0, $$425 = 0, $$4349495 = 0;
 var $$4354 = 0, $$4354$ph = 0, $$4354$ph559 = 0, $$4376 = 0, $$4384 = 0, $$4389$ph = 0, $$4389$ph445 = 0, $$4400 = 0, $$4485 = 0, $$5 = 0, $$5$in = 0, $$5355488 = 0, $$5390487 = 0, $$6378$ph = 0, $$6489 = 0, $$9483 = 0, $$neg442 = 0, $$neg443 = 0, $$pre = 0, $$promoted = 0;
 var $$sink = 0, $$sink421$off0 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0.0, $103 = 0.0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
 var $116 = 0, $117 = 0, $118 = 0, $119 = 0.0, $12 = 0, $120 = 0.0, $121 = 0.0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0.0, $132 = 0.0, $133 = 0.0;
 var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0.0, $144 = 0.0, $145 = 0.0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0;
 var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0.0, $159 = 0.0, $16 = 0, $160 = 0.0, $161 = 0, $162 = 0.0, $163 = 0.0, $164 = 0.0, $165 = 0, $166 = 0, $167 = 0, $168 = 0.0, $169 = 0.0, $17 = 0;
 var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0.0, $177 = 0.0, $178 = 0.0, $179 = 0, $18 = 0, $180 = 0.0, $181 = 0.0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0;
 var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0;
 var $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0;
 var $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0;
 var $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0;
 var $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0;
 var $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0;
 var $298 = 0, $299 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0.0, $304 = 0, $305 = 0, $306 = 0.0, $307 = 0.0, $308 = 0, $309 = 0.0, $31 = 0, $310 = 0.0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0;
 var $316 = 0, $317 = 0.0, $318 = 0.0, $319 = 0, $32 = 0, $320 = 0.0, $321 = 0.0, $322 = 0.0, $323 = 0.0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0;
 var $334 = 0.0, $335 = 0.0, $336 = 0, $337 = 0.0, $338 = 0.0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0.0, $343 = 0.0, $344 = 0.0, $345 = 0.0, $346 = 0, $347 = 0, $348 = 0.0, $349 = 0, $35 = 0, $350 = 0.0, $351 = 0.0;
 var $352 = 0.0, $353 = 0, $354 = 0, $355 = 0, $356 = 0.0, $357 = 0, $358 = 0.0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0.0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0;
 var $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $39 = 0, $40 = 0, $41 = 0;
 var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0;
 var $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0;
 var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0;
 var $98 = 0, $99 = 0, $cond = 0, $exitcond = 0, $exitcond551 = 0, $narrow = 0, $not$ = 0, $or$cond = 0, $or$cond11 = 0, $or$cond14 = 0, $or$cond415 = 0, $or$cond417 = 0, $or$cond419 = 0, $or$cond420 = 0, $or$cond422 = 0, $or$cond422$not = 0, $or$cond423 = 0, $or$cond426 = 0, $or$cond5 = 0, $sum = 0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 512|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(512|0);
 $6 = sp;
 $sum = (($3) + ($2))|0;
 $7 = (0 - ($sum))|0;
 $8 = ((($0)) + 4|0);
 $9 = ((($0)) + 100|0);
 $$0329 = $1;$$0396 = 0;
 L1: while(1) {
  switch ($$0329|0) {
  case 46:  {
   label = 6;
   break L1;
   break;
  }
  case 48:  {
   break;
  }
  default: {
   $$0393 = 0;$$2 = $$0329;$$2398 = $$0396;$366 = 0;$367 = 0;
   break L1;
  }
  }
  $10 = HEAP32[$8>>2]|0;
  $11 = HEAP32[$9>>2]|0;
  $12 = ($10>>>0)<($11>>>0);
  if ($12) {
   $13 = ((($10)) + 1|0);
   HEAP32[$8>>2] = $13;
   $14 = HEAP8[$10>>0]|0;
   $15 = $14&255;
   $$0329 = $15;$$0396 = 1;
   continue;
  } else {
   $16 = (___shgetc($0)|0);
   $$0329 = $16;$$0396 = 1;
   continue;
  }
 }
 if ((label|0) == 6) {
  $17 = HEAP32[$8>>2]|0;
  $18 = HEAP32[$9>>2]|0;
  $19 = ($17>>>0)<($18>>>0);
  if ($19) {
   $20 = ((($17)) + 1|0);
   HEAP32[$8>>2] = $20;
   $21 = HEAP8[$17>>0]|0;
   $22 = $21&255;
   $$1330$ph = $22;
  } else {
   $23 = (___shgetc($0)|0);
   $$1330$ph = $23;
  }
  $24 = ($$1330$ph|0)==(48);
  if ($24) {
   $25 = 0;$26 = 0;
   while(1) {
    $27 = (_i64Add(($25|0),($26|0),-1,-1)|0);
    $28 = tempRet0;
    $29 = HEAP32[$8>>2]|0;
    $30 = HEAP32[$9>>2]|0;
    $31 = ($29>>>0)<($30>>>0);
    if ($31) {
     $32 = ((($29)) + 1|0);
     HEAP32[$8>>2] = $32;
     $33 = HEAP8[$29>>0]|0;
     $34 = $33&255;
     $$1330$be = $34;
    } else {
     $35 = (___shgetc($0)|0);
     $$1330$be = $35;
    }
    $36 = ($$1330$be|0)==(48);
    if ($36) {
     $25 = $27;$26 = $28;
    } else {
     $$0393 = 1;$$2 = $$1330$be;$$2398 = 1;$366 = $27;$367 = $28;
     break;
    }
   }
  } else {
   $$0393 = 1;$$2 = $$1330$ph;$$2398 = $$0396;$366 = 0;$367 = 0;
  }
 }
 HEAP32[$6>>2] = 0;
 $37 = (($$2) + -48)|0;
 $38 = ($37>>>0)<(10);
 $39 = ($$2|0)==(46);
 $40 = $39 | $38;
 L20: do {
  if ($40) {
   $41 = ((($6)) + 496|0);
   $$0341513 = 0;$$0345512 = 0;$$0401509 = 0;$$1394511 = $$0393;$$3399510 = $$2398;$$3514 = $$2;$368 = $39;$369 = $37;$370 = $366;$371 = $367;$44 = 0;$45 = 0;
   L22: while(1) {
    do {
     if ($368) {
      $cond = ($$1394511|0)==(0);
      if ($cond) {
       $$2343 = $$0341513;$$2347 = $$0345512;$$2395 = 1;$$2403 = $$0401509;$$4400 = $$3399510;$372 = $44;$373 = $45;$374 = $44;$375 = $45;
      } else {
       break L22;
      }
     } else {
      $43 = ($$0345512|0)<(125);
      $46 = (_i64Add(($44|0),($45|0),1,0)|0);
      $47 = tempRet0;
      $48 = ($$3514|0)!=(48);
      if (!($43)) {
       if (!($48)) {
        $$2343 = $$0341513;$$2347 = $$0345512;$$2395 = $$1394511;$$2403 = $$0401509;$$4400 = $$3399510;$372 = $370;$373 = $371;$374 = $46;$375 = $47;
        break;
       }
       $57 = HEAP32[$41>>2]|0;
       $58 = $57 | 1;
       HEAP32[$41>>2] = $58;
       $$2343 = $$0341513;$$2347 = $$0345512;$$2395 = $$1394511;$$2403 = $$0401509;$$4400 = $$3399510;$372 = $370;$373 = $371;$374 = $46;$375 = $47;
       break;
      }
      $$$0401 = $48 ? $46 : $$0401509;
      $49 = ($$0341513|0)==(0);
      $$pre = (($6) + ($$0345512<<2)|0);
      if ($49) {
       $$sink = $369;
      } else {
       $50 = HEAP32[$$pre>>2]|0;
       $51 = ($50*10)|0;
       $52 = (($$3514) + -48)|0;
       $53 = (($52) + ($51))|0;
       $$sink = $53;
      }
      HEAP32[$$pre>>2] = $$sink;
      $54 = (($$0341513) + 1)|0;
      $55 = ($54|0)==(9);
      $56 = $55&1;
      $$$0345 = (($56) + ($$0345512))|0;
      $$413 = $55 ? 0 : $54;
      $$2343 = $$413;$$2347 = $$$0345;$$2395 = $$1394511;$$2403 = $$$0401;$$4400 = 1;$372 = $370;$373 = $371;$374 = $46;$375 = $47;
     }
    } while(0);
    $59 = HEAP32[$8>>2]|0;
    $60 = HEAP32[$9>>2]|0;
    $61 = ($59>>>0)<($60>>>0);
    if ($61) {
     $62 = ((($59)) + 1|0);
     HEAP32[$8>>2] = $62;
     $63 = HEAP8[$59>>0]|0;
     $64 = $63&255;
     $$3$be = $64;
    } else {
     $65 = (___shgetc($0)|0);
     $$3$be = $65;
    }
    $66 = (($$3$be) + -48)|0;
    $67 = ($66>>>0)<(10);
    $68 = ($$3$be|0)==(46);
    $69 = $68 | $67;
    if ($69) {
     $$0341513 = $$2343;$$0345512 = $$2347;$$0401509 = $$2403;$$1394511 = $$2395;$$3399510 = $$4400;$$3514 = $$3$be;$368 = $68;$369 = $66;$370 = $372;$371 = $373;$44 = $374;$45 = $375;
    } else {
     $$0341$lcssa = $$2343;$$0345$lcssa = $$2347;$$0401$lcssa = $$2403;$$1394$lcssa = $$2395;$$3$lcssa = $$3$be;$$3399$lcssa = $$4400;$71 = $372;$72 = $374;$74 = $373;$75 = $375;
     label = 29;
     break L20;
    }
   }
   $42 = ($$3399510|0)!=(0);
   $$0341465 = $$0341513;$$0345469 = $$0345512;$$0401475 = $$0401509;$376 = $44;$377 = $45;$378 = $370;$379 = $371;$380 = $42;
   label = 37;
  } else {
   $$0341$lcssa = 0;$$0345$lcssa = 0;$$0401$lcssa = 0;$$1394$lcssa = $$0393;$$3$lcssa = $$2;$$3399$lcssa = $$2398;$71 = $366;$72 = 0;$74 = $367;$75 = 0;
   label = 29;
  }
 } while(0);
 do {
  if ((label|0) == 29) {
   $70 = ($$1394$lcssa|0)==(0);
   $73 = $70 ? $72 : $71;
   $76 = $70 ? $75 : $74;
   $77 = ($$3399$lcssa|0)!=(0);
   $78 = $$3$lcssa | 32;
   $79 = ($78|0)==(101);
   $or$cond415 = $77 & $79;
   if (!($or$cond415)) {
    $94 = ($$3$lcssa|0)>(-1);
    if ($94) {
     $$0341465 = $$0341$lcssa;$$0345469 = $$0345$lcssa;$$0401475 = $$0401$lcssa;$376 = $72;$377 = $75;$378 = $73;$379 = $76;$380 = $77;
     label = 37;
     break;
    } else {
     $$0341464 = $$0341$lcssa;$$0345468 = $$0345$lcssa;$$0401474 = $$0401$lcssa;$381 = $72;$382 = $75;$383 = $77;$384 = $73;$385 = $76;
     label = 39;
     break;
    }
   }
   $80 = (_scanexp($0,$5)|0);
   $81 = tempRet0;
   $82 = ($80|0)==(0);
   $83 = ($81|0)==(-2147483648);
   $84 = $82 & $83;
   if ($84) {
    $85 = ($5|0)==(0);
    if ($85) {
     ___shlim($0,0);
     $$1 = 0.0;
     break;
    }
    $86 = HEAP32[$9>>2]|0;
    $87 = ($86|0)==(0|0);
    if ($87) {
     $90 = 0;$91 = 0;
    } else {
     $88 = HEAP32[$8>>2]|0;
     $89 = ((($88)) + -1|0);
     HEAP32[$8>>2] = $89;
     $90 = 0;$91 = 0;
    }
   } else {
    $90 = $80;$91 = $81;
   }
   $92 = (_i64Add(($90|0),($91|0),($73|0),($76|0))|0);
   $93 = tempRet0;
   $$0341463 = $$0341$lcssa;$$0345467 = $$0345$lcssa;$$0401473 = $$0401$lcssa;$104 = $92;$106 = $72;$107 = $93;$109 = $75;
   label = 41;
  }
 } while(0);
 if ((label|0) == 37) {
  $95 = HEAP32[$9>>2]|0;
  $96 = ($95|0)==(0|0);
  if ($96) {
   $$0341464 = $$0341465;$$0345468 = $$0345469;$$0401474 = $$0401475;$381 = $376;$382 = $377;$383 = $380;$384 = $378;$385 = $379;
   label = 39;
  } else {
   $97 = HEAP32[$8>>2]|0;
   $98 = ((($97)) + -1|0);
   HEAP32[$8>>2] = $98;
   if ($380) {
    $$0341463 = $$0341465;$$0345467 = $$0345469;$$0401473 = $$0401475;$104 = $378;$106 = $376;$107 = $379;$109 = $377;
    label = 41;
   } else {
    label = 40;
   }
  }
 }
 if ((label|0) == 39) {
  if ($383) {
   $$0341463 = $$0341464;$$0345467 = $$0345468;$$0401473 = $$0401474;$104 = $384;$106 = $381;$107 = $385;$109 = $382;
   label = 41;
  } else {
   label = 40;
  }
 }
 do {
  if ((label|0) == 40) {
   $99 = (___errno_location()|0);
   HEAP32[$99>>2] = 22;
   ___shlim($0,0);
   $$1 = 0.0;
  }
  else if ((label|0) == 41) {
   $100 = HEAP32[$6>>2]|0;
   $101 = ($100|0)==(0);
   if ($101) {
    $102 = (+($4|0));
    $103 = $102 * 0.0;
    $$1 = $103;
    break;
   }
   $105 = ($104|0)==($106|0);
   $108 = ($107|0)==($109|0);
   $110 = $105 & $108;
   $111 = ($109|0)<(0);
   $112 = ($106>>>0)<(10);
   $113 = ($109|0)==(0);
   $114 = $113 & $112;
   $115 = $111 | $114;
   $or$cond = $115 & $110;
   if ($or$cond) {
    $116 = ($2|0)>(30);
    $117 = $100 >>> $2;
    $118 = ($117|0)==(0);
    $or$cond417 = $116 | $118;
    if ($or$cond417) {
     $119 = (+($4|0));
     $120 = (+($100>>>0));
     $121 = $119 * $120;
     $$1 = $121;
     break;
    }
   }
   $122 = (($3|0) / -2)&-1;
   $123 = ($122|0)<(0);
   $124 = $123 << 31 >> 31;
   $125 = ($107|0)>($124|0);
   $126 = ($104>>>0)>($122>>>0);
   $127 = ($107|0)==($124|0);
   $128 = $127 & $126;
   $129 = $125 | $128;
   if ($129) {
    $130 = (___errno_location()|0);
    HEAP32[$130>>2] = 34;
    $131 = (+($4|0));
    $132 = $131 * 1.7976931348623157E+308;
    $133 = $132 * 1.7976931348623157E+308;
    $$1 = $133;
    break;
   }
   $134 = (($3) + -106)|0;
   $135 = ($134|0)<(0);
   $136 = $135 << 31 >> 31;
   $137 = ($107|0)<($136|0);
   $138 = ($104>>>0)<($134>>>0);
   $139 = ($107|0)==($136|0);
   $140 = $139 & $138;
   $141 = $137 | $140;
   if ($141) {
    $142 = (___errno_location()|0);
    HEAP32[$142>>2] = 34;
    $143 = (+($4|0));
    $144 = $143 * 2.2250738585072014E-308;
    $145 = $144 * 2.2250738585072014E-308;
    $$1 = $145;
    break;
   }
   $146 = ($$0341463|0)==(0);
   if ($146) {
    $$3348 = $$0345467;
   } else {
    $147 = ($$0341463|0)<(9);
    if ($147) {
     $148 = (($6) + ($$0345467<<2)|0);
     $$promoted = HEAP32[$148>>2]|0;
     $$3344503 = $$0341463;$150 = $$promoted;
     while(1) {
      $149 = ($150*10)|0;
      $151 = (($$3344503) + 1)|0;
      $exitcond551 = ($151|0)==(9);
      if ($exitcond551) {
       break;
      } else {
       $$3344503 = $151;$150 = $149;
      }
     }
     HEAP32[$148>>2] = $149;
    }
    $152 = (($$0345467) + 1)|0;
    $$3348 = $152;
   }
   $153 = ($$0401473|0)<(9);
   if ($153) {
    $154 = ($$0401473|0)<=($104|0);
    $155 = ($104|0)<(18);
    $or$cond5 = $154 & $155;
    if ($or$cond5) {
     $156 = ($104|0)==(9);
     $157 = HEAP32[$6>>2]|0;
     if ($156) {
      $158 = (+($4|0));
      $159 = (+($157>>>0));
      $160 = $158 * $159;
      $$1 = $160;
      break;
     }
     $161 = ($104|0)<(9);
     if ($161) {
      $162 = (+($4|0));
      $163 = (+($157>>>0));
      $164 = $162 * $163;
      $165 = (8 - ($104))|0;
      $166 = (908 + ($165<<2)|0);
      $167 = HEAP32[$166>>2]|0;
      $168 = (+($167|0));
      $169 = $164 / $168;
      $$1 = $169;
      break;
     }
     $$neg442 = Math_imul($104, -3)|0;
     $$neg443 = (($2) + 27)|0;
     $170 = (($$neg443) + ($$neg442))|0;
     $171 = ($170|0)>(30);
     $172 = $157 >>> $170;
     $173 = ($172|0)==(0);
     $or$cond419 = $171 | $173;
     if ($or$cond419) {
      $174 = (($104) + -10)|0;
      $175 = (908 + ($174<<2)|0);
      $176 = (+($4|0));
      $177 = (+($157>>>0));
      $178 = $176 * $177;
      $179 = HEAP32[$175>>2]|0;
      $180 = (+($179|0));
      $181 = $178 * $180;
      $$1 = $181;
      break;
     }
    }
   }
   $182 = (($104|0) % 9)&-1;
   $183 = ($182|0)==(0);
   if ($183) {
    $$0380$ph = 0;$$1373$ph448 = $$3348;$$2352$ph449 = 0;$$2387$ph447 = $104;
   } else {
    $184 = ($104|0)>(-1);
    $185 = (($182) + 9)|0;
    $186 = $184 ? $182 : $185;
    $187 = (8 - ($186))|0;
    $188 = (908 + ($187<<2)|0);
    $189 = HEAP32[$188>>2]|0;
    $190 = ($$3348|0)==(0);
    if ($190) {
     $$0350$lcssa554 = 0;$$0372 = 0;$$0385$lcssa553 = $104;
    } else {
     $191 = (1000000000 / ($189|0))&-1;
     $$0340496 = 0;$$0350494 = 0;$$0385493 = $104;$$4349495 = 0;
     while(1) {
      $192 = (($6) + ($$4349495<<2)|0);
      $193 = HEAP32[$192>>2]|0;
      $194 = (($193>>>0) % ($189>>>0))&-1;
      $195 = (($193>>>0) / ($189>>>0))&-1;
      $196 = (($195) + ($$0340496))|0;
      HEAP32[$192>>2] = $196;
      $197 = Math_imul($191, $194)|0;
      $198 = ($$4349495|0)==($$0350494|0);
      $199 = ($196|0)==(0);
      $or$cond420 = $198 & $199;
      $200 = (($$0350494) + 1)|0;
      $201 = $200 & 127;
      $202 = (($$0385493) + -9)|0;
      $$$0385 = $or$cond420 ? $202 : $$0385493;
      $$$0350 = $or$cond420 ? $201 : $$0350494;
      $203 = (($$4349495) + 1)|0;
      $204 = ($203|0)==($$3348|0);
      if ($204) {
       break;
      } else {
       $$0340496 = $197;$$0350494 = $$$0350;$$0385493 = $$$0385;$$4349495 = $203;
      }
     }
     $205 = ($197|0)==(0);
     if ($205) {
      $$0350$lcssa554 = $$$0350;$$0372 = $$3348;$$0385$lcssa553 = $$$0385;
     } else {
      $206 = (($6) + ($$3348<<2)|0);
      $207 = (($$3348) + 1)|0;
      HEAP32[$206>>2] = $197;
      $$0350$lcssa554 = $$$0350;$$0372 = $207;$$0385$lcssa553 = $$$0385;
     }
    }
    $208 = (9 - ($186))|0;
    $209 = (($208) + ($$0385$lcssa553))|0;
    $$0380$ph = 0;$$1373$ph448 = $$0372;$$2352$ph449 = $$0350$lcssa554;$$2387$ph447 = $209;
   }
   L101: while(1) {
    $210 = ($$2387$ph447|0)<(18);
    $211 = ($$2387$ph447|0)==(18);
    $212 = (($6) + ($$2352$ph449<<2)|0);
    $$0380 = $$0380$ph;$$1373 = $$1373$ph448;
    while(1) {
     if (!($210)) {
      if (!($211)) {
       $$1381$ph = $$0380;$$4354$ph = $$2352$ph449;$$4389$ph445 = $$2387$ph447;$$6378$ph = $$1373;
       break L101;
      }
      $213 = HEAP32[$212>>2]|0;
      $214 = ($213>>>0)<(9007199);
      if (!($214)) {
       $$1381$ph = $$0380;$$4354$ph = $$2352$ph449;$$4389$ph445 = 18;$$6378$ph = $$1373;
       break L101;
      }
     }
     $215 = (($$1373) + 127)|0;
     $$0334 = 0;$$2374 = $$1373;$$5$in = $215;
     while(1) {
      $$5 = $$5$in & 127;
      $216 = (($6) + ($$5<<2)|0);
      $217 = HEAP32[$216>>2]|0;
      $218 = (_bitshift64Shl(($217|0),0,29)|0);
      $219 = tempRet0;
      $220 = (_i64Add(($218|0),($219|0),($$0334|0),0)|0);
      $221 = tempRet0;
      $222 = ($221>>>0)>(0);
      $223 = ($220>>>0)>(1000000000);
      $224 = ($221|0)==(0);
      $225 = $224 & $223;
      $226 = $222 | $225;
      if ($226) {
       $227 = (___udivdi3(($220|0),($221|0),1000000000,0)|0);
       $228 = tempRet0;
       $229 = (___uremdi3(($220|0),($221|0),1000000000,0)|0);
       $230 = tempRet0;
       $$1335 = $227;$$sink421$off0 = $229;
      } else {
       $$1335 = 0;$$sink421$off0 = $220;
      }
      HEAP32[$216>>2] = $$sink421$off0;
      $231 = (($$2374) + 127)|0;
      $232 = $231 & 127;
      $233 = ($$5|0)!=($232|0);
      $234 = ($$5|0)==($$2352$ph449|0);
      $or$cond422 = $233 | $234;
      $or$cond422$not = $or$cond422 ^ 1;
      $235 = ($$sink421$off0|0)==(0);
      $or$cond423 = $235 & $or$cond422$not;
      $$3375 = $or$cond423 ? $$5 : $$2374;
      $236 = (($$5) + -1)|0;
      if ($234) {
       break;
      } else {
       $$0334 = $$1335;$$2374 = $$3375;$$5$in = $236;
      }
     }
     $237 = (($$0380) + -29)|0;
     $238 = ($$1335|0)==(0);
     if ($238) {
      $$0380 = $237;$$1373 = $$3375;
     } else {
      break;
     }
    }
    $239 = (($$2387$ph447) + 9)|0;
    $240 = (($$2352$ph449) + 127)|0;
    $241 = $240 & 127;
    $242 = ($241|0)==($$3375|0);
    $243 = (($$3375) + 127)|0;
    $244 = $243 & 127;
    $245 = (($$3375) + 126)|0;
    $246 = $245 & 127;
    $247 = (($6) + ($246<<2)|0);
    if ($242) {
     $248 = (($6) + ($244<<2)|0);
     $249 = HEAP32[$248>>2]|0;
     $250 = HEAP32[$247>>2]|0;
     $251 = $250 | $249;
     HEAP32[$247>>2] = $251;
     $$4376 = $244;
    } else {
     $$4376 = $$3375;
    }
    $252 = (($6) + ($241<<2)|0);
    HEAP32[$252>>2] = $$1335;
    $$0380$ph = $237;$$1373$ph448 = $$4376;$$2352$ph449 = $241;$$2387$ph447 = $239;
   }
   L119: while(1) {
    $289 = (($$6378$ph) + 1)|0;
    $286 = $289 & 127;
    $290 = (($$6378$ph) + 127)|0;
    $291 = $290 & 127;
    $292 = (($6) + ($291<<2)|0);
    $$1381$ph558 = $$1381$ph;$$4354$ph559 = $$4354$ph;$$4389$ph = $$4389$ph445;
    while(1) {
     $265 = ($$4389$ph|0)==(18);
     $293 = ($$4389$ph|0)>(27);
     $$425 = $293 ? 9 : 1;
     $$1381 = $$1381$ph558;$$4354 = $$4354$ph559;
     while(1) {
      $$0336486 = 0;
      while(1) {
       $253 = (($$0336486) + ($$4354))|0;
       $254 = $253 & 127;
       $255 = ($254|0)==($$6378$ph|0);
       if ($255) {
        $$1337 = 2;
        label = 88;
        break;
       }
       $256 = (($6) + ($254<<2)|0);
       $257 = HEAP32[$256>>2]|0;
       $258 = (940 + ($$0336486<<2)|0);
       $259 = HEAP32[$258>>2]|0;
       $260 = ($257>>>0)<($259>>>0);
       if ($260) {
        $$1337 = 2;
        label = 88;
        break;
       }
       $261 = ($257>>>0)>($259>>>0);
       if ($261) {
        break;
       }
       $262 = (($$0336486) + 1)|0;
       $263 = ($262|0)<(2);
       if ($263) {
        $$0336486 = $262;
       } else {
        $$1337 = $262;
        label = 88;
        break;
       }
      }
      if ((label|0) == 88) {
       label = 0;
       $264 = ($$1337|0)==(2);
       $or$cond11 = $265 & $264;
       if ($or$cond11) {
        $$0365484 = 0.0;$$4485 = 0;$$9483 = $$6378$ph;
        break L119;
       }
      }
      $266 = (($$425) + ($$1381))|0;
      $267 = ($$4354|0)==($$6378$ph|0);
      if ($267) {
       $$1381 = $266;$$4354 = $$6378$ph;
      } else {
       break;
      }
     }
     $268 = 1 << $$425;
     $269 = (($268) + -1)|0;
     $270 = 1000000000 >>> $$425;
     $$0332490 = 0;$$5355488 = $$4354;$$5390487 = $$4389$ph;$$6489 = $$4354;
     while(1) {
      $271 = (($6) + ($$6489<<2)|0);
      $272 = HEAP32[$271>>2]|0;
      $273 = $272 & $269;
      $274 = $272 >>> $$425;
      $275 = (($274) + ($$0332490))|0;
      HEAP32[$271>>2] = $275;
      $276 = Math_imul($273, $270)|0;
      $277 = ($$6489|0)==($$5355488|0);
      $278 = ($275|0)==(0);
      $or$cond426 = $277 & $278;
      $279 = (($$5355488) + 1)|0;
      $280 = $279 & 127;
      $281 = (($$5390487) + -9)|0;
      $$$5390 = $or$cond426 ? $281 : $$5390487;
      $$$5355 = $or$cond426 ? $280 : $$5355488;
      $282 = (($$6489) + 1)|0;
      $283 = $282 & 127;
      $284 = ($283|0)==($$6378$ph|0);
      if ($284) {
       break;
      } else {
       $$0332490 = $276;$$5355488 = $$$5355;$$5390487 = $$$5390;$$6489 = $283;
      }
     }
     $285 = ($276|0)==(0);
     if ($285) {
      $$1381$ph558 = $266;$$4354$ph559 = $$$5355;$$4389$ph = $$$5390;
      continue;
     }
     $287 = ($286|0)==($$$5355|0);
     if (!($287)) {
      break;
     }
     $294 = HEAP32[$292>>2]|0;
     $295 = $294 | 1;
     HEAP32[$292>>2] = $295;
     $$1381$ph558 = $266;$$4354$ph559 = $$$5355;$$4389$ph = $$$5390;
    }
    $288 = (($6) + ($$6378$ph<<2)|0);
    HEAP32[$288>>2] = $276;
    $$1381$ph = $266;$$4354$ph = $$$5355;$$4389$ph445 = $$$5390;$$6378$ph = $286;
   }
   while(1) {
    $296 = (($$4485) + ($$4354))|0;
    $297 = $296 & 127;
    $298 = ($297|0)==($$9483|0);
    $299 = (($$9483) + 1)|0;
    $300 = $299 & 127;
    if ($298) {
     $301 = (($300) + -1)|0;
     $302 = (($6) + ($301<<2)|0);
     HEAP32[$302>>2] = 0;
     $$10 = $300;
    } else {
     $$10 = $$9483;
    }
    $303 = $$0365484 * 1.0E+9;
    $304 = (($6) + ($297<<2)|0);
    $305 = HEAP32[$304>>2]|0;
    $306 = (+($305>>>0));
    $307 = $303 + $306;
    $308 = (($$4485) + 1)|0;
    $exitcond = ($308|0)==(2);
    if ($exitcond) {
     break;
    } else {
     $$0365484 = $307;$$4485 = $308;$$9483 = $$10;
    }
   }
   $309 = (+($4|0));
   $310 = $309 * $307;
   $311 = (($$1381) + 53)|0;
   $312 = (($311) - ($3))|0;
   $313 = ($312|0)<($2|0);
   $314 = ($312|0)>(0);
   $$ = $314 ? $312 : 0;
   $$0333 = $313 ? $$ : $2;
   $315 = ($$0333|0)<(53);
   if ($315) {
    $316 = (105 - ($$0333))|0;
    $317 = (+_scalbn(1.0,$316));
    $318 = (+_copysignl($317,$310));
    $319 = (53 - ($$0333))|0;
    $320 = (+_scalbn(1.0,$319));
    $321 = (+_fmodl($310,$320));
    $322 = $310 - $321;
    $323 = $318 + $322;
    $$0360 = $318;$$0361 = $321;$$1366 = $323;
   } else {
    $$0360 = 0.0;$$0361 = 0.0;$$1366 = $310;
   }
   $324 = (($$4354) + 2)|0;
   $325 = $324 & 127;
   $326 = ($325|0)==($$10|0);
   if ($326) {
    $$3364 = $$0361;
   } else {
    $327 = (($6) + ($325<<2)|0);
    $328 = HEAP32[$327>>2]|0;
    $329 = ($328>>>0)<(500000000);
    do {
     if ($329) {
      $330 = ($328|0)==(0);
      if ($330) {
       $331 = (($$4354) + 3)|0;
       $332 = $331 & 127;
       $333 = ($332|0)==($$10|0);
       if ($333) {
        $$1362 = $$0361;
        break;
       }
      }
      $334 = $309 * 0.25;
      $335 = $334 + $$0361;
      $$1362 = $335;
     } else {
      $336 = ($328|0)==(500000000);
      if (!($336)) {
       $337 = $309 * 0.75;
       $338 = $337 + $$0361;
       $$1362 = $338;
       break;
      }
      $339 = (($$4354) + 3)|0;
      $340 = $339 & 127;
      $341 = ($340|0)==($$10|0);
      if ($341) {
       $342 = $309 * 0.5;
       $343 = $342 + $$0361;
       $$1362 = $343;
       break;
      } else {
       $344 = $309 * 0.75;
       $345 = $344 + $$0361;
       $$1362 = $345;
       break;
      }
     }
    } while(0);
    $346 = (53 - ($$0333))|0;
    $347 = ($346|0)>(1);
    if ($347) {
     $348 = (+_fmodl($$1362,1.0));
     $349 = $348 != 0.0;
     if ($349) {
      $$3364 = $$1362;
     } else {
      $350 = $$1362 + 1.0;
      $$3364 = $350;
     }
    } else {
     $$3364 = $$1362;
    }
   }
   $351 = $$1366 + $$3364;
   $352 = $351 - $$0360;
   $353 = $311 & 2147483647;
   $354 = (-2 - ($sum))|0;
   $355 = ($353|0)>($354|0);
   do {
    if ($355) {
     $356 = (+Math_abs((+$352)));
     $357 = !($356 >= 9007199254740992.0);
     $358 = $352 * 0.5;
     $not$ = $357 ^ 1;
     $359 = $not$&1;
     $$3383 = (($359) + ($$1381))|0;
     $$2367 = $357 ? $352 : $358;
     $360 = (($$3383) + 50)|0;
     $361 = ($360|0)>($7|0);
     if (!($361)) {
      $362 = ($$0333|0)!=($312|0);
      $narrow = $362 | $357;
      $$2371$v = $313 & $narrow;
      $363 = $$3364 != 0.0;
      $or$cond14 = $363 & $$2371$v;
      if (!($or$cond14)) {
       $$3368 = $$2367;$$4384 = $$3383;
       break;
      }
     }
     $364 = (___errno_location()|0);
     HEAP32[$364>>2] = 34;
     $$3368 = $$2367;$$4384 = $$3383;
    } else {
     $$3368 = $352;$$4384 = $$1381;
    }
   } while(0);
   $365 = (+_scalbnl($$3368,$$4384));
   $$1 = $365;
  }
 } while(0);
 STACKTOP = sp;return (+$$1);
}
function _scanexp($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $$04861 = 0, $$049 = 0, $$1$be = 0, $$160 = 0, $$2$be = 0, $$2$lcssa = 0, $$254 = 0, $$3$be = 0, $$lcssa = 0, $$pre = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0;
 var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
 var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0;
 var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0;
 var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0;
 var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $or$cond3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ((($0)) + 4|0);
 $3 = HEAP32[$2>>2]|0;
 $4 = ((($0)) + 100|0);
 $5 = HEAP32[$4>>2]|0;
 $6 = ($3>>>0)<($5>>>0);
 if ($6) {
  $7 = ((($3)) + 1|0);
  HEAP32[$2>>2] = $7;
  $8 = HEAP8[$3>>0]|0;
  $9 = $8&255;
  $11 = $9;
 } else {
  $10 = (___shgetc($0)|0);
  $11 = $10;
 }
 switch ($11|0) {
 case 43: case 45:  {
  $12 = ($11|0)==(45);
  $13 = $12&1;
  $14 = HEAP32[$2>>2]|0;
  $15 = HEAP32[$4>>2]|0;
  $16 = ($14>>>0)<($15>>>0);
  if ($16) {
   $17 = ((($14)) + 1|0);
   HEAP32[$2>>2] = $17;
   $18 = HEAP8[$14>>0]|0;
   $19 = $18&255;
   $22 = $19;
  } else {
   $20 = (___shgetc($0)|0);
   $22 = $20;
  }
  $21 = (($22) + -48)|0;
  $23 = ($21>>>0)>(9);
  $24 = ($1|0)!=(0);
  $or$cond3 = $24 & $23;
  if ($or$cond3) {
   $25 = HEAP32[$4>>2]|0;
   $26 = ($25|0)==(0|0);
   if ($26) {
    $$0 = $13;$$049 = $22;
   } else {
    $27 = HEAP32[$2>>2]|0;
    $28 = ((($27)) + -1|0);
    HEAP32[$2>>2] = $28;
    $$0 = $13;$$049 = $22;
   }
  } else {
   $$0 = $13;$$049 = $22;
  }
  break;
 }
 default: {
  $$0 = 0;$$049 = $11;
 }
 }
 $29 = (($$049) + -48)|0;
 $30 = ($29>>>0)>(9);
 if ($30) {
  $31 = HEAP32[$4>>2]|0;
  $32 = ($31|0)==(0|0);
  if ($32) {
   $100 = -2147483648;$101 = 0;
  } else {
   $33 = HEAP32[$2>>2]|0;
   $34 = ((($33)) + -1|0);
   HEAP32[$2>>2] = $34;
   $100 = -2147483648;$101 = 0;
  }
 } else {
  $$04861 = 0;$$160 = $$049;
  while(1) {
   $35 = ($$04861*10)|0;
   $36 = (($$160) + -48)|0;
   $37 = (($36) + ($35))|0;
   $38 = HEAP32[$2>>2]|0;
   $39 = HEAP32[$4>>2]|0;
   $40 = ($38>>>0)<($39>>>0);
   if ($40) {
    $41 = ((($38)) + 1|0);
    HEAP32[$2>>2] = $41;
    $42 = HEAP8[$38>>0]|0;
    $43 = $42&255;
    $$1$be = $43;
   } else {
    $44 = (___shgetc($0)|0);
    $$1$be = $44;
   }
   $45 = (($$1$be) + -48)|0;
   $46 = ($45>>>0)<(10);
   $47 = ($37|0)<(214748364);
   $48 = $46 & $47;
   if ($48) {
    $$04861 = $37;$$160 = $$1$be;
   } else {
    break;
   }
  }
  $49 = ($37|0)<(0);
  $50 = $49 << 31 >> 31;
  $51 = (($$1$be) + -48)|0;
  $52 = ($51>>>0)<(10);
  if ($52) {
   $$254 = $$1$be;$56 = $37;$57 = $50;
   while(1) {
    $58 = (___muldi3(($56|0),($57|0),10,0)|0);
    $59 = tempRet0;
    $60 = ($$254|0)<(0);
    $61 = $60 << 31 >> 31;
    $62 = (_i64Add(($$254|0),($61|0),-48,-1)|0);
    $63 = tempRet0;
    $64 = (_i64Add(($62|0),($63|0),($58|0),($59|0))|0);
    $65 = tempRet0;
    $66 = HEAP32[$2>>2]|0;
    $67 = HEAP32[$4>>2]|0;
    $68 = ($66>>>0)<($67>>>0);
    if ($68) {
     $69 = ((($66)) + 1|0);
     HEAP32[$2>>2] = $69;
     $70 = HEAP8[$66>>0]|0;
     $71 = $70&255;
     $$2$be = $71;
    } else {
     $72 = (___shgetc($0)|0);
     $$2$be = $72;
    }
    $73 = (($$2$be) + -48)|0;
    $74 = ($73>>>0)<(10);
    $75 = ($65|0)<(21474836);
    $76 = ($64>>>0)<(2061584302);
    $77 = ($65|0)==(21474836);
    $78 = $77 & $76;
    $79 = $75 | $78;
    $80 = $74 & $79;
    if ($80) {
     $$254 = $$2$be;$56 = $64;$57 = $65;
    } else {
     $$2$lcssa = $$2$be;$94 = $64;$95 = $65;
     break;
    }
   }
  } else {
   $$2$lcssa = $$1$be;$94 = $37;$95 = $50;
  }
  $53 = (($$2$lcssa) + -48)|0;
  $54 = ($53>>>0)<(10);
  $55 = HEAP32[$4>>2]|0;
  if ($54) {
   $83 = $55;
   while(1) {
    $81 = HEAP32[$2>>2]|0;
    $82 = ($81>>>0)<($83>>>0);
    if ($82) {
     $84 = ((($81)) + 1|0);
     HEAP32[$2>>2] = $84;
     $85 = HEAP8[$81>>0]|0;
     $86 = $85&255;
     $$3$be = $86;$102 = $83;
    } else {
     $87 = (___shgetc($0)|0);
     $$pre = HEAP32[$4>>2]|0;
     $$3$be = $87;$102 = $$pre;
    }
    $88 = (($$3$be) + -48)|0;
    $89 = ($88>>>0)<(10);
    if ($89) {
     $83 = $102;
    } else {
     $$lcssa = $102;
     break;
    }
   }
  } else {
   $$lcssa = $55;
  }
  $90 = ($$lcssa|0)==(0|0);
  if (!($90)) {
   $91 = HEAP32[$2>>2]|0;
   $92 = ((($91)) + -1|0);
   HEAP32[$2>>2] = $92;
  }
  $93 = ($$0|0)!=(0);
  $96 = (_i64Subtract(0,0,($94|0),($95|0))|0);
  $97 = tempRet0;
  $98 = $93 ? $96 : $94;
  $99 = $93 ? $97 : $95;
  $100 = $99;$101 = $98;
 }
 tempRet0 = ($100);
 return ($101|0);
}
function _scalbn($0,$1) {
 $0 = +$0;
 $1 = $1|0;
 var $$ = 0, $$$ = 0, $$0 = 0.0, $$020 = 0, $$1 = 0, $$1$ = 0, $$21 = 0.0, $$22 = 0.0, $10 = 0.0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0.0, $2 = 0, $20 = 0.0;
 var $3 = 0.0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ($1|0)>(1023);
 if ($2) {
  $3 = $0 * 8.9884656743115795E+307;
  $4 = (($1) + -1023)|0;
  $5 = ($4|0)>(1023);
  $6 = $3 * 8.9884656743115795E+307;
  $7 = (($1) + -2046)|0;
  $8 = ($7|0)<(1023);
  $$ = $8 ? $7 : 1023;
  $$$ = $5 ? $$ : $4;
  $$21 = $5 ? $6 : $3;
  $$0 = $$21;$$020 = $$$;
 } else {
  $9 = ($1|0)<(-1022);
  if ($9) {
   $10 = $0 * 2.2250738585072014E-308;
   $11 = (($1) + 1022)|0;
   $12 = ($11|0)<(-1022);
   $13 = $10 * 2.2250738585072014E-308;
   $14 = (($1) + 2044)|0;
   $15 = ($14|0)>(-1022);
   $$1 = $15 ? $14 : -1022;
   $$1$ = $12 ? $$1 : $11;
   $$22 = $12 ? $13 : $10;
   $$0 = $$22;$$020 = $$1$;
  } else {
   $$0 = $0;$$020 = $1;
  }
 }
 $16 = (($$020) + 1023)|0;
 $17 = (_bitshift64Shl(($16|0),0,52)|0);
 $18 = tempRet0;
 HEAP32[tempDoublePtr>>2] = $17;HEAP32[tempDoublePtr+4>>2] = $18;$19 = +HEAPF64[tempDoublePtr>>3];
 $20 = $$0 * $19;
 return (+$20);
}
function _copysignl($0,$1) {
 $0 = +$0;
 $1 = +$1;
 var $2 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = (+_copysign($0,$1));
 return (+$2);
}
function _fmodl($0,$1) {
 $0 = +$0;
 $1 = +$1;
 var $2 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = (+_fmod($0,$1));
 return (+$2);
}
function _scalbnl($0,$1) {
 $0 = +$0;
 $1 = $1|0;
 var $2 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = (+_scalbn($0,$1));
 return (+$2);
}
function _fmod($0,$1) {
 $0 = +$0;
 $1 = +$1;
 var $$ = 0.0, $$070 = 0.0, $$071$lcssa = 0, $$07194 = 0, $$073$lcssa = 0, $$073100 = 0, $$172$ph = 0, $$174 = 0, $$275$lcssa = 0, $$27586 = 0, $$376$lcssa = 0, $$37683 = 0, $$lcssa = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0.0, $104 = 0, $105 = 0;
 var $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0;
 var $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0.0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0;
 var $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0.0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0;
 var $160 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
 var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0.0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0;
 var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0;
 var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0;
 var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $or$cond = 0, label = 0, sp = 0;
 sp = STACKTOP;
 HEAPF64[tempDoublePtr>>3] = $0;$2 = HEAP32[tempDoublePtr>>2]|0;
 $3 = HEAP32[tempDoublePtr+4>>2]|0;
 HEAPF64[tempDoublePtr>>3] = $1;$4 = HEAP32[tempDoublePtr>>2]|0;
 $5 = HEAP32[tempDoublePtr+4>>2]|0;
 $6 = (_bitshift64Lshr(($2|0),($3|0),52)|0);
 $7 = tempRet0;
 $8 = $6 & 2047;
 $9 = (_bitshift64Lshr(($4|0),($5|0),52)|0);
 $10 = tempRet0;
 $11 = $9 & 2047;
 $12 = $3 & -2147483648;
 $13 = (_bitshift64Shl(($4|0),($5|0),1)|0);
 $14 = tempRet0;
 $15 = ($13|0)==(0);
 $16 = ($14|0)==(0);
 $17 = $15 & $16;
 L1: do {
  if ($17) {
   label = 3;
  } else {
   $18 = (___DOUBLE_BITS_401($1)|0);
   $19 = tempRet0;
   $20 = $19 & 2147483647;
   $21 = ($20>>>0)>(2146435072);
   $22 = ($18>>>0)>(0);
   $23 = ($20|0)==(2146435072);
   $24 = $23 & $22;
   $25 = $21 | $24;
   $26 = ($8|0)==(2047);
   $or$cond = $26 | $25;
   if ($or$cond) {
    label = 3;
   } else {
    $29 = (_bitshift64Shl(($2|0),($3|0),1)|0);
    $30 = tempRet0;
    $31 = ($30>>>0)>($14>>>0);
    $32 = ($29>>>0)>($13>>>0);
    $33 = ($30|0)==($14|0);
    $34 = $33 & $32;
    $35 = $31 | $34;
    if (!($35)) {
     $36 = ($29|0)==($13|0);
     $37 = ($30|0)==($14|0);
     $38 = $36 & $37;
     $39 = $0 * 0.0;
     $$ = $38 ? $39 : $0;
     return (+$$);
    }
    $40 = ($8|0)==(0);
    if ($40) {
     $41 = (_bitshift64Shl(($2|0),($3|0),12)|0);
     $42 = tempRet0;
     $43 = ($42|0)>(-1);
     $44 = ($41>>>0)>(4294967295);
     $45 = ($42|0)==(-1);
     $46 = $45 & $44;
     $47 = $43 | $46;
     if ($47) {
      $$073100 = 0;$49 = $41;$50 = $42;
      while(1) {
       $48 = (($$073100) + -1)|0;
       $51 = (_bitshift64Shl(($49|0),($50|0),1)|0);
       $52 = tempRet0;
       $53 = ($52|0)>(-1);
       $54 = ($51>>>0)>(4294967295);
       $55 = ($52|0)==(-1);
       $56 = $55 & $54;
       $57 = $53 | $56;
       if ($57) {
        $$073100 = $48;$49 = $51;$50 = $52;
       } else {
        $$073$lcssa = $48;
        break;
       }
      }
     } else {
      $$073$lcssa = 0;
     }
     $58 = (1 - ($$073$lcssa))|0;
     $59 = (_bitshift64Shl(($2|0),($3|0),($58|0))|0);
     $60 = tempRet0;
     $$174 = $$073$lcssa;$87 = $59;$88 = $60;
    } else {
     $61 = $3 & 1048575;
     $62 = $61 | 1048576;
     $$174 = $8;$87 = $2;$88 = $62;
    }
    $63 = ($11|0)==(0);
    if ($63) {
     $64 = (_bitshift64Shl(($4|0),($5|0),12)|0);
     $65 = tempRet0;
     $66 = ($65|0)>(-1);
     $67 = ($64>>>0)>(4294967295);
     $68 = ($65|0)==(-1);
     $69 = $68 & $67;
     $70 = $66 | $69;
     if ($70) {
      $$07194 = 0;$72 = $64;$73 = $65;
      while(1) {
       $71 = (($$07194) + -1)|0;
       $74 = (_bitshift64Shl(($72|0),($73|0),1)|0);
       $75 = tempRet0;
       $76 = ($75|0)>(-1);
       $77 = ($74>>>0)>(4294967295);
       $78 = ($75|0)==(-1);
       $79 = $78 & $77;
       $80 = $76 | $79;
       if ($80) {
        $$07194 = $71;$72 = $74;$73 = $75;
       } else {
        $$071$lcssa = $71;
        break;
       }
      }
     } else {
      $$071$lcssa = 0;
     }
     $81 = (1 - ($$071$lcssa))|0;
     $82 = (_bitshift64Shl(($4|0),($5|0),($81|0))|0);
     $83 = tempRet0;
     $$172$ph = $$071$lcssa;$89 = $82;$90 = $83;
    } else {
     $84 = $5 & 1048575;
     $85 = $84 | 1048576;
     $$172$ph = $11;$89 = $4;$90 = $85;
    }
    $86 = ($$174|0)>($$172$ph|0);
    $91 = (_i64Subtract(($87|0),($88|0),($89|0),($90|0))|0);
    $92 = tempRet0;
    $93 = ($92|0)>(-1);
    $94 = ($91>>>0)>(4294967295);
    $95 = ($92|0)==(-1);
    $96 = $95 & $94;
    $97 = $93 | $96;
    L23: do {
     if ($86) {
      $$27586 = $$174;$100 = $92;$156 = $97;$157 = $87;$158 = $88;$98 = $91;
      while(1) {
       if ($156) {
        $99 = ($98|0)==(0);
        $101 = ($100|0)==(0);
        $102 = $99 & $101;
        if ($102) {
         break;
        } else {
         $104 = $98;$105 = $100;
        }
       } else {
        $104 = $157;$105 = $158;
       }
       $106 = (_bitshift64Shl(($104|0),($105|0),1)|0);
       $107 = tempRet0;
       $108 = (($$27586) + -1)|0;
       $109 = ($108|0)>($$172$ph|0);
       $110 = (_i64Subtract(($106|0),($107|0),($89|0),($90|0))|0);
       $111 = tempRet0;
       $112 = ($111|0)>(-1);
       $113 = ($110>>>0)>(4294967295);
       $114 = ($111|0)==(-1);
       $115 = $114 & $113;
       $116 = $112 | $115;
       if ($109) {
        $$27586 = $108;$100 = $111;$156 = $116;$157 = $106;$158 = $107;$98 = $110;
       } else {
        $$275$lcssa = $108;$$lcssa = $116;$117 = $110;$119 = $111;$159 = $106;$160 = $107;
        break L23;
       }
      }
      $103 = $0 * 0.0;
      $$070 = $103;
      break L1;
     } else {
      $$275$lcssa = $$174;$$lcssa = $97;$117 = $91;$119 = $92;$159 = $87;$160 = $88;
     }
    } while(0);
    if ($$lcssa) {
     $118 = ($117|0)==(0);
     $120 = ($119|0)==(0);
     $121 = $118 & $120;
     if ($121) {
      $129 = $0 * 0.0;
      $$070 = $129;
      break;
     } else {
      $122 = $119;$124 = $117;
     }
    } else {
     $122 = $160;$124 = $159;
    }
    $123 = ($122>>>0)<(1048576);
    $125 = ($124>>>0)<(0);
    $126 = ($122|0)==(1048576);
    $127 = $126 & $125;
    $128 = $123 | $127;
    if ($128) {
     $$37683 = $$275$lcssa;$130 = $124;$131 = $122;
     while(1) {
      $132 = (_bitshift64Shl(($130|0),($131|0),1)|0);
      $133 = tempRet0;
      $134 = (($$37683) + -1)|0;
      $135 = ($133>>>0)<(1048576);
      $136 = ($132>>>0)<(0);
      $137 = ($133|0)==(1048576);
      $138 = $137 & $136;
      $139 = $135 | $138;
      if ($139) {
       $$37683 = $134;$130 = $132;$131 = $133;
      } else {
       $$376$lcssa = $134;$141 = $132;$142 = $133;
       break;
      }
     }
    } else {
     $$376$lcssa = $$275$lcssa;$141 = $124;$142 = $122;
    }
    $140 = ($$376$lcssa|0)>(0);
    if ($140) {
     $143 = (_i64Add(($141|0),($142|0),0,-1048576)|0);
     $144 = tempRet0;
     $145 = (_bitshift64Shl(($$376$lcssa|0),0,52)|0);
     $146 = tempRet0;
     $147 = $143 | $145;
     $148 = $144 | $146;
     $153 = $148;$155 = $147;
    } else {
     $149 = (1 - ($$376$lcssa))|0;
     $150 = (_bitshift64Lshr(($141|0),($142|0),($149|0))|0);
     $151 = tempRet0;
     $153 = $151;$155 = $150;
    }
    $152 = $153 | $12;
    HEAP32[tempDoublePtr>>2] = $155;HEAP32[tempDoublePtr+4>>2] = $152;$154 = +HEAPF64[tempDoublePtr>>3];
    $$070 = $154;
   }
  }
 } while(0);
 if ((label|0) == 3) {
  $27 = $0 * $1;
  $28 = $27 / $27;
  $$070 = $28;
 }
 return (+$$070);
}
function ___DOUBLE_BITS_401($0) {
 $0 = +$0;
 var $1 = 0, $2 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 HEAPF64[tempDoublePtr>>3] = $0;$1 = HEAP32[tempDoublePtr>>2]|0;
 $2 = HEAP32[tempDoublePtr+4>>2]|0;
 tempRet0 = ($2);
 return ($1|0);
}
function _copysign($0,$1) {
 $0 = +$0;
 $1 = +$1;
 var $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0.0, label = 0, sp = 0;
 sp = STACKTOP;
 HEAPF64[tempDoublePtr>>3] = $0;$2 = HEAP32[tempDoublePtr>>2]|0;
 $3 = HEAP32[tempDoublePtr+4>>2]|0;
 HEAPF64[tempDoublePtr>>3] = $1;$4 = HEAP32[tempDoublePtr>>2]|0;
 $5 = HEAP32[tempDoublePtr+4>>2]|0;
 $6 = $3 & 2147483647;
 $7 = $5 & -2147483648;
 $8 = $7 | $6;
 HEAP32[tempDoublePtr>>2] = $2;HEAP32[tempDoublePtr+4>>2] = $8;$9 = +HEAPF64[tempDoublePtr>>3];
 return (+$9);
}
function ___pthread_self_566() {
 var $0 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = (_pthread_self()|0);
 return ($0|0);
}
function ___ofl_add($0) {
 $0 = $0|0;
 var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = (___ofl_lock()|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = ((($0)) + 56|0);
 HEAP32[$3>>2] = $2;
 $4 = HEAP32[$1>>2]|0;
 $5 = ($4|0)==(0|0);
 if (!($5)) {
  $6 = ((($4)) + 52|0);
  HEAP32[$6>>2] = $0;
 }
 HEAP32[$1>>2] = $0;
 ___ofl_unlock();
 return ($0|0);
}
function ___ofl_lock() {
 var label = 0, sp = 0;
 sp = STACKTOP;
 ___lock((6172|0));
 return (6180|0);
}
function ___ofl_unlock() {
 var label = 0, sp = 0;
 sp = STACKTOP;
 ___unlock((6172|0));
 return;
}
function _fclose($0) {
 $0 = $0|0;
 var $$pre = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
 var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 76|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = ($2|0)>(-1);
 if ($3) {
  $4 = (___lockfile($0)|0);
  $28 = $4;
 } else {
  $28 = 0;
 }
 ___unlist_locked_file($0);
 $5 = HEAP32[$0>>2]|0;
 $6 = $5 & 1;
 $7 = ($6|0)!=(0);
 if (!($7)) {
  $8 = (___ofl_lock()|0);
  $9 = ((($0)) + 52|0);
  $10 = HEAP32[$9>>2]|0;
  $11 = ($10|0)==(0|0);
  $12 = $10;
  $$pre = ((($0)) + 56|0);
  if (!($11)) {
   $13 = HEAP32[$$pre>>2]|0;
   $14 = ((($10)) + 56|0);
   HEAP32[$14>>2] = $13;
  }
  $15 = HEAP32[$$pre>>2]|0;
  $16 = ($15|0)==(0|0);
  if (!($16)) {
   $17 = ((($15)) + 52|0);
   HEAP32[$17>>2] = $12;
  }
  $18 = HEAP32[$8>>2]|0;
  $19 = ($18|0)==($0|0);
  if ($19) {
   HEAP32[$8>>2] = $15;
  }
  ___ofl_unlock();
 }
 $20 = (_fflush($0)|0);
 $21 = ((($0)) + 12|0);
 $22 = HEAP32[$21>>2]|0;
 $23 = (FUNCTION_TABLE_ii[$22 & 1]($0)|0);
 $24 = $23 | $20;
 $25 = ((($0)) + 92|0);
 $26 = HEAP32[$25>>2]|0;
 $27 = ($26|0)==(0|0);
 if (!($27)) {
  _free($26);
 }
 if ($7) {
  $29 = ($28|0)==(0);
  if (!($29)) {
   ___unlockfile($0);
  }
 } else {
  _free($0);
 }
 return ($24|0);
}
function ___unlist_locked_file($0) {
 $0 = $0|0;
 var $$pre = 0, $$sink = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 68|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = ($2|0)==(0);
 if (!($3)) {
  $4 = ((($0)) + 116|0);
  $5 = HEAP32[$4>>2]|0;
  $6 = ($5|0)==(0|0);
  $$pre = ((($0)) + 112|0);
  if (!($6)) {
   $7 = HEAP32[$$pre>>2]|0;
   $8 = ((($5)) + 112|0);
   HEAP32[$8>>2] = $7;
  }
  $9 = HEAP32[$$pre>>2]|0;
  $10 = ($9|0)==(0|0);
  if ($10) {
   $12 = (___pthread_self_123()|0);
   $13 = ((($12)) + 232|0);
   $$sink = $13;
  } else {
   $11 = ((($9)) + 116|0);
   $$sink = $11;
  }
  HEAP32[$$sink>>2] = $5;
 }
 return;
}
function _fflush($0) {
 $0 = $0|0;
 var $$0 = 0, $$023 = 0, $$02325 = 0, $$02327 = 0, $$024$lcssa = 0, $$02426 = 0, $$1 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
 var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ($0|0)==(0|0);
 do {
  if ($1) {
   $8 = HEAP32[111]|0;
   $9 = ($8|0)==(0|0);
   if ($9) {
    $29 = 0;
   } else {
    $10 = HEAP32[111]|0;
    $11 = (_fflush($10)|0);
    $29 = $11;
   }
   $12 = (___ofl_lock()|0);
   $$02325 = HEAP32[$12>>2]|0;
   $13 = ($$02325|0)==(0|0);
   if ($13) {
    $$024$lcssa = $29;
   } else {
    $$02327 = $$02325;$$02426 = $29;
    while(1) {
     $14 = ((($$02327)) + 76|0);
     $15 = HEAP32[$14>>2]|0;
     $16 = ($15|0)>(-1);
     if ($16) {
      $17 = (___lockfile($$02327)|0);
      $25 = $17;
     } else {
      $25 = 0;
     }
     $18 = ((($$02327)) + 20|0);
     $19 = HEAP32[$18>>2]|0;
     $20 = ((($$02327)) + 28|0);
     $21 = HEAP32[$20>>2]|0;
     $22 = ($19>>>0)>($21>>>0);
     if ($22) {
      $23 = (___fflush_unlocked($$02327)|0);
      $24 = $23 | $$02426;
      $$1 = $24;
     } else {
      $$1 = $$02426;
     }
     $26 = ($25|0)==(0);
     if (!($26)) {
      ___unlockfile($$02327);
     }
     $27 = ((($$02327)) + 56|0);
     $$023 = HEAP32[$27>>2]|0;
     $28 = ($$023|0)==(0|0);
     if ($28) {
      $$024$lcssa = $$1;
      break;
     } else {
      $$02327 = $$023;$$02426 = $$1;
     }
    }
   }
   ___ofl_unlock();
   $$0 = $$024$lcssa;
  } else {
   $2 = ((($0)) + 76|0);
   $3 = HEAP32[$2>>2]|0;
   $4 = ($3|0)>(-1);
   if (!($4)) {
    $5 = (___fflush_unlocked($0)|0);
    $$0 = $5;
    break;
   }
   $6 = (___lockfile($0)|0);
   $phitmp = ($6|0)==(0);
   $7 = (___fflush_unlocked($0)|0);
   if ($phitmp) {
    $$0 = $7;
   } else {
    ___unlockfile($0);
    $$0 = $7;
   }
  }
 } while(0);
 return ($$0|0);
}
function ___fflush_unlocked($0) {
 $0 = $0|0;
 var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
 var $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = ((($0)) + 20|0);
 $2 = HEAP32[$1>>2]|0;
 $3 = ((($0)) + 28|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = ($2>>>0)>($4>>>0);
 if ($5) {
  $6 = ((($0)) + 36|0);
  $7 = HEAP32[$6>>2]|0;
  (FUNCTION_TABLE_iiii[$7 & 7]($0,0,0)|0);
  $8 = HEAP32[$1>>2]|0;
  $9 = ($8|0)==(0|0);
  if ($9) {
   $$0 = -1;
  } else {
   label = 3;
  }
 } else {
  label = 3;
 }
 if ((label|0) == 3) {
  $10 = ((($0)) + 4|0);
  $11 = HEAP32[$10>>2]|0;
  $12 = ((($0)) + 8|0);
  $13 = HEAP32[$12>>2]|0;
  $14 = ($11>>>0)<($13>>>0);
  if ($14) {
   $15 = $11;
   $16 = $13;
   $17 = (($15) - ($16))|0;
   $18 = ((($0)) + 40|0);
   $19 = HEAP32[$18>>2]|0;
   (FUNCTION_TABLE_iiii[$19 & 7]($0,$17,1)|0);
  }
  $20 = ((($0)) + 16|0);
  HEAP32[$20>>2] = 0;
  HEAP32[$3>>2] = 0;
  HEAP32[$1>>2] = 0;
  HEAP32[$12>>2] = 0;
  HEAP32[$10>>2] = 0;
  $$0 = 0;
 }
 return ($$0|0);
}
function ___pthread_self_123() {
 var $0 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $0 = (_pthread_self()|0);
 return ($0|0);
}
function _fprintf($0,$1,$varargs) {
 $0 = $0|0;
 $1 = $1|0;
 $varargs = $varargs|0;
 var $2 = 0, $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $2 = sp;
 HEAP32[$2>>2] = $varargs;
 $3 = (_vfprintf($0,$1,$2)|0);
 STACKTOP = sp;return ($3|0);
}
function _fputc($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
 var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $2 = ((($1)) + 76|0);
 $3 = HEAP32[$2>>2]|0;
 $4 = ($3|0)<(0);
 $5 = $0&255;
 $6 = $0 & 255;
 if ($4) {
  label = 3;
 } else {
  $7 = (___lockfile($1)|0);
  $8 = ($7|0)==(0);
  if ($8) {
   label = 3;
  } else {
   $20 = ((($1)) + 75|0);
   $21 = HEAP8[$20>>0]|0;
   $22 = $21 << 24 >> 24;
   $23 = ($6|0)==($22|0);
   if ($23) {
    label = 10;
   } else {
    $24 = ((($1)) + 20|0);
    $25 = HEAP32[$24>>2]|0;
    $26 = ((($1)) + 16|0);
    $27 = HEAP32[$26>>2]|0;
    $28 = ($25>>>0)<($27>>>0);
    if ($28) {
     $29 = ((($25)) + 1|0);
     HEAP32[$24>>2] = $29;
     HEAP8[$25>>0] = $5;
     $31 = $6;
    } else {
     label = 10;
    }
   }
   if ((label|0) == 10) {
    $30 = (___overflow($1,$0)|0);
    $31 = $30;
   }
   ___unlockfile($1);
   $$0 = $31;
  }
 }
 do {
  if ((label|0) == 3) {
   $9 = ((($1)) + 75|0);
   $10 = HEAP8[$9>>0]|0;
   $11 = $10 << 24 >> 24;
   $12 = ($6|0)==($11|0);
   if (!($12)) {
    $13 = ((($1)) + 20|0);
    $14 = HEAP32[$13>>2]|0;
    $15 = ((($1)) + 16|0);
    $16 = HEAP32[$15>>2]|0;
    $17 = ($14>>>0)<($16>>>0);
    if ($17) {
     $18 = ((($14)) + 1|0);
     HEAP32[$13>>2] = $18;
     HEAP8[$14>>0] = $5;
     $$0 = $6;
     break;
    }
   }
   $19 = (___overflow($1,$0)|0);
   $$0 = $19;
  }
 } while(0);
 return ($$0|0);
}
function ___fdopen($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $$pre = 0, $$pre31 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
 var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $5 = 0, $6 = 0;
 var $7 = 0, $8 = 0, $9 = 0, $memchr = 0, $vararg_buffer = 0, $vararg_buffer12 = 0, $vararg_buffer3 = 0, $vararg_buffer7 = 0, $vararg_ptr1 = 0, $vararg_ptr10 = 0, $vararg_ptr11 = 0, $vararg_ptr15 = 0, $vararg_ptr16 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, dest = 0, label = 0, sp = 0, stop = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
 $vararg_buffer12 = sp + 40|0;
 $vararg_buffer7 = sp + 24|0;
 $vararg_buffer3 = sp + 16|0;
 $vararg_buffer = sp;
 $2 = sp + 56|0;
 $3 = HEAP8[$1>>0]|0;
 $4 = $3 << 24 >> 24;
 $memchr = (_memchr(5550,$4,4)|0);
 $5 = ($memchr|0)==(0|0);
 if ($5) {
  $6 = (___errno_location()|0);
  HEAP32[$6>>2] = 22;
  $$0 = 0;
 } else {
  $7 = (_malloc(1156)|0);
  $8 = ($7|0)==(0|0);
  if ($8) {
   $$0 = 0;
  } else {
   dest=$7; stop=dest+124|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
   $9 = (_strchr($1,43)|0);
   $10 = ($9|0)==(0|0);
   if ($10) {
    $11 = ($3<<24>>24)==(114);
    $12 = $11 ? 8 : 4;
    HEAP32[$7>>2] = $12;
   }
   $13 = (_strchr($1,101)|0);
   $14 = ($13|0)==(0|0);
   if ($14) {
    $15 = $3;
   } else {
    HEAP32[$vararg_buffer>>2] = $0;
    $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
    HEAP32[$vararg_ptr1>>2] = 2;
    $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
    HEAP32[$vararg_ptr2>>2] = 1;
    (___syscall221(221,($vararg_buffer|0))|0);
    $$pre = HEAP8[$1>>0]|0;
    $15 = $$pre;
   }
   $16 = ($15<<24>>24)==(97);
   if ($16) {
    HEAP32[$vararg_buffer3>>2] = $0;
    $vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
    HEAP32[$vararg_ptr6>>2] = 3;
    $17 = (___syscall221(221,($vararg_buffer3|0))|0);
    $18 = $17 & 1024;
    $19 = ($18|0)==(0);
    if ($19) {
     $20 = $17 | 1024;
     HEAP32[$vararg_buffer7>>2] = $0;
     $vararg_ptr10 = ((($vararg_buffer7)) + 4|0);
     HEAP32[$vararg_ptr10>>2] = 4;
     $vararg_ptr11 = ((($vararg_buffer7)) + 8|0);
     HEAP32[$vararg_ptr11>>2] = $20;
     (___syscall221(221,($vararg_buffer7|0))|0);
    }
    $21 = HEAP32[$7>>2]|0;
    $22 = $21 | 128;
    HEAP32[$7>>2] = $22;
    $29 = $22;
   } else {
    $$pre31 = HEAP32[$7>>2]|0;
    $29 = $$pre31;
   }
   $23 = ((($7)) + 60|0);
   HEAP32[$23>>2] = $0;
   $24 = ((($7)) + 132|0);
   $25 = ((($7)) + 44|0);
   HEAP32[$25>>2] = $24;
   $26 = ((($7)) + 48|0);
   HEAP32[$26>>2] = 1024;
   $27 = ((($7)) + 75|0);
   HEAP8[$27>>0] = -1;
   $28 = $29 & 8;
   $30 = ($28|0)==(0);
   if ($30) {
    $31 = $2;
    HEAP32[$vararg_buffer12>>2] = $0;
    $vararg_ptr15 = ((($vararg_buffer12)) + 4|0);
    HEAP32[$vararg_ptr15>>2] = 21523;
    $vararg_ptr16 = ((($vararg_buffer12)) + 8|0);
    HEAP32[$vararg_ptr16>>2] = $31;
    $32 = (___syscall54(54,($vararg_buffer12|0))|0);
    $33 = ($32|0)==(0);
    if ($33) {
     HEAP8[$27>>0] = 10;
    }
   }
   $34 = ((($7)) + 32|0);
   HEAP32[$34>>2] = 4;
   $35 = ((($7)) + 36|0);
   HEAP32[$35>>2] = 5;
   $36 = ((($7)) + 40|0);
   HEAP32[$36>>2] = 3;
   $37 = ((($7)) + 12|0);
   HEAP32[$37>>2] = 1;
   $38 = HEAP32[(6108)>>2]|0;
   $39 = ($38|0)==(0);
   if ($39) {
    $40 = ((($7)) + 76|0);
    HEAP32[$40>>2] = -1;
   }
   $41 = (___ofl_add($7)|0);
   $$0 = $7;
  }
 }
 STACKTOP = sp;return ($$0|0);
}
function _fwrite($0,$1,$2,$3) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 var $$ = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $4 = Math_imul($2, $1)|0;
 $5 = ($1|0)==(0);
 $$ = $5 ? 0 : $2;
 $6 = ((($3)) + 76|0);
 $7 = HEAP32[$6>>2]|0;
 $8 = ($7|0)>(-1);
 if ($8) {
  $10 = (___lockfile($3)|0);
  $phitmp = ($10|0)==(0);
  $11 = (___fwritex($0,$4,$3)|0);
  if ($phitmp) {
   $12 = $11;
  } else {
   ___unlockfile($3);
   $12 = $11;
  }
 } else {
  $9 = (___fwritex($0,$4,$3)|0);
  $12 = $9;
 }
 $13 = ($12|0)==($4|0);
 if ($13) {
  $15 = $$;
 } else {
  $14 = (($12>>>0) / ($1>>>0))&-1;
  $15 = $14;
 }
 return ($15|0);
}
function _fopen($0,$1) {
 $0 = $0|0;
 $1 = $1|0;
 var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $memchr = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_buffer8 = 0, $vararg_ptr1 = 0;
 var $vararg_ptr2 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(48|0);
 $vararg_buffer8 = sp + 32|0;
 $vararg_buffer3 = sp + 16|0;
 $vararg_buffer = sp;
 $2 = HEAP8[$1>>0]|0;
 $3 = $2 << 24 >> 24;
 $memchr = (_memchr(5550,$3,4)|0);
 $4 = ($memchr|0)==(0|0);
 if ($4) {
  $5 = (___errno_location()|0);
  HEAP32[$5>>2] = 22;
  $$0 = 0;
 } else {
  $6 = (___fmodeflags($1)|0);
  $7 = $0;
  $8 = $6 | 32768;
  HEAP32[$vararg_buffer>>2] = $7;
  $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
  HEAP32[$vararg_ptr1>>2] = $8;
  $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
  HEAP32[$vararg_ptr2>>2] = 438;
  $9 = (___syscall5(5,($vararg_buffer|0))|0);
  $10 = (___syscall_ret($9)|0);
  $11 = ($10|0)<(0);
  if ($11) {
   $$0 = 0;
  } else {
   $12 = $6 & 524288;
   $13 = ($12|0)==(0);
   if (!($13)) {
    HEAP32[$vararg_buffer3>>2] = $10;
    $vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
    HEAP32[$vararg_ptr6>>2] = 2;
    $vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
    HEAP32[$vararg_ptr7>>2] = 1;
    (___syscall221(221,($vararg_buffer3|0))|0);
   }
   $14 = (___fdopen($10,$1)|0);
   $15 = ($14|0)==(0|0);
   if ($15) {
    HEAP32[$vararg_buffer8>>2] = $10;
    (___syscall6(6,($vararg_buffer8|0))|0);
    $$0 = 0;
   } else {
    $$0 = $14;
   }
  }
 }
 STACKTOP = sp;return ($$0|0);
}
function ___fmodeflags($0) {
 $0 = $0|0;
 var $$ = 0, $$$4 = 0, $$0 = 0, $$0$ = 0, $$2 = 0, $$2$ = 0, $$4 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0;
 var $8 = 0, $9 = 0, $not$ = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = (_strchr($0,43)|0);
 $2 = ($1|0)==(0|0);
 $3 = HEAP8[$0>>0]|0;
 $not$ = ($3<<24>>24)!=(114);
 $$ = $not$&1;
 $$0 = $2 ? $$ : 2;
 $4 = (_strchr($0,120)|0);
 $5 = ($4|0)==(0|0);
 $6 = $$0 | 128;
 $$0$ = $5 ? $$0 : $6;
 $7 = (_strchr($0,101)|0);
 $8 = ($7|0)==(0|0);
 $9 = $$0$ | 524288;
 $$2 = $8 ? $$0$ : $9;
 $10 = ($3<<24>>24)==(114);
 $11 = $$2 | 64;
 $$2$ = $10 ? $$2 : $11;
 $12 = ($3<<24>>24)==(119);
 $13 = $$2$ | 512;
 $$4 = $12 ? $13 : $$2$;
 $14 = ($3<<24>>24)==(97);
 $15 = $$4 | 1024;
 $$$4 = $14 ? $15 : $$4;
 return ($$$4|0);
}
function _perror($0) {
 $0 = $0|0;
 var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $1 = HEAP32[144]|0;
 $2 = (___errno_location()|0);
 $3 = HEAP32[$2>>2]|0;
 $4 = (_strerror($3)|0);
 $5 = ((($1)) + 76|0);
 $6 = HEAP32[$5>>2]|0;
 $7 = ($6|0)>(-1);
 if ($7) {
  $8 = (___lockfile($1)|0);
  $14 = $8;
 } else {
  $14 = 0;
 }
 $9 = ($0|0)==(0|0);
 if (!($9)) {
  $10 = HEAP8[$0>>0]|0;
  $11 = ($10<<24>>24)==(0);
  if (!($11)) {
   $12 = (_strlen($0)|0);
   (_fwrite($0,$12,1,$1)|0);
   (_fputc(58,$1)|0);
   (_fputc(32,$1)|0);
  }
 }
 $13 = (_strlen($4)|0);
 (_fwrite($4,$13,1,$1)|0);
 (_fputc(10,$1)|0);
 $15 = ($14|0)==(0);
 if (!($15)) {
  ___unlockfile($1);
 }
 return;
}
function _fgets($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $$0 = 0, $$06266 = 0, $$063 = 0, $$064 = 0, $$1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
 var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
 var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond3 = 0;
 var $sext$mask = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $3 = ((($2)) + 76|0);
 $4 = HEAP32[$3>>2]|0;
 $5 = ($4|0)>(-1);
 if ($5) {
  $6 = (___lockfile($2)|0);
  $16 = $6;
 } else {
  $16 = 0;
 }
 $7 = (($1) + -1)|0;
 $8 = ($1|0)<(2);
 $9 = ($7|0)!=(0);
 if ($8) {
  $10 = ((($2)) + 74|0);
  $11 = HEAP8[$10>>0]|0;
  $12 = $11 << 24 >> 24;
  $13 = (($12) + 255)|0;
  $14 = $13 | $12;
  $15 = $14&255;
  HEAP8[$10>>0] = $15;
  $17 = ($16|0)==(0);
  if (!($17)) {
   ___unlockfile($2);
  }
  if ($9) {
   $$0 = 0;
  } else {
   HEAP8[$0>>0] = 0;
   $$0 = $0;
  }
 } else {
  L11: do {
   if ($9) {
    $18 = ((($2)) + 4|0);
    $19 = ((($2)) + 8|0);
    $$063 = $7;$$064 = $0;
    while(1) {
     $20 = HEAP32[$18>>2]|0;
     $21 = HEAP32[$19>>2]|0;
     $22 = $20;
     $23 = (($21) - ($22))|0;
     $24 = (_memchr($20,10,$23)|0);
     $25 = ($24|0)==(0|0);
     $26 = $24;
     $27 = (1 - ($22))|0;
     $28 = (($27) + ($26))|0;
     $29 = $25 ? $23 : $28;
     $30 = ($29>>>0)<($$063>>>0);
     $31 = $30 ? $29 : $$063;
     _memcpy(($$064|0),($20|0),($31|0))|0;
     $32 = HEAP32[$18>>2]|0;
     $33 = (($32) + ($31)|0);
     HEAP32[$18>>2] = $33;
     $34 = (($$064) + ($31)|0);
     $35 = (($$063) - ($31))|0;
     $36 = ($35|0)!=(0);
     $or$cond = $25 & $36;
     if (!($or$cond)) {
      $$1 = $34;
      label = 17;
      break L11;
     }
     $37 = HEAP32[$19>>2]|0;
     $38 = ($33>>>0)<($37>>>0);
     if ($38) {
      $39 = ((($33)) + 1|0);
      HEAP32[$18>>2] = $39;
      $40 = HEAP8[$33>>0]|0;
      $41 = $40&255;
      $50 = $41;
     } else {
      $42 = (___uflow($2)|0);
      $43 = ($42|0)<(0);
      if ($43) {
       break;
      } else {
       $50 = $42;
      }
     }
     $48 = (($35) + -1)|0;
     $49 = $50&255;
     $51 = ((($34)) + 1|0);
     HEAP8[$34>>0] = $49;
     $sext$mask = $50 & 255;
     $52 = ($sext$mask|0)!=(10);
     $53 = ($48|0)!=(0);
     $or$cond3 = $53 & $52;
     if ($or$cond3) {
      $$063 = $48;$$064 = $51;
     } else {
      $$1 = $51;
      label = 17;
      break L11;
     }
    }
    $44 = ($34|0)==($0|0);
    if ($44) {
     $$06266 = 0;
    } else {
     $45 = HEAP32[$2>>2]|0;
     $46 = $45 & 16;
     $47 = ($46|0)==(0);
     if ($47) {
      $$06266 = 0;
     } else {
      $$1 = $34;
      label = 17;
     }
    }
   } else {
    $$1 = $0;
    label = 17;
   }
  } while(0);
  if ((label|0) == 17) {
   $54 = ($0|0)==(0|0);
   if ($54) {
    $$06266 = 0;
   } else {
    HEAP8[$$1>>0] = 0;
    $$06266 = $0;
   }
  }
  $55 = ($16|0)==(0);
  if ($55) {
   $$0 = $$06266;
  } else {
   ___unlockfile($2);
   $$0 = $$06266;
  }
 }
 return ($$0|0);
}
function _printf($0,$varargs) {
 $0 = $0|0;
 $varargs = $varargs|0;
 var $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $1 = sp;
 HEAP32[$1>>2] = $varargs;
 $2 = HEAP32[18]|0;
 $3 = (_vfprintf($2,$0,$1)|0);
 STACKTOP = sp;return ($3|0);
}
function _write($0,$1,$2) {
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 var $3 = 0, $4 = 0, $5 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
 $vararg_buffer = sp;
 $3 = $1;
 HEAP32[$vararg_buffer>>2] = $0;
 $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
 HEAP32[$vararg_ptr1>>2] = $3;
 $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
 HEAP32[$vararg_ptr2>>2] = $2;
 $4 = (___syscall4(4,($vararg_buffer|0))|0);
 $5 = (___syscall_ret($4)|0);
 STACKTOP = sp;return ($5|0);
}
function _atoi($0) {
 $0 = $0|0;
 var $$0 = 0, $$010$lcssa = 0, $$01016 = 0, $$011 = 0, $$1$ph = 0, $$112$ph = 0, $$11215 = 0, $$pre = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0;
 var $7 = 0, $8 = 0, $9 = 0, $isdigit = 0, $isdigit14 = 0, $isdigittmp = 0, $isdigittmp13 = 0, $isdigittmp17 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 $$011 = $0;
 while(1) {
  $1 = HEAP8[$$011>>0]|0;
  $2 = $1 << 24 >> 24;
  $3 = (_isspace($2)|0);
  $4 = ($3|0)==(0);
  $5 = ((($$011)) + 1|0);
  if ($4) {
   break;
  } else {
   $$011 = $5;
  }
 }
 switch ($2|0) {
 case 45:  {
  $$0 = 1;
  label = 5;
  break;
 }
 case 43:  {
  $$0 = 0;
  label = 5;
  break;
 }
 default: {
  $$1$ph = 0;$$112$ph = $$011;$7 = $1;
 }
 }
 if ((label|0) == 5) {
  $$pre = HEAP8[$5>>0]|0;
  $$1$ph = $$0;$$112$ph = $5;$7 = $$pre;
 }
 $6 = $7 << 24 >> 24;
 $isdigittmp13 = (($6) + -48)|0;
 $isdigit14 = ($isdigittmp13>>>0)<(10);
 if ($isdigit14) {
  $$01016 = 0;$$11215 = $$112$ph;$isdigittmp17 = $isdigittmp13;
  while(1) {
   $8 = ($$01016*10)|0;
   $9 = ((($$11215)) + 1|0);
   $10 = (($8) - ($isdigittmp17))|0;
   $11 = HEAP8[$9>>0]|0;
   $12 = $11 << 24 >> 24;
   $isdigittmp = (($12) + -48)|0;
   $isdigit = ($isdigittmp>>>0)<(10);
   if ($isdigit) {
    $$01016 = $10;$$11215 = $9;$isdigittmp17 = $isdigittmp;
   } else {
    $$010$lcssa = $10;
    break;
   }
  }
 } else {
  $$010$lcssa = 0;
 }
 $13 = ($$1$ph|0)!=(0);
 $14 = (0 - ($$010$lcssa))|0;
 $15 = $13 ? $$010$lcssa : $14;
 return ($15|0);
}
function runPostSets() {
}
function _i64Subtract(a, b, c, d) {
    a = a|0; b = b|0; c = c|0; d = d|0;
    var l = 0, h = 0;
    l = (a - c)>>>0;
    h = (b - d)>>>0;
    h = (b - d - (((c>>>0) > (a>>>0))|0))>>>0; // Borrow one from high word to low word on underflow.
    return ((tempRet0 = h,l|0)|0);
}
function _i64Add(a, b, c, d) {
    /*
      x = a + b*2^32
      y = c + d*2^32
      result = l + h*2^32
    */
    a = a|0; b = b|0; c = c|0; d = d|0;
    var l = 0, h = 0;
    l = (a + c)>>>0;
    h = (b + d + (((l>>>0) < (a>>>0))|0))>>>0; // Add carry from low word to high word on overflow.
    return ((tempRet0 = h,l|0)|0);
}
function _memset(ptr, value, num) {
    ptr = ptr|0; value = value|0; num = num|0;
    var end = 0, aligned_end = 0, block_aligned_end = 0, value4 = 0;
    end = (ptr + num)|0;

    value = value & 0xff;
    if ((num|0) >= 67 /* 64 bytes for an unrolled loop + 3 bytes for unaligned head*/) {
      while ((ptr&3) != 0) {
        HEAP8[((ptr)>>0)]=value;
        ptr = (ptr+1)|0;
      }

      aligned_end = (end & -4)|0;
      block_aligned_end = (aligned_end - 64)|0;
      value4 = value | (value << 8) | (value << 16) | (value << 24);

      while((ptr|0) <= (block_aligned_end|0)) {
        HEAP32[((ptr)>>2)]=value4;
        HEAP32[(((ptr)+(4))>>2)]=value4;
        HEAP32[(((ptr)+(8))>>2)]=value4;
        HEAP32[(((ptr)+(12))>>2)]=value4;
        HEAP32[(((ptr)+(16))>>2)]=value4;
        HEAP32[(((ptr)+(20))>>2)]=value4;
        HEAP32[(((ptr)+(24))>>2)]=value4;
        HEAP32[(((ptr)+(28))>>2)]=value4;
        HEAP32[(((ptr)+(32))>>2)]=value4;
        HEAP32[(((ptr)+(36))>>2)]=value4;
        HEAP32[(((ptr)+(40))>>2)]=value4;
        HEAP32[(((ptr)+(44))>>2)]=value4;
        HEAP32[(((ptr)+(48))>>2)]=value4;
        HEAP32[(((ptr)+(52))>>2)]=value4;
        HEAP32[(((ptr)+(56))>>2)]=value4;
        HEAP32[(((ptr)+(60))>>2)]=value4;
        ptr = (ptr + 64)|0;
      }

      while ((ptr|0) < (aligned_end|0) ) {
        HEAP32[((ptr)>>2)]=value4;
        ptr = (ptr+4)|0;
      }
    }
    // The remaining bytes.
    while ((ptr|0) < (end|0)) {
      HEAP8[((ptr)>>0)]=value;
      ptr = (ptr+1)|0;
    }
    return (end-num)|0;
}
function _bitshift64Lshr(low, high, bits) {
    low = low|0; high = high|0; bits = bits|0;
    var ander = 0;
    if ((bits|0) < 32) {
      ander = ((1 << bits) - 1)|0;
      tempRet0 = high >>> bits;
      return (low >>> bits) | ((high&ander) << (32 - bits));
    }
    tempRet0 = 0;
    return (high >>> (bits - 32))|0;
}
function _bitshift64Shl(low, high, bits) {
    low = low|0; high = high|0; bits = bits|0;
    var ander = 0;
    if ((bits|0) < 32) {
      ander = ((1 << bits) - 1)|0;
      tempRet0 = (high << bits) | ((low&(ander << (32 - bits))) >>> (32 - bits));
      return low << bits;
    }
    tempRet0 = low << (bits - 32);
    return 0;
}
function _llvm_cttz_i32(x) {
    x = x|0;
    var ret = 0;
    ret = ((HEAP8[(((cttz_i8)+(x & 0xff))>>0)])|0);
    if ((ret|0) < 8) return ret|0;
    ret = ((HEAP8[(((cttz_i8)+((x >> 8)&0xff))>>0)])|0);
    if ((ret|0) < 8) return (ret + 8)|0;
    ret = ((HEAP8[(((cttz_i8)+((x >> 16)&0xff))>>0)])|0);
    if ((ret|0) < 8) return (ret + 16)|0;
    return (((HEAP8[(((cttz_i8)+(x >>> 24))>>0)])|0) + 24)|0;
}
function ___udivmoddi4($a$0, $a$1, $b$0, $b$1, $rem) {
    $a$0 = $a$0 | 0;
    $a$1 = $a$1 | 0;
    $b$0 = $b$0 | 0;
    $b$1 = $b$1 | 0;
    $rem = $rem | 0;
    var $n_sroa_0_0_extract_trunc = 0, $n_sroa_1_4_extract_shift$0 = 0, $n_sroa_1_4_extract_trunc = 0, $d_sroa_0_0_extract_trunc = 0, $d_sroa_1_4_extract_shift$0 = 0, $d_sroa_1_4_extract_trunc = 0, $4 = 0, $17 = 0, $37 = 0, $49 = 0, $51 = 0, $57 = 0, $58 = 0, $66 = 0, $78 = 0, $86 = 0, $88 = 0, $89 = 0, $91 = 0, $92 = 0, $95 = 0, $105 = 0, $117 = 0, $119 = 0, $125 = 0, $126 = 0, $130 = 0, $q_sroa_1_1_ph = 0, $q_sroa_0_1_ph = 0, $r_sroa_1_1_ph = 0, $r_sroa_0_1_ph = 0, $sr_1_ph = 0, $d_sroa_0_0_insert_insert99$0 = 0, $d_sroa_0_0_insert_insert99$1 = 0, $137$0 = 0, $137$1 = 0, $carry_0203 = 0, $sr_1202 = 0, $r_sroa_0_1201 = 0, $r_sroa_1_1200 = 0, $q_sroa_0_1199 = 0, $q_sroa_1_1198 = 0, $147 = 0, $149 = 0, $r_sroa_0_0_insert_insert42$0 = 0, $r_sroa_0_0_insert_insert42$1 = 0, $150$1 = 0, $151$0 = 0, $152 = 0, $154$0 = 0, $r_sroa_0_0_extract_trunc = 0, $r_sroa_1_4_extract_trunc = 0, $155 = 0, $carry_0_lcssa$0 = 0, $carry_0_lcssa$1 = 0, $r_sroa_0_1_lcssa = 0, $r_sroa_1_1_lcssa = 0, $q_sroa_0_1_lcssa = 0, $q_sroa_1_1_lcssa = 0, $q_sroa_0_0_insert_ext75$0 = 0, $q_sroa_0_0_insert_ext75$1 = 0, $q_sroa_0_0_insert_insert77$1 = 0, $_0$0 = 0, $_0$1 = 0;
    $n_sroa_0_0_extract_trunc = $a$0;
    $n_sroa_1_4_extract_shift$0 = $a$1;
    $n_sroa_1_4_extract_trunc = $n_sroa_1_4_extract_shift$0;
    $d_sroa_0_0_extract_trunc = $b$0;
    $d_sroa_1_4_extract_shift$0 = $b$1;
    $d_sroa_1_4_extract_trunc = $d_sroa_1_4_extract_shift$0;
    if (($n_sroa_1_4_extract_trunc | 0) == 0) {
      $4 = ($rem | 0) != 0;
      if (($d_sroa_1_4_extract_trunc | 0) == 0) {
        if ($4) {
          HEAP32[$rem >> 2] = ($n_sroa_0_0_extract_trunc >>> 0) % ($d_sroa_0_0_extract_trunc >>> 0);
          HEAP32[$rem + 4 >> 2] = 0;
        }
        $_0$1 = 0;
        $_0$0 = ($n_sroa_0_0_extract_trunc >>> 0) / ($d_sroa_0_0_extract_trunc >>> 0) >>> 0;
        return (tempRet0 = $_0$1, $_0$0) | 0;
      } else {
        if (!$4) {
          $_0$1 = 0;
          $_0$0 = 0;
          return (tempRet0 = $_0$1, $_0$0) | 0;
        }
        HEAP32[$rem >> 2] = $a$0 & -1;
        HEAP32[$rem + 4 >> 2] = $a$1 & 0;
        $_0$1 = 0;
        $_0$0 = 0;
        return (tempRet0 = $_0$1, $_0$0) | 0;
      }
    }
    $17 = ($d_sroa_1_4_extract_trunc | 0) == 0;
    do {
      if (($d_sroa_0_0_extract_trunc | 0) == 0) {
        if ($17) {
          if (($rem | 0) != 0) {
            HEAP32[$rem >> 2] = ($n_sroa_1_4_extract_trunc >>> 0) % ($d_sroa_0_0_extract_trunc >>> 0);
            HEAP32[$rem + 4 >> 2] = 0;
          }
          $_0$1 = 0;
          $_0$0 = ($n_sroa_1_4_extract_trunc >>> 0) / ($d_sroa_0_0_extract_trunc >>> 0) >>> 0;
          return (tempRet0 = $_0$1, $_0$0) | 0;
        }
        if (($n_sroa_0_0_extract_trunc | 0) == 0) {
          if (($rem | 0) != 0) {
            HEAP32[$rem >> 2] = 0;
            HEAP32[$rem + 4 >> 2] = ($n_sroa_1_4_extract_trunc >>> 0) % ($d_sroa_1_4_extract_trunc >>> 0);
          }
          $_0$1 = 0;
          $_0$0 = ($n_sroa_1_4_extract_trunc >>> 0) / ($d_sroa_1_4_extract_trunc >>> 0) >>> 0;
          return (tempRet0 = $_0$1, $_0$0) | 0;
        }
        $37 = $d_sroa_1_4_extract_trunc - 1 | 0;
        if (($37 & $d_sroa_1_4_extract_trunc | 0) == 0) {
          if (($rem | 0) != 0) {
            HEAP32[$rem >> 2] = 0 | $a$0 & -1;
            HEAP32[$rem + 4 >> 2] = $37 & $n_sroa_1_4_extract_trunc | $a$1 & 0;
          }
          $_0$1 = 0;
          $_0$0 = $n_sroa_1_4_extract_trunc >>> ((_llvm_cttz_i32($d_sroa_1_4_extract_trunc | 0) | 0) >>> 0);
          return (tempRet0 = $_0$1, $_0$0) | 0;
        }
        $49 = Math_clz32($d_sroa_1_4_extract_trunc | 0) | 0;
        $51 = $49 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
        if ($51 >>> 0 <= 30) {
          $57 = $51 + 1 | 0;
          $58 = 31 - $51 | 0;
          $sr_1_ph = $57;
          $r_sroa_0_1_ph = $n_sroa_1_4_extract_trunc << $58 | $n_sroa_0_0_extract_trunc >>> ($57 >>> 0);
          $r_sroa_1_1_ph = $n_sroa_1_4_extract_trunc >>> ($57 >>> 0);
          $q_sroa_0_1_ph = 0;
          $q_sroa_1_1_ph = $n_sroa_0_0_extract_trunc << $58;
          break;
        }
        if (($rem | 0) == 0) {
          $_0$1 = 0;
          $_0$0 = 0;
          return (tempRet0 = $_0$1, $_0$0) | 0;
        }
        HEAP32[$rem >> 2] = 0 | $a$0 & -1;
        HEAP32[$rem + 4 >> 2] = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
        $_0$1 = 0;
        $_0$0 = 0;
        return (tempRet0 = $_0$1, $_0$0) | 0;
      } else {
        if (!$17) {
          $117 = Math_clz32($d_sroa_1_4_extract_trunc | 0) | 0;
          $119 = $117 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
          if ($119 >>> 0 <= 31) {
            $125 = $119 + 1 | 0;
            $126 = 31 - $119 | 0;
            $130 = $119 - 31 >> 31;
            $sr_1_ph = $125;
            $r_sroa_0_1_ph = $n_sroa_0_0_extract_trunc >>> ($125 >>> 0) & $130 | $n_sroa_1_4_extract_trunc << $126;
            $r_sroa_1_1_ph = $n_sroa_1_4_extract_trunc >>> ($125 >>> 0) & $130;
            $q_sroa_0_1_ph = 0;
            $q_sroa_1_1_ph = $n_sroa_0_0_extract_trunc << $126;
            break;
          }
          if (($rem | 0) == 0) {
            $_0$1 = 0;
            $_0$0 = 0;
            return (tempRet0 = $_0$1, $_0$0) | 0;
          }
          HEAP32[$rem >> 2] = 0 | $a$0 & -1;
          HEAP32[$rem + 4 >> 2] = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
          $_0$1 = 0;
          $_0$0 = 0;
          return (tempRet0 = $_0$1, $_0$0) | 0;
        }
        $66 = $d_sroa_0_0_extract_trunc - 1 | 0;
        if (($66 & $d_sroa_0_0_extract_trunc | 0) != 0) {
          $86 = (Math_clz32($d_sroa_0_0_extract_trunc | 0) | 0) + 33 | 0;
          $88 = $86 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
          $89 = 64 - $88 | 0;
          $91 = 32 - $88 | 0;
          $92 = $91 >> 31;
          $95 = $88 - 32 | 0;
          $105 = $95 >> 31;
          $sr_1_ph = $88;
          $r_sroa_0_1_ph = $91 - 1 >> 31 & $n_sroa_1_4_extract_trunc >>> ($95 >>> 0) | ($n_sroa_1_4_extract_trunc << $91 | $n_sroa_0_0_extract_trunc >>> ($88 >>> 0)) & $105;
          $r_sroa_1_1_ph = $105 & $n_sroa_1_4_extract_trunc >>> ($88 >>> 0);
          $q_sroa_0_1_ph = $n_sroa_0_0_extract_trunc << $89 & $92;
          $q_sroa_1_1_ph = ($n_sroa_1_4_extract_trunc << $89 | $n_sroa_0_0_extract_trunc >>> ($95 >>> 0)) & $92 | $n_sroa_0_0_extract_trunc << $91 & $88 - 33 >> 31;
          break;
        }
        if (($rem | 0) != 0) {
          HEAP32[$rem >> 2] = $66 & $n_sroa_0_0_extract_trunc;
          HEAP32[$rem + 4 >> 2] = 0;
        }
        if (($d_sroa_0_0_extract_trunc | 0) == 1) {
          $_0$1 = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
          $_0$0 = 0 | $a$0 & -1;
          return (tempRet0 = $_0$1, $_0$0) | 0;
        } else {
          $78 = _llvm_cttz_i32($d_sroa_0_0_extract_trunc | 0) | 0;
          $_0$1 = 0 | $n_sroa_1_4_extract_trunc >>> ($78 >>> 0);
          $_0$0 = $n_sroa_1_4_extract_trunc << 32 - $78 | $n_sroa_0_0_extract_trunc >>> ($78 >>> 0) | 0;
          return (tempRet0 = $_0$1, $_0$0) | 0;
        }
      }
    } while (0);
    if (($sr_1_ph | 0) == 0) {
      $q_sroa_1_1_lcssa = $q_sroa_1_1_ph;
      $q_sroa_0_1_lcssa = $q_sroa_0_1_ph;
      $r_sroa_1_1_lcssa = $r_sroa_1_1_ph;
      $r_sroa_0_1_lcssa = $r_sroa_0_1_ph;
      $carry_0_lcssa$1 = 0;
      $carry_0_lcssa$0 = 0;
    } else {
      $d_sroa_0_0_insert_insert99$0 = 0 | $b$0 & -1;
      $d_sroa_0_0_insert_insert99$1 = $d_sroa_1_4_extract_shift$0 | $b$1 & 0;
      $137$0 = _i64Add($d_sroa_0_0_insert_insert99$0 | 0, $d_sroa_0_0_insert_insert99$1 | 0, -1, -1) | 0;
      $137$1 = tempRet0;
      $q_sroa_1_1198 = $q_sroa_1_1_ph;
      $q_sroa_0_1199 = $q_sroa_0_1_ph;
      $r_sroa_1_1200 = $r_sroa_1_1_ph;
      $r_sroa_0_1201 = $r_sroa_0_1_ph;
      $sr_1202 = $sr_1_ph;
      $carry_0203 = 0;
      while (1) {
        $147 = $q_sroa_0_1199 >>> 31 | $q_sroa_1_1198 << 1;
        $149 = $carry_0203 | $q_sroa_0_1199 << 1;
        $r_sroa_0_0_insert_insert42$0 = 0 | ($r_sroa_0_1201 << 1 | $q_sroa_1_1198 >>> 31);
        $r_sroa_0_0_insert_insert42$1 = $r_sroa_0_1201 >>> 31 | $r_sroa_1_1200 << 1 | 0;
        _i64Subtract($137$0 | 0, $137$1 | 0, $r_sroa_0_0_insert_insert42$0 | 0, $r_sroa_0_0_insert_insert42$1 | 0) | 0;
        $150$1 = tempRet0;
        $151$0 = $150$1 >> 31 | (($150$1 | 0) < 0 ? -1 : 0) << 1;
        $152 = $151$0 & 1;
        $154$0 = _i64Subtract($r_sroa_0_0_insert_insert42$0 | 0, $r_sroa_0_0_insert_insert42$1 | 0, $151$0 & $d_sroa_0_0_insert_insert99$0 | 0, ((($150$1 | 0) < 0 ? -1 : 0) >> 31 | (($150$1 | 0) < 0 ? -1 : 0) << 1) & $d_sroa_0_0_insert_insert99$1 | 0) | 0;
        $r_sroa_0_0_extract_trunc = $154$0;
        $r_sroa_1_4_extract_trunc = tempRet0;
        $155 = $sr_1202 - 1 | 0;
        if (($155 | 0) == 0) {
          break;
        } else {
          $q_sroa_1_1198 = $147;
          $q_sroa_0_1199 = $149;
          $r_sroa_1_1200 = $r_sroa_1_4_extract_trunc;
          $r_sroa_0_1201 = $r_sroa_0_0_extract_trunc;
          $sr_1202 = $155;
          $carry_0203 = $152;
        }
      }
      $q_sroa_1_1_lcssa = $147;
      $q_sroa_0_1_lcssa = $149;
      $r_sroa_1_1_lcssa = $r_sroa_1_4_extract_trunc;
      $r_sroa_0_1_lcssa = $r_sroa_0_0_extract_trunc;
      $carry_0_lcssa$1 = 0;
      $carry_0_lcssa$0 = $152;
    }
    $q_sroa_0_0_insert_ext75$0 = $q_sroa_0_1_lcssa;
    $q_sroa_0_0_insert_ext75$1 = 0;
    $q_sroa_0_0_insert_insert77$1 = $q_sroa_1_1_lcssa | $q_sroa_0_0_insert_ext75$1;
    if (($rem | 0) != 0) {
      HEAP32[$rem >> 2] = 0 | $r_sroa_0_1_lcssa;
      HEAP32[$rem + 4 >> 2] = $r_sroa_1_1_lcssa | 0;
    }
    $_0$1 = (0 | $q_sroa_0_0_insert_ext75$0) >>> 31 | $q_sroa_0_0_insert_insert77$1 << 1 | ($q_sroa_0_0_insert_ext75$1 << 1 | $q_sroa_0_0_insert_ext75$0 >>> 31) & 0 | $carry_0_lcssa$1;
    $_0$0 = ($q_sroa_0_0_insert_ext75$0 << 1 | 0 >>> 31) & -2 | $carry_0_lcssa$0;
    return (tempRet0 = $_0$1, $_0$0) | 0;
}
function ___udivdi3($a$0, $a$1, $b$0, $b$1) {
    $a$0 = $a$0 | 0;
    $a$1 = $a$1 | 0;
    $b$0 = $b$0 | 0;
    $b$1 = $b$1 | 0;
    var $1$0 = 0;
    $1$0 = ___udivmoddi4($a$0, $a$1, $b$0, $b$1, 0) | 0;
    return $1$0 | 0;
}
function ___muldsi3($a, $b) {
    $a = $a | 0;
    $b = $b | 0;
    var $1 = 0, $2 = 0, $3 = 0, $6 = 0, $8 = 0, $11 = 0, $12 = 0;
    $1 = $a & 65535;
    $2 = $b & 65535;
    $3 = Math_imul($2, $1) | 0;
    $6 = $a >>> 16;
    $8 = ($3 >>> 16) + (Math_imul($2, $6) | 0) | 0;
    $11 = $b >>> 16;
    $12 = Math_imul($11, $1) | 0;
    return (tempRet0 = (($8 >>> 16) + (Math_imul($11, $6) | 0) | 0) + ((($8 & 65535) + $12 | 0) >>> 16) | 0, 0 | ($8 + $12 << 16 | $3 & 65535)) | 0;
}
function ___muldi3($a$0, $a$1, $b$0, $b$1) {
    $a$0 = $a$0 | 0;
    $a$1 = $a$1 | 0;
    $b$0 = $b$0 | 0;
    $b$1 = $b$1 | 0;
    var $x_sroa_0_0_extract_trunc = 0, $y_sroa_0_0_extract_trunc = 0, $1$0 = 0, $1$1 = 0, $2 = 0;
    $x_sroa_0_0_extract_trunc = $a$0;
    $y_sroa_0_0_extract_trunc = $b$0;
    $1$0 = ___muldsi3($x_sroa_0_0_extract_trunc, $y_sroa_0_0_extract_trunc) | 0;
    $1$1 = tempRet0;
    $2 = Math_imul($a$1, $y_sroa_0_0_extract_trunc) | 0;
    return (tempRet0 = ((Math_imul($b$1, $x_sroa_0_0_extract_trunc) | 0) + $2 | 0) + $1$1 | $1$1 & 0, 0 | $1$0 & -1) | 0;
}
function _sbrk(increment) {
    increment = increment|0;
    var oldDynamicTop = 0;
    var oldDynamicTopOnChange = 0;
    var newDynamicTop = 0;
    var totalMemory = 0;
    increment = ((increment + 15) & -16)|0;
    oldDynamicTop = HEAP32[DYNAMICTOP_PTR>>2]|0;
    newDynamicTop = oldDynamicTop + increment | 0;

    if (((increment|0) > 0 & (newDynamicTop|0) < (oldDynamicTop|0)) // Detect and fail if we would wrap around signed 32-bit int.
      | (newDynamicTop|0) < 0) { // Also underflow, sbrk() should be able to be used to subtract.
      abortOnCannotGrowMemory()|0;
      ___setErrNo(12);
      return -1;
    }

    HEAP32[DYNAMICTOP_PTR>>2] = newDynamicTop;
    totalMemory = getTotalMemory()|0;
    if ((newDynamicTop|0) > (totalMemory|0)) {
      if ((enlargeMemory()|0) == 0) {
        HEAP32[DYNAMICTOP_PTR>>2] = oldDynamicTop;
        ___setErrNo(12);
        return -1;
      }
    }
    return oldDynamicTop|0;
}
function ___uremdi3($a$0, $a$1, $b$0, $b$1) {
    $a$0 = $a$0 | 0;
    $a$1 = $a$1 | 0;
    $b$0 = $b$0 | 0;
    $b$1 = $b$1 | 0;
    var $rem = 0, __stackBase__ = 0;
    __stackBase__ = STACKTOP;
    STACKTOP = STACKTOP + 16 | 0;
    $rem = __stackBase__ | 0;
    ___udivmoddi4($a$0, $a$1, $b$0, $b$1, $rem) | 0;
    STACKTOP = __stackBase__;
    return (tempRet0 = HEAP32[$rem + 4 >> 2] | 0, HEAP32[$rem >> 2] | 0) | 0;
}
function _memcpy(dest, src, num) {
    dest = dest|0; src = src|0; num = num|0;
    var ret = 0;
    var aligned_dest_end = 0;
    var block_aligned_dest_end = 0;
    var dest_end = 0;
    // Test against a benchmarked cutoff limit for when HEAPU8.set() becomes faster to use.
    if ((num|0) >=
      8192
    ) {
      return _emscripten_memcpy_big(dest|0, src|0, num|0)|0;
    }

    ret = dest|0;
    dest_end = (dest + num)|0;
    if ((dest&3) == (src&3)) {
      // The initial unaligned < 4-byte front.
      while (dest & 3) {
        if ((num|0) == 0) return ret|0;
        HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
        dest = (dest+1)|0;
        src = (src+1)|0;
        num = (num-1)|0;
      }
      aligned_dest_end = (dest_end & -4)|0;
      block_aligned_dest_end = (aligned_dest_end - 64)|0;
      while ((dest|0) <= (block_aligned_dest_end|0) ) {
        HEAP32[((dest)>>2)]=((HEAP32[((src)>>2)])|0);
        HEAP32[(((dest)+(4))>>2)]=((HEAP32[(((src)+(4))>>2)])|0);
        HEAP32[(((dest)+(8))>>2)]=((HEAP32[(((src)+(8))>>2)])|0);
        HEAP32[(((dest)+(12))>>2)]=((HEAP32[(((src)+(12))>>2)])|0);
        HEAP32[(((dest)+(16))>>2)]=((HEAP32[(((src)+(16))>>2)])|0);
        HEAP32[(((dest)+(20))>>2)]=((HEAP32[(((src)+(20))>>2)])|0);
        HEAP32[(((dest)+(24))>>2)]=((HEAP32[(((src)+(24))>>2)])|0);
        HEAP32[(((dest)+(28))>>2)]=((HEAP32[(((src)+(28))>>2)])|0);
        HEAP32[(((dest)+(32))>>2)]=((HEAP32[(((src)+(32))>>2)])|0);
        HEAP32[(((dest)+(36))>>2)]=((HEAP32[(((src)+(36))>>2)])|0);
        HEAP32[(((dest)+(40))>>2)]=((HEAP32[(((src)+(40))>>2)])|0);
        HEAP32[(((dest)+(44))>>2)]=((HEAP32[(((src)+(44))>>2)])|0);
        HEAP32[(((dest)+(48))>>2)]=((HEAP32[(((src)+(48))>>2)])|0);
        HEAP32[(((dest)+(52))>>2)]=((HEAP32[(((src)+(52))>>2)])|0);
        HEAP32[(((dest)+(56))>>2)]=((HEAP32[(((src)+(56))>>2)])|0);
        HEAP32[(((dest)+(60))>>2)]=((HEAP32[(((src)+(60))>>2)])|0);
        dest = (dest+64)|0;
        src = (src+64)|0;
      }
      while ((dest|0) < (aligned_dest_end|0) ) {
        HEAP32[((dest)>>2)]=((HEAP32[((src)>>2)])|0);
        dest = (dest+4)|0;
        src = (src+4)|0;
      }
    } else {
      // In the unaligned copy case, unroll a bit as well.
      aligned_dest_end = (dest_end - 4)|0;
      while ((dest|0) < (aligned_dest_end|0) ) {
        HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
        HEAP8[(((dest)+(1))>>0)]=((HEAP8[(((src)+(1))>>0)])|0);
        HEAP8[(((dest)+(2))>>0)]=((HEAP8[(((src)+(2))>>0)])|0);
        HEAP8[(((dest)+(3))>>0)]=((HEAP8[(((src)+(3))>>0)])|0);
        dest = (dest+4)|0;
        src = (src+4)|0;
      }
    }
    // The remaining unaligned < 4 byte tail.
    while ((dest|0) < (dest_end|0)) {
      HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
      dest = (dest+1)|0;
      src = (src+1)|0;
    }
    return ret|0;
}
function _llvm_bswap_i32(x) {
    x = x|0;
    return (((x&0xff)<<24) | (((x>>8)&0xff)<<16) | (((x>>16)&0xff)<<8) | (x>>>24))|0;
}

  
function dynCall_ii(index,a1) {
  index = index|0;
  a1=a1|0;
  return FUNCTION_TABLE_ii[index&1](a1|0)|0;
}


function dynCall_iiii(index,a1,a2,a3) {
  index = index|0;
  a1=a1|0; a2=a2|0; a3=a3|0;
  return FUNCTION_TABLE_iiii[index&7](a1|0,a2|0,a3|0)|0;
}

function b0(p0) {
 p0 = p0|0; nullFunc_ii(0);return 0;
}
function b1(p0,p1,p2) {
 p0 = p0|0;p1 = p1|0;p2 = p2|0; nullFunc_iiii(1);return 0;
}

// EMSCRIPTEN_END_FUNCS
var FUNCTION_TABLE_ii = [b0,___stdio_close];
var FUNCTION_TABLE_iiii = [b1,b1,___stdout_write,___stdio_seek,___stdio_read,___stdio_write,b1,b1];

  return { _llvm_bswap_i32: _llvm_bswap_i32, _main: _main, _i64Subtract: _i64Subtract, ___udivdi3: ___udivdi3, setThrew: setThrew, _bitshift64Lshr: _bitshift64Lshr, _bitshift64Shl: _bitshift64Shl, ___errno_location: ___errno_location, _memset: _memset, _sbrk: _sbrk, _memcpy: _memcpy, stackAlloc: stackAlloc, ___muldi3: ___muldi3, ___uremdi3: ___uremdi3, getTempRet0: getTempRet0, setTempRet0: setTempRet0, _i64Add: _i64Add, dynCall_iiii: dynCall_iiii, _emscripten_get_global_libc: _emscripten_get_global_libc, dynCall_ii: dynCall_ii, stackSave: stackSave, _free: _free, runPostSets: runPostSets, establishStackSpace: establishStackSpace, stackRestore: stackRestore, _malloc: _malloc };
})
// EMSCRIPTEN_END_ASM
(Module.asmGlobalArg, Module.asmLibraryArg, buffer);

var real__llvm_bswap_i32 = asm["_llvm_bswap_i32"]; asm["_llvm_bswap_i32"] = function() {
  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  return real__llvm_bswap_i32.apply(null, arguments);
};

var real__main = asm["_main"]; asm["_main"] = function() {
  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  return real__main.apply(null, arguments);
};

var real_getTempRet0 = asm["getTempRet0"]; asm["getTempRet0"] = function() {
  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  return real_getTempRet0.apply(null, arguments);
};

var real____udivdi3 = asm["___udivdi3"]; asm["___udivdi3"] = function() {
  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  return real____udivdi3.apply(null, arguments);
};

var real_setThrew = asm["setThrew"]; asm["setThrew"] = function() {
  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  return real_setThrew.apply(null, arguments);
};

var real__bitshift64Lshr = asm["_bitshift64Lshr"]; asm["_bitshift64Lshr"] = function() {
  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  return real__bitshift64Lshr.apply(null, arguments);
};

var real__bitshift64Shl = asm["_bitshift64Shl"]; asm["_bitshift64Shl"] = function() {
  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  return real__bitshift64Shl.apply(null, arguments);
};

var real__sbrk = asm["_sbrk"]; asm["_sbrk"] = function() {
  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  return real__sbrk.apply(null, arguments);
};

var real____errno_location = asm["___errno_location"]; asm["___errno_location"] = function() {
  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  return real____errno_location.apply(null, arguments);
};

var real____muldi3 = asm["___muldi3"]; asm["___muldi3"] = function() {
  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  return real____muldi3.apply(null, arguments);
};

var real____uremdi3 = asm["___uremdi3"]; asm["___uremdi3"] = function() {
  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  return real____uremdi3.apply(null, arguments);
};

var real_stackAlloc = asm["stackAlloc"]; asm["stackAlloc"] = function() {
  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  return real_stackAlloc.apply(null, arguments);
};

var real__i64Subtract = asm["_i64Subtract"]; asm["_i64Subtract"] = function() {
  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  return real__i64Subtract.apply(null, arguments);
};

var real_setTempRet0 = asm["setTempRet0"]; asm["setTempRet0"] = function() {
  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  return real_setTempRet0.apply(null, arguments);
};

var real__i64Add = asm["_i64Add"]; asm["_i64Add"] = function() {
  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  return real__i64Add.apply(null, arguments);
};

var real__emscripten_get_global_libc = asm["_emscripten_get_global_libc"]; asm["_emscripten_get_global_libc"] = function() {
  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  return real__emscripten_get_global_libc.apply(null, arguments);
};

var real_stackSave = asm["stackSave"]; asm["stackSave"] = function() {
  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  return real_stackSave.apply(null, arguments);
};

var real__free = asm["_free"]; asm["_free"] = function() {
  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  return real__free.apply(null, arguments);
};

var real_establishStackSpace = asm["establishStackSpace"]; asm["establishStackSpace"] = function() {
  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  return real_establishStackSpace.apply(null, arguments);
};

var real_stackRestore = asm["stackRestore"]; asm["stackRestore"] = function() {
  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  return real_stackRestore.apply(null, arguments);
};

var real__malloc = asm["_malloc"]; asm["_malloc"] = function() {
  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
  return real__malloc.apply(null, arguments);
};
var _llvm_bswap_i32 = Module["_llvm_bswap_i32"] = asm["_llvm_bswap_i32"];
var _main = Module["_main"] = asm["_main"];
var getTempRet0 = Module["getTempRet0"] = asm["getTempRet0"];
var ___udivdi3 = Module["___udivdi3"] = asm["___udivdi3"];
var setThrew = Module["setThrew"] = asm["setThrew"];
var _bitshift64Lshr = Module["_bitshift64Lshr"] = asm["_bitshift64Lshr"];
var _bitshift64Shl = Module["_bitshift64Shl"] = asm["_bitshift64Shl"];
var _memset = Module["_memset"] = asm["_memset"];
var _sbrk = Module["_sbrk"] = asm["_sbrk"];
var _memcpy = Module["_memcpy"] = asm["_memcpy"];
var ___errno_location = Module["___errno_location"] = asm["___errno_location"];
var ___muldi3 = Module["___muldi3"] = asm["___muldi3"];
var ___uremdi3 = Module["___uremdi3"] = asm["___uremdi3"];
var stackAlloc = Module["stackAlloc"] = asm["stackAlloc"];
var _i64Subtract = Module["_i64Subtract"] = asm["_i64Subtract"];
var setTempRet0 = Module["setTempRet0"] = asm["setTempRet0"];
var _i64Add = Module["_i64Add"] = asm["_i64Add"];
var _emscripten_get_global_libc = Module["_emscripten_get_global_libc"] = asm["_emscripten_get_global_libc"];
var stackSave = Module["stackSave"] = asm["stackSave"];
var _free = Module["_free"] = asm["_free"];
var runPostSets = Module["runPostSets"] = asm["runPostSets"];
var establishStackSpace = Module["establishStackSpace"] = asm["establishStackSpace"];
var stackRestore = Module["stackRestore"] = asm["stackRestore"];
var _malloc = Module["_malloc"] = asm["_malloc"];
var dynCall_ii = Module["dynCall_ii"] = asm["dynCall_ii"];
var dynCall_iiii = Module["dynCall_iiii"] = asm["dynCall_iiii"];
;
Runtime.stackAlloc = Module['stackAlloc'];
Runtime.stackSave = Module['stackSave'];
Runtime.stackRestore = Module['stackRestore'];
Runtime.establishStackSpace = Module['establishStackSpace'];
Runtime.setTempRet0 = Module['setTempRet0'];
Runtime.getTempRet0 = Module['getTempRet0'];


// === Auto-generated postamble setup entry stuff ===

Module['asm'] = asm;







/**
 * @constructor
 * @extends {Error}
 */
function ExitStatus(status) {
  this.name = "ExitStatus";
  this.message = "Program terminated with exit(" + status + ")";
  this.status = status;
};
ExitStatus.prototype = new Error();
ExitStatus.prototype.constructor = ExitStatus;

var initialStackTop;
var preloadStartTime = null;
var calledMain = false;

dependenciesFulfilled = function runCaller() {
  // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false)
  if (!Module['calledRun']) run();
  if (!Module['calledRun']) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled
}

Module['callMain'] = Module.callMain = function callMain(args) {
  assert(runDependencies == 0, 'cannot call main when async dependencies remain! (listen on __ATMAIN__)');
  assert(__ATPRERUN__.length == 0, 'cannot call main when preRun functions remain to be called');

  args = args || [];

  ensureInitRuntime();

  var argc = args.length+1;
  function pad() {
    for (var i = 0; i < 4-1; i++) {
      argv.push(0);
    }
  }
  var argv = [allocate(intArrayFromString(Module['thisProgram']), 'i8', ALLOC_NORMAL) ];
  pad();
  for (var i = 0; i < argc-1; i = i + 1) {
    argv.push(allocate(intArrayFromString(args[i]), 'i8', ALLOC_NORMAL));
    pad();
  }
  argv.push(0);
  argv = allocate(argv, 'i32', ALLOC_NORMAL);


  try {

    var ret = Module['_main'](argc, argv, 0);


    // if we're not running an evented main loop, it's time to exit
    exit(ret, /* implicit = */ true);
  }
  catch(e) {
    if (e instanceof ExitStatus) {
      // exit() throws this once it's done to make sure execution
      // has been stopped completely
      return;
    } else if (e == 'SimulateInfiniteLoop') {
      // running an evented main loop, don't immediately exit
      Module['noExitRuntime'] = true;
      return;
    } else {
      var toLog = e;
      if (e && typeof e === 'object' && e.stack) {
        toLog = [e, e.stack];
      }
      Module.printErr('exception thrown: ' + toLog);
      Module['quit'](1, e);
    }
  } finally {
    calledMain = true;
  }
}




/** @type {function(Array=)} */
function run(args) {
  args = args || Module['arguments'];

  if (preloadStartTime === null) preloadStartTime = Date.now();

  if (runDependencies > 0) {
    return;
  }

  writeStackCookie();

  preRun();

  if (runDependencies > 0) return; // a preRun added a dependency, run will be called later
  if (Module['calledRun']) return; // run may have just been called through dependencies being fulfilled just in this very frame

  function doRun() {
    if (Module['calledRun']) return; // run may have just been called while the async setStatus time below was happening
    Module['calledRun'] = true;

    if (ABORT) return;

    ensureInitRuntime();

    preMain();

    if (ENVIRONMENT_IS_WEB && preloadStartTime !== null) {
      Module.printErr('pre-main prep time: ' + (Date.now() - preloadStartTime) + ' ms');
    }

    if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized']();

    if (Module['_main'] && shouldRunNow) Module['callMain'](args);

    postRun();
  }

  if (Module['setStatus']) {
    Module['setStatus']('Running...');
    setTimeout(function() {
      setTimeout(function() {
        Module['setStatus']('');
      }, 1);
      doRun();
    }, 1);
  } else {
    doRun();
  }
  checkStackCookie();
}
Module['run'] = Module.run = run;

function exit(status, implicit) {
  if (implicit && Module['noExitRuntime']) {
    Module.printErr('exit(' + status + ') implicitly called by end of main(), but noExitRuntime, so not exiting the runtime (you can use emscripten_force_exit, if you want to force a true shutdown)');
    return;
  }

  if (Module['noExitRuntime']) {
    Module.printErr('exit(' + status + ') called, but noExitRuntime, so halting execution but not exiting the runtime or preventing further async execution (you can use emscripten_force_exit, if you want to force a true shutdown)');
  } else {

    ABORT = true;
    EXITSTATUS = status;
    STACKTOP = initialStackTop;

    exitRuntime();

    if (Module['onExit']) Module['onExit'](status);
  }

  if (ENVIRONMENT_IS_NODE) {
    process['exit'](status);
  }
  Module['quit'](status, new ExitStatus(status));
}
Module['exit'] = Module.exit = exit;

var abortDecorators = [];

function abort(what) {
  if (Module['onAbort']) {
    Module['onAbort'](what);
  }

  if (what !== undefined) {
    Module.print(what);
    Module.printErr(what);
    what = JSON.stringify(what)
  } else {
    what = '';
  }

  ABORT = true;
  EXITSTATUS = 1;

  var extra = '';

  var output = 'abort(' + what + ') at ' + stackTrace() + extra;
  if (abortDecorators) {
    abortDecorators.forEach(function(decorator) {
      output = decorator(output, what);
    });
  }
  throw output;
}
Module['abort'] = Module.abort = abort;

// {{PRE_RUN_ADDITIONS}}

if (Module['preInit']) {
  if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']];
  while (Module['preInit'].length > 0) {
    Module['preInit'].pop()();
  }
}

// shouldRunNow refers to calling main(), not run().
var shouldRunNow = true;
if (Module['noInitialRun']) {
  shouldRunNow = false;
}

Module["noExitRuntime"] = true;

run();

// {{POST_RUN_ADDITIONS}}





// {{MODULE_ADDITIONS}}



if (typeof window === "object" && (typeof ENVIRONMENT_IS_PTHREAD === 'undefined' || !ENVIRONMENT_IS_PTHREAD)) {
  function emrun_register_handlers() {
    // When C code exit()s, we may still have remaining stdout and stderr messages in flight. In that case, we can't close
    // the browser until all those XHRs have finished, so the following state variables track that all communication is done,
    // after which we can close.
    var emrun_num_post_messages_in_flight = 0;
    var emrun_should_close_itself = false;
    function postExit(msg) {
      var http = new XMLHttpRequest();
      http.onreadystatechange = function() {
        if (http.readyState == 4 /*DONE*/) {
          try {
            // Try closing the current browser window, since it exit()ed itself. This can shut down the browser process
            // and emrun does not need to kill the whole browser process.
            if (typeof window !== 'undefined' && window.close) window.close();
          } catch(e) {}
        }
      }
      http.open("POST", "stdio.html", true);
      http.send(msg);
    }
    function post(msg) {
      var http = new XMLHttpRequest();
      ++emrun_num_post_messages_in_flight;
      http.onreadystatechange = function() {
        if (http.readyState == 4 /*DONE*/) {
          if (--emrun_num_post_messages_in_flight == 0 && emrun_should_close_itself) postExit('^exit^'+EXITSTATUS);
        }
      }
      http.open("POST", "stdio.html", true);
      http.send(msg);
    }
    // If the address contains localhost, or we are running the page from port 6931, we can assume we're running the test runner and should post stdout logs.
    if (document.URL.search("localhost") != -1 || document.URL.search(":6931/") != -1) {
      var emrun_http_sequence_number = 1;
      var prevPrint = Module['print'];
      var prevErr = Module['printErr'];
      function emrun_exit() { if (emrun_num_post_messages_in_flight == 0) postExit('^exit^'+EXITSTATUS); else emrun_should_close_itself = true; };
      Module['addOnExit'](emrun_exit);
      Module['print'] = function emrun_print(text) { post('^out^'+(emrun_http_sequence_number++)+'^'+encodeURIComponent(text)); prevPrint(text); }
      Module['printErr'] = function emrun_printErr(text) { post('^err^'+(emrun_http_sequence_number++)+'^'+encodeURIComponent(text)); prevErr(text); }

      // Notify emrun web server that this browser has successfully launched the page.
      post('^pageload^');
    }
  }

  // POSTs the given binary data represented as a (typed) array data back to the emrun-based web server.
  // To use from C code, call e.g. EM_ASM({emrun_file_dump("file.dat", HEAPU8.subarray($0, $0 + $1));}, my_data_pointer, my_data_pointer_byte_length);
  function emrun_file_dump(filename, data) {
    var http = new XMLHttpRequest();
    Module['print']('Dumping out file "' + filename + '" with ' + data.length + ' bytes of data.');
    http.open("POST", "stdio.html?file=" + filename, true);
    http.send(data); // XXX  this does not work in workers, for some odd reason (issue #2681)
  }

  if (typeof Module !== 'undefined' && typeof document !== 'undefined') emrun_register_handlers();
}